Gene Symbol | Gene ID | Gene Info |
---|---|---|
E2f2
|
ENSMUSG00000018983.9 | E2f2 |
E2f5
|
ENSMUSG00000027552.8 | E2f5 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
E2f2 | chr4_136171811_136172176 | 401 | 0.797781 | 0.60 | 4.1e-07 | Click! |
E2f2 | chr4_136192949_136193100 | 12241 | 0.133188 | -0.48 | 9.2e-05 | Click! |
E2f2 | chr4_136179934_136181463 | 85 | 0.959789 | 0.43 | 5.8e-04 | Click! |
E2f2 | chr4_136186534_136187164 | 6066 | 0.148865 | -0.33 | 1.1e-02 | Click! |
E2f2 | chr4_136172411_136173624 | 623 | 0.649241 | 0.29 | 2.6e-02 | Click! |
E2f5 | chr3_14578660_14579890 | 604 | 0.659291 | 0.64 | 3.1e-08 | Click! |
E2f5 | chr3_14578370_14578544 | 184 | 0.925292 | 0.53 | 1.2e-05 | Click! |
E2f5 | chr3_14582646_14582957 | 4130 | 0.162352 | 0.24 | 7.0e-02 | Click! |
E2f5 | chr3_14580778_14580929 | 2182 | 0.229770 | 0.16 | 2.2e-01 | Click! |
E2f5 | chr3_14581079_14581561 | 2649 | 0.201263 | -0.03 | 8.4e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr2_26140700_26141111 | 2.48 |
Tmem250-ps |
transmembrane protein 250, pseudogene |
384 |
0.77 |
chr1_93803525_93803742 | 2.36 |
Ing5 |
inhibitor of growth family, member 5 |
332 |
0.78 |
chr3_30509147_30509438 | 2.32 |
Mecom |
MDS1 and EVI1 complex locus |
195 |
0.92 |
chr15_58135304_58135455 | 2.19 |
Atad2 |
ATPase family, AAA domain containing 2 |
297 |
0.85 |
chr19_23136050_23136335 | 2.15 |
2410080I02Rik |
RIKEN cDNA 2410080I02 gene |
1292 |
0.4 |
chr10_7210927_7211475 | 2.11 |
Cnksr3 |
Cnksr family member 3 |
1036 |
0.67 |
chr14_58071914_58072118 | 2.09 |
Fgf9 |
fibroblast growth factor 9 |
670 |
0.69 |
chr4_117289538_117289770 | 2.08 |
Rnf220 |
ring finger protein 220 |
176 |
0.91 |
chr13_100107622_100108016 | 2.03 |
Serf1 |
small EDRK-rich factor 1 |
193 |
0.77 |
chr7_98838076_98838445 | 2.01 |
Wnt11 |
wingless-type MMTV integration site family, member 11 |
585 |
0.71 |
chr5_142928836_142929703 | 2.00 |
Actb |
actin, beta |
22515 |
0.13 |
chr16_90935031_90935308 | 2.00 |
Cfap298 |
cilia and flagella associate protien 298 |
55 |
0.69 |
chr3_30600562_30601216 | 1.99 |
Actrt3 |
actin related protein T3 |
950 |
0.34 |
chr11_102774855_102775341 | 1.99 |
Adam11 |
a disintegrin and metallopeptidase domain 11 |
981 |
0.41 |
chrX_68678260_68678430 | 1.96 |
Fmr1 |
fragile X mental retardation 1 |
196 |
0.94 |
chr15_79883545_79883906 | 1.96 |
AC113595.1 |
novel transcript, antisense to Apobec3 |
5807 |
0.11 |
chr3_98013133_98013449 | 1.96 |
Notch2 |
notch 2 |
236 |
0.93 |
chr13_12105059_12105454 | 1.95 |
Ryr2 |
ryanodine receptor 2, cardiac |
1203 |
0.48 |
chr17_47593153_47593304 | 1.91 |
Ccnd3 |
cyclin D3 |
208 |
0.89 |
chr9_83440344_83440772 | 1.88 |
Lca5 |
Leber congenital amaurosis 5 (human) |
469 |
0.74 |
chr10_75772648_75773350 | 1.87 |
Ddt |
D-dopachrome tautomerase |
35 |
0.95 |
chr7_44996617_44997237 | 1.86 |
Bcl2l12 |
BCL2-like 12 (proline rich) |
326 |
0.58 |
chr6_88519047_88519558 | 1.85 |
Gm44430 |
predicted gene, 44430 |
289 |
0.58 |
chr11_120950276_120950971 | 1.83 |
Slc16a3 |
solute carrier family 16 (monocarboxylic acid transporters), member 3 |
65 |
0.95 |
chr16_74410085_74410783 | 1.83 |
Robo2 |
roundabout guidance receptor 2 |
478 |
0.87 |
chr3_151002106_151002257 | 1.82 |
Mir3963 |
microRNA 3963 |
21681 |
0.23 |
chr9_79716645_79717059 | 1.77 |
Col12a1 |
collagen, type XII, alpha 1 |
1642 |
0.36 |
chrX_75084232_75084791 | 1.75 |
Gab3 |
growth factor receptor bound protein 2-associated protein 3 |
246 |
0.87 |
chr19_47864998_47865617 | 1.74 |
Gsto2 |
glutathione S-transferase omega 2 |
227 |
0.9 |
chr19_24280683_24280929 | 1.74 |
Fxn |
frataxin |
201 |
0.94 |
chr1_189342678_189343152 | 1.72 |
Kcnk2 |
potassium channel, subfamily K, member 2 |
440 |
0.52 |
chr10_128747600_128747751 | 1.71 |
Pym1 |
PYM homolog 1, exon junction complex associated factor |
214 |
0.84 |
chr7_79392369_79392901 | 1.70 |
Fanci |
Fanconi anemia, complementation group I |
282 |
0.86 |
chr13_38659108_38659308 | 1.69 |
Eef1e1 |
eukaryotic translation elongation factor 1 epsilon 1 |
150 |
0.94 |
chr10_121034007_121034503 | 1.69 |
Wif1 |
Wnt inhibitory factor 1 |
231 |
0.92 |
chr18_67205057_67205236 | 1.69 |
Chmp1b |
charged multivesicular body protein 1B |
220 |
0.83 |
chr13_23519085_23519469 | 1.69 |
n-TStga1 |
nuclear encoded tRNA serine 1 (anticodon TGA) |
1135 |
0.19 |
chr12_113141740_113143605 | 1.68 |
Crip2 |
cysteine rich protein 2 |
136 |
0.92 |
chr3_116326940_116327520 | 1.66 |
Gm29151 |
predicted gene 29151 |
22873 |
0.17 |
chr11_101466246_101466397 | 1.64 |
Vat1 |
vesicle amine transport 1 |
91 |
0.88 |
chr4_147936037_147936691 | 1.62 |
Plod1 |
procollagen-lysine, 2-oxoglutarate 5-dioxygenase 1 |
344 |
0.78 |
chr8_60505731_60506662 | 1.61 |
Aadat |
aminoadipate aminotransferase |
81 |
0.97 |
chr6_53266962_53267177 | 1.60 |
Creb5 |
cAMP responsive element binding protein 5 |
20201 |
0.22 |
chrX_164076295_164076484 | 1.60 |
Siah1b |
siah E3 ubiquitin protein ligase 1B |
104 |
0.96 |
chr13_55329260_55329709 | 1.60 |
Mxd3 |
Max dimerization protein 3 |
132 |
0.92 |
chr2_118900700_118901202 | 1.57 |
Bahd1 |
bromo adjacent homology domain containing 1 |
502 |
0.73 |
chr8_48511120_48511677 | 1.56 |
Tenm3 |
teneurin transmembrane protein 3 |
43915 |
0.19 |
chr5_136116322_136116534 | 1.56 |
Polr2j |
polymerase (RNA) II (DNA directed) polypeptide J |
203 |
0.85 |
chr9_72492053_72492513 | 1.55 |
Tex9 |
testis expressed gene 9 |
71 |
0.94 |
chr14_54253480_54253850 | 1.53 |
Dad1 |
defender against cell death 1 |
249 |
0.67 |
chr1_131153244_131154030 | 1.53 |
Eif2d |
eukaryotic translation initiation factor 2D |
456 |
0.76 |
chr17_56764801_56765194 | 1.52 |
Dus3l |
dihydrouridine synthase 3-like (S. cerevisiae) |
213 |
0.88 |
chr11_74832519_74833213 | 1.51 |
Mnt |
max binding protein |
1946 |
0.23 |
chr16_91728834_91729148 | 1.50 |
Cryzl1 |
crystallin, zeta (quinone reductase)-like 1 |
16 |
0.8 |
chr6_77244137_77244322 | 1.50 |
Lrrtm1 |
leucine rich repeat transmembrane neuronal 1 |
1307 |
0.55 |
chr2_127247118_127247702 | 1.50 |
Ciao1 |
cytosolic iron-sulfur protein assembly 1 |
210 |
0.73 |
chr5_120503046_120503583 | 1.50 |
Plbd2 |
phospholipase B domain containing 2 |
287 |
0.83 |
chr18_23803452_23803822 | 1.49 |
Mapre2 |
microtubule-associated protein, RP/EB family, member 2 |
347 |
0.86 |
chr8_105636561_105636775 | 1.48 |
Ctcf |
CCCTC-binding factor |
89 |
0.83 |
chr9_123478066_123478514 | 1.47 |
Limd1 |
LIM domains containing 1 |
416 |
0.84 |
chr16_87432662_87432829 | 1.46 |
Ltn1 |
listerin E3 ubiquitin protein ligase 1 |
133 |
0.94 |
chr18_20001039_20002512 | 1.45 |
Dsc3 |
desmocollin 3 |
180 |
0.96 |
chr9_57520819_57521116 | 1.45 |
Cox5a |
cytochrome c oxidase subunit 5A |
307 |
0.79 |
chr11_78924584_78925402 | 1.44 |
Nos2 |
nitric oxide synthase 2, inducible |
183 |
0.95 |
chr6_91806804_91807812 | 1.44 |
Grip2 |
glutamate receptor interacting protein 2 |
10 |
0.98 |
chr3_9629663_9630437 | 1.44 |
Zfp704 |
zinc finger protein 704 |
19965 |
0.19 |
chr17_24151779_24152298 | 1.43 |
Pdpk1 |
3-phosphoinositide dependent protein kinase 1 |
1114 |
0.28 |
chr11_106083701_106084129 | 1.43 |
Map3k3 |
mitogen-activated protein kinase kinase kinase 3 |
698 |
0.52 |
chrX_62776517_62776856 | 1.43 |
Sms-ps |
spermine synthase, pseudogene |
1 |
0.99 |
chr3_53526232_53526383 | 1.42 |
Frem2 |
Fras1 related extracellular matrix protein 2 |
3287 |
0.18 |
chr2_15048543_15049248 | 1.42 |
Nsun6 |
NOL1/NOP2/Sun domain family member 6 |
384 |
0.54 |
chr7_142581782_142582165 | 1.42 |
H19 |
H19, imprinted maternally expressed transcript |
3830 |
0.12 |
chr1_13590062_13590244 | 1.41 |
Tram1 |
translocating chain-associating membrane protein 1 |
243 |
0.93 |
chr11_5901312_5902503 | 1.41 |
Gck |
glucokinase |
180 |
0.9 |
chr10_82083013_82083242 | 1.41 |
BC024063 |
cDNA sequence BC024063 |
226 |
0.89 |
chr12_85110487_85110777 | 1.40 |
Prox2 |
prospero homeobox 2 |
127 |
0.59 |
chr12_86947459_86948330 | 1.39 |
Cipc |
CLOCK interacting protein, circadian |
404 |
0.83 |
chr9_88859064_88859485 | 1.38 |
Gm26611 |
predicted gene, 26611 |
263 |
0.57 |
chr5_24602961_24603112 | 1.38 |
Smarcd3 |
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily d, member 3 |
1024 |
0.35 |
chr13_54575524_54575812 | 1.38 |
Arl10 |
ADP-ribosylation factor-like 10 |
621 |
0.53 |
chr4_132843278_132843489 | 1.37 |
Ppp1r8 |
protein phosphatase 1, regulatory subunit 8 |
214 |
0.89 |
chr3_97033464_97033889 | 1.37 |
Gja5 |
gap junction protein, alpha 5 |
1260 |
0.43 |
chrX_84076569_84077653 | 1.36 |
Dmd |
dystrophin, muscular dystrophy |
462 |
0.87 |
chr5_65536384_65536535 | 1.36 |
Smim14 |
small integral membrane protein 14 |
670 |
0.29 |
chr9_39603818_39604406 | 1.35 |
AW551984 |
expressed sequence AW551984 |
12 |
0.95 |
chr9_115310732_115311169 | 1.35 |
Stt3b |
STT3, subunit of the oligosaccharyltransferase complex, homolog B (S. cerevisiae) |
529 |
0.76 |
chr14_47568571_47568817 | 1.34 |
Atg14 |
autophagy related 14 |
260 |
0.8 |
chr1_134079290_134079527 | 1.32 |
Btg2 |
BTG anti-proliferation factor 2 |
288 |
0.86 |
chr6_72597676_72598385 | 1.30 |
Elmod3 |
ELMO/CED-12 domain containing 3 |
312 |
0.55 |
chr7_127405900_127406778 | 1.30 |
Zfp764 |
zinc finger protein 764 |
444 |
0.58 |
chr1_44042201_44042840 | 1.29 |
Gm8251 |
predicted gene 8251 |
19416 |
0.11 |
chr18_46198937_46199447 | 1.29 |
1700018A14Rik |
RIKEN cDNA 1700018A14 gene |
171 |
0.73 |
chr2_134643074_134643700 | 1.29 |
Tmx4 |
thioredoxin-related transmembrane protein 4 |
654 |
0.79 |
chr2_31142064_31142344 | 1.29 |
Fnbp1 |
formin binding protein 1 |
196 |
0.92 |
chr15_59649773_59650083 | 1.29 |
Trib1 |
tribbles pseudokinase 1 |
1275 |
0.48 |
chr6_134863030_134863674 | 1.28 |
Crebl2 |
cAMP responsive element binding protein-like 2 |
12194 |
0.11 |
chr11_21999153_21999972 | 1.28 |
Otx1 |
orthodenticle homeobox 1 |
2053 |
0.4 |
chr5_114130853_114131102 | 1.28 |
Ung |
uracil DNA glycosylase |
51 |
0.95 |
chr3_10012108_10012520 | 1.27 |
Fabp5 |
fatty acid binding protein 5, epidermal |
234 |
0.92 |
chr5_110363290_110364062 | 1.27 |
Lrcol1 |
leucine rich colipase-like 1 |
9518 |
0.1 |
chr1_152401153_152401486 | 1.26 |
Colgalt2 |
collagen beta(1-O)galactosyltransferase 2 |
1489 |
0.39 |
chr8_18950058_18950375 | 1.26 |
Xkr5 |
X-linked Kx blood group related 5 |
655 |
0.59 |
chr7_141326651_141327566 | 1.26 |
Deaf1 |
DEAF1, transcription factor |
385 |
0.54 |
chr5_100428947_100429488 | 1.26 |
5430416N02Rik |
RIKEN cDNA 5430416N02 gene |
158 |
0.81 |
chr11_60139924_60140201 | 1.25 |
Rai1 |
retinoic acid induced 1 |
20 |
0.97 |
chr12_8921625_8921892 | 1.25 |
Laptm4a |
lysosomal-associated protein transmembrane 4A |
94 |
0.96 |
chr8_123065084_123065344 | 1.24 |
Spg7 |
SPG7, paraplegin matrix AAA peptidase subunit |
35 |
0.95 |
chr8_13200696_13201435 | 1.24 |
2810030D12Rik |
RIKEN cDNA 2810030D12 gene |
245 |
0.65 |
chr7_128239007_128239164 | 1.23 |
9130023H24Rik |
RIKEN cDNA 9130023H24 gene |
1054 |
0.26 |
chr3_32511176_32511485 | 1.22 |
Zfp639 |
zinc finger protein 639 |
434 |
0.67 |
chr4_126321818_126322048 | 1.21 |
Adprhl2 |
ADP-ribosylhydrolase like 2 |
230 |
0.86 |
chr7_125491576_125491885 | 1.21 |
Nsmce1 |
NSE1 homolog, SMC5-SMC6 complex component |
134 |
0.96 |
chr16_92301321_92301934 | 1.21 |
Smim11 |
small integral membrane protein 11 |
331 |
0.81 |
chr4_102254418_102255744 | 1.21 |
Pde4b |
phosphodiesterase 4B, cAMP specific |
78 |
0.99 |
chr9_88599683_88600077 | 1.21 |
9430037G07Rik |
RIKEN cDNA 9430037G07 gene |
364 |
0.72 |
chr10_110919570_110919797 | 1.21 |
Csrp2 |
cysteine and glycine-rich protein 2 |
106 |
0.96 |
chr9_57260900_57261051 | 1.20 |
1700017B05Rik |
RIKEN cDNA 1700017B05 gene |
534 |
0.74 |
chr9_102626331_102626539 | 1.20 |
Cep63 |
centrosomal protein 63 |
74 |
0.54 |
chr4_97771688_97772205 | 1.20 |
Nfia |
nuclear factor I/A |
788 |
0.65 |
chr13_98031507_98031951 | 1.19 |
Arhgef28 |
Rho guanine nucleotide exchange factor (GEF) 28 |
950 |
0.68 |
chr8_99414293_99414856 | 1.19 |
Cdh8 |
cadherin 8 |
1745 |
0.36 |
chr10_7726644_7726869 | 1.19 |
Katna1 |
katanin p60 (ATPase-containing) subunit A1 |
748 |
0.55 |
chr13_97197771_97198301 | 1.19 |
Hexb |
hexosaminidase B |
259 |
0.89 |
chr5_100719749_100720214 | 1.18 |
Hpse |
heparanase |
265 |
0.89 |
chr13_107247429_107247791 | 1.18 |
Gm2726 |
predicted gene 2726 |
32581 |
0.2 |
chr9_71168680_71168945 | 1.18 |
Gm32511 |
predicted gene, 32511 |
36 |
0.62 |
chr8_105289279_105289519 | 1.18 |
4931428F04Rik |
RIKEN cDNA 4931428F04 gene |
105 |
0.68 |
chr19_37376820_37377147 | 1.17 |
Kif11 |
kinesin family member 11 |
580 |
0.67 |
chr2_129947768_129948304 | 1.17 |
Gm28196 |
predicted gene 28196 |
532 |
0.8 |
chr9_56041562_56041758 | 1.17 |
Rcn2 |
reticulocalbin 2 |
185 |
0.93 |
chr7_71324824_71324975 | 1.16 |
Gm45066 |
predicted gene 45066 |
6594 |
0.18 |
chr2_170400566_170401621 | 1.16 |
Bcas1os1 |
breast carcinoma amplified sequence 1, opposite strand 1 |
4088 |
0.2 |
chr4_23982768_23983757 | 1.16 |
Gm28448 |
predicted gene 28448 |
49308 |
0.19 |
chr6_131387291_131387817 | 1.16 |
Ybx3 |
Y box protein 3 |
884 |
0.51 |
chr13_55634675_55634912 | 1.16 |
Ddx46 |
DEAD (Asp-Glu-Ala-Asp) box polypeptide 46 |
234 |
0.87 |
chr7_80343442_80344016 | 1.15 |
Hddc3 |
HD domain containing 3 |
37 |
0.95 |
chr11_75678848_75679065 | 1.15 |
Crk |
v-crk avian sarcoma virus CT10 oncogene homolog |
303 |
0.85 |
chr2_73312730_73312990 | 1.14 |
Cir1 |
corepressor interacting with RBPJ, 1 |
159 |
0.52 |
chr7_3111762_3111983 | 1.14 |
Gm7353 |
predicted pseudogene 7353 |
91 |
0.92 |
chr9_85842413_85842586 | 1.13 |
Tpbg |
trophoblast glycoprotein |
119 |
0.91 |
chr9_89066462_89066702 | 1.13 |
Gm24463 |
predicted gene, 24463 |
8754 |
0.14 |
chr3_34639390_34639872 | 1.13 |
Sox2ot |
SOX2 overlapping transcript (non-protein coding) |
1127 |
0.27 |
chr16_44139510_44139688 | 1.13 |
Atp6v1a |
ATPase, H+ transporting, lysosomal V1 subunit A |
31 |
0.75 |
chr10_128922873_128923122 | 1.13 |
Bloc1s1 |
biogenesis of lysosomal organelles complex-1, subunit 1 |
29 |
0.58 |
chr1_152090676_152091159 | 1.13 |
1700025G04Rik |
RIKEN cDNA 1700025G04 gene |
792 |
0.72 |
chr18_37643677_37644133 | 1.13 |
Taf7 |
TATA-box binding protein associated factor 7 |
299 |
0.69 |
chr1_44147418_44147793 | 1.13 |
Ercc5 |
excision repair cross-complementing rodent repair deficiency, complementation group 5 |
139 |
0.94 |
chr10_128232091_128232277 | 1.13 |
Timeless |
timeless circadian clock 1 |
50 |
0.93 |
chr7_98838449_98839900 | 1.12 |
Wnt11 |
wingless-type MMTV integration site family, member 11 |
276 |
0.9 |
chr7_44747810_44748395 | 1.12 |
Zfp473 |
zinc finger protein 473 |
53 |
0.79 |
chr11_88203795_88204247 | 1.12 |
Mrps23 |
mitochondrial ribosomal protein S23 |
367 |
0.85 |
chr8_77517309_77517971 | 1.12 |
Arhgap10 |
Rho GTPase activating protein 10 |
143 |
0.82 |
chr3_94412462_94413013 | 1.11 |
1700040D17Rik |
RIKEN cDNA 1700040D17 gene |
182 |
0.67 |
chr6_100286080_100286312 | 1.11 |
Rybp |
RING1 and YY1 binding protein |
552 |
0.75 |
chr15_73060315_73061023 | 1.11 |
Trappc9 |
trafficking protein particle complex 9 |
376 |
0.88 |
chr9_121705099_121705609 | 1.10 |
Sec22c |
SEC22 homolog C, vesicle trafficking protein |
111 |
0.93 |
chr1_75124701_75124934 | 1.10 |
Nhej1 |
non-homologous end joining factor 1 |
383 |
0.73 |
chr10_71347309_71347708 | 1.09 |
Ipmk |
inositol polyphosphate multikinase |
255 |
0.88 |
chrX_135838754_135839971 | 1.09 |
Gprasp2 |
G protein-coupled receptor associated sorting protein 2 |
256 |
0.9 |
chr5_33782910_33783143 | 1.08 |
Letm1 |
leucine zipper-EF-hand containing transmembrane protein 1 |
209 |
0.9 |
chrX_51205728_51206168 | 1.08 |
Mbnl3 |
muscleblind like splicing factor 3 |
42 |
0.97 |
chr1_43827990_43828559 | 1.08 |
Uxs1 |
UDP-glucuronate decarboxylase 1 |
474 |
0.77 |
chr11_102606785_102607497 | 1.08 |
Fzd2 |
frizzled class receptor 2 |
2745 |
0.14 |
chr4_57299752_57300063 | 1.07 |
Gm12536 |
predicted gene 12536 |
189 |
0.77 |
chr5_77803755_77804404 | 1.07 |
Gm42673 |
predicted gene 42673 |
105381 |
0.07 |
chr7_43672407_43672972 | 1.07 |
Ctu1 |
cytosolic thiouridylase subunit 1 |
673 |
0.42 |
chr7_39544434_39545338 | 1.07 |
Gm44573 |
predicted gene 44573 |
20 |
0.89 |
chr3_152092314_152093141 | 1.07 |
Gipc2 |
GIPC PDZ domain containing family, member 2 |
10127 |
0.14 |
chr11_87817152_87817646 | 1.07 |
Lpo |
lactoperoxidase |
106 |
0.93 |
chr9_120021605_120021794 | 1.06 |
Xirp1 |
xin actin-binding repeat containing 1 |
1884 |
0.19 |
chr9_51009335_51009739 | 1.06 |
Sik2 |
salt inducible kinase 2 |
464 |
0.81 |
chr18_60623340_60623999 | 1.06 |
Synpo |
synaptopodin |
344 |
0.87 |
chrX_95025550_95026671 | 1.06 |
Spin4 |
spindlin family, member 4 |
572 |
0.77 |
chr1_39535368_39535654 | 1.06 |
Cnot11 |
CCR4-NOT transcription complex, subunit 11 |
291 |
0.84 |
chr2_126706874_126707201 | 1.05 |
Usp8 |
ubiquitin specific peptidase 8 |
291 |
0.86 |
chr6_24514808_24515401 | 1.05 |
Iqub |
IQ motif and ubiquitin domain containing |
37 |
0.97 |
chr10_79554194_79554804 | 1.05 |
Mier2 |
MIER family member 2 |
106 |
0.94 |
chr5_141890098_141890249 | 1.05 |
Sdk1 |
sidekick cell adhesion molecule 1 |
33386 |
0.24 |
chr2_80128704_80129752 | 1.04 |
Pde1a |
phosphodiesterase 1A, calmodulin-dependent |
230 |
0.94 |
chr16_76373206_76373751 | 1.04 |
Nrip1 |
nuclear receptor interacting protein 1 |
348 |
0.88 |
chr6_56704794_56705009 | 1.04 |
Lsm5 |
LSM5 homolog, U6 small nuclear RNA and mRNA degradation associated |
191 |
0.94 |
chr3_96196548_96197204 | 1.03 |
Bola1 |
bolA-like 1 (E. coli) |
710 |
0.31 |
chr2_30794362_30794693 | 1.03 |
1700001O22Rik |
RIKEN cDNA 1700001O22 gene |
2137 |
0.21 |
chr15_74671697_74672942 | 1.03 |
Arc |
activity regulated cytoskeletal-associated protein |
249 |
0.86 |
chr7_110121320_110121770 | 1.03 |
Wee1 |
WEE 1 homolog 1 (S. pombe) |
501 |
0.66 |
chr4_152185357_152186985 | 1.02 |
Acot7 |
acyl-CoA thioesterase 7 |
35 |
0.96 |
chr14_70888689_70889187 | 1.02 |
Gfra2 |
glial cell line derived neurotrophic factor family receptor alpha 2 |
1182 |
0.54 |
chr5_24452443_24452818 | 1.02 |
Agap3 |
ArfGAP with GTPase domain, ankyrin repeat and PH domain 3 |
296 |
0.69 |
chr8_120589402_120589953 | 1.01 |
Gm10614 |
predicted gene 10614 |
146 |
0.73 |
chr9_110116769_110117363 | 1.01 |
Dhx30 |
DEAH (Asp-Glu-Ala-His) box polypeptide 30 |
21 |
0.92 |
chr18_68794144_68795165 | 1.01 |
Gm50260 |
predicted gene, 50260 |
10704 |
0.25 |
chr7_116307269_116307483 | 1.01 |
Plekha7 |
pleckstrin homology domain containing, family A member 7 |
674 |
0.6 |
chr16_30120665_30121235 | 1.01 |
Gm6029 |
predicted gene 6029 |
18509 |
0.13 |
chr8_123224892_123225508 | 1.00 |
Cdk10 |
cyclin-dependent kinase 10 |
313 |
0.72 |
chr6_30508912_30509672 | 1.00 |
Tmem209 |
transmembrane protein 209 |
412 |
0.54 |
chr3_51559982_51560654 | 0.99 |
5031434O11Rik |
RIKEN cDNA 5031434O11 gene |
283 |
0.58 |
chr5_136135598_136136007 | 0.99 |
Lrwd1 |
leucine-rich repeats and WD repeat domain containing 1 |
195 |
0.64 |
chr16_5884597_5886147 | 0.99 |
Rbfox1 |
RNA binding protein, fox-1 homolog (C. elegans) 1 |
17 |
0.99 |
chr6_38550502_38551204 | 0.99 |
Luc7l2 |
LUC7-like 2 (S. cerevisiae) |
481 |
0.75 |
chr2_152753862_152754826 | 0.98 |
Cox4i2 |
cytochrome c oxidase subunit 4I2 |
171 |
0.91 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.2 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.7 | 2.9 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.7 | 2.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.6 | 1.7 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.6 | 1.7 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.5 | 1.5 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
0.5 | 1.9 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.5 | 1.4 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.4 | 1.3 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.4 | 1.7 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.4 | 2.1 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.4 | 2.1 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.4 | 1.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.4 | 1.6 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.4 | 1.5 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
0.4 | 1.1 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.4 | 1.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.4 | 1.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.4 | 1.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.4 | 2.5 | GO:0042436 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.3 | 2.1 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.3 | 1.0 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.3 | 1.4 | GO:0030035 | microspike assembly(GO:0030035) |
0.3 | 0.7 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.3 | 1.0 | GO:0051182 | coenzyme transport(GO:0051182) |
0.3 | 1.3 | GO:0048478 | replication fork protection(GO:0048478) |
0.3 | 1.0 | GO:0046078 | dUMP metabolic process(GO:0046078) |
0.3 | 0.6 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.3 | 1.0 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.3 | 0.3 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.3 | 1.2 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.3 | 0.9 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.3 | 1.2 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.3 | 0.9 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.3 | 1.2 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.3 | 2.1 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.3 | 0.3 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
0.3 | 2.3 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.3 | 0.8 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.3 | 0.8 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.3 | 0.8 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.3 | 1.1 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.3 | 2.2 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.3 | 0.5 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
0.3 | 0.5 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.3 | 1.3 | GO:0007619 | courtship behavior(GO:0007619) |
0.3 | 1.1 | GO:0019230 | proprioception(GO:0019230) |
0.3 | 3.4 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
0.3 | 1.0 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.3 | 1.3 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.3 | 0.5 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.3 | 0.5 | GO:0010635 | regulation of mitochondrial fusion(GO:0010635) |
0.3 | 0.8 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.3 | 1.3 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.2 | 0.5 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.2 | 0.2 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.2 | 1.0 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.2 | 1.7 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.2 | 0.7 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.2 | 1.5 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.2 | 1.2 | GO:0072757 | cellular response to camptothecin(GO:0072757) |
0.2 | 0.5 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.2 | 1.2 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.2 | 0.2 | GO:0009176 | pyrimidine deoxyribonucleoside monophosphate metabolic process(GO:0009176) |
0.2 | 0.7 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.2 | 0.7 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.2 | 0.7 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.2 | 0.2 | GO:0010182 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.2 | 0.5 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
0.2 | 0.7 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.2 | 0.7 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.2 | 1.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.2 | 0.7 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.2 | 2.0 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.2 | 0.7 | GO:0060737 | prostate epithelial cord elongation(GO:0060523) prostate gland morphogenetic growth(GO:0060737) |
0.2 | 0.7 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.2 | 0.2 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.2 | 0.7 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.2 | 0.4 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.2 | 0.7 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.2 | 0.2 | GO:0051665 | membrane raft localization(GO:0051665) |
0.2 | 0.2 | GO:0046959 | habituation(GO:0046959) |
0.2 | 0.9 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.2 | 2.8 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.2 | 1.3 | GO:0042148 | strand invasion(GO:0042148) |
0.2 | 0.6 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.2 | 2.1 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
0.2 | 0.6 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.2 | 0.8 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.2 | 1.9 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.2 | 0.6 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.2 | 1.3 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.2 | 0.6 | GO:2000850 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.2 | 0.4 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.2 | 2.1 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
0.2 | 0.6 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.2 | 1.0 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.2 | 0.2 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.2 | 0.8 | GO:2000969 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.2 | 0.4 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.2 | 2.4 | GO:0032717 | negative regulation of interleukin-8 production(GO:0032717) |
0.2 | 1.4 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
0.2 | 1.0 | GO:0080009 | mRNA methylation(GO:0080009) |
0.2 | 0.8 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.2 | 2.0 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.2 | 1.2 | GO:0048102 | autophagic cell death(GO:0048102) |
0.2 | 1.0 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.2 | 1.0 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.2 | 0.6 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.2 | 1.3 | GO:0097264 | self proteolysis(GO:0097264) |
0.2 | 1.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.2 | 0.9 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.2 | 0.7 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.2 | 0.4 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.2 | 0.4 | GO:0071351 | cellular response to interleukin-18(GO:0071351) |
0.2 | 1.5 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.2 | 1.3 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.2 | 1.1 | GO:0051013 | microtubule severing(GO:0051013) |
0.2 | 0.5 | GO:0034476 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
0.2 | 0.2 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
0.2 | 0.2 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.2 | 0.5 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.2 | 0.9 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.2 | 0.5 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.2 | 0.9 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.2 | 0.5 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
0.2 | 0.7 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
0.2 | 0.3 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.2 | 0.7 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.2 | 0.9 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.2 | 0.3 | GO:1900238 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.2 | 2.0 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
0.2 | 2.5 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.2 | 0.2 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
0.2 | 0.7 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.2 | 0.8 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.2 | 0.3 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.2 | 1.2 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.2 | 0.2 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.2 | 0.5 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.2 | 0.5 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.2 | 0.3 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.2 | 0.5 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.2 | 0.5 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.2 | 0.7 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.2 | 0.7 | GO:0046909 | intermembrane transport(GO:0046909) |
0.2 | 0.3 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.2 | 0.2 | GO:2000643 | positive regulation of vacuolar transport(GO:1903337) positive regulation of early endosome to late endosome transport(GO:2000643) |
0.2 | 0.6 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
0.2 | 0.5 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.2 | 0.3 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.2 | 0.3 | GO:0014056 | acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) |
0.2 | 0.6 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.2 | 0.6 | GO:0007418 | ventral midline development(GO:0007418) |
0.2 | 0.3 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.2 | 0.6 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
0.2 | 0.3 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.2 | 0.6 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
0.2 | 2.7 | GO:0010972 | negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
0.2 | 0.3 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.2 | 0.5 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.2 | 0.5 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.2 | 1.7 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
0.2 | 0.6 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.2 | 0.5 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.2 | 0.9 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.1 | 0.4 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.1 | 0.4 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 0.4 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.1 | 0.6 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.1 | 0.4 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.1 | 0.7 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.1 | 0.7 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
0.1 | 1.2 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.1 | 1.2 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 0.3 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.1 | 1.0 | GO:0051135 | positive regulation of NK T cell activation(GO:0051135) |
0.1 | 0.6 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.1 | 0.6 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.1 | 0.3 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.1 | 0.4 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.1 | 0.6 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
0.1 | 2.0 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.1 | 0.4 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.1 | 0.7 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.1 | 0.6 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.1 | 0.1 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
0.1 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.8 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.1 | 1.1 | GO:0014824 | artery smooth muscle contraction(GO:0014824) |
0.1 | 0.1 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
0.1 | 1.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.1 | 0.4 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.1 | 0.7 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.1 | 0.3 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.1 | 0.1 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
0.1 | 0.5 | GO:0044849 | estrous cycle(GO:0044849) |
0.1 | 0.1 | GO:1902219 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.1 | 0.3 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.1 | 1.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.1 | 0.8 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.1 | 0.4 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.1 | 0.7 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.1 | 0.4 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.1 | 1.2 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.1 | 0.8 | GO:2000794 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
0.1 | 0.4 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.1 | 0.5 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.1 | 0.4 | GO:0040031 | snRNA modification(GO:0040031) |
0.1 | 0.4 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.1 | 0.9 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.1 | 0.1 | GO:1903598 | positive regulation of gap junction assembly(GO:1903598) |
0.1 | 0.4 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.4 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.1 | 0.5 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.1 | 0.5 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.1 | 1.5 | GO:0035879 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.1 | 0.4 | GO:0000478 | endonucleolytic cleavage involved in rRNA processing(GO:0000478) |
0.1 | 0.4 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.5 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.1 | 0.6 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.1 | 0.5 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.1 | 0.6 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.1 | 1.6 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.1 | 0.2 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.1 | 0.2 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
0.1 | 1.2 | GO:2001212 | regulation of vasculogenesis(GO:2001212) |
0.1 | 1.1 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
0.1 | 0.1 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.1 | 0.2 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.1 | 0.2 | GO:0072197 | ureter morphogenesis(GO:0072197) |
0.1 | 0.2 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
0.1 | 0.4 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.1 | 0.5 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.1 | 0.4 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.1 | 0.2 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.1 | 0.1 | GO:0046321 | positive regulation of fatty acid oxidation(GO:0046321) |
0.1 | 0.5 | GO:0002278 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.1 | 0.8 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
0.1 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.1 | 0.4 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.1 | 1.4 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.1 | 0.5 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.1 | 0.6 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.1 | 0.5 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.1 | 1.6 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.1 | 1.4 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 1.3 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
0.1 | 0.2 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.1 | 0.2 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.1 | 0.5 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.1 | 0.7 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.1 | 0.5 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.1 | 1.7 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.1 | 0.5 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.1 | 0.5 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.1 | 0.2 | GO:0003284 | septum primum development(GO:0003284) |
0.1 | 0.6 | GO:0006266 | DNA ligation(GO:0006266) |
0.1 | 0.5 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.1 | 0.5 | GO:0060613 | fat pad development(GO:0060613) |
0.1 | 0.5 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.1 | 1.2 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.1 | 1.0 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
0.1 | 0.9 | GO:0006273 | lagging strand elongation(GO:0006273) |
0.1 | 0.3 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.1 | 0.8 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.1 | 0.4 | GO:0030578 | PML body organization(GO:0030578) |
0.1 | 0.8 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.1 | 0.3 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.3 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 0.9 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) |
0.1 | 0.8 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.1 | 0.4 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.1 | 0.3 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.1 | 0.2 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.1 | 1.0 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
0.1 | 0.7 | GO:0070474 | positive regulation of uterine smooth muscle contraction(GO:0070474) |
0.1 | 0.3 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.2 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
0.1 | 3.2 | GO:0015988 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.1 | 0.4 | GO:0042546 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.1 | 0.1 | GO:0071047 | nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
0.1 | 1.0 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.1 | 0.2 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.1 | 0.2 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.1 | 0.3 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.1 | 0.2 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.1 | 0.2 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.1 | 0.9 | GO:0071379 | cellular response to prostaglandin stimulus(GO:0071379) |
0.1 | 0.1 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.1 | 0.3 | GO:0030242 | pexophagy(GO:0030242) |
0.1 | 0.5 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.1 | 0.2 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.1 | 0.6 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.1 | 0.2 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 1.3 | GO:0043687 | post-translational protein modification(GO:0043687) |
0.1 | 0.3 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.8 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.1 | 0.3 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
0.1 | 2.0 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 3.1 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.1 | 0.5 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.1 | 0.2 | GO:0045964 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.1 | 1.1 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.1 | 0.7 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.1 | 0.6 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.1 | 0.3 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 0.1 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) nucleobase catabolic process(GO:0046113) |
0.1 | 0.5 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
0.1 | 0.7 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.1 | 0.1 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.1 | 0.4 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.1 | 0.7 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.1 | 0.3 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.1 | 0.3 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.1 | 0.4 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.1 | 0.2 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.1 | 0.4 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.1 | 0.2 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.1 | 0.3 | GO:0086043 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.1 | 0.6 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.1 | 0.3 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.1 | 0.1 | GO:1903963 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
0.1 | 0.2 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.1 | 0.3 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.1 | 0.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 0.2 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.1 | 0.7 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.1 | 0.3 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 0.5 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 0.7 | GO:0007000 | nucleolus organization(GO:0007000) |
0.1 | 0.2 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.1 | 0.3 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.1 | 1.5 | GO:0018126 | protein hydroxylation(GO:0018126) |
0.1 | 0.6 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.1 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 1.1 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.1 | 0.3 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.1 | 0.3 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.1 | 0.3 | GO:0035813 | renal sodium excretion(GO:0035812) regulation of renal sodium excretion(GO:0035813) |
0.1 | 0.2 | GO:1902947 | regulation of tau-protein kinase activity(GO:1902947) |
0.1 | 0.3 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.7 | GO:0048311 | mitochondrion distribution(GO:0048311) |
0.1 | 0.1 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.1 | 0.5 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
0.1 | 2.3 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
0.1 | 0.3 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.1 | 1.2 | GO:0060074 | synapse maturation(GO:0060074) |
0.1 | 0.5 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.1 | 0.7 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 1.3 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.1 | 0.4 | GO:0033025 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
0.1 | 0.7 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.1 | 0.1 | GO:0035425 | autocrine signaling(GO:0035425) |
0.1 | 0.2 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.1 | 0.1 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.1 | 0.3 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.1 | 0.7 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.1 | 0.3 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.1 | 0.4 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.1 | 0.1 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.1 | 0.4 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 0.1 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
0.1 | 1.7 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
0.1 | 0.1 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.1 | 0.4 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
0.1 | 0.2 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.1 | 0.5 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.1 | 0.6 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.1 | 3.6 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.1 | 0.7 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.1 | 0.5 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.1 | 0.2 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.1 | 0.1 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.1 | 0.8 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.1 | 0.3 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.1 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.1 | 0.5 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.1 | 0.4 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.4 | GO:0051189 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.1 | 1.5 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.1 | 0.5 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.1 | 0.2 | GO:0003192 | mitral valve formation(GO:0003192) |
0.1 | 2.2 | GO:0098930 | axonal transport(GO:0098930) |
0.1 | 0.2 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.1 | 0.4 | GO:0019532 | oxalate transport(GO:0019532) |
0.1 | 0.3 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.1 | 0.3 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.1 | 0.3 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.1 | 0.2 | GO:2000121 | regulation of removal of superoxide radicals(GO:2000121) |
0.1 | 1.8 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
0.1 | 0.1 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.1 | 0.3 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.1 | 0.2 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.1 | 0.3 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.1 | 0.3 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
0.1 | 0.5 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
0.1 | 0.4 | GO:0061081 | positive regulation of macrophage cytokine production(GO:0060907) positive regulation of myeloid leukocyte cytokine production involved in immune response(GO:0061081) |
0.1 | 0.2 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.1 | 0.4 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.1 | 0.3 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.1 | 0.1 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
0.1 | 0.3 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.1 | 1.6 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
0.1 | 0.7 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.1 | 0.2 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.1 | 0.4 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.1 | 0.9 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.1 | 1.0 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.1 | 0.3 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.1 | 0.2 | GO:0043366 | beta selection(GO:0043366) |
0.1 | 0.3 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
0.1 | 0.1 | GO:0072711 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
0.1 | 0.8 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.1 | 0.3 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.1 | 2.7 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.1 | 0.3 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.1 | 0.3 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.1 | 0.3 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.1 | 0.3 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 0.2 | GO:0060437 | lung growth(GO:0060437) |
0.1 | 0.9 | GO:0042407 | cristae formation(GO:0042407) |
0.1 | 0.6 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.1 | 0.9 | GO:0051601 | exocyst localization(GO:0051601) |
0.1 | 0.4 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
0.1 | 0.4 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.2 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.1 | 0.5 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.1 | 0.2 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.1 | 0.1 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.1 | 0.9 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.1 | 0.2 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
0.1 | 0.2 | GO:0032202 | telomere assembly(GO:0032202) |
0.1 | 0.6 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
0.1 | 0.2 | GO:0045713 | low-density lipoprotein particle receptor biosynthetic process(GO:0045713) regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.1 | 0.1 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.1 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.4 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.1 | 0.2 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.1 | 0.6 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
0.1 | 2.4 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
0.1 | 0.2 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.2 | GO:1904181 | positive regulation of mitochondrial depolarization(GO:0051901) positive regulation of membrane depolarization(GO:1904181) |
0.1 | 0.2 | GO:0043416 | regulation of skeletal muscle tissue regeneration(GO:0043416) |
0.1 | 0.3 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.1 | 0.2 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 1.0 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.1 | 1.0 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.1 | 0.4 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.1 | 0.8 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.1 | 1.0 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
0.1 | 0.2 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.1 | 1.6 | GO:0007032 | endosome organization(GO:0007032) |
0.1 | 0.2 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.1 | 0.6 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.1 | 0.2 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
0.1 | 0.3 | GO:2000105 | positive regulation of DNA-dependent DNA replication(GO:2000105) |
0.1 | 0.2 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.1 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.5 | GO:1903817 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
0.1 | 0.2 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.1 | 0.4 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 1.5 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.1 | 0.2 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.1 | 0.1 | GO:0033121 | regulation of purine nucleotide catabolic process(GO:0033121) regulation of fermentation(GO:0043465) regulation of NAD metabolic process(GO:1902688) regulation of glucose catabolic process to lactate via pyruvate(GO:1904023) |
0.1 | 0.2 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.1 | 0.2 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.1 | 1.2 | GO:0000154 | rRNA modification(GO:0000154) |
0.1 | 0.1 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.1 | 0.2 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.1 | 1.2 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.1 | 0.2 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.1 | 0.4 | GO:0046836 | glycolipid transport(GO:0046836) |
0.1 | 1.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.1 | 0.4 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.1 | 1.0 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.1 | 0.4 | GO:0006145 | purine nucleobase catabolic process(GO:0006145) |
0.1 | 0.5 | GO:0006221 | pyrimidine nucleotide biosynthetic process(GO:0006221) |
0.1 | 0.3 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.1 | 0.4 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.1 | 0.5 | GO:0097369 | sodium ion import(GO:0097369) |
0.1 | 0.3 | GO:0072015 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
0.1 | 0.2 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.1 | 0.2 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.1 | 0.4 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
0.1 | 2.1 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.1 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.1 | 0.2 | GO:0021756 | striatum development(GO:0021756) |
0.1 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.1 | 0.4 | GO:0015808 | L-alanine transport(GO:0015808) |
0.1 | 0.4 | GO:0009249 | protein lipoylation(GO:0009249) |
0.1 | 0.4 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.1 | 0.4 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.1 | 0.2 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.1 | 0.7 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
0.1 | 0.1 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.1 | 0.4 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
0.1 | 0.2 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.1 | 0.1 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.1 | 0.4 | GO:1902308 | regulation of peptidyl-serine dephosphorylation(GO:1902308) |
0.1 | 0.1 | GO:0010958 | regulation of amino acid import(GO:0010958) regulation of L-arginine import(GO:0010963) |
0.1 | 0.2 | GO:0000087 | mitotic M phase(GO:0000087) |
0.1 | 0.6 | GO:0070266 | necroptotic process(GO:0070266) |
0.1 | 0.3 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
0.1 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.1 | 0.5 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.1 | 0.2 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.1 | 0.5 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.1 | 0.2 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
0.1 | 0.1 | GO:0045715 | negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
0.1 | 0.3 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.1 | 0.3 | GO:0060013 | righting reflex(GO:0060013) |
0.1 | 0.1 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.1 | 0.2 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.1 | 0.3 | GO:0046039 | GTP metabolic process(GO:0046039) |
0.1 | 0.9 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
0.1 | 1.0 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.1 | 0.3 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.1 | 0.1 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.1 | 0.6 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.1 | 0.2 | GO:1901341 | positive regulation of store-operated calcium channel activity(GO:1901341) |
0.1 | 0.1 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.1 | 0.3 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.1 | 0.2 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.1 | 0.2 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.1 | 0.1 | GO:0033260 | nuclear DNA replication(GO:0033260) |
0.1 | 0.3 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.1 | 0.2 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.1 | 0.5 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.9 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.1 | 0.1 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.1 | 0.2 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.1 | 0.1 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
0.1 | 0.2 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.1 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.3 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.1 | 0.1 | GO:0003011 | diaphragm contraction(GO:0002086) involuntary skeletal muscle contraction(GO:0003011) |
0.1 | 0.2 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.1 | 0.3 | GO:0014050 | negative regulation of glutamate secretion(GO:0014050) |
0.1 | 1.0 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
0.1 | 0.2 | GO:0060296 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
0.1 | 1.5 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.1 | 0.2 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.1 | 0.3 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) |
0.1 | 0.5 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.1 | 0.4 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
0.1 | 0.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.1 | 0.1 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.1 | 0.1 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
0.1 | 0.1 | GO:0086069 | bundle of His cell to Purkinje myocyte communication(GO:0086069) |
0.1 | 0.6 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.1 | 0.2 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.1 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.1 | 0.4 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.1 | 0.1 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.1 | 0.2 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.1 | 0.3 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.1 | 0.2 | GO:0097048 | dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
0.1 | 0.2 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.1 | 1.1 | GO:0032232 | negative regulation of actin filament bundle assembly(GO:0032232) |
0.1 | 0.1 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.1 | 0.6 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.1 | 0.1 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
0.1 | 0.1 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.1 | 0.8 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
0.1 | 0.7 | GO:0030431 | sleep(GO:0030431) |
0.1 | 0.2 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.1 | 0.4 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.1 | 0.2 | GO:0072396 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) |
0.1 | 0.1 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) |
0.1 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.1 | 0.8 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.1 | 0.2 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.1 | 0.3 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.2 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.1 | 0.2 | GO:0019062 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
0.1 | 0.2 | GO:0072567 | chemokine (C-X-C motif) ligand 2 production(GO:0072567) regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000341) |
0.1 | 0.4 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.1 | 0.2 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
0.1 | 0.2 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.1 | 0.2 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.1 | 0.7 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.1 | 1.2 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.1 | 0.2 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.1 | 0.1 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.1 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.1 | 0.1 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.1 | 0.1 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
0.1 | 0.2 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.1 | 0.6 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.1 | 0.3 | GO:1902600 | hydrogen ion transmembrane transport(GO:1902600) |
0.1 | 0.2 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.1 | 0.5 | GO:0060292 | long term synaptic depression(GO:0060292) |
0.1 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 1.8 | GO:2001022 | positive regulation of response to DNA damage stimulus(GO:2001022) |
0.1 | 1.1 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.1 | 0.2 | GO:1901070 | GMP biosynthetic process(GO:0006177) guanosine-containing compound biosynthetic process(GO:1901070) |
0.1 | 0.2 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.1 | 0.1 | GO:0038109 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.1 | 0.5 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
0.1 | 0.1 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.1 | 0.1 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.1 | 0.7 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.2 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.1 | 0.2 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
0.1 | 0.2 | GO:0007035 | vacuolar acidification(GO:0007035) |
0.1 | 0.1 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.1 | 0.1 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.1 | 0.3 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.1 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.2 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.1 | 0.3 | GO:0007614 | short-term memory(GO:0007614) |
0.1 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.1 | 0.2 | GO:0006085 | acetyl-CoA biosynthetic process(GO:0006085) |
0.1 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.1 | 0.2 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.1 | 0.2 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.1 | 0.2 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.1 | 0.1 | GO:0032898 | neurotrophin production(GO:0032898) |
0.1 | 0.1 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.1 | 0.1 | GO:0045837 | negative regulation of membrane potential(GO:0045837) |
0.1 | 0.3 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) |
0.1 | 0.1 | GO:0061356 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.1 | 0.1 | GO:1901201 | regulation of extracellular matrix assembly(GO:1901201) |
0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.1 | 0.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.1 | 0.4 | GO:0015791 | polyol transport(GO:0015791) |
0.1 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.1 | 0.1 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
0.1 | 0.5 | GO:0015858 | nucleoside transport(GO:0015858) |
0.1 | 0.2 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.1 | 0.2 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.1 | 0.7 | GO:0030488 | tRNA methylation(GO:0030488) |
0.1 | 0.6 | GO:0006828 | manganese ion transport(GO:0006828) |
0.1 | 0.2 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.1 | 0.2 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.1 | 0.4 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
0.1 | 0.4 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.1 | 0.4 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.3 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.1 | 0.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.1 | 0.2 | GO:0071025 | RNA surveillance(GO:0071025) |
0.1 | 0.7 | GO:0006582 | melanin metabolic process(GO:0006582) |
0.1 | 0.2 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.1 | 0.2 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.1 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.1 | 0.3 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
0.1 | 0.3 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.1 | 0.1 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) regulation of gastro-intestinal system smooth muscle contraction(GO:1904304) |
0.1 | 0.1 | GO:1903431 | positive regulation of cell maturation(GO:1903431) |
0.1 | 0.1 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
0.1 | 0.1 | GO:0001757 | somite specification(GO:0001757) |
0.1 | 0.8 | GO:0010107 | potassium ion import(GO:0010107) |
0.1 | 0.1 | GO:0001302 | replicative cell aging(GO:0001302) |
0.1 | 0.2 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 0.8 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
0.1 | 0.2 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.1 | 0.1 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
0.1 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.1 | 0.1 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
0.1 | 0.4 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.1 | 0.3 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
0.1 | 0.1 | GO:2001197 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
0.1 | 0.6 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
0.0 | 0.3 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.0 | GO:0061511 | centriole elongation(GO:0061511) |
0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.0 | 0.1 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.0 | 1.2 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.0 | 0.1 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 0.7 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.0 | 0.1 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.3 | GO:1901660 | calcium ion export(GO:1901660) |
0.0 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 0.1 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.0 | 0.2 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.0 | 0.2 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.0 | 0.5 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
0.0 | 0.3 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.0 | 0.3 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.0 | 0.0 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
0.0 | 0.3 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.0 | 0.2 | GO:1900746 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902547) |
0.0 | 0.1 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.0 | 0.4 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.0 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
0.0 | 0.5 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
0.0 | 0.0 | GO:1904177 | regulation of adipose tissue development(GO:1904177) |
0.0 | 0.4 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.2 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.0 | GO:1903802 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.0 | 0.0 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
0.0 | 0.1 | GO:0038001 | paracrine signaling(GO:0038001) |
0.0 | 0.0 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.1 | GO:0006562 | proline catabolic process(GO:0006562) |
0.0 | 0.1 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
0.0 | 0.1 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.0 | 0.2 | GO:0061588 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
0.0 | 0.1 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.0 | 0.1 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.0 | 0.4 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.1 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.0 | 0.2 | GO:0071569 | protein ufmylation(GO:0071569) protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.0 | 0.1 | GO:0033572 | transferrin transport(GO:0033572) |
0.0 | 0.1 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.0 | 0.3 | GO:0009081 | branched-chain amino acid metabolic process(GO:0009081) branched-chain amino acid catabolic process(GO:0009083) |
0.0 | 0.2 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.5 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.0 | 0.4 | GO:0000338 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.0 | 0.1 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.0 | 0.3 | GO:0060632 | regulation of microtubule-based movement(GO:0060632) |
0.0 | 0.1 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.0 | 0.0 | GO:2001169 | regulation of ATP biosynthetic process(GO:2001169) |
0.0 | 0.3 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.2 | GO:0072610 | interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) |
0.0 | 0.3 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.0 | 0.2 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
0.0 | 0.1 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.0 | 0.2 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 3.7 | GO:0006399 | tRNA metabolic process(GO:0006399) |
0.0 | 0.0 | GO:0052200 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.0 | 0.0 | GO:0070199 | establishment of protein localization to chromosome(GO:0070199) |
0.0 | 0.1 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.0 | 0.6 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.1 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.0 | 0.3 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.4 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.1 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.0 | 0.0 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.0 | 0.1 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.0 | 0.2 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.2 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.1 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.0 | GO:0070391 | response to lipoteichoic acid(GO:0070391) cellular response to lipoteichoic acid(GO:0071223) |
0.0 | 0.1 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.0 | 0.6 | GO:0050775 | positive regulation of dendrite morphogenesis(GO:0050775) |
0.0 | 0.9 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 0.1 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
0.0 | 0.1 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.0 | 0.0 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
0.0 | 0.4 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
0.0 | 0.2 | GO:0006983 | ER overload response(GO:0006983) |
0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.0 | 0.3 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
0.0 | 0.1 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.0 | 0.2 | GO:0042026 | protein refolding(GO:0042026) |
0.0 | 1.0 | GO:0022900 | electron transport chain(GO:0022900) |
0.0 | 0.1 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.0 | 0.7 | GO:0030261 | chromosome condensation(GO:0030261) |
0.0 | 1.2 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.2 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.8 | GO:1903146 | regulation of mitophagy(GO:1903146) |
0.0 | 0.0 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.0 | 0.2 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.0 | 0.0 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.0 | 0.1 | GO:0019884 | antigen processing and presentation of exogenous antigen(GO:0019884) |
0.0 | 0.1 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.0 | 0.2 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.4 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.0 | 0.1 | GO:0061317 | canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:0061317) |
0.0 | 0.3 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.0 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
0.0 | 0.1 | GO:0019068 | virion assembly(GO:0019068) |
0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.0 | 0.1 | GO:0010225 | response to UV-C(GO:0010225) |
0.0 | 0.3 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.0 | 0.2 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.1 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.0 | 0.2 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
0.0 | 0.3 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.0 | 0.6 | GO:0032456 | endocytic recycling(GO:0032456) |
0.0 | 0.2 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
0.0 | 3.5 | GO:0042254 | ribosome biogenesis(GO:0042254) |
0.0 | 0.1 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.2 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
0.0 | 0.3 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.0 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.0 | 0.1 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
0.0 | 0.3 | GO:0060033 | anatomical structure regression(GO:0060033) |
0.0 | 0.2 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.0 | 0.0 | GO:1902176 | negative regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902176) |
0.0 | 0.1 | GO:0072126 | positive regulation of glomerular mesangial cell proliferation(GO:0072126) |
0.0 | 0.1 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.1 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.0 | 0.1 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
0.0 | 0.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.0 | 0.7 | GO:1901998 | toxin transport(GO:1901998) |
0.0 | 0.1 | GO:0055098 | response to low-density lipoprotein particle(GO:0055098) |
0.0 | 0.1 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.0 | 0.3 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.2 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.0 | 0.2 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.0 | 0.3 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
0.0 | 0.0 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.0 | 0.1 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.1 | GO:0032252 | secretory granule localization(GO:0032252) |
0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.0 | 0.1 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.1 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.0 | 0.1 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.0 | 0.2 | GO:0071364 | cellular response to epidermal growth factor stimulus(GO:0071364) |
0.0 | 1.0 | GO:0015914 | phospholipid transport(GO:0015914) |
0.0 | 0.3 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.1 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.1 | GO:0008228 | opsonization(GO:0008228) |
0.0 | 0.1 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.0 | 0.1 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.0 | 0.0 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.0 | 0.0 | GO:0072553 | terminal button organization(GO:0072553) |
0.0 | 0.2 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
0.0 | 0.3 | GO:0007603 | phototransduction, visible light(GO:0007603) |
0.0 | 0.0 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
0.0 | 0.2 | GO:0030033 | microvillus assembly(GO:0030033) |
0.0 | 0.0 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.2 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.0 | 0.1 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.0 | 0.0 | GO:0090399 | replicative senescence(GO:0090399) |
0.0 | 0.1 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.0 | 0.6 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
0.0 | 0.0 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
0.0 | 0.0 | GO:0010042 | response to manganese ion(GO:0010042) |
0.0 | 0.2 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.0 | 0.4 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.2 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
0.0 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.0 | 0.1 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.1 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.1 | GO:0002584 | negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
0.0 | 0.0 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.0 | 0.2 | GO:2000778 | positive regulation of interleukin-6 secretion(GO:2000778) |
0.0 | 0.1 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.0 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.0 | 0.1 | GO:0000237 | leptotene(GO:0000237) |
0.0 | 0.2 | GO:0051646 | mitochondrion localization(GO:0051646) |
0.0 | 0.3 | GO:0032781 | positive regulation of ATPase activity(GO:0032781) |
0.0 | 0.0 | GO:0071971 | extracellular exosome assembly(GO:0071971) regulation of extracellular exosome assembly(GO:1903551) |
0.0 | 0.4 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.2 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 0.0 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
0.0 | 0.3 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.1 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.0 | 0.1 | GO:0018119 | peptidyl-cysteine S-nitrosylation(GO:0018119) |
0.0 | 0.0 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.0 | 0.2 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.2 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
0.0 | 0.1 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.1 | GO:0035437 | maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
0.0 | 0.3 | GO:0009251 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
0.0 | 0.3 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.0 | 0.2 | GO:0006071 | glycerol metabolic process(GO:0006071) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.2 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.0 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.0 | 0.1 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.0 | 0.2 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
0.0 | 0.1 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
0.0 | 0.9 | GO:0001578 | microtubule bundle formation(GO:0001578) |
0.0 | 0.0 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.0 | 0.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.0 | 0.2 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.0 | 0.3 | GO:0009395 | phospholipid catabolic process(GO:0009395) |
0.0 | 0.3 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.0 | 0.5 | GO:0061512 | protein localization to cilium(GO:0061512) |
0.0 | 0.1 | GO:0016074 | snoRNA metabolic process(GO:0016074) |
0.0 | 0.1 | GO:0034435 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
0.0 | 0.1 | GO:0006265 | DNA topological change(GO:0006265) |
0.0 | 0.2 | GO:0001675 | acrosome assembly(GO:0001675) |
0.0 | 0.2 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.2 | GO:0014002 | astrocyte development(GO:0014002) |
0.0 | 0.3 | GO:0006541 | glutamine metabolic process(GO:0006541) |
0.0 | 0.0 | GO:0032570 | response to progesterone(GO:0032570) |
0.0 | 0.1 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
0.0 | 0.1 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.0 | 0.1 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.0 | 0.1 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.0 | 0.2 | GO:0009303 | rRNA transcription(GO:0009303) |
0.0 | 0.2 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
0.0 | 0.0 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.0 | 0.1 | GO:0006101 | citrate metabolic process(GO:0006101) |
0.0 | 0.1 | GO:0031281 | positive regulation of cyclase activity(GO:0031281) |
0.0 | 0.1 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.3 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.0 | 0.1 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.0 | 0.3 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.0 | 0.2 | GO:0048753 | melanosome organization(GO:0032438) pigment granule organization(GO:0048753) |
0.0 | 0.1 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.0 | 0.1 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.0 | 0.1 | GO:0030202 | heparin metabolic process(GO:0030202) |
0.0 | 0.2 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.0 | 0.2 | GO:0007099 | centriole replication(GO:0007099) centriole assembly(GO:0098534) |
0.0 | 0.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.2 | GO:0006825 | copper ion transport(GO:0006825) |
0.0 | 0.3 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
0.0 | 0.0 | GO:0055093 | response to increased oxygen levels(GO:0036296) response to hyperoxia(GO:0055093) |
0.0 | 0.1 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.0 | 0.3 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.4 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.0 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
0.0 | 0.1 | GO:0051944 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.0 | 0.2 | GO:0003351 | epithelial cilium movement(GO:0003351) |
0.0 | 0.0 | GO:0003032 | detection of oxygen(GO:0003032) |
0.0 | 0.2 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.2 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 0.0 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.0 | 0.3 | GO:0015992 | proton transport(GO:0015992) |
0.0 | 0.1 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
0.0 | 0.2 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
0.0 | 0.3 | GO:0007602 | phototransduction(GO:0007602) |
0.0 | 0.1 | GO:0034397 | telomere localization(GO:0034397) |
0.0 | 0.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.0 | 0.0 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.0 | 0.0 | GO:0010544 | negative regulation of platelet activation(GO:0010544) |
0.0 | 0.0 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.0 | 0.2 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
0.0 | 0.0 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.0 | 0.0 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.0 | 0.2 | GO:0008038 | neuron recognition(GO:0008038) |
0.0 | 0.0 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.0 | 0.0 | GO:2001267 | regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001267) |
0.0 | 0.1 | GO:0009650 | UV protection(GO:0009650) |
0.0 | 0.2 | GO:0071800 | podosome assembly(GO:0071800) |
0.0 | 0.1 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.0 | 0.1 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.0 | 0.0 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.0 | 0.0 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
0.0 | 0.2 | GO:0099500 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.1 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.0 | 0.2 | GO:1901264 | carbohydrate derivative transport(GO:1901264) |
0.0 | 0.5 | GO:0016575 | histone deacetylation(GO:0016575) |
0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.0 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
0.0 | 0.2 | GO:0031294 | lymphocyte costimulation(GO:0031294) |
0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.2 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.0 | 0.1 | GO:0070417 | cellular response to cold(GO:0070417) |
0.0 | 0.5 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
0.0 | 0.2 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
0.0 | 0.1 | GO:0032660 | regulation of interleukin-17 production(GO:0032660) |
0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.0 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.0 | 0.1 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.0 | 0.0 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
0.0 | 0.0 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
0.0 | 0.1 | GO:0032816 | positive regulation of natural killer cell activation(GO:0032816) |
0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.0 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.0 | 0.6 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.1 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.0 | 0.1 | GO:0033194 | response to hydroperoxide(GO:0033194) |
0.0 | 0.2 | GO:0051930 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
0.0 | 0.4 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
0.0 | 0.0 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.2 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.0 | 0.1 | GO:0002759 | regulation of antimicrobial humoral response(GO:0002759) |
0.0 | 0.3 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
0.0 | 0.4 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.0 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
0.0 | 0.2 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.1 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.3 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
0.0 | 0.0 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.0 | GO:2001271 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.0 | 0.1 | GO:0033344 | cholesterol efflux(GO:0033344) |
0.0 | 0.0 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 0.0 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.0 | 0.0 | GO:0098762 | M phase(GO:0000279) meiotic prophase I(GO:0007128) prophase(GO:0051324) meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
0.0 | 0.0 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.0 | 0.0 | GO:0097104 | postsynaptic membrane assembly(GO:0097104) |
0.0 | 0.0 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.0 | 0.3 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.0 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
0.0 | 0.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.1 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.0 | 0.4 | GO:1902115 | regulation of organelle assembly(GO:1902115) |
0.0 | 0.0 | GO:0097113 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.0 | 0.1 | GO:0008088 | axo-dendritic transport(GO:0008088) |
0.0 | 0.0 | GO:2000674 | regulation of type B pancreatic cell apoptotic process(GO:2000674) |
0.0 | 1.1 | GO:0098792 | xenophagy(GO:0098792) |
0.0 | 0.1 | GO:0009060 | aerobic respiration(GO:0009060) |
0.0 | 0.0 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.0 | 0.1 | GO:0046686 | response to cadmium ion(GO:0046686) |
0.0 | 0.0 | GO:0031442 | positive regulation of mRNA 3'-end processing(GO:0031442) |
0.0 | 1.1 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 0.0 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.0 | 0.0 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
0.0 | 0.0 | GO:0001553 | luteinization(GO:0001553) |
0.0 | 0.0 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.0 | 0.6 | GO:0002323 | natural killer cell activation involved in immune response(GO:0002323) |
0.0 | 0.1 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
0.0 | 0.1 | GO:1902222 | L-phenylalanine catabolic process(GO:0006559) tyrosine catabolic process(GO:0006572) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.0 | GO:0015755 | fructose transport(GO:0015755) |
0.0 | 0.0 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.0 | 0.1 | GO:0006903 | vesicle targeting(GO:0006903) |
0.0 | 0.0 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.0 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.1 | GO:0006220 | pyrimidine nucleotide metabolic process(GO:0006220) |
0.0 | 0.1 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 1.4 | GO:0060271 | cilium morphogenesis(GO:0060271) |
0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.0 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.0 | 0.3 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.0 | 0.0 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.0 | GO:0060685 | regulation of prostatic bud formation(GO:0060685) |
0.0 | 0.1 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.0 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.0 | 0.1 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.1 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.0 | 0.0 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.0 | 0.0 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.0 | 0.0 | GO:2000987 | regulation of fear response(GO:1903365) positive regulation of fear response(GO:1903367) regulation of behavioral fear response(GO:2000822) positive regulation of behavioral fear response(GO:2000987) |
0.0 | 0.2 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
0.0 | 0.0 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.0 | 0.0 | GO:0071865 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
0.0 | 0.1 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.0 | 0.0 | GO:0046459 | short-chain fatty acid metabolic process(GO:0046459) |
0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.0 | GO:0003096 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
0.0 | 0.0 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.0 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
0.0 | 0.0 | GO:0032462 | regulation of protein homooligomerization(GO:0032462) |
0.0 | 0.0 | GO:0015810 | aspartate transport(GO:0015810) |
0.0 | 0.2 | GO:0051668 | localization within membrane(GO:0051668) |
0.0 | 0.1 | GO:0022617 | extracellular matrix disassembly(GO:0022617) |
0.0 | 0.6 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
0.0 | 0.0 | GO:1902175 | regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902175) |
0.0 | 0.0 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.0 | 0.0 | GO:0045343 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.0 | 0.3 | GO:1902653 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
0.0 | 0.0 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.0 | 0.2 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
0.0 | 0.0 | GO:0010896 | regulation of triglyceride catabolic process(GO:0010896) |
0.0 | 0.0 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.0 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
0.0 | 0.0 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
0.0 | 0.0 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
0.0 | 0.1 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.0 | 0.0 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.0 | 0.0 | GO:0071715 | icosanoid transport(GO:0071715) fatty acid derivative transport(GO:1901571) |
0.0 | 0.0 | GO:1904385 | cellular response to angiotensin(GO:1904385) response to angiotensin(GO:1990776) |
0.0 | 0.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.1 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.0 | 0.0 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.0 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.0 | 0.0 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.0 | 0.0 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.0 | 0.0 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.0 | 0.0 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.0 | 0.2 | GO:0019915 | lipid storage(GO:0019915) |
0.0 | 0.2 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.0 | 0.1 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
0.0 | 0.0 | GO:0060717 | chorion development(GO:0060717) extraembryonic membrane development(GO:1903867) |
0.0 | 0.1 | GO:0002717 | positive regulation of natural killer cell mediated immunity(GO:0002717) |
0.0 | 0.0 | GO:0047496 | vesicle transport along microtubule(GO:0047496) |
0.0 | 0.0 | GO:0017014 | protein nitrosylation(GO:0017014) |
0.0 | 0.0 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.0 | 0.0 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.0 | 0.0 | GO:0010979 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
0.0 | 0.0 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.0 | 0.0 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.0 | 0.0 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.0 | 0.0 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.0 | 0.0 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.0 | 0.0 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.0 | 0.0 | GO:0002775 | antimicrobial peptide production(GO:0002775) antibacterial peptide production(GO:0002778) |
0.0 | 0.0 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.0 | 0.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.0 | GO:0061001 | regulation of dendritic spine morphogenesis(GO:0061001) |
0.0 | 0.0 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.0 | 0.1 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.0 | 0.2 | GO:0030574 | collagen catabolic process(GO:0030574) multicellular organism catabolic process(GO:0044243) |
0.0 | 0.0 | GO:0072194 | kidney smooth muscle tissue development(GO:0072194) |
0.0 | 0.0 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 2.2 | GO:0006397 | mRNA processing(GO:0006397) |
0.0 | 0.0 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.0 | 0.0 | GO:0016137 | glycoside metabolic process(GO:0016137) polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.0 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.0 | 0.0 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.1 | GO:0019885 | antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
0.0 | 0.0 | GO:0042637 | catagen(GO:0042637) |
0.0 | 0.0 | GO:0046134 | pyrimidine nucleoside biosynthetic process(GO:0046134) |
0.0 | 0.0 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.9 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.4 | 1.2 | GO:0005745 | m-AAA complex(GO:0005745) |
0.4 | 1.9 | GO:0005683 | U7 snRNP(GO:0005683) |
0.4 | 1.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.4 | 2.2 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.4 | 1.1 | GO:0031523 | Myb complex(GO:0031523) |
0.4 | 1.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.3 | 1.0 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.3 | 1.2 | GO:0032021 | NELF complex(GO:0032021) |
0.3 | 1.2 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.3 | 0.9 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.3 | 1.2 | GO:0071817 | MMXD complex(GO:0071817) |
0.3 | 0.3 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.3 | 0.9 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.3 | 2.0 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.3 | 1.6 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.3 | 0.8 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.3 | 0.8 | GO:0036396 | MIS complex(GO:0036396) |
0.2 | 1.0 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.2 | 2.2 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.2 | 2.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.2 | 0.7 | GO:0044393 | microspike(GO:0044393) |
0.2 | 1.2 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.2 | 0.9 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.2 | 1.6 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.2 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
0.2 | 0.9 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.2 | 0.7 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.2 | 0.9 | GO:0071797 | LUBAC complex(GO:0071797) |
0.2 | 0.7 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.2 | 1.3 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.2 | 1.5 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.2 | 1.1 | GO:0000235 | astral microtubule(GO:0000235) |
0.2 | 1.5 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.2 | 0.8 | GO:1990130 | Iml1 complex(GO:1990130) |
0.2 | 1.4 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.2 | 0.6 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.2 | 0.2 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.2 | 1.0 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.2 | 0.7 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.2 | 1.6 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.2 | 0.5 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.2 | 0.7 | GO:0045298 | tubulin complex(GO:0045298) |
0.2 | 2.0 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.2 | 0.8 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.2 | 0.5 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.2 | 0.6 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.2 | 0.6 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.2 | 1.1 | GO:0045180 | basal cortex(GO:0045180) |
0.2 | 0.6 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.2 | 0.8 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.2 | 1.7 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.2 | 0.5 | GO:0000811 | GINS complex(GO:0000811) |
0.2 | 0.8 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.2 | 0.9 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.2 | 0.8 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.1 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.1 | 0.4 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.1 | 1.3 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 1.7 | GO:0005652 | nuclear lamina(GO:0005652) |
0.1 | 0.4 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 0.6 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.1 | 1.9 | GO:0070822 | Sin3-type complex(GO:0070822) |
0.1 | 0.5 | GO:0071953 | elastic fiber(GO:0071953) |
0.1 | 0.5 | GO:0000805 | X chromosome(GO:0000805) |
0.1 | 0.5 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.1 | 0.5 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.1 | 0.5 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.1 | 0.7 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 1.0 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.1 | 0.5 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.1 | 2.2 | GO:0005686 | U2 snRNP(GO:0005686) |
0.1 | 0.3 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.1 | 0.1 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.1 | 0.6 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.1 | 0.4 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 0.5 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.1 | 0.4 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.1 | 1.7 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.1 | 0.4 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.1 | 0.4 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 0.9 | GO:0005688 | U6 snRNP(GO:0005688) |
0.1 | 1.0 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.1 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 0.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.1 | 1.3 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.1 | 2.8 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.1 | 0.4 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.1 | 1.9 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.1 | 1.3 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 0.3 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 1.1 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.1 | 0.6 | GO:0070187 | telosome(GO:0070187) |
0.1 | 0.3 | GO:1990635 | proximal dendrite(GO:1990635) |
0.1 | 0.7 | GO:0000796 | condensin complex(GO:0000796) |
0.1 | 0.8 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.1 | 0.5 | GO:0030870 | Mre11 complex(GO:0030870) |
0.1 | 0.4 | GO:0097422 | tubular endosome(GO:0097422) |
0.1 | 0.4 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.1 | 0.4 | GO:1990246 | uniplex complex(GO:1990246) |
0.1 | 0.1 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
0.1 | 0.2 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 1.5 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.1 | 0.1 | GO:1903349 | omegasome membrane(GO:1903349) |
0.1 | 2.1 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 1.5 | GO:0071565 | nBAF complex(GO:0071565) |
0.1 | 0.3 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 0.3 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 0.3 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.1 | 0.3 | GO:0045240 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) dihydrolipoyl dehydrogenase complex(GO:0045240) |
0.1 | 0.6 | GO:0002177 | manchette(GO:0002177) |
0.1 | 4.3 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.3 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.1 | 1.7 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.1 | 1.0 | GO:0001527 | microfibril(GO:0001527) |
0.1 | 1.0 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.1 | 0.3 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.5 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.1 | 0.6 | GO:1990752 | microtubule end(GO:1990752) |
0.1 | 0.6 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 0.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 0.4 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.1 | 0.5 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.2 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.1 | 0.6 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 0.4 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 1.3 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.1 | 0.9 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.1 | 0.3 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 2.3 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 2.7 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.1 | 0.8 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.1 | 3.2 | GO:0031201 | SNARE complex(GO:0031201) |
0.1 | 0.3 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 0.7 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 0.9 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 0.4 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.1 | 0.8 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.1 | 0.4 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 0.4 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.1 | 0.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.1 | 0.5 | GO:0031983 | vesicle lumen(GO:0031983) |
0.1 | 0.4 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.1 | 0.6 | GO:0071439 | clathrin complex(GO:0071439) |
0.1 | 1.1 | GO:1990391 | DNA repair complex(GO:1990391) |
0.1 | 1.3 | GO:0000145 | exocyst(GO:0000145) |
0.1 | 1.3 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.1 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.1 | 0.2 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.1 | 3.1 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 1.7 | GO:0030057 | desmosome(GO:0030057) |
0.1 | 2.2 | GO:0030684 | preribosome(GO:0030684) |
0.1 | 1.1 | GO:0031305 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
0.1 | 0.4 | GO:0034709 | methylosome(GO:0034709) |
0.1 | 0.5 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.4 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.5 | GO:0000242 | pericentriolar material(GO:0000242) |
0.1 | 0.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.5 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 0.6 | GO:0097542 | ciliary tip(GO:0097542) |
0.1 | 1.8 | GO:0015030 | Cajal body(GO:0015030) |
0.1 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.1 | 0.2 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.1 | 0.3 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
0.1 | 0.5 | GO:0032797 | SMN complex(GO:0032797) |
0.1 | 0.8 | GO:0031528 | microvillus membrane(GO:0031528) |
0.1 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.2 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.1 | 0.3 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 1.0 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.1 | 0.9 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.1 | 0.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 0.5 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.1 | 0.3 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 0.3 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.1 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.2 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.1 | 0.3 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.2 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.1 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.1 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 0.1 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 0.6 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.1 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 3.3 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
0.1 | 2.4 | GO:0014704 | intercalated disc(GO:0014704) |
0.1 | 0.9 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 0.3 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 0.4 | GO:0097526 | U4/U6 x U5 tri-snRNP complex(GO:0046540) spliceosomal tri-snRNP complex(GO:0097526) |
0.1 | 0.6 | GO:0031082 | BLOC complex(GO:0031082) |
0.1 | 4.0 | GO:0030496 | midbody(GO:0030496) |
0.1 | 4.5 | GO:0036064 | ciliary basal body(GO:0036064) |
0.1 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.2 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.6 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.1 | 0.6 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.1 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 1.7 | GO:0016235 | aggresome(GO:0016235) |
0.1 | 0.2 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 2.2 | GO:0005844 | polysome(GO:0005844) |
0.1 | 1.5 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.1 | 0.2 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) TAP complex(GO:0042825) |
0.1 | 0.1 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.1 | 0.2 | GO:0043511 | inhibin complex(GO:0043511) |
0.1 | 0.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.1 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.1 | 0.1 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.1 | 0.7 | GO:0035267 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.1 | 0.3 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.1 | 0.5 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.1 | 0.4 | GO:0097449 | astrocyte projection(GO:0097449) |
0.1 | 2.3 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.1 | 2.7 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.1 | 2.6 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.1 | 0.7 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.1 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 5.8 | GO:0043296 | apical junction complex(GO:0043296) |
0.1 | 0.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.1 | 2.2 | GO:0072686 | mitotic spindle(GO:0072686) |
0.1 | 0.1 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 0.2 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.1 | 0.3 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.1 | 1.2 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.1 | 0.5 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.1 | 1.3 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.1 | 1.9 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.1 | 0.6 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.1 | 1.0 | GO:0042641 | actomyosin(GO:0042641) |
0.1 | 0.3 | GO:0097470 | ribbon synapse(GO:0097470) |
0.1 | 0.4 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.4 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.4 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 0.4 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.2 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.0 | 2.5 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.0 | 3.5 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.2 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.3 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 0.3 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.4 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.1 | GO:0030894 | replisome(GO:0030894) |
0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 6.6 | GO:0031965 | nuclear membrane(GO:0031965) |
0.0 | 0.1 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 3.2 | GO:0031513 | nonmotile primary cilium(GO:0031513) |
0.0 | 0.2 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.0 | 0.1 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.0 | 0.3 | GO:0001939 | female pronucleus(GO:0001939) |
0.0 | 0.4 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.0 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.4 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.0 | 0.2 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.4 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.6 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.2 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.8 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.0 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.5 | GO:0043596 | nuclear replication fork(GO:0043596) |
0.0 | 2.0 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.1 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.8 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.1 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.0 | 0.3 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.3 | GO:0030135 | coated vesicle(GO:0030135) |
0.0 | 0.3 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 1.1 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.6 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.2 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 0.5 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.0 | 0.2 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.0 | 0.6 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.0 | 0.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 0.3 | GO:0008278 | cohesin complex(GO:0008278) |
0.0 | 0.3 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 1.7 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.0 | 0.4 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.3 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 3.9 | GO:0005813 | centrosome(GO:0005813) |
0.0 | 0.5 | GO:0072372 | primary cilium(GO:0072372) |
0.0 | 2.4 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 1.3 | GO:0043198 | dendritic shaft(GO:0043198) |
0.0 | 0.7 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 1.3 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.0 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.0 | 3.4 | GO:0043209 | myelin sheath(GO:0043209) |
0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.5 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 2.0 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
0.0 | 0.5 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.0 | 0.6 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.4 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 0.4 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.2 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 5.6 | GO:0005929 | cilium(GO:0005929) |
0.0 | 0.8 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.7 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.1 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 2.3 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.0 | 0.2 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.0 | 0.4 | GO:1990204 | oxidoreductase complex(GO:1990204) |
0.0 | 0.5 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.0 | 3.5 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.0 | 3.5 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.2 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.0 | 0.2 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 0.1 | GO:0016234 | inclusion body(GO:0016234) |
0.0 | 6.6 | GO:0005924 | cell-substrate adherens junction(GO:0005924) focal adhesion(GO:0005925) |
0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.0 | 0.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.6 | GO:0034704 | calcium channel complex(GO:0034704) |
0.0 | 0.1 | GO:0070160 | occluding junction(GO:0070160) |
0.0 | 0.3 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.0 | 0.2 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.0 | 0.4 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 1.1 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.3 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 0.1 | GO:0030914 | STAGA complex(GO:0030914) |
0.0 | 0.4 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.0 | 0.0 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.0 | 0.0 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 1.0 | GO:0000776 | kinetochore(GO:0000776) |
0.0 | 25.4 | GO:0005739 | mitochondrion(GO:0005739) |
0.0 | 0.1 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 0.1 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.3 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.0 | GO:0030891 | VCB complex(GO:0030891) |
0.0 | 0.1 | GO:0030677 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.0 | 2.0 | GO:0098852 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
0.0 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.0 | 0.1 | GO:0031672 | A band(GO:0031672) |
0.0 | 2.3 | GO:0005769 | early endosome(GO:0005769) |
0.0 | 0.4 | GO:0031526 | brush border membrane(GO:0031526) |
0.0 | 0.8 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.0 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.1 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.0 | GO:0097525 | spliceosomal snRNP complex(GO:0097525) |
0.0 | 0.9 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
0.0 | 0.6 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.1 | GO:0071010 | prespliceosome(GO:0071010) |
0.0 | 0.4 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.0 | 0.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 2.4 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
0.0 | 0.0 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 0.1 | GO:0042599 | lamellar body(GO:0042599) |
0.0 | 0.3 | GO:0005815 | microtubule organizing center(GO:0005815) |
0.0 | 0.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.0 | 0.0 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.0 | 0.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.0 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 0.0 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.2 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.2 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.0 | 0.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 0.2 | GO:0010008 | endosome membrane(GO:0010008) |
0.0 | 0.0 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 0.1 | GO:0070161 | adherens junction(GO:0005912) anchoring junction(GO:0070161) |
0.0 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 5.4 | GO:0005730 | nucleolus(GO:0005730) |
0.0 | 0.1 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.0 | 0.2 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.0 | 0.8 | GO:0005802 | trans-Golgi network(GO:0005802) |
0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.8 | GO:0005938 | cell cortex(GO:0005938) |
0.0 | 4.9 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 21.1 | GO:0070062 | extracellular exosome(GO:0070062) |
0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.1 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.1 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.6 | GO:0045177 | apical part of cell(GO:0045177) |
0.0 | 0.0 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.0 | 0.1 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.2 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.1 | GO:0098636 | protein complex involved in cell adhesion(GO:0098636) |
0.0 | 0.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 6.1 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 2.3 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.6 | 1.9 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.5 | 1.6 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.5 | 1.9 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.4 | 1.3 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
0.4 | 1.2 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.4 | 2.0 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.4 | 1.2 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.4 | 1.9 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.4 | 1.5 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.4 | 1.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.3 | 2.4 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.3 | 1.0 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.3 | 1.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.3 | 1.0 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.3 | 1.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.3 | 1.0 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.3 | 1.9 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.3 | 0.9 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.3 | 1.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.3 | 1.4 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.3 | 0.9 | GO:0008142 | oxysterol binding(GO:0008142) |
0.3 | 1.4 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.3 | 1.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.3 | 0.6 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.3 | 0.8 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.3 | 1.1 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.3 | 1.1 | GO:0004083 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) |
0.3 | 1.4 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.3 | 0.3 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
0.3 | 0.8 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.3 | 0.8 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.3 | 0.8 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.3 | 1.8 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.2 | 0.7 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.2 | 1.0 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.2 | 0.9 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.2 | 0.9 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.2 | 0.7 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.2 | 1.3 | GO:0000150 | recombinase activity(GO:0000150) |
0.2 | 0.8 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.2 | 0.6 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.2 | 0.2 | GO:0016414 | O-octanoyltransferase activity(GO:0016414) |
0.2 | 1.2 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.2 | 0.6 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.2 | 1.6 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.2 | 1.4 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.2 | 1.7 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.2 | 0.6 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.2 | 0.2 | GO:0008169 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
0.2 | 0.6 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.2 | 0.7 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.2 | 2.1 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.2 | 2.4 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.2 | 0.5 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.2 | 1.3 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.2 | 0.7 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.2 | 0.7 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.2 | 1.4 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.2 | 1.1 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
0.2 | 1.2 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.2 | 5.2 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.2 | 0.7 | GO:0009374 | biotin binding(GO:0009374) |
0.2 | 0.7 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.2 | 2.2 | GO:0070403 | NAD+ binding(GO:0070403) |
0.2 | 0.7 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.2 | 1.4 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.2 | 0.5 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.2 | 1.0 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.2 | 1.5 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.2 | 1.0 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.2 | 1.2 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.2 | 0.2 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.2 | 1.3 | GO:0070990 | snRNP binding(GO:0070990) |
0.2 | 1.5 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.2 | 0.3 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.2 | 0.5 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.2 | 0.5 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.2 | 1.9 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.2 | 0.6 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.2 | 0.5 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.2 | 0.5 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.2 | 0.5 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.2 | 0.6 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.2 | 0.6 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.2 | 0.6 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.2 | 0.9 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.2 | 3.2 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
0.1 | 0.4 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.1 | 0.1 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.1 | 0.7 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.1 | 0.3 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.1 | 0.7 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.1 | 0.4 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.1 | 0.4 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.1 | 0.7 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.1 | 0.6 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.1 | 1.4 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.1 | 0.6 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 0.3 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 1.5 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.1 | 0.8 | GO:0043747 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
0.1 | 0.3 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.4 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
0.1 | 0.5 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.1 | 1.7 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.1 | 3.2 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.1 | 0.5 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 0.6 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.1 | 0.4 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.9 | GO:0018649 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 0.6 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.1 | 0.4 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.1 | 0.5 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
0.1 | 0.6 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
0.1 | 2.6 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 0.2 | GO:1990188 | euchromatin binding(GO:1990188) |
0.1 | 0.4 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.7 | GO:0016595 | glutamate binding(GO:0016595) |
0.1 | 0.5 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 0.4 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.1 | 0.5 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 4.3 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 1.8 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.1 | 2.8 | GO:0030552 | cAMP binding(GO:0030552) |
0.1 | 1.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.4 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.1 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.1 | 1.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 0.4 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 1.3 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.1 | 2.4 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 0.4 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.1 | 0.9 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.1 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 1.0 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.1 | 0.8 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.1 | 0.8 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.1 | 0.3 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.1 | 1.0 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.1 | 0.3 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.1 | 1.6 | GO:0030515 | snoRNA binding(GO:0030515) |
0.1 | 0.3 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.1 | 0.1 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.1 | 1.3 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 0.9 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 0.7 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.1 | 0.8 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 0.3 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.1 | 0.6 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.2 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.1 | 0.2 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.1 | 6.8 | GO:0008186 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.1 | 0.3 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 3.4 | GO:0043738 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) NADPH:sulfur oxidoreductase activity(GO:0043914) epoxyqueuosine reductase activity(GO:0052693) |
0.1 | 0.9 | GO:0017136 | NAD-dependent histone deacetylase activity(GO:0017136) |
0.1 | 1.1 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.1 | 2.9 | GO:0043531 | ADP binding(GO:0043531) |
0.1 | 0.2 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.1 | 0.8 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.1 | 0.2 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.1 | 0.3 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.1 | 0.6 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.1 | 0.2 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.1 | 1.3 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 0.8 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.5 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.2 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
0.1 | 0.5 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.1 | 0.5 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.1 | 0.5 | GO:0000182 | rDNA binding(GO:0000182) |
0.1 | 4.5 | GO:0035064 | methylated histone binding(GO:0035064) |
0.1 | 0.8 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.1 | 0.7 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.1 | 0.4 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 0.4 | GO:0019808 | polyamine binding(GO:0019808) |
0.1 | 4.4 | GO:0043022 | ribosome binding(GO:0043022) |
0.1 | 0.5 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.1 | 0.3 | GO:0005345 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.1 | 0.7 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.1 | 0.8 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.1 | 0.4 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.1 | 0.2 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.1 | 0.3 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 0.4 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 0.1 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
0.1 | 0.9 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.1 | 0.3 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.1 | 0.7 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.1 | 1.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.1 | 0.7 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.1 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.1 | 1.2 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.1 | 0.6 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.1 | 0.5 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.1 | 0.9 | GO:0008061 | chitin binding(GO:0008061) |
0.1 | 0.9 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.1 | 0.5 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.1 | 0.5 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.1 | 0.7 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.1 | 0.5 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 0.9 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 0.5 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 0.2 | GO:0000828 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.1 | 0.5 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 0.4 | GO:0098505 | single-stranded telomeric DNA binding(GO:0043047) G-rich strand telomeric DNA binding(GO:0098505) |
0.1 | 0.9 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.1 | 0.3 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.1 | 0.3 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.1 | 0.3 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.1 | 0.2 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.1 | 0.1 | GO:0032138 | single base insertion or deletion binding(GO:0032138) |
0.1 | 0.8 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.3 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.1 | 0.8 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 0.3 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.1 | 0.3 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 0.1 | GO:0005119 | smoothened binding(GO:0005119) |
0.1 | 0.1 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.1 | 0.5 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.1 | 1.3 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.1 | 0.5 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 0.4 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.1 | 0.9 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.7 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.1 | 0.4 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.1 | 0.3 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.1 | 0.2 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.1 | 0.6 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.1 | 0.2 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.1 | 0.2 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.1 | 1.3 | GO:0016504 | peptidase activator activity(GO:0016504) |
0.1 | 0.9 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.1 | 0.3 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 0.3 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 0.2 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.1 | 0.5 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 2.1 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 0.2 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.1 | 0.4 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
0.1 | 0.5 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
0.1 | 0.6 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.1 | 0.2 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.1 | 0.4 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.7 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.1 | 2.1 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.1 | 0.3 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.1 | 0.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.1 | 0.2 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.1 | 0.2 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.1 | 0.3 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.7 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.1 | 0.8 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.1 | 0.4 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 0.4 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.1 | 0.8 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.1 | 0.2 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 0.6 | GO:0031432 | titin binding(GO:0031432) |
0.1 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.1 | 0.3 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.4 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.1 | 4.3 | GO:0016627 | oxidoreductase activity, acting on the CH-CH group of donors(GO:0016627) |
0.1 | 0.2 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.1 | 0.5 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.1 | 0.4 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.1 | 1.9 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.1 | 0.2 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.1 | 0.6 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.1 | 1.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.1 | 0.2 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.1 | 1.0 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.1 | 0.6 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 0.9 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.1 | 0.8 | GO:0000175 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.1 | 1.1 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.1 | 0.1 | GO:0002054 | nucleobase binding(GO:0002054) |
0.1 | 0.5 | GO:0042299 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
0.1 | 0.2 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.1 | 0.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 0.1 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.1 | 1.6 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.1 | 0.2 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 0.2 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.1 | 0.9 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.1 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 0.9 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 0.4 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 1.1 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.3 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.1 | 0.2 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.1 | 0.5 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.1 | 1.3 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.1 | 1.1 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.1 | 0.3 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.1 | 0.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 1.3 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.1 | 1.2 | GO:0045296 | cadherin binding(GO:0045296) |
0.1 | 0.3 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.1 | 0.2 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.1 | 0.8 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.1 | 1.3 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.3 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
0.1 | 0.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.8 | GO:0005521 | lamin binding(GO:0005521) |
0.1 | 0.9 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.1 | 0.3 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.1 | 3.1 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.1 | 0.3 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.1 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.3 | GO:0000217 | DNA secondary structure binding(GO:0000217) |
0.1 | 0.1 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.1 | 0.2 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.1 | 0.6 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.1 | 0.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.1 | 0.9 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.1 | 2.3 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.1 | 0.1 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
0.1 | 0.2 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.1 | 0.1 | GO:0070840 | dynein complex binding(GO:0070840) |
0.1 | 0.5 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.1 | 0.7 | GO:0031402 | sodium ion binding(GO:0031402) |
0.1 | 0.7 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.1 | 0.1 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.1 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 0.2 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.1 | 0.4 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.1 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.1 | 0.2 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.1 | 0.1 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
0.1 | 0.3 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.1 | 0.5 | GO:0018449 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.1 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 0.4 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.1 | 0.2 | GO:0038100 | nodal binding(GO:0038100) |
0.1 | 0.9 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.1 | 0.2 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 0.1 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.1 | 9.2 | GO:0061659 | ubiquitin protein ligase activity(GO:0061630) ubiquitin-like protein ligase activity(GO:0061659) |
0.1 | 0.3 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 1.4 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.1 | 1.0 | GO:0052744 | phosphatidylinositol monophosphate phosphatase activity(GO:0052744) |
0.1 | 0.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.1 | 0.2 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.1 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.1 | 0.1 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.1 | 0.3 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 0.3 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.1 | 0.1 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.1 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.1 | 0.3 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 0.6 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.1 | 0.5 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.1 | 0.4 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.1 | 0.3 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.1 | 0.2 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.1 | 0.7 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.1 | 0.9 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.1 | 0.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 0.2 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.1 | 0.3 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.1 | 2.0 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
0.1 | 0.8 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.1 | 1.4 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.1 | 0.3 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.1 | 0.2 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
0.1 | 0.3 | GO:0030276 | clathrin binding(GO:0030276) |
0.1 | 1.9 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.1 | 0.3 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 0.2 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 1.7 | GO:0035254 | glutamate receptor binding(GO:0035254) |
0.1 | 0.6 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.1 | 0.2 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.1 | 0.5 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.1 | 0.2 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.1 | 0.2 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.1 | 0.1 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.1 | 0.2 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.1 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.2 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.0 | 0.4 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.4 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 1.5 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.0 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.0 | 0.2 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.0 | 0.4 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.5 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.9 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.0 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.0 | 0.0 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.1 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
0.0 | 0.4 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.6 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.8 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.0 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.0 | 0.2 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.2 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.3 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.0 | 3.4 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.1 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.0 | 1.9 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 0.1 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.3 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.4 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.3 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.0 | 0.1 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.0 | 0.6 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.1 | GO:0031013 | troponin I binding(GO:0031013) |
0.0 | 0.0 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.0 | 0.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 1.2 | GO:0016684 | oxidoreductase activity, acting on peroxide as acceptor(GO:0016684) |
0.0 | 1.2 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.2 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 1.3 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.3 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.4 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.0 | GO:0004954 | prostanoid receptor activity(GO:0004954) |
0.0 | 0.8 | GO:0005504 | fatty acid binding(GO:0005504) |
0.0 | 1.2 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 1.5 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 7.8 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 1.3 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.0 | 0.1 | GO:0018574 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 0.9 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.2 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
0.0 | 1.6 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.2 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.1 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.0 | 0.3 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.1 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.3 | GO:0071949 | FAD binding(GO:0071949) |
0.0 | 0.2 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 1.3 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.6 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.5 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.0 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.2 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.0 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 2.9 | GO:0008173 | RNA methyltransferase activity(GO:0008173) |
0.0 | 0.6 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.2 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.1 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.0 | 0.3 | GO:0005123 | death receptor binding(GO:0005123) |
0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.0 | GO:0016415 | octanoyltransferase activity(GO:0016415) |
0.0 | 0.1 | GO:0043121 | neurotrophin binding(GO:0043121) nerve growth factor binding(GO:0048406) |
0.0 | 0.4 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.2 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.0 | 0.3 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.3 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.1 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.0 | 0.4 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 2.8 | GO:0004721 | phosphoprotein phosphatase activity(GO:0004721) |
0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.0 | 0.8 | GO:0016776 | phosphotransferase activity, phosphate group as acceptor(GO:0016776) |
0.0 | 0.3 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.1 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.0 | 0.7 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.1 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
0.0 | 0.5 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.0 | 0.3 | GO:0051378 | serotonin binding(GO:0051378) |
0.0 | 0.2 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.0 | 0.1 | GO:0001962 | alpha-1,3-galactosyltransferase activity(GO:0001962) |
0.0 | 0.1 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.0 | 0.2 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
0.0 | 0.0 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.3 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
0.0 | 0.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.2 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.8 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
0.0 | 1.7 | GO:0017124 | SH3 domain binding(GO:0017124) |
0.0 | 3.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.3 | GO:0019843 | rRNA binding(GO:0019843) |
0.0 | 0.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.0 | 0.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.0 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.0 | 0.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.0 | 0.4 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.1 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
0.0 | 0.1 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.0 | 0.2 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 1.6 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 6.0 | GO:0005525 | GTP binding(GO:0005525) |
0.0 | 0.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 0.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.0 | 0.3 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.7 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.1 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0008556 | potassium-transporting ATPase activity(GO:0008556) |
0.0 | 0.7 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.1 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.0 | 0.2 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.0 | 0.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.1 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.0 | 0.4 | GO:0003924 | GTPase activity(GO:0003924) |
0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.3 | GO:0032561 | guanyl ribonucleotide binding(GO:0032561) |
0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.2 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.1 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.0 | 0.1 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
0.0 | 0.1 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.0 | 0.0 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.0 | 0.0 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.1 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.0 | 4.1 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.0 | 0.2 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 2.8 | GO:0035091 | phosphatidylinositol binding(GO:0035091) |
0.0 | 0.6 | GO:0015078 | hydrogen ion transmembrane transporter activity(GO:0015078) |
0.0 | 0.1 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 0.1 | GO:0044390 | ubiquitin conjugating enzyme binding(GO:0031624) ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.0 | 0.2 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.0 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.0 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.2 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.0 | 0.0 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.1 | GO:0016936 | galactoside binding(GO:0016936) |
0.0 | 1.1 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
0.0 | 0.0 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.0 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.0 | 0.1 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.1 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.0 | 0.7 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.0 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.3 | GO:1901505 | carbohydrate derivative transporter activity(GO:1901505) |
0.0 | 1.4 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 0.2 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.3 | GO:0017022 | myosin binding(GO:0017022) |
0.0 | 0.2 | GO:0035250 | UDP-galactosyltransferase activity(GO:0035250) |
0.0 | 1.3 | GO:0051015 | actin filament binding(GO:0051015) |
0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.0 | 0.2 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.0 | 0.3 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.1 | GO:1901682 | sulfur compound transmembrane transporter activity(GO:1901682) |
0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.2 | GO:0005088 | Ras guanyl-nucleotide exchange factor activity(GO:0005088) |
0.0 | 0.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.0 | 0.2 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.0 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.0 | 0.1 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.1 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.0 | 0.1 | GO:0004953 | icosanoid receptor activity(GO:0004953) |
0.0 | 0.1 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
0.0 | 0.1 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.0 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.1 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.1 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.2 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.6 | GO:0004540 | ribonuclease activity(GO:0004540) |
0.0 | 0.7 | GO:0019210 | kinase inhibitor activity(GO:0019210) |
0.0 | 2.6 | GO:0003779 | actin binding(GO:0003779) |
0.0 | 0.1 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.0 | 0.1 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.0 | 0.0 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.0 | 0.1 | GO:0035173 | histone kinase activity(GO:0035173) |
0.0 | 0.1 | GO:0055103 | ligase regulator activity(GO:0055103) |
0.0 | 0.1 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.0 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.0 | 0.0 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.0 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.2 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 0.0 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.0 | 0.0 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.0 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
0.0 | 0.1 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.0 | 0.1 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.0 | 0.0 | GO:0050780 | dopamine receptor binding(GO:0050780) |
0.0 | 0.1 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.3 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.0 | 0.1 | GO:0034902 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.0 | 0.0 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.2 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.0 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.0 | 0.0 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.0 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.0 | 0.5 | GO:0008237 | metallopeptidase activity(GO:0008237) |
0.0 | 2.0 | GO:0016874 | ligase activity(GO:0016874) |
0.0 | 0.0 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.0 | 0.0 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.2 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.2 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.0 | 0.5 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
0.0 | 0.0 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.0 | 0.0 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.0 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.0 | 0.0 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.0 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 3.5 | GO:0005509 | calcium ion binding(GO:0005509) |
0.0 | 0.0 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.2 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.0 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.2 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.2 | 0.5 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.2 | 0.5 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.2 | 0.3 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 0.6 | ST ADRENERGIC | Adrenergic Pathway |
0.1 | 1.7 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 0.7 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.1 | 2.1 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.1 | 0.1 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 3.4 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.1 | 0.5 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.1 | 1.0 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 1.7 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 0.3 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.1 | 1.0 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.1 | 0.6 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.1 | 0.4 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.1 | 2.6 | PID BARD1 PATHWAY | BARD1 signaling events |
0.1 | 0.4 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 0.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 3.2 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.1 | 0.5 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.1 | 0.4 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.1 | 5.3 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.1 | 1.9 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.1 | 1.4 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.1 | 0.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 1.5 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.1 | 0.5 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 0.5 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.1 | 0.2 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.1 | 0.2 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.1 | 1.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.1 | 3.0 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.1 | 0.8 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.6 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.1 | 0.3 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.1 | 0.5 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 2.0 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 0.8 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 2.0 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.1 | 0.8 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 0.1 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.1 | 0.4 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 1.0 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 0.9 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 0.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 1.1 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.1 | 1.0 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.1 | 0.5 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 0.9 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 1.5 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.1 | 0.4 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.1 | 0.3 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.1 | 2.1 | PID FGF PATHWAY | FGF signaling pathway |
0.1 | 2.1 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.1 | 1.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.1 | 1.8 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.1 | 1.0 | PID ATM PATHWAY | ATM pathway |
0.1 | 0.6 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.1 | 1.9 | PID PLK1 PATHWAY | PLK1 signaling events |
0.1 | 0.7 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.1 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.1 | 0.4 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 0.3 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 1.1 | PID FOXO PATHWAY | FoxO family signaling |
0.1 | 0.3 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.1 | 0.5 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.1 | 0.9 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.4 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.9 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.0 | 0.9 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 1.8 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.2 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.9 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.3 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.6 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.5 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.2 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.7 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.7 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 1.3 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.5 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.4 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 1.0 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.4 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.8 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.1 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.2 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.0 | 0.3 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.4 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.4 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.2 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.3 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.3 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.7 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.1 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.0 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.0 | 0.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.3 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 2.8 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.1 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 0.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.2 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 1.6 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 1.6 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.0 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 0.1 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 0.4 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
0.4 | 0.8 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.3 | 0.3 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.3 | 2.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.2 | 2.3 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.2 | 3.8 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.2 | 2.0 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.2 | 0.7 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.2 | 0.4 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.2 | 2.0 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.2 | 0.5 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.2 | 2.0 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.2 | 1.0 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.2 | 0.8 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
0.2 | 3.6 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.2 | 2.0 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.2 | 1.5 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.2 | 1.8 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.2 | 0.8 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.2 | 0.3 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.1 | 3.1 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.1 | 1.4 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.1 | 0.8 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
0.1 | 3.7 | REACTOME TRANSCRIPTION COUPLED NER TC NER | Genes involved in Transcription-coupled NER (TC-NER) |
0.1 | 2.0 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 1.4 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 2.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.1 | 2.9 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.1 | 1.0 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.1 | 1.2 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 2.2 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.1 | 1.3 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 0.7 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.1 | 1.9 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.1 | 0.1 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.1 | 0.9 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.1 | 1.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.1 | 0.3 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.1 | 3.5 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 0.2 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 0.6 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 1.7 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.1 | 1.5 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.1 | 1.2 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.1 | 4.7 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.1 | 1.7 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.1 | 2.8 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.1 | 0.6 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.1 | 0.2 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 1.6 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.1 | 2.1 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.1 | 1.1 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.1 | 0.9 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.1 | 3.9 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 0.9 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
0.1 | 1.0 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.1 | 0.3 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.1 | 1.2 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 1.1 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
0.1 | 0.9 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 3.8 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.1 | 0.7 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.1 | 1.2 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
0.1 | 0.2 | REACTOME CELL CELL COMMUNICATION | Genes involved in Cell-Cell communication |
0.1 | 0.6 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.1 | 0.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.1 | 1.1 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.1 | 0.2 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.1 | 4.5 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 1.2 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.1 | 1.2 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.1 | 1.0 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.1 | 2.5 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.1 | 0.8 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.1 | 1.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 1.0 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 0.8 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 1.0 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.1 | 1.0 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 1.5 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.1 | 0.3 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
0.1 | 0.8 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.1 | 3.4 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.1 | 0.4 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.1 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.1 | 1.7 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.1 | 0.6 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.1 | 1.1 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.1 | 1.4 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.1 | 0.5 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 0.5 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
0.1 | 1.6 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.1 | 1.1 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
0.1 | 1.2 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 0.4 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 0.9 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 6.8 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.1 | 2.8 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.1 | 0.4 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.1 | 0.3 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
0.1 | 4.8 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.1 | 1.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 1.4 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 4.9 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.0 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.3 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.6 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 1.0 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.8 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.9 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.0 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 1.3 | REACTOME UNFOLDED PROTEIN RESPONSE | Genes involved in Unfolded Protein Response |
0.0 | 0.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.0 | 1.0 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.1 | REACTOME PI3K EVENTS IN ERBB2 SIGNALING | Genes involved in PI3K events in ERBB2 signaling |
0.0 | 0.0 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 1.2 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.5 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.4 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.8 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.6 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.0 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.0 | 1.0 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.5 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.5 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.5 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 1.0 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.3 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.3 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.6 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.0 | 0.2 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.2 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.3 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.3 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.0 | 0.5 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 0.2 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.1 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
0.0 | 0.2 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.0 | 0.2 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.2 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.3 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.0 | REACTOME SIGNAL AMPLIFICATION | Genes involved in Signal amplification |
0.0 | 0.2 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.1 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
0.0 | 0.2 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.0 | 0.3 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.0 | 1.4 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 0.2 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.5 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.6 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.0 | 0.1 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.0 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
0.0 | 2.0 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.0 | 0.1 | REACTOME TCA CYCLE AND RESPIRATORY ELECTRON TRANSPORT | Genes involved in The citric acid (TCA) cycle and respiratory electron transport |
0.0 | 0.6 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.0 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.0 | 0.3 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.1 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
0.0 | 0.4 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 2.1 | REACTOME GASTRIN CREB SIGNALLING PATHWAY VIA PKC AND MAPK | Genes involved in Gastrin-CREB signalling pathway via PKC and MAPK |
0.0 | 0.2 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.1 | REACTOME TOLL RECEPTOR CASCADES | Genes involved in Toll Receptor Cascades |
0.0 | 0.3 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.1 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.0 | 0.0 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.1 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
0.0 | 0.2 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.1 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.1 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
0.0 | 0.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 0.0 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.1 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 0.0 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.0 | 0.1 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.0 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |