Gene Symbol | Gene ID | Gene Info |
---|---|---|
Egr1
|
ENSMUSG00000038418.7 | Egr1 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Egr1 | chr18_34860822_34861095 | 249 | 0.892859 | -0.42 | 8.7e-04 | Click! |
Egr1 | chr18_34863915_34864154 | 2827 | 0.194438 | 0.32 | 1.3e-02 | Click! |
Egr1 | chr18_34887498_34888142 | 26613 | 0.106964 | -0.30 | 1.8e-02 | Click! |
Egr1 | chr18_34855738_34855916 | 3996 | 0.162619 | -0.28 | 3.3e-02 | Click! |
Egr1 | chr18_34863200_34863351 | 2068 | 0.240191 | 0.25 | 5.7e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr11_96282910_96285155 | 1.56 |
Hoxb8 |
homeobox B8 |
1307 |
0.19 |
chr2_119237001_119238240 | 1.38 |
Spint1 |
serine protease inhibitor, Kunitz type 1 |
67 |
0.95 |
chr1_140180846_140181083 | 1.33 |
Cfh |
complement component factor h |
2316 |
0.37 |
chr11_116109279_116110529 | 1.20 |
Trim47 |
tripartite motif-containing 47 |
333 |
0.78 |
chr2_66783826_66785264 | 1.20 |
Scn7a |
sodium channel, voltage-gated, type VII, alpha |
369 |
0.91 |
chr2_74749244_74750558 | 1.17 |
Haglr |
Hoxd antisense growth associated long non-coding RNA |
605 |
0.44 |
chr2_174502638_174503246 | 1.14 |
Gm14385 |
predicted gene 14385 |
17366 |
0.13 |
chr14_21962628_21963016 | 1.13 |
Zfp503 |
zinc finger protein 503 |
26779 |
0.12 |
chr6_52178790_52180823 | 1.13 |
5730596B20Rik |
RIKEN cDNA 5730596B20 gene |
2308 |
0.09 |
chr11_96343236_96346574 | 1.10 |
Hoxb3 |
homeobox B3 |
1136 |
0.24 |
chr2_131561093_131563116 | 0.99 |
Adra1d |
adrenergic receptor, alpha 1d |
179 |
0.79 |
chr2_74745819_74748448 | 0.98 |
Hoxd3 |
homeobox D3 |
1411 |
0.17 |
chr7_121734282_121735298 | 0.95 |
Scnn1g |
sodium channel, nonvoltage-gated 1 gamma |
311 |
0.89 |
chr10_98930234_98930774 | 0.94 |
Atp2b1 |
ATPase, Ca++ transporting, plasma membrane 1 |
15032 |
0.25 |
chr2_144224341_144224579 | 0.92 |
Gm5535 |
predicted gene 5535 |
16470 |
0.11 |
chr6_124719018_124719688 | 0.92 |
Gm15884 |
predicted gene 15884 |
522 |
0.36 |
chr19_28677931_28680368 | 0.89 |
Glis3 |
GLIS family zinc finger 3 |
459 |
0.68 |
chr9_119579066_119579436 | 0.88 |
Scn5a |
sodium channel, voltage-gated, type V, alpha |
235 |
0.95 |
chr2_147083670_147085642 | 0.87 |
Nkx2-4 |
NK2 homeobox 4 |
789 |
0.65 |
chr15_37733930_37734441 | 0.85 |
Gm49397 |
predicted gene, 49397 |
150 |
0.54 |
chr13_46217950_46218678 | 0.82 |
Gm10113 |
predicted gene 10113 |
27268 |
0.21 |
chr11_96304390_96305296 | 0.79 |
Hoxb5os |
homeobox B5 and homeobox B6, opposite strand |
238 |
0.77 |
chr11_98327227_98329144 | 0.77 |
Neurod2 |
neurogenic differentiation 2 |
1463 |
0.23 |
chr11_71429806_71430038 | 0.75 |
Gm16013 |
predicted gene 16013 |
6258 |
0.25 |
chr12_28551951_28552433 | 0.74 |
Dcdc2c |
doublecortin domain containing 2C |
92 |
0.97 |
chr11_96331807_96334248 | 0.74 |
Hoxb3 |
homeobox B3 |
4965 |
0.08 |
chr7_16475227_16477102 | 0.73 |
Npas1 |
neuronal PAS domain protein 1 |
476 |
0.67 |
chr7_79617107_79617920 | 0.72 |
Rhcg |
Rhesus blood group-associated C glycoprotein |
144 |
0.93 |
chr4_127168414_127169711 | 0.72 |
Dlgap3 |
DLG associated protein 3 |
142 |
0.94 |
chr11_111583176_111584131 | 0.71 |
Gm11676 |
predicted gene 11676 |
29653 |
0.25 |
chr17_26840808_26841709 | 0.71 |
Nkx2-5 |
NK2 homeobox 5 |
307 |
0.83 |
chr1_52597776_52598270 | 0.71 |
Gm5527 |
predicted gene 5527 |
13505 |
0.13 |
chr11_62821634_62822188 | 0.71 |
Trim16 |
tripartite motif-containing 16 |
1442 |
0.29 |
chr5_52254526_52255173 | 0.70 |
Gm43180 |
predicted gene 43180 |
15513 |
0.15 |
chr2_139677368_139678869 | 0.70 |
Ism1 |
isthmin 1, angiogenesis inhibitor |
60 |
0.86 |
chr17_45544425_45546027 | 0.69 |
Tmem151b |
transmembrane protein 151B |
4451 |
0.11 |
chr7_44350602_44354420 | 0.69 |
Shank1 |
SH3 and multiple ankyrin repeat domains 1 |
1749 |
0.15 |
chr5_148990792_148991310 | 0.68 |
Gm42791 |
predicted gene 42791 |
4096 |
0.1 |
chr5_101703476_101703804 | 0.68 |
9430085M18Rik |
RIKEN cDNA 9430085M18 gene |
54 |
0.87 |
chr2_74748525_74748913 | 0.66 |
Haglr |
Hoxd antisense growth associated long non-coding RNA |
1787 |
0.13 |
chr17_35320263_35321688 | 0.65 |
H2-Q1 |
histocompatibility 2, Q region locus 1 |
417 |
0.62 |
chr6_52164011_52165366 | 0.64 |
Hoxa2 |
homeobox A2 |
143 |
0.83 |
chr9_120022870_120023448 | 0.64 |
Xirp1 |
xin actin-binding repeat containing 1 |
439 |
0.69 |
chr8_36905044_36905195 | 0.63 |
Dlc1 |
deleted in liver cancer 1 |
47238 |
0.15 |
chr7_107209278_107210698 | 0.63 |
Rbmxl2 |
RNA binding motif protein, X-linked-like 2 |
543 |
0.67 |
chr12_104864340_104864969 | 0.62 |
Clmn |
calmin |
355 |
0.69 |
chr14_57057134_57058429 | 0.62 |
Gja3 |
gap junction protein, alpha 3 |
58 |
0.97 |
chr7_125183061_125183212 | 0.62 |
Gm21957 |
predicted gene, 21957 |
36750 |
0.18 |
chr10_79920087_79922058 | 0.61 |
R3hdm4 |
R3H domain containing 4 |
136 |
0.86 |
chr19_5559639_5561263 | 0.61 |
1810058N15Rik |
RIKEN cDNA 1810058N15 gene |
191 |
0.47 |
chr2_26201799_26203343 | 0.60 |
Lhx3 |
LIM homeobox protein 3 |
295 |
0.83 |
chr5_150466366_150466940 | 0.60 |
Fry |
FRY microtubule binding protein |
6007 |
0.12 |
chr7_130727108_130727477 | 0.60 |
Tacc2 |
transforming, acidic coiled-coil containing protein 2 |
1458 |
0.39 |
chr11_106709558_106710158 | 0.60 |
Pecam1 |
platelet/endothelial cell adhesion molecule 1 |
5088 |
0.16 |
chr15_80671180_80672586 | 0.60 |
Fam83f |
family with sequence similarity 83, member F |
36 |
0.96 |
chr11_119546839_119548177 | 0.60 |
Nptx1 |
neuronal pentraxin 1 |
245 |
0.86 |
chr11_19827943_19828094 | 0.60 |
Gm12029 |
predicted gene 12029 |
44366 |
0.15 |
chr8_94976904_94978618 | 0.60 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
652 |
0.59 |
chr8_69887012_69889642 | 0.60 |
Yjefn3 |
YjeF N-terminal domain containing 3 |
142 |
0.84 |
chr5_74268328_74268479 | 0.60 |
Gm42599 |
predicted gene 42599 |
18787 |
0.15 |
chr15_80012110_80012261 | 0.59 |
Gm41361 |
predicted gene, 41361 |
146 |
0.89 |
chr15_76197527_76199931 | 0.59 |
Plec |
plectin |
520 |
0.59 |
chrX_111894411_111895700 | 0.58 |
Gm45194 |
predicted gene 45194 |
3479 |
0.27 |
chr10_22843057_22844289 | 0.58 |
Tcf21 |
transcription factor 21 |
23499 |
0.16 |
chr15_100723569_100723720 | 0.58 |
Galnt6 |
polypeptide N-acetylgalactosaminyltransferase 6 |
3167 |
0.15 |
chr1_134513098_134514080 | 0.58 |
Gm15454 |
predicted gene 15454 |
4492 |
0.12 |
chr2_180224713_180226140 | 0.57 |
Lama5 |
laminin, alpha 5 |
433 |
0.75 |
chr6_65516868_65517059 | 0.57 |
Tnip3 |
TNFAIP3 interacting protein 3 |
8350 |
0.23 |
chr15_75997413_75999048 | 0.57 |
Mapk15 |
mitogen-activated protein kinase 15 |
141 |
0.89 |
chr10_80013157_80014908 | 0.57 |
Arhgap45 |
Rho GTPase activating protein 45 |
2621 |
0.11 |
chr11_96319562_96320434 | 0.57 |
Hoxb4 |
homeobox B4 |
1731 |
0.14 |
chr7_131542096_131543636 | 0.57 |
Hmx3 |
H6 homeobox 3 |
1 |
0.97 |
chr17_83214385_83216706 | 0.56 |
Pkdcc |
protein kinase domain containing, cytoplasmic |
253 |
0.94 |
chr18_41860653_41861741 | 0.56 |
Gm50410 |
predicted gene, 50410 |
13637 |
0.22 |
chr5_144357138_144358729 | 0.55 |
Dmrt1i |
Dmrt1 interacting ncRNA |
10 |
0.7 |
chr15_80013738_80014370 | 0.55 |
Pdgfb |
platelet derived growth factor, B polypeptide |
754 |
0.46 |
chr2_172862630_172863799 | 0.55 |
Gm22773 |
predicted gene, 22773 |
1127 |
0.58 |
chr2_158610228_158611991 | 0.54 |
Slc32a1 |
solute carrier family 32 (GABA vesicular transporter), member 1 |
342 |
0.44 |
chr1_74881912_74883211 | 0.54 |
Fev |
FEV transcription factor, ETS family member |
2047 |
0.18 |
chr11_75795022_75796150 | 0.54 |
Gm12339 |
predicted gene 12339 |
366 |
0.55 |
chr4_125490136_125491914 | 0.54 |
Grik3 |
glutamate receptor, ionotropic, kainate 3 |
325 |
0.89 |
chr13_119649318_119649753 | 0.53 |
Ccl28 |
chemokine (C-C motif) ligand 28 |
19 |
0.96 |
chr17_6742258_6742582 | 0.53 |
Ezr |
ezrin |
401 |
0.83 |
chr6_29434692_29436459 | 0.53 |
Flnc |
filamin C, gamma |
2299 |
0.16 |
chr15_99248527_99250738 | 0.52 |
1700120C14Rik |
RIKEN cDNA 1700120C14 gene |
121 |
0.74 |
chr6_88200114_88201718 | 0.52 |
Gata2 |
GATA binding protein 2 |
3 |
0.96 |
chr4_53384889_53385121 | 0.52 |
Gm12496 |
predicted gene 12496 |
19025 |
0.2 |
chr16_94722721_94723264 | 0.51 |
Gm41505 |
predicted gene, 41505 |
1098 |
0.52 |
chr2_31313954_31314959 | 0.51 |
Hmcn2 |
hemicentin 2 |
41 |
0.98 |
chr16_34922552_34923302 | 0.51 |
Mylk |
myosin, light polypeptide kinase |
7415 |
0.19 |
chr5_31094185_31095713 | 0.51 |
Gm9924 |
predicted gene 9924 |
35 |
0.63 |
chr15_28024567_28025840 | 0.50 |
Trio |
triple functional domain (PTPRF interacting) |
249 |
0.93 |
chr7_144838434_144839673 | 0.50 |
Fgf3 |
fibroblast growth factor 3 |
458 |
0.73 |
chr19_44755099_44757716 | 0.50 |
Pax2 |
paired box 2 |
362 |
0.83 |
chr12_108334199_108334795 | 0.49 |
Cyp46a1 |
cytochrome P450, family 46, subfamily a, polypeptide 1 |
30 |
0.97 |
chr6_85423823_85424338 | 0.49 |
Noto |
notochord homeobox |
12 |
0.96 |
chr11_96318060_96319501 | 0.49 |
Hoxb4 |
homeobox B4 |
513 |
0.51 |
chr11_100355257_100356214 | 0.49 |
Hap1 |
huntingtin-associated protein 1 |
352 |
0.71 |
chr11_96352529_96353688 | 0.49 |
Hoxb2 |
homeobox B2 |
1477 |
0.18 |
chr17_56123820_56124985 | 0.49 |
Lrg1 |
leucine-rich alpha-2-glycoprotein 1 |
2401 |
0.13 |
chr1_21963069_21963530 | 0.48 |
Kcnq5 |
potassium voltage-gated channel, subfamily Q, member 5 |
1357 |
0.56 |
chr9_79976568_79977294 | 0.48 |
Filip1 |
filamin A interacting protein 1 |
728 |
0.66 |
chr10_127748635_127749453 | 0.48 |
Gpr182 |
G protein-coupled receptor 182 |
2688 |
0.12 |
chr19_24896949_24897990 | 0.48 |
Foxd4 |
forkhead box D4 |
3728 |
0.17 |
chr13_12105751_12107037 | 0.48 |
Ryr2 |
ryanodine receptor 2, cardiac |
65 |
0.97 |
chr17_5975415_5976190 | 0.48 |
Synj2 |
synaptojanin 2 |
62 |
0.97 |
chr15_98295414_98296526 | 0.48 |
Zfp641 |
zinc finger protein 641 |
160 |
0.92 |
chr11_61022134_61023265 | 0.47 |
Kcnj12 |
potassium inwardly-rectifying channel, subfamily J, member 12 |
135 |
0.96 |
chr7_3292731_3293965 | 0.47 |
Myadm |
myeloid-associated differentiation marker |
254 |
0.81 |
chr4_136081582_136082336 | 0.46 |
Gm13009 |
predicted gene 13009 |
6987 |
0.13 |
chr8_104630432_104631968 | 0.46 |
Rrad |
Ras-related associated with diabetes |
40 |
0.73 |
chr5_66080287_66081072 | 0.46 |
Rbm47 |
RNA binding motif protein 47 |
305 |
0.84 |
chr4_46343785_46345364 | 0.46 |
Gm12446 |
predicted gene 12446 |
941 |
0.34 |
chr1_127577185_127577336 | 0.46 |
Tmem163 |
transmembrane protein 163 |
39830 |
0.18 |
chr18_37985250_37985629 | 0.46 |
Arap3 |
ArfGAP with RhoGAP domain, ankyrin repeat and PH domain 3 |
1010 |
0.34 |
chr11_72408624_72409355 | 0.45 |
Smtnl2 |
smoothelin-like 2 |
2722 |
0.18 |
chr1_189228531_189228964 | 0.45 |
Kcnk2 |
potassium channel, subfamily K, member 2 |
13530 |
0.19 |
chr10_77902577_77903608 | 0.45 |
Lrrc3 |
leucine rich repeat containing 3 |
556 |
0.53 |
chr5_36428093_36428244 | 0.45 |
Sorcs2 |
sortilin-related VPS10 domain containing receptor 2 |
30029 |
0.12 |
chr9_96536722_96537233 | 0.45 |
Gm8495 |
predicted gene 8495 |
184 |
0.91 |
chr11_102665115_102666490 | 0.45 |
Meioc |
meiosis specific with coiled-coil domain |
179 |
0.9 |
chr9_55283384_55284127 | 0.45 |
Nrg4 |
neuregulin 4 |
130 |
0.96 |
chr4_156082276_156082804 | 0.45 |
Gm13648 |
predicted gene 13648 |
22738 |
0.07 |
chr4_131920577_131922124 | 0.45 |
Tmem200b |
transmembrane protein 200B |
150 |
0.52 |
chr11_88193021_88194051 | 0.45 |
Cuedc1 |
CUE domain containing 1 |
5715 |
0.18 |
chrX_12128468_12128774 | 0.45 |
Bcor |
BCL6 interacting corepressor |
221 |
0.96 |
chr18_35652499_35653717 | 0.44 |
Prob1 |
proline rich basic protein 1 |
1102 |
0.28 |
chr2_74705003_74706025 | 0.44 |
Hoxd8 |
homeobox D8 |
362 |
0.61 |
chr4_123233207_123234595 | 0.44 |
Heyl |
hairy/enhancer-of-split related with YRPW motif-like |
48 |
0.96 |
chr2_9882196_9886301 | 0.44 |
9230102O04Rik |
RIKEN cDNA 9230102O04 gene |
255 |
0.84 |
chr12_56533030_56535358 | 0.44 |
Nkx2-1 |
NK2 homeobox 1 |
912 |
0.36 |
chr11_121702141_121703669 | 0.44 |
Metrnl |
meteorin, glial cell differentiation regulator-like |
142 |
0.96 |
chr5_28209280_28210515 | 0.44 |
Cnpy1 |
canopy FGF signaling regulator 1 |
125 |
0.97 |
chr14_59478693_59479244 | 0.44 |
Cab39l |
calcium binding protein 39-like |
152 |
0.96 |
chr10_58812359_58813662 | 0.44 |
Gm9987 |
predicted gene 9987 |
132 |
0.76 |
chr1_47853852_47854290 | 0.44 |
Gm19206 |
predicted gene, 19206 |
61744 |
0.14 |
chr11_70213711_70215145 | 0.43 |
Slc16a11 |
solute carrier family 16 (monocarboxylic acid transporters), member 11 |
134 |
0.89 |
chr14_119123052_119124306 | 0.43 |
Hs6st3 |
heparan sulfate 6-O-sulfotransferase 3 |
14662 |
0.18 |
chr19_44751770_44753571 | 0.43 |
Pax2 |
paired box 2 |
3375 |
0.18 |
chr19_16870451_16872053 | 0.43 |
Gm32341 |
predicted gene, 32341 |
160 |
0.95 |
chr15_78544540_78545208 | 0.43 |
Sstr3 |
somatostatin receptor 3 |
189 |
0.89 |
chr9_58308381_58308873 | 0.43 |
Loxl1 |
lysyl oxidase-like 1 |
4559 |
0.18 |
chr2_68873756_68874637 | 0.43 |
Cers6 |
ceramide synthase 6 |
12610 |
0.14 |
chr15_79893596_79894135 | 0.43 |
Apobec3 |
apolipoprotein B mRNA editing enzyme, catalytic polypeptide 3 |
1158 |
0.33 |
chrX_102643774_102644884 | 0.42 |
Phka1 |
phosphorylase kinase alpha 1 |
83 |
0.95 |
chr16_91534485_91534882 | 0.42 |
Gm7860 |
predicted gene 7860 |
5377 |
0.11 |
chr8_45021852_45022227 | 0.42 |
Gm2366 |
predicted gene 2366 |
346 |
0.87 |
chr10_20204894_20205970 | 0.42 |
Rpl32l |
ribosomal protein L32-like |
3058 |
0.2 |
chr3_129223881_129225649 | 0.42 |
Gm43697 |
predicted gene 43697 |
763 |
0.61 |
chr14_101841178_101841822 | 0.42 |
Lmo7 |
LIM domain only 7 |
681 |
0.79 |
chr12_105511935_105512198 | 0.42 |
AU015791 |
expressed sequence AU015791 |
1414 |
0.4 |
chr1_69105258_69106691 | 0.42 |
Gm16076 |
predicted gene 16076 |
766 |
0.61 |
chr15_80190031_80190182 | 0.41 |
Mgat3 |
mannoside acetylglucosaminyltransferase 3 |
16385 |
0.11 |
chr11_105967508_105968816 | 0.41 |
Ace |
angiotensin I converting enzyme (peptidyl-dipeptidase A) 1 |
217 |
0.88 |
chr4_152318040_152319290 | 0.41 |
Rnf207 |
ring finger protein 207 |
40 |
0.96 |
chr14_41336637_41337064 | 0.41 |
Gm5798 |
predicted gene 5798 |
11759 |
0.13 |
chr12_3806578_3808221 | 0.41 |
Dnmt3a |
DNA methyltransferase 3A |
239 |
0.92 |
chrX_161718507_161718752 | 0.41 |
Rai2 |
retinoic acid induced 2 |
1002 |
0.69 |
chr8_121088119_121090419 | 0.41 |
Gm27530 |
predicted gene, 27530 |
4563 |
0.13 |
chr11_69397288_69398777 | 0.40 |
Tmem88 |
transmembrane protein 88 |
202 |
0.83 |
chr3_126615248_126615480 | 0.40 |
Gm43010 |
predicted gene 43010 |
10516 |
0.13 |
chr5_23598515_23598876 | 0.40 |
Srpk2 |
serine/arginine-rich protein specific kinase 2 |
17839 |
0.17 |
chr5_106560273_106561734 | 0.40 |
Gm28050 |
predicted gene, 28050 |
13712 |
0.14 |
chr3_30019575_30019867 | 0.40 |
Mecomos |
MDS1 and EVI1 complex locus, opposite strand |
2193 |
0.32 |
chr11_97534226_97535710 | 0.40 |
Srcin1 |
SRC kinase signaling inhibitor 1 |
1977 |
0.23 |
chr11_50952280_50952539 | 0.40 |
Prop1 |
paired like homeodomain factor 1 |
45 |
0.94 |
chr11_5861455_5863487 | 0.40 |
Aebp1 |
AE binding protein 1 |
524 |
0.66 |
chr2_74734325_74737080 | 0.40 |
Hoxd3 |
homeobox D3 |
813 |
0.31 |
chr11_32221179_32222558 | 0.40 |
Rhbdf1 |
rhomboid 5 homolog 1 |
376 |
0.76 |
chr11_118568846_118570341 | 0.39 |
Rbfox3 |
RNA binding protein, fox-1 homolog (C. elegans) 3 |
317 |
0.91 |
chr9_56712582_56712844 | 0.39 |
Lingo1 |
leucine rich repeat and Ig domain containing 1 |
27460 |
0.18 |
chr15_102746399_102747628 | 0.39 |
Calcoco1 |
calcium binding and coiled coil domain 1 |
24835 |
0.12 |
chr15_83366703_83367634 | 0.39 |
1700001L05Rik |
RIKEN cDNA 1700001L05 gene |
109 |
0.96 |
chr5_36868663_36870303 | 0.39 |
Ppp2r2c |
protein phosphatase 2, regulatory subunit B, gamma |
820 |
0.55 |
chr8_106136230_106137393 | 0.39 |
Esrp2 |
epithelial splicing regulatory protein 2 |
2 |
0.77 |
chr17_23674874_23675429 | 0.39 |
Thoc6 |
THO complex 6 |
1269 |
0.15 |
chr2_84871674_84872750 | 0.39 |
Rtn4rl2 |
reticulon 4 receptor-like 2 |
14264 |
0.11 |
chr17_36144823_36145988 | 0.39 |
Gm10499 |
predicted gene 10499 |
339 |
0.41 |
chr11_83852457_83853638 | 0.39 |
Hnf1b |
HNF1 homeobox B |
87 |
0.96 |
chr13_3358323_3359294 | 0.39 |
Gm48530 |
predicted gene, 48530 |
353 |
0.61 |
chr8_71692430_71694055 | 0.39 |
Gm45756 |
predicted gene 45756 |
2366 |
0.13 |
chr7_24954055_24955590 | 0.39 |
Gm44970 |
predicted gene 44970 |
95 |
0.93 |
chr3_37063433_37063949 | 0.39 |
Adad1 |
adenosine deaminase domain containing 1 (testis specific) |
13 |
0.96 |
chr6_59425317_59426325 | 0.39 |
Gprin3 |
GPRIN family member 3 |
473 |
0.89 |
chr7_28104523_28105198 | 0.39 |
Fcgbp |
Fc fragment of IgG binding protein |
4051 |
0.13 |
chr4_152349775_152350796 | 0.39 |
Gm13645 |
predicted gene 13645 |
3356 |
0.16 |
chr17_35358800_35360139 | 0.39 |
H2-Q3 |
histocompatibility 2, Q region locus 3 |
480 |
0.57 |
chr4_64045841_64047503 | 0.39 |
Tnc |
tenascin C |
343 |
0.9 |
chr19_45223108_45223381 | 0.39 |
Lbx1 |
ladybird homeobox 1 |
12568 |
0.18 |
chr8_121124848_121126422 | 0.39 |
Foxl1 |
forkhead box L1 |
2305 |
0.19 |
chr15_79481133_79481488 | 0.38 |
Gm49593 |
predicted gene, 49593 |
1364 |
0.26 |
chr5_35391428_35392811 | 0.38 |
4930442P19Rik |
RIKEN cDNA 4930442P19 gene |
207 |
0.9 |
chr2_130696801_130698041 | 0.38 |
Slc4a11 |
solute carrier family 4, sodium bicarbonate transporter-like, member 11 |
48 |
0.96 |
chr6_52174920_52176658 | 0.38 |
Hoxaas3 |
Hoxa cluster antisense RNA 3 |
554 |
0.41 |
chr4_55530488_55531930 | 0.38 |
Klf4 |
Kruppel-like factor 4 (gut) |
561 |
0.73 |
chr5_32729738_32729889 | 0.38 |
Gm2420 |
predicted gene 2420 |
9422 |
0.11 |
chr19_45742375_45743443 | 0.38 |
Fgf8 |
fibroblast growth factor 8 |
6 |
0.97 |
chr4_141856567_141856718 | 0.38 |
Ctrc |
chymotrypsin C (caldecrin) |
10283 |
0.1 |
chr15_36139699_36140784 | 0.38 |
Rgs22 |
regulator of G-protein signalling 22 |
144 |
0.93 |
chr18_84103217_84103514 | 0.38 |
Gm31854 |
predicted gene, 31854 |
1099 |
0.45 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.4 | GO:0086068 | Purkinje myocyte to ventricular cardiac muscle cell signaling(GO:0086029) Purkinje myocyte to ventricular cardiac muscle cell communication(GO:0086068) |
0.3 | 1.3 | GO:1900211 | mesenchymal cell apoptotic process involved in metanephros development(GO:1900200) regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900211) negative regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900212) |
0.3 | 1.2 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.3 | 1.1 | GO:0021569 | rhombomere 3 development(GO:0021569) |
0.3 | 0.8 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.3 | 0.8 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) |
0.3 | 1.0 | GO:1904995 | negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
0.2 | 0.7 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.2 | 0.7 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.2 | 0.7 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.2 | 0.2 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.2 | 0.7 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.2 | 0.5 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.2 | 0.5 | GO:1900238 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.2 | 0.7 | GO:0043622 | cortical microtubule organization(GO:0043622) |
0.2 | 0.7 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.2 | 0.7 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.2 | 0.6 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
0.2 | 0.2 | GO:0072040 | regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072039) negative regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072040) mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:1901145) regulation of somatic stem cell population maintenance(GO:1904672) negative regulation of somatic stem cell population maintenance(GO:1904673) |
0.2 | 0.3 | GO:0070346 | positive regulation of fat cell proliferation(GO:0070346) |
0.1 | 0.4 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.1 | 0.6 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
0.1 | 0.4 | GO:0060128 | corticotropin hormone secreting cell differentiation(GO:0060128) |
0.1 | 0.3 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.1 | 0.4 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.1 | 0.4 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.1 | 0.4 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
0.1 | 0.5 | GO:0032898 | neurotrophin production(GO:0032898) |
0.1 | 0.8 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.4 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.1 | 0.5 | GO:0007494 | midgut development(GO:0007494) |
0.1 | 0.4 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.1 | 0.1 | GO:0051794 | regulation of catagen(GO:0051794) |
0.1 | 0.4 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.1 | 0.4 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.1 | 0.4 | GO:0065001 | specification of axis polarity(GO:0065001) |
0.1 | 0.1 | GO:0072223 | metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
0.1 | 1.4 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.1 | 0.3 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.1 | 1.0 | GO:0003184 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
0.1 | 0.3 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.1 | 0.3 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.1 | 0.3 | GO:0048818 | positive regulation of hair follicle maturation(GO:0048818) |
0.1 | 0.2 | GO:0002085 | inhibition of neuroepithelial cell differentiation(GO:0002085) |
0.1 | 0.1 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 0.3 | GO:1902338 | negative regulation of apoptotic process involved in morphogenesis(GO:1902338) negative regulation of apoptotic process involved in development(GO:1904746) |
0.1 | 0.4 | GO:0060596 | mammary placode formation(GO:0060596) |
0.1 | 0.4 | GO:1903596 | regulation of gap junction assembly(GO:1903596) |
0.1 | 0.2 | GO:0021558 | trochlear nerve development(GO:0021558) |
0.1 | 0.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.1 | 0.3 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 0.2 | GO:0072108 | positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) |
0.1 | 0.2 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
0.1 | 0.3 | GO:1900135 | positive regulation of renin secretion into blood stream(GO:1900135) |
0.1 | 0.3 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.1 | 0.2 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
0.1 | 0.6 | GO:0048539 | bone marrow development(GO:0048539) |
0.1 | 0.3 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.1 | 0.2 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
0.1 | 0.4 | GO:0030035 | microspike assembly(GO:0030035) |
0.1 | 0.4 | GO:0090427 | activation of meiosis(GO:0090427) |
0.1 | 0.1 | GO:0021571 | rhombomere 5 development(GO:0021571) |
0.1 | 0.2 | GO:0060435 | bronchiole development(GO:0060435) |
0.1 | 0.2 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.1 | 0.2 | GO:2000437 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
0.1 | 0.3 | GO:0003257 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) |
0.1 | 0.4 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.1 | 0.2 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
0.1 | 0.4 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.1 | 0.1 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) |
0.1 | 0.2 | GO:0061010 | gall bladder development(GO:0061010) |
0.1 | 0.6 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.1 | 0.4 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.1 | 0.3 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.1 | 0.2 | GO:0008355 | olfactory learning(GO:0008355) |
0.1 | 0.2 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.1 | 0.3 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.1 | 0.1 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.1 | 0.3 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.1 | 0.3 | GO:0042637 | catagen(GO:0042637) |
0.1 | 1.6 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
0.1 | 0.3 | GO:0046959 | habituation(GO:0046959) |
0.1 | 0.4 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.1 | 0.3 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
0.1 | 0.1 | GO:0035483 | gastric emptying(GO:0035483) |
0.1 | 0.2 | GO:0035799 | ureter maturation(GO:0035799) |
0.1 | 0.1 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.1 | 0.1 | GO:0070384 | Harderian gland development(GO:0070384) |
0.1 | 0.1 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
0.1 | 0.2 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.1 | 0.3 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.1 | 0.1 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) prostate gland morphogenetic growth(GO:0060737) |
0.1 | 0.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.1 | 0.4 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.1 | 0.3 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
0.1 | 0.2 | GO:2000053 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.1 | 0.2 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.1 | 0.3 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 0.3 | GO:0097688 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.1 | 0.1 | GO:0035290 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
0.1 | 0.2 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.1 | 0.1 | GO:0043134 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
0.1 | 0.2 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.1 | 2.4 | GO:0055078 | sodium ion homeostasis(GO:0055078) |
0.1 | 0.2 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.1 | 0.2 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.1 | 0.2 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.1 | 0.5 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.1 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.1 | 0.1 | GO:0035910 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.1 | 0.1 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.1 | 0.2 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.1 | 0.5 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.2 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.1 | 0.1 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.1 | 0.1 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
0.1 | 0.4 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.1 | 0.1 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.1 | 0.7 | GO:0036035 | osteoclast development(GO:0036035) |
0.1 | 0.5 | GO:2001223 | negative regulation of neuron migration(GO:2001223) |
0.1 | 0.2 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.1 | 0.2 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.1 | 0.1 | GO:2000974 | negative regulation of pro-B cell differentiation(GO:2000974) |
0.1 | 0.4 | GO:1990118 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.1 | 0.2 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.1 | 0.8 | GO:0030903 | notochord development(GO:0030903) |
0.1 | 0.2 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.1 | 0.9 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
0.1 | 1.0 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
0.1 | 0.4 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
0.1 | 0.6 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.2 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.1 | 0.2 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
0.1 | 0.2 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.1 | 0.2 | GO:0060527 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
0.1 | 0.2 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.0 | 0.2 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.0 | 0.1 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.0 | 0.2 | GO:0001705 | ectoderm formation(GO:0001705) |
0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.5 | GO:0042711 | maternal behavior(GO:0042711) |
0.0 | 0.1 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.0 | 0.1 | GO:0072198 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.0 | 0.0 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
0.0 | 0.1 | GO:0097503 | sialylation(GO:0097503) |
0.0 | 0.2 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.0 | 0.1 | GO:2001225 | regulation of chloride transport(GO:2001225) |
0.0 | 0.1 | GO:0060214 | endocardium formation(GO:0060214) |
0.0 | 0.1 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.0 | 0.6 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
0.0 | 0.4 | GO:0046541 | saliva secretion(GO:0046541) |
0.0 | 0.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.0 | 0.0 | GO:0060638 | mesenchymal-epithelial cell signaling(GO:0060638) |
0.0 | 0.1 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.0 | 0.1 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.0 | 0.3 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
0.0 | 0.2 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.2 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.0 | 0.0 | GO:0035907 | dorsal aorta development(GO:0035907) dorsal aorta morphogenesis(GO:0035912) |
0.0 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.0 | 0.1 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
0.0 | 0.2 | GO:0002159 | desmosome assembly(GO:0002159) |
0.0 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.0 | 0.2 | GO:0015822 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.0 | 0.4 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
0.0 | 0.1 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
0.0 | 0.3 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
0.0 | 0.0 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
0.0 | 0.2 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.0 | 0.0 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
0.0 | 0.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.0 | 0.1 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
0.0 | 0.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.0 | 0.2 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.0 | 0.2 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.0 | 0.2 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.0 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.0 | 0.2 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.0 | 0.0 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.0 | 0.2 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.0 | 0.2 | GO:0086070 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) SA node cell to atrial cardiac muscle cell communication(GO:0086070) |
0.0 | 0.1 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.0 | 0.1 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.0 | 0.1 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
0.0 | 0.1 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.0 | 0.1 | GO:1902966 | protein localization to early endosome(GO:1902946) regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
0.0 | 0.2 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.0 | 0.3 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.0 | 0.1 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
0.0 | 0.0 | GO:0048865 | stem cell fate commitment(GO:0048865) |
0.0 | 0.1 | GO:0060745 | mammary gland branching involved in pregnancy(GO:0060745) |
0.0 | 0.2 | GO:0019336 | phenol-containing compound catabolic process(GO:0019336) |
0.0 | 0.1 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.3 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
0.0 | 0.1 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.0 | 0.1 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.0 | 0.2 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.0 | 0.3 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
0.0 | 0.0 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.0 | 0.3 | GO:0090190 | positive regulation of mesonephros development(GO:0061213) positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
0.0 | 0.2 | GO:0099625 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
0.0 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.0 | 0.0 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
0.0 | 0.0 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.0 | 0.1 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.0 | 0.2 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
0.0 | 0.4 | GO:0035879 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.0 | 0.3 | GO:0031643 | positive regulation of myelination(GO:0031643) |
0.0 | 0.1 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.0 | 0.2 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.0 | 0.1 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.0 | 0.3 | GO:0007144 | female meiosis I(GO:0007144) |
0.0 | 0.2 | GO:0001696 | gastric acid secretion(GO:0001696) |
0.0 | 0.1 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.0 | 0.0 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.0 | 0.1 | GO:0050904 | diapedesis(GO:0050904) |
0.0 | 0.4 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.1 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.0 | 0.3 | GO:0051446 | positive regulation of meiotic cell cycle(GO:0051446) |
0.0 | 0.3 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
0.0 | 0.1 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.0 | 0.2 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.2 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.1 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.0 | 0.1 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.0 | 0.2 | GO:0015816 | glycine transport(GO:0015816) |
0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.0 | 0.1 | GO:0046533 | negative regulation of photoreceptor cell differentiation(GO:0046533) |
0.0 | 0.5 | GO:0010107 | potassium ion import(GO:0010107) |
0.0 | 0.1 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.0 | 0.1 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.0 | 0.5 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.0 | 0.2 | GO:1901660 | calcium ion export(GO:1901660) |
0.0 | 0.1 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.1 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
0.0 | 0.1 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.0 | 0.1 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.0 | 0.1 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.0 | 0.1 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.0 | 0.1 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
0.0 | 0.2 | GO:0042737 | drug catabolic process(GO:0042737) |
0.0 | 0.0 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.0 | 0.1 | GO:0015808 | L-alanine transport(GO:0015808) |
0.0 | 0.1 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.0 | 0.1 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.0 | 0.0 | GO:0043397 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) |
0.0 | 0.1 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.0 | 0.2 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.0 | 0.1 | GO:2000650 | negative regulation of sodium ion transmembrane transporter activity(GO:2000650) |
0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.1 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.0 | 0.2 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.0 | 0.1 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.0 | 0.1 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
0.0 | 0.0 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.0 | 0.1 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.0 | 0.1 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.0 | 0.1 | GO:0006971 | hypotonic response(GO:0006971) |
0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.0 | 0.1 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.0 | 0.2 | GO:0043416 | regulation of skeletal muscle tissue regeneration(GO:0043416) |
0.0 | 0.8 | GO:0009268 | response to pH(GO:0009268) |
0.0 | 0.1 | GO:0021586 | pons maturation(GO:0021586) |
0.0 | 0.1 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.0 | 0.4 | GO:0010842 | retina layer formation(GO:0010842) |
0.0 | 0.2 | GO:0048484 | enteric nervous system development(GO:0048484) |
0.0 | 0.1 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.0 | 0.1 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.2 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
0.0 | 0.0 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.0 | 0.3 | GO:0048665 | neuron fate specification(GO:0048665) |
0.0 | 0.1 | GO:0060631 | regulation of meiosis I(GO:0060631) |
0.0 | 0.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.0 | 0.2 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.0 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.0 | 0.0 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.0 | 0.1 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.0 | 0.1 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.0 | 0.0 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.0 | 0.1 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.0 | 0.1 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.0 | 0.0 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.2 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.0 | 0.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.0 | 0.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.0 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.0 | 1.8 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
0.0 | 0.0 | GO:0071679 | commissural neuron axon guidance(GO:0071679) |
0.0 | 0.0 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.0 | 0.1 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
0.0 | 0.0 | GO:0071655 | macrophage colony-stimulating factor production(GO:0036301) granulocyte colony-stimulating factor production(GO:0071611) regulation of granulocyte colony-stimulating factor production(GO:0071655) regulation of macrophage colony-stimulating factor production(GO:1901256) |
0.0 | 0.1 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.0 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.0 | 0.1 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.0 | 0.1 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.1 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.0 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.0 | 0.4 | GO:0030514 | negative regulation of BMP signaling pathway(GO:0030514) |
0.0 | 0.0 | GO:0014832 | urinary bladder smooth muscle contraction(GO:0014832) urinary tract smooth muscle contraction(GO:0014848) |
0.0 | 0.0 | GO:2000668 | dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
0.0 | 0.2 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.0 | 0.0 | GO:0048382 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) mesendoderm development(GO:0048382) |
0.0 | 0.1 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.0 | 0.0 | GO:1903935 | response to sodium arsenite(GO:1903935) |
0.0 | 0.1 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.2 | GO:0045056 | transcytosis(GO:0045056) |
0.0 | 0.0 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.0 | 0.1 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.0 | 0.0 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.0 | 0.2 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.1 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
0.0 | 0.1 | GO:0030578 | PML body organization(GO:0030578) |
0.0 | 0.3 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.0 | GO:0090237 | regulation of arachidonic acid secretion(GO:0090237) |
0.0 | 0.0 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.0 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.0 | 0.1 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.0 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.0 | 0.0 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.3 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.1 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.0 | 0.0 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.0 | 0.1 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.2 | GO:0060065 | uterus development(GO:0060065) |
0.0 | 0.1 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.0 | 0.0 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.0 | 0.1 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.0 | 0.1 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.0 | 0.0 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.0 | 0.0 | GO:0035697 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) |
0.0 | 0.0 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.0 | 0.1 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.0 | 0.1 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.0 | 0.0 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.1 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.0 | GO:0002339 | B cell selection(GO:0002339) |
0.0 | 0.0 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.0 | 0.0 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.0 | 0.1 | GO:0051451 | myoblast migration(GO:0051451) |
0.0 | 0.0 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.0 | 0.1 | GO:0071493 | cellular response to UV-B(GO:0071493) |
0.0 | 0.1 | GO:0033574 | response to testosterone(GO:0033574) |
0.0 | 0.0 | GO:0019064 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.0 | 0.1 | GO:0007614 | short-term memory(GO:0007614) |
0.0 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.1 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.0 | 0.1 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.0 | 0.1 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.0 | 0.1 | GO:1901890 | positive regulation of cell junction assembly(GO:1901890) |
0.0 | 0.1 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
0.0 | 0.1 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.0 | 0.0 | GO:0042695 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.0 | 0.1 | GO:0021670 | lateral ventricle development(GO:0021670) |
0.0 | 0.1 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.0 | 0.0 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.0 | 0.8 | GO:0007566 | embryo implantation(GO:0007566) |
0.0 | 0.1 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.0 | 0.0 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) |
0.0 | 0.0 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
0.0 | 0.0 | GO:1901858 | regulation of mitochondrial DNA metabolic process(GO:1901858) |
0.0 | 0.0 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.0 | GO:0032762 | mast cell cytokine production(GO:0032762) regulation of mast cell cytokine production(GO:0032763) |
0.0 | 0.0 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.0 | 0.1 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.2 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.1 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.0 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
0.0 | 0.1 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.2 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
0.0 | 0.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.0 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.0 | 0.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.0 | 0.0 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.0 | 0.1 | GO:1903963 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
0.0 | 0.2 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.0 | 0.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.3 | GO:0072337 | modified amino acid transport(GO:0072337) |
0.0 | 0.2 | GO:1903859 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.0 | 0.1 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.0 | 0.1 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
0.0 | 0.0 | GO:0044849 | estrous cycle(GO:0044849) |
0.0 | 0.1 | GO:0060749 | mammary gland alveolus development(GO:0060749) mammary gland lobule development(GO:0061377) |
0.0 | 0.1 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.0 | 0.6 | GO:0016525 | negative regulation of angiogenesis(GO:0016525) |
0.0 | 0.0 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.0 | 0.0 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.0 | 0.1 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.0 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.0 | GO:0071313 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.0 | 0.1 | GO:2001258 | negative regulation of cation channel activity(GO:2001258) |
0.0 | 0.0 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.0 | 0.1 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.0 | 0.1 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
0.0 | 0.0 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.0 | 0.0 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.0 | 0.0 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.0 | 0.0 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.1 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.0 | 0.0 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.0 | 0.0 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.1 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 0.1 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
0.0 | 0.0 | GO:0007619 | courtship behavior(GO:0007619) |
0.0 | 0.0 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.0 | 0.1 | GO:0001976 | neurological system process involved in regulation of systemic arterial blood pressure(GO:0001976) |
0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.0 | 0.0 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.1 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
0.0 | 0.0 | GO:0086027 | AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) AV node cell to bundle of His cell communication(GO:0086067) |
0.0 | 0.1 | GO:0071402 | cellular response to lipoprotein particle stimulus(GO:0071402) cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.1 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
0.0 | 0.0 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.0 | 0.1 | GO:0032119 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.0 | 0.0 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
0.0 | 0.0 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.0 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.1 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
0.0 | 0.3 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
0.0 | 0.0 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.0 | 0.2 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
0.0 | 0.1 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.0 | 0.0 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.0 | 0.8 | GO:0071805 | potassium ion transmembrane transport(GO:0071805) |
0.0 | 0.0 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
0.0 | 0.0 | GO:0060056 | mammary gland involution(GO:0060056) |
0.0 | 0.0 | GO:0072189 | ureter development(GO:0072189) |
0.0 | 0.0 | GO:0046655 | folic acid metabolic process(GO:0046655) |
0.0 | 0.0 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.0 | 0.1 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.0 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.0 | 0.2 | GO:0032098 | regulation of appetite(GO:0032098) |
0.0 | 0.0 | GO:0045136 | development of secondary sexual characteristics(GO:0045136) |
0.0 | 0.0 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.0 | 0.0 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.1 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
0.0 | 0.0 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.0 | 0.0 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.0 | 0.0 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.0 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.0 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.0 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.0 | 0.0 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.0 | 0.2 | GO:0009409 | response to cold(GO:0009409) |
0.0 | 0.0 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.0 | 0.1 | GO:0075733 | intracellular transport of virus(GO:0075733) multi-organism intracellular transport(GO:1902583) |
0.0 | 0.0 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.0 | 0.0 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.0 | 0.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.0 | 0.1 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
0.0 | 0.0 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.2 | GO:0007266 | Rho protein signal transduction(GO:0007266) |
0.0 | 0.2 | GO:0015909 | long-chain fatty acid transport(GO:0015909) |
0.0 | 0.1 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
0.0 | 0.1 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
0.0 | 0.1 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
0.0 | 0.0 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.0 | 0.1 | GO:0031645 | negative regulation of neurological system process(GO:0031645) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.0 | 0.0 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.0 | 0.0 | GO:1990035 | calcium ion import into cell(GO:1990035) |
0.0 | 0.0 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.0 | 0.1 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.0 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.0 | 0.0 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.0 | 0.1 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.0 | 0.1 | GO:0036315 | cellular response to sterol(GO:0036315) |
0.0 | 0.0 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.0 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.0 | 0.0 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.2 | GO:0043001 | Golgi to plasma membrane protein transport(GO:0043001) |
0.0 | 0.0 | GO:0051594 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.0 | 0.0 | GO:0035826 | rubidium ion transport(GO:0035826) |
0.0 | 0.1 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
0.0 | 0.1 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.0 | 0.0 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.2 | GO:0019933 | cAMP-mediated signaling(GO:0019933) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.8 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.2 | 0.4 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.1 | 0.4 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 1.9 | GO:0034706 | sodium channel complex(GO:0034706) |
0.1 | 0.3 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 0.3 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.1 | 1.3 | GO:0097386 | glial cell projection(GO:0097386) |
0.1 | 0.3 | GO:1990357 | terminal web(GO:1990357) |
0.1 | 0.6 | GO:0030056 | hemidesmosome(GO:0030056) |
0.1 | 0.4 | GO:0008091 | spectrin(GO:0008091) |
0.1 | 0.2 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.1 | 0.4 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 0.9 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.1 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 0.4 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 0.2 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 0.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
0.1 | 0.4 | GO:0005861 | troponin complex(GO:0005861) |
0.0 | 0.1 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.0 | 0.4 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.0 | 0.1 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.0 | 0.6 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.4 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.2 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.1 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.0 | 0.0 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.0 | 0.8 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.2 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.0 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.0 | 0.9 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.6 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.3 | GO:0043194 | axon initial segment(GO:0043194) |
0.0 | 0.2 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.0 | 1.2 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.0 | 0.3 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.0 | 0.3 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.4 | GO:0005916 | fascia adherens(GO:0005916) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 2.1 | GO:0034705 | potassium channel complex(GO:0034705) |
0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.0 | 0.1 | GO:0033268 | node of Ranvier(GO:0033268) |
0.0 | 0.3 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.2 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.3 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 0.2 | GO:0072687 | meiotic spindle(GO:0072687) |
0.0 | 0.1 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.0 | 0.2 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.1 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
0.0 | 0.2 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.0 | 0.1 | GO:1990462 | omegasome(GO:1990462) |
0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.0 | 0.4 | GO:0008305 | integrin complex(GO:0008305) |
0.0 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.1 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 0.8 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 1.1 | GO:0031526 | brush border membrane(GO:0031526) |
0.0 | 0.7 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
0.0 | 0.1 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.0 | 0.2 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.4 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.1 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 0.6 | GO:0060170 | ciliary membrane(GO:0060170) |
0.0 | 0.2 | GO:0030673 | axolemma(GO:0030673) |
0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 0.5 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.0 | 0.7 | GO:0032421 | stereocilium bundle(GO:0032421) |
0.0 | 1.7 | GO:0042383 | sarcolemma(GO:0042383) |
0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 0.1 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.1 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.0 | 0.5 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.1 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.0 | 0.0 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.0 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.1 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.2 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 1.9 | GO:0044306 | neuron projection terminus(GO:0044306) |
0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 0.2 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.1 | GO:0071437 | invadopodium(GO:0071437) |
0.0 | 0.0 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.2 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.0 | 0.1 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.2 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.1 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 0.0 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
0.0 | 0.1 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 0.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.0 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 0.5 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.0 | 0.1 | GO:0031011 | Ino80 complex(GO:0031011) |
0.0 | 3.7 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.1 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.2 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.1 | GO:0044453 | nuclear membrane part(GO:0044453) |
0.0 | 0.0 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.8 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.2 | 0.7 | GO:0035939 | microsatellite binding(GO:0035939) |
0.2 | 0.6 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.2 | 0.7 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.2 | 0.9 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.2 | 1.1 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.1 | 0.5 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 1.6 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 0.4 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.1 | 0.4 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 0.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.1 | 0.7 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.1 | 0.3 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.1 | 1.9 | GO:0030506 | ankyrin binding(GO:0030506) |
0.1 | 0.5 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.1 | 0.4 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.1 | 0.3 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.1 | 0.4 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.2 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.1 | 1.1 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.1 | 0.5 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.1 | 0.4 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.1 | 0.2 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.1 | 0.4 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 0.4 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 0.2 | GO:0051870 | methotrexate binding(GO:0051870) |
0.1 | 0.2 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.1 | 0.5 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.2 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.1 | 0.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.2 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.1 | 0.2 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.1 | 0.4 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.1 | 0.2 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.1 | 1.9 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.1 | 0.7 | GO:0048185 | activin binding(GO:0048185) |
0.1 | 0.8 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.1 | 0.2 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.1 | 0.3 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 0.2 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.1 | 0.2 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.2 | GO:0009374 | biotin binding(GO:0009374) |
0.1 | 0.3 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.1 | 0.5 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.1 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.0 | 0.2 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.0 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.5 | GO:0001846 | opsonin binding(GO:0001846) |
0.0 | 0.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.0 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.5 | GO:0015385 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.0 | 0.2 | GO:0038132 | neuregulin binding(GO:0038132) |
0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.0 | 0.6 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.6 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.0 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.0 | 0.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 0.5 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.4 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 2.9 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.3 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.0 | 0.5 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.2 | GO:0043829 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
0.0 | 0.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.0 | 0.2 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.0 | 0.8 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.3 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.0 | 0.1 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.0 | 0.4 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.0 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.2 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.0 | 0.3 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.1 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.0 | 0.1 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.0 | 0.5 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.0 | 0.1 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.0 | 0.2 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.2 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.0 | 0.2 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.9 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.0 | 0.5 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.1 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.2 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.0 | 0.1 | GO:0030172 | troponin C binding(GO:0030172) |
0.0 | 0.1 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.0 | 0.1 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.3 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.2 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.3 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.6 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.3 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 1.0 | GO:0098531 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.0 | 0.2 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 1.8 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.0 | 0.9 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.2 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.2 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.0 | 0.2 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.0 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.0 | 0.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.7 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 0.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.1 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.0 | 0.2 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.0 | 0.1 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.1 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.0 | 0.1 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.0 | 0.0 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.0 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.0 | 0.0 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 0.2 | GO:0031402 | sodium ion binding(GO:0031402) |
0.0 | 0.5 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.1 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.0 | 0.0 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.0 | 0.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.3 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.0 | 0.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.0 | 0.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.0 | 0.3 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.1 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 0.2 | GO:0090079 | translation regulator activity, nucleic acid binding(GO:0090079) |
0.0 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.8 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.0 | 0.3 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.2 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.7 | GO:0008009 | chemokine activity(GO:0008009) |
0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.0 | 0.2 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 0.2 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.3 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.0 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.1 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.2 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.0 | 0.3 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.3 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.0 | 0.2 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.0 | 0.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.3 | GO:0042805 | actinin binding(GO:0042805) |
0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 1.8 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 0.3 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.0 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.2 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.0 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.0 | 0.3 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.0 | 0.3 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.0 | 0.1 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.1 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.0 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.0 | 0.1 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 0.0 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.1 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.0 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 0.1 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 0.2 | GO:0045182 | translation regulator activity(GO:0045182) |
0.0 | 0.3 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.0 | 0.0 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.3 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.1 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.0 | 0.0 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.3 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.0 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.0 | 0.1 | GO:0015922 | aspartate oxidase activity(GO:0015922) |
0.0 | 0.0 | GO:0031433 | telethonin binding(GO:0031433) |
0.0 | 0.0 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.0 | 0.1 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.0 | 0.1 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.0 | 0.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.0 | 0.0 | GO:0050693 | LBD domain binding(GO:0050693) |
0.0 | 0.0 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.0 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.1 | GO:0022840 | leak channel activity(GO:0022840) potassium ion leak channel activity(GO:0022841) narrow pore channel activity(GO:0022842) |
0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.7 | GO:0016247 | channel regulator activity(GO:0016247) |
0.0 | 0.0 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.0 | 0.1 | GO:0010851 | cyclase regulator activity(GO:0010851) guanylate cyclase regulator activity(GO:0030249) |
0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.1 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 0.2 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.1 | 2.6 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.1 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.8 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.2 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.5 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.9 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 1.0 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.8 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.4 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.1 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.1 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.5 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 0.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.1 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.5 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.2 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.8 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.4 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.1 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.4 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.0 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 4.3 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 1.9 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 1.9 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.1 | ST ADRENERGIC | Adrenergic Pathway |
0.0 | 0.0 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.3 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.1 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.0 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.1 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 2.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 0.8 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 0.8 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 0.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.1 | 0.5 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.1 | 0.1 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.1 | 2.1 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 0.8 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 1.8 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.1 | 0.7 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.0 | 0.7 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.8 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 0.3 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
0.0 | 0.4 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.0 | 0.3 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.3 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.0 | 0.4 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.3 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 0.9 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.0 | 0.4 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 1.1 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 1.3 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.5 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.3 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.0 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.0 | 0.6 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.6 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 2.0 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 0.3 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.1 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.6 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.0 | 0.5 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.1 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.0 | 0.2 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.9 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 1.0 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.0 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.0 | 1.1 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.2 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 0.0 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.1 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
0.0 | 0.2 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.2 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.3 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.0 | 0.6 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.3 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.2 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.2 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 0.1 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.0 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.0 | 0.2 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.0 | 0.0 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
0.0 | 0.2 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.0 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.0 | 0.2 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.0 | 0.3 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 1.4 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.0 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.3 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.3 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.8 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.1 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.1 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.1 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.0 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.2 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.0 | REACTOME CELL CELL COMMUNICATION | Genes involved in Cell-Cell communication |
0.0 | 0.0 | REACTOME TCR SIGNALING | Genes involved in TCR signaling |
0.0 | 0.2 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 0.3 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 0.8 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |