| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Aire
|
ENSMUSG00000000731.9 | autoimmune regulator (autoimmune polyendocrinopathy candidiasis ectodermal dystrophy) |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr10_78043169_78043984 | Aire | 4 | 0.949154 | -0.50 | 4.1e-05 | Click! |
| chr10_78037631_78037782 | Aire | 552 | 0.636067 | -0.13 | 3.4e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chrX_7966827_7967869 | 8.92 |
Gata1 |
GATA binding protein 1 |
562 |
0.55 |
| chr19_32238162_32238506 | 7.98 |
Sgms1 |
sphingomyelin synthase 1 |
478 |
0.85 |
| chr4_115057577_115059724 | 6.79 |
Tal1 |
T cell acute lymphocytic leukemia 1 |
839 |
0.56 |
| chr10_115817324_115818606 | 6.43 |
Tspan8 |
tetraspanin 8 |
681 |
0.78 |
| chr9_44340460_44342952 | 5.02 |
Hmbs |
hydroxymethylbilane synthase |
473 |
0.51 |
| chr17_40812075_40812470 | 4.89 |
Rhag |
Rhesus blood group-associated A glycoprotein |
1088 |
0.44 |
| chr17_40811481_40812037 | 4.36 |
Rhag |
Rhesus blood group-associated A glycoprotein |
575 |
0.7 |
| chr9_48338929_48340200 | 4.22 |
Nxpe2 |
neurexophilin and PC-esterase domain family, member 2 |
1270 |
0.48 |
| chr12_32123180_32123577 | 4.18 |
5430401H09Rik |
RIKEN cDNA 5430401H09 gene |
324 |
0.89 |
| chr11_87756102_87757558 | 4.17 |
Mir142 |
microRNA 142 |
34 |
0.59 |
| chr12_78904719_78905643 | 4.11 |
Plek2 |
pleckstrin 2 |
1783 |
0.34 |
| chr5_66081275_66082011 | 4.09 |
Rbm47 |
RNA binding motif protein 47 |
347 |
0.81 |
| chr10_115819043_115819440 | 4.03 |
Tspan8 |
tetraspanin 8 |
1957 |
0.43 |
| chr11_82845042_82846306 | 3.98 |
Rffl |
ring finger and FYVE like domain containing protein |
418 |
0.75 |
| chr11_115901935_115902451 | 3.87 |
Smim5 |
small integral membrane protein 5 |
1991 |
0.16 |
| chr2_163547257_163548345 | 3.82 |
Hnf4a |
hepatic nuclear factor 4, alpha |
613 |
0.63 |
| chr17_40810971_40811398 | 3.78 |
Rhag |
Rhesus blood group-associated A glycoprotein |
0 |
0.97 |
| chr7_132773129_132773862 | 3.64 |
Fam53b |
family with sequence similarity 53, member B |
3421 |
0.25 |
| chr18_65245240_65245906 | 3.48 |
Gm29966 |
predicted gene, 29966 |
1274 |
0.38 |
| chr8_117701899_117703135 | 3.45 |
Hsd17b2 |
hydroxysteroid (17-beta) dehydrogenase 2 |
430 |
0.77 |
| chr8_104963800_104964181 | 3.38 |
Ces2g |
carboxylesterase 2G |
2215 |
0.17 |
| chr14_70624394_70624692 | 3.35 |
Dmtn |
dematin actin binding protein |
1612 |
0.25 |
| chr6_29694287_29695938 | 3.31 |
Tspan33 |
tetraspanin 33 |
878 |
0.58 |
| chrX_9275213_9275657 | 3.31 |
Xk |
X-linked Kx blood group |
2679 |
0.18 |
| chr7_100494865_100496416 | 3.30 |
Ucp2 |
uncoupling protein 2 (mitochondrial, proton carrier) |
439 |
0.68 |
| chr3_51226325_51226945 | 3.25 |
Noct |
nocturnin |
2165 |
0.24 |
| chr4_136176679_136177522 | 3.24 |
E2f2 |
E2F transcription factor 2 |
3683 |
0.17 |
| chr18_64486564_64486718 | 3.22 |
Fech |
ferrochelatase |
2300 |
0.25 |
| chr3_83048284_83048966 | 3.22 |
Fgb |
fibrinogen beta chain |
1238 |
0.39 |
| chr1_58971597_58971799 | 3.19 |
Trak2 |
trafficking protein, kinesin binding 2 |
1731 |
0.25 |
| chr14_20340818_20341016 | 3.18 |
Ecd |
ecdysoneless cell cycle regulator |
7133 |
0.12 |
| chr5_64810297_64813272 | 3.18 |
Klf3 |
Kruppel-like factor 3 (basic) |
555 |
0.71 |
| chr19_4301696_4304008 | 3.13 |
Grk2 |
G protein-coupled receptor kinase 2 |
2356 |
0.14 |
| chr14_48538424_48539155 | 3.12 |
4930572G02Rik |
RIKEN cDNA 4930572G02 gene |
430 |
0.76 |
| chr3_122247075_122247647 | 3.10 |
Gclm |
glutamate-cysteine ligase, modifier subunit |
1280 |
0.26 |
| chr5_107874374_107875235 | 3.08 |
Evi5 |
ecotropic viral integration site 5 |
240 |
0.86 |
| chr12_86891509_86893562 | 3.06 |
Irf2bpl |
interferon regulatory factor 2 binding protein-like |
7737 |
0.19 |
| chr1_131135705_131136011 | 3.04 |
Dyrk3 |
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 3 |
2387 |
0.21 |
| chr6_60827248_60827682 | 3.04 |
Snca |
synuclein, alpha |
91 |
0.97 |
| chr18_32557788_32558922 | 3.03 |
Gypc |
glycophorin C |
1625 |
0.41 |
| chr11_75449209_75449924 | 3.03 |
Wdr81 |
WD repeat domain 81 |
214 |
0.84 |
| chr12_118296552_118297427 | 3.02 |
Sp4 |
trans-acting transcription factor 4 |
4379 |
0.3 |
| chr1_134072926_134073249 | 3.01 |
Btg2 |
BTG anti-proliferation factor 2 |
6033 |
0.14 |
| chr17_36874370_36874689 | 3.00 |
Trim10 |
tripartite motif-containing 10 |
4955 |
0.09 |
| chr8_80494157_80494570 | 2.93 |
Gypa |
glycophorin A |
582 |
0.8 |
| chr14_70625458_70627688 | 2.91 |
Dmtn |
dematin actin binding protein |
418 |
0.75 |
| chr19_32236497_32236706 | 2.89 |
Sgms1 |
sphingomyelin synthase 1 |
2211 |
0.36 |
| chr12_30913560_30913966 | 2.87 |
Sh3yl1 |
Sh3 domain YSC-like 1 |
1576 |
0.33 |
| chr3_127894696_127895269 | 2.87 |
Fam241a |
family with sequence similarity 241, member A |
1306 |
0.34 |
| chr2_121037229_121037401 | 2.87 |
Epb42 |
erythrocyte membrane protein band 4.2 |
243 |
0.87 |
| chr15_83169748_83171160 | 2.86 |
Cyb5r3 |
cytochrome b5 reductase 3 |
52 |
0.95 |
| chr16_17332659_17332870 | 2.86 |
Serpind1 |
serine (or cysteine) peptidase inhibitor, clade D, member 1 |
1381 |
0.31 |
| chr5_97002293_97002729 | 2.82 |
Bmp2k |
BMP2 inducible kinase |
4822 |
0.15 |
| chr5_105409514_105410008 | 2.80 |
Gm32051 |
predicted gene, 32051 |
394 |
0.82 |
| chr17_50331281_50331977 | 2.80 |
Gm49906 |
predicted gene, 49906 |
7623 |
0.21 |
| chr1_185456264_185456428 | 2.80 |
Gm2061 |
predicted gene 2061 |
778 |
0.45 |
| chrX_103479028_103479792 | 2.80 |
Xist |
inactive X specific transcripts |
3844 |
0.1 |
| chr10_75939108_75939976 | 2.79 |
Gm867 |
predicted gene 867 |
1069 |
0.25 |
| chr3_152198156_152198390 | 2.77 |
Dnajb4 |
DnaJ heat shock protein family (Hsp40) member B4 |
4428 |
0.14 |
| chr11_115899671_115901427 | 2.76 |
Smim5 |
small integral membrane protein 5 |
347 |
0.75 |
| chr3_153852195_153852415 | 2.76 |
Asb17os |
ankyrin repeat and SOCS box-containing 17, opposite strand |
96 |
0.94 |
| chr7_103825389_103825783 | 2.75 |
Hbb-bs |
hemoglobin, beta adult s chain |
2139 |
0.11 |
| chr11_97511052_97512791 | 2.73 |
Gm11611 |
predicted gene 11611 |
9974 |
0.12 |
| chr5_123131617_123134965 | 2.71 |
Rhof |
ras homolog family member F (in filopodia) |
599 |
0.36 |
| chr9_31252540_31253078 | 2.71 |
Gm7244 |
predicted gene 7244 |
22012 |
0.14 |
| chr3_51227179_51227330 | 2.66 |
Noct |
nocturnin |
2784 |
0.2 |
| chr1_58969882_58970334 | 2.65 |
Trak2 |
trafficking protein, kinesin binding 2 |
3321 |
0.18 |
| chr9_43101838_43102807 | 2.64 |
Arhgef12 |
Rho guanine nucleotide exchange factor (GEF) 12 |
3164 |
0.24 |
| chr7_143007094_143009025 | 2.63 |
Tspan32os |
tetraspanin 32, opposite strand |
26 |
0.96 |
| chr9_98298951_98299324 | 2.63 |
Nmnat3 |
nicotinamide nucleotide adenylyltransferase 3 |
2475 |
0.28 |
| chr6_83315880_83316808 | 2.61 |
Gm43890 |
predicted gene, 43890 |
599 |
0.53 |
| chr4_104874559_104874767 | 2.60 |
C8a |
complement component 8, alpha polypeptide |
1720 |
0.37 |
| chr7_115846310_115846461 | 2.60 |
Sox6 |
SRY (sex determining region Y)-box 6 |
234 |
0.96 |
| chrX_140954758_140955070 | 2.58 |
Psmd10 |
proteasome (prosome, macropain) 26S subunit, non-ATPase, 10 |
1775 |
0.3 |
| chr11_83065104_83067047 | 2.57 |
Slfn2 |
schlafen 2 |
963 |
0.31 |
| chr16_90043846_90044623 | 2.56 |
Gm2805 |
predicted gene 2805 |
45749 |
0.15 |
| chr11_102360845_102363484 | 2.49 |
Slc4a1 |
solute carrier family 4 (anion exchanger), member 1 |
1540 |
0.24 |
| chr8_23034845_23035677 | 2.48 |
Ank1 |
ankyrin 1, erythroid |
30 |
0.98 |
| chr14_66998263_66998507 | 2.48 |
Bnip3l |
BCL2/adenovirus E1B interacting protein 3-like |
1272 |
0.38 |
| chr6_122391330_122392825 | 2.46 |
1700063H04Rik |
RIKEN cDNA 1700063H04 gene |
698 |
0.58 |
| chr9_44580109_44580444 | 2.45 |
Gm47230 |
predicted gene, 47230 |
649 |
0.47 |
| chr1_165766563_165766714 | 2.44 |
Creg1 |
cellular repressor of E1A-stimulated genes 1 |
2838 |
0.13 |
| chr5_66079835_66080179 | 2.42 |
Rbm47 |
RNA binding motif protein 47 |
977 |
0.43 |
| chr1_131638462_131638811 | 2.41 |
Ctse |
cathepsin E |
142 |
0.95 |
| chr17_48271857_48272276 | 2.40 |
Treml4 |
triggering receptor expressed on myeloid cells-like 4 |
373 |
0.79 |
| chr12_111442182_111444685 | 2.40 |
Tnfaip2 |
tumor necrosis factor, alpha-induced protein 2 |
771 |
0.51 |
| chr15_76666348_76670076 | 2.39 |
Foxh1 |
forkhead box H1 |
1590 |
0.15 |
| chr11_120628644_120631479 | 2.39 |
Mafg |
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein G (avian) |
87 |
0.89 |
| chr7_4751858_4753020 | 2.39 |
Cox6b2 |
cytochrome c oxidase subunit 6B2 |
89 |
0.92 |
| chr5_103759804_103761265 | 2.39 |
Aff1 |
AF4/FMR2 family, member 1 |
5961 |
0.23 |
| chr14_69282071_69282727 | 2.38 |
Gm20236 |
predicted gene, 20236 |
259 |
0.8 |
| chr10_86023427_86024178 | 2.38 |
A230060F14Rik |
RIKEN cDNA A230060F14 gene |
1473 |
0.24 |
| chr14_69500320_69500976 | 2.37 |
Gm37094 |
predicted gene, 37094 |
258 |
0.81 |
| chr14_40962109_40963182 | 2.36 |
Tspan14 |
tetraspanin 14 |
4162 |
0.22 |
| chr1_23282787_23283466 | 2.35 |
Gm27028 |
predicted gene, 27028 |
8411 |
0.12 |
| chr10_83153256_83154297 | 2.35 |
Gm23122 |
predicted gene, 23122 |
4351 |
0.24 |
| chr19_55927688_55927839 | 2.35 |
Tcf7l2 |
transcription factor 7 like 2, T cell specific, HMG box |
29454 |
0.2 |
| chr5_92127753_92128096 | 2.35 |
Gm24931 |
predicted gene, 24931 |
9641 |
0.12 |
| chr5_115269704_115270480 | 2.34 |
Rnf10 |
ring finger protein 10 |
2209 |
0.14 |
| chr8_80500537_80501246 | 2.34 |
Gypa |
glycophorin A |
7110 |
0.23 |
| chr18_70570299_70570652 | 2.32 |
Mbd2 |
methyl-CpG binding domain protein 2 |
2141 |
0.31 |
| chr11_96298885_96301196 | 2.32 |
Hoxb6 |
homeobox B6 |
869 |
0.31 |
| chr17_24848553_24849107 | 2.31 |
Fahd1 |
fumarylacetoacetate hydrolase domain containing 1 |
1534 |
0.18 |
| chr3_14887713_14888243 | 2.30 |
Car2 |
carbonic anhydrase 2 |
1339 |
0.44 |
| chr5_74064229_74066220 | 2.29 |
Usp46 |
ubiquitin specific peptidase 46 |
524 |
0.65 |
| chr10_80569864_80570541 | 2.28 |
Klf16 |
Kruppel-like factor 16 |
7119 |
0.08 |
| chr12_91745342_91746056 | 2.28 |
Ston2 |
stonin 2 |
385 |
0.85 |
| chr5_66080287_66081072 | 2.23 |
Rbm47 |
RNA binding motif protein 47 |
305 |
0.84 |
| chr4_115062473_115064166 | 2.23 |
Tal1 |
T cell acute lymphocytic leukemia 1 |
3811 |
0.18 |
| chr1_55084432_55085110 | 2.23 |
Hspd1 |
heat shock protein 1 (chaperonin) |
3253 |
0.13 |
| chr11_78074087_78074838 | 2.23 |
Mir451b |
microRNA 451b |
1221 |
0.18 |
| chr4_141161542_141161808 | 2.22 |
Fbxo42 |
F-box protein 42 |
13753 |
0.11 |
| chr12_91744157_91744724 | 2.21 |
Ston2 |
stonin 2 |
585 |
0.74 |
| chr11_84825718_84825869 | 2.21 |
Dhrs11 |
dehydrogenase/reductase (SDR family) member 11 |
3171 |
0.15 |
| chr9_95560936_95561583 | 2.20 |
Paqr9 |
progestin and adipoQ receptor family member IX |
1602 |
0.28 |
| chr4_121015123_121015563 | 2.20 |
Smap2 |
small ArfGAP 2 |
1904 |
0.24 |
| chr3_100485235_100486511 | 2.20 |
Tent5c |
terminal nucleotidyltransferase 5C |
3321 |
0.18 |
| chr14_31127090_31127702 | 2.19 |
Smim4 |
small integral membrane protein 4 |
1442 |
0.26 |
| chr11_31895900_31896399 | 2.19 |
Cpeb4 |
cytoplasmic polyadenylation element binding protein 4 |
22874 |
0.18 |
| chr3_14891263_14891907 | 2.18 |
Car2 |
carbonic anhydrase 2 |
4946 |
0.21 |
| chrX_150547515_150548479 | 2.18 |
Alas2 |
aminolevulinic acid synthase 2, erythroid |
538 |
0.44 |
| chr12_4873247_4874779 | 2.17 |
Mfsd2b |
major facilitator superfamily domain containing 2B |
332 |
0.82 |
| chr11_85803390_85804226 | 2.16 |
2610027K06Rik |
RIKEN cDNA 2610027K06 gene |
347 |
0.79 |
| chr19_45447201_45447888 | 2.16 |
Btrc |
beta-transducin repeat containing protein |
2036 |
0.3 |
| chr2_84735706_84738103 | 2.16 |
Ypel4 |
yippee like 4 |
2677 |
0.11 |
| chr8_94178564_94180490 | 2.15 |
Mt1 |
metallothionein 1 |
286 |
0.81 |
| chr2_131189769_131190290 | 2.14 |
Cdc25b |
cell division cycle 25B |
1321 |
0.25 |
| chr2_131260441_131261132 | 2.13 |
Pank2 |
pantothenate kinase 2 |
1709 |
0.23 |
| chr2_157131809_157132115 | 2.13 |
Samhd1 |
SAM domain and HD domain, 1 |
1905 |
0.28 |
| chr11_121434299_121435595 | 2.13 |
Fn3k |
fructosamine 3 kinase |
20 |
0.96 |
| chr10_40149812_40150388 | 2.13 |
Slc16a10 |
solute carrier family 16 (monocarboxylic acid transporters), member 10 |
7842 |
0.13 |
| chr5_66053427_66053638 | 2.11 |
Rbm47 |
RNA binding motif protein 47 |
1020 |
0.42 |
| chr19_55938446_55939225 | 2.11 |
Tcf7l2 |
transcription factor 7 like 2, T cell specific, HMG box |
40526 |
0.17 |
| chr2_26011889_26012040 | 2.11 |
Ubac1 |
ubiquitin associated domain containing 1 |
1011 |
0.44 |
| chr5_142651168_142651432 | 2.10 |
Wipi2 |
WD repeat domain, phosphoinositide interacting 2 |
11214 |
0.16 |
| chr16_32611646_32611832 | 2.09 |
Tfrc |
transferrin receptor |
2489 |
0.22 |
| chr17_56826781_56826932 | 2.09 |
Rfx2 |
regulatory factor X, 2 (influences HLA class II expression) |
4083 |
0.15 |
| chr4_108867134_108867465 | 2.09 |
Txndc12 |
thioredoxin domain containing 12 (endoplasmic reticulum) |
9807 |
0.13 |
| chr10_42272092_42272243 | 2.08 |
Foxo3 |
forkhead box O3 |
4529 |
0.28 |
| chr9_64814145_64814685 | 2.07 |
Dennd4a |
DENN/MADD domain containing 4A |
2871 |
0.28 |
| chr1_155414821_155416000 | 2.06 |
Xpr1 |
xenotropic and polytropic retrovirus receptor 1 |
1919 |
0.42 |
| chr3_116862834_116862985 | 2.06 |
Frrs1 |
ferric-chelate reductase 1 |
3342 |
0.16 |
| chrX_38575712_38576177 | 2.06 |
Cul4b |
cullin 4B |
239 |
0.93 |
| chr6_34478266_34479868 | 2.06 |
Bpgm |
2,3-bisphosphoglycerate mutase |
1925 |
0.3 |
| chr12_100955703_100956210 | 2.05 |
Ccdc88c |
coiled-coil domain containing 88C |
10783 |
0.12 |
| chr2_132575466_132576424 | 2.05 |
Gpcpd1 |
glycerophosphocholine phosphodiesterase 1 |
2188 |
0.27 |
| chr8_80497324_80498362 | 2.05 |
Gypa |
glycophorin A |
4062 |
0.27 |
| chr5_124022290_124022567 | 2.04 |
Vps37b |
vacuolar protein sorting 37B |
9830 |
0.1 |
| chr18_54422355_54422833 | 2.03 |
Redrum |
Redrum, erythroid developmental long intergenic non-protein coding transcript |
299 |
0.93 |
| chr2_154631717_154631891 | 2.02 |
Gm14198 |
predicted gene 14198 |
832 |
0.46 |
| chr3_100482118_100482393 | 2.01 |
Tent5c |
terminal nucleotidyltransferase 5C |
6939 |
0.15 |
| chr14_114948177_114949378 | 2.01 |
Gm31072 |
predicted gene, 31072 |
2752 |
0.2 |
| chr7_45238275_45239242 | 2.00 |
Cd37 |
CD37 antigen |
38 |
0.92 |
| chr2_84738253_84739261 | 2.00 |
Mir130a |
microRNA 130a |
2421 |
0.12 |
| chr4_46393219_46393626 | 1.99 |
Trmo |
tRNA methyltransferase O |
3985 |
0.15 |
| chr15_36322257_36323004 | 1.99 |
Rpl7a-ps3 |
ribosomal protein L7A, pseudogene 3 |
13686 |
0.12 |
| chr2_35318882_35319453 | 1.99 |
Stom |
stomatin |
1338 |
0.35 |
| chr10_23784536_23785205 | 1.98 |
Snora33 |
small nucleolar RNA, H/ACA box 33 |
605 |
0.42 |
| chr1_132365874_132366736 | 1.98 |
Tmcc2 |
transmembrane and coiled-coil domains 2 |
767 |
0.54 |
| chr3_146406668_146406946 | 1.98 |
Ssx2ip |
synovial sarcoma, X 2 interacting protein |
1829 |
0.25 |
| chr8_105300231_105300842 | 1.98 |
E2f4 |
E2F transcription factor 4 |
2819 |
0.08 |
| chr11_32290084_32290341 | 1.98 |
Hbq1b |
hemoglobin, theta 1B |
3211 |
0.13 |
| chr1_171840630_171841077 | 1.97 |
Cd84 |
CD84 antigen |
220 |
0.92 |
| chr11_78169162_78169671 | 1.97 |
Nek8 |
NIMA (never in mitosis gene a)-related expressed kinase 8 |
412 |
0.6 |
| chr19_38123347_38124097 | 1.97 |
Rbp4 |
retinol binding protein 4, plasma |
1003 |
0.47 |
| chr10_111167681_111168396 | 1.96 |
Osbpl8 |
oxysterol binding protein-like 8 |
3236 |
0.18 |
| chr6_5296442_5296878 | 1.96 |
Pon2 |
paraoxonase 2 |
1670 |
0.36 |
| chr16_58675826_58676599 | 1.94 |
Cpox |
coproporphyrinogen oxidase |
1627 |
0.28 |
| chr1_173331444_173331908 | 1.94 |
Ackr1 |
atypical chemokine receptor 1 (Duffy blood group) |
1826 |
0.27 |
| chr16_49854630_49854998 | 1.94 |
Cd47 |
CD47 antigen (Rh-related antigen, integrin-associated signal transducer) |
552 |
0.84 |
| chr6_41700699_41701150 | 1.94 |
Kel |
Kell blood group |
1756 |
0.24 |
| chr11_103102696_103105788 | 1.93 |
Acbd4 |
acyl-Coenzyme A binding domain containing 4 |
463 |
0.7 |
| chr13_24501559_24502461 | 1.92 |
Ripor2 |
RHO family interacting cell polarization regulator 2 |
485 |
0.79 |
| chr15_97847842_97848144 | 1.92 |
Hdac7 |
histone deacetylase 7 |
3491 |
0.2 |
| chr18_65801667_65801985 | 1.92 |
Sec11c |
SEC11 homolog C, signal peptidase complex subunit |
524 |
0.68 |
| chr3_14892830_14893278 | 1.92 |
Car2 |
carbonic anhydrase 2 |
6415 |
0.2 |
| chr7_80197844_80199539 | 1.91 |
Sema4b |
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4B |
155 |
0.91 |
| chr11_85340610_85340853 | 1.90 |
Bcas3 |
breast carcinoma amplified sequence 3 |
12436 |
0.2 |
| chr14_32167841_32168504 | 1.90 |
Ncoa4 |
nuclear receptor coactivator 4 |
2051 |
0.19 |
| chr10_58371395_58372247 | 1.89 |
Lims1 |
LIM and senescent cell antigen-like domains 1 |
367 |
0.87 |
| chrX_9274237_9274969 | 1.89 |
Xk |
X-linked Kx blood group |
1847 |
0.24 |
| chr8_120504115_120505872 | 1.89 |
Gm26971 |
predicted gene, 26971 |
15622 |
0.12 |
| chr13_32969345_32969673 | 1.89 |
Serpinb6b |
serine (or cysteine) peptidase inhibitor, clade B, member 6b |
1989 |
0.24 |
| chr17_40812809_40813139 | 1.89 |
Rhag |
Rhesus blood group-associated A glycoprotein |
1790 |
0.29 |
| chr8_23042468_23042927 | 1.89 |
Ank1 |
ankyrin 1, erythroid |
7466 |
0.18 |
| chr6_67186343_67186608 | 1.88 |
Gm8566 |
predicted pseudogene 8566 |
19144 |
0.12 |
| chr5_23430460_23431470 | 1.88 |
5031425E22Rik |
RIKEN cDNA 5031425E22 gene |
2344 |
0.21 |
| chr2_4559087_4560437 | 1.88 |
Frmd4a |
FERM domain containing 4A |
6 |
0.98 |
| chr6_56921888_56922511 | 1.87 |
Nt5c3 |
5'-nucleotidase, cytosolic III |
1525 |
0.25 |
| chr13_76014527_76014860 | 1.87 |
Rfesd |
Rieske (Fe-S) domain containing |
3775 |
0.15 |
| chr1_138174613_138175183 | 1.87 |
Ptprc |
protein tyrosine phosphatase, receptor type, C |
291 |
0.87 |
| chr1_130732649_130733832 | 1.87 |
AA986860 |
expressed sequence AA986860 |
1130 |
0.29 |
| chr17_29493756_29495031 | 1.87 |
Pim1 |
proviral integration site 1 |
986 |
0.37 |
| chr3_84035854_84036258 | 1.86 |
Tmem131l |
transmembrane 131 like |
4072 |
0.27 |
| chr3_83026692_83027527 | 1.86 |
Fga |
fibrinogen alpha chain |
894 |
0.5 |
| chr2_84940292_84940460 | 1.86 |
Slc43a3 |
solute carrier family 43, member 3 |
3486 |
0.16 |
| chr11_109720064_109720695 | 1.86 |
Fam20a |
family with sequence similarity 20, member A |
1877 |
0.33 |
| chr4_142017816_142018715 | 1.86 |
4930455G09Rik |
RIKEN cDNA 4930455G09 gene |
367 |
0.8 |
| chr16_8736142_8736633 | 1.85 |
Usp7 |
ubiquitin specific peptidase 7 |
1955 |
0.29 |
| chr2_35332266_35332464 | 1.84 |
Stom |
stomatin |
4611 |
0.15 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.1 | 9.4 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 2.6 | 5.1 | GO:0071733 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 2.1 | 10.4 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 2.0 | 5.9 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
| 1.8 | 8.8 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 1.6 | 4.7 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 1.5 | 7.6 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 1.4 | 9.8 | GO:0015684 | ferrous iron transport(GO:0015684) |
| 1.3 | 3.9 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
| 1.2 | 3.7 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 1.2 | 3.6 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 1.2 | 3.6 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 1.1 | 3.4 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 1.1 | 4.4 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 1.0 | 7.1 | GO:0002576 | platelet degranulation(GO:0002576) |
| 1.0 | 3.9 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 1.0 | 2.9 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.9 | 2.7 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.9 | 3.5 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.8 | 1.7 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.8 | 2.4 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.8 | 3.2 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.8 | 1.6 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.8 | 3.1 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.8 | 15.6 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.8 | 2.3 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.8 | 1.5 | GO:1901671 | positive regulation of superoxide dismutase activity(GO:1901671) positive regulation of removal of superoxide radicals(GO:1904833) |
| 0.8 | 3.8 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.7 | 3.7 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.7 | 0.7 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.7 | 0.7 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
| 0.7 | 2.8 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.7 | 0.7 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
| 0.7 | 4.2 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.7 | 2.8 | GO:0046618 | drug export(GO:0046618) |
| 0.7 | 0.7 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.7 | 2.0 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
| 0.6 | 1.9 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.6 | 0.6 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.6 | 3.2 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.6 | 3.2 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.6 | 3.8 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.6 | 1.8 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.6 | 4.8 | GO:0097286 | iron ion import(GO:0097286) |
| 0.6 | 1.8 | GO:0033668 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
| 0.6 | 0.6 | GO:0010958 | regulation of amino acid import(GO:0010958) |
| 0.6 | 1.2 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.6 | 1.8 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.6 | 2.3 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
| 0.6 | 0.6 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.6 | 3.9 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.6 | 1.7 | GO:0000087 | mitotic M phase(GO:0000087) |
| 0.6 | 1.7 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.6 | 1.7 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.6 | 2.2 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.6 | 2.2 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.5 | 1.1 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.5 | 6.0 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.5 | 2.2 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.5 | 2.2 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 0.5 | 1.6 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.5 | 2.7 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.5 | 1.6 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.5 | 0.5 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.5 | 0.5 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.5 | 0.5 | GO:0036258 | multivesicular body assembly(GO:0036258) |
| 0.5 | 1.6 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.5 | 1.6 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.5 | 1.0 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.5 | 2.0 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.5 | 1.5 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
| 0.5 | 1.4 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.5 | 3.9 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.5 | 1.9 | GO:0006742 | NADP catabolic process(GO:0006742) |
| 0.5 | 2.4 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 0.5 | 1.4 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.5 | 1.4 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.5 | 1.4 | GO:0032910 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
| 0.5 | 1.4 | GO:0034633 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
| 0.5 | 0.5 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.5 | 1.4 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.5 | 3.2 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.5 | 1.4 | GO:0042117 | monocyte activation(GO:0042117) |
| 0.5 | 2.3 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
| 0.5 | 0.9 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.4 | 3.1 | GO:0060396 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.4 | 2.2 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.4 | 0.9 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.4 | 1.3 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.4 | 1.8 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.4 | 1.3 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
| 0.4 | 1.3 | GO:0001805 | type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
| 0.4 | 1.3 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.4 | 2.6 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
| 0.4 | 2.1 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.4 | 1.7 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.4 | 1.3 | GO:0008228 | opsonization(GO:0008228) |
| 0.4 | 1.3 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.4 | 1.7 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.4 | 1.3 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.4 | 1.3 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 0.4 | 3.3 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.4 | 2.9 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.4 | 1.7 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.4 | 1.2 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.4 | 1.2 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.4 | 2.1 | GO:0070836 | caveola assembly(GO:0070836) |
| 0.4 | 0.8 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.4 | 1.2 | GO:0006227 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.4 | 0.4 | GO:0031627 | telomeric loop formation(GO:0031627) |
| 0.4 | 1.2 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.4 | 1.2 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.4 | 1.2 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.4 | 8.5 | GO:0048821 | erythrocyte development(GO:0048821) |
| 0.4 | 3.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.4 | 1.6 | GO:0050812 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.4 | 4.4 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
| 0.4 | 1.6 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 0.4 | 1.2 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
| 0.4 | 1.6 | GO:0036492 | regulation of translation in response to endoplasmic reticulum stress(GO:0036490) regulation of translation initiation in response to endoplasmic reticulum stress(GO:0036491) eiF2alpha phosphorylation in response to endoplasmic reticulum stress(GO:0036492) negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.4 | 2.4 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.4 | 1.6 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.4 | 1.9 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
| 0.4 | 1.9 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.4 | 4.2 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.4 | 1.1 | GO:0033131 | regulation of glucokinase activity(GO:0033131) positive regulation of glucokinase activity(GO:0033133) |
| 0.4 | 1.5 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.4 | 1.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.4 | 1.1 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.4 | 0.4 | GO:0075136 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 0.4 | 6.7 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.4 | 0.4 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.4 | 1.9 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.4 | 1.5 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.4 | 1.1 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.4 | 1.8 | GO:0006983 | ER overload response(GO:0006983) |
| 0.4 | 1.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.4 | 0.7 | GO:0015677 | copper ion import(GO:0015677) |
| 0.4 | 0.7 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.4 | 0.4 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.4 | 1.4 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.4 | 1.1 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.4 | 1.4 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.4 | 0.7 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.4 | 6.4 | GO:0000305 | response to oxygen radical(GO:0000305) |
| 0.4 | 1.4 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.4 | 0.4 | GO:0044854 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) |
| 0.4 | 1.1 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
| 0.3 | 1.4 | GO:1900200 | mesenchymal cell apoptotic process involved in metanephros development(GO:1900200) regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900211) negative regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900212) |
| 0.3 | 1.4 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.3 | 1.4 | GO:0090155 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
| 0.3 | 6.6 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.3 | 1.0 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
| 0.3 | 1.7 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
| 0.3 | 2.4 | GO:2000258 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
| 0.3 | 1.7 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.3 | 1.4 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.3 | 1.4 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.3 | 0.7 | GO:1900226 | negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
| 0.3 | 2.7 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.3 | 1.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.3 | 2.3 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.3 | 0.7 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
| 0.3 | 0.3 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
| 0.3 | 0.7 | GO:0006658 | phosphatidylserine metabolic process(GO:0006658) |
| 0.3 | 1.0 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.3 | 3.6 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.3 | 1.0 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.3 | 1.0 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
| 0.3 | 1.0 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
| 0.3 | 1.3 | GO:0036233 | glycine import(GO:0036233) |
| 0.3 | 1.9 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.3 | 2.9 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.3 | 0.6 | GO:0052422 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.3 | 1.0 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.3 | 1.0 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.3 | 1.0 | GO:0070488 | neutrophil aggregation(GO:0070488) |
| 0.3 | 1.6 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.3 | 2.2 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.3 | 0.3 | GO:2000644 | regulation of receptor catabolic process(GO:2000644) |
| 0.3 | 0.6 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.3 | 1.0 | GO:0002578 | negative regulation of antigen processing and presentation(GO:0002578) negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
| 0.3 | 0.9 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.3 | 0.6 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 0.3 | 0.9 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.3 | 0.6 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.3 | 0.3 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
| 0.3 | 0.6 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.3 | 0.3 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.3 | 0.9 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 0.3 | 1.5 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.3 | 1.5 | GO:0010985 | negative regulation of lipoprotein particle clearance(GO:0010985) |
| 0.3 | 0.3 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
| 0.3 | 0.9 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.3 | 0.6 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.3 | 1.5 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.3 | 0.6 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.3 | 0.9 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.3 | 0.9 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
| 0.3 | 2.7 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.3 | 0.6 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.3 | 0.9 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.3 | 0.6 | GO:2000566 | positive regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000566) |
| 0.3 | 0.9 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.3 | 0.9 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.3 | 1.2 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.3 | 5.0 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.3 | 0.9 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
| 0.3 | 1.2 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.3 | 2.6 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.3 | 1.7 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.3 | 0.6 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
| 0.3 | 2.0 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.3 | 0.9 | GO:0072319 | vesicle uncoating(GO:0072319) |
| 0.3 | 0.3 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.3 | 0.6 | GO:0071922 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.3 | 0.9 | GO:0019042 | viral latency(GO:0019042) |
| 0.3 | 0.9 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.3 | 0.6 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
| 0.3 | 0.6 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.3 | 1.7 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.3 | 1.1 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.3 | 2.2 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
| 0.3 | 0.3 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.3 | 0.8 | GO:0009157 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 0.3 | 1.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.3 | 1.7 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.3 | 1.1 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.3 | 0.5 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
| 0.3 | 1.9 | GO:0015825 | L-serine transport(GO:0015825) |
| 0.3 | 0.8 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.3 | 0.3 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.3 | 0.3 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.3 | 0.8 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.3 | 2.4 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.3 | 1.1 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.3 | 1.3 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
| 0.3 | 1.3 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.3 | 1.3 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.3 | 2.7 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.3 | 1.3 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.3 | 1.9 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.3 | 0.5 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.3 | 2.6 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.3 | 1.3 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.3 | 0.8 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.3 | 0.5 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.3 | 2.1 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
| 0.3 | 0.5 | GO:0019230 | proprioception(GO:0019230) |
| 0.3 | 0.3 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
| 0.3 | 0.8 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.3 | 1.0 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.3 | 0.3 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.3 | 0.8 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.3 | 1.3 | GO:0032075 | positive regulation of nuclease activity(GO:0032075) |
| 0.3 | 1.5 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.3 | 1.5 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.3 | 0.8 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 0.3 | 0.8 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.3 | 0.3 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.3 | 0.5 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.3 | 1.3 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.3 | 0.5 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
| 0.2 | 3.0 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.2 | 0.2 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.2 | 2.2 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.2 | 0.7 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.2 | 3.9 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.2 | 0.7 | GO:0071046 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent tRNA catabolic process(GO:0071038) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
| 0.2 | 1.0 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.2 | 3.4 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.2 | 0.5 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.2 | 0.2 | GO:0030242 | pexophagy(GO:0030242) |
| 0.2 | 2.4 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.2 | 3.1 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.2 | 1.2 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.2 | 1.2 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.2 | 0.5 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.2 | 0.7 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
| 0.2 | 0.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.2 | 1.2 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
| 0.2 | 1.9 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.2 | 6.4 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.2 | 0.7 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.2 | 1.4 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.2 | 1.4 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.2 | 2.1 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.2 | 1.2 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.2 | 1.6 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.2 | 0.2 | GO:0032875 | regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
| 0.2 | 1.1 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.2 | 0.2 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.2 | 0.2 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.2 | 3.2 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.2 | 0.2 | GO:0032831 | positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
| 0.2 | 0.7 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.2 | 0.9 | GO:0031577 | spindle checkpoint(GO:0031577) |
| 0.2 | 0.2 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.2 | 0.9 | GO:0042420 | dopamine catabolic process(GO:0042420) |
| 0.2 | 1.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.2 | 0.7 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.2 | 0.2 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
| 0.2 | 0.7 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.2 | 2.2 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.2 | 0.7 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.2 | 0.9 | GO:0006188 | IMP biosynthetic process(GO:0006188) |
| 0.2 | 1.6 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.2 | 1.1 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.2 | 0.4 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.2 | 0.4 | GO:0046060 | dATP metabolic process(GO:0046060) |
| 0.2 | 0.7 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.2 | 1.5 | GO:0072431 | signal transduction involved in mitotic G1 DNA damage checkpoint(GO:0072431) intracellular signal transduction involved in G1 DNA damage checkpoint(GO:1902400) |
| 0.2 | 0.7 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
| 0.2 | 0.7 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.2 | 0.7 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.2 | 0.4 | GO:0060061 | Spemann organizer formation(GO:0060061) |
| 0.2 | 2.4 | GO:0046697 | decidualization(GO:0046697) |
| 0.2 | 0.2 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.2 | 0.7 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.2 | 0.2 | GO:1904468 | negative regulation of tumor necrosis factor secretion(GO:1904468) |
| 0.2 | 0.4 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.2 | 0.7 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 0.2 | 0.9 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.2 | 0.2 | GO:0043987 | histone-serine phosphorylation(GO:0035404) histone H3-S10 phosphorylation(GO:0043987) |
| 0.2 | 0.6 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.2 | 0.6 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.2 | 1.9 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.2 | 1.5 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.2 | 4.5 | GO:0010965 | regulation of mitotic sister chromatid separation(GO:0010965) |
| 0.2 | 0.9 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.2 | 0.6 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.2 | 3.0 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.2 | 1.5 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.2 | 0.2 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.2 | 0.6 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.2 | 0.6 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.2 | 0.2 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
| 0.2 | 1.5 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.2 | 0.2 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.2 | 0.8 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.2 | 1.0 | GO:2000489 | regulation of hepatic stellate cell activation(GO:2000489) |
| 0.2 | 0.8 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
| 0.2 | 1.0 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.2 | 0.6 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.2 | 0.6 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.2 | 0.8 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.2 | 1.4 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
| 0.2 | 0.8 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.2 | 3.0 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.2 | 0.8 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.2 | 0.4 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.2 | 0.2 | GO:0090467 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
| 0.2 | 1.2 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.2 | 0.4 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.2 | 0.6 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.2 | 0.8 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.2 | 0.8 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.2 | 0.2 | GO:0010424 | DNA methylation on cytosine within a CG sequence(GO:0010424) DNA methylation on cytosine(GO:0032776) |
| 0.2 | 0.4 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.2 | 0.8 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.2 | 0.2 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) positive regulation of receptor catabolic process(GO:2000646) |
| 0.2 | 0.6 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.2 | 1.2 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.2 | 0.6 | GO:0035624 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.2 | 0.6 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.2 | 0.4 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.2 | 1.2 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
| 0.2 | 0.4 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
| 0.2 | 1.0 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
| 0.2 | 1.7 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.2 | 0.4 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.2 | 1.0 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
| 0.2 | 0.4 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.2 | 0.6 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.2 | 1.0 | GO:0000237 | leptotene(GO:0000237) |
| 0.2 | 1.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.2 | 0.4 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.2 | 0.8 | GO:0034434 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.2 | 0.6 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.2 | 0.4 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.2 | 1.9 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.2 | 0.2 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.2 | 1.1 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.2 | 0.8 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.2 | 0.8 | GO:0051255 | spindle midzone assembly(GO:0051255) |
| 0.2 | 0.8 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
| 0.2 | 0.8 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.2 | 0.7 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.2 | 0.2 | GO:0060416 | response to growth hormone(GO:0060416) |
| 0.2 | 0.4 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.2 | 0.2 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.2 | 0.2 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) regulation of mRNA polyadenylation(GO:1900363) negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.2 | 0.6 | GO:1903286 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
| 0.2 | 1.1 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
| 0.2 | 2.0 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
| 0.2 | 1.3 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.2 | 2.0 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.2 | 0.2 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.2 | 0.4 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 0.2 | 1.8 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.2 | 0.6 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.2 | 0.6 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.2 | 3.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.2 | 1.3 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.2 | 0.5 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.2 | 0.5 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.2 | 1.1 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.2 | 1.5 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.2 | 0.2 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.2 | 0.9 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.2 | 0.4 | GO:0051029 | RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) rRNA transport(GO:0051029) |
| 0.2 | 0.5 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
| 0.2 | 0.2 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.2 | 0.5 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.2 | 1.1 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.2 | 0.5 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.2 | 0.2 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
| 0.2 | 0.5 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.2 | 0.4 | GO:0033363 | secretory granule organization(GO:0033363) |
| 0.2 | 0.2 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.2 | 1.6 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.2 | 0.9 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.2 | 0.5 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.2 | 0.2 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
| 0.2 | 0.4 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.2 | 0.4 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.2 | 1.1 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.2 | 6.0 | GO:1902653 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
| 0.2 | 0.2 | GO:0009445 | putrescine metabolic process(GO:0009445) |
| 0.2 | 0.5 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.2 | 0.9 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.2 | 0.5 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.2 | 1.9 | GO:0032727 | positive regulation of interferon-alpha production(GO:0032727) |
| 0.2 | 2.8 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.2 | 6.0 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.2 | 0.5 | GO:0010886 | cholesterol storage(GO:0010878) positive regulation of cholesterol storage(GO:0010886) |
| 0.2 | 1.4 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.2 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.2 | 1.9 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.2 | 0.5 | GO:0009174 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.2 | 0.9 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.2 | 1.0 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.2 | 1.7 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.2 | 1.9 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
| 0.2 | 0.5 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.2 | 0.9 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.2 | 0.5 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) COPII-coated vesicle budding(GO:0090114) |
| 0.2 | 0.2 | GO:0045991 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) carbon catabolite activation of transcription(GO:0045991) positive regulation of transcription by glucose(GO:0046016) |
| 0.2 | 0.2 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.2 | 0.3 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) |
| 0.2 | 0.5 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.2 | 2.7 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.2 | 0.7 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.2 | 1.8 | GO:0006778 | porphyrin-containing compound metabolic process(GO:0006778) |
| 0.2 | 0.5 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.2 | 0.2 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.2 | 0.8 | GO:0060177 | regulation of angiotensin levels in blood(GO:0002002) regulation of angiotensin metabolic process(GO:0060177) |
| 0.2 | 0.3 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.2 | 1.0 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
| 0.2 | 1.7 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.2 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.2 | 0.8 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.2 | 1.5 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.2 | 1.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.2 | 0.2 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.2 | 1.0 | GO:0006527 | arginine catabolic process(GO:0006527) |
| 0.2 | 0.8 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.2 | 0.7 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.2 | 0.6 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.2 | 0.2 | GO:0009158 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 0.2 | 0.8 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.2 | 0.2 | GO:1902188 | positive regulation of viral release from host cell(GO:1902188) |
| 0.2 | 0.2 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
| 0.2 | 1.9 | GO:0042407 | cristae formation(GO:0042407) |
| 0.2 | 1.3 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.2 | 0.6 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.2 | 0.6 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
| 0.2 | 2.8 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.2 | 0.3 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 0.2 | 0.2 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.2 | 0.5 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.2 | 0.3 | GO:2000257 | regulation of protein activation cascade(GO:2000257) |
| 0.2 | 1.2 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.2 | 0.2 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.2 | 1.2 | GO:0006513 | protein monoubiquitination(GO:0006513) |
| 0.2 | 0.6 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.2 | 0.3 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
| 0.2 | 0.6 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.2 | 0.3 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.2 | 0.2 | GO:1902065 | response to L-glutamate(GO:1902065) |
| 0.2 | 0.6 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.2 | 0.5 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.2 | 0.5 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
| 0.2 | 0.3 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.2 | 0.6 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
| 0.2 | 0.3 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.2 | 1.2 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.2 | 0.3 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.2 | 0.6 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.2 | 1.1 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.2 | 1.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.2 | 2.0 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
| 0.1 | 1.5 | GO:0006577 | amino-acid betaine metabolic process(GO:0006577) |
| 0.1 | 5.7 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.1 | 0.6 | GO:0033700 | phospholipid efflux(GO:0033700) |
| 0.1 | 0.4 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.1 | 1.2 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.1 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.1 | 0.3 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.1 | 0.1 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.1 | 0.4 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.1 | 0.4 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.1 | 0.6 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
| 0.1 | 0.1 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.1 | 1.4 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 0.1 | 1.2 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.1 | 1.2 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| 0.1 | 0.4 | GO:1904587 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
| 0.1 | 0.3 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.1 | 3.7 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.1 | 0.1 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
| 0.1 | 4.9 | GO:0006040 | amino sugar metabolic process(GO:0006040) |
| 0.1 | 0.7 | GO:0051126 | negative regulation of actin nucleation(GO:0051126) |
| 0.1 | 0.6 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.1 | 0.3 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.1 | 2.6 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.1 | 5.1 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 0.1 | 1.3 | GO:1901976 | regulation of cell cycle checkpoint(GO:1901976) |
| 0.1 | 0.4 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.1 | 0.8 | GO:0032392 | DNA geometric change(GO:0032392) |
| 0.1 | 0.4 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.1 | 0.3 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.1 | 1.5 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
| 0.1 | 4.5 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.1 | 3.9 | GO:1900047 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
| 0.1 | 0.3 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.1 | 0.7 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.1 | 0.4 | GO:0003099 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
| 0.1 | 0.6 | GO:0018101 | protein citrullination(GO:0018101) |
| 0.1 | 0.3 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.1 | 0.3 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.1 | 0.1 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.1 | 1.8 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.1 | 1.0 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.1 | 0.4 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.1 | 0.4 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.1 | 0.5 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
| 0.1 | 0.3 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.1 | 0.7 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 | 0.3 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.1 | 0.3 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.1 | 0.4 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.1 | 0.3 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
| 0.1 | 0.1 | GO:0031446 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 0.1 | 0.7 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.1 | 1.6 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.1 | 0.4 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.1 | 0.4 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.1 | 0.8 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.1 | 1.1 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.1 | 1.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.1 | 0.4 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.1 | 2.7 | GO:0046834 | lipid phosphorylation(GO:0046834) |
| 0.1 | 0.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.1 | 0.3 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.1 | 0.1 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.1 | 0.9 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.1 | 0.5 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.1 | 0.3 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
| 0.1 | 0.8 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.1 | 0.4 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.1 | 0.8 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.1 | 0.3 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.1 | 0.5 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 | 0.1 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.1 | 0.7 | GO:1904814 | regulation of protein localization to chromosome, telomeric region(GO:1904814) |
| 0.1 | 1.6 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
| 0.1 | 0.4 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.1 | 0.4 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 | 0.5 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.1 | 0.5 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.1 | 0.3 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
| 0.1 | 0.3 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.1 | 0.6 | GO:0006415 | translational termination(GO:0006415) |
| 0.1 | 0.4 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.1 | 0.4 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.1 | 0.4 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
| 0.1 | 0.8 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.1 | 3.9 | GO:0006446 | regulation of translational initiation(GO:0006446) |
| 0.1 | 0.8 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 | 0.4 | GO:1902268 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 | 0.8 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.1 | 0.9 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.1 | 0.8 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.1 | 0.3 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 0.1 | 0.4 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.1 | 0.1 | GO:0032329 | serine transport(GO:0032329) |
| 0.1 | 0.3 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.1 | 0.1 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.1 | 0.6 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 0.1 | GO:0043173 | nucleotide salvage(GO:0043173) |
| 0.1 | 0.5 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
| 0.1 | 0.5 | GO:0002349 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.1 | 0.1 | GO:0006216 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.1 | 0.1 | GO:0036480 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
| 0.1 | 0.6 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 0.4 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.1 | 0.1 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
| 0.1 | 1.1 | GO:0051205 | protein insertion into membrane(GO:0051205) |
| 0.1 | 0.7 | GO:0042559 | pteridine-containing compound biosynthetic process(GO:0042559) |
| 0.1 | 0.7 | GO:0048757 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.1 | 5.5 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
| 0.1 | 5.2 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
| 0.1 | 0.4 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.5 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.1 | 0.7 | GO:0007035 | vacuolar acidification(GO:0007035) |
| 0.1 | 0.2 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.1 | 1.2 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.1 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 | 0.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 | 0.6 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.1 | 0.1 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.1 | 0.4 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.1 | 0.7 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 2.9 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.1 | 0.2 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
| 0.1 | 0.1 | GO:0014735 | regulation of muscle atrophy(GO:0014735) |
| 0.1 | 0.1 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
| 0.1 | 0.2 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 0.8 | GO:0032801 | receptor catabolic process(GO:0032801) |
| 0.1 | 0.4 | GO:0015705 | iodide transport(GO:0015705) |
| 0.1 | 1.4 | GO:0002820 | negative regulation of adaptive immune response(GO:0002820) |
| 0.1 | 0.1 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
| 0.1 | 0.4 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.1 | 1.3 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.1 | 0.7 | GO:0032366 | intracellular sterol transport(GO:0032366) |
| 0.1 | 0.4 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.1 | 0.8 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 | 0.6 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 | 0.2 | GO:0060789 | hair follicle placode formation(GO:0060789) |
| 0.1 | 1.7 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.1 | 1.9 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.1 | 0.2 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
| 0.1 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.1 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 0.2 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.1 | 0.3 | GO:0050684 | regulation of mRNA processing(GO:0050684) |
| 0.1 | 0.5 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.1 | GO:0061724 | lipophagy(GO:0061724) |
| 0.1 | 0.6 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.1 | 0.5 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.1 | 1.8 | GO:0007052 | mitotic spindle organization(GO:0007052) |
| 0.1 | 0.2 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 | 0.2 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 | 0.3 | GO:0021570 | rhombomere 4 development(GO:0021570) |
| 0.1 | 0.6 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.1 | 0.8 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
| 0.1 | 0.3 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
| 0.1 | 0.3 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
| 0.1 | 0.6 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
| 0.1 | 0.6 | GO:0045332 | phospholipid translocation(GO:0045332) |
| 0.1 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
| 0.1 | 0.3 | GO:0072350 | tricarboxylic acid metabolic process(GO:0072350) |
| 0.1 | 0.2 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
| 0.1 | 0.2 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 2.1 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.1 | 1.0 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.1 | 3.9 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.1 | 0.7 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
| 0.1 | 0.3 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.1 | 0.4 | GO:0045144 | meiotic sister chromatid segregation(GO:0045144) meiotic sister chromatid cohesion(GO:0051177) |
| 0.1 | 0.2 | GO:0045625 | regulation of T-helper 1 cell differentiation(GO:0045625) |
| 0.1 | 0.7 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.1 | 1.2 | GO:0000070 | mitotic sister chromatid segregation(GO:0000070) |
| 0.1 | 0.4 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.1 | 0.4 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.1 | 0.8 | GO:0031498 | nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) protein-DNA complex disassembly(GO:0032986) |
| 0.1 | 0.4 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 0.1 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
| 0.1 | 4.4 | GO:0009060 | aerobic respiration(GO:0009060) |
| 0.1 | 0.9 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.1 | 0.2 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
| 0.1 | 0.3 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.1 | 1.6 | GO:0033006 | regulation of mast cell activation involved in immune response(GO:0033006) regulation of mast cell degranulation(GO:0043304) |
| 0.1 | 1.0 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
| 0.1 | 2.7 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
| 0.1 | 0.1 | GO:0042401 | amine biosynthetic process(GO:0009309) cellular biogenic amine biosynthetic process(GO:0042401) |
| 0.1 | 0.1 | GO:0046645 | positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
| 0.1 | 0.5 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 | 0.4 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
| 0.1 | 0.3 | GO:0008216 | spermidine metabolic process(GO:0008216) |
| 0.1 | 0.3 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
| 0.1 | 0.1 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
| 0.1 | 0.1 | GO:0034204 | lipid translocation(GO:0034204) |
| 0.1 | 0.2 | GO:0030952 | establishment or maintenance of cytoskeleton polarity(GO:0030952) |
| 0.1 | 0.2 | GO:0051095 | regulation of helicase activity(GO:0051095) |
| 0.1 | 0.4 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.1 | 0.2 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.8 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.1 | 2.9 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
| 0.1 | 0.2 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
| 0.1 | 0.2 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.1 | 0.2 | GO:0072423 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) |
| 0.1 | 0.1 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
| 0.1 | 2.3 | GO:0006414 | translational elongation(GO:0006414) |
| 0.1 | 0.3 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.1 | 0.3 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.1 | 0.6 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.1 | 0.3 | GO:0014010 | negative regulation of Schwann cell proliferation(GO:0010626) Schwann cell proliferation(GO:0014010) |
| 0.1 | 0.6 | GO:0030889 | negative regulation of B cell proliferation(GO:0030889) |
| 0.1 | 0.3 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.1 | 0.2 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
| 0.1 | 0.1 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 0.1 | 0.1 | GO:0002580 | regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
| 0.1 | 0.4 | GO:0015816 | glycine transport(GO:0015816) |
| 0.1 | 0.3 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.1 | 0.5 | GO:0015074 | DNA integration(GO:0015074) |
| 0.1 | 0.5 | GO:1902808 | positive regulation of cell cycle G1/S phase transition(GO:1902808) |
| 0.1 | 0.2 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.1 | 0.3 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 0.3 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.1 | 0.1 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.1 | 0.4 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.1 | 0.2 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.1 | 0.5 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.1 | 0.6 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.1 | 0.4 | GO:0009414 | response to water deprivation(GO:0009414) |
| 0.1 | 0.1 | GO:0007135 | meiosis II(GO:0007135) |
| 0.1 | 0.1 | GO:0035268 | protein mannosylation(GO:0035268) mannosylation(GO:0097502) |
| 0.1 | 1.7 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.1 | 0.4 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
| 0.1 | 0.3 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.1 | 0.1 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.1 | 0.2 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.1 | 0.2 | GO:0042891 | antibiotic transport(GO:0042891) |
| 0.1 | 0.4 | GO:0046130 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.1 | 0.3 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.1 | 0.5 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.1 | 0.2 | GO:0019068 | virion assembly(GO:0019068) |
| 0.1 | 0.2 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.1 | 0.3 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 2.1 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.1 | 0.6 | GO:0072525 | pyridine-containing compound biosynthetic process(GO:0072525) |
| 0.1 | 0.2 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.1 | 0.3 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
| 0.1 | 0.3 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.1 | 0.2 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.1 | 0.2 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.1 | 0.1 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
| 0.1 | 0.2 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.1 | 0.1 | GO:0070340 | detection of bacterial lipopeptide(GO:0070340) |
| 0.1 | 0.1 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) |
| 0.1 | 1.9 | GO:0006413 | translational initiation(GO:0006413) |
| 0.1 | 1.5 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 | 0.5 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
| 0.1 | 0.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.1 | 0.4 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.1 | 1.3 | GO:0010324 | membrane invagination(GO:0010324) |
| 0.1 | 0.3 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.1 | 0.3 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.1 | 0.3 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.1 | 0.3 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.1 | 0.4 | GO:0035493 | SNARE complex assembly(GO:0035493) |
| 0.1 | 0.5 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.1 | 0.1 | GO:0046929 | negative regulation of neurotransmitter secretion(GO:0046929) |
| 0.1 | 0.2 | GO:0000478 | endonucleolytic cleavage involved in rRNA processing(GO:0000478) |
| 0.1 | 0.6 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.1 | 0.2 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.1 | 0.5 | GO:0030575 | nuclear body organization(GO:0030575) |
| 0.1 | 0.2 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.1 | 0.3 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.1 | 0.1 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.1 | 0.5 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.1 | 0.2 | GO:0000270 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.1 | 0.8 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
| 0.1 | 0.1 | GO:0021569 | rhombomere 3 development(GO:0021569) |
| 0.1 | 0.3 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
| 0.1 | 0.1 | GO:0036260 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.1 | 0.8 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 | 0.5 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 0.4 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.1 | 0.1 | GO:0046599 | regulation of centriole replication(GO:0046599) |
| 0.1 | 0.4 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.1 | 0.2 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.1 | 0.2 | GO:0032607 | interferon-alpha production(GO:0032607) |
| 0.1 | 0.2 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.1 | 1.6 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
| 0.1 | 0.3 | GO:0000288 | nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:0000288) |
| 0.1 | 0.2 | GO:0061038 | uterus morphogenesis(GO:0061038) |
| 0.1 | 0.3 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.1 | 0.1 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.1 | 0.2 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.1 | 1.1 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.1 | 0.3 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.1 | 3.5 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.1 | 0.8 | GO:0035455 | response to interferon-alpha(GO:0035455) |
| 0.1 | 0.3 | GO:0072672 | neutrophil extravasation(GO:0072672) |
| 0.1 | 1.1 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.1 | 0.8 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.1 | 0.1 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.1 | 0.6 | GO:0046464 | neutral lipid catabolic process(GO:0046461) acylglycerol catabolic process(GO:0046464) |
| 0.1 | 0.3 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.1 | 2.6 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.1 | 0.7 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.1 | 0.2 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.1 | 0.2 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.1 | 1.8 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
| 0.1 | 0.2 | GO:0030813 | positive regulation of nucleotide catabolic process(GO:0030813) |
| 0.1 | 0.2 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.1 | 0.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.1 | 0.6 | GO:0042574 | retinal metabolic process(GO:0042574) |
| 0.1 | 0.4 | GO:0042026 | protein refolding(GO:0042026) |
| 0.1 | 1.0 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.1 | 0.2 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
| 0.1 | 0.2 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.1 | 0.2 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.1 | 0.2 | GO:0010755 | regulation of plasminogen activation(GO:0010755) |
| 0.1 | 0.1 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
| 0.1 | 0.9 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.1 | 0.7 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.1 | 0.3 | GO:1901678 | iron coordination entity transport(GO:1901678) |
| 0.1 | 0.2 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.1 | 0.2 | GO:0039532 | negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
| 0.1 | 0.2 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
| 0.1 | 0.3 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.1 | 1.5 | GO:0006956 | complement activation(GO:0006956) |
| 0.1 | 0.2 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.1 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.1 | 0.2 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 | 0.2 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
| 0.1 | 0.2 | GO:0051295 | polar body extrusion after meiotic divisions(GO:0040038) establishment of meiotic spindle localization(GO:0051295) formin-nucleated actin cable assembly(GO:0070649) |
| 0.1 | 1.0 | GO:0032435 | negative regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032435) |
| 0.1 | 0.2 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.1 | 0.1 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.1 | 0.9 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.1 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 | 0.5 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.1 | 0.5 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 | 0.2 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 0.1 | 0.1 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.1 | 0.1 | GO:0048069 | eye pigmentation(GO:0048069) |
| 0.1 | 0.5 | GO:0010388 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
| 0.1 | 0.2 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.1 | 0.3 | GO:0048002 | antigen processing and presentation of peptide antigen(GO:0048002) |
| 0.1 | 0.4 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.2 | GO:0002664 | regulation of T cell tolerance induction(GO:0002664) |
| 0.1 | 0.3 | GO:0009992 | cellular water homeostasis(GO:0009992) |
| 0.1 | 0.1 | GO:0001893 | maternal placenta development(GO:0001893) |
| 0.1 | 0.1 | GO:0046040 | IMP metabolic process(GO:0046040) |
| 0.1 | 0.4 | GO:0010561 | negative regulation of glycoprotein biosynthetic process(GO:0010561) |
| 0.1 | 11.9 | GO:0008380 | RNA splicing(GO:0008380) |
| 0.1 | 0.7 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.1 | 2.2 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
| 0.1 | 0.1 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.1 | 1.0 | GO:0035825 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.1 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.1 | 0.2 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.1 | 0.8 | GO:0030851 | granulocyte differentiation(GO:0030851) |
| 0.1 | 0.3 | GO:0016045 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.1 | 0.2 | GO:0008272 | sulfate transport(GO:0008272) |
| 0.1 | 1.0 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.1 | 0.2 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.1 | 0.3 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.1 | 0.1 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
| 0.1 | 1.5 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
| 0.1 | 0.1 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
| 0.1 | 0.3 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
| 0.1 | 0.2 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.1 | 0.7 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
| 0.1 | 0.2 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 0.1 | 0.2 | GO:0090207 | regulation of triglyceride metabolic process(GO:0090207) |
| 0.1 | 0.1 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.1 | 0.8 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 | 0.1 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
| 0.1 | 0.2 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.1 | 0.2 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
| 0.1 | 0.1 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
| 0.1 | 0.1 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.1 | 0.2 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.1 | 0.2 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.1 | 0.1 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 0.1 | 0.6 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 0.1 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.1 | 0.5 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
| 0.1 | 0.1 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
| 0.1 | 1.6 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
| 0.1 | 0.3 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.1 | 0.1 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
| 0.1 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.1 | 0.8 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 | 0.2 | GO:0007603 | phototransduction, visible light(GO:0007603) |
| 0.1 | 0.8 | GO:0006482 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
| 0.1 | 1.2 | GO:0045576 | mast cell activation(GO:0045576) |
| 0.1 | 0.3 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.1 | 1.0 | GO:0007093 | mitotic cell cycle checkpoint(GO:0007093) |
| 0.1 | 0.9 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.1 | 0.3 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
| 0.1 | 0.6 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.1 | 0.1 | GO:2000197 | regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
| 0.1 | 0.3 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.1 | 0.3 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
| 0.1 | 0.3 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 0.1 | 0.1 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.1 | 0.6 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
| 0.1 | 0.1 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.1 | 0.3 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.1 | 0.1 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.1 | 0.5 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.1 | 0.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 0.1 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.1 | 0.4 | GO:0046514 | ceramide catabolic process(GO:0046514) |
| 0.1 | 0.7 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.1 | 0.1 | GO:2001140 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
| 0.1 | 0.2 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
| 0.1 | 0.1 | GO:2001225 | regulation of chloride transport(GO:2001225) |
| 0.1 | 0.2 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 0.1 | GO:0000730 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.1 | 0.1 | GO:0042737 | drug catabolic process(GO:0042737) |
| 0.1 | 0.4 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.1 | 0.2 | GO:0002363 | alpha-beta T cell lineage commitment(GO:0002363) |
| 0.1 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.1 | 0.4 | GO:0098534 | centriole assembly(GO:0098534) |
| 0.1 | 0.1 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
| 0.1 | 0.2 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.1 | 0.1 | GO:0015846 | polyamine transport(GO:0015846) |
| 0.1 | 0.3 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.1 | 0.1 | GO:0070071 | proton-transporting two-sector ATPase complex assembly(GO:0070071) |
| 0.1 | 0.1 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.1 | 0.2 | GO:0022615 | protein to membrane docking(GO:0022615) |
| 0.1 | 0.1 | GO:0061050 | regulation of cell growth involved in cardiac muscle cell development(GO:0061050) |
| 0.1 | 0.7 | GO:0045954 | positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
| 0.1 | 0.5 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.1 | 0.2 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.1 | 0.4 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.1 | 0.2 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.1 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.1 | 0.2 | GO:0050665 | hydrogen peroxide biosynthetic process(GO:0050665) |
| 0.1 | 0.1 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.1 | 0.7 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.1 | 0.2 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.1 | 0.2 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
| 0.1 | 0.2 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
| 0.1 | 0.2 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 0.1 | 0.8 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
| 0.1 | 0.2 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.1 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.1 | 0.1 | GO:0032493 | response to bacterial lipoprotein(GO:0032493) |
| 0.1 | 0.6 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.1 | 0.2 | GO:0042095 | interferon-gamma biosynthetic process(GO:0042095) |
| 0.1 | 0.3 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.1 | 0.2 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.1 | 0.8 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.1 | 0.1 | GO:1903998 | regulation of eating behavior(GO:1903998) |
| 0.1 | 1.1 | GO:0000724 | double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 0.1 | 0.2 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.1 | 0.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.1 | 0.3 | GO:0010390 | histone monoubiquitination(GO:0010390) |
| 0.1 | 0.2 | GO:0009074 | aromatic amino acid family catabolic process(GO:0009074) |
| 0.1 | 0.7 | GO:0070059 | intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0070059) |
| 0.1 | 1.5 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
| 0.1 | 0.3 | GO:0055070 | copper ion homeostasis(GO:0055070) |
| 0.1 | 0.3 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.1 | 0.2 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.1 | 0.2 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
| 0.1 | 0.6 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.1 | 0.4 | GO:0097354 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.1 | 0.1 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.1 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 0.1 | GO:0051036 | regulation of endosome size(GO:0051036) |
| 0.1 | 0.1 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.1 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.1 | 0.6 | GO:2000398 | regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
| 0.1 | 0.4 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.1 | 0.3 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 | 0.9 | GO:0052696 | flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 0.1 | 0.2 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.1 | 0.1 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
| 0.1 | 1.8 | GO:0006399 | tRNA metabolic process(GO:0006399) |
| 0.1 | 0.1 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.0 | 0.7 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.0 | 1.1 | GO:0098840 | protein transport along microtubule(GO:0098840) |
| 0.0 | 0.0 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
| 0.0 | 0.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.0 | 1.9 | GO:0030641 | regulation of cellular pH(GO:0030641) |
| 0.0 | 0.0 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.0 | 0.1 | GO:0061013 | regulation of mRNA catabolic process(GO:0061013) |
| 0.0 | 0.2 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.2 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.2 | GO:0016446 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 | 0.0 | GO:0009946 | proximal/distal axis specification(GO:0009946) specification of axis polarity(GO:0065001) |
| 0.0 | 0.3 | GO:0007143 | female meiotic division(GO:0007143) |
| 0.0 | 0.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 | 0.1 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
| 0.0 | 0.2 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.9 | GO:0061512 | protein localization to cilium(GO:0061512) |
| 0.0 | 0.2 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.0 | 3.9 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.0 | 0.2 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.0 | 0.1 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.0 | 0.1 | GO:0061623 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process through glucose-1-phosphate(GO:0061622) glycolytic process from galactose(GO:0061623) |
| 0.0 | 0.0 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
| 0.0 | 0.0 | GO:0042253 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
| 0.0 | 0.2 | GO:0009642 | response to light intensity(GO:0009642) |
| 0.0 | 0.2 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 0.0 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.0 | 0.1 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.5 | GO:0042537 | benzene-containing compound metabolic process(GO:0042537) |
| 0.0 | 0.0 | GO:1903019 | negative regulation of glycoprotein metabolic process(GO:1903019) |
| 0.0 | 0.4 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.0 | 0.5 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.1 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.0 | 1.1 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.0 | 0.0 | GO:0051304 | chromosome separation(GO:0051304) |
| 0.0 | 0.3 | GO:0070265 | necrotic cell death(GO:0070265) |
| 0.0 | 0.7 | GO:0051180 | vitamin transport(GO:0051180) |
| 0.0 | 0.0 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.0 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.0 | 0.1 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.0 | 0.3 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.2 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
| 0.0 | 0.2 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.3 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 0.0 | 0.2 | GO:0006360 | transcription from RNA polymerase I promoter(GO:0006360) |
| 0.0 | 1.2 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.0 | 0.2 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 0.2 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.0 | 0.4 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.1 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.0 | 0.2 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 | 0.0 | GO:0019614 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
| 0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
| 0.0 | 0.0 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
| 0.0 | 0.1 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.0 | 0.2 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.0 | 0.2 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 | 0.1 | GO:0071826 | ribonucleoprotein complex subunit organization(GO:0071826) |
| 0.0 | 0.1 | GO:0045589 | regulation of regulatory T cell differentiation(GO:0045589) |
| 0.0 | 0.1 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
| 0.0 | 0.0 | GO:0018904 | ether metabolic process(GO:0018904) |
| 0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.0 | 0.1 | GO:0002347 | response to tumor cell(GO:0002347) |
| 0.0 | 0.1 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.0 | 0.0 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.0 | 0.3 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.0 | 0.1 | GO:0070193 | synaptonemal complex assembly(GO:0007130) synaptonemal complex organization(GO:0070193) |
| 0.0 | 0.0 | GO:0033087 | regulation of immature T cell proliferation(GO:0033083) negative regulation of immature T cell proliferation(GO:0033087) |
| 0.0 | 1.3 | GO:0042254 | ribosome biogenesis(GO:0042254) |
| 0.0 | 0.0 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 | 0.5 | GO:0019835 | cytolysis(GO:0019835) |
| 0.0 | 1.0 | GO:0006397 | mRNA processing(GO:0006397) |
| 0.0 | 0.1 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) |
| 0.0 | 0.0 | GO:0046641 | positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 0.0 | 0.2 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
| 0.0 | 0.1 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
| 0.0 | 0.0 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.0 | 2.2 | GO:0006457 | protein folding(GO:0006457) |
| 0.0 | 0.1 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.0 | 0.4 | GO:0060218 | hematopoietic stem cell differentiation(GO:0060218) |
| 0.0 | 0.0 | GO:0042983 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.0 | 0.1 | GO:0070669 | response to interleukin-2(GO:0070669) |
| 0.0 | 0.4 | GO:0007032 | endosome organization(GO:0007032) |
| 0.0 | 0.2 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.0 | 0.4 | GO:1903146 | regulation of mitophagy(GO:1903146) |
| 0.0 | 0.1 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.0 | 3.7 | GO:0007067 | mitotic nuclear division(GO:0007067) |
| 0.0 | 0.1 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 0.0 | 0.2 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.0 | 0.0 | GO:0034383 | low-density lipoprotein particle clearance(GO:0034383) |
| 0.0 | 0.1 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.0 | 0.4 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.0 | 0.1 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.0 | 0.1 | GO:0042993 | positive regulation of transcription factor import into nucleus(GO:0042993) |
| 0.0 | 0.1 | GO:0022605 | oogenesis stage(GO:0022605) |
| 0.0 | 0.2 | GO:0095500 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.0 | 1.0 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 0.1 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.0 | 0.0 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.0 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.0 | 0.1 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.3 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.0 | 0.2 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
| 0.0 | 0.1 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.0 | 0.0 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.0 | 0.1 | GO:0009112 | nucleobase metabolic process(GO:0009112) |
| 0.0 | 0.1 | GO:0031936 | regulation of chromatin silencing(GO:0031935) negative regulation of chromatin silencing(GO:0031936) |
| 0.0 | 0.7 | GO:0007030 | Golgi organization(GO:0007030) |
| 0.0 | 0.1 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.0 | 0.1 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.0 | 0.2 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.0 | 0.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.1 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
| 0.0 | 0.0 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.0 | 0.0 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.0 | 0.0 | GO:0002645 | positive regulation of tolerance induction(GO:0002645) |
| 0.0 | 0.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 1.1 | GO:0050912 | detection of chemical stimulus involved in sensory perception of taste(GO:0050912) |
| 0.0 | 0.2 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 | 0.1 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
| 0.0 | 0.1 | GO:0046466 | membrane lipid catabolic process(GO:0046466) |
| 0.0 | 0.1 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.0 | 1.7 | GO:0007599 | hemostasis(GO:0007599) |
| 0.0 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.0 | 0.6 | GO:0035036 | sperm-egg recognition(GO:0035036) |
| 0.0 | 0.3 | GO:0006829 | zinc II ion transport(GO:0006829) |
| 0.0 | 0.3 | GO:1901998 | toxin transport(GO:1901998) |
| 0.0 | 0.0 | GO:0051176 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of sulfur metabolic process(GO:0051176) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.0 | 0.2 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.0 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
| 0.0 | 0.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 | 0.0 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.0 | 0.2 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.0 | 0.0 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
| 0.0 | 0.2 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.0 | 0.0 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.0 | 0.0 | GO:0002538 | arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
| 0.0 | 0.0 | GO:0006007 | glucose catabolic process(GO:0006007) |
| 0.0 | 0.0 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
| 0.0 | 0.0 | GO:0071569 | protein ufmylation(GO:0071569) protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.0 | 0.3 | GO:0015914 | phospholipid transport(GO:0015914) |
| 0.0 | 0.3 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 1.1 | GO:0006633 | fatty acid biosynthetic process(GO:0006633) |
| 0.0 | 0.0 | GO:0035872 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.0 | 0.1 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
| 0.0 | 0.1 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.0 | 0.2 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
| 0.0 | 0.1 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
| 0.0 | 0.1 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.0 | 0.0 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
| 0.0 | 0.0 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.0 | 0.0 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.0 | 0.1 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
| 0.0 | 0.0 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) |
| 0.0 | 0.1 | GO:0007028 | cytoplasm organization(GO:0007028) |
| 0.0 | 0.0 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.0 | 0.0 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 | 0.1 | GO:0006278 | RNA-dependent DNA biosynthetic process(GO:0006278) telomere maintenance via telomerase(GO:0007004) |
| 0.0 | 0.0 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
| 0.0 | 0.0 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
| 0.0 | 0.0 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
| 0.0 | 0.0 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
| 0.0 | 0.1 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.0 | 2.0 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.0 | 0.0 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.0 | 0.0 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.0 | 0.0 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
| 0.0 | 0.0 | GO:0009624 | response to nematode(GO:0009624) |
| 0.0 | 0.0 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
| 0.0 | 0.1 | GO:0007602 | phototransduction(GO:0007602) |
| 0.0 | 0.4 | GO:0008203 | cholesterol metabolic process(GO:0008203) |
| 0.0 | 0.0 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.0 | 0.1 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.0 | 0.0 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.0 | 0.0 | GO:0039531 | regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039531) |
| 0.0 | 0.1 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
| 0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.0 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.0 | 0.0 | GO:0002638 | negative regulation of immunoglobulin production(GO:0002638) |
| 0.0 | 0.1 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.0 | 0.0 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.0 | 0.0 | GO:0045655 | regulation of monocyte differentiation(GO:0045655) |
| 0.0 | 0.0 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.0 | 0.0 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
| 0.0 | 0.1 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.0 | 0.0 | GO:0051712 | positive regulation of killing of cells of other organism(GO:0051712) |
| 0.0 | 0.0 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.0 | 0.1 | GO:0008156 | negative regulation of DNA replication(GO:0008156) |
| 0.0 | 0.0 | GO:0046686 | response to cadmium ion(GO:0046686) |
| 0.0 | 0.0 | GO:0002029 | desensitization of G-protein coupled receptor protein signaling pathway(GO:0002029) negative adaptation of signaling pathway(GO:0022401) |
| 0.0 | 0.0 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
| 0.0 | 0.1 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 0.0 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.0 | 0.0 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.0 | 0.0 | GO:0006595 | polyamine metabolic process(GO:0006595) |
| 0.0 | 0.0 | GO:0009225 | nucleotide-sugar metabolic process(GO:0009225) |
| 0.0 | 0.1 | GO:0002084 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 0.0 | GO:0033108 | mitochondrial respiratory chain complex assembly(GO:0033108) |
| 0.0 | 0.0 | GO:0044117 | growth involved in symbiotic interaction(GO:0044110) growth of symbiont involved in interaction with host(GO:0044116) growth of symbiont in host(GO:0044117) |
| 0.0 | 0.3 | GO:0002323 | natural killer cell activation involved in immune response(GO:0002323) |
| 0.0 | 0.0 | GO:0050856 | regulation of T cell receptor signaling pathway(GO:0050856) |
| 0.0 | 0.2 | GO:0006749 | glutathione metabolic process(GO:0006749) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.5 | 7.7 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 1.5 | 9.0 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 1.5 | 8.9 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 1.4 | 4.3 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.7 | 3.4 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.7 | 2.7 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.6 | 1.8 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.6 | 4.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.6 | 1.7 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.6 | 2.8 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.5 | 2.7 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.5 | 1.6 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.5 | 3.7 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.5 | 2.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.5 | 1.5 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.5 | 0.5 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.5 | 2.5 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.5 | 0.5 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.5 | 1.4 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.5 | 2.4 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.5 | 1.9 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.5 | 2.7 | GO:0000796 | condensin complex(GO:0000796) |
| 0.5 | 4.5 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.5 | 1.4 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.4 | 1.8 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.4 | 1.7 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.4 | 2.8 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.4 | 1.6 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.4 | 1.2 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.4 | 2.0 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.4 | 0.4 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.4 | 1.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.4 | 1.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.3 | 1.4 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 0.3 | 1.0 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.3 | 1.6 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.3 | 1.0 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.3 | 1.9 | GO:0005818 | aster(GO:0005818) |
| 0.3 | 1.3 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.3 | 0.3 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.3 | 2.5 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.3 | 1.6 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.3 | 0.9 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.3 | 1.6 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.3 | 1.2 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.3 | 0.9 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.3 | 0.9 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.3 | 1.2 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.3 | 2.1 | GO:0070187 | telosome(GO:0070187) |
| 0.3 | 2.9 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.3 | 1.4 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.3 | 0.9 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 0.3 | 1.7 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 0.3 | 0.8 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.3 | 1.1 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.3 | 1.4 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.3 | 0.8 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.3 | 1.9 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.3 | 1.1 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.3 | 0.8 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.3 | 2.6 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.3 | 0.8 | GO:0097413 | Lewy body(GO:0097413) |
| 0.3 | 0.5 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.3 | 1.8 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.3 | 0.8 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.3 | 1.0 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.3 | 1.3 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.3 | 1.3 | GO:0000805 | X chromosome(GO:0000805) |
| 0.3 | 0.5 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.3 | 2.5 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.2 | 1.0 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.2 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.2 | 1.5 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.2 | 0.7 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.2 | 1.9 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.2 | 1.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.2 | 0.7 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.2 | 1.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.2 | 3.6 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.2 | 1.7 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.2 | 0.2 | GO:0015934 | large ribosomal subunit(GO:0015934) |
| 0.2 | 0.7 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.2 | 2.6 | GO:0042555 | MCM complex(GO:0042555) |
| 0.2 | 0.7 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.2 | 1.4 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.2 | 3.5 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.2 | 1.6 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.2 | 1.6 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.2 | 1.4 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.2 | 1.9 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.2 | 1.4 | GO:0070820 | tertiary granule(GO:0070820) |
| 0.2 | 0.5 | GO:1902555 | endoribonuclease complex(GO:1902555) |
| 0.2 | 18.6 | GO:0000776 | kinetochore(GO:0000776) |
| 0.2 | 1.1 | GO:0016589 | NURF complex(GO:0016589) |
| 0.2 | 3.8 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.2 | 3.6 | GO:0000145 | exocyst(GO:0000145) |
| 0.2 | 1.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.2 | 0.7 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.2 | 0.2 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.2 | 0.9 | GO:0035363 | histone locus body(GO:0035363) |
| 0.2 | 0.7 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.2 | 2.0 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
| 0.2 | 0.9 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.2 | 0.9 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.2 | 1.9 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.2 | 0.6 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.2 | 7.4 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.2 | 2.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.2 | 1.9 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.2 | 0.6 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.2 | 2.1 | GO:0045120 | pronucleus(GO:0045120) |
| 0.2 | 1.4 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.2 | 1.9 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.2 | 3.9 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.2 | 0.4 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.2 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.2 | 1.4 | GO:0032797 | SMN complex(GO:0032797) |
| 0.2 | 2.4 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.2 | 1.2 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.2 | 0.2 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.2 | 0.6 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.2 | 1.2 | GO:0031415 | NatA complex(GO:0031415) |
| 0.2 | 0.8 | GO:0071203 | WASH complex(GO:0071203) |
| 0.2 | 4.3 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.2 | 2.6 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.2 | 1.0 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.2 | 4.9 | GO:0015030 | Cajal body(GO:0015030) |
| 0.2 | 1.0 | GO:0005638 | lamin filament(GO:0005638) |
| 0.2 | 0.6 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.2 | 0.2 | GO:0072588 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
| 0.2 | 1.2 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.2 | 4.3 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.2 | 0.4 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.2 | 7.8 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.2 | 0.8 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.2 | 1.3 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.2 | 0.7 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.2 | 0.9 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.2 | 0.7 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.2 | 1.5 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.2 | 0.4 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.2 | 0.7 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.2 | 4.3 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.2 | 0.5 | GO:0043203 | axon hillock(GO:0043203) |
| 0.2 | 0.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.2 | 4.6 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.2 | 4.3 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.2 | 1.6 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.2 | 0.7 | GO:0030689 | Noc complex(GO:0030689) |
| 0.2 | 0.5 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.2 | 0.5 | GO:1990923 | PET complex(GO:1990923) |
| 0.2 | 2.3 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.2 | 0.7 | GO:0098536 | deuterosome(GO:0098536) |
| 0.2 | 0.9 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.2 | 0.5 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.2 | 2.0 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.2 | 3.6 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.2 | 0.7 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.2 | 8.0 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.2 | 0.7 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.2 | 0.5 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.2 | 3.0 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.2 | 1.5 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.2 | 4.7 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.2 | 8.0 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.2 | 1.6 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.2 | 6.8 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.2 | 1.1 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
| 0.2 | 0.5 | GO:0031523 | Myb complex(GO:0031523) |
| 0.2 | 0.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.2 | 0.5 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.2 | 0.6 | GO:0034709 | methylosome(GO:0034709) |
| 0.2 | 0.6 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.2 | 1.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.2 | 21.4 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.2 | 0.8 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.2 | 5.8 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.2 | 0.3 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.2 | 0.5 | GO:0038201 | TORC2 complex(GO:0031932) TOR complex(GO:0038201) |
| 0.2 | 5.1 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.2 | 1.6 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.2 | 0.8 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
| 0.2 | 0.5 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.2 | 9.9 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.2 | 0.3 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.2 | 1.4 | GO:0042581 | specific granule(GO:0042581) |
| 0.2 | 12.3 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.2 | 1.2 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.2 | 4.1 | GO:0016592 | mediator complex(GO:0016592) |
| 0.2 | 3.7 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.2 | 0.8 | GO:0010369 | chromocenter(GO:0010369) |
| 0.2 | 0.9 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.2 | 0.3 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.2 | 0.8 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 3.0 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.1 | 0.7 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.1 | 1.6 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.1 | 0.4 | GO:0072487 | MSL complex(GO:0072487) |
| 0.1 | 0.4 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.1 | 0.6 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.1 | 0.7 | GO:0033503 | HULC complex(GO:0033503) |
| 0.1 | 0.6 | GO:0097526 | spliceosomal tri-snRNP complex(GO:0097526) |
| 0.1 | 0.7 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 2.5 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.1 | 1.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 7.4 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.1 | 0.3 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.1 | 0.3 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.1 | 6.5 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
| 0.1 | 1.8 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.1 | 0.5 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.1 | 0.5 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.1 | 0.3 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 6.9 | GO:0000793 | condensed chromosome(GO:0000793) |
| 0.1 | 0.9 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.1 | 0.4 | GO:0089701 | U2AF(GO:0089701) |
| 0.1 | 0.8 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
| 0.1 | 5.7 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.1 | 1.6 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.1 | 0.7 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.1 | 0.3 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.1 | 0.6 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.1 | 0.5 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 0.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 3.8 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.1 | 0.6 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.1 | 0.3 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.1 | 1.4 | GO:0098687 | chromosomal region(GO:0098687) |
| 0.1 | 36.4 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.1 | 2.7 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.1 | 0.6 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.1 | 0.2 | GO:0005657 | replication fork(GO:0005657) |
| 0.1 | 0.5 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 0.5 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.1 | 0.2 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 1.2 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.1 | 0.5 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.1 | 0.8 | GO:0001527 | microfibril(GO:0001527) |
| 0.1 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.1 | 0.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.1 | 3.8 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.1 | 2.1 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.1 | 4.7 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.1 | 2.8 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 0.5 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.1 | 0.2 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.1 | 1.2 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.1 | 3.1 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.1 | 1.4 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 2.1 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 0.6 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 0.7 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.1 | 0.2 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.1 | 0.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.1 | 13.7 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.1 | 0.1 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.1 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 1.7 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.1 | 1.4 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.1 | 2.0 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.1 | 4.9 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.1 | 0.3 | GO:0042627 | chylomicron(GO:0042627) |
| 0.1 | 0.9 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.1 | 0.3 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.1 | 0.2 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.1 | 1.1 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.1 | 0.7 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 0.8 | GO:0070938 | contractile ring(GO:0070938) |
| 0.1 | 0.1 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.1 | 0.5 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.1 | 0.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 3.9 | GO:0005681 | spliceosomal complex(GO:0005681) |
| 0.1 | 0.3 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.1 | 0.4 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.1 | 0.5 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.1 | 0.7 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.1 | 4.8 | GO:0000922 | spindle pole(GO:0000922) |
| 0.1 | 0.9 | GO:0032806 | carboxy-terminal domain protein kinase complex(GO:0032806) |
| 0.1 | 0.2 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.1 | 0.2 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.1 | 3.7 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.1 | 0.4 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.1 | 0.3 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
| 0.1 | 1.3 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
| 0.1 | 0.1 | GO:0030662 | coated vesicle membrane(GO:0030662) |
| 0.1 | 0.2 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.1 | 3.0 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.1 | 2.1 | GO:1990204 | oxidoreductase complex(GO:1990204) |
| 0.1 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.1 | 2.0 | GO:0030684 | preribosome(GO:0030684) |
| 0.1 | 0.7 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.1 | 0.8 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 3.6 | GO:0030880 | RNA polymerase complex(GO:0030880) |
| 0.1 | 0.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 0.3 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.1 | 0.3 | GO:0043219 | lateral loop(GO:0043219) |
| 0.1 | 7.0 | GO:0044440 | endosomal part(GO:0044440) |
| 0.1 | 0.3 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
| 0.1 | 0.7 | GO:0030894 | replisome(GO:0030894) |
| 0.1 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.1 | 0.1 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
| 0.1 | 5.0 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.1 | 0.6 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.1 | 0.1 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.1 | 2.5 | GO:0005811 | lipid particle(GO:0005811) |
| 0.1 | 0.7 | GO:0031011 | Ino80 complex(GO:0031011) |
| 0.1 | 0.2 | GO:0000811 | GINS complex(GO:0000811) |
| 0.1 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.1 | 0.4 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 0.6 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.1 | 0.8 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.1 | 0.3 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.1 | 0.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.1 | 0.7 | GO:0002102 | podosome(GO:0002102) |
| 0.1 | 0.6 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.1 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.1 | 2.5 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
| 0.1 | 1.4 | GO:0005844 | polysome(GO:0005844) |
| 0.1 | 0.6 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.1 | 0.9 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.1 | 0.3 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.1 | 0.6 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.1 | 0.4 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.4 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.1 | 0.6 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
| 0.1 | 0.1 | GO:0051286 | cell tip(GO:0051286) |
| 0.1 | 0.3 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 0.2 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.1 | 0.7 | GO:0033176 | proton-transporting V-type ATPase complex(GO:0033176) |
| 0.1 | 2.4 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.1 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.1 | 0.1 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.1 | 0.3 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 0.5 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.1 | 0.3 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.1 | 0.3 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.1 | 0.2 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 0.1 | 0.5 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.1 | 0.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.1 | 1.5 | GO:0044439 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
| 0.1 | 0.4 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.1 | 0.4 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.1 | 0.3 | GO:0002177 | manchette(GO:0002177) |
| 0.1 | 3.2 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
| 0.1 | 0.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 0.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.1 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 0.2 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.1 | 0.6 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 0.8 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.1 | 3.7 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.1 | 0.8 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.1 | 0.2 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.1 | 6.6 | GO:0000139 | Golgi membrane(GO:0000139) |
| 0.1 | 1.4 | GO:0008305 | integrin complex(GO:0008305) |
| 0.1 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.1 | 0.7 | GO:0016234 | inclusion body(GO:0016234) |
| 0.1 | 0.1 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.1 | 2.0 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.1 | 0.2 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.1 | 0.2 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.1 | 0.5 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.1 | 1.4 | GO:0008287 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
| 0.1 | 0.2 | GO:0043293 | apoptosome(GO:0043293) |
| 0.1 | 0.6 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.1 | 0.3 | GO:0035859 | Seh1-associated complex(GO:0035859) |
| 0.1 | 0.3 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.1 | 1.1 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.1 | 0.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.1 | 4.5 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.1 | 0.1 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.1 | 0.3 | GO:0060091 | kinocilium(GO:0060091) |
| 0.1 | 2.4 | GO:0005635 | nuclear envelope(GO:0005635) |
| 0.1 | 1.9 | GO:0005819 | spindle(GO:0005819) |
| 0.1 | 0.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.1 | 1.8 | GO:0005902 | microvillus(GO:0005902) |
| 0.1 | 0.5 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.1 | 0.3 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 0.4 | GO:0044452 | nucleolar part(GO:0044452) |
| 0.1 | 0.1 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.1 | 39.0 | GO:0005739 | mitochondrion(GO:0005739) |
| 0.1 | 1.2 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.1 | 1.5 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.1 | 0.2 | GO:0031417 | NatC complex(GO:0031417) |
| 0.0 | 0.9 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 0.4 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
| 0.0 | 0.1 | GO:0000791 | euchromatin(GO:0000791) |
| 0.0 | 0.9 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 0.4 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 1.8 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.1 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 0.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.5 | GO:0031301 | integral component of organelle membrane(GO:0031301) |
| 0.0 | 5.3 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
| 0.0 | 0.5 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.0 | 0.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.3 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.0 | GO:0098636 | protein complex involved in cell adhesion(GO:0098636) |
| 0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.0 | 29.3 | GO:0005654 | nucleoplasm(GO:0005654) |
| 0.0 | 0.4 | GO:0005776 | autophagosome(GO:0005776) |
| 0.0 | 0.1 | GO:0005775 | vacuolar lumen(GO:0005775) |
| 0.0 | 0.0 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.0 | 0.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 0.1 | GO:0000792 | heterochromatin(GO:0000792) |
| 0.0 | 1.8 | GO:0012506 | vesicle membrane(GO:0012506) |
| 0.0 | 0.5 | GO:0005770 | late endosome(GO:0005770) |
| 0.0 | 0.1 | GO:0031082 | BLOC complex(GO:0031082) |
| 0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.1 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.0 | 5.6 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.0 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 0.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.0 | 33.0 | GO:0070062 | extracellular exosome(GO:0070062) |
| 0.0 | 0.1 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 9.7 | GO:0005829 | cytosol(GO:0005829) |
| 0.0 | 0.0 | GO:0044450 | microtubule organizing center part(GO:0044450) |
| 0.0 | 1.8 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.7 | GO:0030133 | transport vesicle(GO:0030133) |
| 0.0 | 0.0 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.9 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.0 | 0.0 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.0 | 2.4 | GO:0005730 | nucleolus(GO:0005730) |
| 0.0 | 0.0 | GO:0070603 | SWI/SNF superfamily-type complex(GO:0070603) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.5 | 4.4 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 1.2 | 8.7 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 1.1 | 6.4 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.9 | 2.6 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.8 | 2.4 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.8 | 5.3 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.7 | 3.0 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.7 | 2.1 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.7 | 2.1 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.7 | 12.1 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.7 | 2.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.6 | 5.8 | GO:1901567 | icosanoid binding(GO:0050542) fatty acid derivative binding(GO:1901567) |
| 0.6 | 2.5 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.6 | 2.5 | GO:0031720 | haptoglobin binding(GO:0031720) |
| 0.6 | 1.8 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.6 | 3.0 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.6 | 3.5 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.6 | 3.4 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.6 | 2.8 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.6 | 0.6 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.5 | 4.4 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.5 | 2.2 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.5 | 4.3 | GO:0051735 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.5 | 2.1 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.5 | 1.5 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.5 | 3.0 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.5 | 1.5 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.5 | 1.9 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.5 | 2.4 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.5 | 4.2 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.5 | 1.9 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.5 | 3.6 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.5 | 10.8 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
| 0.4 | 2.7 | GO:0043559 | insulin binding(GO:0043559) |
| 0.4 | 1.8 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.4 | 3.5 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.4 | 5.7 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.4 | 1.7 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.4 | 1.3 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.4 | 1.2 | GO:0019961 | interferon binding(GO:0019961) |
| 0.4 | 1.6 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.4 | 3.2 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.4 | 1.6 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.4 | 1.6 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.4 | 3.2 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.4 | 1.2 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.4 | 1.9 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.4 | 1.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.4 | 0.4 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.4 | 0.8 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
| 0.4 | 1.1 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.4 | 2.2 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.4 | 5.2 | GO:0005521 | lamin binding(GO:0005521) |
| 0.4 | 2.6 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.4 | 1.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.4 | 1.4 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.4 | 2.5 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
| 0.4 | 2.5 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.4 | 1.4 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.3 | 2.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.3 | 1.7 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.3 | 1.7 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.3 | 1.0 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.3 | 2.0 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.3 | 1.0 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.3 | 1.0 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.3 | 3.3 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.3 | 1.3 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.3 | 1.3 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.3 | 0.9 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.3 | 3.4 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.3 | 1.3 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.3 | 1.6 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.3 | 1.5 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.3 | 0.9 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.3 | 1.5 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.3 | 2.4 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.3 | 2.4 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.3 | 1.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.3 | 0.9 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.3 | 0.9 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
| 0.3 | 1.5 | GO:0052813 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
| 0.3 | 0.6 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.3 | 1.2 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.3 | 0.9 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.3 | 1.4 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.3 | 0.6 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
| 0.3 | 2.3 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.3 | 0.9 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.3 | 0.9 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.3 | 1.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.3 | 0.8 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.3 | 1.4 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.3 | 2.5 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.3 | 0.8 | GO:2001070 | starch binding(GO:2001070) |
| 0.3 | 2.0 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.3 | 0.5 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.3 | 0.5 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.3 | 0.5 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.3 | 1.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.3 | 3.5 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
| 0.3 | 1.1 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.3 | 0.8 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.3 | 1.3 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.3 | 0.5 | GO:0032356 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
| 0.3 | 1.6 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
| 0.3 | 1.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.3 | 2.1 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.3 | 0.8 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.3 | 0.8 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.3 | 0.5 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.3 | 7.0 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.3 | 3.1 | GO:0043176 | amine binding(GO:0043176) |
| 0.3 | 1.3 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.3 | 0.3 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
| 0.3 | 2.3 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.3 | 1.0 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.3 | 1.0 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.3 | 3.0 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.3 | 0.8 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.2 | 0.7 | GO:0019767 | IgE receptor activity(GO:0019767) |
| 0.2 | 1.0 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.2 | 0.7 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.2 | 2.0 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.2 | 0.7 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.2 | 3.7 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.2 | 1.0 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.2 | 3.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.2 | 1.2 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.2 | 0.7 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.2 | 0.7 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.2 | 1.4 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.2 | 2.1 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
| 0.2 | 0.7 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.2 | 6.8 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.2 | 0.9 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.2 | 0.7 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.2 | 0.9 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.2 | 0.9 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.2 | 0.2 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.2 | 0.7 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.2 | 0.4 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.2 | 0.7 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
| 0.2 | 0.4 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.2 | 0.2 | GO:0016428 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.2 | 0.4 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.2 | 2.0 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.2 | 0.7 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 0.2 | 1.8 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.2 | 1.8 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.2 | 1.8 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
| 0.2 | 0.7 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.2 | 3.1 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.2 | 0.7 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.2 | 1.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.2 | 0.6 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.2 | 3.9 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.2 | 0.6 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.2 | 0.2 | GO:0032135 | DNA insertion or deletion binding(GO:0032135) |
| 0.2 | 0.4 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.2 | 1.5 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.2 | 0.2 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.2 | 1.9 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.2 | 0.4 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.2 | 0.4 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.2 | 3.9 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.2 | 0.6 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.2 | 0.6 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.2 | 1.2 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.2 | 1.8 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.2 | 5.2 | GO:0045502 | dynein binding(GO:0045502) |
| 0.2 | 4.0 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.2 | 1.2 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.2 | 2.0 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.2 | 8.9 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.2 | 0.8 | GO:0009374 | biotin binding(GO:0009374) |
| 0.2 | 5.5 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.2 | 0.6 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.2 | 2.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.2 | 2.3 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.2 | 0.6 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.2 | 4.5 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.2 | 1.4 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.2 | 0.6 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.2 | 0.8 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 0.2 | 1.0 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.2 | 0.2 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.2 | 0.6 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.2 | 5.6 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.2 | 2.5 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.2 | 1.3 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.2 | 0.6 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.2 | 1.9 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.2 | 0.6 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.2 | 1.9 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.2 | 0.6 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.2 | 2.8 | GO:0001848 | complement binding(GO:0001848) |
| 0.2 | 0.6 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.2 | 0.9 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.2 | 1.7 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.2 | 1.5 | GO:0034891 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
| 0.2 | 0.7 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.2 | 2.9 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.2 | 0.7 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.2 | 0.4 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.2 | 0.2 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.2 | 0.7 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.2 | 1.8 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.2 | 0.7 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.2 | 0.7 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.2 | 0.9 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.2 | 2.3 | GO:0019865 | immunoglobulin binding(GO:0019865) |
| 0.2 | 4.5 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.2 | 1.6 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.2 | 1.2 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.2 | 1.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.2 | 0.9 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.2 | 0.5 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
| 0.2 | 0.4 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
| 0.2 | 1.6 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.2 | 0.5 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.2 | 2.3 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.2 | 1.4 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.2 | 0.3 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.2 | 2.4 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
| 0.2 | 0.5 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.2 | 0.2 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.2 | 0.3 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.2 | 2.0 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.2 | 4.7 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.2 | 0.7 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.2 | 0.8 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.2 | 0.3 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
| 0.2 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.2 | 1.2 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.2 | 0.2 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.2 | 1.2 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.2 | 0.5 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.2 | 0.8 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.2 | 0.2 | GO:0016895 | exodeoxyribonuclease activity(GO:0004529) exodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016895) |
| 0.2 | 2.0 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.2 | 0.7 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.2 | 0.5 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.2 | 1.8 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.2 | 1.3 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.2 | 0.6 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.2 | 0.5 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.2 | 3.0 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.2 | 1.4 | GO:0008932 | lytic endotransglycosylase activity(GO:0008932) |
| 0.2 | 2.1 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.2 | 0.6 | GO:0102345 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
| 0.2 | 0.3 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.2 | 2.0 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.2 | 0.5 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.2 | 1.9 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.2 | 0.6 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.2 | 0.9 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.2 | 0.9 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.2 | 0.6 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.2 | 1.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.2 | 4.9 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.2 | 0.8 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.2 | 0.5 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.2 | 0.6 | GO:0046790 | virion binding(GO:0046790) |
| 0.2 | 0.5 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.2 | 0.5 | GO:0019976 | interleukin-2 binding(GO:0019976) |
| 0.2 | 2.0 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.2 | 0.3 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.1 | 0.4 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
| 0.1 | 1.3 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.1 | 0.9 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.1 | 4.8 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.1 | 4.9 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
| 0.1 | 0.3 | GO:0045182 | translation regulator activity(GO:0045182) |
| 0.1 | 0.6 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.1 | 0.4 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
| 0.1 | 1.0 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.1 | 1.9 | GO:0019825 | oxygen binding(GO:0019825) |
| 0.1 | 4.5 | GO:0051723 | protein methylesterase activity(GO:0051723) |
| 0.1 | 1.3 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.1 | 2.0 | GO:0016594 | glycine binding(GO:0016594) |
| 0.1 | 0.3 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.1 | 3.0 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.1 | 1.9 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.1 | 1.4 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.1 | 0.7 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.1 | 1.1 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.1 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.1 | 1.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 4.8 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
| 0.1 | 0.3 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.1 | 0.7 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.4 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.1 | 0.6 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.1 | 0.5 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.1 | 5.3 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.1 | 1.4 | GO:0010181 | FMN binding(GO:0010181) |
| 0.1 | 0.3 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
| 0.1 | 0.1 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.1 | 0.7 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.3 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.1 | 0.8 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.1 | 0.8 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 0.1 | 0.8 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.1 | 1.2 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 0.3 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.1 | 0.9 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.1 | 0.7 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.1 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 0.1 | 0.4 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.1 | 0.8 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 0.6 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.1 | 0.3 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.1 | 0.4 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.1 | 0.4 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.1 | 1.2 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.1 | 20.7 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
| 0.1 | 0.5 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
| 0.1 | 1.3 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
| 0.1 | 1.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.1 | 0.4 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.1 | 1.5 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
| 0.1 | 1.3 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 0.4 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.1 | 2.0 | GO:0043531 | ADP binding(GO:0043531) |
| 0.1 | 0.5 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.1 | 2.8 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.1 | 0.4 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.1 | 0.9 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.1 | 0.7 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
| 0.1 | 0.2 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.1 | 0.6 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.1 | 4.7 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.1 | 12.4 | GO:0042393 | histone binding(GO:0042393) |
| 0.1 | 0.4 | GO:0070035 | ATP-dependent helicase activity(GO:0008026) purine NTP-dependent helicase activity(GO:0070035) |
| 0.1 | 2.9 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.1 | 0.6 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.1 | 0.7 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.1 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.1 | 0.1 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.1 | 0.7 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.1 | 1.7 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 3.9 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.1 | 0.6 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.1 | 20.8 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.1 | 0.2 | GO:0003917 | DNA topoisomerase activity(GO:0003916) DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 0.4 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.1 | 0.6 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
| 0.1 | 0.1 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
| 0.1 | 2.3 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.1 | 0.8 | GO:0005522 | profilin binding(GO:0005522) |
| 0.1 | 0.7 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.1 | 0.1 | GO:0097617 | annealing helicase activity(GO:0036310) annealing activity(GO:0097617) |
| 0.1 | 0.1 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
| 0.1 | 0.5 | GO:0015185 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.1 | 0.3 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.1 | 1.0 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.1 | 0.3 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 4.3 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.1 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.1 | 0.2 | GO:0070717 | poly-purine tract binding(GO:0070717) |
| 0.1 | 1.4 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 0.5 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.1 | 0.3 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.1 | 0.4 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.1 | 0.6 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.1 | 1.2 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.1 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.1 | 5.0 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.1 | 1.1 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.1 | 0.3 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.1 | 1.1 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.1 | 0.4 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.1 | 0.4 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.1 | 0.4 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.1 | 0.4 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.1 | 2.2 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.1 | 1.0 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.1 | 6.3 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.1 | 1.0 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.1 | 0.1 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.1 | 0.6 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.1 | 0.5 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 0.9 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
| 0.1 | 0.6 | GO:0015254 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
| 0.1 | 0.4 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.1 | 0.6 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.1 | 0.4 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.1 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.1 | 1.0 | GO:0034843 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
| 0.1 | 2.6 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
| 0.1 | 0.2 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 0.4 | GO:0015925 | galactosidase activity(GO:0015925) |
| 0.1 | 0.9 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.1 | 0.9 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.1 | 0.1 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
| 0.1 | 11.4 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.1 | 4.9 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.1 | 0.3 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.1 | 0.1 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.1 | 0.2 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.1 | 0.5 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.1 | 0.1 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
| 0.1 | 0.7 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.1 | 0.5 | GO:0016893 | endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 5'-phosphomonoesters(GO:0016893) |
| 0.1 | 0.3 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.1 | 0.3 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.1 | 0.2 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.1 | 0.7 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.1 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
| 0.1 | 2.0 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.1 | 1.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.1 | 0.5 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.1 | 0.2 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.1 | 0.2 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
| 0.1 | 0.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.4 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
| 0.1 | 1.9 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.5 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.1 | 1.1 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
| 0.1 | 0.5 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.1 | 0.5 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.2 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.1 | 0.5 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.1 | 5.9 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.1 | 0.2 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.1 | 0.4 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.1 | 0.3 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 1.0 | GO:0019003 | GDP binding(GO:0019003) |
| 0.1 | 2.0 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.1 | 0.1 | GO:0030249 | guanylate cyclase regulator activity(GO:0030249) |
| 0.1 | 0.3 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.1 | 0.2 | GO:0004536 | deoxyribonuclease activity(GO:0004536) |
| 0.1 | 0.3 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.1 | 2.1 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.1 | 0.3 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.1 | 1.3 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 1.3 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.1 | 0.6 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.1 | 0.3 | GO:0017069 | snRNA binding(GO:0017069) |
| 0.1 | 0.1 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
| 0.1 | 2.7 | GO:0016209 | antioxidant activity(GO:0016209) |
| 0.1 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 0.2 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 0.2 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.1 | 0.7 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.1 | 1.1 | GO:0015928 | fucosidase activity(GO:0015928) |
| 0.1 | 0.2 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.1 | 1.6 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.1 | 0.2 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.1 | 0.3 | GO:0052794 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.1 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 0.3 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.1 | 0.2 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.1 | 0.2 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.1 | 4.2 | GO:0003724 | RNA helicase activity(GO:0003724) |
| 0.1 | 0.5 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.1 | 0.2 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.1 | 0.4 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.1 | 0.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 3.0 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.1 | 5.8 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.1 | 0.3 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.1 | 0.9 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.1 | 0.2 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.1 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 1.1 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 0.6 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.1 | 0.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.1 | 1.3 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.1 | 1.6 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.1 | 0.2 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.1 | 0.4 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.1 | 0.5 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.1 | 0.4 | GO:0008251 | tRNA-specific adenosine deaminase activity(GO:0008251) |
| 0.1 | 0.2 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.1 | 2.6 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
| 0.1 | 0.1 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
| 0.1 | 0.8 | GO:0019841 | retinol binding(GO:0019841) |
| 0.1 | 10.0 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.1 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.1 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.1 | 0.3 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.1 | 0.2 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.1 | 6.6 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.1 | 2.1 | GO:0008907 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
| 0.1 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.1 | 0.3 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.1 | 0.7 | GO:0003678 | DNA helicase activity(GO:0003678) |
| 0.1 | 0.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.1 | 0.3 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.1 | 44.2 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
| 0.1 | 1.8 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.1 | 0.8 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.1 | 0.8 | GO:0016651 | oxidoreductase activity, acting on NAD(P)H(GO:0016651) |
| 0.1 | 1.2 | GO:0052693 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
| 0.1 | 0.3 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.1 | 0.4 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
| 0.1 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 0.3 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.1 | 0.1 | GO:0017136 | NAD-dependent histone deacetylase activity(GO:0017136) |
| 0.1 | 0.3 | GO:0070513 | death domain binding(GO:0070513) |
| 0.1 | 0.7 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
| 0.1 | 1.4 | GO:0045543 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
| 0.1 | 0.3 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.1 | 0.1 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 3'-phosphomonoesters(GO:0016894) |
| 0.1 | 0.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.1 | 0.3 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.1 | 0.1 | GO:0052742 | phosphatidylinositol kinase activity(GO:0052742) |
| 0.1 | 0.2 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.1 | 0.1 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
| 0.1 | 0.6 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.1 | 0.3 | GO:0008173 | RNA methyltransferase activity(GO:0008173) |
| 0.1 | 0.4 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 0.4 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.1 | 1.8 | GO:0004553 | hydrolase activity, hydrolyzing O-glycosyl compounds(GO:0004553) |
| 0.1 | 0.5 | GO:0008759 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
| 0.1 | 0.7 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.1 | 0.2 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.1 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.1 | 0.9 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.1 | 1.6 | GO:0004519 | endonuclease activity(GO:0004519) |
| 0.1 | 0.2 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.1 | 0.5 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.1 | 0.2 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 0.4 | GO:0052686 | succinate-CoA ligase activity(GO:0004774) 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
| 0.1 | 2.0 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
| 0.1 | 0.6 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
| 0.1 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 0.1 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
| 0.1 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.1 | 0.3 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.1 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.1 | 0.1 | GO:1904680 | peptide transmembrane transporter activity(GO:1904680) |
| 0.1 | 0.2 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.1 | 0.2 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.1 | 0.4 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.1 | 0.4 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.1 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
| 0.1 | 1.2 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
| 0.1 | 0.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.1 | 0.6 | GO:0019783 | ubiquitin-like protein-specific protease activity(GO:0019783) |
| 0.1 | 0.1 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.1 | 0.4 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 2.0 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.1 | 0.9 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 0.3 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.1 | 0.1 | GO:0034786 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
| 0.1 | 1.5 | GO:0070330 | aromatase activity(GO:0070330) |
| 0.1 | 0.2 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.1 | 4.4 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
| 0.1 | 0.2 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.2 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.1 | 0.3 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.1 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.0 | 0.1 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.0 | 0.9 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.0 | 0.4 | GO:0061650 | ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.0 | 0.0 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.0 | 0.2 | GO:0050661 | NADP binding(GO:0050661) |
| 0.0 | 0.0 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 0.7 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.0 | 1.4 | GO:0016627 | oxidoreductase activity, acting on the CH-CH group of donors(GO:0016627) |
| 0.0 | 0.9 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.2 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.1 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.0 | 0.0 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.0 | 1.1 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.0 | 3.7 | GO:0000287 | magnesium ion binding(GO:0000287) |
| 0.0 | 0.3 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.1 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.3 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.0 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.0 | 0.7 | GO:0005186 | pheromone activity(GO:0005186) |
| 0.0 | 0.6 | GO:0004386 | helicase activity(GO:0004386) |
| 0.0 | 0.2 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.2 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.0 | 0.8 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.0 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.0 | 1.2 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.3 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.0 | 0.0 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.0 | 0.5 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
| 0.0 | 0.7 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
| 0.0 | 0.1 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.6 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.0 | 0.3 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.1 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.0 | 0.2 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
| 0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.2 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.0 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.0 | 5.6 | GO:0017171 | serine hydrolase activity(GO:0017171) |
| 0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 1.5 | GO:0000149 | SNARE binding(GO:0000149) |
| 0.0 | 0.1 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.0 | 0.1 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.1 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.0 | 1.1 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.1 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.0 | 0.2 | GO:0004540 | ribonuclease activity(GO:0004540) |
| 0.0 | 0.2 | GO:0005536 | glucose binding(GO:0005536) |
| 0.0 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 1.1 | GO:0017048 | Rho GTPase binding(GO:0017048) |
| 0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.0 | 0.1 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 0.2 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
| 0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 2.4 | GO:0005550 | pheromone binding(GO:0005550) |
| 0.0 | 1.0 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
| 0.0 | 0.1 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.1 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.0 | 0.5 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
| 0.0 | 0.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.0 | 0.1 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.2 | GO:0016410 | N-acyltransferase activity(GO:0016410) |
| 0.0 | 0.0 | GO:0043842 | Kdo transferase activity(GO:0043842) |
| 0.0 | 2.5 | GO:0005525 | GTP binding(GO:0005525) |
| 0.0 | 0.0 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.0 | 4.6 | GO:0004674 | protein serine/threonine kinase activity(GO:0004674) |
| 0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.0 | GO:0015927 | trehalase activity(GO:0015927) |
| 0.0 | 0.1 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.2 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.1 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
| 0.0 | 0.4 | GO:0051117 | ATPase binding(GO:0051117) |
| 0.0 | 0.0 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.0 | 0.0 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.0 | 0.6 | GO:0005496 | steroid binding(GO:0005496) |
| 0.0 | 0.0 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.0 | 0.2 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.0 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.0 | 0.0 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.0 | 0.0 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 0.0 | GO:0046915 | transition metal ion transmembrane transporter activity(GO:0046915) |
| 0.0 | 0.1 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.0 | 0.1 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.6 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
| 0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.0 | 0.0 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.0 | 0.0 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.0 | 0.0 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 0.4 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.0 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 1.4 | GO:0016758 | transferase activity, transferring hexosyl groups(GO:0016758) |
| 0.0 | 0.0 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 18.6 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.5 | 0.5 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.4 | 4.7 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.4 | 15.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.3 | 2.8 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.3 | 3.4 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.3 | 2.4 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.3 | 7.5 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.3 | 10.5 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.2 | 7.0 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.2 | 7.0 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.2 | 7.3 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.2 | 10.2 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.2 | 5.0 | PID ATR PATHWAY | ATR signaling pathway |
| 0.2 | 3.6 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.2 | 3.9 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.2 | 1.9 | PID MYC PATHWAY | C-MYC pathway |
| 0.2 | 3.1 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.2 | 0.4 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.2 | 1.2 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.2 | 11.8 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.2 | 2.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.2 | 2.9 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.2 | 6.0 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.2 | 5.6 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.2 | 4.2 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.2 | 5.8 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.2 | 5.5 | PID E2F PATHWAY | E2F transcription factor network |
| 0.2 | 0.5 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.2 | 3.2 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.2 | 0.3 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.2 | 3.8 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.2 | 4.5 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.1 | 0.4 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.1 | 1.6 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 0.9 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.1 | 1.8 | PID EPO PATHWAY | EPO signaling pathway |
| 0.1 | 0.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 0.8 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.1 | 0.5 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.1 | 0.4 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.1 | 0.4 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.1 | 0.5 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.1 | 1.7 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.1 | 2.1 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.1 | 0.7 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 5.4 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.1 | 0.9 | PID FOXO PATHWAY | FoxO family signaling |
| 0.1 | 2.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.1 | 2.0 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.1 | 0.3 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.1 | 7.0 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.1 | 1.0 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.1 | 0.2 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 1.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.1 | 0.3 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.1 | 3.3 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.1 | 0.3 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.1 | 1.0 | PID ATM PATHWAY | ATM pathway |
| 0.1 | 0.9 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.1 | 1.1 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.1 | 0.8 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.1 | 0.4 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.1 | 0.6 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.1 | 0.8 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.1 | 0.4 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 0.5 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.1 | 1.4 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.1 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.1 | 0.2 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 1.1 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.1 | 0.6 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 0.3 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.1 | 2.6 | PID CMYB PATHWAY | C-MYB transcription factor network |
| 0.1 | 0.2 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.1 | 1.3 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.1 | 0.5 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.1 | 0.2 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.1 | 1.0 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.1 | 0.9 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.1 | 1.5 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.1 | 0.3 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.1 | 0.6 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.1 | 0.7 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.1 | 0.5 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.1 | 0.9 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 0.4 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 0.7 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.2 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.4 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.0 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.0 | 0.4 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.4 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.0 | 0.2 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.0 | 0.4 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.5 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.3 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.0 | 0.4 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 0.3 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 0.2 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.7 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 0.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.1 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.0 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.0 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.5 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.0 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.0 | 0.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.1 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 0.3 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.0 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 0.1 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 0.1 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.3 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.2 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 14.1 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.6 | 7.5 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.5 | 5.3 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.5 | 6.3 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.5 | 5.9 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.5 | 2.8 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.5 | 2.3 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.4 | 1.3 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.4 | 11.0 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.4 | 6.0 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.4 | 9.4 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.4 | 4.3 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.4 | 5.7 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.3 | 4.3 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.3 | 1.3 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.3 | 3.0 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.3 | 3.2 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.3 | 10.0 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.3 | 0.6 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.3 | 4.2 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.3 | 3.0 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.3 | 0.6 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.3 | 2.6 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.3 | 3.6 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.3 | 0.6 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.3 | 1.1 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.3 | 0.5 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.3 | 1.9 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.3 | 21.1 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.3 | 8.9 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.3 | 2.3 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.3 | 2.0 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.3 | 2.8 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.2 | 2.5 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.2 | 0.7 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.2 | 2.0 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.2 | 4.1 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.2 | 4.1 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.2 | 5.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.2 | 0.5 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.2 | 1.4 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.2 | 3.4 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.2 | 2.7 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.2 | 5.4 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.2 | 5.1 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.2 | 2.2 | REACTOME INTEGRIN ALPHAIIB BETA3 SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
| 0.2 | 0.2 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.2 | 0.9 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.2 | 2.0 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.2 | 3.5 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.2 | 1.3 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.2 | 3.7 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.2 | 0.4 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
| 0.2 | 3.2 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.2 | 2.8 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.2 | 3.7 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.2 | 0.2 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.2 | 2.1 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.2 | 0.2 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.2 | 5.0 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.2 | 0.6 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.2 | 1.8 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.2 | 1.6 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.2 | 8.7 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.2 | 3.4 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.2 | 2.6 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.2 | 1.0 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.2 | 1.4 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.2 | 4.0 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.2 | 1.5 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.2 | 17.1 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.2 | 1.5 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.2 | 18.4 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.2 | 0.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.2 | 0.8 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.2 | 1.7 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.2 | 0.9 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.2 | 2.4 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.2 | 3.7 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.2 | 3.7 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.2 | 2.8 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.2 | 1.5 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.2 | 9.9 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.2 | 1.1 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.2 | 2.8 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.2 | 0.5 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.2 | 1.5 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.2 | 3.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.2 | 1.0 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
| 0.2 | 2.8 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.2 | 13.2 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.2 | 3.3 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.2 | 1.5 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.1 | 3.1 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 1.0 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.1 | 2.0 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.1 | 0.9 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.1 | 1.3 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.1 | 0.4 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.1 | 1.8 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.1 | 2.1 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.1 | 0.6 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 3.7 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.1 | 0.1 | REACTOME REGULATION OF MITOTIC CELL CYCLE | Genes involved in Regulation of mitotic cell cycle |
| 0.1 | 1.2 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.1 | 3.5 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.1 | 1.3 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.1 | 3.4 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
| 0.1 | 0.6 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.1 | 2.2 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.1 | 2.0 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.1 | 9.6 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.1 | 1.0 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.1 | 0.3 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.1 | 1.4 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.1 | 0.5 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.1 | 1.7 | REACTOME CELL CYCLE CHECKPOINTS | Genes involved in Cell Cycle Checkpoints |
| 0.1 | 1.9 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.1 | 2.5 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.1 | 0.1 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
| 0.1 | 1.3 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 4.1 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.1 | 0.9 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.1 | 1.6 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.1 | 1.1 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.1 | 2.4 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.1 | 2.9 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.1 | 3.6 | REACTOME UNFOLDED PROTEIN RESPONSE | Genes involved in Unfolded Protein Response |
| 0.1 | 1.3 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.1 | 0.6 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.1 | 0.6 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.1 | 0.2 | REACTOME MITOTIC G1 G1 S PHASES | Genes involved in Mitotic G1-G1/S phases |
| 0.1 | 0.3 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.1 | 1.8 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
| 0.1 | 1.1 | REACTOME METABOLISM OF NUCLEOTIDES | Genes involved in Metabolism of nucleotides |
| 0.1 | 2.7 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.1 | 1.0 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.1 | 0.1 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 0.1 | 1.2 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.1 | 0.7 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.1 | 1.8 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 0.2 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.1 | 2.5 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.1 | 1.0 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.1 | 0.5 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.1 | 1.4 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 0.1 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.1 | 1.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.1 | 1.1 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.1 | 1.9 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.1 | 0.5 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.1 | 1.7 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.1 | 0.4 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.1 | 0.9 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.1 | 1.3 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.1 | 0.2 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 1.0 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
| 0.1 | 0.9 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.1 | 0.1 | REACTOME SIGNALING BY ILS | Genes involved in Signaling by Interleukins |
| 0.1 | 3.4 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
| 0.1 | 0.9 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 0.6 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.1 | 0.9 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.1 | 0.5 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.1 | 1.0 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
| 0.1 | 0.9 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.1 | 1.4 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.1 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 0.5 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.1 | 4.4 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
| 0.1 | 0.9 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 0.8 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
| 0.1 | 1.5 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.1 | 0.7 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.1 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.1 | 0.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 0.4 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.1 | 0.4 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.1 | 4.9 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.1 | 0.4 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.1 | 0.8 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.1 | 1.7 | REACTOME PHOSPHOLIPID METABOLISM | Genes involved in Phospholipid metabolism |
| 0.1 | 2.1 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.1 | 0.4 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.1 | 0.9 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
| 0.0 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 0.4 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 0.3 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.0 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 5.2 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 1.0 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.7 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.3 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 0.0 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.0 | 0.5 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
| 0.0 | 0.1 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.2 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.0 | 0.6 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.0 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
| 0.0 | 0.3 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 0.1 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
| 0.0 | 0.0 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.3 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
| 0.0 | 0.2 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.2 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.0 | 0.2 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 0.0 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.3 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.0 | 0.3 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.0 | 0.7 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
| 0.0 | 0.1 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 0.3 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.0 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 0.2 | REACTOME METABOLISM OF RNA | Genes involved in Metabolism of RNA |
| 0.0 | 0.7 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.0 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
| 0.0 | 0.4 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.2 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 0.0 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
| 0.0 | 0.1 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.4 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 0.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 0.6 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.0 | 0.1 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |