Gene Symbol | Gene ID | Gene Info |
---|---|---|
Ascl2
|
ENSMUSG00000009248.5 | Ascl2 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Ascl2 | chr7_142968811_142969345 | 186 | 0.924955 | 0.10 | 4.6e-01 | Click! |
Ascl2 | chr7_142967500_142968798 | 568 | 0.685251 | 0.01 | 9.6e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr19_45230983_45235468 | 2.35 |
Lbx1 |
ladybird homeobox 1 |
2587 |
0.27 |
chr11_78694313_78696159 | 2.25 |
Nlk |
nemo like kinase |
1258 |
0.39 |
chr9_63144078_63146888 | 1.49 |
Skor1 |
SKI family transcriptional corepressor 1 |
1497 |
0.38 |
chr12_101105069_101105425 | 1.42 |
Gm21056 |
predicted gene, 21056 |
260 |
0.88 |
chr4_134017500_134018935 | 1.41 |
Gm13061 |
predicted gene 13061 |
70 |
0.63 |
chr12_72939449_72940864 | 1.32 |
4930447C04Rik |
RIKEN cDNA 4930447C04 gene |
73 |
0.75 |
chrX_105390628_105392456 | 1.32 |
5330434G04Rik |
RIKEN cDNA 5330434G04 gene |
212 |
0.93 |
chr13_92425754_92427030 | 1.23 |
Ankrd34b |
ankyrin repeat domain 34B |
51 |
0.94 |
chr2_29908337_29908488 | 1.23 |
Odf2 |
outer dense fiber of sperm tails 2 |
4212 |
0.13 |
chr11_117451542_117451709 | 1.22 |
Gm11732 |
predicted gene 11732 |
25447 |
0.11 |
chrX_57919624_57922497 | 1.22 |
Gm25023 |
predicted gene, 25023 |
68413 |
0.11 |
chrX_7921647_7923257 | 1.20 |
Pcsk1n |
proprotein convertase subtilisin/kexin type 1 inhibitor |
2630 |
0.1 |
chr12_80123554_80123705 | 1.19 |
2310015A10Rik |
RIKEN cDNA 2310015A10 gene |
2490 |
0.19 |
chr11_115608322_115608857 | 1.17 |
Mif4gd |
MIF4G domain containing |
3537 |
0.11 |
chr4_115918044_115918448 | 1.16 |
Dmbx1 |
diencephalon/mesencephalon homeobox 1 |
7392 |
0.13 |
chr9_102262181_102262379 | 1.16 |
Gm37260 |
predicted gene, 37260 |
11456 |
0.19 |
chr2_74745819_74748448 | 1.13 |
Hoxd3 |
homeobox D3 |
1411 |
0.17 |
chr5_37241461_37244349 | 1.13 |
Crmp1 |
collapsin response mediator protein 1 |
171 |
0.95 |
chrX_5467696_5468887 | 1.11 |
Mycs |
myc-like oncogene, s-myc protein |
974 |
0.62 |
chr18_43686487_43688415 | 1.08 |
Jakmip2 |
janus kinase and microtubule interacting protein 2 |
174 |
0.96 |
chr13_55835316_55837389 | 1.07 |
Pitx1 |
paired-like homeodomain transcription factor 1 |
160 |
0.62 |
chr13_63554202_63556305 | 1.04 |
Ptch1 |
patched 1 |
8562 |
0.14 |
chr8_57326741_57329467 | 1.03 |
Hand2os1 |
Hand2, opposite strand 1 |
3871 |
0.15 |
chr5_147187904_147189474 | 1.02 |
Gsx1 |
GS homeobox 1 |
7 |
0.97 |
chr1_167830936_167831845 | 1.02 |
Lmx1a |
LIM homeobox transcription factor 1 alpha |
141833 |
0.05 |
chr7_112825291_112826896 | 0.99 |
Tead1 |
TEA domain family member 1 |
13541 |
0.24 |
chr19_44758783_44762005 | 0.98 |
Pax2 |
paired box 2 |
479 |
0.75 |
chr2_23320682_23322069 | 0.95 |
Nxph2 |
neurexophilin 2 |
129 |
0.97 |
chr17_34671242_34672659 | 0.95 |
Tnxb |
tenascin XB |
1415 |
0.18 |
chr4_22497544_22499061 | 0.95 |
Gm30731 |
predicted gene, 30731 |
7754 |
0.16 |
chr5_28457868_28460972 | 0.94 |
9530036O11Rik |
RIKEN cDNA 9530036O11Rik |
1146 |
0.51 |
chr19_6250078_6250229 | 0.94 |
Atg2a |
autophagy related 2A |
1335 |
0.21 |
chr2_174283563_174287177 | 0.94 |
Gnas |
GNAS (guanine nucleotide binding protein, alpha stimulating) complex locus |
12 |
0.53 |
chr15_98849237_98849748 | 0.93 |
Kmt2d |
lysine (K)-specific methyltransferase 2D |
255 |
0.81 |
chr11_88169575_88170238 | 0.92 |
Cuedc1 |
CUE domain containing 1 |
7645 |
0.18 |
chr12_100945256_100945407 | 0.92 |
Ccdc88c |
coiled-coil domain containing 88C |
158 |
0.93 |
chr4_125490136_125491914 | 0.92 |
Grik3 |
glutamate receptor, ionotropic, kainate 3 |
325 |
0.89 |
chr10_42581935_42584872 | 0.92 |
Nr2e1 |
nuclear receptor subfamily 2, group E, member 1 |
229 |
0.69 |
chr17_25846344_25846735 | 0.92 |
Wdr90 |
WD repeat domain 90 |
42 |
0.9 |
chr12_110187430_110189676 | 0.91 |
Gm34785 |
predicted gene, 34785 |
492 |
0.73 |
chr10_19356598_19357962 | 0.91 |
Olig3 |
oligodendrocyte transcription factor 3 |
747 |
0.72 |
chr1_84695175_84696294 | 0.91 |
Mir5126 |
microRNA 5126 |
105 |
0.73 |
chr4_91399504_91400258 | 0.90 |
Elavl2 |
ELAV like RNA binding protein 1 |
95 |
0.97 |
chr14_63247276_63249044 | 0.90 |
Gata4 |
GATA binding protein 4 |
2889 |
0.24 |
chr8_121118797_121121438 | 0.89 |
Foxc2 |
forkhead box C2 |
3946 |
0.14 |
chr7_6189448_6190004 | 0.89 |
Zfp444 |
zinc finger protein 444 |
6150 |
0.1 |
chr11_98601780_98602920 | 0.88 |
Lrrc3c |
leucine rich repeat containing 3C |
4059 |
0.12 |
chr11_58379807_58380405 | 0.87 |
Lypd8 |
LY6/PLAUR domain containing 8 |
1063 |
0.32 |
chr15_89067515_89068710 | 0.87 |
Panx2 |
pannexin 2 |
1561 |
0.22 |
chr13_48664673_48666478 | 0.87 |
Barx1 |
BarH-like homeobox 1 |
2577 |
0.26 |
chr1_177446374_177448525 | 0.87 |
Zbtb18 |
zinc finger and BTB domain containing 18 |
1628 |
0.31 |
chr18_56884043_56884282 | 0.87 |
Gm18087 |
predicted gene, 18087 |
31926 |
0.17 |
chr12_117988794_117990154 | 0.86 |
Dnah11 |
dynein, axonemal, heavy chain 11 |
70829 |
0.12 |
chr7_29865514_29865665 | 0.86 |
Zfp420 |
zinc finger protein 420 |
5548 |
0.09 |
chr5_33430330_33431900 | 0.85 |
Nkx1-1 |
NK1 homeobox 1 |
2861 |
0.23 |
chr2_172040251_172043672 | 0.85 |
Cbln4 |
cerebellin 4 precursor protein |
1505 |
0.35 |
chr8_4210688_4210839 | 0.85 |
4932443L11Rik |
RIKEN cDNA 4932443L11 gene |
3881 |
0.1 |
chr13_73262153_73264451 | 0.85 |
Irx4 |
Iroquois homeobox 4 |
2805 |
0.22 |
chr7_126292288_126292728 | 0.84 |
Sbk1 |
SH3-binding kinase 1 |
1428 |
0.29 |
chr11_4947036_4948194 | 0.84 |
Nefh |
neurofilament, heavy polypeptide |
449 |
0.76 |
chr10_79738605_79739629 | 0.84 |
Polrmt |
polymerase (RNA) mitochondrial (DNA directed) |
257 |
0.79 |
chr2_146834060_146838027 | 0.84 |
Gm14114 |
predicted gene 14114 |
3689 |
0.27 |
chr17_56108797_56108993 | 0.83 |
Plin4 |
perilipin 4 |
907 |
0.36 |
chr16_38362450_38363226 | 0.83 |
Popdc2 |
popeye domain containing 2 |
593 |
0.63 |
chr11_46165792_46166685 | 0.83 |
Nipal4 |
NIPA-like domain containing 4 |
270 |
0.86 |
chr9_24769617_24771807 | 0.83 |
Tbx20 |
T-box 20 |
962 |
0.56 |
chr5_28209280_28210515 | 0.82 |
Cnpy1 |
canopy FGF signaling regulator 1 |
125 |
0.97 |
chr6_52167312_52169129 | 0.82 |
Hoxaas2 |
Hoxa cluster antisense RNA 2 |
290 |
0.7 |
chr8_87372151_87372302 | 0.81 |
Gm27207 |
predicted gene 27207 |
849 |
0.6 |
chr7_27371795_27372578 | 0.81 |
Gm20479 |
predicted gene 20479 |
14767 |
0.1 |
chr14_123626367_123627548 | 0.81 |
Nalcn |
sodium leak channel, non-selective |
4 |
0.98 |
chr11_120161291_120161690 | 0.80 |
Slc38a10 |
solute carrier family 38, member 10 |
10144 |
0.1 |
chr1_135324343_135325907 | 0.80 |
Lmod1 |
leiomodin 1 (smooth muscle) |
318 |
0.83 |
chr4_120712192_120712343 | 0.80 |
Kcnq4 |
potassium voltage-gated channel, subfamily Q, member 4 |
34981 |
0.1 |
chr16_37583822_37585033 | 0.79 |
Hgd |
homogentisate 1, 2-dioxygenase |
4145 |
0.17 |
chr8_84995691_84996165 | 0.79 |
Hook2 |
hook microtubule tethering protein 2 |
2563 |
0.09 |
chr11_63923270_63924923 | 0.79 |
Hs3st3b1 |
heparan sulfate (glucosamine) 3-O-sulfotransferase 3B1 |
1806 |
0.39 |
chr2_74725879_74728683 | 0.78 |
Hoxd4 |
homeobox D4 |
207 |
0.67 |
chr16_60605121_60606481 | 0.77 |
Gm9017 |
predicted gene 9017 |
46 |
0.78 |
chr11_116009104_116009282 | 0.77 |
Galk1 |
galactokinase 1 |
3526 |
0.13 |
chr13_60175871_60177453 | 0.77 |
Gm48488 |
predicted gene, 48488 |
20 |
0.8 |
chr17_27181697_27181994 | 0.77 |
Lemd2 |
LEM domain containing 2 |
11635 |
0.09 |
chr8_92362973_92364962 | 0.77 |
Irx5 |
Iroquois homeobox 5 |
6218 |
0.19 |
chr2_178411563_178412733 | 0.77 |
Ppp1r3d |
protein phosphatase 1, regulatory subunit 3D |
2324 |
0.22 |
chr8_70451835_70452583 | 0.76 |
Crtc1 |
CREB regulated transcription coactivator 1 |
12630 |
0.09 |
chr7_127111351_127111502 | 0.76 |
Qprt |
quinolinate phosphoribosyltransferase |
10592 |
0.07 |
chr5_139548537_139550176 | 0.76 |
Uncx |
UNC homeobox |
5458 |
0.19 |
chr13_65562682_65563537 | 0.76 |
Cbx3-ps2 |
chromobox 3, pseudogene 2 |
3941 |
0.1 |
chr5_35279136_35280046 | 0.75 |
Adra2c |
adrenergic receptor, alpha 2c |
1272 |
0.51 |
chr3_17793835_17795104 | 0.75 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
427 |
0.75 |
chr19_25505518_25507191 | 0.75 |
Dmrt1 |
doublesex and mab-3 related transcription factor 1 |
647 |
0.72 |
chr7_30633440_30635827 | 0.75 |
Etv2 |
ets variant 2 |
1219 |
0.2 |
chr5_135040249_135040420 | 0.75 |
Stx1a |
syntaxin 1A (brain) |
726 |
0.42 |
chr5_117841452_117842996 | 0.74 |
Nos1 |
nitric oxide synthase 1, neuronal |
38 |
0.98 |
chr3_92080511_92081802 | 0.74 |
Lor |
loricrin |
1986 |
0.2 |
chr15_71727651_71728452 | 0.74 |
Fam135b |
family with sequence similarity 135, member B |
213 |
0.95 |
chr17_47672108_47673259 | 0.74 |
Usp49 |
ubiquitin specific peptidase 49 |
37 |
0.94 |
chr2_31948567_31948718 | 0.74 |
Aif1l |
allograft inflammatory factor 1-like |
1497 |
0.27 |
chr17_46132261_46132556 | 0.74 |
Rsph9 |
radial spoke head 9 homolog (Chlamydomonas) |
4387 |
0.12 |
chr9_46269846_46270690 | 0.74 |
Gm47544 |
predicted gene, 47544 |
1097 |
0.23 |
chr6_83711777_83712184 | 0.73 |
Vax2os |
ventral anterior homeobox 2, opposite strand |
221 |
0.78 |
chr15_72546044_72547992 | 0.73 |
Kcnk9 |
potassium channel, subfamily K, member 9 |
678 |
0.75 |
chr12_22905479_22906703 | 0.73 |
Gm48042 |
predicted gene, 48042 |
72 |
0.96 |
chr2_165563067_165564027 | 0.73 |
Eya2 |
EYA transcriptional coactivator and phosphatase 2 |
31485 |
0.13 |
chr14_48654842_48656229 | 0.73 |
Gm23469 |
predicted gene, 23469 |
3036 |
0.12 |
chr14_122255370_122256551 | 0.73 |
Clybl |
citrate lyase beta like |
2081 |
0.33 |
chr17_25244898_25245101 | 0.73 |
Mir3547 |
microRNA 3547 |
639 |
0.34 |
chr18_76859073_76860559 | 0.73 |
Skor2 |
SKI family transcriptional corepressor 2 |
3411 |
0.29 |
chr12_112747021_112747471 | 0.73 |
Cep170b |
centrosomal protein 170B |
3282 |
0.12 |
chr11_77471635_77471786 | 0.72 |
Ankrd13b |
ankyrin repeat domain 13b |
1915 |
0.23 |
chr17_88791510_88792237 | 0.72 |
Lhcgr |
luteinizing hormone/choriogonadotropin receptor |
98 |
0.98 |
chr11_96343236_96346574 | 0.72 |
Hoxb3 |
homeobox B3 |
1136 |
0.24 |
chr9_52148115_52149635 | 0.72 |
Zc3h12c |
zinc finger CCCH type containing 12C |
19236 |
0.18 |
chr4_40724876_40726660 | 0.72 |
Dnaja1 |
DnaJ heat shock protein family (Hsp40) member A1 |
1719 |
0.23 |
chr2_74739700_74741193 | 0.72 |
Hoxd3 |
homeobox D3 |
827 |
0.31 |
chr2_147083670_147085642 | 0.71 |
Nkx2-4 |
NK2 homeobox 4 |
789 |
0.65 |
chr11_79593364_79593812 | 0.71 |
Gm23293 |
predicted gene, 23293 |
1577 |
0.24 |
chr4_154635108_154637998 | 0.71 |
Prdm16 |
PR domain containing 16 |
244 |
0.83 |
chr2_57255277_57255792 | 0.71 |
Gpd2 |
glycerol phosphate dehydrogenase 2, mitochondrial |
9601 |
0.16 |
chr8_71480966_71481305 | 0.71 |
Ano8 |
anoctamin 8 |
2603 |
0.12 |
chr10_79782010_79782201 | 0.71 |
Fstl3 |
follistatin-like 3 |
1524 |
0.16 |
chr2_33639069_33641423 | 0.70 |
Lmx1b |
LIM homeobox transcription factor 1 beta |
234 |
0.85 |
chr2_71551375_71552379 | 0.70 |
Dlx2 |
distal-less homeobox 2 |
5123 |
0.16 |
chr1_153703492_153704014 | 0.70 |
5530400K19Rik |
RIKEN cDNA 5530400K19 gene |
10901 |
0.11 |
chr1_132765843_132766599 | 0.70 |
Nfasc |
neurofascin |
24424 |
0.16 |
chr4_150651111_150652374 | 0.70 |
Slc45a1 |
solute carrier family 45, member 1 |
355 |
0.88 |
chr17_87745516_87746757 | 0.70 |
Msh2 |
mutS homolog 2 |
49595 |
0.12 |
chr11_18873955_18876215 | 0.70 |
8430419K02Rik |
RIKEN cDNA 8430419K02 gene |
776 |
0.61 |
chr19_45143255_45144066 | 0.70 |
Tlx1 |
T cell leukemia, homeobox 1 |
7020 |
0.15 |
chr5_147274260_147275198 | 0.70 |
Plut |
PDX1 associated lncRNA, upregulator of transcription |
3208 |
0.14 |
chr9_53974078_53975628 | 0.70 |
Elmod1 |
ELMO/CED-12 domain containing 1 |
212 |
0.95 |
chr2_9882196_9886301 | 0.69 |
9230102O04Rik |
RIKEN cDNA 9230102O04 gene |
255 |
0.84 |
chr5_37821115_37822599 | 0.69 |
Msx1 |
msh homeobox 1 |
2725 |
0.28 |
chr13_21300747_21300951 | 0.69 |
Gm11270 |
predicted gene 11270 |
4131 |
0.13 |
chr11_65261969_65263039 | 0.69 |
Myocd |
myocardin |
7350 |
0.22 |
chr15_79827898_79829170 | 0.68 |
Cbx6 |
chromobox 6 |
5264 |
0.11 |
chr4_120267673_120269153 | 0.68 |
Foxo6 |
forkhead box O6 |
18936 |
0.2 |
chr17_35710107_35710258 | 0.67 |
Ddr1 |
discoidin domain receptor family, member 1 |
5561 |
0.09 |
chr1_93190721_93191081 | 0.67 |
Crocc2 |
ciliary rootlet coiled-coil, rootletin family member 2 |
22176 |
0.11 |
chr11_69346665_69346816 | 0.67 |
Chd3 |
chromodomain helicase DNA binding protein 3 |
394 |
0.66 |
chr7_140172338_140172489 | 0.67 |
Olfr523 |
olfactory receptor 523 |
804 |
0.43 |
chr8_45380998_45382350 | 0.67 |
Fam149a |
family with sequence similarity 149, member A |
617 |
0.68 |
chr3_129753687_129755492 | 0.67 |
Egf |
epidermal growth factor |
727 |
0.4 |
chr12_23188694_23189971 | 0.67 |
Gm47385 |
predicted gene, 47385 |
66 |
0.96 |
chr6_99204059_99205669 | 0.67 |
Foxp1 |
forkhead box P1 |
41846 |
0.2 |
chr2_178141581_178143125 | 0.66 |
Phactr3 |
phosphatase and actin regulator 3 |
420 |
0.88 |
chr8_19534867_19535916 | 0.66 |
Gm27852 |
predicted gene, 27852 |
17 |
0.53 |
chr17_27505294_27505818 | 0.66 |
Grm4 |
glutamate receptor, metabotropic 4 |
2232 |
0.16 |
chr1_129273098_129274282 | 0.66 |
Thsd7b |
thrombospondin, type I, domain containing 7B |
205 |
0.95 |
chr4_55204249_55204534 | 0.66 |
Gm12509 |
predicted gene 12509 |
41383 |
0.13 |
chr7_4781483_4781634 | 0.66 |
Il11 |
interleukin 11 |
1299 |
0.18 |
chr4_11964013_11964651 | 0.66 |
Pdp1 |
pyruvate dehyrogenase phosphatase catalytic subunit 1 |
1489 |
0.31 |
chr11_81152519_81153660 | 0.66 |
Asic2 |
acid-sensing (proton-gated) ion channel 2 |
232 |
0.96 |
chr11_108975902_108976053 | 0.66 |
Gm11668 |
predicted gene 11668 |
31674 |
0.14 |
chr1_74898735_74898886 | 0.65 |
Mir375 |
microRNA 375 |
1911 |
0.18 |
chr14_67236008_67239452 | 0.65 |
Ebf2 |
early B cell factor 2 |
3086 |
0.21 |
chr18_37690944_37692448 | 0.65 |
Pcdhgb2 |
protocadherin gamma subfamily B, 2 |
1861 |
0.09 |
chr2_31210174_31210549 | 0.65 |
Gpr107 |
G protein-coupled receptor 107 |
261 |
0.83 |
chrX_114816407_114816558 | 0.65 |
Gm14897 |
predicted gene 14897 |
41405 |
0.14 |
chr12_104471272_104472544 | 0.65 |
Gsc |
goosecoid homeobox |
1422 |
0.28 |
chr6_30733087_30733640 | 0.65 |
Mest |
mesoderm specific transcript |
91 |
0.95 |
chr18_37732160_37733414 | 0.65 |
Pcdhgb5 |
protocadherin gamma subfamily B, 5 |
1733 |
0.09 |
chr11_99147242_99147482 | 0.65 |
Ccr7 |
chemokine (C-C motif) receptor 7 |
7715 |
0.16 |
chr3_129223881_129225649 | 0.65 |
Gm43697 |
predicted gene 43697 |
763 |
0.61 |
chr15_76737177_76737328 | 0.64 |
Arhgap39 |
Rho GTPase activating protein 39 |
11649 |
0.08 |
chr16_38365459_38365635 | 0.64 |
Popdc2 |
popeye domain containing 2 |
3263 |
0.16 |
chr14_122478089_122479067 | 0.64 |
Zic2 |
zinc finger protein of the cerebellum 2 |
478 |
0.68 |
chr19_6070862_6071747 | 0.64 |
Vps51 |
VPS51 GARP complex subunit |
1606 |
0.11 |
chr6_8694046_8694201 | 0.64 |
Ica1 |
islet cell autoantigen 1 |
21806 |
0.24 |
chr5_125532320_125533519 | 0.64 |
Tmem132b |
transmembrane protein 132B |
532 |
0.76 |
chr3_38907656_38908739 | 0.64 |
Fat4 |
FAT atypical cadherin 4 |
17255 |
0.21 |
chr19_53557067_53557881 | 0.63 |
Gm50394 |
predicted gene, 50394 |
27819 |
0.11 |
chr7_29172569_29173191 | 0.63 |
Ggn |
gametogenetin |
2376 |
0.11 |
chr7_48960076_48960785 | 0.63 |
Nav2 |
neuron navigator 2 |
1333 |
0.41 |
chr4_54073101_54073376 | 0.63 |
Gm24177 |
predicted gene, 24177 |
69181 |
0.11 |
chr1_90775497_90776005 | 0.63 |
Col6a3 |
collagen, type VI, alpha 3 |
2536 |
0.32 |
chr5_111221096_111221247 | 0.63 |
Ttc28 |
tetratricopeptide repeat domain 28 |
4287 |
0.22 |
chr11_70657209_70658413 | 0.63 |
Eno3 |
enolase 3, beta muscle |
15 |
0.91 |
chr7_18402566_18403598 | 0.63 |
Gm45104 |
predicted gene 45104 |
2217 |
0.18 |
chr15_103155671_103156416 | 0.63 |
Smug1 |
single-strand selective monofunctional uracil DNA glycosylase |
1959 |
0.2 |
chr12_73044500_73046647 | 0.63 |
Six1 |
sine oculis-related homeobox 1 |
282 |
0.92 |
chr2_29747113_29747729 | 0.63 |
Gm13420 |
predicted gene 13420 |
4264 |
0.13 |
chr1_168426195_168428871 | 0.63 |
Pbx1 |
pre B cell leukemia homeobox 1 |
3971 |
0.3 |
chr5_67095606_67096884 | 0.63 |
Phox2b |
paired-like homeobox 2b |
2812 |
0.22 |
chr9_110205981_110206132 | 0.63 |
Smarcc1 |
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily c, member 1 |
20324 |
0.13 |
chr5_113075938_113076089 | 0.63 |
Crybb3 |
crystallin, beta B3 |
4378 |
0.12 |
chr11_43775557_43776559 | 0.63 |
Ttc1 |
tetratricopeptide repeat domain 1 |
28050 |
0.17 |
chr7_140921669_140921874 | 0.62 |
Nlrp6 |
NLR family, pyrin domain containing 6 |
335 |
0.69 |
chr11_69115590_69116173 | 0.62 |
Hes7 |
hes family bHLH transcription factor 7 |
4523 |
0.09 |
chr11_73234159_73234383 | 0.62 |
Trpv1 |
transient receptor potential cation channel, subfamily V, member 1 |
21 |
0.96 |
chr2_91653652_91653895 | 0.62 |
Arhgap1 |
Rho GTPase activating protein 1 |
565 |
0.62 |
chr4_152125109_152126881 | 0.62 |
Espn |
espin |
2930 |
0.16 |
chr1_177444257_177446079 | 0.62 |
Zbtb18 |
zinc finger and BTB domain containing 18 |
230 |
0.9 |
chr2_162660089_162661112 | 0.62 |
Ptprt |
protein tyrosine phosphatase, receptor type, T |
494 |
0.5 |
chr19_36130100_36130251 | 0.62 |
Ankrd1 |
ankyrin repeat domain 1 (cardiac muscle) |
10076 |
0.19 |
chr2_76804052_76804549 | 0.61 |
Ttn |
titin |
22242 |
0.22 |
chr11_95125435_95125822 | 0.61 |
Dlx3 |
distal-less homeobox 3 |
5509 |
0.14 |
chr11_88138797_88139913 | 0.61 |
Cuedc1 |
CUE domain containing 1 |
22906 |
0.15 |
chr11_97499926_97501235 | 0.61 |
4933428G20Rik |
RIKEN cDNA 4933428G20 gene |
240 |
0.89 |
chr5_119706281_119707028 | 0.61 |
Tbx3os2 |
T-box 3, opposite strand 2 |
15436 |
0.15 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.0 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.6 | 1.7 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
0.6 | 1.7 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.5 | 1.4 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.4 | 1.3 | GO:0036166 | phenotypic switching(GO:0036166) |
0.4 | 2.2 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.4 | 1.3 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
0.4 | 0.4 | GO:0021550 | medulla oblongata development(GO:0021550) |
0.4 | 1.2 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
0.4 | 2.0 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) |
0.4 | 1.1 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.4 | 1.1 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.4 | 0.7 | GO:0010159 | specification of organ position(GO:0010159) |
0.3 | 1.0 | GO:0009629 | response to gravity(GO:0009629) |
0.3 | 1.7 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.3 | 1.7 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
0.3 | 1.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.3 | 0.7 | GO:0048880 | sensory system development(GO:0048880) |
0.3 | 0.6 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.3 | 1.0 | GO:0001555 | oocyte growth(GO:0001555) |
0.3 | 1.0 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.3 | 0.6 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.3 | 0.6 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.3 | 0.9 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.3 | 1.2 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.3 | 0.3 | GO:0060435 | bronchiole development(GO:0060435) |
0.3 | 1.2 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.3 | 0.6 | GO:0072108 | positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) |
0.3 | 0.9 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.3 | 0.9 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.3 | 0.9 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.3 | 1.1 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.3 | 3.4 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.3 | 1.4 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.3 | 0.8 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.3 | 0.8 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.3 | 1.0 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.3 | 0.3 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.3 | 0.8 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.3 | 3.0 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.2 | 0.7 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
0.2 | 0.7 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
0.2 | 1.0 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.2 | 1.0 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
0.2 | 0.5 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) |
0.2 | 1.4 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
0.2 | 0.5 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.2 | 0.7 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.2 | 0.7 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
0.2 | 0.9 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.2 | 0.4 | GO:0061205 | paramesonephric duct development(GO:0061205) |
0.2 | 0.7 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.2 | 0.2 | GO:0060535 | trachea cartilage morphogenesis(GO:0060535) |
0.2 | 0.4 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.2 | 0.4 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.2 | 0.6 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.2 | 0.4 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
0.2 | 0.6 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.2 | 1.2 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.2 | 0.6 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.2 | 0.2 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.2 | 0.4 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
0.2 | 0.4 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.2 | 1.4 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.2 | 0.4 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.2 | 2.4 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.2 | 0.6 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.2 | 0.6 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.2 | 0.6 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.2 | 0.2 | GO:0061549 | sympathetic ganglion development(GO:0061549) |
0.2 | 1.2 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
0.2 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.2 | 0.6 | GO:0021586 | pons maturation(GO:0021586) |
0.2 | 0.2 | GO:0072199 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) |
0.2 | 0.6 | GO:0003257 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) |
0.2 | 0.6 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.2 | 1.7 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.2 | 0.6 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.2 | 0.4 | GO:0035106 | operant conditioning(GO:0035106) |
0.2 | 0.9 | GO:0003010 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
0.2 | 0.7 | GO:0061743 | motor learning(GO:0061743) |
0.2 | 0.5 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.2 | 0.4 | GO:0086068 | Purkinje myocyte action potential(GO:0086017) Purkinje myocyte to ventricular cardiac muscle cell signaling(GO:0086029) Purkinje myocyte to ventricular cardiac muscle cell communication(GO:0086068) |
0.2 | 0.2 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.2 | 0.4 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.2 | 0.5 | GO:0001546 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
0.2 | 0.4 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.2 | 0.2 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
0.2 | 0.2 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.2 | 0.7 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.2 | 0.5 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.2 | 0.5 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.2 | 0.5 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
0.2 | 0.7 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.2 | 0.2 | GO:0003256 | regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003256) |
0.2 | 0.5 | GO:0014029 | neural crest formation(GO:0014029) |
0.2 | 0.7 | GO:0030035 | microspike assembly(GO:0030035) |
0.2 | 0.2 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.2 | 0.2 | GO:0032222 | regulation of synaptic transmission, cholinergic(GO:0032222) |
0.2 | 0.6 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
0.2 | 0.2 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.2 | 0.3 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.2 | 0.8 | GO:0098598 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.2 | 0.5 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.2 | 0.3 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.2 | 1.4 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.2 | 0.8 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.2 | 0.5 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.2 | 0.2 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
0.2 | 0.5 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.2 | 0.6 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.2 | 0.2 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.2 | 0.6 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.4 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.1 | 2.2 | GO:0048665 | neuron fate specification(GO:0048665) |
0.1 | 0.1 | GO:0061526 | acetylcholine secretion(GO:0061526) |
0.1 | 0.4 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.1 | 0.7 | GO:0042637 | catagen(GO:0042637) |
0.1 | 0.4 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.1 | 0.3 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.1 | 0.4 | GO:0031635 | adenylate cyclase-inhibiting opioid receptor signaling pathway(GO:0031635) |
0.1 | 0.3 | GO:0007494 | midgut development(GO:0007494) |
0.1 | 0.7 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.1 | 0.1 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.1 | 0.4 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.1 | 0.4 | GO:0046959 | habituation(GO:0046959) |
0.1 | 0.1 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.1 | 0.7 | GO:1904970 | brush border assembly(GO:1904970) |
0.1 | 0.4 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.1 | 0.5 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
0.1 | 0.1 | GO:0072048 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.1 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.1 | 0.9 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.1 | 0.4 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.1 | 0.3 | GO:0034651 | cortisol biosynthetic process(GO:0034651) |
0.1 | 0.3 | GO:0072610 | interleukin-12 secretion(GO:0072610) |
0.1 | 0.4 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.4 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.1 | 0.1 | GO:0071504 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.1 | 0.4 | GO:0010002 | cardioblast differentiation(GO:0010002) |
0.1 | 0.8 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.1 | 0.1 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.1 | 0.3 | GO:0033058 | directional locomotion(GO:0033058) |
0.1 | 0.3 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
0.1 | 0.5 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.1 | 0.2 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.1 | 0.6 | GO:0071316 | cellular response to nicotine(GO:0071316) |
0.1 | 0.7 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.1 | 0.1 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.1 | 0.2 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
0.1 | 1.1 | GO:0021936 | regulation of cerebellar granule cell precursor proliferation(GO:0021936) |
0.1 | 0.4 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.1 | 0.4 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.2 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.4 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.1 | 0.2 | GO:0009732 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.1 | 0.3 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.1 | 0.2 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.1 | 0.3 | GO:0032344 | regulation of aldosterone metabolic process(GO:0032344) |
0.1 | 0.5 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.1 | 0.5 | GO:0010288 | response to lead ion(GO:0010288) |
0.1 | 0.2 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 0.3 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.1 | 0.4 | GO:0048505 | regulation of timing of cell differentiation(GO:0048505) |
0.1 | 0.4 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.1 | 0.3 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.1 | 0.2 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.1 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 0.8 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.1 | 0.4 | GO:2001054 | negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
0.1 | 0.1 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.1 | 0.2 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 0.6 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.1 | 0.5 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.1 | 1.6 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
0.1 | 0.3 | GO:0070948 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.1 | 0.3 | GO:0007412 | axon target recognition(GO:0007412) |
0.1 | 0.3 | GO:0021546 | rhombomere development(GO:0021546) central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.1 | 0.5 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.1 | 0.5 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
0.1 | 0.2 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.1 | 0.5 | GO:0008354 | germ cell migration(GO:0008354) |
0.1 | 0.3 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.1 | 1.2 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 0.7 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.1 | 0.3 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.1 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
0.1 | 0.2 | GO:0031033 | myosin filament organization(GO:0031033) |
0.1 | 0.4 | GO:0014028 | notochord formation(GO:0014028) |
0.1 | 0.1 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.1 | 0.3 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.1 | 0.2 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.1 | 0.1 | GO:0072069 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.1 | 0.3 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.1 | 0.1 | GO:0071314 | cellular response to cocaine(GO:0071314) |
0.1 | 0.2 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.1 | 0.3 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) positive regulation of osteoclast proliferation(GO:0090290) |
0.1 | 0.1 | GO:0071672 | negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
0.1 | 0.4 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
0.1 | 0.1 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.1 | 0.3 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.1 | 0.3 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.1 | 0.1 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
0.1 | 0.3 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.1 | 0.5 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 0.2 | GO:0014824 | artery smooth muscle contraction(GO:0014824) |
0.1 | 0.1 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.1 | 0.5 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.1 | 1.8 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.3 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.1 | 0.7 | GO:0060068 | vagina development(GO:0060068) |
0.1 | 0.5 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
0.1 | 0.1 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.1 | 0.2 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.2 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.1 | 0.2 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.1 | 0.5 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.1 | 2.0 | GO:0001964 | startle response(GO:0001964) |
0.1 | 0.7 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.1 | 0.1 | GO:0010255 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.1 | 0.2 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.3 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.1 | 0.2 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.1 | 0.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.1 | 0.7 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.1 | 0.5 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.1 | 0.2 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.1 | 0.3 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.1 | 1.3 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.1 | 0.2 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.1 | 0.2 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.1 | 0.4 | GO:0086018 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) SA node cell to atrial cardiac muscle cell communication(GO:0086070) |
0.1 | 0.2 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.1 | 0.2 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.1 | 0.3 | GO:0033504 | floor plate development(GO:0033504) |
0.1 | 0.3 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.1 | 0.3 | GO:0015744 | succinate transport(GO:0015744) |
0.1 | 0.2 | GO:0086012 | membrane depolarization during cardiac muscle cell action potential(GO:0086012) |
0.1 | 0.3 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.1 | 0.2 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.1 | 0.3 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.1 | 0.5 | GO:0035878 | nail development(GO:0035878) |
0.1 | 0.4 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.1 | 0.7 | GO:0033574 | response to testosterone(GO:0033574) |
0.1 | 1.2 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.1 | 1.1 | GO:0045686 | negative regulation of glial cell differentiation(GO:0045686) |
0.1 | 0.4 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 0.6 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.1 | 0.2 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.1 | 0.2 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.2 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.1 | 0.3 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.1 | 0.2 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.1 | 0.2 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.1 | 0.2 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.1 | 0.6 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.1 | 0.2 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
0.1 | 0.1 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.1 | 0.9 | GO:0001709 | cell fate determination(GO:0001709) |
0.1 | 0.2 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.1 | 0.3 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.1 | 0.1 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
0.1 | 0.2 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.1 | 0.3 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.1 | 0.1 | GO:0060601 | lateral sprouting from an epithelium(GO:0060601) |
0.1 | 0.3 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.6 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.1 | 0.1 | GO:0060459 | left lung development(GO:0060459) |
0.1 | 0.2 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.1 | 0.2 | GO:0031296 | B cell costimulation(GO:0031296) |
0.1 | 1.3 | GO:0035136 | forelimb morphogenesis(GO:0035136) |
0.1 | 0.4 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.1 | 0.2 | GO:0003352 | regulation of cilium movement(GO:0003352) |
0.1 | 0.1 | GO:0035112 | genitalia morphogenesis(GO:0035112) |
0.1 | 0.5 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.1 | 0.1 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.1 | 0.4 | GO:0090179 | planar cell polarity pathway involved in neural tube closure(GO:0090179) |
0.1 | 0.4 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 0.3 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 0.1 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.1 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.1 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.1 | 0.1 | GO:0070384 | Harderian gland development(GO:0070384) |
0.1 | 0.1 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
0.1 | 0.2 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.1 | 0.3 | GO:0051138 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.1 | 0.1 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
0.1 | 0.5 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
0.1 | 0.3 | GO:0045760 | positive regulation of action potential(GO:0045760) |
0.1 | 0.3 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.1 | 0.3 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
0.1 | 0.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.1 | 0.6 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.1 | 0.6 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.1 | 0.4 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.1 | 0.4 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.1 | 0.2 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.1 | 0.2 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
0.1 | 0.1 | GO:0034633 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.1 | 0.1 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.1 | 0.1 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.1 | 0.3 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.1 | 0.1 | GO:2000848 | positive regulation of cortisol secretion(GO:0051464) positive regulation of corticosteroid hormone secretion(GO:2000848) positive regulation of glucocorticoid secretion(GO:2000851) |
0.1 | 0.2 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.1 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 1.3 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
0.1 | 0.1 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.1 | 0.4 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.1 | 0.1 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
0.1 | 0.4 | GO:0015671 | oxygen transport(GO:0015671) |
0.1 | 0.3 | GO:0046618 | drug export(GO:0046618) |
0.1 | 0.2 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.1 | GO:0051944 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.1 | 0.1 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.1 | 0.2 | GO:0044821 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.1 | 0.5 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.1 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.1 | 0.6 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.1 | 0.2 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.1 | 0.2 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.1 | 0.1 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.1 | 0.1 | GO:0072176 | nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
0.1 | 0.2 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.1 | 0.1 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
0.1 | 0.1 | GO:0003176 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
0.1 | 0.7 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.4 | GO:0060312 | regulation of blood vessel remodeling(GO:0060312) |
0.1 | 0.5 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.1 | 0.2 | GO:0051142 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.1 | 0.5 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
0.1 | 0.2 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.1 | 0.3 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
0.1 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.1 | 0.2 | GO:0015911 | plasma membrane long-chain fatty acid transport(GO:0015911) fatty acid transmembrane transport(GO:1902001) |
0.1 | 0.4 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.1 | 0.1 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.1 | 0.2 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.1 | 0.2 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.1 | 0.1 | GO:0061525 | hindgut development(GO:0061525) |
0.1 | 0.6 | GO:0045350 | interferon-beta biosynthetic process(GO:0045350) regulation of interferon-beta biosynthetic process(GO:0045357) |
0.1 | 0.1 | GO:0048664 | neuron fate determination(GO:0048664) |
0.1 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.1 | GO:0060424 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
0.1 | 0.2 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.1 | 0.3 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.1 | 0.3 | GO:0060914 | heart formation(GO:0060914) |
0.1 | 0.9 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.1 | 0.3 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.1 | 0.2 | GO:1903899 | positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
0.1 | 0.3 | GO:0015884 | folic acid transport(GO:0015884) |
0.1 | 0.2 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.1 | 0.2 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) |
0.1 | 1.0 | GO:0035640 | exploration behavior(GO:0035640) |
0.1 | 3.3 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.1 | 0.2 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.3 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.1 | 0.1 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.1 | 0.5 | GO:0061162 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
0.1 | 0.1 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.1 | 0.1 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.1 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.1 | 0.3 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.1 | 0.2 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.1 | 0.3 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
0.1 | 0.2 | GO:0021854 | hypothalamus development(GO:0021854) |
0.1 | 1.0 | GO:1903861 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.1 | 0.1 | GO:0071321 | cellular response to cGMP(GO:0071321) |
0.1 | 0.2 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
0.1 | 0.2 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.1 | GO:0097154 | GABAergic neuron differentiation(GO:0097154) |
0.1 | 0.3 | GO:0060179 | male mating behavior(GO:0060179) |
0.1 | 0.2 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.1 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
0.1 | 0.2 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.1 | 0.1 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.1 | 0.2 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.1 | 0.3 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.1 | 0.2 | GO:0060965 | negative regulation of gene silencing by miRNA(GO:0060965) |
0.1 | 0.2 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.1 | 0.3 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.1 | 0.1 | GO:0034650 | cortisol metabolic process(GO:0034650) |
0.1 | 0.1 | GO:0060527 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
0.1 | 0.1 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.1 | 0.1 | GO:2000543 | deltoid tuberosity development(GO:0035993) positive regulation of gastrulation(GO:2000543) |
0.1 | 0.3 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.1 | 0.4 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.1 | 0.1 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.1 | 0.2 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.3 | GO:0006477 | protein sulfation(GO:0006477) |
0.0 | 0.1 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.0 | 0.4 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.0 | 0.1 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.0 | 0.2 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.0 | 0.1 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.0 | 0.2 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.0 | 0.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.0 | 0.6 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.2 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.0 | 0.2 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.1 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
0.0 | 0.4 | GO:0007614 | short-term memory(GO:0007614) |
0.0 | 0.0 | GO:0072193 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
0.0 | 0.7 | GO:0019228 | neuronal action potential(GO:0019228) |
0.0 | 1.9 | GO:0048704 | embryonic skeletal system morphogenesis(GO:0048704) |
0.0 | 1.1 | GO:0010107 | potassium ion import(GO:0010107) |
0.0 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.0 | 0.1 | GO:0071313 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.0 | 0.1 | GO:0060947 | cardiac vascular smooth muscle cell differentiation(GO:0060947) |
0.0 | 0.0 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 0.2 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.0 | 0.2 | GO:0048537 | mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
0.0 | 0.2 | GO:0070874 | negative regulation of glycogen metabolic process(GO:0070874) |
0.0 | 0.3 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
0.0 | 0.1 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.0 | 0.2 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.4 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
0.0 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.0 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
0.0 | 0.1 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) |
0.0 | 0.1 | GO:0099622 | cardiac muscle cell membrane repolarization(GO:0099622) |
0.0 | 0.1 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.0 | 0.2 | GO:0002604 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) |
0.0 | 0.2 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.0 | 0.2 | GO:0035624 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
0.0 | 0.2 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.0 | 0.4 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
0.0 | 0.1 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.0 | 0.1 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.1 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
0.0 | 0.2 | GO:0048368 | lateral mesoderm development(GO:0048368) |
0.0 | 0.2 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.0 | 0.3 | GO:0035137 | hindlimb morphogenesis(GO:0035137) |
0.0 | 0.0 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.0 | 0.3 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.0 | 0.2 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
0.0 | 0.3 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.0 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.0 | 0.0 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
0.0 | 0.3 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.2 | GO:0061588 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
0.0 | 0.0 | GO:0060290 | transdifferentiation(GO:0060290) |
0.0 | 0.3 | GO:0023019 | signal transduction involved in regulation of gene expression(GO:0023019) |
0.0 | 0.1 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.0 | 0.4 | GO:0021884 | forebrain neuron development(GO:0021884) |
0.0 | 0.1 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.0 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.1 | GO:0006203 | dGTP catabolic process(GO:0006203) |
0.0 | 0.1 | GO:2000705 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
0.0 | 0.0 | GO:0060157 | potassium ion homeostasis(GO:0055075) urinary bladder development(GO:0060157) |
0.0 | 0.1 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.0 | 0.2 | GO:0032096 | negative regulation of response to food(GO:0032096) negative regulation of appetite(GO:0032099) |
0.0 | 0.6 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
0.0 | 0.1 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
0.0 | 0.2 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.0 | 0.5 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.0 | 0.1 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
0.0 | 0.1 | GO:0002278 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.0 | 0.0 | GO:1904468 | negative regulation of tumor necrosis factor secretion(GO:1904468) |
0.0 | 0.1 | GO:0001865 | NK T cell differentiation(GO:0001865) |
0.0 | 0.4 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.0 | 0.1 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.0 | 0.1 | GO:0015755 | fructose transport(GO:0015755) |
0.0 | 0.2 | GO:0034214 | protein hexamerization(GO:0034214) |
0.0 | 0.4 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
0.0 | 0.2 | GO:0002591 | positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
0.0 | 0.7 | GO:0060325 | face morphogenesis(GO:0060325) |
0.0 | 0.2 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
0.0 | 0.4 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.0 | 0.2 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.0 | 0.1 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.0 | 0.5 | GO:0003298 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.3 | GO:0048645 | organ formation(GO:0048645) |
0.0 | 0.2 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.0 | 0.4 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.0 | 0.1 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.0 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.0 | 0.1 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.0 | 0.1 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
0.0 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.0 | 0.5 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.1 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.0 | 0.1 | GO:0048485 | sympathetic nervous system development(GO:0048485) |
0.0 | 0.2 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.0 | 0.0 | GO:0031076 | embryonic camera-type eye development(GO:0031076) |
0.0 | 0.1 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.0 | 0.1 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
0.0 | 0.1 | GO:0060278 | regulation of ovulation(GO:0060278) |
0.0 | 0.2 | GO:0010460 | positive regulation of heart rate(GO:0010460) |
0.0 | 0.3 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.0 | 0.1 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.0 | 0.6 | GO:0055006 | cardiac cell development(GO:0055006) |
0.0 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.0 | 0.5 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.0 | 0.1 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
0.0 | 0.0 | GO:0032098 | regulation of appetite(GO:0032098) |
0.0 | 0.1 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.0 | 0.5 | GO:0010842 | retina layer formation(GO:0010842) |
0.0 | 0.1 | GO:0099612 | protein localization to axon(GO:0099612) |
0.0 | 0.3 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.0 | 0.3 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.3 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.0 | 0.1 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
0.0 | 0.1 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.0 | 0.2 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.0 | 0.0 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.0 | 0.1 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.0 | 0.1 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.0 | 0.0 | GO:2000018 | regulation of male gonad development(GO:2000018) |
0.0 | 0.1 | GO:0010880 | regulation of release of sequestered calcium ion into cytosol by sarcoplasmic reticulum(GO:0010880) |
0.0 | 0.0 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.0 | 0.1 | GO:1990035 | calcium ion import into cell(GO:1990035) |
0.0 | 0.4 | GO:0003416 | endochondral bone growth(GO:0003416) |
0.0 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.0 | 0.1 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.0 | 0.1 | GO:1901642 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.0 | 0.1 | GO:0044038 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.2 | GO:0070417 | cellular response to cold(GO:0070417) |
0.0 | 0.1 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.0 | 0.2 | GO:0072311 | renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
0.0 | 0.1 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.1 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.0 | 0.1 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.0 | 0.1 | GO:0044062 | regulation of excretion(GO:0044062) |
0.0 | 0.3 | GO:0035510 | DNA dealkylation(GO:0035510) |
0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.1 | GO:0060043 | regulation of cardiac muscle cell proliferation(GO:0060043) |
0.0 | 0.3 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.3 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.0 | 0.2 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.1 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
0.0 | 0.0 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.0 | 0.1 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.0 | 0.1 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.0 | 0.1 | GO:0046655 | folic acid metabolic process(GO:0046655) |
0.0 | 0.1 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.0 | 0.1 | GO:0042511 | positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
0.0 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.0 | 0.1 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.0 | 0.1 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.0 | 0.1 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.0 | 0.0 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
0.0 | 0.3 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.0 | GO:0043634 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
0.0 | 0.1 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
0.0 | 1.6 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 0.0 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.0 | 0.1 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
0.0 | 0.1 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.0 | 0.1 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.1 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
0.0 | 0.2 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.1 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.1 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 0.0 | GO:0046880 | regulation of follicle-stimulating hormone secretion(GO:0046880) follicle-stimulating hormone secretion(GO:0046884) |
0.0 | 0.0 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.0 | 0.1 | GO:0032252 | secretory granule localization(GO:0032252) |
0.0 | 0.1 | GO:0002484 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
0.0 | 0.1 | GO:0043584 | nose development(GO:0043584) |
0.0 | 0.6 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
0.0 | 0.0 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.0 | 0.0 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.0 | 0.3 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
0.0 | 0.2 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.3 | GO:0045197 | establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
0.0 | 0.1 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.0 | 0.1 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
0.0 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.0 | 0.0 | GO:0014900 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.0 | 0.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.0 | 0.7 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.0 | 0.1 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
0.0 | 0.1 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.0 | 0.1 | GO:0071684 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.0 | 0.4 | GO:0008542 | visual learning(GO:0008542) |
0.0 | 0.2 | GO:0042491 | auditory receptor cell differentiation(GO:0042491) |
0.0 | 0.2 | GO:1903831 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
0.0 | 0.1 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.2 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
0.0 | 0.0 | GO:0060022 | hard palate development(GO:0060022) |
0.0 | 0.1 | GO:0007603 | phototransduction, visible light(GO:0007603) |
0.0 | 0.1 | GO:0018101 | protein citrullination(GO:0018101) |
0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.0 | 0.0 | GO:0006704 | glucocorticoid biosynthetic process(GO:0006704) |
0.0 | 0.3 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
0.0 | 0.0 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.0 | 0.2 | GO:0006855 | drug transmembrane transport(GO:0006855) |
0.0 | 0.0 | GO:1901723 | negative regulation of cell proliferation involved in kidney development(GO:1901723) |
0.0 | 0.1 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.0 | 0.0 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.0 | 0.0 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.0 | 0.1 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.0 | 0.1 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
0.0 | 0.3 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.0 | 0.0 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.0 | GO:0030903 | notochord development(GO:0030903) |
0.0 | 0.0 | GO:0006700 | C21-steroid hormone biosynthetic process(GO:0006700) |
0.0 | 0.0 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.0 | 0.1 | GO:0051775 | response to redox state(GO:0051775) |
0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.0 | GO:1904238 | pericyte cell differentiation(GO:1904238) |
0.0 | 0.0 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
0.0 | 0.0 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.0 | 0.2 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.0 | 0.2 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.0 | 0.0 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.0 | 0.1 | GO:0045842 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.0 | 0.1 | GO:0007351 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
0.0 | 0.0 | GO:0042435 | indole-containing compound biosynthetic process(GO:0042435) |
0.0 | 0.1 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.0 | 0.0 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.0 | 0.0 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.0 | 0.0 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) |
0.0 | 0.7 | GO:0007498 | mesoderm development(GO:0007498) |
0.0 | 0.2 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.2 | GO:0030901 | midbrain development(GO:0030901) |
0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.0 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.0 | 0.1 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.0 | 0.1 | GO:0002325 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.0 | 0.1 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.0 | 0.1 | GO:0021544 | subpallium development(GO:0021544) |
0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.0 | 0.1 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.0 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
0.0 | 0.0 | GO:0033684 | regulation of luteinizing hormone secretion(GO:0033684) |
0.0 | 0.0 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.0 | 0.2 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.1 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.0 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.0 | 0.0 | GO:0072087 | renal vesicle development(GO:0072087) |
0.0 | 0.0 | GO:1900125 | regulation of hyaluronan biosynthetic process(GO:1900125) positive regulation of hyaluronan biosynthetic process(GO:1900127) |
0.0 | 0.1 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.0 | 0.0 | GO:0001975 | response to amphetamine(GO:0001975) |
0.0 | 0.1 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.0 | 0.0 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.0 | 0.0 | GO:0032415 | regulation of sodium:proton antiporter activity(GO:0032415) positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.0 | 0.1 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
0.0 | 0.1 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
0.0 | 0.1 | GO:0050926 | regulation of positive chemotaxis(GO:0050926) positive regulation of positive chemotaxis(GO:0050927) |
0.0 | 0.0 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.0 | 0.2 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.0 | 0.0 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.0 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.0 | 0.1 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.0 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.0 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.0 | 0.1 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.0 | 0.1 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
0.0 | 0.0 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.0 | 0.1 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.0 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.0 | 0.0 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.0 | 0.0 | GO:0060413 | atrial septum morphogenesis(GO:0060413) |
0.0 | 0.0 | GO:0072319 | vesicle uncoating(GO:0072319) |
0.0 | 0.1 | GO:0060359 | response to ammonium ion(GO:0060359) |
0.0 | 0.0 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
0.0 | 0.0 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.0 | 0.0 | GO:1902946 | protein localization to early endosome(GO:1902946) |
0.0 | 0.2 | GO:0055078 | sodium ion homeostasis(GO:0055078) |
0.0 | 0.1 | GO:2000765 | regulation of cytoplasmic translation(GO:2000765) |
0.0 | 0.0 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.0 | 0.1 | GO:0071639 | positive regulation of monocyte chemotactic protein-1 production(GO:0071639) |
0.0 | 0.1 | GO:0007028 | cytoplasm organization(GO:0007028) |
0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.0 | 0.1 | GO:0009080 | alanine catabolic process(GO:0006524) pyruvate family amino acid catabolic process(GO:0009080) |
0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.1 | GO:0048048 | embryonic eye morphogenesis(GO:0048048) |
0.0 | 0.2 | GO:1903541 | regulation of exosomal secretion(GO:1903541) positive regulation of exosomal secretion(GO:1903543) |
0.0 | 0.1 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.2 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.0 | 0.0 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.2 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.0 | GO:0019661 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.0 | 0.6 | GO:0048024 | regulation of mRNA splicing, via spliceosome(GO:0048024) |
0.0 | 0.0 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.0 | 0.0 | GO:0060430 | lung saccule development(GO:0060430) |
0.0 | 0.0 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.0 | 0.0 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.0 | 0.4 | GO:0007129 | synapsis(GO:0007129) |
0.0 | 0.1 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.0 | 0.1 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.0 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.1 | GO:0039532 | negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
0.0 | 0.0 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
0.0 | 0.1 | GO:0008272 | sulfate transport(GO:0008272) |
0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.1 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.0 | 0.1 | GO:0002093 | auditory receptor cell morphogenesis(GO:0002093) |
0.0 | 0.0 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
0.0 | 0.3 | GO:0030890 | positive regulation of B cell proliferation(GO:0030890) |
0.0 | 0.2 | GO:0002066 | columnar/cuboidal epithelial cell development(GO:0002066) |
0.0 | 0.0 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.0 | GO:0006573 | valine metabolic process(GO:0006573) |
0.0 | 0.0 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
0.0 | 0.0 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.0 | 0.2 | GO:0046677 | response to antibiotic(GO:0046677) |
0.0 | 0.0 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.0 | 0.0 | GO:0061245 | establishment or maintenance of apical/basal cell polarity(GO:0035088) establishment or maintenance of bipolar cell polarity(GO:0061245) |
0.0 | 0.1 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.0 | 0.2 | GO:0042472 | inner ear morphogenesis(GO:0042472) |
0.0 | 0.0 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.0 | 0.5 | GO:0007613 | memory(GO:0007613) |
0.0 | 0.0 | GO:0002877 | regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
0.0 | 0.0 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.0 | 0.0 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.0 | GO:0046909 | intermembrane transport(GO:0046909) |
0.0 | 0.0 | GO:0001802 | type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
0.0 | 0.0 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.0 | 0.4 | GO:0001895 | retina homeostasis(GO:0001895) |
0.0 | 0.0 | GO:0021877 | forebrain neuron fate commitment(GO:0021877) |
0.0 | 0.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.0 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
0.0 | 0.2 | GO:0019226 | transmission of nerve impulse(GO:0019226) |
0.0 | 0.1 | GO:0060421 | positive regulation of heart growth(GO:0060421) |
0.0 | 0.0 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.0 | 0.1 | GO:0050802 | circadian sleep/wake cycle, sleep(GO:0050802) |
0.0 | 0.0 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.0 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.0 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.1 | GO:0009624 | response to nematode(GO:0009624) |
0.0 | 0.1 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.0 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.0 | 0.1 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
0.0 | 0.0 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
0.0 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
0.0 | 0.0 | GO:1901020 | negative regulation of calcium ion transmembrane transporter activity(GO:1901020) |
0.0 | 0.8 | GO:0007601 | visual perception(GO:0007601) |
0.0 | 0.1 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
0.0 | 0.1 | GO:0015846 | polyamine transport(GO:0015846) |
0.0 | 0.1 | GO:0045214 | sarcomere organization(GO:0045214) |
0.0 | 0.0 | GO:0048483 | autonomic nervous system development(GO:0048483) |
0.0 | 0.0 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.0 | 0.0 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
0.0 | 0.0 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.0 | 0.0 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
0.0 | 0.0 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.0 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.0 | 0.1 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.0 | 0.1 | GO:0007588 | excretion(GO:0007588) |
0.0 | 0.1 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.0 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.0 | 0.1 | GO:0045056 | transcytosis(GO:0045056) |
0.0 | 0.0 | GO:0010523 | negative regulation of calcium ion transport into cytosol(GO:0010523) |
0.0 | 0.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 0.1 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.0 | 0.0 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
0.0 | 0.0 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
0.0 | 0.0 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.0 | 0.0 | GO:0021879 | forebrain neuron differentiation(GO:0021879) |
0.0 | 0.0 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
0.0 | 0.1 | GO:0002084 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.0 | 0.0 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
0.0 | 0.1 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 0.0 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.0 | 0.0 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.0 | 0.0 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.0 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.0 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 2.4 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.3 | 1.0 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.3 | 0.8 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.2 | 0.7 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.2 | 0.6 | GO:0044393 | microspike(GO:0044393) |
0.2 | 0.6 | GO:0035838 | growing cell tip(GO:0035838) |
0.2 | 0.2 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.2 | 0.5 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.2 | 2.1 | GO:0043194 | axon initial segment(GO:0043194) |
0.2 | 2.0 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.2 | 0.5 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.2 | 0.8 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.2 | 0.5 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.2 | 1.2 | GO:0005861 | troponin complex(GO:0005861) |
0.1 | 0.4 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 1.2 | GO:0072687 | meiotic spindle(GO:0072687) |
0.1 | 1.1 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 0.6 | GO:0005638 | lamin filament(GO:0005638) |
0.1 | 0.4 | GO:0033010 | paranodal junction(GO:0033010) |
0.1 | 0.5 | GO:1990696 | USH2 complex(GO:1990696) |
0.1 | 0.4 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.5 | GO:0043203 | axon hillock(GO:0043203) |
0.1 | 1.3 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 0.6 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.1 | 0.3 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.1 | 1.0 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 0.3 | GO:0072534 | perineuronal net(GO:0072534) |
0.1 | 0.4 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.1 | 1.3 | GO:0031527 | filopodium membrane(GO:0031527) |
0.1 | 0.5 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.1 | 0.8 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.1 | 0.6 | GO:0032584 | growth cone membrane(GO:0032584) |
0.1 | 1.4 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 1.7 | GO:0043034 | costamere(GO:0043034) |
0.1 | 0.5 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.1 | 0.3 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 0.3 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 0.2 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 0.2 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.1 | 0.5 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.1 | 0.5 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.1 | 0.6 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 0.7 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.1 | 0.6 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.1 | 0.3 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.4 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 2.4 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 0.9 | GO:0034706 | sodium channel complex(GO:0034706) |
0.1 | 0.4 | GO:0045179 | apical cortex(GO:0045179) |
0.1 | 0.2 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.1 | 0.3 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.7 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.1 | 0.2 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 0.3 | GO:0071953 | elastic fiber(GO:0071953) |
0.1 | 0.3 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 1.3 | GO:0030057 | desmosome(GO:0030057) |
0.1 | 0.3 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 0.1 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.1 | 0.2 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.4 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.1 | 1.1 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.1 | 0.9 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.1 | 0.3 | GO:0000235 | astral microtubule(GO:0000235) aster(GO:0005818) |
0.1 | 0.3 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 0.2 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.3 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
0.1 | 5.3 | GO:0043204 | perikaryon(GO:0043204) |
0.1 | 3.3 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.1 | 0.7 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.5 | GO:0036156 | inner dynein arm(GO:0036156) |
0.1 | 0.2 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.1 | 0.1 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.1 | 0.2 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.1 | 0.9 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.1 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 17.8 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.6 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.2 | GO:0070545 | PeBoW complex(GO:0070545) |
0.0 | 0.4 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.0 | GO:0034705 | potassium channel complex(GO:0034705) |
0.0 | 1.5 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 0.1 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.0 | 0.2 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 1.2 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.2 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.5 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.3 | GO:0005858 | axonemal dynein complex(GO:0005858) |
0.0 | 0.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.6 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.3 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.4 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.7 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.0 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.4 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.9 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 0.6 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 1.0 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.2 | GO:0032590 | dendrite membrane(GO:0032590) |
0.0 | 0.3 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.1 | GO:0042825 | TAP complex(GO:0042825) |
0.0 | 0.5 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.2 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.3 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.1 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.2 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 1.1 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.4 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.0 | 0.1 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 0.2 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.7 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 0.6 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.2 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.0 | 0.1 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.0 | 0.1 | GO:0032806 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) carboxy-terminal domain protein kinase complex(GO:0032806) |
0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.1 | GO:0033268 | node of Ranvier(GO:0033268) |
0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.1 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.0 | 0.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.0 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.6 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.1 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 2.6 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.0 | 0.1 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.4 | GO:0097060 | synaptic membrane(GO:0097060) |
0.0 | 0.1 | GO:0000800 | lateral element(GO:0000800) |
0.0 | 0.1 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.3 | GO:0036379 | myofilament(GO:0036379) |
0.0 | 0.2 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 0.2 | GO:0044453 | nuclear membrane part(GO:0044453) |
0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.1 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 1.6 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.1 | GO:0071439 | clathrin complex(GO:0071439) |
0.0 | 0.0 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.3 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 4.2 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.1 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.2 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.2 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.1 | GO:0060091 | kinocilium(GO:0060091) |
0.0 | 0.1 | GO:0070695 | FHF complex(GO:0070695) |
0.0 | 1.4 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.0 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.0 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.0 | 0.1 | GO:0044447 | axoneme part(GO:0044447) |
0.0 | 0.5 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.0 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.0 | 0.1 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 0.3 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.0 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.5 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.0 | GO:0071438 | invadopodium membrane(GO:0071438) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.0 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.3 | 1.5 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.3 | 0.9 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.3 | 0.9 | GO:0051373 | FATZ binding(GO:0051373) |
0.3 | 0.8 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.3 | 0.8 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.3 | 0.8 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.3 | 0.8 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.2 | 0.8 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.2 | 0.6 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.2 | 0.6 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.2 | 0.6 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.2 | 0.6 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.2 | 0.9 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.2 | 1.4 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.2 | 0.5 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.2 | 0.2 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.2 | 1.4 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.2 | 0.9 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.2 | 0.5 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.2 | 1.2 | GO:0003680 | AT DNA binding(GO:0003680) |
0.2 | 0.7 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.2 | 0.7 | GO:0031433 | telethonin binding(GO:0031433) |
0.2 | 1.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.2 | 0.3 | GO:0030172 | troponin C binding(GO:0030172) |
0.2 | 1.0 | GO:0048495 | Roundabout binding(GO:0048495) |
0.2 | 0.6 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.2 | 0.6 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.2 | 0.5 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.2 | 0.5 | GO:0070840 | dynein complex binding(GO:0070840) |
0.2 | 0.5 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.1 | 0.7 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.1 | 0.3 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.1 | 0.6 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.1 | 0.4 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 0.4 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.1 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.1 | 0.5 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.1 | 0.4 | GO:0031014 | troponin T binding(GO:0031014) |
0.1 | 0.4 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.1 | 0.5 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.1 | 0.9 | GO:0031432 | titin binding(GO:0031432) |
0.1 | 0.9 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.1 | 0.4 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.1 | 1.0 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.1 | 1.1 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.1 | 0.4 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.1 | 1.7 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.1 | 1.8 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
0.1 | 0.5 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 0.4 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.1 | 0.5 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 2.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.5 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.5 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 0.3 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.1 | 1.3 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 0.3 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.1 | 0.8 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.1 | 0.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.1 | 1.0 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.1 | 0.5 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.1 | 0.6 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 0.3 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.1 | 0.6 | GO:0034889 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.1 | 0.1 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 0.4 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.4 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 0.8 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.1 | 0.9 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.1 | 0.4 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.1 | 2.0 | GO:0005272 | sodium channel activity(GO:0005272) |
0.1 | 0.8 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.1 | 0.3 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.1 | 0.3 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.1 | 0.3 | GO:0055100 | adiponectin binding(GO:0055100) |
0.1 | 0.3 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.1 | 0.6 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.1 | 0.4 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.1 | 0.4 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 0.3 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.1 | 0.4 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.1 | 0.3 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 0.4 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
0.1 | 0.3 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.1 | 0.4 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 6.8 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
0.1 | 0.2 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.1 | 0.4 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.1 | 0.3 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.1 | 0.1 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
0.1 | 0.2 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.1 | 0.4 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.1 | 0.2 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.1 | 1.1 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.6 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.1 | 2.0 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 0.7 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.1 | 0.2 | GO:0036033 | mediator complex binding(GO:0036033) |
0.1 | 0.5 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.1 | 0.3 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.1 | 0.5 | GO:0019113 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 0.2 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.1 | 0.2 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.1 | 0.2 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.1 | 0.9 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 0.8 | GO:0051393 | alpha-actinin binding(GO:0051393) |
0.1 | 1.0 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 2.1 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.1 | 0.8 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.1 | 0.2 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.1 | 0.4 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 0.9 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.1 | 0.4 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.1 | 0.4 | GO:0038132 | neuregulin binding(GO:0038132) |
0.1 | 0.5 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.1 | 0.9 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.3 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.1 | 0.2 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.1 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.1 | 0.2 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.1 | 14.4 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.1 | 0.8 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 0.3 | GO:0043515 | kinetochore binding(GO:0043515) |
0.1 | 0.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.1 | 0.9 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.1 | 0.3 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.4 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 1.6 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.1 | 0.4 | GO:0005113 | patched binding(GO:0005113) |
0.1 | 0.2 | GO:0019808 | polyamine binding(GO:0019808) |
0.1 | 0.4 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.1 | 0.3 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.1 | 0.1 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.1 | 0.2 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
0.1 | 1.4 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
0.1 | 0.2 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.1 | 0.8 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 0.7 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.1 | 1.0 | GO:0015026 | coreceptor activity(GO:0015026) |
0.1 | 0.6 | GO:0043121 | neurotrophin binding(GO:0043121) |
0.1 | 0.2 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.1 | 0.2 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.1 | 0.2 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.1 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.4 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.1 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.1 | 2.6 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
0.1 | 0.3 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.1 | 0.7 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.1 | 1.0 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.1 | 1.1 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.3 | GO:0030249 | cyclase regulator activity(GO:0010851) guanylate cyclase regulator activity(GO:0030249) |
0.1 | 0.3 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.1 | 0.2 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.1 | 0.3 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 0.2 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.1 | 0.8 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.1 | 0.5 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.1 | 0.7 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.1 | 0.2 | GO:0030519 | snoRNP binding(GO:0030519) |
0.1 | 0.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.1 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 0.5 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.1 | 0.4 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.1 | 0.3 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.1 | 1.3 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.1 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 0.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.3 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.1 | 0.9 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.1 | 0.8 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.1 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.1 | 0.2 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.1 | 0.8 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.4 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.4 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.4 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.4 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.0 | 0.2 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.0 | 0.1 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.0 | 0.4 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 0.0 | GO:0043398 | HLH domain binding(GO:0043398) |
0.0 | 0.2 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.5 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 1.0 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.8 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.2 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.4 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
0.0 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
0.0 | 0.1 | GO:0032357 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.0 | 0.2 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.0 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.1 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.0 | 0.2 | GO:0097001 | ceramide binding(GO:0097001) |
0.0 | 0.6 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.0 | 0.1 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.8 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 1.3 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.0 | 0.2 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.2 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.5 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.0 | 0.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.0 | 0.2 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.0 | 0.6 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.0 | 0.3 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 0.2 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 0.3 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
0.0 | 0.2 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.0 | 0.4 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.0 | 0.8 | GO:0043394 | proteoglycan binding(GO:0043394) |
0.0 | 0.4 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) acidic amino acid transmembrane transporter activity(GO:0015172) |
0.0 | 0.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.0 | 0.2 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.2 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.2 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.1 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.0 | 0.2 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.0 | 0.2 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.0 | 0.5 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 18.7 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
0.0 | 0.4 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.0 | 0.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.0 | 0.4 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.2 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.1 | GO:0032551 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.0 | 0.1 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.0 | 0.2 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.0 | 0.0 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.6 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.0 | 0.2 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.0 | 0.3 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 1.0 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
0.0 | 0.1 | GO:0034895 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.1 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.0 | 0.1 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.7 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.1 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.0 | 0.1 | GO:0022829 | wide pore channel activity(GO:0022829) |
0.0 | 0.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.0 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.5 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.0 | GO:0004027 | alcohol sulfotransferase activity(GO:0004027) |
0.0 | 0.0 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 0.0 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.1 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.0 | 0.4 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.0 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.2 | GO:0034943 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.1 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
0.0 | 0.4 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.7 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
0.0 | 0.1 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.0 | 0.1 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.0 | 0.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.0 | 0.4 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.1 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.0 | 0.3 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.2 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.0 | 0.3 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.0 | 0.0 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.0 | 0.0 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.0 | 0.2 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
0.0 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.0 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.2 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.1 | GO:0046977 | TAP binding(GO:0046977) |
0.0 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 0.1 | GO:0046625 | sphingolipid binding(GO:0046625) |
0.0 | 0.0 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.4 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 0.2 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 0.1 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.0 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.0 | 0.0 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 0.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.0 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.2 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.0 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.0 | 0.1 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.0 | 0.0 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.0 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 0.1 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 0.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.2 | GO:0008146 | sulfotransferase activity(GO:0008146) |
0.0 | 0.1 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 1.1 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.1 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.0 | 0.2 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.2 | GO:0034946 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 1.0 | GO:0005179 | hormone activity(GO:0005179) |
0.0 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.0 | 0.0 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.2 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.0 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.0 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.0 | 0.0 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.0 | 0.2 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.1 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
0.0 | 0.0 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.0 | 0.0 | GO:0005148 | prolactin receptor binding(GO:0005148) |
0.0 | 0.0 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.0 | 0.0 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.3 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.0 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.1 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.0 | 0.2 | GO:0008009 | chemokine activity(GO:0008009) |
0.0 | 0.0 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.4 | GO:0042826 | histone deacetylase binding(GO:0042826) |
0.0 | 0.0 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 0.4 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.3 | 0.6 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.1 | 0.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.2 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 0.3 | PID CDC42 PATHWAY | CDC42 signaling events |
0.1 | 0.1 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.1 | 0.4 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.1 | 2.0 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 0.6 | ST STAT3 PATHWAY | STAT3 Pathway |
0.1 | 0.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.1 | 0.1 | PID SHP2 PATHWAY | SHP2 signaling |
0.1 | 1.6 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.1 | 0.8 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.1 | 0.6 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.1 | 1.7 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.7 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.0 | 0.5 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 2.0 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.8 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.6 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.0 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.6 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.0 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.7 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.3 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.2 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.6 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.7 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.7 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.5 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 1.1 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.3 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 1.1 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 1.0 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.4 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.4 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.8 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.5 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 3.1 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.2 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.3 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.1 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.0 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 3.1 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.0 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.2 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.3 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.2 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.6 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 1.6 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.1 | 1.5 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 2.7 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
0.1 | 1.8 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.1 | 3.0 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 0.2 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.1 | 0.1 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
0.1 | 1.0 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.1 | 0.5 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.1 | 0.8 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.1 | 2.4 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.1 | 1.1 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.1 | 0.8 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.1 | 0.9 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.1 | 1.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 0.1 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.1 | 0.1 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
0.1 | 0.7 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.1 | 0.2 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
0.1 | 0.9 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.1 | 2.4 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.1 | 0.6 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.1 | 0.8 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.1 | 1.7 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.1 | 0.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.1 | 1.6 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.1 | 1.4 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.1 | 0.6 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.1 | 0.5 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 1.2 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 1.1 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.1 | 0.8 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.1 | 2.7 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.1 | 1.7 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 2.8 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.1 | 1.0 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.1 | 0.1 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.0 | 0.6 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.0 | 0.0 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.0 | 0.3 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.5 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.4 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 0.0 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 0.3 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 1.1 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 1.1 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.7 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.4 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.0 | 0.2 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 1.4 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.5 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.3 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.0 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.0 | 0.1 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 5.3 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 1.5 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.4 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.0 | 0.4 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.2 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 0.7 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.0 | 0.5 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.8 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.2 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.0 | 0.2 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.1 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.4 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.2 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.0 | 0.5 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
0.0 | 0.2 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.1 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.0 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 0.3 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 0.0 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.0 | 0.1 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.0 | 0.2 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.0 | 0.3 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.0 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
0.0 | 0.4 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
0.0 | 0.1 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
0.0 | 0.1 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.5 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
0.0 | 0.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.0 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.1 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
0.0 | 0.2 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
0.0 | 0.0 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.0 | 0.0 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.0 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.0 | 0.0 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.1 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.0 | 0.0 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.0 | 0.2 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.3 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |