Gene Symbol | Gene ID | Gene Info |
---|---|---|
Foxo6
|
ENSMUSG00000052135.8 | Foxo6 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Foxo6 | chr4_120286678_120287988 | 16 | 0.979926 | 0.48 | 1.2e-04 | Click! |
Foxo6 | chr4_120282318_120283616 | 4382 | 0.243104 | 0.43 | 7.1e-04 | Click! |
Foxo6 | chr4_120285738_120286051 | 1455 | 0.441069 | 0.42 | 7.4e-04 | Click! |
Foxo6 | chr4_120285395_120285699 | 1802 | 0.377862 | 0.40 | 1.4e-03 | Click! |
Foxo6 | chr4_120284104_120284440 | 3077 | 0.276120 | 0.34 | 7.0e-03 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr8_70119024_70120981 | 2.58 |
Ncan |
neurocan |
871 |
0.35 |
chr7_62417849_62418010 | 2.47 |
Mkrn3 |
makorin, ring finger protein, 3 |
2210 |
0.26 |
chr1_32174771_32175297 | 2.24 |
Khdrbs2 |
KH domain containing, RNA binding, signal transduction associated 2 |
2147 |
0.41 |
chr6_136171003_136171483 | 2.21 |
Grin2b |
glutamate receptor, ionotropic, NMDA2B (epsilon 2) |
646 |
0.69 |
chrX_48520840_48520991 | 2.11 |
Rab33a |
RAB33A, member RAS oncogene family |
1630 |
0.33 |
chr10_110454837_110455019 | 2.08 |
Nav3 |
neuron navigator 3 |
1276 |
0.51 |
chr13_117603755_117604285 | 2.06 |
Hcn1 |
hyperpolarization activated cyclic nucleotide gated potassium channel 1 |
1540 |
0.54 |
chr3_5223526_5223955 | 2.03 |
Zfhx4 |
zinc finger homeodomain 4 |
2235 |
0.28 |
chr13_109442519_109443753 | 1.99 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
953 |
0.73 |
chr10_64086822_64087463 | 1.79 |
Lrrtm3 |
leucine rich repeat transmembrane neuronal 3 |
3105 |
0.4 |
chr18_69595622_69596635 | 1.79 |
Tcf4 |
transcription factor 4 |
1946 |
0.44 |
chr7_44443183_44443767 | 1.78 |
Lrrc4b |
leucine rich repeat containing 4B |
738 |
0.4 |
chr11_42422264_42422415 | 1.74 |
Gabrb2 |
gamma-aminobutyric acid (GABA) A receptor, subunit beta 2 |
989 |
0.7 |
chr1_143640264_143641520 | 1.72 |
B3galt2 |
UDP-Gal:betaGlcNAc beta 1,3-galactosyltransferase, polypeptide 2 |
228 |
0.59 |
chr18_6513819_6514449 | 1.67 |
Epc1 |
enhancer of polycomb homolog 1 |
1974 |
0.29 |
chr6_63258040_63258352 | 1.66 |
9330118I20Rik |
RIKEN cDNA 9330118I20 gene |
571 |
0.68 |
chr9_35424475_35426234 | 1.65 |
Cdon |
cell adhesion molecule-related/down-regulated by oncogenes |
1766 |
0.31 |
chr4_6987725_6988203 | 1.64 |
Tox |
thymocyte selection-associated high mobility group box |
2519 |
0.39 |
chr12_49386539_49386878 | 1.61 |
Gm43517 |
predicted gene 43517 |
1534 |
0.27 |
chr12_46815602_46816139 | 1.61 |
Nova1 |
NOVA alternative splicing regulator 1 |
1090 |
0.54 |
chr12_38783979_38784442 | 1.59 |
Etv1 |
ets variant 1 |
701 |
0.73 |
chr1_66388178_66389004 | 1.58 |
Map2 |
microtubule-associated protein 2 |
1580 |
0.42 |
chrX_12763822_12763973 | 1.41 |
Gm14634 |
predicted gene 14634 |
1353 |
0.37 |
chr3_8509825_8511666 | 1.40 |
Stmn2 |
stathmin-like 2 |
1159 |
0.54 |
chr5_107498769_107499247 | 1.40 |
Btbd8 |
BTB (POZ) domain containing 8 |
1229 |
0.33 |
chr1_66322405_66322814 | 1.37 |
Map2 |
microtubule-associated protein 2 |
507 |
0.79 |
chr2_180026566_180026717 | 1.35 |
Lsm14b |
LSM family member 14B |
243 |
0.88 |
chr6_32586393_32586563 | 1.34 |
Plxna4 |
plexin A4 |
1714 |
0.42 |
chr5_43236846_43237650 | 1.34 |
Cpeb2 |
cytoplasmic polyadenylation element binding protein 2 |
67 |
0.96 |
chr5_111425949_111427685 | 1.33 |
Gm43119 |
predicted gene 43119 |
3228 |
0.22 |
chr17_36181694_36181845 | 1.31 |
Gm20495 |
predicted gene 20495 |
661 |
0.31 |
chr5_131531462_131532675 | 1.24 |
Auts2 |
autism susceptibility candidate 2 |
2329 |
0.29 |
chr11_54596156_54596462 | 1.24 |
Rapgef6 |
Rap guanine nucleotide exchange factor (GEF) 6 |
135 |
0.97 |
chr8_41052368_41053980 | 1.23 |
Gm16193 |
predicted gene 16193 |
64 |
0.96 |
chr10_103023713_103024276 | 1.20 |
Alx1 |
ALX homeobox 1 |
221 |
0.94 |
chr9_45117853_45119000 | 1.20 |
Scn2b |
sodium channel, voltage-gated, type II, beta |
545 |
0.57 |
chr6_55680133_55680881 | 1.19 |
Neurod6 |
neurogenic differentiation 6 |
756 |
0.69 |
chr3_59342632_59342783 | 1.19 |
Igsf10 |
immunoglobulin superfamily, member 10 |
1452 |
0.3 |
chr13_60029973_60030124 | 1.18 |
A530065N20Rik |
RIKEN cDNA A530046M15 gene |
337 |
0.87 |
chr14_76421824_76421975 | 1.18 |
Tsc22d1 |
TSC22 domain family, member 1 |
3071 |
0.34 |
chr3_106724914_106725065 | 1.17 |
Gm38253 |
predicted gene, 38253 |
610 |
0.71 |
chr7_137311015_137311991 | 1.17 |
Ebf3 |
early B cell factor 3 |
2413 |
0.29 |
chrX_75577044_75577513 | 1.15 |
Rab39b |
RAB39B, member RAS oncogene family |
953 |
0.4 |
chr8_61229531_61230140 | 1.13 |
Sh3rf1 |
SH3 domain containing ring finger 1 |
5591 |
0.22 |
chr12_70344161_70344678 | 1.13 |
Trim9 |
tripartite motif-containing 9 |
2670 |
0.25 |
chr5_9723072_9723239 | 1.10 |
Grm3 |
glutamate receptor, metabotropic 3 |
2015 |
0.37 |
chr2_6883618_6884699 | 1.10 |
Gm13389 |
predicted gene 13389 |
112 |
0.85 |
chr4_34328044_34328577 | 1.09 |
Gm12751 |
predicted gene 12751 |
25733 |
0.18 |
chr14_110752538_110752819 | 1.09 |
Slitrk6 |
SLIT and NTRK-like family, member 6 |
2471 |
0.26 |
chr4_82915737_82916950 | 1.09 |
Frem1 |
Fras1 related extracellular matrix protein 1 |
1909 |
0.38 |
chr2_55439535_55439810 | 1.08 |
Kcnj3 |
potassium inwardly-rectifying channel, subfamily J, member 3 |
2507 |
0.37 |
chr3_154325337_154325672 | 1.08 |
Lhx8 |
LIM homeobox protein 8 |
621 |
0.74 |
chr2_134788469_134789062 | 1.08 |
Plcb1 |
phospholipase C, beta 1 |
2235 |
0.3 |
chr10_58815948_58816985 | 1.06 |
Sh3rf3 |
SH3 domain containing ring finger 3 |
2407 |
0.27 |
chr8_71567423_71567574 | 1.04 |
Nxnl1 |
nucleoredoxin-like 1 |
897 |
0.29 |
chr2_136713069_136714459 | 1.04 |
Snap25 |
synaptosomal-associated protein 25 |
286 |
0.92 |
chr3_45379351_45381850 | 1.03 |
Pcdh10 |
protocadherin 10 |
2033 |
0.25 |
chr13_34125172_34126139 | 1.03 |
Tubb2b |
tubulin, beta 2B class IIB |
4699 |
0.12 |
chr11_54596531_54596823 | 1.01 |
Rapgef6 |
Rap guanine nucleotide exchange factor (GEF) 6 |
503 |
0.82 |
chr3_149190517_149191107 | 1.01 |
Gm42647 |
predicted gene 42647 |
19459 |
0.21 |
chr4_9019889_9020169 | 1.01 |
Rps18-ps2 |
ribosomal protein S18, pseudogene 2 |
78770 |
0.11 |
chr2_37519004_37519477 | 1.00 |
Gpr21 |
G protein-coupled receptor 21 |
2614 |
0.2 |
chr1_138346039_138346510 | 1.00 |
Gm28500 |
predicted gene 28500 |
30990 |
0.17 |
chr19_59072869_59073575 | 0.99 |
Shtn1 |
shootin 1 |
2847 |
0.26 |
chr6_118011118_118012108 | 0.99 |
Rasgef1a |
RasGEF domain family, member 1A |
175 |
0.94 |
chr7_105784070_105785178 | 0.99 |
Dchs1 |
dachsous cadherin related 1 |
2928 |
0.14 |
chr14_93701256_93701943 | 0.99 |
Gm48967 |
predicted gene, 48967 |
82753 |
0.1 |
chr4_22483631_22483884 | 0.97 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
4609 |
0.19 |
chr17_85796098_85796249 | 0.97 |
Gm29418 |
predicted gene 29418 |
27871 |
0.21 |
chr5_37821115_37822599 | 0.96 |
Msx1 |
msh homeobox 1 |
2725 |
0.28 |
chr2_156422539_156423005 | 0.95 |
Epb41l1 |
erythrocyte membrane protein band 4.1 like 1 |
1660 |
0.2 |
chr14_110753127_110753447 | 0.95 |
Slitrk6 |
SLIT and NTRK-like family, member 6 |
1862 |
0.32 |
chr8_48900291_48900442 | 0.94 |
Gm19744 |
predicted gene, 19744 |
44949 |
0.15 |
chr3_55785698_55785971 | 0.94 |
Nbea |
neurobeachin |
1068 |
0.52 |
chr5_115214824_115215967 | 0.93 |
Gm13828 |
predicted gene 13828 |
17052 |
0.08 |
chr4_88716105_88716256 | 0.93 |
Gm26566 |
predicted gene, 26566 |
5625 |
0.05 |
chr13_97248475_97250229 | 0.92 |
Enc1 |
ectodermal-neural cortex 1 |
8247 |
0.17 |
chrX_69363262_69363944 | 0.92 |
Gm14705 |
predicted gene 14705 |
2334 |
0.33 |
chr16_63860769_63861945 | 0.92 |
Epha3 |
Eph receptor A3 |
2056 |
0.46 |
chr16_66657056_66657245 | 0.91 |
1700010K23Rik |
RIKEN cDNA 1700010K23 gene |
32 |
0.99 |
chr9_61376232_61377980 | 0.91 |
Tle3 |
transducin-like enhancer of split 3 |
1577 |
0.38 |
chrX_104198423_104198882 | 0.91 |
Nexmif |
neurite extension and migration factor |
2465 |
0.34 |
chr18_54982401_54983349 | 0.91 |
Zfp608 |
zinc finger protein 608 |
7291 |
0.21 |
chr9_90699202_90699438 | 0.91 |
Gm2497 |
predicted gene 2497 |
34204 |
0.15 |
chr2_80126598_80127760 | 0.90 |
Pde1a |
phosphodiesterase 1A, calmodulin-dependent |
1655 |
0.42 |
chr1_56967796_56968470 | 0.90 |
Satb2 |
special AT-rich sequence binding protein 2 |
1707 |
0.32 |
chr6_132414173_132414324 | 0.90 |
Gm44003 |
predicted gene, 44003 |
24873 |
0.1 |
chr13_83741336_83742027 | 0.89 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
2818 |
0.16 |
chr11_55607331_55608633 | 0.89 |
Glra1 |
glycine receptor, alpha 1 subunit |
161 |
0.96 |
chr10_123267201_123267837 | 0.89 |
Tafa2 |
TAFA chemokine like family member 2 |
2534 |
0.32 |
chr4_110281444_110282224 | 0.88 |
Elavl4 |
ELAV like RNA binding protein 4 |
4782 |
0.33 |
chrX_43425298_43425483 | 0.88 |
Tenm1 |
teneurin transmembrane protein 1 |
3613 |
0.26 |
chr18_62926248_62926888 | 0.88 |
Apcdd1 |
adenomatosis polyposis coli down-regulated 1 |
4062 |
0.23 |
chr5_138618566_138618717 | 0.88 |
Gm42815 |
predicted gene 42815 |
647 |
0.47 |
chr12_61446972_61447123 | 0.88 |
Nanog-ps2 |
Nanog pseudogene 2 |
11463 |
0.23 |
chr2_4017802_4019015 | 0.87 |
Frmd4a |
FERM domain containing 4A |
664 |
0.68 |
chr13_78938362_78938571 | 0.87 |
Gm8345 |
predicted gene 8345 |
16326 |
0.29 |
chr15_97607571_97607856 | 0.87 |
Gm49506 |
predicted gene, 49506 |
49423 |
0.13 |
chr1_191300499_191300650 | 0.86 |
Nenf |
neuron derived neurotrophic factor |
17620 |
0.13 |
chr10_82112715_82112929 | 0.86 |
AU041133 |
expressed sequence AU041133 |
15191 |
0.11 |
chr14_122465313_122465487 | 0.86 |
Zic5 |
zinc finger protein of the cerebellum 5 |
277 |
0.85 |
chr16_42189874_42190332 | 0.85 |
Gm49737 |
predicted gene, 49737 |
5186 |
0.22 |
chr8_96864581_96864934 | 0.85 |
Gm24132 |
predicted gene, 24132 |
208628 |
0.02 |
chr2_103588658_103588899 | 0.84 |
Abtb2 |
ankyrin repeat and BTB (POZ) domain containing 2 |
22468 |
0.18 |
chr2_57613916_57615034 | 0.84 |
Gm13532 |
predicted gene 13532 |
14753 |
0.2 |
chr1_98174711_98174964 | 0.84 |
Gm29461 |
predicted gene 29461 |
1189 |
0.52 |
chr1_35850021_35850443 | 0.84 |
1110002O04Rik |
RIKEN cDNA 1110002O04 gene |
29613 |
0.16 |
chr5_99728012_99728562 | 0.83 |
Rasgef1b |
RasGEF domain family, member 1B |
525 |
0.75 |
chr5_13125231_13126281 | 0.83 |
Sema3a |
sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3A |
163 |
0.95 |
chr16_90820814_90820965 | 0.83 |
Eva1c |
eva-1 homolog C (C. elegans) |
5830 |
0.15 |
chr3_107041271_107042100 | 0.83 |
AI504432 |
expressed sequence AI504432 |
2181 |
0.26 |
chr14_33977643_33977794 | 0.83 |
Zfp488 |
zinc finger protein 488 |
1046 |
0.4 |
chr12_114648625_114648776 | 0.83 |
Ighv1-14 |
immunoglobulin heavy variable 1-14 |
1644 |
0.24 |
chr16_60601453_60601735 | 0.82 |
Gm9017 |
predicted gene 9017 |
3172 |
0.22 |
chr3_79736867_79737018 | 0.82 |
Rxfp1 |
relaxin/insulin-like family peptide receptor 1 |
852 |
0.63 |
chr14_79766436_79766914 | 0.82 |
Gm9748 |
predicted gene 9748 |
3233 |
0.19 |
chr17_81667343_81667494 | 0.82 |
Slc8a1 |
solute carrier family 8 (sodium/calcium exchanger), member 1 |
2769 |
0.4 |
chr18_28077524_28077955 | 0.81 |
Gm5064 |
predicted gene 5064 |
111078 |
0.07 |
chr7_4842515_4843640 | 0.81 |
Shisa7 |
shisa family member 7 |
1619 |
0.18 |
chr10_25199343_25200463 | 0.80 |
Akap7 |
A kinase (PRKA) anchor protein 7 |
255 |
0.93 |
chr3_126643766_126643962 | 0.80 |
Gm43009 |
predicted gene 43009 |
597 |
0.63 |
chr12_61523440_61524787 | 0.80 |
Lrfn5 |
leucine rich repeat and fibronectin type III domain containing 5 |
165 |
0.95 |
chr13_116304809_116305674 | 0.79 |
Isl1 |
ISL1 transcription factor, LIM/homeodomain |
1156 |
0.55 |
chrX_168121584_168121735 | 0.79 |
Frmpd4 |
FERM and PDZ domain containing 4 |
1167 |
0.6 |
chr14_124191277_124191428 | 0.79 |
Fgf14 |
fibroblast growth factor 14 |
1550 |
0.55 |
chr7_12841716_12842371 | 0.79 |
Zfp110 |
zinc finger protein 110 |
5752 |
0.09 |
chr1_57224300_57224879 | 0.77 |
BC055402 |
cDNA sequence BC055402 |
9596 |
0.23 |
chr5_84413029_84413589 | 0.76 |
Epha5 |
Eph receptor A5 |
3497 |
0.31 |
chr15_37205881_37206032 | 0.76 |
Gm8664 |
predicted gene 8664 |
23255 |
0.12 |
chr2_44060535_44060772 | 0.76 |
Arhgap15 |
Rho GTPase activating protein 15 |
4388 |
0.27 |
chr9_45370028_45371246 | 0.75 |
Fxyd6 |
FXYD domain-containing ion transport regulator 6 |
195 |
0.91 |
chr18_43058416_43059778 | 0.75 |
Ppp2r2b |
protein phosphatase 2, regulatory subunit B, beta |
374 |
0.86 |
chrX_169829262_169829609 | 0.75 |
Mid1 |
midline 1 |
1276 |
0.55 |
chr4_55526186_55526344 | 0.75 |
Klf4 |
Kruppel-like factor 4 (gut) |
5505 |
0.17 |
chr10_119820571_119821220 | 0.74 |
Grip1 |
glutamate receptor interacting protein 1 |
1370 |
0.48 |
chr12_73042328_73042946 | 0.74 |
Six1 |
sine oculis-related homeobox 1 |
178 |
0.95 |
chr19_44296570_44297359 | 0.74 |
Scd2 |
stearoyl-Coenzyme A desaturase 2 |
2888 |
0.15 |
chr15_72805381_72805998 | 0.74 |
Peg13 |
paternally expressed 13 |
4635 |
0.28 |
chr2_116061308_116062718 | 0.73 |
Meis2 |
Meis homeobox 2 |
347 |
0.86 |
chr5_57721137_57722906 | 0.73 |
Pcdh7 |
protocadherin 7 |
108 |
0.94 |
chr10_60133760_60133911 | 0.73 |
Mir6906 |
microRNA 6906 |
7059 |
0.2 |
chr17_15702797_15702948 | 0.73 |
Chd1 |
chromodomain helicase DNA binding protein 1 |
2095 |
0.33 |
chr2_110361449_110361600 | 0.73 |
Fibin |
fin bud initiation factor homolog (zebrafish) |
1659 |
0.42 |
chr11_88714836_88715643 | 0.73 |
Msi2 |
musashi RNA-binding protein 2 |
2862 |
0.23 |
chr13_53454655_53455466 | 0.72 |
Msx2 |
msh homeobox 2 |
18014 |
0.17 |
chr18_21593544_21593695 | 0.72 |
4930426D05Rik |
RIKEN cDNA 4930426D05 gene |
57829 |
0.13 |
chr3_133876507_133877266 | 0.72 |
Gm30484 |
predicted gene, 30484 |
58368 |
0.13 |
chr1_56969244_56970464 | 0.72 |
Satb2 |
special AT-rich sequence binding protein 2 |
14 |
0.97 |
chr15_45114048_45115133 | 0.72 |
Kcnv1 |
potassium channel, subfamily V, member 1 |
237 |
0.95 |
chr2_104814478_104815021 | 0.71 |
Qser1 |
glutamine and serine rich 1 |
1947 |
0.26 |
chr7_126823319_126824529 | 0.71 |
Fam57b |
family with sequence similarity 57, member B |
621 |
0.41 |
chr10_110452627_110452868 | 0.71 |
Nav3 |
neuron navigator 3 |
3457 |
0.28 |
chr18_82765452_82765786 | 0.71 |
2210420H20Rik |
RIKEN cDNA 2210420H20 gene |
6578 |
0.12 |
chr5_73484440_73485339 | 0.71 |
Dcun1d4 |
DCN1, defective in cullin neddylation 1, domain containing 4 (S. cerevisiae) |
445 |
0.78 |
chr6_93911862_93913573 | 0.71 |
Magi1 |
membrane associated guanylate kinase, WW and PDZ domain containing 1 |
213 |
0.95 |
chr10_56373255_56373698 | 0.70 |
Gja1 |
gap junction protein, alpha 1 |
3854 |
0.24 |
chr7_6735508_6735671 | 0.70 |
Usp29 |
ubiquitin specific peptidase 29 |
107 |
0.93 |
chr11_102609159_102609359 | 0.70 |
Fzd2 |
frizzled class receptor 2 |
4863 |
0.11 |
chr6_114284426_114284577 | 0.70 |
Slc6a1 |
solute carrier family 6 (neurotransmitter transporter, GABA), member 1 |
1711 |
0.46 |
chrX_110818058_110818665 | 0.70 |
Pou3f4 |
POU domain, class 3, transcription factor 4 |
4081 |
0.27 |
chr2_45103612_45103976 | 0.70 |
Zeb2 |
zinc finger E-box binding homeobox 2 |
6282 |
0.21 |
chr1_152407157_152407715 | 0.70 |
Gm15618 |
predicted gene 15618 |
89 |
0.97 |
chr9_113814153_113814309 | 0.70 |
Clasp2 |
CLIP associating protein 2 |
1631 |
0.43 |
chr2_20339506_20340619 | 0.69 |
Etl4 |
enhancer trap locus 4 |
238 |
0.94 |
chr10_120721676_120722691 | 0.69 |
Gm37505 |
predicted gene, 37505 |
9632 |
0.13 |
chr5_105400206_105400811 | 0.69 |
Gm26519 |
predicted gene, 26519 |
737 |
0.61 |
chr13_8205494_8206737 | 0.69 |
Adarb2 |
adenosine deaminase, RNA-specific, B2 |
3193 |
0.23 |
chr14_47986698_47986849 | 0.69 |
Gm49304 |
predicted gene, 49304 |
7030 |
0.16 |
chr3_97288619_97288770 | 0.69 |
Bcl9 |
B cell CLL/lymphoma 9 |
9223 |
0.17 |
chr17_15827995_15828281 | 0.69 |
Rgmb |
repulsive guidance molecule family member B |
1552 |
0.32 |
chr1_125909072_125909223 | 0.69 |
Lypd1 |
Ly6/Plaur domain containing 1 |
1761 |
0.38 |
chr3_54363261_54363486 | 0.68 |
Postn |
periostin, osteoblast specific factor |
2230 |
0.43 |
chr6_14904950_14905101 | 0.68 |
Foxp2 |
forkhead box P2 |
1568 |
0.56 |
chr2_20722419_20723480 | 0.68 |
Etl4 |
enhancer trap locus 4 |
324 |
0.91 |
chr8_84004085_84004783 | 0.68 |
Mir8111 |
microRNA 8111 |
1194 |
0.21 |
chr3_53043747_53045351 | 0.68 |
Gm42901 |
predicted gene 42901 |
2794 |
0.16 |
chr11_3370456_3371381 | 0.68 |
Limk2 |
LIM motif-containing protein kinase 2 |
417 |
0.76 |
chr16_40805516_40805667 | 0.68 |
Gm26381 |
predicted gene, 26381 |
412154 |
0.01 |
chr15_85681936_85682281 | 0.68 |
Lncppara |
long noncoding RNA near Ppara |
21665 |
0.12 |
chr15_6624467_6625565 | 0.67 |
Fyb |
FYN binding protein |
5422 |
0.21 |
chr7_107757713_107758343 | 0.67 |
Cyb5r2 |
cytochrome b5 reductase 2 |
4 |
0.96 |
chr2_45119197_45119672 | 0.67 |
Zeb2 |
zinc finger E-box binding homeobox 2 |
2039 |
0.33 |
chr8_57311011_57311162 | 0.67 |
Hand2os1 |
Hand2, opposite strand 1 |
561 |
0.68 |
chr15_98950561_98950712 | 0.67 |
Gm49450 |
predicted gene, 49450 |
2915 |
0.1 |
chr4_97788585_97788930 | 0.67 |
E130114P18Rik |
RIKEN cDNA E130114P18 gene |
10679 |
0.2 |
chr7_138397699_138398444 | 0.67 |
Tcerg1l |
transcription elongation regulator 1-like |
341 |
0.91 |
chr3_61368261_61368412 | 0.67 |
B430305J03Rik |
RIKEN cDNA B430305J03 gene |
2385 |
0.25 |
chr1_42505318_42505469 | 0.67 |
Gm37047 |
predicted gene, 37047 |
13580 |
0.25 |
chr6_140712946_140713097 | 0.67 |
Gm11077 |
predicted gene 11077 |
16263 |
0.19 |
chr10_30840937_30841237 | 0.66 |
Hey2 |
hairy/enhancer-of-split related with YRPW motif 2 |
928 |
0.55 |
chr1_177449667_177450314 | 0.66 |
Zbtb18 |
zinc finger and BTB domain containing 18 |
4169 |
0.18 |
chr16_38095634_38095908 | 0.66 |
Gsk3b |
glycogen synthase kinase 3 beta |
5483 |
0.24 |
chr8_54956411_54956563 | 0.66 |
Gpm6a |
glycoprotein m6a |
1644 |
0.32 |
chr16_77501809_77502037 | 0.66 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
1539 |
0.28 |
chr4_25797148_25797299 | 0.66 |
Fut9 |
fucosyltransferase 9 |
2632 |
0.27 |
chr9_10901080_10901259 | 0.66 |
Gm32710 |
predicted gene, 32710 |
3176 |
0.27 |
chr5_32713090_32713944 | 0.66 |
Gm43852 |
predicted gene 43852 |
471 |
0.7 |
chrX_164579568_164579719 | 0.65 |
Asb9 |
ankyrin repeat and SOCS box-containing 9 |
73316 |
0.11 |
chr18_13973933_13974513 | 0.65 |
Zfp521 |
zinc finger protein 521 |
1436 |
0.55 |
chr3_59007352_59007503 | 0.64 |
Med12l |
mediator complex subunit 12-like |
449 |
0.69 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.4 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.4 | 1.1 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.4 | 1.1 | GO:1903375 | cerebral cortex tangential migration using cell-axon interactions(GO:0021824) gonadotrophin-releasing hormone neuronal migration to the hypothalamus(GO:0021828) hypothalamic tangential migration using cell-axon interactions(GO:0021856) facioacoustic ganglion development(GO:1903375) |
0.3 | 0.7 | GO:0061551 | trigeminal ganglion development(GO:0061551) |
0.3 | 1.3 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.3 | 1.2 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.3 | 1.8 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.2 | 0.7 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.2 | 0.7 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.2 | 1.5 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.2 | 2.7 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.2 | 1.5 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.2 | 0.8 | GO:0090427 | activation of meiosis(GO:0090427) |
0.2 | 0.6 | GO:0021636 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) |
0.2 | 0.5 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.2 | 1.4 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.2 | 0.5 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.2 | 1.4 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.2 | 0.5 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.2 | 0.6 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.2 | 0.5 | GO:0060618 | nipple development(GO:0060618) |
0.1 | 0.4 | GO:0035910 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.1 | 0.6 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.1 | 1.6 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
0.1 | 0.7 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.1 | 0.4 | GO:0060594 | mammary gland specification(GO:0060594) |
0.1 | 0.4 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.4 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.1 | 0.4 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.1 | 0.9 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.1 | 0.5 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
0.1 | 0.2 | GO:1904023 | regulation of fermentation(GO:0043465) regulation of NAD metabolic process(GO:1902688) regulation of glucose catabolic process to lactate via pyruvate(GO:1904023) |
0.1 | 1.0 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.1 | 0.7 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.1 | 0.9 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
0.1 | 0.3 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
0.1 | 0.3 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.1 | 0.3 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.1 | 0.3 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.1 | 0.1 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.1 | 0.4 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.1 | 0.3 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.1 | 2.2 | GO:0030033 | microvillus assembly(GO:0030033) |
0.1 | 1.0 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.1 | 0.8 | GO:0071625 | vocalization behavior(GO:0071625) |
0.1 | 0.3 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 0.3 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.1 | 0.4 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 0.3 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.1 | 0.3 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.1 | 0.4 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.1 | 0.3 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.2 | GO:0021827 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.1 | 0.3 | GO:0070268 | cornification(GO:0070268) |
0.1 | 0.4 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.1 | 0.6 | GO:0048664 | neuron fate determination(GO:0048664) |
0.1 | 1.3 | GO:0031114 | regulation of microtubule depolymerization(GO:0031114) |
0.1 | 0.1 | GO:0033058 | directional locomotion(GO:0033058) |
0.1 | 0.3 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 0.2 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.1 | 0.2 | GO:0007525 | somatic muscle development(GO:0007525) |
0.1 | 0.1 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.1 | 0.1 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.1 | 0.6 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.1 | 0.4 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.1 | 0.3 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.1 | 0.3 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.1 | 0.9 | GO:0031629 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.1 | 0.1 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.1 | 0.1 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.1 | 0.3 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.1 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 0.2 | GO:0007412 | axon target recognition(GO:0007412) |
0.1 | 0.2 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.1 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.1 | 0.3 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.1 | 0.2 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.1 | 0.1 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.1 | 0.2 | GO:0072191 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
0.1 | 0.2 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.1 | 0.2 | GO:0045006 | DNA deamination(GO:0045006) |
0.1 | 0.2 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.1 | 0.8 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.1 | 0.1 | GO:0021557 | oculomotor nerve development(GO:0021557) |
0.1 | 0.5 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.1 | 0.1 | GO:0051794 | regulation of catagen(GO:0051794) |
0.1 | 0.1 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.1 | 0.3 | GO:2000794 | regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
0.1 | 0.4 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.1 | 0.2 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.1 | 0.4 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.1 | 0.2 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.1 | 0.2 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.1 | 0.2 | GO:0002877 | regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
0.1 | 0.1 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.1 | 0.5 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.1 | 0.1 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
0.1 | 0.5 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.1 | 0.2 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.1 | 0.1 | GO:0061004 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.1 | 0.4 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.2 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.0 | 2.5 | GO:0021954 | central nervous system neuron development(GO:0021954) |
0.0 | 0.2 | GO:0032530 | regulation of microvillus organization(GO:0032530) regulation of microvillus length(GO:0032532) |
0.0 | 0.1 | GO:0048371 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.0 | 0.2 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.0 | 0.1 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.0 | 0.1 | GO:0021910 | smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021910) |
0.0 | 0.2 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.0 | 0.1 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.0 | 0.3 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.0 | 0.1 | GO:0006868 | glutamine transport(GO:0006868) |
0.0 | 0.0 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
0.0 | 0.2 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
0.0 | 0.2 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.0 | 0.1 | GO:0051464 | positive regulation of cortisol secretion(GO:0051464) |
0.0 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.0 | 0.3 | GO:0019336 | phenol-containing compound catabolic process(GO:0019336) |
0.0 | 0.2 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.0 | 0.4 | GO:2000341 | regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000341) |
0.0 | 0.1 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.1 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.0 | 0.4 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
0.0 | 0.0 | GO:0045168 | cell-cell signaling involved in cell fate commitment(GO:0045168) |
0.0 | 0.5 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.2 | GO:0032278 | positive regulation of gonadotropin secretion(GO:0032278) |
0.0 | 0.8 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.0 | 0.0 | GO:0033122 | negative regulation of purine nucleotide catabolic process(GO:0033122) |
0.0 | 0.1 | GO:0007494 | midgut development(GO:0007494) |
0.0 | 0.0 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
0.0 | 0.1 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.0 | 0.2 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.0 | 0.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.0 | 0.1 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.0 | 0.2 | GO:0055015 | ventricular cardiac muscle cell development(GO:0055015) |
0.0 | 0.0 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
0.0 | 0.0 | GO:0014029 | neural crest formation(GO:0014029) |
0.0 | 0.1 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.0 | 0.2 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.2 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.0 | 0.0 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.0 | 0.1 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.0 | 0.0 | GO:2000978 | negative regulation of forebrain neuron differentiation(GO:2000978) |
0.0 | 0.1 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 0.1 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.0 | 0.2 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.0 | 0.2 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.0 | 0.4 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.0 | 0.1 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.0 | 1.9 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.0 | 0.1 | GO:0002016 | regulation of blood volume by renin-angiotensin(GO:0002016) |
0.0 | 0.0 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.0 | 0.1 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.0 | 0.2 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.0 | 2.3 | GO:0060606 | neural tube closure(GO:0001843) tube closure(GO:0060606) |
0.0 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.2 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.0 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
0.0 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.0 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.2 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.0 | 0.2 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.0 | 0.0 | GO:0061110 | dense core granule biogenesis(GO:0061110) |
0.0 | 0.1 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.0 | 0.6 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
0.0 | 0.1 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.0 | 0.2 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.0 | 0.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.0 | 0.3 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.0 | 0.2 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.0 | 0.0 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.0 | 0.3 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
0.0 | 0.0 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.0 | 0.1 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
0.0 | 0.1 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.0 | 0.3 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.3 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.2 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.0 | GO:0038086 | VEGF-activated platelet-derived growth factor receptor signaling pathway(GO:0038086) positive regulation of cell proliferation by VEGF-activated platelet derived growth factor receptor signaling pathway(GO:0038091) |
0.0 | 0.1 | GO:2000065 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.0 | 0.2 | GO:0043278 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.5 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.8 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
0.0 | 0.0 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.0 | 0.0 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.0 | 0.4 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.0 | 0.1 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.0 | 0.0 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.0 | 0.4 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
0.0 | 0.2 | GO:0051894 | positive regulation of focal adhesion assembly(GO:0051894) |
0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
0.0 | 0.0 | GO:0061055 | myotome development(GO:0061055) |
0.0 | 0.2 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.1 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.0 | 0.1 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.0 | 0.0 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.2 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.0 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.1 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.0 | 0.3 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
0.0 | 0.0 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.0 | 0.1 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.1 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.3 | GO:0095500 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
0.0 | 0.1 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.0 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
0.0 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.0 | 0.2 | GO:0043584 | nose development(GO:0043584) |
0.0 | 0.1 | GO:2000318 | positive regulation of T-helper 17 type immune response(GO:2000318) |
0.0 | 0.6 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.0 | 0.1 | GO:0002591 | positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
0.0 | 0.2 | GO:0060074 | synapse maturation(GO:0060074) |
0.0 | 0.1 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.0 | 0.1 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
0.0 | 0.0 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.0 | 0.1 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.0 | 0.1 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.0 | 0.0 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.0 | 0.0 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
0.0 | 0.0 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.0 | 0.1 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.0 | 0.0 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.0 | 0.1 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.0 | 0.0 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.0 | 0.0 | GO:2000437 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
0.0 | 0.1 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.1 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.0 | 0.0 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
0.0 | 0.4 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
0.0 | 0.1 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.0 | 0.1 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) |
0.0 | 0.1 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.1 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.1 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.0 | 0.1 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.0 | 0.1 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.0 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.1 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.0 | 0.2 | GO:0034030 | coenzyme A biosynthetic process(GO:0015937) nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
0.0 | 0.1 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.0 | 0.0 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.0 | 0.0 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.1 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.0 | GO:1900164 | determination of left/right asymmetry in lateral mesoderm(GO:0003140) nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
0.0 | 0.0 | GO:0021826 | substrate-independent telencephalic tangential migration(GO:0021826) interneuron migration from the subpallium to the cortex(GO:0021830) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
0.0 | 0.1 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.0 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.0 | 0.2 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 0.0 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.0 | 0.0 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
0.0 | 0.2 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.0 | 0.0 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.0 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.0 | 0.0 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.1 | GO:0007183 | SMAD protein complex assembly(GO:0007183) |
0.0 | 0.0 | GO:1902338 | negative regulation of apoptotic process involved in morphogenesis(GO:1902338) negative regulation of apoptotic process involved in development(GO:1904746) |
0.0 | 0.1 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.0 | 0.1 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.0 | 0.1 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.0 | 0.0 | GO:0071321 | response to cGMP(GO:0070305) cellular response to cGMP(GO:0071321) |
0.0 | 0.1 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
0.0 | 0.1 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.0 | 0.0 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.0 | 0.1 | GO:0021854 | hypothalamus development(GO:0021854) |
0.0 | 0.0 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.0 | 0.2 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.0 | 0.2 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.0 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.0 | 0.0 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.0 | 0.0 | GO:0072578 | neurotransmitter-gated ion channel clustering(GO:0072578) |
0.0 | 0.0 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
0.0 | 0.0 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.0 | GO:0060831 | smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:0060831) |
0.0 | 0.1 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.0 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.0 | 0.1 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.0 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.0 | 0.0 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.2 | GO:0002021 | response to dietary excess(GO:0002021) |
0.0 | 0.0 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.1 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.0 | 0.2 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
0.0 | 0.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.0 | 0.0 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.0 | 1.0 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 0.2 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.1 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.0 | 0.1 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.0 | 0.1 | GO:0047497 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.0 | 0.0 | GO:0032096 | negative regulation of response to food(GO:0032096) |
0.0 | 0.1 | GO:0032098 | regulation of appetite(GO:0032098) |
0.0 | 0.4 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.0 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.0 | 0.1 | GO:2001054 | negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
0.0 | 0.0 | GO:0052203 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.0 | 0.1 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.0 | 0.0 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.0 | GO:0090135 | actin filament branching(GO:0090135) |
0.0 | 0.1 | GO:0003010 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
0.0 | 0.0 | GO:0019364 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
0.0 | 0.1 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.0 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.0 | 0.1 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
0.0 | 0.0 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.0 | 0.1 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.0 | 0.0 | GO:0070842 | aggresome assembly(GO:0070842) |
0.0 | 0.1 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.0 | 0.3 | GO:0051966 | regulation of synaptic transmission, glutamatergic(GO:0051966) |
0.0 | 0.2 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
0.0 | 0.0 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.0 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.0 | 0.0 | GO:0044088 | regulation of vacuole organization(GO:0044088) |
0.0 | 0.2 | GO:0007215 | glutamate receptor signaling pathway(GO:0007215) |
0.0 | 0.0 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.0 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.0 | 0.1 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.0 | 0.0 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.0 | 0.1 | GO:0002076 | osteoblast development(GO:0002076) |
0.0 | 0.0 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.0 | 0.3 | GO:0019228 | neuronal action potential(GO:0019228) |
0.0 | 0.0 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.0 | 0.4 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.0 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.0 | 0.1 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
0.0 | 0.1 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
0.0 | 0.1 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.0 | 0.1 | GO:0051703 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
0.0 | 0.0 | GO:1904124 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.0 | 0.0 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.0 | 0.1 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.0 | 0.1 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.0 | 0.1 | GO:0051195 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
0.0 | 0.0 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.2 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
0.0 | 0.1 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.0 | 0.0 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.0 | 0.0 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.0 | 0.1 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 0.0 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.0 | 0.1 | GO:0007625 | grooming behavior(GO:0007625) |
0.0 | 0.0 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.0 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.2 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
0.0 | 0.0 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.0 | 0.0 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.0 | 0.2 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
0.0 | 0.0 | GO:0014877 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.0 | 0.0 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.0 | 0.0 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.0 | 0.0 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 1.0 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.2 | 1.6 | GO:0043083 | synaptic cleft(GO:0043083) |
0.2 | 1.0 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 1.2 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 0.3 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.1 | 0.8 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 0.7 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.1 | 1.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 1.5 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.1 | 1.3 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 4.3 | GO:0043198 | dendritic shaft(GO:0043198) |
0.1 | 0.3 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 0.3 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.1 | 0.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 0.6 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.5 | GO:0097449 | astrocyte projection(GO:0097449) |
0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
0.0 | 0.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.0 | 1.5 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.3 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.3 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 0.2 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 0.4 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.0 | 0.4 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.0 | 0.5 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 0.3 | GO:0016342 | catenin complex(GO:0016342) |
0.0 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 1.0 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.2 | GO:0043203 | axon hillock(GO:0043203) |
0.0 | 0.3 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.2 | GO:0070847 | core mediator complex(GO:0070847) |
0.0 | 0.5 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.4 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.1 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.4 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.8 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.4 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.3 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 0.9 | GO:0008328 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.6 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 1.4 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 1.0 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 0.3 | GO:0001741 | XY body(GO:0001741) |
0.0 | 2.6 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.0 | 0.0 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.1 | GO:0005916 | fascia adherens(GO:0005916) |
0.0 | 0.4 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.0 | 0.0 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.8 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.4 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.0 | 0.2 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 0.1 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.1 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.1 | GO:0071437 | invadopodium(GO:0071437) |
0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.0 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.1 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.0 | 0.0 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.1 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.2 | GO:0071565 | nBAF complex(GO:0071565) |
0.0 | 0.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.0 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.0 | 0.2 | GO:0097060 | synaptic membrane(GO:0097060) |
0.0 | 1.0 | GO:0030426 | growth cone(GO:0030426) |
0.0 | 0.0 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 0.0 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.0 | 0.0 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.0 | 0.0 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.0 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.0 | GO:0016939 | kinesin II complex(GO:0016939) |
0.0 | 0.0 | GO:0070545 | PeBoW complex(GO:0070545) |
0.0 | 1.5 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.6 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.0 | 0.0 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.0 | 1.0 | GO:0070160 | occluding junction(GO:0070160) |
0.0 | 0.1 | GO:0032590 | dendrite membrane(GO:0032590) |
0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.0 | GO:0044326 | dendritic spine neck(GO:0044326) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.3 | 2.6 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.3 | 1.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.2 | 1.5 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.2 | 1.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.2 | 1.7 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.2 | 0.6 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.2 | 0.5 | GO:0035939 | microsatellite binding(GO:0035939) |
0.2 | 0.8 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.1 | 1.9 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.1 | 0.9 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.1 | 0.7 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.1 | 0.6 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.1 | 1.2 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.1 | 0.3 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.1 | 0.4 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.1 | 0.4 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 0.9 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.3 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 0.3 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.1 | 0.3 | GO:0018591 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.1 | 0.3 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.1 | 0.2 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.1 | 0.2 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.1 | 0.4 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.1 | 1.5 | GO:0052712 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.1 | 0.4 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.1 | 0.3 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 1.3 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 0.2 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.1 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 0.4 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.1 | 0.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.5 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.1 | 0.3 | GO:0030553 | cGMP binding(GO:0030553) |
0.1 | 0.2 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.1 | 0.2 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.1 | 0.1 | GO:0070052 | collagen V binding(GO:0070052) |
0.1 | 0.8 | GO:0008143 | poly(A) binding(GO:0008143) |
0.1 | 0.6 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.1 | 0.3 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.1 | 0.2 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.4 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.1 | 0.7 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.2 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.0 | 0.5 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.2 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.0 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.2 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.0 | 0.2 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.0 | 0.5 | GO:1905030 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.0 | 0.3 | GO:0003680 | AT DNA binding(GO:0003680) |
0.0 | 0.4 | GO:0051378 | serotonin binding(GO:0051378) |
0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.3 | GO:0018498 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.0 | 0.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.0 | 1.4 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.5 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.2 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.6 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.2 | GO:0031433 | telethonin binding(GO:0031433) |
0.0 | 0.9 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.3 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.7 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.4 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.0 | 0.2 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.0 | 0.5 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.0 | 0.3 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.2 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.0 | 0.5 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.2 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.0 | 0.1 | GO:0005221 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.0 | 0.1 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.0 | 0.3 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.3 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.1 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.4 | GO:0022835 | transmitter-gated ion channel activity(GO:0022824) transmitter-gated channel activity(GO:0022835) |
0.0 | 0.3 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.0 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.5 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 0.8 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.0 | 1.7 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.3 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.4 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.7 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.0 | 0.1 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.0 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.7 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.2 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.1 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.0 | 0.2 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.4 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.1 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.1 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
0.0 | 0.2 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
0.0 | 0.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.1 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.0 | 0.3 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.0 | GO:0031014 | troponin T binding(GO:0031014) |
0.0 | 0.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.4 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.0 | 0.0 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.2 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.5 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.0 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.1 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.0 | 0.1 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.1 | GO:0043731 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.0 | 0.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.0 | 0.0 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.0 | 0.0 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) C4-dicarboxylate transmembrane transporter activity(GO:0015556) |
0.0 | 0.1 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.0 | 3.4 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.0 | 0.0 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 0.1 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.0 | 0.4 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.6 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
0.0 | 0.2 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.0 | 0.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 0.1 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.2 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.0 | 0.2 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.2 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.0 | 0.4 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.1 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.6 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.1 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.0 | 0.1 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.2 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.4 | GO:0043734 | DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
0.0 | 0.0 | GO:0048045 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.0 | 0.0 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.0 | 0.0 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.0 | 0.1 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.0 | 0.1 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 0.1 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.0 | 0.4 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.0 | 0.0 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.0 | 0.7 | GO:0008146 | sulfotransferase activity(GO:0008146) |
0.0 | 0.0 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.1 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.0 | 0.4 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.7 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.0 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.1 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.0 | 0.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.2 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.4 | GO:0032947 | protein complex scaffold(GO:0032947) |
0.0 | 0.1 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.0 | 0.0 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.0 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.1 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.0 | 0.1 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.0 | 0.2 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 0.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 2.4 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 0.9 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.9 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.4 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.6 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.9 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.2 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.3 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.6 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 1.5 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.6 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.8 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.0 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 0.6 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.1 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.2 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.0 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 1.9 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.1 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.3 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.5 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 3.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.1 | 1.9 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.1 | 1.1 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.1 | 2.5 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 1.3 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 0.9 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.1 | 1.3 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.9 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.1 | REACTOME TRANSMISSION ACROSS CHEMICAL SYNAPSES | Genes involved in Transmission across Chemical Synapses |
0.0 | 1.0 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 1.6 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.4 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 0.1 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.0 | 0.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.5 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.0 | 0.0 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.3 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.3 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.0 | 0.4 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.4 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 0.3 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.6 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.3 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.0 | 0.3 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.5 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.7 | REACTOME HEPARAN SULFATE HEPARIN HS GAG METABOLISM | Genes involved in Heparan sulfate/heparin (HS-GAG) metabolism |
0.0 | 0.4 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.3 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 2.6 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.3 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.4 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 1.1 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.0 | 0.2 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.1 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.0 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.0 | 0.0 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.4 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |