Gene Symbol | Gene ID | Gene Info |
---|---|---|
Fubp1
|
ENSMUSG00000028034.9 | Fubp1 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Fubp1 | chr3_152211518_152211693 | 1084 | 0.324182 | 0.32 | 1.2e-02 | Click! |
Fubp1 | chr3_152212912_152213690 | 2780 | 0.168480 | 0.26 | 4.2e-02 | Click! |
Fubp1 | chr3_152210525_152211504 | 493 | 0.531678 | 0.23 | 7.3e-02 | Click! |
Fubp1 | chr3_152214359_152214542 | 2981 | 0.165936 | 0.22 | 9.5e-02 | Click! |
Fubp1 | chr3_152231827_152231978 | 4061 | 0.146764 | 0.08 | 5.3e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr3_17790150_17790808 | 4.43 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
522 |
0.77 |
chr7_79500711_79501247 | 4.06 |
Mir9-3hg |
Mir9-3 host gene |
858 |
0.39 |
chr2_6883618_6884699 | 4.04 |
Gm13389 |
predicted gene 13389 |
112 |
0.85 |
chr9_4794566_4795419 | 3.94 |
Gria4 |
glutamate receptor, ionotropic, AMPA4 (alpha 4) |
527 |
0.88 |
chr18_77564268_77564635 | 3.40 |
Rnf165 |
ring finger protein 165 |
158 |
0.96 |
chr3_17791321_17791472 | 2.83 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
1439 |
0.39 |
chr5_88583326_88583955 | 2.69 |
Rufy3 |
RUN and FYVE domain containing 3 |
62 |
0.97 |
chr8_89039543_89040259 | 2.62 |
Sall1 |
spalt like transcription factor 1 |
4261 |
0.26 |
chr13_99442575_99442931 | 2.58 |
Map1b |
microtubule-associated protein 1B |
1191 |
0.48 |
chr1_42689823_42691041 | 2.48 |
Pantr1 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 1 |
2661 |
0.19 |
chr19_47015958_47016210 | 2.35 |
Nt5c2 |
5'-nucleotidase, cytosolic II |
931 |
0.38 |
chr9_10903843_10905236 | 2.30 |
Cntn5 |
contactin 5 |
90 |
0.65 |
chr14_60380755_60381381 | 2.30 |
Amer2 |
APC membrane recruitment 2 |
2782 |
0.3 |
chr14_93883900_93884713 | 2.26 |
Pcdh9 |
protocadherin 9 |
1442 |
0.55 |
chr7_73377306_73377710 | 2.25 |
A730056A06Rik |
RIKEN cDNA A730056A06 gene |
1734 |
0.24 |
chr1_42687984_42688646 | 2.23 |
Pantr1 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 1 |
4778 |
0.15 |
chr11_41999400_42000640 | 2.15 |
Gabrg2 |
gamma-aminobutyric acid (GABA) A receptor, subunit gamma 2 |
336 |
0.92 |
chr8_12399326_12400483 | 2.14 |
Gm25239 |
predicted gene, 25239 |
3501 |
0.16 |
chr12_52700044_52701597 | 2.08 |
Akap6 |
A kinase (PRKA) anchor protein 6 |
1437 |
0.46 |
chr9_40270433_40270721 | 2.03 |
Scn3b |
sodium channel, voltage-gated, type III, beta |
890 |
0.48 |
chr2_105678552_105679922 | 1.99 |
Pax6 |
paired box 6 |
630 |
0.68 |
chr1_42701809_42702229 | 1.97 |
Pantr2 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 2 |
6033 |
0.14 |
chr10_128015835_128016219 | 1.96 |
Prim1 |
DNA primase, p49 subunit |
831 |
0.38 |
chr9_35427115_35427995 | 1.91 |
Cdon |
cell adhesion molecule-related/down-regulated by oncogenes |
3967 |
0.19 |
chrX_93279571_93279845 | 1.89 |
Arx |
aristaless related homeobox |
6737 |
0.23 |
chr13_78187943_78188977 | 1.89 |
Nr2f1 |
nuclear receptor subfamily 2, group F, member 1 |
1983 |
0.23 |
chr2_158606690_158608449 | 1.87 |
Gm14204 |
predicted gene 14204 |
3021 |
0.15 |
chr9_52148115_52149635 | 1.85 |
Zc3h12c |
zinc finger CCCH type containing 12C |
19236 |
0.18 |
chr4_22483209_22483553 | 1.85 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
4985 |
0.18 |
chr2_105683499_105683650 | 1.85 |
Pax6 |
paired box 6 |
180 |
0.94 |
chr13_83719687_83720586 | 1.85 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
1245 |
0.36 |
chr13_21897738_21897959 | 1.81 |
Mir1983 |
microRNA 1983 |
799 |
0.35 |
chr13_109442519_109443753 | 1.81 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
953 |
0.73 |
chr13_29014379_29014649 | 1.80 |
A330102I10Rik |
RIKEN cDNA A330102I10 gene |
42 |
0.98 |
chr19_14593554_14593705 | 1.80 |
Tle4 |
transducin-like enhancer of split 4 |
1910 |
0.46 |
chr16_28752596_28753856 | 1.80 |
Fgf12 |
fibroblast growth factor 12 |
158 |
0.97 |
chr3_34377333_34377676 | 1.79 |
Gm38505 |
predicted gene, 38505 |
25792 |
0.17 |
chr14_122459815_122460898 | 1.76 |
Zic5 |
zinc finger protein of the cerebellum 5 |
335 |
0.81 |
chr5_88583963_88584847 | 1.73 |
Rufy3 |
RUN and FYVE domain containing 3 |
611 |
0.7 |
chr2_97468266_97469202 | 1.72 |
Lrrc4c |
leucine rich repeat containing 4C |
645 |
0.83 |
chr17_25794599_25794750 | 1.72 |
Gm50367 |
predicted gene, 50367 |
985 |
0.18 |
chr4_9270926_9271667 | 1.71 |
Clvs1 |
clavesin 1 |
159 |
0.96 |
chr6_116056244_116057282 | 1.69 |
Tmcc1 |
transmembrane and coiled coil domains 1 |
192 |
0.94 |
chr10_18408068_18409081 | 1.64 |
Nhsl1 |
NHS-like 1 |
899 |
0.67 |
chr2_52038470_52039720 | 1.64 |
Tnfaip6 |
tumor necrosis factor alpha induced protein 6 |
1086 |
0.54 |
chr2_18042311_18043883 | 1.63 |
Skida1 |
SKI/DACH domain containing 1 |
1475 |
0.25 |
chr6_112943851_112944495 | 1.62 |
Srgap3 |
SLIT-ROBO Rho GTPase activating protein 3 |
2581 |
0.19 |
chr2_73775928_73776225 | 1.60 |
Chn1 |
chimerin 1 |
730 |
0.7 |
chr14_122481884_122483266 | 1.60 |
Zic2 |
zinc finger protein of the cerebellum 2 |
4475 |
0.12 |
chr14_122480308_122481080 | 1.59 |
Zic2 |
zinc finger protein of the cerebellum 2 |
2594 |
0.16 |
chr4_150651111_150652374 | 1.59 |
Slc45a1 |
solute carrier family 45, member 1 |
355 |
0.88 |
chr5_115339433_115339584 | 1.59 |
Gatc |
glutamyl-tRNA(Gln) amidotransferase, subunit C |
1670 |
0.15 |
chr8_89036575_89038609 | 1.59 |
Sall1 |
spalt like transcription factor 1 |
6570 |
0.23 |
chr1_177444257_177446079 | 1.58 |
Zbtb18 |
zinc finger and BTB domain containing 18 |
230 |
0.9 |
chr17_78508180_78509392 | 1.56 |
Vit |
vitrin |
614 |
0.7 |
chr8_31915784_31916390 | 1.54 |
Nrg1 |
neuregulin 1 |
1563 |
0.42 |
chr2_74713881_74716227 | 1.51 |
Hoxd3os1 |
homeobox D3, opposite strand 1 |
942 |
0.23 |
chrX_69362591_69363214 | 1.51 |
Gm14705 |
predicted gene 14705 |
1633 |
0.4 |
chr4_110290101_110291006 | 1.47 |
Elavl4 |
ELAV like RNA binding protein 4 |
281 |
0.95 |
chr5_142811653_142812209 | 1.47 |
Tnrc18 |
trinucleotide repeat containing 18 |
5449 |
0.19 |
chr8_41052368_41053980 | 1.46 |
Gm16193 |
predicted gene 16193 |
64 |
0.96 |
chrX_6091588_6092836 | 1.46 |
Gm26618 |
predicted gene, 26618 |
57 |
0.96 |
chr4_22483966_22484156 | 1.44 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
4305 |
0.19 |
chr13_83726534_83727321 | 1.44 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
1179 |
0.35 |
chr12_53250254_53250669 | 1.43 |
Npas3 |
neuronal PAS domain protein 3 |
1784 |
0.48 |
chr1_42701498_42701775 | 1.42 |
Pou3f3 |
POU domain, class 3, transcription factor 3 |
5868 |
0.14 |
chr1_77507828_77508329 | 1.41 |
Epha4 |
Eph receptor A4 |
7001 |
0.19 |
chr14_115043258_115044172 | 1.38 |
Mir17 |
microRNA 17 |
44 |
0.47 |
chr8_33747278_33748028 | 1.37 |
Smim18 |
small integral membrane protein 18 |
117 |
0.95 |
chr9_78503900_78504103 | 1.36 |
Eef1a1 |
eukaryotic translation elongation factor 1 alpha 1 |
14850 |
0.11 |
chr2_18315510_18316536 | 1.35 |
Dnajc1 |
DnaJ heat shock protein family (Hsp40) member C1 |
5765 |
0.22 |
chr13_83717521_83718816 | 1.35 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
3213 |
0.17 |
chr17_85623199_85624146 | 1.34 |
Six3 |
sine oculis-related homeobox 3 |
2641 |
0.19 |
chr5_111421306_111422790 | 1.34 |
Gm43119 |
predicted gene 43119 |
1541 |
0.35 |
chr4_110284889_110285145 | 1.33 |
Elavl4 |
ELAV like RNA binding protein 4 |
1599 |
0.53 |
chr11_104234777_104235157 | 1.33 |
Mapt |
microtubule-associated protein tau |
3383 |
0.19 |
chr3_34638141_34639272 | 1.31 |
Sox2ot |
SOX2 overlapping transcript (non-protein coding) |
202 |
0.53 |
chr6_77245550_77245946 | 1.31 |
Lrrtm1 |
leucine rich repeat transmembrane neuronal 1 |
2826 |
0.35 |
chr9_69758363_69758936 | 1.31 |
B230323A14Rik |
RIKEN cDNA B230323A14 gene |
91 |
0.97 |
chrX_58028680_58029480 | 1.30 |
Zic3 |
zinc finger protein of the cerebellum 3 |
1563 |
0.48 |
chr14_59628760_59629024 | 1.30 |
Shisa2 |
shisa family member 2 |
1703 |
0.32 |
chr11_102554998_102555286 | 1.29 |
Gpatch8 |
G patch domain containing 8 |
1034 |
0.35 |
chr5_142809290_142809906 | 1.29 |
Tnrc18 |
trinucleotide repeat containing 18 |
7782 |
0.18 |
chr19_47013396_47013844 | 1.28 |
Ina |
internexin neuronal intermediate filament protein, alpha |
1078 |
0.34 |
chr1_168426195_168428871 | 1.26 |
Pbx1 |
pre B cell leukemia homeobox 1 |
3971 |
0.3 |
chr8_106338605_106338871 | 1.26 |
Smpd3 |
sphingomyelin phosphodiesterase 3, neutral |
750 |
0.67 |
chr1_111862798_111863699 | 1.26 |
Dsel |
dermatan sulfate epimerase-like |
1520 |
0.41 |
chr15_98989928_98991865 | 1.24 |
4930578M01Rik |
RIKEN cDNA 4930578M01 gene |
5002 |
0.1 |
chr15_102349198_102349349 | 1.24 |
Aaas |
achalasia, adrenocortical insufficiency, alacrimia |
807 |
0.35 |
chr2_102661017_102661704 | 1.23 |
Slc1a2 |
solute carrier family 1 (glial high affinity glutamate transporter), member 2 |
2079 |
0.37 |
chr5_5264770_5266186 | 1.22 |
Cdk14 |
cyclin-dependent kinase 14 |
169 |
0.96 |
chr8_109245493_109246323 | 1.22 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
3958 |
0.33 |
chr13_36729169_36729320 | 1.22 |
Nrn1 |
neuritin 1 |
1424 |
0.33 |
chr15_96293427_96293578 | 1.21 |
Arid2 |
AT rich interactive domain 2 (ARID, RFX-like) |
5929 |
0.21 |
chr7_84408298_84408449 | 1.20 |
Arnt2 |
aryl hydrocarbon receptor nuclear translocator 2 |
1510 |
0.37 |
chr18_69563283_69563781 | 1.19 |
Tcf4 |
transcription factor 4 |
197 |
0.96 |
chr12_46816152_46816702 | 1.17 |
Nova1 |
NOVA alternative splicing regulator 1 |
533 |
0.8 |
chr18_69349496_69350227 | 1.17 |
Tcf4 |
transcription factor 4 |
917 |
0.69 |
chr12_72233267_72233815 | 1.16 |
Rtn1 |
reticulon 1 |
2198 |
0.35 |
chr10_75212843_75213184 | 1.16 |
Specc1l |
sperm antigen with calponin homology and coiled-coil domains 1-like |
593 |
0.76 |
chrX_143930842_143933141 | 1.16 |
Dcx |
doublecortin |
1059 |
0.64 |
chr12_71049290_71050137 | 1.15 |
Arid4a |
AT rich interactive domain 4A (RBP1-like) |
1372 |
0.4 |
chr2_71525880_71527745 | 1.15 |
Dlx1as |
distal-less homeobox 1, antisense |
1107 |
0.33 |
chr18_77046520_77046739 | 1.15 |
Katnal2 |
katanin p60 subunit A-like 2 |
614 |
0.75 |
chr15_98983254_98984205 | 1.15 |
4930578M01Rik |
RIKEN cDNA 4930578M01 gene |
102 |
0.93 |
chr6_37642279_37643109 | 1.15 |
Ybx1-ps2 |
Y box protein 1, pseudogene 2 |
44501 |
0.17 |
chr5_38153230_38154533 | 1.14 |
Nsg1 |
neuron specific gene family member 1 |
5150 |
0.17 |
chr7_6435207_6435948 | 1.14 |
Olfr1344 |
olfactory receptor 1344 |
3111 |
0.1 |
chr19_41484520_41484901 | 1.14 |
Lcor |
ligand dependent nuclear receptor corepressor |
1681 |
0.41 |
chr9_91377840_91378089 | 1.14 |
Zic4 |
zinc finger protein of the cerebellum 4 |
233 |
0.88 |
chr18_42895118_42895392 | 1.13 |
Ppp2r2b |
protein phosphatase 2, regulatory subunit B, beta |
3560 |
0.3 |
chr3_144197270_144197856 | 1.13 |
Gm43445 |
predicted gene 43445 |
1699 |
0.34 |
chr2_104589853_104590233 | 1.13 |
Cstf3 |
cleavage stimulation factor, 3' pre-RNA, subunit 3 |
480 |
0.72 |
chr1_182410542_182411314 | 1.12 |
Trp53bp2 |
transformation related protein 53 binding protein 2 |
1756 |
0.25 |
chr7_93082007_93082946 | 1.12 |
Gm9934 |
predicted gene 9934 |
1449 |
0.36 |
chr7_3690121_3690272 | 1.12 |
Mboat7 |
membrane bound O-acyltransferase domain containing 7 |
1671 |
0.15 |
chr16_94996546_94998023 | 1.12 |
Kcnj6 |
potassium inwardly-rectifying channel, subfamily J, member 6 |
32 |
0.99 |
chr1_25830818_25831017 | 1.11 |
Gm9884 |
predicted gene 9884 |
260 |
0.82 |
chr11_77486623_77487566 | 1.10 |
Ankrd13b |
ankyrin repeat domain 13b |
2572 |
0.17 |
chr17_26064324_26064479 | 1.10 |
Rab11fip3 |
RAB11 family interacting protein 3 (class II) |
4834 |
0.1 |
chr2_65565600_65566271 | 1.10 |
Scn3a |
sodium channel, voltage-gated, type III, alpha |
1557 |
0.45 |
chr2_65934605_65934840 | 1.10 |
Csrnp3 |
cysteine-serine-rich nuclear protein 3 |
2857 |
0.29 |
chr2_29845025_29845242 | 1.10 |
Mir219b |
microRNA 219b |
514 |
0.43 |
chr5_114172969_114173120 | 1.09 |
Acacb |
acetyl-Coenzyme A carboxylase beta |
2862 |
0.19 |
chr8_41054476_41055299 | 1.09 |
Mtus1 |
mitochondrial tumor suppressor 1 |
93 |
0.95 |
chr18_69597107_69597709 | 1.08 |
Tcf4 |
transcription factor 4 |
2128 |
0.42 |
chr2_65846012_65846807 | 1.07 |
Csrnp3 |
cysteine-serine-rich nuclear protein 3 |
554 |
0.79 |
chr8_31916563_31917105 | 1.06 |
Nrg1 |
neuregulin 1 |
816 |
0.63 |
chr12_29534026_29534177 | 1.06 |
Myt1l |
myelin transcription factor 1-like |
485 |
0.64 |
chr4_116223265_116224130 | 1.06 |
Pik3r3 |
phosphoinositide-3-kinase regulatory subunit 3 |
2001 |
0.23 |
chr1_64533541_64534368 | 1.06 |
Creb1 |
cAMP responsive element binding protein 1 |
1060 |
0.57 |
chr16_77594640_77595970 | 1.06 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
403 |
0.71 |
chr11_61476970_61478118 | 1.06 |
Mfap4 |
microfibrillar-associated protein 4 |
7887 |
0.11 |
chr6_54562685_54562852 | 1.06 |
Scrn1 |
secernin 1 |
3721 |
0.21 |
chrX_20664995_20665668 | 1.04 |
Uba1 |
ubiquitin-like modifier activating enzyme 1 |
2433 |
0.2 |
chr1_39700877_39701028 | 1.04 |
Rfx8 |
regulatory factor X 8 |
9081 |
0.18 |
chr2_165387026_165387319 | 1.04 |
Zfp334 |
zinc finger protein 334 |
1087 |
0.4 |
chr2_96317494_96318819 | 1.04 |
Lrrc4c |
leucine rich repeat containing 4C |
13 |
0.99 |
chr4_25797578_25797990 | 1.03 |
Fut9 |
fucosyltransferase 9 |
2071 |
0.32 |
chr3_107034533_107034912 | 1.03 |
Kcna3 |
potassium voltage-gated channel, shaker-related subfamily, member 3 |
1447 |
0.37 |
chr4_13748964_13749170 | 1.03 |
Runx1t1 |
RUNX1 translocation partner 1 |
2230 |
0.44 |
chr3_45382505_45382699 | 1.02 |
Pcdh10 |
protocadherin 10 |
31 |
0.97 |
chr12_27338037_27338443 | 1.02 |
Sox11 |
SRY (sex determining region Y)-box 11 |
4334 |
0.33 |
chr8_94995811_94996872 | 1.02 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
680 |
0.57 |
chr2_65934036_65934599 | 1.02 |
Csrnp3 |
cysteine-serine-rich nuclear protein 3 |
2452 |
0.32 |
chr8_55939901_55941088 | 1.02 |
Glra3 |
glycine receptor, alpha 3 subunit |
15 |
0.98 |
chr12_52699339_52699808 | 1.01 |
Akap6 |
A kinase (PRKA) anchor protein 6 |
190 |
0.95 |
chr17_85624908_85626448 | 1.00 |
Six3 |
sine oculis-related homeobox 3 |
4647 |
0.16 |
chr6_23382210_23383537 | 1.00 |
Cadps2 |
Ca2+-dependent activator protein for secretion 2 |
26954 |
0.22 |
chr18_61691759_61692669 | 1.00 |
Gm38165 |
predicted gene, 38165 |
170 |
0.91 |
chr7_70353768_70354120 | 1.00 |
Nr2f2 |
nuclear receptor subfamily 2, group F, member 2 |
1293 |
0.32 |
chr9_72535274_72535444 | 0.99 |
Rfx7 |
regulatory factor X, 7 |
2624 |
0.14 |
chrX_113299632_113299783 | 0.98 |
Dach2 |
dachshund family transcription factor 2 |
1073 |
0.58 |
chr7_127874468_127874714 | 0.97 |
Zfp668 |
zinc finger protein 668 |
1055 |
0.23 |
chr16_43504464_43505047 | 0.97 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
1058 |
0.61 |
chr3_17789318_17789657 | 0.97 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
434 |
0.83 |
chr2_162867099_162868100 | 0.97 |
Gm14255 |
predicted gene 14255 |
595 |
0.68 |
chr10_103026340_103027824 | 0.96 |
Alx1 |
ALX homeobox 1 |
1545 |
0.39 |
chr1_181839488_181840486 | 0.96 |
Gm26004 |
predicted gene, 26004 |
581 |
0.64 |
chr7_76185345_76186076 | 0.96 |
Agbl1 |
ATP/GTP binding protein-like 1 |
44177 |
0.17 |
chr1_173389412_173390669 | 0.96 |
Cadm3 |
cell adhesion molecule 3 |
22345 |
0.14 |
chr11_98749539_98750006 | 0.95 |
Thra |
thyroid hormone receptor alpha |
3814 |
0.12 |
chr7_128688434_128689045 | 0.95 |
Gm43580 |
predicted gene 43580 |
204 |
0.53 |
chr1_38320013_38320646 | 0.95 |
Gm16151 |
predicted gene 16151 |
12427 |
0.22 |
chr9_35443576_35443727 | 0.95 |
Cdon |
cell adhesion molecule-related/down-regulated by oncogenes |
8425 |
0.15 |
chr18_31316134_31317386 | 0.95 |
Rit2 |
Ras-like without CAAX 2 |
351 |
0.9 |
chr9_78504198_78504349 | 0.94 |
Eef1a1 |
eukaryotic translation elongation factor 1 alpha 1 |
15122 |
0.11 |
chrX_95163813_95164963 | 0.94 |
Arhgef9 |
CDC42 guanine nucleotide exchange factor (GEF) 9 |
1437 |
0.48 |
chr5_116590520_116593206 | 0.94 |
Srrm4 |
serine/arginine repetitive matrix 4 |
46 |
0.98 |
chr8_84769977_84770575 | 0.93 |
Nfix |
nuclear factor I/X |
3120 |
0.15 |
chr7_60449424_60450258 | 0.93 |
Gm30196 |
predicted gene, 30196 |
156637 |
0.03 |
chr4_22484307_22484937 | 0.93 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
3744 |
0.2 |
chr5_88587035_88587274 | 0.93 |
Rufy3 |
RUN and FYVE domain containing 3 |
3360 |
0.21 |
chr4_82499063_82499632 | 0.92 |
Nfib |
nuclear factor I/B |
31 |
0.98 |
chr8_72240801_72241242 | 0.92 |
Ap1m1 |
adaptor-related protein complex AP-1, mu subunit 1 |
698 |
0.52 |
chr4_22481292_22481918 | 0.92 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
6761 |
0.17 |
chr12_54860685_54861218 | 0.92 |
Cfl2 |
cofilin 2, muscle |
787 |
0.49 |
chr10_109832096_109833441 | 0.92 |
Nav3 |
neuron navigator 3 |
453 |
0.9 |
chr2_90886739_90886966 | 0.92 |
C1qtnf4 |
C1q and tumor necrosis factor related protein 4 |
992 |
0.36 |
chr2_6881042_6881689 | 0.92 |
Gm13389 |
predicted gene 13389 |
2905 |
0.24 |
chr19_44757990_44758435 | 0.91 |
Pax2 |
paired box 2 |
818 |
0.54 |
chr8_109249737_109249899 | 0.91 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
48 |
0.99 |
chr5_131531462_131532675 | 0.91 |
Auts2 |
autism susceptibility candidate 2 |
2329 |
0.29 |
chr3_124322351_124322502 | 0.91 |
Tram1l1 |
translocation associated membrane protein 1-like 1 |
1571 |
0.34 |
chr14_60086016_60087318 | 0.91 |
Atp8a2 |
ATPase, aminophospholipid transporter-like, class I, type 8A, member 2 |
167 |
0.75 |
chr13_23411783_23413150 | 0.91 |
Abt1 |
activator of basal transcription 1 |
11400 |
0.08 |
chr13_83728524_83729044 | 0.91 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
678 |
0.43 |
chr15_103100722_103100939 | 0.91 |
Gm28876 |
predicted gene 28876 |
1281 |
0.23 |
chr13_99443316_99444666 | 0.90 |
Map1b |
microtubule-associated protein 1B |
47 |
0.98 |
chr1_177448882_177449429 | 0.90 |
Zbtb18 |
zinc finger and BTB domain containing 18 |
3334 |
0.19 |
chr9_54499315_54499466 | 0.90 |
Dmxl2 |
Dmx-like 2 |
2106 |
0.33 |
chr19_59465334_59465659 | 0.89 |
Emx2 |
empty spiracles homeobox 2 |
2694 |
0.23 |
chr1_158354059_158354432 | 0.89 |
Brinp2 |
bone morphogenic protein/retinoic acid inducible neural-specific 2 |
1984 |
0.33 |
chr11_102394791_102396113 | 0.89 |
Rundc3a |
RUN domain containing 3A |
2049 |
0.17 |
chr3_96199424_96199575 | 0.89 |
Bola1 |
bolA-like 1 (E. coli) |
1010 |
0.2 |
chr4_110285468_110287125 | 0.89 |
Elavl4 |
ELAV like RNA binding protein 4 |
320 |
0.94 |
chr11_97781288_97781534 | 0.88 |
Snora21 |
small nucleolar RNA, H/ACA box 21 |
364 |
0.57 |
chr19_8839622_8840720 | 0.88 |
Bscl2 |
Berardinelli-Seip congenital lipodystrophy 2 (seipin) |
348 |
0.56 |
chr2_50970840_50970991 | 0.88 |
Gm13498 |
predicted gene 13498 |
61231 |
0.15 |
chr10_29143400_29144848 | 0.88 |
Soga3 |
SOGA family member 3 |
65 |
0.5 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 3.6 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
1.0 | 1.0 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
0.7 | 2.2 | GO:0072240 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.6 | 1.8 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.6 | 3.9 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.5 | 1.0 | GO:0048880 | sensory system development(GO:0048880) |
0.5 | 2.3 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.4 | 1.8 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) |
0.4 | 2.9 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.4 | 1.1 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.3 | 0.3 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.3 | 1.0 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.3 | 1.3 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.3 | 2.7 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.3 | 1.0 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.3 | 0.9 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.3 | 0.9 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.3 | 1.5 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.3 | 1.5 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.3 | 0.9 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.3 | 1.4 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.3 | 0.8 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.3 | 1.4 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.3 | 0.8 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.3 | 0.8 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.2 | 1.0 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
0.2 | 1.0 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.2 | 0.7 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.2 | 1.0 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.2 | 1.2 | GO:0033762 | response to glucagon(GO:0033762) |
0.2 | 2.6 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.2 | 0.5 | GO:0021827 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.2 | 0.7 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.2 | 0.5 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.2 | 0.7 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.2 | 3.5 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
0.2 | 0.7 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.2 | 0.7 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.2 | 0.4 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.2 | 1.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.2 | 1.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.2 | 0.6 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
0.2 | 0.4 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.2 | 0.6 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.2 | 0.8 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.2 | 0.4 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.2 | 0.8 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.2 | 0.6 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.2 | 0.6 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.2 | 0.6 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.2 | 0.7 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.2 | 0.5 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.2 | 3.4 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
0.2 | 0.5 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.2 | 0.7 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.2 | 1.2 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.2 | 0.5 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.2 | 3.3 | GO:0060384 | innervation(GO:0060384) |
0.2 | 0.5 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.2 | 1.3 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.2 | 0.3 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.2 | 0.3 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.2 | 0.8 | GO:0038107 | nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
0.2 | 0.6 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.2 | 0.5 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.2 | 0.6 | GO:0051031 | tRNA transport(GO:0051031) |
0.2 | 0.9 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.2 | 1.2 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
0.2 | 1.1 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.2 | 0.6 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.2 | 0.5 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
0.2 | 0.3 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.2 | 0.5 | GO:0000087 | mitotic M phase(GO:0000087) |
0.1 | 0.4 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.1 | 0.7 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.1 | 3.3 | GO:0001964 | startle response(GO:0001964) |
0.1 | 0.7 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 0.8 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
0.1 | 1.3 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.1 | 0.6 | GO:0014028 | notochord formation(GO:0014028) |
0.1 | 0.4 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.1 | 0.4 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.1 | 0.5 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 1.2 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.1 | 0.5 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.1 | 0.4 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.1 | 0.5 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.1 | 1.2 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.1 | 0.1 | GO:1903753 | negative regulation of p38MAPK cascade(GO:1903753) |
0.1 | 0.3 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.1 | 0.1 | GO:0097688 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.1 | 0.5 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.1 | 0.6 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.1 | 0.2 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.1 | 0.9 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
0.1 | 0.2 | GO:0060166 | olfactory pit development(GO:0060166) |
0.1 | 0.6 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.1 | 0.1 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) regulation of opioid receptor signaling pathway(GO:2000474) |
0.1 | 0.6 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.1 | 0.4 | GO:0030242 | pexophagy(GO:0030242) |
0.1 | 0.6 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.1 | 0.1 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) positive regulation of glucose mediated signaling pathway(GO:1902661) |
0.1 | 0.5 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.1 | 0.2 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.1 | 0.6 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.1 | 0.2 | GO:0003051 | angiotensin-mediated drinking behavior(GO:0003051) |
0.1 | 0.3 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.1 | 0.2 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.1 | 0.9 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
0.1 | 0.4 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.1 | 0.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.1 | 0.3 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.1 | 0.7 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.1 | 0.2 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.1 | 0.3 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.1 | 0.2 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.1 | 0.4 | GO:2001138 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
0.1 | 0.2 | GO:2000909 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
0.1 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.1 | 0.3 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.1 | 0.4 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.1 | 0.7 | GO:0097264 | self proteolysis(GO:0097264) |
0.1 | 0.3 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
0.1 | 0.3 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.1 | 0.3 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.1 | 0.2 | GO:0021843 | substrate-independent telencephalic tangential migration(GO:0021826) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
0.1 | 0.8 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.1 | 0.3 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.1 | 5.8 | GO:0043488 | regulation of mRNA stability(GO:0043488) |
0.1 | 0.3 | GO:0072017 | distal tubule development(GO:0072017) |
0.1 | 0.3 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 1.7 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.1 | 0.1 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.1 | 1.7 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.1 | 0.9 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.1 | 0.3 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.1 | 0.3 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.3 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.1 | 0.3 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.2 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.1 | 0.3 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.1 | 0.1 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
0.1 | 0.3 | GO:0001555 | oocyte growth(GO:0001555) |
0.1 | 0.2 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.1 | 0.3 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.1 | 0.5 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.1 | 0.3 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.1 | 0.1 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.1 | 0.3 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.1 | 0.5 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.1 | 0.3 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.1 | 0.4 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.1 | 0.5 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.1 | 0.2 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.1 | 0.7 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 0.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.1 | 0.9 | GO:0035418 | protein localization to synapse(GO:0035418) |
0.1 | 0.3 | GO:0015817 | histidine transport(GO:0015817) |
0.1 | 0.2 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 0.2 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.1 | 0.7 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.2 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.1 | 0.2 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.1 | 0.1 | GO:0071481 | cellular response to X-ray(GO:0071481) |
0.1 | 0.4 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.1 | 0.8 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.1 | 0.3 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.1 | 2.6 | GO:0021766 | hippocampus development(GO:0021766) |
0.1 | 0.5 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.1 | 0.3 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.1 | 0.3 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.1 | 0.4 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
0.1 | 0.3 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.1 | 0.3 | GO:0090148 | membrane fission(GO:0090148) |
0.1 | 0.4 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.2 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.1 | 0.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.1 | 0.7 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.1 | 0.6 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.1 | 0.2 | GO:0018214 | protein carboxylation(GO:0018214) |
0.1 | 0.2 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.1 | 0.2 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.1 | 0.3 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.1 | 0.3 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.1 | 0.2 | GO:0061549 | sympathetic ganglion development(GO:0061549) |
0.1 | 0.2 | GO:1904468 | negative regulation of tumor necrosis factor secretion(GO:1904468) |
0.1 | 0.2 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.1 | 0.2 | GO:0032328 | alanine transport(GO:0032328) |
0.1 | 0.2 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.1 | 0.2 | GO:2000617 | positive regulation of histone H3-K9 acetylation(GO:2000617) |
0.1 | 0.4 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.1 | 0.5 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.1 | 0.9 | GO:0021884 | forebrain neuron development(GO:0021884) |
0.1 | 0.4 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.1 | 0.2 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.1 | 0.4 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.1 | 0.2 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.1 | 0.2 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.1 | 0.2 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.1 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.2 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.1 | 1.3 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
0.1 | 0.4 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.2 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.1 | 0.3 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.1 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
0.1 | 0.4 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.1 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.1 | 0.6 | GO:0015816 | glycine transport(GO:0015816) |
0.1 | 0.2 | GO:0019042 | viral latency(GO:0019042) |
0.1 | 0.1 | GO:1901724 | positive regulation of cell proliferation involved in kidney development(GO:1901724) |
0.1 | 0.1 | GO:0036480 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
0.1 | 0.1 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.3 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.1 | 0.1 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.1 | 0.4 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.1 | 0.1 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) |
0.1 | 0.3 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.1 | 0.1 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.1 | 0.4 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.1 | 0.3 | GO:0046836 | glycolipid transport(GO:0046836) |
0.1 | 0.1 | GO:0072553 | terminal button organization(GO:0072553) |
0.1 | 0.2 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.1 | 0.2 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.1 | 0.2 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.1 | 0.2 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.2 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.1 | 0.2 | GO:0071816 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.1 | 0.2 | GO:0021699 | cerebellum maturation(GO:0021590) cerebellar cortex maturation(GO:0021699) |
0.1 | 0.3 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.1 | 0.6 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
0.1 | 0.1 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.1 | 0.3 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.3 | GO:0015808 | L-alanine transport(GO:0015808) |
0.1 | 0.4 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.1 | 0.3 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.1 | 1.2 | GO:0007616 | long-term memory(GO:0007616) |
0.1 | 0.3 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.1 | 0.1 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.1 | 0.1 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.1 | 0.5 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.1 | 0.4 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 0.1 | GO:0033504 | floor plate development(GO:0033504) |
0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.2 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.1 | 0.3 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.1 | 0.5 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.1 | 0.2 | GO:0032100 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
0.1 | 0.3 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.1 | 0.1 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.1 | 0.4 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.1 | 0.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.1 | 0.2 | GO:0015867 | ATP transport(GO:0015867) |
0.1 | 0.2 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.1 | 0.1 | GO:0007412 | axon target recognition(GO:0007412) |
0.1 | 0.2 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.1 | 0.1 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.1 | 0.1 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.1 | 0.7 | GO:0006999 | nuclear pore organization(GO:0006999) |
0.1 | 0.2 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.1 | 0.2 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.1 | 0.3 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.1 | 0.4 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.1 | 0.2 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.1 | 0.3 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.1 | 1.0 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.1 | 0.2 | GO:0019740 | nitrogen utilization(GO:0019740) |
0.1 | 0.6 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
0.1 | 0.6 | GO:0034389 | lipid particle organization(GO:0034389) |
0.1 | 0.8 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.1 | 0.4 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.1 | 0.3 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.1 | 0.3 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.1 | 0.2 | GO:0070857 | regulation of bile acid biosynthetic process(GO:0070857) |
0.1 | 0.1 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.1 | 0.6 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.1 | 0.2 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
0.1 | 0.1 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.1 | 0.3 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.1 | 0.1 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.1 | 0.2 | GO:0008228 | opsonization(GO:0008228) |
0.1 | 0.8 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 0.3 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.1 | 0.1 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.1 | 0.2 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.1 | 0.2 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.1 | 0.3 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.1 | 0.4 | GO:0007000 | nucleolus organization(GO:0007000) |
0.1 | 0.2 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.1 | 0.1 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
0.1 | 0.2 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 0.3 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.1 | 0.2 | GO:0032202 | telomere assembly(GO:0032202) |
0.1 | 0.1 | GO:0061205 | paramesonephric duct development(GO:0061205) |
0.1 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
0.1 | 0.5 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.1 | 0.3 | GO:0021955 | central nervous system neuron axonogenesis(GO:0021955) |
0.1 | 0.2 | GO:0090155 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
0.1 | 0.1 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
0.1 | 0.2 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.1 | 0.3 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.1 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.2 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.1 | 1.1 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
0.1 | 0.2 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.1 | 0.9 | GO:0031114 | regulation of microtubule depolymerization(GO:0031114) |
0.1 | 0.2 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 0.2 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.1 | 0.3 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.1 | 0.1 | GO:0031448 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
0.1 | 0.5 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
0.1 | 0.1 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.0 | 0.3 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.0 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.0 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.0 | 1.1 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
0.0 | 0.0 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.0 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.0 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.0 | 0.7 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.0 | 0.0 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.0 | 0.4 | GO:0000338 | protein deneddylation(GO:0000338) |
0.0 | 0.8 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.0 | 0.2 | GO:0006983 | ER overload response(GO:0006983) |
0.0 | 0.1 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
0.0 | 0.2 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
0.0 | 0.2 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.0 | 0.2 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.0 | 0.0 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.0 | 0.1 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
0.0 | 0.1 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.0 | 5.0 | GO:0050770 | regulation of axonogenesis(GO:0050770) |
0.0 | 0.0 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.0 | 0.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.4 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 2.8 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.0 | 0.1 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 0.1 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.0 | 0.1 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.0 | 0.1 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.1 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.0 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
0.0 | 0.2 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.0 | 0.5 | GO:0009437 | carnitine metabolic process(GO:0009437) |
0.0 | 0.6 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.0 | 0.1 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
0.0 | 0.2 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.1 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.0 | 0.3 | GO:0002591 | positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
0.0 | 0.1 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.0 | 0.2 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.0 | 0.1 | GO:0060022 | hard palate development(GO:0060022) |
0.0 | 0.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.0 | 0.1 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
0.0 | 0.1 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.0 | 0.2 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.0 | 0.1 | GO:1900113 | regulation of histone H3-K9 trimethylation(GO:1900112) negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.0 | 0.0 | GO:0010042 | response to manganese ion(GO:0010042) |
0.0 | 0.3 | GO:0046606 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.2 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.0 | 0.2 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.0 | 0.1 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.0 | 0.0 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.0 | 0.4 | GO:0031442 | positive regulation of mRNA 3'-end processing(GO:0031442) |
0.0 | 0.4 | GO:0044783 | G1 DNA damage checkpoint(GO:0044783) |
0.0 | 0.3 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.0 | 0.2 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.0 | 0.3 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.7 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
0.0 | 0.1 | GO:0072401 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
0.0 | 0.3 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.0 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.0 | 0.2 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.0 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.3 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.0 | 0.0 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.0 | 0.5 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.1 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.0 | 0.0 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.0 | 0.1 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.0 | 0.1 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
0.0 | 0.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.0 | 0.0 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.0 | 0.1 | GO:0051299 | centrosome separation(GO:0051299) |
0.0 | 0.2 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.0 | 0.1 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.0 | 0.2 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.0 | 0.2 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.2 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
0.0 | 0.2 | GO:0070474 | positive regulation of uterine smooth muscle contraction(GO:0070474) |
0.0 | 0.0 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.0 | 0.2 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.0 | 0.1 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.1 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.0 | 0.2 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.1 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.0 | 0.4 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
0.0 | 0.0 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.0 | 0.1 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.0 | 0.6 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.0 | 0.1 | GO:0015684 | ferrous iron transport(GO:0015684) |
0.0 | 1.0 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.5 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.0 | 0.1 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.6 | GO:0030033 | microvillus assembly(GO:0030033) |
0.0 | 0.2 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.0 | 0.2 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.0 | 0.1 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.0 | 0.2 | GO:0070831 | basement membrane assembly(GO:0070831) |
0.0 | 0.5 | GO:2001222 | regulation of neuron migration(GO:2001222) |
0.0 | 0.0 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.0 | 0.0 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.0 | 0.8 | GO:0007093 | mitotic cell cycle checkpoint(GO:0007093) |
0.0 | 0.1 | GO:1900619 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.0 | 0.2 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.0 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.0 | 0.4 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.0 | 0.1 | GO:0090343 | positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
0.0 | 0.1 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.0 | 0.4 | GO:0043482 | cellular pigment accumulation(GO:0043482) |
0.0 | 0.8 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
0.0 | 0.2 | GO:2000197 | regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
0.0 | 0.1 | GO:0036005 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
0.0 | 0.0 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.1 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.0 | 0.1 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.0 | 0.0 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
0.0 | 0.5 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
0.0 | 0.2 | GO:0070071 | proton-transporting V-type ATPase complex assembly(GO:0070070) proton-transporting two-sector ATPase complex assembly(GO:0070071) |
0.0 | 0.4 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.0 | 0.1 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
0.0 | 0.1 | GO:0022605 | oogenesis stage(GO:0022605) |
0.0 | 0.0 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.0 | 0.5 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
0.0 | 0.0 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.0 | 0.2 | GO:0061450 | trophoblast cell migration(GO:0061450) |
0.0 | 0.1 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.0 | 0.4 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 0.3 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.0 | 0.1 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.0 | 0.1 | GO:0018202 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
0.0 | 0.1 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.0 | 0.1 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.0 | 0.3 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.2 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.0 | 0.0 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.0 | 0.0 | GO:0048505 | regulation of timing of cell differentiation(GO:0048505) |
0.0 | 0.1 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.0 | 0.1 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.0 | 0.1 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.0 | 1.3 | GO:0008543 | fibroblast growth factor receptor signaling pathway(GO:0008543) |
0.0 | 0.5 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.2 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.0 | 0.0 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.0 | 1.6 | GO:0050684 | regulation of mRNA processing(GO:0050684) |
0.0 | 0.1 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.0 | 0.2 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
0.0 | 0.2 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.1 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
0.0 | 0.2 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.2 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.0 | 0.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.1 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.0 | 0.1 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.0 | 0.1 | GO:0032049 | phosphatidylglycerol biosynthetic process(GO:0006655) cardiolipin biosynthetic process(GO:0032049) |
0.0 | 0.2 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.1 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.1 | GO:0021554 | optic nerve development(GO:0021554) |
0.0 | 0.4 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.0 | 0.4 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.0 | 0.0 | GO:0065001 | specification of axis polarity(GO:0065001) |
0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.3 | GO:0030828 | positive regulation of cGMP metabolic process(GO:0030825) positive regulation of cGMP biosynthetic process(GO:0030828) |
0.0 | 0.0 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.0 | 0.1 | GO:0001539 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
0.0 | 0.2 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.0 | 0.5 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.1 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.0 | 0.3 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.3 | GO:0006359 | regulation of transcription from RNA polymerase III promoter(GO:0006359) |
0.0 | 0.0 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
0.0 | 0.0 | GO:0040031 | snRNA modification(GO:0040031) |
0.0 | 0.0 | GO:1905214 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.1 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.0 | 0.1 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
0.0 | 0.1 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
0.0 | 0.1 | GO:0098828 | modulation of inhibitory postsynaptic potential(GO:0098828) |
0.0 | 0.1 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.0 | 0.0 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.0 | 0.2 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.1 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.0 | 0.1 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.0 | 0.3 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.2 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 0.1 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.0 | 0.7 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
0.0 | 0.1 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.0 | 0.0 | GO:0014732 | skeletal muscle atrophy(GO:0014732) striated muscle atrophy(GO:0014891) |
0.0 | 1.3 | GO:0080171 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
0.0 | 0.1 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.0 | 0.1 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.0 | 0.1 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.0 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.0 | 0.1 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.0 | 0.1 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.0 | 0.1 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
0.0 | 0.1 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.0 | 0.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.0 | 0.2 | GO:0009650 | UV protection(GO:0009650) |
0.0 | 0.1 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.0 | 0.1 | GO:0070316 | G0 to G1 transition(GO:0045023) regulation of G0 to G1 transition(GO:0070316) |
0.0 | 0.1 | GO:0010915 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
0.0 | 0.3 | GO:0006465 | signal peptide processing(GO:0006465) |
0.0 | 0.1 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
0.0 | 0.0 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.0 | 1.9 | GO:0008033 | tRNA processing(GO:0008033) |
0.0 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.0 | 0.2 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.0 | 0.1 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
0.0 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.2 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.0 | 0.1 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.0 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.0 | 0.1 | GO:0015870 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
0.0 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.1 | GO:1901533 | negative regulation of hematopoietic progenitor cell differentiation(GO:1901533) |
0.0 | 0.2 | GO:0006621 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
0.0 | 0.1 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.0 | 0.1 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.0 | 0.1 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
0.0 | 0.3 | GO:0072663 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
0.0 | 0.3 | GO:0032148 | activation of protein kinase B activity(GO:0032148) |
0.0 | 1.1 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.0 | GO:0036514 | dopaminergic neuron axon guidance(GO:0036514) planar cell polarity pathway involved in axon guidance(GO:1904938) |
0.0 | 0.2 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.3 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.0 | 0.6 | GO:0007405 | neuroblast proliferation(GO:0007405) |
0.0 | 0.2 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.0 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.0 | 0.2 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.0 | 0.1 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.2 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.0 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.0 | 0.2 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
0.0 | 0.0 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.0 | 0.1 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.0 | 0.4 | GO:0031124 | mRNA 3'-end processing(GO:0031124) |
0.0 | 0.1 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.0 | 0.2 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
0.0 | 0.1 | GO:0021794 | thalamus development(GO:0021794) |
0.0 | 0.1 | GO:0032536 | regulation of cell projection size(GO:0032536) |
0.0 | 0.7 | GO:0090662 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.0 | 0.1 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.0 | 0.2 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.0 | 0.2 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.0 | 0.0 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.0 | 0.0 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.2 | GO:0046716 | muscle cell cellular homeostasis(GO:0046716) |
0.0 | 0.3 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.0 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.1 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.0 | 0.1 | GO:1902308 | regulation of peptidyl-serine dephosphorylation(GO:1902308) |
0.0 | 0.1 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.0 | 0.1 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
0.0 | 0.1 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.0 | GO:1904177 | regulation of adipose tissue development(GO:1904177) |
0.0 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.0 | 0.1 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.0 | 1.3 | GO:0044839 | cell cycle G2/M phase transition(GO:0044839) |
0.0 | 0.1 | GO:0045713 | low-density lipoprotein particle receptor biosynthetic process(GO:0045713) regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.0 | 0.1 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.0 | 0.1 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
0.0 | 0.2 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.1 | GO:0061084 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
0.0 | 0.0 | GO:0070384 | Harderian gland development(GO:0070384) |
0.0 | 0.0 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
0.0 | 0.0 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.0 | 0.2 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
0.0 | 0.0 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.0 | 0.0 | GO:0051985 | negative regulation of chromosome segregation(GO:0051985) |
0.0 | 0.1 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.0 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
0.0 | 0.5 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
0.0 | 0.1 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
0.0 | 0.0 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.0 | 0.1 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.0 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
0.0 | 0.4 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
0.0 | 0.1 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.0 | 0.1 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.0 | 0.2 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.0 | 0.1 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
0.0 | 0.3 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.0 | 0.0 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.0 | 0.1 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.0 | 0.0 | GO:0046931 | pore complex assembly(GO:0046931) |
0.0 | 0.5 | GO:0006414 | translational elongation(GO:0006414) |
0.0 | 0.1 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.2 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.0 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.0 | 0.1 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.0 | 0.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.0 | 0.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.0 | GO:0021612 | rhombomere 4 development(GO:0021570) facial nerve structural organization(GO:0021612) |
0.0 | 0.1 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
0.0 | 0.3 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.3 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.0 | 0.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.0 | 0.0 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.0 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.0 | 0.0 | GO:0006356 | regulation of transcription from RNA polymerase I promoter(GO:0006356) |
0.0 | 0.0 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.0 | 0.0 | GO:0090325 | regulation of locomotion involved in locomotory behavior(GO:0090325) |
0.0 | 0.1 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.0 | 0.2 | GO:0007097 | nuclear migration(GO:0007097) |
0.0 | 0.0 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.0 | 0.1 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.0 | 0.0 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.1 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.2 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.0 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.0 | 0.0 | GO:0031577 | spindle checkpoint(GO:0031577) |
0.0 | 0.2 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.0 | 0.0 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.0 | 0.0 | GO:0043038 | amino acid activation(GO:0043038) |
0.0 | 0.0 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.1 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.0 | 0.2 | GO:0043032 | positive regulation of macrophage activation(GO:0043032) |
0.0 | 0.0 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.0 | 0.1 | GO:1902592 | viral budding(GO:0046755) multi-organism organelle organization(GO:1902590) multi-organism membrane budding(GO:1902592) |
0.0 | 0.2 | GO:0002063 | chondrocyte development(GO:0002063) |
0.0 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.0 | 0.0 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.0 | 0.1 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.0 | 0.4 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.0 | 0.0 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.0 | 0.1 | GO:0061098 | positive regulation of protein tyrosine kinase activity(GO:0061098) |
0.0 | 0.1 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.0 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.0 | 0.0 | GO:0045345 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.0 | 1.0 | GO:0051028 | mRNA transport(GO:0051028) |
0.0 | 0.0 | GO:0061511 | centriole elongation(GO:0061511) |
0.0 | 0.1 | GO:0060736 | prostate gland growth(GO:0060736) |
0.0 | 0.5 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.2 | GO:0014003 | oligodendrocyte development(GO:0014003) |
0.0 | 0.6 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.0 | 0.1 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
0.0 | 0.0 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.0 | 0.2 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
0.0 | 0.0 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.1 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
0.0 | 0.1 | GO:0051798 | positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
0.0 | 0.0 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.6 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.0 | GO:0061743 | motor learning(GO:0061743) |
0.0 | 0.0 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.1 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.0 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.0 | 0.0 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
0.0 | 0.1 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.0 | 0.3 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
0.0 | 0.0 | GO:0051294 | establishment of spindle orientation(GO:0051294) |
0.0 | 0.6 | GO:0035773 | insulin secretion involved in cellular response to glucose stimulus(GO:0035773) |
0.0 | 0.3 | GO:0043113 | receptor clustering(GO:0043113) |
0.0 | 0.0 | GO:0006921 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.0 | 0.5 | GO:0001783 | B cell apoptotic process(GO:0001783) |
0.0 | 0.0 | GO:0002278 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.0 | 0.2 | GO:0048709 | oligodendrocyte differentiation(GO:0048709) |
0.0 | 0.0 | GO:0072033 | renal vesicle formation(GO:0072033) metanephric renal vesicle formation(GO:0072093) |
0.0 | 0.1 | GO:0017014 | protein nitrosylation(GO:0017014) |
0.0 | 0.1 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.0 | 0.1 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.0 | 0.0 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.0 | 0.1 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.0 | 0.0 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
0.0 | 0.1 | GO:0021571 | rhombomere 5 development(GO:0021571) |
0.0 | 0.0 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.0 | 0.1 | GO:0015884 | folic acid transport(GO:0015884) |
0.0 | 0.1 | GO:0002084 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.0 | 0.0 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.0 | 0.1 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.0 | 0.0 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.0 | 0.0 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.0 | 0.1 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.0 | 0.1 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.0 | 0.0 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.0 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.0 | 0.0 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
0.0 | 0.2 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.1 | GO:0043045 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
0.0 | 0.0 | GO:0009750 | response to fructose(GO:0009750) |
0.0 | 0.0 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
0.0 | 0.1 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.1 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.0 | GO:0010523 | negative regulation of calcium ion transport into cytosol(GO:0010523) |
0.0 | 0.0 | GO:0061038 | uterus morphogenesis(GO:0061038) |
0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.0 | GO:0034214 | protein hexamerization(GO:0034214) |
0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.0 | GO:0034969 | histone arginine methylation(GO:0034969) |
0.0 | 0.1 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.0 | 0.0 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.0 | 0.0 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.0 | 0.0 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.0 | 0.3 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.0 | 0.0 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.1 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.0 | 0.1 | GO:0008334 | histone mRNA metabolic process(GO:0008334) |
0.0 | 0.0 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.0 | 0.2 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.0 | 0.2 | GO:0008272 | sulfate transport(GO:0008272) |
0.0 | 0.2 | GO:0031294 | lymphocyte costimulation(GO:0031294) T cell costimulation(GO:0031295) |
0.0 | 0.1 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.0 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.0 | GO:0001941 | postsynaptic membrane organization(GO:0001941) |
0.0 | 0.1 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.0 | 0.2 | GO:0042517 | positive regulation of tyrosine phosphorylation of Stat3 protein(GO:0042517) |
0.0 | 0.0 | GO:0006360 | transcription from RNA polymerase I promoter(GO:0006360) |
0.0 | 0.2 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.0 | GO:0044351 | macropinocytosis(GO:0044351) |
0.0 | 0.0 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.0 | 0.0 | GO:0000237 | leptotene(GO:0000237) |
0.0 | 0.1 | GO:0032827 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.0 | 0.0 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.0 | 0.2 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
0.0 | 0.1 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.0 | 0.0 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.0 | 0.1 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.0 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.0 | 0.0 | GO:0070649 | polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
0.0 | 0.0 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.0 | 0.3 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
0.0 | 0.1 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.0 | 0.1 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.1 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.0 | 0.0 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.0 | 0.3 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.0 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
0.0 | 0.1 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.0 | 0.0 | GO:0002254 | kinin cascade(GO:0002254) |
0.0 | 0.0 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.0 | 0.1 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 0.0 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
0.0 | 0.1 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.0 | 0.0 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
0.0 | 0.0 | GO:1900120 | regulation of receptor binding(GO:1900120) |
0.0 | 0.0 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.0 | 0.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.0 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.3 | GO:0043407 | negative regulation of MAP kinase activity(GO:0043407) |
0.0 | 0.6 | GO:0001843 | neural tube closure(GO:0001843) |
0.0 | 0.4 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.0 | 0.1 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.0 | 0.0 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.0 | 0.0 | GO:0046321 | positive regulation of fatty acid oxidation(GO:0046321) |
0.0 | 0.0 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
0.0 | 0.1 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.0 | 0.4 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.0 | 0.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.1 | GO:0030432 | peristalsis(GO:0030432) |
0.0 | 0.2 | GO:1903363 | negative regulation of cellular protein catabolic process(GO:1903363) |
0.0 | 0.5 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.1 | GO:0035337 | fatty-acyl-CoA metabolic process(GO:0035337) |
0.0 | 0.1 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
0.0 | 0.0 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.0 | 0.0 | GO:0006405 | RNA export from nucleus(GO:0006405) |
0.0 | 0.0 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.0 | GO:0060253 | negative regulation of glial cell proliferation(GO:0060253) |
0.0 | 0.0 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
0.0 | 0.0 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.0 | 0.1 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.0 | 0.1 | GO:0042255 | ribosome assembly(GO:0042255) |
0.0 | 0.4 | GO:0006399 | tRNA metabolic process(GO:0006399) |
0.0 | 0.0 | GO:0035826 | rubidium ion transport(GO:0035826) |
0.0 | 0.0 | GO:0060831 | smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:0060831) |
0.0 | 0.1 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.0 | 0.0 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.0 | 0.0 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) small RNA loading onto RISC(GO:0070922) |
0.0 | 0.1 | GO:0090312 | positive regulation of protein deacetylation(GO:0090312) |
0.0 | 0.1 | GO:1901522 | positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
0.0 | 0.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.0 | GO:0007208 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) |
0.0 | 0.0 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
0.0 | 0.1 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.0 | 0.0 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.0 | 0.0 | GO:1902175 | regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902175) |
0.0 | 0.1 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.0 | 0.0 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.0 | 0.0 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.0 | 0.0 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.0 | 0.0 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.3 | GO:0042773 | ATP synthesis coupled electron transport(GO:0042773) |
0.0 | 0.1 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.0 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.0 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.0 | 0.1 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
0.0 | 0.0 | GO:0015888 | thiamine transport(GO:0015888) |
0.0 | 0.2 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.0 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.0 | 0.0 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.0 | 0.0 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.7 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 0.0 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.0 | 0.0 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.0 | 0.5 | GO:0006364 | rRNA processing(GO:0006364) |
0.0 | 0.0 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
0.0 | 0.1 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.0 | 0.1 | GO:0031929 | TOR signaling(GO:0031929) |
0.0 | 0.0 | GO:0042148 | strand invasion(GO:0042148) |
0.0 | 0.0 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.0 | 0.6 | GO:1903955 | positive regulation of establishment of protein localization to mitochondrion(GO:1903749) positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.0 | 0.0 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.0 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
0.0 | 0.0 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.0 | 0.3 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.0 | 0.0 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.0 | 0.0 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.0 | 0.0 | GO:0070417 | cellular response to cold(GO:0070417) |
0.0 | 0.0 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.0 | 0.0 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.0 | GO:0050779 | RNA destabilization(GO:0050779) |
0.0 | 0.0 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.1 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.0 | 0.0 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.0 | 0.0 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.0 | 0.1 | GO:0007603 | phototransduction, visible light(GO:0007603) |
0.0 | 0.0 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.0 | GO:2000095 | regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000095) |
0.0 | 0.0 | GO:0046950 | cellular ketone body metabolic process(GO:0046950) |
0.0 | 0.1 | GO:0032094 | response to food(GO:0032094) |
0.0 | 0.0 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.0 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.0 | 0.1 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.0 | 0.0 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 0.1 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.1 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
0.0 | 0.0 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.0 | 0.0 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 4.1 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.6 | 1.8 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.6 | 4.8 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.5 | 4.1 | GO:0071437 | invadopodium(GO:0071437) |
0.3 | 0.9 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.2 | 4.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.2 | 3.9 | GO:0030673 | axolemma(GO:0030673) |
0.2 | 0.8 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.2 | 0.5 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.2 | 1.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.2 | 1.6 | GO:0005883 | neurofilament(GO:0005883) |
0.2 | 1.1 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.2 | 2.2 | GO:0043196 | varicosity(GO:0043196) |
0.2 | 0.8 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.2 | 1.1 | GO:0032584 | growth cone membrane(GO:0032584) |
0.1 | 1.7 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 0.9 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.1 | 1.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 1.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 0.9 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 0.5 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.5 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 0.4 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 0.3 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 0.5 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 0.3 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.4 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.1 | 0.9 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 0.4 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 0.6 | GO:0070847 | core mediator complex(GO:0070847) |
0.1 | 0.3 | GO:0097427 | microtubule bundle(GO:0097427) |
0.1 | 0.9 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 0.3 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.1 | 0.2 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 0.3 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.1 | 0.4 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 0.4 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 0.6 | GO:0001940 | male pronucleus(GO:0001940) |
0.1 | 0.4 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.1 | 0.2 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.5 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.4 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.5 | GO:0097433 | dense body(GO:0097433) |
0.1 | 0.7 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.1 | 0.9 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 1.3 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 0.4 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.1 | 0.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.5 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.1 | 0.2 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 0.3 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 3.7 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.1 | 0.6 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 1.3 | GO:0010369 | chromocenter(GO:0010369) |
0.1 | 1.9 | GO:0044295 | axonal growth cone(GO:0044295) |
0.1 | 0.3 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.1 | 1.5 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.1 | 0.3 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.1 | 0.4 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 0.6 | GO:0044327 | dendritic spine head(GO:0044327) |
0.1 | 0.3 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.1 | 0.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.1 | 0.3 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 2.1 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 0.2 | GO:0016939 | kinesin II complex(GO:0016939) |
0.1 | 0.5 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 0.3 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 0.2 | GO:0036396 | MIS complex(GO:0036396) |
0.1 | 0.5 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 0.2 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 0.4 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 0.6 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 0.5 | GO:0098576 | lumenal side of membrane(GO:0098576) |
0.1 | 0.2 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.1 | 0.2 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.1 | 0.4 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.1 | 0.5 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.1 | 0.2 | GO:0005745 | m-AAA complex(GO:0005745) |
0.1 | 0.3 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.1 | 0.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.1 | 0.6 | GO:0031512 | motile primary cilium(GO:0031512) |
0.1 | 0.3 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.1 | 1.5 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.1 | 0.5 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.2 | GO:0031417 | NatC complex(GO:0031417) |
0.1 | 0.2 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.1 | 0.9 | GO:0001741 | XY body(GO:0001741) |
0.1 | 0.8 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.1 | 0.5 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.1 | 1.7 | GO:0032040 | small-subunit processome(GO:0032040) |
0.1 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.1 | 0.2 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.1 | 0.5 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 0.3 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.1 | 0.8 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.1 | 0.2 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.1 | 0.3 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.1 | 0.5 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 0.5 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.1 | 0.9 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 0.2 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.1 | 0.1 | GO:0001939 | female pronucleus(GO:0001939) |
0.1 | 2.0 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 0.3 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.1 | 0.4 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.1 | 0.6 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 0.4 | GO:0005686 | U2 snRNP(GO:0005686) |
0.1 | 1.1 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.0 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 1.0 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.4 | GO:0090544 | BAF-type complex(GO:0090544) |
0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.0 | 0.3 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.0 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.0 | 0.3 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.0 | 0.3 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.3 | GO:0005688 | U6 snRNP(GO:0005688) |
0.0 | 0.9 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 1.0 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.9 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.0 | 0.4 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 0.7 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
0.0 | 1.2 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 0.3 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.0 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.0 | 0.6 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 1.1 | GO:0030894 | replisome(GO:0030894) |
0.0 | 0.3 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.1 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.5 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.2 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.0 | 0.1 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.2 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.0 | 0.4 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.0 | 0.4 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.1 | GO:0033010 | paranodal junction(GO:0033010) |
0.0 | 0.3 | GO:0000243 | commitment complex(GO:0000243) |
0.0 | 0.3 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.0 | 0.1 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
0.0 | 0.4 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.3 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.3 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 1.7 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.0 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.0 | 0.5 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 1.9 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.0 | 0.3 | GO:0070938 | contractile ring(GO:0070938) |
0.0 | 0.3 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 0.3 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.2 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.0 | 0.3 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.1 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.0 | 0.2 | GO:0032590 | dendrite membrane(GO:0032590) |
0.0 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.5 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 1.2 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.3 | GO:0031011 | Ino80 complex(GO:0031011) |
0.0 | 0.2 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.3 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 6.3 | GO:0000790 | nuclear chromatin(GO:0000790) |
0.0 | 0.4 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 1.8 | GO:0005643 | nuclear pore(GO:0005643) |
0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.0 | 4.6 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.0 | 0.2 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 2.4 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.3 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 0.3 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.8 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.3 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.7 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.3 | GO:0030914 | STAGA complex(GO:0030914) |
0.0 | 1.2 | GO:0015935 | small ribosomal subunit(GO:0015935) |
0.0 | 0.1 | GO:0035859 | Seh1-associated complex(GO:0035859) |
0.0 | 0.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.1 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 0.8 | GO:0032993 | protein-DNA complex(GO:0032993) |
0.0 | 0.4 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.2 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 0.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 0.8 | GO:0030684 | preribosome(GO:0030684) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.3 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
0.0 | 0.5 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.1 | GO:0035102 | PRC1 complex(GO:0035102) |
0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.1 | GO:0043203 | axon hillock(GO:0043203) |
0.0 | 0.3 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
0.0 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.0 | 0.8 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.1 | GO:0005767 | secondary lysosome(GO:0005767) |
0.0 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.5 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.3 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 1.4 | GO:0044438 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.0 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.1 | GO:0045180 | basal cortex(GO:0045180) |
0.0 | 0.2 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.0 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.0 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.1 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.0 | 1.7 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.0 | 3.0 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.2 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 0.1 | GO:0044815 | DNA packaging complex(GO:0044815) |
0.0 | 0.0 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.0 | 0.0 | GO:0044298 | cell body membrane(GO:0044298) |
0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.3 | GO:0070382 | exocytic vesicle(GO:0070382) |
0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.9 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
0.0 | 0.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 1.0 | GO:0070469 | respiratory chain(GO:0070469) |
0.0 | 0.5 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.1 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.1 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.1 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.1 | GO:0045259 | proton-transporting ATP synthase complex(GO:0045259) |
0.0 | 0.0 | GO:0097443 | sorting endosome(GO:0097443) |
0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.2 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 4.7 | GO:0005874 | microtubule(GO:0005874) |
0.0 | 0.6 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.1 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.4 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.0 | 0.0 | GO:0032437 | cuticular plate(GO:0032437) |
0.0 | 0.6 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 1.7 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 0.1 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
0.0 | 0.4 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 1.0 | GO:0030426 | growth cone(GO:0030426) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.0 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.0 | 0.1 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.5 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.0 | 0.3 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 0.2 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.0 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 1.2 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.0 | 0.1 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.7 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 0.4 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.0 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.0 | 0.1 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.0 | 0.1 | GO:0036452 | ESCRT complex(GO:0036452) |
0.0 | 0.4 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.1 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.1 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.0 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.0 | 0.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.2 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 1.6 | GO:0030424 | axon(GO:0030424) |
0.0 | 1.2 | GO:0005802 | trans-Golgi network(GO:0005802) |
0.0 | 0.7 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.0 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.0 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.0 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.0 | GO:0000791 | euchromatin(GO:0000791) |
0.0 | 0.1 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.0 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 0.5 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.0 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.0 | 0.0 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.0 | 0.1 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.0 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.0 | 0.0 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 0.1 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 2.9 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
1.0 | 3.9 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.8 | 2.3 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.7 | 3.6 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.5 | 0.5 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.5 | 4.2 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.4 | 2.9 | GO:0003680 | AT DNA binding(GO:0003680) |
0.4 | 1.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.3 | 1.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.3 | 1.9 | GO:0043495 | protein anchor(GO:0043495) |
0.3 | 1.6 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.3 | 1.0 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.2 | 0.7 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.2 | 5.3 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.2 | 0.6 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.2 | 0.6 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.2 | 0.6 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.2 | 1.3 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.2 | 0.9 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.2 | 0.7 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.2 | 0.4 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.2 | 0.7 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.2 | 0.5 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.2 | 0.5 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.2 | 1.3 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.2 | 3.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.2 | 0.3 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.2 | 0.6 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 0.4 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.1 | 0.6 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.1 | 0.4 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.1 | 2.5 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.1 | 0.6 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.8 | GO:0043814 | CTP:2,3-di-O-geranylgeranyl-sn-glycero-1-phosphate cytidyltransferase activity(GO:0043338) phospholactate guanylyltransferase activity(GO:0043814) ATP:coenzyme F420 adenylyltransferase activity(GO:0043910) UDP-N-acetylgalactosamine diphosphorylase activity(GO:0052630) |
0.1 | 0.4 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.1 | 0.5 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.1 | 0.5 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.1 | 0.3 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.1 | 1.0 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.1 | 0.5 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 1.2 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.1 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.1 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.1 | 0.5 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 0.9 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 3.7 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.1 | 0.8 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.1 | 2.2 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.1 | 0.4 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 0.2 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.1 | 0.3 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.1 | 1.2 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 2.1 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 0.6 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 0.3 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.1 | 0.3 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.1 | 1.8 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
0.1 | 0.9 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.1 | 1.1 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.1 | 2.1 | GO:0030332 | cyclin binding(GO:0030332) |
0.1 | 0.3 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.1 | 0.3 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.1 | 0.2 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.1 | 0.4 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 0.3 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.1 | 1.2 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.1 | 0.2 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
0.1 | 1.1 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.1 | 0.8 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 1.1 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.1 | 0.4 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.5 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.5 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.5 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.1 | 0.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 0.6 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 2.3 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 0.3 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 0.4 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.1 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.1 | 0.2 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 0.7 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
0.1 | 0.4 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 0.2 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.1 | 0.3 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 0.3 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.2 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.1 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 1.2 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.1 | 0.5 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.1 | 0.2 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 0.8 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 0.7 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 0.2 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.1 | 0.2 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.1 | 0.6 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.1 | 0.3 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.1 | 0.3 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.1 | 0.5 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.1 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.3 | GO:0043820 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
0.1 | 0.8 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.1 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 1.0 | GO:0015026 | coreceptor activity(GO:0015026) |
0.1 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.1 | 0.4 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.1 | 0.1 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.1 | 0.4 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.1 | 0.6 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.1 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 0.2 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 0.4 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 0.4 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.1 | 0.3 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.1 | 0.1 | GO:0015149 | hexose transmembrane transporter activity(GO:0015149) |
0.1 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.3 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.2 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.1 | 0.2 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 0.2 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.2 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.1 | 0.2 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.6 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.2 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.1 | 0.4 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.1 | 0.2 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.1 | 0.1 | GO:0003678 | DNA helicase activity(GO:0003678) |
0.1 | 0.2 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.1 | 0.5 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 0.2 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.2 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.1 | 0.6 | GO:0044466 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.1 | 0.2 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.1 | 0.2 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.1 | 0.3 | GO:0016936 | galactoside binding(GO:0016936) |
0.1 | 0.2 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.3 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.1 | 0.4 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 0.4 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.1 | 0.2 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.1 | 1.4 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 0.6 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 0.4 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.2 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.1 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.1 | 0.2 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 0.2 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.1 | 0.2 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.1 | 0.5 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.1 | 0.1 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.1 | 0.5 | GO:0070403 | NAD+ binding(GO:0070403) |
0.1 | 0.8 | GO:0031402 | sodium ion binding(GO:0031402) |
0.1 | 0.7 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.1 | 0.4 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.1 | 0.2 | GO:0030519 | snoRNP binding(GO:0030519) |
0.1 | 0.2 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.1 | 0.3 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.1 | 1.0 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.1 | 0.2 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.1 | 0.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.0 | 0.3 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.0 | 0.3 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.0 | 0.2 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.3 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.5 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.6 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.1 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
0.0 | 0.6 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.3 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.2 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.0 | 0.1 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.0 | 0.1 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.0 | 0.3 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.0 | 0.2 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.1 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.0 | 0.3 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.0 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.3 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.0 | 0.1 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.1 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.0 | 0.2 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.2 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.0 | 0.6 | GO:0004407 | histone deacetylase activity(GO:0004407) |
0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
0.0 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.0 | 0.8 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) |
0.0 | 0.7 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.0 | 0.4 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.0 | 0.3 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.0 | 0.1 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 0.8 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.0 | 0.2 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.3 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.3 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.0 | 0.3 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.0 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.7 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.0 | 0.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.0 | 0.5 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 0.0 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
0.0 | 0.9 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.2 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.0 | 0.5 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 0.2 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.6 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.5 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.1 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.0 | 0.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.2 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.0 | 0.5 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.0 | 0.1 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.1 | GO:0034808 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.0 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.1 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.0 | 0.7 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.0 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.0 | 0.7 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.8 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.1 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.0 | 0.1 | GO:0070840 | dynein complex binding(GO:0070840) |
0.0 | 1.0 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
0.0 | 0.6 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 4.4 | GO:0003729 | mRNA binding(GO:0003729) |
0.0 | 0.4 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.5 | GO:0030515 | snoRNA binding(GO:0030515) |
0.0 | 0.3 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.3 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.3 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.4 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.4 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.9 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.8 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.4 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.3 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.3 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.0 | 0.8 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.2 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.0 | 0.1 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.1 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
0.0 | 0.0 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.2 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.3 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.2 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.1 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 0.1 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.3 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 1.8 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
0.0 | 0.5 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.0 | 0.9 | GO:0019843 | rRNA binding(GO:0019843) |
0.0 | 0.1 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.2 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.0 | 0.1 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.2 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.0 | 0.2 | GO:0036442 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) hydrogen-exporting ATPase activity(GO:0036442) |
0.0 | 2.2 | GO:0047485 | protein N-terminus binding(GO:0047485) |
0.0 | 0.4 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.6 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.2 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.1 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.0 | 0.2 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.0 | 0.2 | GO:0000150 | recombinase activity(GO:0000150) |
0.0 | 0.2 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.3 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.1 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.0 | 0.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.2 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
0.0 | 0.1 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.0 | 0.2 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 1.1 | GO:0043765 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.2 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.0 | 0.1 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
0.0 | 0.0 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) C4-dicarboxylate transmembrane transporter activity(GO:0015556) |
0.0 | 0.1 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.0 | 0.2 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.4 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.0 | 0.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.5 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.0 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.0 | 0.1 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.8 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.0 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.0 | 0.3 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.7 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.1 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.1 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.0 | 0.3 | GO:0051119 | sugar transmembrane transporter activity(GO:0051119) |
0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.1 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.0 | 1.2 | GO:0003724 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 1.0 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.8 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.0 | 0.4 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.8 | GO:0002039 | p53 binding(GO:0002039) |
0.0 | 0.1 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) calcium:cation antiporter activity(GO:0015368) |
0.0 | 0.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.0 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.0 | 0.1 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.2 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.2 | GO:0010181 | FMN binding(GO:0010181) |
0.0 | 0.2 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.2 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
0.0 | 0.6 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 0.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.0 | 0.0 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.0 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.0 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.0 | 0.1 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.4 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.1 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
0.0 | 0.1 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.2 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.2 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.0 | 0.1 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 3.0 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.2 | GO:0030275 | LRR domain binding(GO:0030275) |
0.0 | 0.3 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.0 | 0.0 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 0.1 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.0 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
0.0 | 0.1 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 2.6 | GO:0008017 | microtubule binding(GO:0008017) |
0.0 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.2 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.1 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.1 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.0 | 10.5 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
0.0 | 0.1 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.1 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.0 | 0.1 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.0 | GO:0004954 | prostanoid receptor activity(GO:0004954) |
0.0 | 2.4 | GO:0061659 | ubiquitin-like protein ligase activity(GO:0061659) |
0.0 | 0.0 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.1 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.0 | 0.4 | GO:0042165 | neurotransmitter binding(GO:0042165) |
0.0 | 0.0 | GO:0035939 | microsatellite binding(GO:0035939) |
0.0 | 0.2 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.0 | 0.0 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.1 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 1.7 | GO:0003714 | transcription corepressor activity(GO:0003714) |
0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.0 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.2 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.0 | 0.0 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.0 | 0.3 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.1 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 0.0 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.1 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.1 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.0 | 0.1 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.1 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.0 | 0.0 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.0 | 0.2 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.5 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.9 | GO:0003774 | motor activity(GO:0003774) |
0.0 | 0.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.1 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
0.0 | 0.0 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.0 | 0.1 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.1 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.0 | 0.2 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.1 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.0 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.0 | 0.0 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.1 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.0 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.3 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
0.0 | 0.0 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.0 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.0 | 0.1 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.0 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.0 | 0.0 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.0 | 0.0 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.0 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.0 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.2 | GO:0070035 | ATP-dependent helicase activity(GO:0008026) purine NTP-dependent helicase activity(GO:0070035) |
0.0 | 0.0 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.0 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.0 | 0.1 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.0 | 0.0 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.0 | 0.0 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.0 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.0 | 0.0 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.0 | 0.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.1 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
0.0 | 0.3 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.0 | 0.0 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.0 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.0 | 0.0 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.2 | GO:0004527 | exonuclease activity(GO:0004527) |
0.0 | 0.0 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.0 | 0.0 | GO:0000295 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.0 | 0.1 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.0 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.0 | 1.2 | GO:0003924 | GTPase activity(GO:0003924) |
0.0 | 0.0 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
0.0 | 0.0 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.0 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.0 | 0.6 | GO:0016782 | transferase activity, transferring sulfur-containing groups(GO:0016782) |
0.0 | 0.0 | GO:0010851 | cyclase regulator activity(GO:0010851) guanylate cyclase regulator activity(GO:0030249) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 2.6 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 3.7 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.1 | 0.2 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.1 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 1.4 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 1.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 4.2 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.1 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 0.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 1.4 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 1.5 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 0.5 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 1.0 | PID ARF 3PATHWAY | Arf1 pathway |
0.1 | 1.2 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 0.2 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 2.3 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.8 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.6 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.5 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.7 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.8 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 1.3 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.0 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.5 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.9 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.0 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 0.4 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.2 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.0 | 0.4 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.6 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 0.6 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.6 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.5 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.8 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.3 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.7 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.5 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.2 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.2 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.0 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.0 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.2 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 0.6 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.5 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 1.4 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.3 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.2 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.1 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.0 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 0.1 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.0 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.4 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.3 | PID PLK1 PATHWAY | PLK1 signaling events |
0.0 | 0.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.1 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.1 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.3 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 4.2 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.3 | 3.5 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.2 | 2.9 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.2 | 2.5 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.2 | 5.3 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.2 | 1.5 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.2 | 0.7 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.2 | 1.7 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.1 | 1.1 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 2.0 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 0.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.1 | 0.9 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 0.4 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 0.1 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.1 | 0.7 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 1.2 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.1 | 1.3 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
0.1 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.1 | 0.6 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 1.0 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.1 | 0.7 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.1 | 0.2 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.1 | 1.4 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.1 | 0.6 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.1 | 1.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 1.8 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.1 | 0.3 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
0.1 | 0.5 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.1 | 1.6 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.1 | 1.7 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.1 | 0.5 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 0.2 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 1.5 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 0.1 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.1 | 0.3 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 0.1 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.1 | 0.3 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.1 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.0 | 0.5 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.5 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.7 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
0.0 | 1.0 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.6 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.3 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.4 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.0 | 0.0 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
0.0 | 0.4 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.3 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.2 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.7 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 1.6 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 3.0 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.2 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 1.8 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.4 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.0 | 0.1 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
0.0 | 0.6 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.0 | 0.8 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 3.1 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
0.0 | 0.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.2 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.0 | 0.0 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.0 | 0.2 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
0.0 | 0.8 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.4 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 1.4 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.0 | 0.2 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.4 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.2 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.0 | 0.4 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 1.0 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.0 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.0 | 0.3 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.0 | 0.3 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.0 | 1.6 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.1 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.0 | 0.4 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.3 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.0 | 0.3 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.0 | 0.4 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.3 | REACTOME TELOMERE MAINTENANCE | Genes involved in Telomere Maintenance |
0.0 | 0.0 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
0.0 | 0.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.3 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.1 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.3 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.2 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.0 | 0.7 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.2 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
0.0 | 0.0 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 0.4 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.3 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.4 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.2 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.0 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
0.0 | 1.2 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.0 | 0.2 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.1 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.0 | 0.3 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.4 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.1 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
0.0 | 0.1 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 0.5 | REACTOME TRANSLATION | Genes involved in Translation |
0.0 | 0.2 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.0 | 0.1 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.1 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 0.2 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 0.9 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
0.0 | 0.1 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.2 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.2 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 1.5 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.1 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.5 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
0.0 | 0.0 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.1 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.1 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.0 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.0 | 0.0 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.0 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.0 | 0.1 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |