Gene Symbol | Gene ID | Gene Info |
---|---|---|
Gata3
|
ENSMUSG00000015619.10 | GATA binding protein 3 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
chr2_9878849_9879623 | Gata3 | 636 | 0.532448 | -0.49 | 5.8e-05 | Click! |
chr2_9878472_9878776 | Gata3 | 24 | 0.947524 | -0.43 | 5.7e-04 | Click! |
chr2_9853332_9853483 | Gata3 | 20265 | 0.120830 | 0.39 | 2.1e-03 | Click! |
chr2_9878291_9878451 | Gata3 | 229 | 0.836843 | -0.36 | 5.3e-03 | Click! |
chr2_9870829_9870980 | Gata3 | 2768 | 0.174299 | -0.32 | 1.3e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr14_66344363_66345813 | 17.00 |
Stmn4 |
stathmin-like 4 |
707 |
0.65 |
chr3_94478073_94479450 | 15.56 |
Celf3 |
CUGBP, Elav-like family member 3 |
70 |
0.92 |
chr3_88208985_88210116 | 14.63 |
Gm3764 |
predicted gene 3764 |
78 |
0.92 |
chr19_6499251_6500132 | 14.59 |
Nrxn2 |
neurexin II |
1856 |
0.23 |
chr10_80300884_80302968 | 13.57 |
Apc2 |
APC regulator of WNT signaling pathway 2 |
106 |
0.9 |
chr4_110285468_110287125 | 11.75 |
Elavl4 |
ELAV like RNA binding protein 4 |
320 |
0.94 |
chr9_110051810_110053856 | 11.25 |
Map4 |
microtubule-associated protein 4 |
781 |
0.54 |
chr4_9269280_9270516 | 10.93 |
Clvs1 |
clavesin 1 |
551 |
0.81 |
chr11_84520959_84524590 | 10.37 |
Lhx1 |
LIM homeobox protein 1 |
63 |
0.97 |
chr2_158614356_158617139 | 10.16 |
Gm14205 |
predicted gene 14205 |
3927 |
0.13 |
chr10_80298461_80300404 | 10.10 |
Apc2 |
APC regulator of WNT signaling pathway 2 |
341 |
0.69 |
chr5_116590520_116593206 | 10.07 |
Srrm4 |
serine/arginine repetitive matrix 4 |
46 |
0.98 |
chr5_135806693_135807939 | 9.97 |
Srrm3 |
serine/arginine repetitive matrix 3 |
419 |
0.73 |
chr2_70564530_70567543 | 9.62 |
Gad1 |
glutamate decarboxylase 1 |
341 |
0.83 |
chr2_25264308_25268001 | 9.51 |
Tprn |
taperin |
1410 |
0.14 |
chr7_44336079_44337576 | 9.21 |
Shank1 |
SH3 and multiple ankyrin repeat domains 1 |
811 |
0.34 |
chr7_126702563_126704731 | 9.00 |
Coro1a |
coronin, actin binding protein 1A |
473 |
0.55 |
chr7_140080531_140082545 | 8.92 |
Caly |
calcyon neuron-specific vesicular protein |
689 |
0.48 |
chr8_106336310_106337932 | 8.85 |
Smpd3 |
sphingomyelin phosphodiesterase 3, neutral |
867 |
0.61 |
chr11_87759834_87761999 | 8.80 |
Tspoap1 |
TSPO associated protein 1 |
329 |
0.75 |
chr19_44758783_44762005 | 8.62 |
Pax2 |
paired box 2 |
479 |
0.75 |
chrX_7638310_7639997 | 8.39 |
Syp |
synaptophysin |
152 |
0.88 |
chr15_82255980_82257145 | 8.34 |
1500009C09Rik |
RIKEN cDNA 1500009C09 gene |
539 |
0.56 |
chr11_102360845_102363484 | 8.32 |
Slc4a1 |
solute carrier family 4 (anion exchanger), member 1 |
1540 |
0.24 |
chr1_172056022_172057415 | 8.22 |
Nhlh1 |
nescient helix loop helix 1 |
855 |
0.45 |
chr2_158610228_158611991 | 8.16 |
Slc32a1 |
solute carrier family 32 (GABA vesicular transporter), member 1 |
342 |
0.44 |
chr7_25004827_25006284 | 7.99 |
Atp1a3 |
ATPase, Na+/K+ transporting, alpha 3 polypeptide |
340 |
0.79 |
chr19_45230983_45235468 | 7.77 |
Lbx1 |
ladybird homeobox 1 |
2587 |
0.27 |
chr5_37248332_37249378 | 7.69 |
Crmp1 |
collapsin response mediator protein 1 |
1570 |
0.39 |
chr11_96343236_96346574 | 7.65 |
Hoxb3 |
homeobox B3 |
1136 |
0.24 |
chr11_77933689_77934630 | 7.62 |
Sez6 |
seizure related gene 6 |
3120 |
0.17 |
chr7_51623529_51624502 | 7.61 |
Slc17a6 |
solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 6 |
1133 |
0.51 |
chr9_21196536_21198489 | 7.57 |
Pde4a |
phosphodiesterase 4A, cAMP specific |
807 |
0.45 |
chr12_29533001_29533958 | 7.54 |
Myt1l |
myelin transcription factor 1-like |
94 |
0.96 |
chr8_109250241_109250821 | 7.50 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
665 |
0.8 |
chr19_7421074_7423945 | 7.46 |
Mir6991 |
microRNA 6991 |
64 |
0.94 |
chr5_106453173_106456366 | 7.40 |
Barhl2 |
BarH like homeobox 2 |
3397 |
0.22 |
chr4_148284201_148285628 | 7.38 |
Disp3 |
dispatched RND transporter family member 3 |
3051 |
0.22 |
chr2_152083384_152083946 | 7.30 |
Scrt2 |
scratch family zinc finger 2 |
2136 |
0.23 |
chr3_17793835_17795104 | 7.30 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
427 |
0.75 |
chr3_158559356_158560580 | 7.29 |
Lrrc7 |
leucine rich repeat containing 7 |
1368 |
0.57 |
chr8_84934799_84937325 | 7.27 |
Mast1 |
microtubule associated serine/threonine kinase 1 |
1282 |
0.19 |
chr5_120433178_120434996 | 7.21 |
Gm27199 |
predicted gene 27199 |
2320 |
0.19 |
chr2_21367263_21369086 | 7.21 |
Gpr158 |
G protein-coupled receptor 158 |
607 |
0.59 |
chr12_88724589_88725423 | 7.19 |
Nrxn3 |
neurexin III |
3 |
0.98 |
chr6_83185720_83187846 | 6.98 |
Dctn1 |
dynactin 1 |
837 |
0.39 |
chr8_121730928_121732115 | 6.96 |
Jph3 |
junctophilin 3 |
954 |
0.49 |
chr1_173332160_173333204 | 6.96 |
Ackr1 |
atypical chemokine receptor 1 (Duffy blood group) |
820 |
0.54 |
chr9_69758963_69761490 | 6.93 |
Foxb1 |
forkhead box B1 |
714 |
0.5 |
chr2_164967685_164969910 | 6.93 |
Slc12a5 |
solute carrier family 12, member 5 |
516 |
0.7 |
chr2_158613157_158614206 | 6.88 |
Gm14205 |
predicted gene 14205 |
1861 |
0.2 |
chr10_81472751_81473777 | 6.88 |
Celf5 |
CUGBP, Elav-like family member 5 |
114 |
0.9 |
chr14_70623688_70624289 | 6.80 |
Dmtn |
dematin actin binding protein |
2167 |
0.19 |
chr12_72234504_72235243 | 6.73 |
Rtn1 |
reticulon 1 |
866 |
0.66 |
chr15_76519928_76521866 | 6.68 |
Scrt1 |
scratch family zinc finger 1 |
1005 |
0.28 |
chr3_102011198_102013204 | 6.66 |
Nhlh2 |
nescient helix loop helix 2 |
2046 |
0.32 |
chr8_123410787_123412789 | 6.64 |
Tubb3 |
tubulin, beta 3 class III |
198 |
0.84 |
chr9_58197310_58202560 | 6.62 |
Islr2 |
immunoglobulin superfamily containing leucine-rich repeat 2 |
637 |
0.54 |
chr3_31309226_31310664 | 6.56 |
Slc7a14 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 14 |
433 |
0.72 |
chr9_91369028_91370469 | 6.54 |
Zic4 |
zinc finger protein of the cerebellum 4 |
250 |
0.86 |
chr5_115908055_115909691 | 6.52 |
Cit |
citron |
1403 |
0.37 |
chr3_108410436_108412210 | 6.51 |
Celsr2 |
cadherin, EGF LAG seven-pass G-type receptor 2 |
4229 |
0.11 |
chr13_105444000_105445296 | 6.48 |
Htr1a |
5-hydroxytryptamine (serotonin) receptor 1A |
1009 |
0.69 |
chr8_94997776_94998724 | 6.45 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
2589 |
0.18 |
chr7_126950022_126951260 | 6.37 |
Sez6l2 |
seizure related 6 homolog like 2 |
57 |
0.89 |
chrX_105390628_105392456 | 6.33 |
5330434G04Rik |
RIKEN cDNA 5330434G04 gene |
212 |
0.93 |
chr2_172040251_172043672 | 6.31 |
Cbln4 |
cerebellin 4 precursor protein |
1505 |
0.35 |
chr3_88831100_88832914 | 6.29 |
1500004A13Rik |
RIKEN cDNA 1500004A13 gene |
361 |
0.77 |
chr8_94994139_94995207 | 6.28 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
77 |
0.95 |
chr2_84735706_84738103 | 6.27 |
Ypel4 |
yippee like 4 |
2677 |
0.11 |
chr1_64117867_64118702 | 6.24 |
Klf7 |
Kruppel-like factor 7 (ubiquitous) |
3198 |
0.25 |
chr2_181763361_181764530 | 6.23 |
Myt1 |
myelin transcription factor 1 |
613 |
0.66 |
chr8_84741754_84745977 | 6.23 |
G430095P16Rik |
RIKEN cDNA G430095P16 gene |
20858 |
0.09 |
chr12_88725972_88726370 | 6.20 |
Nrxn3 |
neurexin III |
490 |
0.84 |
chr11_55607331_55608633 | 6.11 |
Glra1 |
glycine receptor, alpha 1 subunit |
161 |
0.96 |
chr1_132541040_132543287 | 6.05 |
Cntn2 |
contactin 2 |
702 |
0.64 |
chr14_70625458_70627688 | 6.03 |
Dmtn |
dematin actin binding protein |
418 |
0.75 |
chr13_83727321_83728283 | 6.01 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
304 |
0.83 |
chr7_105568525_105569825 | 6.01 |
Apbb1 |
amyloid beta (A4) precursor protein-binding, family B, member 1 |
90 |
0.94 |
chr14_70627710_70629563 | 5.97 |
Dmtn |
dematin actin binding protein |
363 |
0.79 |
chr11_76466993_76468433 | 5.94 |
Abr |
active BCR-related gene |
585 |
0.77 |
chr16_20713558_20714737 | 5.88 |
Clcn2 |
chloride channel, voltage-sensitive 2 |
479 |
0.59 |
chr11_33202043_33204837 | 5.87 |
Tlx3 |
T cell leukemia, homeobox 3 |
149 |
0.86 |
chr5_120424691_120425521 | 5.82 |
Lhx5 |
LIM homeobox protein 5 |
6593 |
0.14 |
chr12_29537800_29538885 | 5.82 |
Myt1l |
myelin transcription factor 1-like |
3120 |
0.28 |
chr2_31638722_31641540 | 5.80 |
Prdm12 |
PR domain containing 12 |
94 |
0.84 |
chr13_34125172_34126139 | 5.79 |
Tubb2b |
tubulin, beta 2B class IIB |
4699 |
0.12 |
chr8_41052368_41053980 | 5.77 |
Gm16193 |
predicted gene 16193 |
64 |
0.96 |
chr3_88213113_88214199 | 5.75 |
Gm3764 |
predicted gene 3764 |
829 |
0.3 |
chr8_14382368_14383445 | 5.70 |
Dlgap2 |
DLG associated protein 2 |
910 |
0.66 |
chr13_69737356_69737994 | 5.66 |
Ube2ql1 |
ubiquitin-conjugating enzyme E2Q family-like 1 |
2214 |
0.21 |
chr5_98180058_98181966 | 5.63 |
Prdm8 |
PR domain containing 8 |
34 |
0.97 |
chr11_31872311_31873528 | 5.63 |
Cpeb4 |
cytoplasmic polyadenylation element binding protein 4 |
356 |
0.89 |
chr9_96729464_96730774 | 5.63 |
Zbtb38 |
zinc finger and BTB domain containing 38 |
1083 |
0.47 |
chr3_88214322_88216234 | 5.56 |
Mir3093 |
microRNA 3093 |
107 |
0.63 |
chr12_29529828_29531185 | 5.53 |
Gm20208 |
predicted gene, 20208 |
609 |
0.74 |
chr12_29534253_29535510 | 5.52 |
Gm20208 |
predicted gene, 20208 |
10 |
0.8 |
chr15_25754845_25755428 | 5.50 |
Myo10 |
myosin X |
2157 |
0.37 |
chr5_120431744_120433119 | 5.48 |
Gm27199 |
predicted gene 27199 |
664 |
0.41 |
chr7_142091808_142093330 | 5.46 |
Dusp8 |
dual specificity phosphatase 8 |
2703 |
0.11 |
chr13_55483242_55484428 | 5.41 |
Dbn1 |
drebrin 1 |
134 |
0.9 |
chr6_88872932_88873571 | 5.39 |
Podxl2 |
podocalyxin-like 2 |
794 |
0.47 |
chr14_67236008_67239452 | 5.37 |
Ebf2 |
early B cell factor 2 |
3086 |
0.21 |
chr15_72807706_72808811 | 5.35 |
Peg13 |
paternally expressed 13 |
2066 |
0.4 |
chr10_81229656_81230911 | 5.34 |
Atcay |
ataxia, cerebellar, Cayman type |
502 |
0.53 |
chr4_32862939_32864770 | 5.34 |
Ankrd6 |
ankyrin repeat domain 6 |
3171 |
0.24 |
chr2_52557337_52558561 | 5.33 |
Cacnb4 |
calcium channel, voltage-dependent, beta 4 subunit |
611 |
0.74 |
chr9_63144078_63146888 | 5.33 |
Skor1 |
SKI family transcriptional corepressor 1 |
1497 |
0.38 |
chr1_17146083_17146352 | 5.32 |
Gdap1 |
ganglioside-induced differentiation-associated-protein 1 |
749 |
0.64 |
chr1_92849002_92850443 | 5.31 |
Mir149 |
microRNA 149 |
656 |
0.43 |
chr17_91092075_91093120 | 5.30 |
Nrxn1 |
neurexin I |
136 |
0.95 |
chr6_60827699_60828046 | 5.30 |
Snca |
synuclein, alpha |
316 |
0.9 |
chr4_155893812_155895517 | 5.27 |
Acap3 |
ArfGAP with coiled-coil, ankyrin repeat and PH domains 3 |
2352 |
0.11 |
chr9_44340460_44342952 | 5.24 |
Hmbs |
hydroxymethylbilane synthase |
473 |
0.51 |
chr2_136060447_136061114 | 5.24 |
Lamp5 |
lysosomal-associated membrane protein family, member 5 |
1349 |
0.48 |
chr11_41999400_42000640 | 5.23 |
Gabrg2 |
gamma-aminobutyric acid (GABA) A receptor, subunit gamma 2 |
336 |
0.92 |
chr6_124463804_124465512 | 5.21 |
Clstn3 |
calsyntenin 3 |
136 |
0.92 |
chr18_59062200_59063436 | 5.19 |
Minar2 |
membrane integral NOTCH2 associated receptor 2 |
307 |
0.94 |
chr5_37241461_37244349 | 5.19 |
Crmp1 |
collapsin response mediator protein 1 |
171 |
0.95 |
chr12_87026152_87027307 | 5.17 |
Tmem63c |
transmembrane protein 63c |
113 |
0.95 |
chr13_83717521_83718816 | 5.16 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
3213 |
0.17 |
chr8_122751484_122752386 | 5.15 |
C230057M02Rik |
RIKEN cDNA C230057M02 gene |
390 |
0.75 |
chr12_102555272_102555761 | 5.14 |
Chga |
chromogranin A |
530 |
0.74 |
chr13_8207058_8207829 | 5.11 |
Adarb2 |
adenosine deaminase, RNA-specific, B2 |
4521 |
0.2 |
chr15_76666348_76670076 | 5.10 |
Foxh1 |
forkhead box H1 |
1590 |
0.15 |
chr8_109247005_109247806 | 5.08 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
2461 |
0.39 |
chr3_34656299_34657721 | 5.08 |
Sox2ot |
SOX2 overlapping transcript (non-protein coding) |
974 |
0.4 |
chr2_70561988_70564432 | 5.05 |
Gad1os |
glutamate decarboxylase 1, opposite strand |
147 |
0.61 |
chr7_44479611_44481283 | 5.05 |
5430431A17Rik |
RIKEN cDNA 5430431A17 gene |
4070 |
0.08 |
chr9_22050521_22051976 | 5.03 |
Elavl3 |
ELAV like RNA binding protein 3 |
762 |
0.41 |
chr1_92847884_92848981 | 5.02 |
Gm29480 |
predicted gene 29480 |
339 |
0.76 |
chr15_99527112_99528245 | 5.02 |
Faim2 |
Fas apoptotic inhibitory molecule 2 |
3 |
0.96 |
chr6_114282516_114283979 | 5.00 |
Slc6a1 |
solute carrier family 6 (neurotransmitter transporter, GABA), member 1 |
457 |
0.87 |
chr8_70119024_70120981 | 4.99 |
Ncan |
neurocan |
871 |
0.35 |
chr8_124430797_124432255 | 4.99 |
Pgbd5 |
piggyBac transposable element derived 5 |
2410 |
0.31 |
chr4_42951254_42951979 | 4.99 |
Dnajb5 |
DnaJ heat shock protein family (Hsp40) member B5 |
1176 |
0.34 |
chr4_115133068_115134495 | 4.98 |
Cyp4x1os |
cytochrome P450, family 4, subfamily x, polypeptide 1, opposite strand |
51 |
0.69 |
chr6_103510606_103512502 | 4.95 |
Chl1 |
cell adhesion molecule L1-like |
224 |
0.93 |
chr10_57784547_57786586 | 4.95 |
Fabp7 |
fatty acid binding protein 7, brain |
643 |
0.68 |
chr4_91380440_91381612 | 4.95 |
Elavl2 |
ELAV like RNA binding protein 1 |
4530 |
0.22 |
chr8_31089411_31091663 | 4.92 |
Dusp26 |
dual specificity phosphatase 26 (putative) |
733 |
0.65 |
chr8_94995811_94996872 | 4.89 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
680 |
0.57 |
chrX_143930842_143933141 | 4.87 |
Dcx |
doublecortin |
1059 |
0.64 |
chr15_78770199_78773461 | 4.85 |
Mfng |
MFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
64 |
0.96 |
chr3_94479508_94480443 | 4.84 |
Riiad1 |
regulatory subunit of type II PKA R-subunit (RIIa) domain containing 1 |
366 |
0.63 |
chr15_78116860_78117881 | 4.83 |
A730060N03Rik |
RIKEN cDNA A730060N03 gene |
2336 |
0.22 |
chr8_54954519_54955779 | 4.77 |
Gpm6a |
glycoprotein m6a |
306 |
0.88 |
chr4_110290101_110291006 | 4.77 |
Elavl4 |
ELAV like RNA binding protein 4 |
281 |
0.95 |
chr2_181155937_181157234 | 4.76 |
Eef1a2 |
eukaryotic translation elongation factor 1 alpha 2 |
429 |
0.73 |
chr6_113193892_113195750 | 4.74 |
Lhfpl4 |
lipoma HMGIC fusion partner-like protein 4 |
563 |
0.7 |
chr12_52700044_52701597 | 4.74 |
Akap6 |
A kinase (PRKA) anchor protein 6 |
1437 |
0.46 |
chr11_54597790_54598295 | 4.73 |
Rapgef6 |
Rap guanine nucleotide exchange factor (GEF) 6 |
1868 |
0.38 |
chr1_173365727_173366467 | 4.72 |
Cadm3 |
cell adhesion molecule 3 |
1536 |
0.34 |
chr17_47877478_47879368 | 4.71 |
Foxp4 |
forkhead box P4 |
530 |
0.7 |
chr2_136715590_136716138 | 4.71 |
Snap25 |
synaptosomal-associated protein 25 |
2386 |
0.31 |
chr7_25180336_25182324 | 4.71 |
Pou2f2 |
POU domain, class 2, transcription factor 2 |
1604 |
0.22 |
chr6_13835523_13837039 | 4.69 |
Gpr85 |
G protein-coupled receptor 85 |
960 |
0.59 |
chr2_74737192_74739622 | 4.69 |
Hoxd3 |
homeobox D3 |
1212 |
0.2 |
chr5_88583963_88584847 | 4.68 |
Rufy3 |
RUN and FYVE domain containing 3 |
611 |
0.7 |
chr8_123978308_123979538 | 4.64 |
Abcb10 |
ATP-binding cassette, sub-family B (MDR/TAP), member 10 |
4199 |
0.12 |
chr1_136132801_136134260 | 4.64 |
Kif21b |
kinesin family member 21B |
2076 |
0.19 |
chr14_55114527_55116659 | 4.61 |
Jph4 |
junctophilin 4 |
41 |
0.94 |
chr4_156184450_156185176 | 4.60 |
Agrn |
agrin |
1088 |
0.33 |
chr7_126823319_126824529 | 4.60 |
Fam57b |
family with sequence similarity 57, member B |
621 |
0.41 |
chr1_132740444_132742155 | 4.60 |
Nfasc |
neurofascin |
458 |
0.83 |
chr7_140154045_140155011 | 4.60 |
Sprn |
shadow of prion protein |
349 |
0.75 |
chr15_76124987_76126454 | 4.58 |
BC024139 |
cDNA sequence BC024139 |
351 |
0.73 |
chr9_41378412_41379411 | 4.57 |
Mir100hg |
Mir100 Mirlet7a-2 Mir125b-1 cluster host gene |
2350 |
0.27 |
chr12_3370750_3371679 | 4.57 |
Gm48511 |
predicted gene, 48511 |
2785 |
0.18 |
chr16_16558986_16560577 | 4.57 |
Fgd4 |
FYVE, RhoGEF and PH domain containing 4 |
209 |
0.94 |
chr11_6604576_6606131 | 4.56 |
Nacad |
NAC alpha domain containing |
700 |
0.46 |
chr10_75939108_75939976 | 4.55 |
Gm867 |
predicted gene 867 |
1069 |
0.25 |
chr3_89243498_89245184 | 4.53 |
Trim46 |
tripartite motif-containing 46 |
672 |
0.36 |
chr10_127532001_127533071 | 4.53 |
Nxph4 |
neurexophilin 4 |
2023 |
0.18 |
chr14_55054119_55054818 | 4.53 |
Gm20687 |
predicted gene 20687 |
477 |
0.41 |
chr4_156183474_156184054 | 4.50 |
Agrn |
agrin |
2137 |
0.17 |
chr9_108825632_108827025 | 4.48 |
Celsr3 |
cadherin, EGF LAG seven-pass G-type receptor 3 |
8 |
0.91 |
chr1_132387629_132389330 | 4.48 |
Tmcc2 |
transmembrane and coiled-coil domains 2 |
1839 |
0.25 |
chr2_6881042_6881689 | 4.47 |
Gm13389 |
predicted gene 13389 |
2905 |
0.24 |
chr18_76855816_76857376 | 4.47 |
Skor2 |
SKI family transcriptional corepressor 2 |
191 |
0.96 |
chr10_80856664_80858456 | 4.47 |
Sppl2b |
signal peptide peptidase like 2B |
439 |
0.61 |
chr1_75277211_75278430 | 4.47 |
Resp18 |
regulated endocrine-specific protein 18 |
464 |
0.62 |
chr15_72546044_72547992 | 4.46 |
Kcnk9 |
potassium channel, subfamily K, member 9 |
678 |
0.75 |
chr5_108549212_108550612 | 4.46 |
Cplx1 |
complexin 1 |
88 |
0.95 |
chr15_103026302_103028215 | 4.43 |
Hoxc4 |
homeobox C4 |
7137 |
0.09 |
chr4_125490136_125491914 | 4.43 |
Grik3 |
glutamate receptor, ionotropic, kainate 3 |
325 |
0.89 |
chr4_140245362_140247262 | 4.42 |
Igsf21 |
immunoglobulin superfamily, member 21 |
472 |
0.85 |
chr3_34648572_34651394 | 4.42 |
Sox2 |
SRY (sex determining region Y)-box 2 |
422 |
0.73 |
chr7_128689234_128689975 | 4.42 |
Gm43580 |
predicted gene 43580 |
1069 |
0.26 |
chr3_27371157_27372632 | 4.41 |
Ghsr |
growth hormone secretagogue receptor |
543 |
0.81 |
chr10_6789275_6790095 | 4.40 |
Oprm1 |
opioid receptor, mu 1 |
586 |
0.81 |
chr1_135579927_135581701 | 4.40 |
Gm4793 |
predicted gene 4793 |
3959 |
0.2 |
chr6_60828283_60829739 | 4.40 |
Snca |
synuclein, alpha |
7 |
0.98 |
chr13_78189592_78191761 | 4.40 |
Nr2f1 |
nuclear receptor subfamily 2, group F, member 1 |
233 |
0.9 |
chr7_142088584_142090929 | 4.38 |
Dusp8 |
dual specificity phosphatase 8 |
5516 |
0.09 |
chr14_64588312_64589438 | 4.38 |
Mir124a-1hg |
Mir124-1 host gene (non-protein coding) |
341 |
0.81 |
chr9_74865733_74868961 | 4.37 |
Onecut1 |
one cut domain, family member 1 |
863 |
0.54 |
chr5_117241784_117242411 | 4.36 |
Taok3 |
TAO kinase 3 |
1637 |
0.3 |
chr7_45047563_45050465 | 4.35 |
Prr12 |
proline rich 12 |
3867 |
0.07 |
chr3_88458101_88459325 | 4.32 |
Sema4a |
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4A |
163 |
0.88 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
6.4 | 19.3 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
5.9 | 17.7 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
5.4 | 16.2 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
4.9 | 14.8 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
4.3 | 12.9 | GO:0072069 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
4.1 | 12.4 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
4.1 | 12.3 | GO:0045963 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
4.0 | 8.0 | GO:0048880 | sensory system development(GO:0048880) |
3.9 | 11.8 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
3.8 | 7.5 | GO:0031635 | adenylate cyclase-inhibiting opioid receptor signaling pathway(GO:0031635) |
3.7 | 14.8 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
3.7 | 11.0 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
3.6 | 3.6 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
3.4 | 13.4 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
3.3 | 10.0 | GO:0033239 | negative regulation of cellular amine metabolic process(GO:0033239) |
3.2 | 35.0 | GO:0071625 | vocalization behavior(GO:0071625) |
3.1 | 6.2 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
2.9 | 23.0 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
2.8 | 38.9 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
2.7 | 8.1 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
2.7 | 24.3 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
2.6 | 7.7 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
2.6 | 15.4 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
2.6 | 12.8 | GO:0031133 | regulation of axon diameter(GO:0031133) |
2.5 | 7.5 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
2.5 | 2.5 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
2.5 | 4.9 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
2.4 | 9.7 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
2.4 | 14.4 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
2.4 | 4.8 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
2.3 | 7.0 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
2.3 | 9.2 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
2.3 | 27.6 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
2.3 | 4.6 | GO:0036515 | dopaminergic neuron axon guidance(GO:0036514) serotonergic neuron axon guidance(GO:0036515) planar cell polarity pathway involved in axon guidance(GO:1904938) |
2.2 | 6.6 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
2.2 | 19.4 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
2.1 | 12.3 | GO:0015816 | glycine transport(GO:0015816) |
2.0 | 8.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
2.0 | 8.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
2.0 | 10.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
2.0 | 6.0 | GO:0097503 | sialylation(GO:0097503) |
2.0 | 6.0 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
2.0 | 7.9 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
2.0 | 5.9 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
2.0 | 5.9 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
1.9 | 1.9 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
1.9 | 11.3 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
1.9 | 1.9 | GO:0097688 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
1.8 | 21.9 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
1.8 | 12.7 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
1.8 | 7.3 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
1.8 | 1.8 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
1.8 | 3.6 | GO:0032097 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
1.8 | 5.4 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
1.8 | 5.3 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
1.8 | 1.8 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
1.8 | 8.8 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
1.7 | 5.2 | GO:0021779 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
1.7 | 37.9 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
1.7 | 3.4 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
1.7 | 8.6 | GO:0002865 | negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) |
1.7 | 28.6 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
1.7 | 10.1 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
1.7 | 1.7 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
1.6 | 4.9 | GO:0001661 | conditioned taste aversion(GO:0001661) |
1.6 | 4.9 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
1.6 | 4.8 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
1.6 | 49.0 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
1.6 | 3.1 | GO:0021553 | olfactory nerve development(GO:0021553) |
1.5 | 4.6 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
1.5 | 6.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
1.5 | 1.5 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
1.5 | 4.5 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
1.5 | 8.9 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
1.5 | 5.9 | GO:0060155 | platelet dense granule organization(GO:0060155) |
1.5 | 5.8 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
1.4 | 4.3 | GO:0021570 | rhombomere 4 development(GO:0021570) |
1.4 | 21.6 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
1.4 | 5.7 | GO:0007412 | axon target recognition(GO:0007412) |
1.4 | 4.2 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
1.4 | 4.2 | GO:0007386 | compartment pattern specification(GO:0007386) |
1.4 | 5.6 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
1.4 | 5.6 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
1.4 | 2.8 | GO:1902683 | regulation of protein localization to synapse(GO:1902473) regulation of receptor localization to synapse(GO:1902683) |
1.4 | 1.4 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
1.4 | 28.7 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
1.4 | 4.1 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
1.4 | 5.5 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
1.3 | 1.3 | GO:0021626 | hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
1.3 | 9.3 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
1.3 | 19.9 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
1.3 | 6.6 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
1.3 | 14.3 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
1.3 | 7.8 | GO:0097120 | receptor localization to synapse(GO:0097120) |
1.3 | 3.9 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
1.3 | 5.1 | GO:0030035 | microspike assembly(GO:0030035) |
1.3 | 6.4 | GO:0060298 | positive regulation of sarcomere organization(GO:0060298) |
1.3 | 2.5 | GO:0002432 | granuloma formation(GO:0002432) |
1.3 | 5.1 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
1.3 | 15.0 | GO:0048268 | clathrin coat assembly(GO:0048268) |
1.2 | 1.2 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
1.2 | 2.5 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
1.2 | 2.5 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
1.2 | 2.4 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
1.2 | 6.1 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
1.2 | 3.6 | GO:0097286 | iron ion import(GO:0097286) |
1.2 | 3.6 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
1.2 | 2.4 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
1.2 | 3.6 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
1.2 | 3.6 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
1.2 | 5.9 | GO:0097501 | stress response to metal ion(GO:0097501) |
1.2 | 1.2 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
1.2 | 7.1 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
1.1 | 19.5 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
1.1 | 1.1 | GO:0098828 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
1.1 | 12.6 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
1.1 | 9.2 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
1.1 | 5.7 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
1.1 | 4.5 | GO:0030432 | peristalsis(GO:0030432) |
1.1 | 2.3 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
1.1 | 3.4 | GO:0023021 | termination of signal transduction(GO:0023021) |
1.1 | 2.2 | GO:0046684 | response to pyrethroid(GO:0046684) |
1.1 | 3.3 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
1.1 | 4.4 | GO:0032264 | IMP salvage(GO:0032264) |
1.1 | 4.3 | GO:0046958 | nonassociative learning(GO:0046958) |
1.1 | 5.4 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
1.1 | 1.1 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
1.1 | 2.1 | GO:0060374 | mast cell differentiation(GO:0060374) |
1.1 | 1.1 | GO:1902262 | apoptotic process involved in patterning of blood vessels(GO:1902262) |
1.1 | 3.2 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
1.1 | 1.1 | GO:0036258 | multivesicular body assembly(GO:0036258) |
1.1 | 1.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
1.1 | 12.7 | GO:0046549 | retinal cone cell development(GO:0046549) |
1.0 | 1.0 | GO:1904587 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
1.0 | 3.1 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
1.0 | 3.1 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
1.0 | 5.2 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
1.0 | 3.1 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
1.0 | 3.1 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
1.0 | 5.1 | GO:1902308 | regulation of peptidyl-serine dephosphorylation(GO:1902308) |
1.0 | 2.0 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
1.0 | 1.0 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
1.0 | 1.0 | GO:0017085 | response to insecticide(GO:0017085) |
1.0 | 2.0 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
1.0 | 3.0 | GO:0090135 | actin filament branching(GO:0090135) |
1.0 | 2.0 | GO:0015684 | ferrous iron transport(GO:0015684) |
1.0 | 5.0 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
1.0 | 8.0 | GO:0060134 | prepulse inhibition(GO:0060134) |
1.0 | 3.0 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
1.0 | 4.0 | GO:0035625 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
1.0 | 4.0 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
1.0 | 6.9 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
1.0 | 10.8 | GO:0007616 | long-term memory(GO:0007616) |
1.0 | 5.8 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
1.0 | 9.7 | GO:0021542 | dentate gyrus development(GO:0021542) |
1.0 | 1.0 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
1.0 | 3.8 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
1.0 | 3.8 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.9 | 4.7 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.9 | 2.8 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.9 | 2.8 | GO:0042117 | monocyte activation(GO:0042117) |
0.9 | 14.0 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.9 | 0.9 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.9 | 3.7 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
0.9 | 1.8 | GO:0070253 | somatostatin secretion(GO:0070253) |
0.9 | 2.8 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.9 | 6.4 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.9 | 2.7 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.9 | 0.9 | GO:0086011 | membrane repolarization during action potential(GO:0086011) |
0.9 | 2.7 | GO:0051462 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) positive regulation of cortisol secretion(GO:0051464) |
0.9 | 6.4 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.9 | 7.2 | GO:0050957 | equilibrioception(GO:0050957) |
0.9 | 1.8 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.9 | 6.3 | GO:0001964 | startle response(GO:0001964) |
0.9 | 1.8 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.9 | 4.5 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.9 | 0.9 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.9 | 1.8 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.9 | 1.8 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.9 | 1.8 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
0.9 | 2.7 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.9 | 4.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.9 | 5.3 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.9 | 0.9 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.9 | 12.2 | GO:0007019 | microtubule depolymerization(GO:0007019) |
0.9 | 0.9 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.9 | 0.9 | GO:0014055 | acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) |
0.9 | 1.7 | GO:0046149 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.9 | 3.4 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.9 | 2.6 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.9 | 1.7 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.8 | 3.4 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.8 | 5.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.8 | 1.7 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.8 | 4.2 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.8 | 2.5 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.8 | 1.7 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.8 | 2.5 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.8 | 4.1 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
0.8 | 1.6 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.8 | 4.1 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.8 | 3.3 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.8 | 3.3 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.8 | 3.3 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.8 | 1.6 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.8 | 4.0 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.8 | 2.4 | GO:1903286 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
0.8 | 3.2 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.8 | 1.6 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.8 | 3.2 | GO:0015886 | heme transport(GO:0015886) |
0.8 | 2.4 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.8 | 0.8 | GO:0019230 | proprioception(GO:0019230) |
0.8 | 3.9 | GO:0097012 | response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
0.8 | 0.8 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.8 | 2.4 | GO:0035106 | operant conditioning(GO:0035106) |
0.8 | 14.9 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.8 | 7.0 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.8 | 9.2 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.8 | 36.9 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.8 | 4.6 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.8 | 6.1 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
0.8 | 2.3 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
0.8 | 0.8 | GO:0045632 | negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
0.8 | 11.3 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.8 | 6.8 | GO:0045176 | apical protein localization(GO:0045176) |
0.8 | 0.8 | GO:0000375 | RNA splicing, via transesterification reactions(GO:0000375) |
0.7 | 1.5 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
0.7 | 7.5 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.7 | 4.5 | GO:0038107 | nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
0.7 | 6.0 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.7 | 3.7 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.7 | 2.9 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.7 | 2.2 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.7 | 2.2 | GO:0061511 | centriole elongation(GO:0061511) |
0.7 | 2.2 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.7 | 2.1 | GO:0010915 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
0.7 | 49.5 | GO:0007612 | learning(GO:0007612) |
0.7 | 4.9 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.7 | 2.8 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.7 | 2.1 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.7 | 2.8 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.7 | 2.8 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.7 | 2.8 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.7 | 2.1 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
0.7 | 2.8 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.7 | 2.1 | GO:0008050 | female courtship behavior(GO:0008050) |
0.7 | 5.5 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.7 | 2.0 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.7 | 2.0 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.7 | 5.4 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.7 | 0.7 | GO:0046101 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
0.7 | 6.6 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.7 | 2.7 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.7 | 2.0 | GO:0001546 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
0.7 | 4.6 | GO:0046040 | IMP metabolic process(GO:0046040) |
0.7 | 2.0 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.7 | 4.6 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.7 | 3.9 | GO:1902222 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.7 | 2.6 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.7 | 1.3 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.7 | 2.6 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.7 | 2.0 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.6 | 0.6 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.6 | 3.9 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.6 | 3.2 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
0.6 | 1.3 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.6 | 2.6 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
0.6 | 10.3 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.6 | 0.6 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
0.6 | 1.9 | GO:0071816 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.6 | 3.8 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.6 | 1.9 | GO:0015810 | aspartate transport(GO:0015810) |
0.6 | 2.5 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.6 | 0.6 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.6 | 1.3 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.6 | 0.6 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.6 | 1.3 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.6 | 3.1 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.6 | 1.2 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.6 | 3.1 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.6 | 1.9 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.6 | 2.5 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.6 | 1.2 | GO:0009629 | response to gravity(GO:0009629) |
0.6 | 2.5 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.6 | 0.6 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
0.6 | 3.7 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.6 | 4.9 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.6 | 0.6 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.6 | 14.1 | GO:2000171 | negative regulation of dendrite development(GO:2000171) |
0.6 | 0.6 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
0.6 | 1.8 | GO:0015808 | L-alanine transport(GO:0015808) |
0.6 | 1.8 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.6 | 1.8 | GO:0048102 | autophagic cell death(GO:0048102) |
0.6 | 0.6 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) glandular epithelial cell maturation(GO:0002071) |
0.6 | 0.6 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.6 | 0.6 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.6 | 1.2 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.6 | 3.0 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
0.6 | 4.7 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.6 | 3.0 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.6 | 4.7 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.6 | 5.3 | GO:0006828 | manganese ion transport(GO:0006828) |
0.6 | 1.2 | GO:0010042 | response to manganese ion(GO:0010042) |
0.6 | 3.5 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.6 | 1.2 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.6 | 1.2 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.6 | 2.3 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.6 | 1.7 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.6 | 1.7 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.6 | 2.3 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.6 | 5.2 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.6 | 2.9 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.6 | 2.3 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.6 | 1.7 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.6 | 1.7 | GO:0000087 | mitotic M phase(GO:0000087) |
0.6 | 1.7 | GO:0019042 | viral latency(GO:0019042) |
0.6 | 0.6 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.6 | 1.7 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.6 | 3.9 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
0.6 | 2.3 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
0.6 | 2.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.6 | 2.2 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.6 | 1.7 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.6 | 2.2 | GO:0001905 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
0.6 | 2.2 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.6 | 1.7 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.6 | 8.3 | GO:0035249 | synaptic transmission, glutamatergic(GO:0035249) |
0.6 | 2.8 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.6 | 4.4 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
0.5 | 1.6 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.5 | 1.1 | GO:0015677 | copper ion import(GO:0015677) |
0.5 | 1.1 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
0.5 | 0.5 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.5 | 2.7 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.5 | 2.2 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.5 | 2.2 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.5 | 2.2 | GO:0006598 | polyamine catabolic process(GO:0006598) |
0.5 | 7.0 | GO:1901381 | positive regulation of potassium ion transmembrane transport(GO:1901381) |
0.5 | 3.8 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.5 | 1.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.5 | 1.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.5 | 1.1 | GO:0034633 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.5 | 2.1 | GO:0032202 | telomere assembly(GO:0032202) |
0.5 | 1.6 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.5 | 1.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.5 | 1.0 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.5 | 4.2 | GO:0035640 | exploration behavior(GO:0035640) |
0.5 | 1.6 | GO:0003072 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
0.5 | 2.1 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.5 | 1.0 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.5 | 2.1 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.5 | 1.5 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
0.5 | 1.5 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.5 | 4.6 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.5 | 1.5 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.5 | 1.5 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.5 | 1.5 | GO:0001555 | oocyte growth(GO:0001555) |
0.5 | 0.5 | GO:0048313 | Golgi inheritance(GO:0048313) |
0.5 | 0.5 | GO:0044827 | modulation by host of viral genome replication(GO:0044827) |
0.5 | 3.0 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.5 | 2.0 | GO:0001810 | regulation of type I hypersensitivity(GO:0001810) type I hypersensitivity(GO:0016068) |
0.5 | 1.5 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.5 | 1.0 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
0.5 | 0.5 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.5 | 1.5 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.5 | 1.5 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.5 | 2.0 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.5 | 1.5 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.5 | 1.0 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
0.5 | 1.9 | GO:0032230 | positive regulation of synaptic transmission, GABAergic(GO:0032230) |
0.5 | 0.5 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.5 | 2.4 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.5 | 1.4 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
0.5 | 1.9 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.5 | 1.9 | GO:0072393 | microtubule anchoring at microtubule organizing center(GO:0072393) |
0.5 | 0.5 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.5 | 1.0 | GO:0052490 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.5 | 1.0 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.5 | 6.7 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.5 | 1.0 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.5 | 1.4 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.5 | 4.3 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
0.5 | 1.4 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.5 | 0.5 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
0.5 | 2.3 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.5 | 0.5 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.5 | 2.3 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.5 | 0.5 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
0.5 | 1.9 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.5 | 1.9 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.5 | 1.4 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.5 | 2.3 | GO:0015879 | carnitine transport(GO:0015879) |
0.5 | 2.3 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.5 | 1.4 | GO:0086066 | atrial cardiac muscle cell action potential(GO:0086014) atrial cardiac muscle cell to AV node cell signaling(GO:0086026) atrial cardiac muscle cell to AV node cell communication(GO:0086066) |
0.5 | 0.9 | GO:0010642 | negative regulation of platelet-derived growth factor receptor signaling pathway(GO:0010642) |
0.5 | 1.8 | GO:2000617 | positive regulation of histone H3-K9 acetylation(GO:2000617) |
0.5 | 0.5 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.5 | 1.8 | GO:0019359 | nicotinamide nucleotide biosynthetic process(GO:0019359) |
0.5 | 0.9 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.5 | 0.5 | GO:0071672 | negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
0.5 | 0.9 | GO:0035973 | aggrephagy(GO:0035973) |
0.5 | 1.8 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.5 | 2.3 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.5 | 0.9 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.5 | 1.4 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.5 | 2.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.5 | 2.7 | GO:1904321 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.5 | 3.2 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.4 | 0.9 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.4 | 2.2 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
0.4 | 0.9 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.4 | 6.7 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.4 | 0.9 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.4 | 0.9 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.4 | 0.9 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.4 | 2.2 | GO:1905145 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
0.4 | 6.2 | GO:0007270 | neuron-neuron synaptic transmission(GO:0007270) |
0.4 | 1.3 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.4 | 2.2 | GO:1903961 | positive regulation of anion transmembrane transport(GO:1903961) |
0.4 | 1.3 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.4 | 4.4 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
0.4 | 0.9 | GO:0072611 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) regulation of interleukin-13 secretion(GO:2000665) |
0.4 | 0.4 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.4 | 2.2 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.4 | 0.9 | GO:0043267 | negative regulation of potassium ion transport(GO:0043267) |
0.4 | 1.3 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
0.4 | 1.8 | GO:0042168 | heme metabolic process(GO:0042168) |
0.4 | 2.2 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
0.4 | 2.2 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.4 | 2.2 | GO:0042435 | indole-containing compound biosynthetic process(GO:0042435) |
0.4 | 2.2 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
0.4 | 1.7 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.4 | 1.3 | GO:0040031 | snRNA modification(GO:0040031) |
0.4 | 2.2 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.4 | 3.0 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.4 | 0.4 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
0.4 | 3.0 | GO:0033131 | regulation of glucokinase activity(GO:0033131) regulation of hexokinase activity(GO:1903299) |
0.4 | 1.3 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.4 | 0.4 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.4 | 0.4 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.4 | 1.7 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.4 | 1.3 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.4 | 0.8 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
0.4 | 0.4 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.4 | 1.7 | GO:0070922 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) small RNA loading onto RISC(GO:0070922) |
0.4 | 0.8 | GO:0003289 | septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
0.4 | 1.2 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.4 | 2.9 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.4 | 2.5 | GO:0071265 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.4 | 0.8 | GO:0033091 | positive regulation of immature T cell proliferation(GO:0033091) |
0.4 | 0.8 | GO:1902075 | cellular response to salt(GO:1902075) |
0.4 | 2.0 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.4 | 2.4 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.4 | 2.0 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.4 | 0.8 | GO:0030952 | establishment or maintenance of cytoskeleton polarity(GO:0030952) |
0.4 | 0.8 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.4 | 0.4 | GO:0014050 | negative regulation of glutamate secretion(GO:0014050) |
0.4 | 1.6 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.4 | 0.4 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.4 | 1.2 | GO:0001975 | response to amphetamine(GO:0001975) |
0.4 | 3.2 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.4 | 3.6 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.4 | 0.8 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.4 | 7.6 | GO:0010107 | potassium ion import(GO:0010107) |
0.4 | 2.4 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.4 | 0.4 | GO:0036480 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
0.4 | 1.2 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.4 | 3.6 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.4 | 1.2 | GO:0015747 | urate transport(GO:0015747) |
0.4 | 0.4 | GO:0006778 | porphyrin-containing compound metabolic process(GO:0006778) |
0.4 | 0.8 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.4 | 2.4 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.4 | 1.2 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.4 | 1.9 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.4 | 0.8 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.4 | 1.2 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.4 | 1.5 | GO:0035627 | ceramide transport(GO:0035627) |
0.4 | 0.4 | GO:1901374 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
0.4 | 1.1 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.4 | 1.5 | GO:2001258 | negative regulation of cation channel activity(GO:2001258) |
0.4 | 1.1 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.4 | 1.9 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.4 | 0.8 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.4 | 1.5 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.4 | 1.5 | GO:0009414 | response to water deprivation(GO:0009414) |
0.4 | 1.1 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.4 | 0.8 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.4 | 1.1 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.4 | 1.9 | GO:0042220 | response to cocaine(GO:0042220) |
0.4 | 1.5 | GO:0051458 | corticotropin secretion(GO:0051458) regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
0.4 | 1.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.4 | 0.4 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.4 | 0.8 | GO:0045023 | G0 to G1 transition(GO:0045023) regulation of G0 to G1 transition(GO:0070316) |
0.4 | 1.5 | GO:0045188 | circadian sleep/wake cycle, non-REM sleep(GO:0042748) regulation of circadian sleep/wake cycle, non-REM sleep(GO:0045188) |
0.4 | 0.8 | GO:2000118 | sodium-dependent phosphate transport(GO:0044341) regulation of sodium-dependent phosphate transport(GO:2000118) |
0.4 | 3.0 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.4 | 2.2 | GO:0046686 | response to cadmium ion(GO:0046686) |
0.4 | 0.7 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
0.4 | 0.7 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.4 | 0.4 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.4 | 0.4 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.4 | 1.1 | GO:0046066 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.4 | 1.8 | GO:0070417 | cellular response to cold(GO:0070417) |
0.4 | 2.6 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.4 | 0.7 | GO:0015817 | histidine transport(GO:0015817) |
0.4 | 1.5 | GO:0010458 | exit from mitosis(GO:0010458) |
0.4 | 1.8 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.4 | 0.4 | GO:0032329 | serine transport(GO:0032329) |
0.4 | 1.1 | GO:1900060 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
0.4 | 0.4 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
0.4 | 0.7 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.4 | 0.7 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
0.4 | 2.5 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
0.4 | 0.7 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.4 | 2.2 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.4 | 2.9 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.4 | 4.3 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.4 | 0.7 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.4 | 1.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.4 | 0.4 | GO:1903312 | negative regulation of mRNA metabolic process(GO:1903312) |
0.4 | 2.8 | GO:0032095 | regulation of response to food(GO:0032095) |
0.4 | 3.5 | GO:0051601 | exocyst localization(GO:0051601) |
0.4 | 5.7 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.4 | 1.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.4 | 1.8 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.4 | 1.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.4 | 0.4 | GO:0072298 | regulation of metanephric glomerulus development(GO:0072298) |
0.4 | 0.7 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.4 | 0.4 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.4 | 14.0 | GO:0035773 | insulin secretion involved in cellular response to glucose stimulus(GO:0035773) |
0.4 | 0.7 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.3 | 0.3 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.3 | 5.2 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
0.3 | 1.4 | GO:0032239 | regulation of nucleobase-containing compound transport(GO:0032239) |
0.3 | 1.7 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.3 | 1.0 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.3 | 1.0 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.3 | 4.5 | GO:0042772 | DNA damage response, signal transduction resulting in transcription(GO:0042772) |
0.3 | 3.5 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.3 | 6.9 | GO:0006491 | N-glycan processing(GO:0006491) |
0.3 | 0.3 | GO:0010996 | response to auditory stimulus(GO:0010996) |
0.3 | 1.0 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.3 | 0.3 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.3 | 3.1 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
0.3 | 0.7 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.3 | 0.3 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.3 | 0.7 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.3 | 1.0 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.3 | 1.0 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.3 | 1.7 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.3 | 0.3 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.3 | 1.0 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.3 | 0.3 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
0.3 | 0.3 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.3 | 0.3 | GO:2000674 | regulation of type B pancreatic cell apoptotic process(GO:2000674) |
0.3 | 0.7 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
0.3 | 0.7 | GO:0034214 | protein hexamerization(GO:0034214) |
0.3 | 0.7 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.3 | 1.7 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.3 | 0.3 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
0.3 | 1.0 | GO:0048069 | eye pigmentation(GO:0048069) |
0.3 | 3.0 | GO:0034389 | lipid particle organization(GO:0034389) |
0.3 | 1.0 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.3 | 2.3 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.3 | 2.0 | GO:0060078 | regulation of postsynaptic membrane potential(GO:0060078) |
0.3 | 1.0 | GO:0031296 | B cell costimulation(GO:0031296) |
0.3 | 1.7 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.3 | 1.3 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.3 | 0.3 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.3 | 0.7 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.3 | 0.7 | GO:0060215 | primitive hemopoiesis(GO:0060215) |
0.3 | 3.9 | GO:0043248 | proteasome assembly(GO:0043248) |
0.3 | 3.0 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
0.3 | 0.3 | GO:0072553 | terminal button organization(GO:0072553) |
0.3 | 0.3 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.3 | 0.3 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.3 | 0.3 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.3 | 2.0 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.3 | 1.6 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.3 | 1.0 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.3 | 1.6 | GO:0001842 | neural fold formation(GO:0001842) |
0.3 | 10.6 | GO:0080171 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
0.3 | 0.3 | GO:0086043 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.3 | 1.0 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.3 | 1.3 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.3 | 1.3 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.3 | 1.6 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.3 | 0.9 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.3 | 4.1 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.3 | 1.3 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.3 | 1.6 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.3 | 0.3 | GO:0048242 | epinephrine secretion(GO:0048242) |
0.3 | 4.7 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.3 | 1.2 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.3 | 2.2 | GO:1990089 | response to nerve growth factor(GO:1990089) cellular response to nerve growth factor stimulus(GO:1990090) |
0.3 | 2.5 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.3 | 1.9 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.3 | 0.3 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.3 | 2.5 | GO:0070269 | pyroptosis(GO:0070269) |
0.3 | 15.4 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
0.3 | 0.3 | GO:1900271 | regulation of long-term synaptic potentiation(GO:1900271) |
0.3 | 2.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.3 | 1.5 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.3 | 0.6 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
0.3 | 2.7 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.3 | 12.2 | GO:0007269 | neurotransmitter secretion(GO:0007269) signal release from synapse(GO:0099643) |
0.3 | 0.9 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.3 | 0.3 | GO:0097154 | GABAergic neuron differentiation(GO:0097154) |
0.3 | 0.6 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.3 | 6.1 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
0.3 | 0.9 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.3 | 0.9 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.3 | 1.8 | GO:0002591 | positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
0.3 | 9.6 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
0.3 | 1.8 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.3 | 1.2 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.3 | 0.9 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.3 | 1.8 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.3 | 2.7 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.3 | 0.3 | GO:1990144 | intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
0.3 | 2.4 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
0.3 | 0.9 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.3 | 3.0 | GO:0014003 | oligodendrocyte development(GO:0014003) |
0.3 | 0.6 | GO:0032831 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.3 | 0.3 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
0.3 | 9.5 | GO:0006414 | translational elongation(GO:0006414) |
0.3 | 4.1 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
0.3 | 3.3 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.3 | 1.2 | GO:0019885 | antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
0.3 | 2.6 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.3 | 0.3 | GO:0014059 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
0.3 | 0.9 | GO:0002438 | acute inflammatory response to antigenic stimulus(GO:0002438) |
0.3 | 0.6 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.3 | 2.3 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.3 | 0.6 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.3 | 0.6 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.3 | 0.9 | GO:0072525 | pyridine-containing compound biosynthetic process(GO:0072525) |
0.3 | 0.6 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.3 | 4.9 | GO:0015807 | L-amino acid transport(GO:0015807) |
0.3 | 2.9 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.3 | 2.0 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
0.3 | 4.3 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.3 | 0.6 | GO:0006903 | vesicle targeting(GO:0006903) |
0.3 | 1.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.3 | 1.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.3 | 1.4 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.3 | 0.6 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.3 | 0.6 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.3 | 1.1 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.3 | 2.0 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.3 | 0.3 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.3 | 4.5 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.3 | 0.9 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.3 | 1.1 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.3 | 0.6 | GO:0001768 | establishment of lymphocyte polarity(GO:0001767) establishment of T cell polarity(GO:0001768) |
0.3 | 2.3 | GO:0048821 | erythrocyte development(GO:0048821) |
0.3 | 1.4 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.3 | 10.2 | GO:0032091 | negative regulation of protein binding(GO:0032091) |
0.3 | 0.8 | GO:0031126 | snoRNA 3'-end processing(GO:0031126) |
0.3 | 0.8 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.3 | 0.6 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.3 | 5.3 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.3 | 14.8 | GO:0050770 | regulation of axonogenesis(GO:0050770) |
0.3 | 0.8 | GO:0030449 | regulation of complement activation(GO:0030449) regulation of protein activation cascade(GO:2000257) |
0.3 | 3.1 | GO:0021766 | hippocampus development(GO:0021766) |
0.3 | 4.2 | GO:0030488 | tRNA methylation(GO:0030488) |
0.3 | 0.6 | GO:0002215 | defense response to nematode(GO:0002215) |
0.3 | 0.6 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.3 | 0.8 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.3 | 0.5 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
0.3 | 0.3 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
0.3 | 0.5 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.3 | 0.3 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
0.3 | 1.1 | GO:1904152 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.3 | 1.9 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
0.3 | 8.1 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.3 | 1.6 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.3 | 0.3 | GO:1902003 | regulation of beta-amyloid formation(GO:1902003) |
0.3 | 1.1 | GO:0032824 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.3 | 1.3 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.3 | 0.8 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.3 | 0.3 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.3 | 0.8 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.3 | 1.1 | GO:1901679 | nucleotide transmembrane transport(GO:1901679) |
0.3 | 2.1 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.3 | 0.5 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.3 | 1.3 | GO:0006586 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
0.3 | 0.8 | GO:1903998 | regulation of eating behavior(GO:1903998) |
0.3 | 0.5 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.3 | 0.8 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) cardiolipin biosynthetic process(GO:0032049) |
0.3 | 1.0 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.3 | 0.3 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
0.3 | 1.6 | GO:0031167 | rRNA methylation(GO:0031167) |
0.3 | 0.8 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.3 | 12.0 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.3 | 0.3 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.3 | 0.3 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.3 | 0.8 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.3 | 0.3 | GO:0071025 | RNA surveillance(GO:0071025) nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.3 | 0.5 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.3 | 3.3 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.3 | 1.8 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.3 | 0.3 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.3 | 0.3 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.3 | 3.6 | GO:2001222 | regulation of neuron migration(GO:2001222) |
0.3 | 0.5 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.3 | 2.3 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.3 | 0.3 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.3 | 0.5 | GO:0018343 | protein farnesylation(GO:0018343) |
0.2 | 0.5 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.2 | 0.5 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.2 | 0.7 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.2 | 0.5 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.2 | 0.2 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.2 | 0.2 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
0.2 | 7.4 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.2 | 0.7 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.2 | 0.5 | GO:0032415 | regulation of sodium:proton antiporter activity(GO:0032415) positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.2 | 0.2 | GO:1902235 | regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902235) |
0.2 | 1.2 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.2 | 0.2 | GO:1900102 | negative regulation of endoplasmic reticulum unfolded protein response(GO:1900102) |
0.2 | 3.6 | GO:0044705 | mating behavior(GO:0007617) multi-organism reproductive behavior(GO:0044705) |
0.2 | 0.2 | GO:0040038 | polar body extrusion after meiotic divisions(GO:0040038) |
0.2 | 0.5 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
0.2 | 6.8 | GO:0050684 | regulation of mRNA processing(GO:0050684) |
0.2 | 1.7 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.2 | 0.5 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.2 | 0.7 | GO:0051305 | chromosome movement towards spindle pole(GO:0051305) |
0.2 | 1.4 | GO:0051573 | negative regulation of histone H3-K9 methylation(GO:0051573) |
0.2 | 0.2 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
0.2 | 0.2 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
0.2 | 0.5 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.2 | 0.2 | GO:0072289 | metanephric nephron tubule formation(GO:0072289) |
0.2 | 0.7 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.2 | 1.0 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.2 | 1.0 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.2 | 0.5 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.2 | 2.6 | GO:0045116 | protein neddylation(GO:0045116) |
0.2 | 0.7 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.2 | 1.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.2 | 0.9 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.2 | 0.7 | GO:0008038 | neuron recognition(GO:0008038) |
0.2 | 0.5 | GO:0009597 | detection of virus(GO:0009597) |
0.2 | 1.2 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
0.2 | 0.7 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.2 | 0.7 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.2 | 0.9 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
0.2 | 1.1 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.2 | 0.2 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.2 | 1.1 | GO:0015671 | oxygen transport(GO:0015671) |
0.2 | 1.1 | GO:0002431 | Fc receptor mediated stimulatory signaling pathway(GO:0002431) |
0.2 | 0.5 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.2 | 0.2 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.2 | 0.9 | GO:0008215 | spermine metabolic process(GO:0008215) |
0.2 | 0.5 | GO:1901142 | insulin metabolic process(GO:1901142) |
0.2 | 0.5 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.2 | 4.1 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.2 | 0.4 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.2 | 0.9 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.2 | 0.7 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.2 | 11.9 | GO:0071805 | cellular potassium ion transport(GO:0071804) potassium ion transmembrane transport(GO:0071805) |
0.2 | 2.2 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.2 | 3.1 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.2 | 2.7 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.2 | 0.4 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.2 | 2.4 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
0.2 | 0.2 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.2 | 0.2 | GO:0051036 | regulation of endosome size(GO:0051036) |
0.2 | 1.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.2 | 11.1 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.2 | 5.3 | GO:0046847 | filopodium assembly(GO:0046847) |
0.2 | 2.0 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.2 | 1.3 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.2 | 0.2 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.2 | 1.8 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.2 | 5.5 | GO:1901998 | toxin transport(GO:1901998) |
0.2 | 0.9 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.2 | 1.3 | GO:0006415 | translational termination(GO:0006415) |
0.2 | 0.4 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.2 | 1.5 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.2 | 1.5 | GO:0044804 | nucleophagy(GO:0044804) |
0.2 | 0.2 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
0.2 | 1.3 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.2 | 1.5 | GO:0001919 | regulation of receptor recycling(GO:0001919) |
0.2 | 0.6 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.2 | 1.3 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.2 | 1.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.2 | 1.3 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.2 | 0.2 | GO:0046834 | lipid phosphorylation(GO:0046834) |
0.2 | 1.3 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.2 | 0.6 | GO:2000416 | regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
0.2 | 2.7 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.2 | 0.4 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.2 | 0.6 | GO:0042048 | olfactory behavior(GO:0042048) |
0.2 | 0.2 | GO:0070585 | protein localization to mitochondrion(GO:0070585) |
0.2 | 0.8 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.2 | 0.2 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
0.2 | 0.2 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.2 | 0.8 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) DNA-templated transcriptional preinitiation complex assembly(GO:0070897) |
0.2 | 0.4 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.2 | 0.8 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.2 | 0.6 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.2 | 1.0 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.2 | 0.4 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.2 | 1.2 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.2 | 0.6 | GO:0032495 | response to muramyl dipeptide(GO:0032495) |
0.2 | 0.8 | GO:0040023 | establishment of nucleus localization(GO:0040023) |
0.2 | 2.0 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.2 | 1.6 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.2 | 3.2 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.2 | 0.4 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.2 | 1.2 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.2 | 0.8 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
0.2 | 0.8 | GO:0045078 | regulation of interferon-gamma biosynthetic process(GO:0045072) positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
0.2 | 1.4 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.2 | 1.6 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
0.2 | 0.8 | GO:0010592 | positive regulation of lamellipodium assembly(GO:0010592) |
0.2 | 0.2 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
0.2 | 4.3 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.2 | 0.8 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.2 | 0.6 | GO:0033762 | response to glucagon(GO:0033762) |
0.2 | 1.4 | GO:0034088 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
0.2 | 0.2 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.2 | 1.7 | GO:0019068 | virion assembly(GO:0019068) |
0.2 | 0.2 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.2 | 0.9 | GO:0002052 | positive regulation of neuroblast proliferation(GO:0002052) |
0.2 | 0.8 | GO:0043243 | positive regulation of protein complex disassembly(GO:0043243) |
0.2 | 0.9 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.2 | 0.4 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
0.2 | 0.2 | GO:0032700 | negative regulation of interleukin-17 production(GO:0032700) |
0.2 | 0.6 | GO:0009651 | response to salt stress(GO:0009651) |
0.2 | 0.2 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
0.2 | 0.2 | GO:0070432 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070432) |
0.2 | 0.4 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.2 | 1.3 | GO:0016075 | rRNA catabolic process(GO:0016075) |
0.2 | 1.7 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
0.2 | 1.9 | GO:0019933 | cAMP-mediated signaling(GO:0019933) |
0.2 | 0.2 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.2 | 0.6 | GO:0043558 | regulation of translational initiation in response to stress(GO:0043558) |
0.2 | 0.7 | GO:0097240 | telomere tethering at nuclear periphery(GO:0034398) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.2 | 0.9 | GO:0009201 | purine nucleoside triphosphate biosynthetic process(GO:0009145) ribonucleoside triphosphate biosynthetic process(GO:0009201) |
0.2 | 0.4 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.2 | 2.9 | GO:1990138 | neuron projection extension(GO:1990138) |
0.2 | 1.1 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
0.2 | 1.8 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.2 | 0.2 | GO:1901727 | positive regulation of deacetylase activity(GO:0090045) regulation of histone deacetylase activity(GO:1901725) positive regulation of histone deacetylase activity(GO:1901727) |
0.2 | 0.9 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.2 | 0.4 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.2 | 0.2 | GO:0045815 | positive regulation of gene expression, epigenetic(GO:0045815) |
0.2 | 0.7 | GO:0006116 | NADH oxidation(GO:0006116) |
0.2 | 0.2 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
0.2 | 0.4 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.2 | 1.4 | GO:0001675 | acrosome assembly(GO:0001675) |
0.2 | 0.2 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.2 | 2.0 | GO:0003016 | respiratory system process(GO:0003016) |
0.2 | 1.6 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.2 | 0.4 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.2 | 0.2 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.2 | 0.9 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.2 | 0.7 | GO:0018119 | peptidyl-cysteine S-nitrosylation(GO:0018119) |
0.2 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.2 | 0.7 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.2 | 0.4 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.2 | 0.2 | GO:0042095 | interferon-gamma biosynthetic process(GO:0042095) |
0.2 | 0.2 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
0.2 | 0.4 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.2 | 3.0 | GO:0019835 | cytolysis(GO:0019835) |
0.2 | 0.2 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.2 | 0.7 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.2 | 0.7 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.2 | 0.2 | GO:0033025 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
0.2 | 0.7 | GO:0030091 | protein repair(GO:0030091) |
0.2 | 1.0 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.2 | 0.5 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.2 | 0.3 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.2 | 1.7 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.2 | 0.8 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.2 | 0.2 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.2 | 0.5 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.2 | 0.2 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.2 | 7.6 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
0.2 | 0.5 | GO:0051646 | mitochondrion localization(GO:0051646) |
0.2 | 0.5 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.2 | 0.5 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.2 | 0.5 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.2 | 0.7 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.2 | 1.9 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.2 | 0.3 | GO:0043486 | histone exchange(GO:0043486) |
0.2 | 0.5 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.2 | 1.0 | GO:0006465 | signal peptide processing(GO:0006465) |
0.2 | 0.6 | GO:0006921 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.2 | 0.5 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.2 | 2.4 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.2 | 0.2 | GO:0016556 | mRNA modification(GO:0016556) |
0.2 | 0.3 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.2 | 5.1 | GO:1902653 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
0.2 | 0.3 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
0.2 | 0.3 | GO:0043144 | snoRNA processing(GO:0043144) |
0.2 | 0.3 | GO:0043174 | nucleoside salvage(GO:0043174) |
0.2 | 0.5 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
0.2 | 3.1 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
0.2 | 0.6 | GO:0007296 | vitellogenesis(GO:0007296) |
0.2 | 1.8 | GO:0010765 | positive regulation of sodium ion transport(GO:0010765) |
0.2 | 0.3 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.2 | 0.3 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.2 | 0.5 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.2 | 0.5 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.2 | 0.5 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.2 | 0.9 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.2 | 0.2 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.2 | 0.2 | GO:0060296 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
0.2 | 0.5 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.2 | 0.3 | GO:0033700 | phospholipid efflux(GO:0033700) |
0.1 | 1.0 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
0.1 | 0.3 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.1 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 0.7 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.1 | 0.3 | GO:0090151 | protein import into mitochondrial inner membrane(GO:0045039) establishment of protein localization to mitochondrial membrane(GO:0090151) |
0.1 | 0.3 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 13.1 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
0.1 | 0.9 | GO:0097354 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
0.1 | 0.1 | GO:0070099 | regulation of chemokine-mediated signaling pathway(GO:0070099) |
0.1 | 0.1 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.1 | 1.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.1 | 0.9 | GO:0051026 | chiasma assembly(GO:0051026) |
0.1 | 0.4 | GO:0010869 | regulation of receptor biosynthetic process(GO:0010869) |
0.1 | 3.1 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.1 | 1.3 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.1 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
0.1 | 0.8 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.1 | 0.7 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 0.6 | GO:0035418 | protein localization to synapse(GO:0035418) |
0.1 | 0.4 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.1 | 1.0 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.1 | 3.5 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.1 | 8.4 | GO:0006626 | protein targeting to mitochondrion(GO:0006626) |
0.1 | 0.3 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.1 | 0.3 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.1 | 0.7 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.1 | 1.1 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.1 | 2.1 | GO:0006406 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.1 | 1.5 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
0.1 | 0.8 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
0.1 | 0.3 | GO:0051657 | maintenance of organelle location(GO:0051657) |
0.1 | 0.3 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 0.7 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.1 | 0.4 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.1 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 0.1 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
0.1 | 0.1 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
0.1 | 0.4 | GO:0031506 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.1 | 0.1 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.1 | 0.4 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
0.1 | 0.3 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.1 | 1.6 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.1 | 0.4 | GO:0006560 | proline metabolic process(GO:0006560) |
0.1 | 4.2 | GO:0006401 | RNA catabolic process(GO:0006401) |
0.1 | 0.1 | GO:0001806 | type IV hypersensitivity(GO:0001806) |
0.1 | 0.4 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.1 | 0.4 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.1 | 0.7 | GO:1901409 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.1 | 0.1 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.1 | 0.8 | GO:0030431 | sleep(GO:0030431) |
0.1 | 0.1 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.1 | 0.8 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.1 | 0.1 | GO:0000436 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
0.1 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.1 | 0.5 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.1 | 2.5 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.1 | 0.3 | GO:0019081 | viral translation(GO:0019081) |
0.1 | 3.9 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.1 | 1.0 | GO:0009208 | pyrimidine ribonucleoside triphosphate metabolic process(GO:0009208) |
0.1 | 1.9 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
0.1 | 0.8 | GO:0030033 | microvillus assembly(GO:0030033) |
0.1 | 0.1 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.1 | 0.1 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
0.1 | 0.2 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.1 | 0.6 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
0.1 | 0.7 | GO:1990542 | mitochondrial transmembrane transport(GO:1990542) |
0.1 | 0.7 | GO:0052803 | imidazole-containing compound metabolic process(GO:0052803) |
0.1 | 0.2 | GO:0030242 | pexophagy(GO:0030242) |
0.1 | 0.1 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.1 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.1 | 2.4 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
0.1 | 0.2 | GO:2001140 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
0.1 | 0.1 | GO:0098657 | import into cell(GO:0098657) |
0.1 | 0.5 | GO:0051256 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.1 | 0.2 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.1 | 0.9 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.1 | 0.1 | GO:0071922 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.1 | 0.1 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
0.1 | 0.8 | GO:0031062 | positive regulation of histone methylation(GO:0031062) |
0.1 | 0.1 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.1 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.1 | 1.0 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.1 | 0.1 | GO:0042420 | dopamine catabolic process(GO:0042420) |
0.1 | 1.2 | GO:1901032 | negative regulation of response to reactive oxygen species(GO:1901032) |
0.1 | 0.2 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.1 | 0.2 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.1 | 0.1 | GO:0044088 | regulation of vacuole organization(GO:0044088) |
0.1 | 0.1 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.1 | 0.2 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.1 | 0.1 | GO:1901859 | negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
0.1 | 0.1 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.1 | 0.1 | GO:0051709 | regulation of killing of cells of other organism(GO:0051709) |
0.1 | 0.1 | GO:2001182 | regulation of interleukin-12 secretion(GO:2001182) |
0.1 | 0.3 | GO:0001835 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.1 | 2.8 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.1 | 0.4 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.1 | 0.2 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.1 | 0.3 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
0.1 | 0.4 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.1 | 0.1 | GO:0090148 | membrane fission(GO:0090148) |
0.1 | 1.0 | GO:0043631 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
0.1 | 0.1 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.1 | 0.2 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.1 | 0.2 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.1 | 0.3 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
0.1 | 0.2 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.1 | 19.3 | GO:0006397 | mRNA processing(GO:0006397) |
0.1 | 0.4 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
0.1 | 0.1 | GO:0007632 | visual behavior(GO:0007632) |
0.1 | 2.9 | GO:0009247 | glycolipid biosynthetic process(GO:0009247) |
0.1 | 0.6 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 1.1 | GO:0042398 | cellular modified amino acid biosynthetic process(GO:0042398) |
0.1 | 0.2 | GO:0015705 | iodide transport(GO:0015705) |
0.1 | 0.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.1 | 0.2 | GO:0032365 | intracellular lipid transport(GO:0032365) |
0.1 | 0.4 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 2.0 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.1 | 0.2 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
0.1 | 0.3 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.7 | GO:0090266 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
0.1 | 0.1 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.1 | 0.5 | GO:0046464 | neutral lipid catabolic process(GO:0046461) acylglycerol catabolic process(GO:0046464) |
0.1 | 0.5 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.1 | 0.5 | GO:0009067 | aspartate family amino acid biosynthetic process(GO:0009067) |
0.1 | 0.3 | GO:0086036 | regulation of cardiac muscle cell membrane potential(GO:0086036) |
0.1 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.1 | 0.4 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.1 | 0.2 | GO:0000019 | regulation of mitotic recombination(GO:0000019) |
0.1 | 1.7 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.1 | 0.2 | GO:0071428 | rRNA-containing ribonucleoprotein complex export from nucleus(GO:0071428) |
0.1 | 0.1 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
0.1 | 0.1 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
0.1 | 0.2 | GO:0001302 | replicative cell aging(GO:0001302) |
0.1 | 0.2 | GO:0008216 | spermidine metabolic process(GO:0008216) |
0.1 | 0.7 | GO:0045005 | DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
0.1 | 0.1 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.1 | 1.0 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.1 | 0.3 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.1 | 0.6 | GO:0042158 | lipoprotein biosynthetic process(GO:0042158) |
0.1 | 0.2 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.1 | 0.3 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.1 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.1 | 0.1 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
0.1 | 1.1 | GO:0033344 | cholesterol efflux(GO:0033344) |
0.1 | 0.1 | GO:0021593 | rhombomere morphogenesis(GO:0021593) |
0.1 | 0.3 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
0.1 | 0.7 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.1 | 0.1 | GO:0071500 | response to nitrosative stress(GO:0051409) cellular response to nitrosative stress(GO:0071500) |
0.1 | 0.2 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.1 | 0.2 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.1 | 0.2 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.1 | 0.2 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.1 | 3.5 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
0.1 | 0.1 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.1 | 0.5 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
0.1 | 0.2 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.1 | 0.5 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.1 | 0.5 | GO:0098534 | centriole assembly(GO:0098534) |
0.1 | 0.4 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.1 | 0.3 | GO:0007614 | short-term memory(GO:0007614) |
0.1 | 0.2 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.1 | 0.4 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
0.1 | 0.1 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.1 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
0.1 | 2.0 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.1 | 0.2 | GO:0015740 | C4-dicarboxylate transport(GO:0015740) |
0.1 | 0.1 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.1 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.1 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.1 | 0.3 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.1 | 0.2 | GO:0002363 | alpha-beta T cell lineage commitment(GO:0002363) CD4-positive or CD8-positive, alpha-beta T cell lineage commitment(GO:0043369) T-helper 17 cell lineage commitment(GO:0072540) |
0.1 | 2.3 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.1 | 0.1 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.1 | 0.2 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.1 | 0.1 | GO:0046415 | urate metabolic process(GO:0046415) |
0.1 | 1.1 | GO:0046888 | negative regulation of hormone secretion(GO:0046888) |
0.1 | 0.2 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.1 | 0.2 | GO:0016045 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
0.1 | 1.2 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.1 | 0.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.1 | 0.1 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
0.1 | 0.1 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.1 | 2.7 | GO:0000209 | protein polyubiquitination(GO:0000209) |
0.1 | 0.1 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.1 | 1.6 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.1 | 0.1 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
0.1 | 0.3 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.1 | 0.2 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
0.1 | 0.1 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.1 | 0.1 | GO:0048668 | collateral sprouting(GO:0048668) |
0.1 | 0.2 | GO:0007215 | glutamate receptor signaling pathway(GO:0007215) |
0.1 | 0.1 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.1 | 0.6 | GO:0071539 | protein localization to centrosome(GO:0071539) |
0.1 | 0.1 | GO:0070163 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) |
0.1 | 0.1 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.1 | 0.9 | GO:0072384 | organelle transport along microtubule(GO:0072384) |
0.1 | 0.7 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.1 | 0.1 | GO:0034135 | regulation of toll-like receptor 2 signaling pathway(GO:0034135) negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
0.1 | 0.5 | GO:0000045 | autophagosome assembly(GO:0000045) |
0.1 | 0.2 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.1 | 0.2 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.1 | 0.1 | GO:0032607 | interferon-alpha production(GO:0032607) |
0.1 | 0.1 | GO:0021747 | cochlear nucleus development(GO:0021747) |
0.1 | 0.1 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.1 | 0.1 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) |
0.1 | 0.5 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
0.1 | 0.2 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.1 | 0.3 | GO:2000269 | regulation of fibroblast apoptotic process(GO:2000269) |
0.1 | 0.2 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.1 | 0.1 | GO:0002857 | positive regulation of natural killer cell mediated immune response to tumor cell(GO:0002857) positive regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002860) |
0.1 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.1 | 0.2 | GO:0006482 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
0.1 | 0.1 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.1 | 0.2 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.1 | 2.3 | GO:0050912 | detection of chemical stimulus involved in sensory perception of taste(GO:0050912) |
0.1 | 0.3 | GO:0070059 | intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0070059) |
0.1 | 0.1 | GO:0009624 | response to nematode(GO:0009624) |
0.1 | 0.1 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.1 | 0.9 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.1 | 0.2 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.1 | 0.3 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.1 | 0.1 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.1 | 0.4 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.1 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.1 | GO:0071554 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
0.1 | 1.3 | GO:0006611 | protein export from nucleus(GO:0006611) |
0.0 | 1.3 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 0.1 | GO:0002407 | dendritic cell chemotaxis(GO:0002407) |
0.0 | 0.0 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.0 | 0.4 | GO:0007130 | synaptonemal complex assembly(GO:0007130) synaptonemal complex organization(GO:0070193) |
0.0 | 0.1 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.0 | 0.0 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.1 | GO:0006544 | glycine metabolic process(GO:0006544) |
0.0 | 0.0 | GO:0042745 | circadian sleep/wake cycle(GO:0042745) |
0.0 | 0.0 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
0.0 | 0.2 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.0 | 0.3 | GO:0031033 | myosin filament organization(GO:0031033) |
0.0 | 0.3 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
0.0 | 0.4 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
0.0 | 0.3 | GO:0042982 | amyloid precursor protein metabolic process(GO:0042982) |
0.0 | 0.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.2 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.2 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.0 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.0 | 0.2 | GO:0043217 | myelin maintenance(GO:0043217) |
0.0 | 1.7 | GO:0016579 | protein deubiquitination(GO:0016579) |
0.0 | 0.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.1 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.0 | 0.1 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 1.7 | GO:0008033 | tRNA processing(GO:0008033) |
0.0 | 0.0 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.0 | 0.0 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
0.0 | 0.3 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.3 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.0 | 1.5 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
0.0 | 0.1 | GO:0002360 | T cell lineage commitment(GO:0002360) |
0.0 | 0.1 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.0 | 0.0 | GO:0002638 | negative regulation of immunoglobulin production(GO:0002638) |
0.0 | 0.1 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.0 | 0.1 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.0 | 0.0 | GO:0043576 | regulation of respiratory gaseous exchange(GO:0043576) |
0.0 | 0.1 | GO:0060005 | vestibular reflex(GO:0060005) |
0.0 | 0.0 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.0 | 0.2 | GO:0051383 | kinetochore organization(GO:0051383) |
0.0 | 0.1 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) |
0.0 | 0.0 | GO:0002254 | kinin cascade(GO:0002254) |
0.0 | 0.4 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
0.0 | 0.1 | GO:0070874 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
0.0 | 0.1 | GO:0009642 | response to light intensity(GO:0009642) |
0.0 | 0.1 | GO:0006591 | ornithine metabolic process(GO:0006591) |
0.0 | 0.0 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.0 | 0.1 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.0 | 0.0 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
0.0 | 0.1 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.0 | 0.2 | GO:0016574 | histone ubiquitination(GO:0016574) |
0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.0 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.0 | 0.0 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.0 | 0.0 | GO:0034204 | lipid translocation(GO:0034204) |
0.0 | 0.0 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.0 | 0.0 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.0 | 0.2 | GO:0001782 | B cell homeostasis(GO:0001782) |
0.0 | 0.1 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.3 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.0 | 0.0 | GO:0035561 | regulation of chromatin binding(GO:0035561) |
0.0 | 0.1 | GO:0042255 | ribosome assembly(GO:0042255) |
0.0 | 0.1 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 0.1 | GO:0016048 | detection of temperature stimulus(GO:0016048) |
0.0 | 0.6 | GO:1902600 | hydrogen ion transmembrane transport(GO:1902600) |
0.0 | 0.1 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
0.0 | 0.1 | GO:0007007 | inner mitochondrial membrane organization(GO:0007007) |
0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.0 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.0 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.0 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
0.0 | 2.8 | GO:0050907 | detection of chemical stimulus involved in sensory perception(GO:0050907) |
0.0 | 0.0 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 1.3 | GO:0007286 | spermatid development(GO:0007286) |
0.0 | 0.0 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) positive regulation of osteoclast proliferation(GO:0090290) |
0.0 | 0.0 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.0 | 0.0 | GO:0006206 | pyrimidine nucleobase metabolic process(GO:0006206) |
0.0 | 0.1 | GO:0071173 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
0.0 | 0.0 | GO:0035524 | proline transmembrane transport(GO:0035524) |
0.0 | 0.0 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.0 | GO:0090383 | phagosome acidification(GO:0090383) |
0.0 | 0.0 | GO:0051133 | regulation of NK T cell activation(GO:0051133) |
0.0 | 0.2 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
7.1 | 21.2 | GO:0097451 | glial limiting end-foot(GO:0097451) |
5.0 | 29.9 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
3.9 | 11.8 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
3.6 | 21.6 | GO:0031258 | lamellipodium membrane(GO:0031258) |
3.1 | 3.1 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
3.1 | 6.2 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
3.1 | 12.4 | GO:0044308 | axonal spine(GO:0044308) |
3.0 | 24.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
2.9 | 54.5 | GO:0060077 | inhibitory synapse(GO:0060077) |
2.7 | 18.8 | GO:0032584 | growth cone membrane(GO:0032584) |
2.4 | 7.3 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
2.4 | 19.1 | GO:0043083 | synaptic cleft(GO:0043083) |
2.4 | 11.8 | GO:0044326 | dendritic spine neck(GO:0044326) |
2.2 | 21.8 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
2.1 | 18.9 | GO:0005883 | neurofilament(GO:0005883) |
2.1 | 18.7 | GO:0030673 | axolemma(GO:0030673) |
2.1 | 6.2 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
2.0 | 6.1 | GO:0042583 | chromaffin granule(GO:0042583) |
2.0 | 8.1 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
2.0 | 6.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
2.0 | 6.0 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
1.9 | 98.8 | GO:0042734 | presynaptic membrane(GO:0042734) |
1.8 | 17.9 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
1.7 | 5.2 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
1.7 | 8.3 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
1.6 | 8.2 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
1.6 | 4.7 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
1.5 | 3.0 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
1.5 | 7.3 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
1.4 | 35.7 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
1.4 | 4.3 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
1.4 | 5.5 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
1.3 | 5.4 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
1.3 | 6.3 | GO:0097449 | astrocyte projection(GO:0097449) |
1.2 | 38.5 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
1.2 | 3.6 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
1.1 | 3.4 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
1.1 | 41.5 | GO:0043198 | dendritic shaft(GO:0043198) |
1.1 | 9.5 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
1.0 | 3.0 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
1.0 | 15.6 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
1.0 | 9.6 | GO:0043194 | axon initial segment(GO:0043194) |
1.0 | 3.8 | GO:0097433 | dense body(GO:0097433) |
0.9 | 0.9 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.9 | 3.7 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.9 | 6.4 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.9 | 12.6 | GO:0071565 | nBAF complex(GO:0071565) |
0.9 | 0.9 | GO:0044327 | dendritic spine head(GO:0044327) |
0.9 | 0.9 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.9 | 7.9 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.9 | 3.5 | GO:0033269 | internode region of axon(GO:0033269) |
0.9 | 5.2 | GO:0043203 | axon hillock(GO:0043203) |
0.9 | 2.6 | GO:0072534 | perineuronal net(GO:0072534) |
0.9 | 5.2 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.8 | 1.7 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.8 | 3.3 | GO:0045298 | tubulin complex(GO:0045298) |
0.8 | 3.3 | GO:0005667 | transcription factor complex(GO:0005667) |
0.8 | 3.3 | GO:1990130 | Iml1 complex(GO:1990130) |
0.8 | 0.8 | GO:0097422 | tubular endosome(GO:0097422) |
0.8 | 2.4 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.8 | 2.4 | GO:0097413 | Lewy body(GO:0097413) |
0.8 | 7.2 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.8 | 7.2 | GO:0005869 | dynactin complex(GO:0005869) |
0.8 | 3.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.8 | 1.6 | GO:1990635 | proximal dendrite(GO:1990635) |
0.8 | 6.0 | GO:0071437 | invadopodium(GO:0071437) |
0.7 | 0.7 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.7 | 21.1 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.7 | 5.7 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.7 | 1.4 | GO:0005579 | membrane attack complex(GO:0005579) |
0.7 | 4.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.7 | 6.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.7 | 3.3 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.7 | 4.6 | GO:0097440 | apical dendrite(GO:0097440) |
0.6 | 1.9 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.6 | 1.9 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.6 | 4.5 | GO:0016600 | flotillin complex(GO:0016600) |
0.6 | 5.0 | GO:0001650 | fibrillar center(GO:0001650) |
0.6 | 2.5 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.6 | 4.4 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.6 | 64.6 | GO:0030426 | growth cone(GO:0030426) |
0.6 | 0.6 | GO:0097513 | myosin II filament(GO:0097513) |
0.6 | 6.7 | GO:0031045 | dense core granule(GO:0031045) |
0.6 | 1.2 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.6 | 41.4 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.6 | 2.4 | GO:0033268 | node of Ranvier(GO:0033268) |
0.6 | 7.6 | GO:0043197 | dendritic spine(GO:0043197) |
0.6 | 78.7 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.6 | 1.7 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.6 | 4.6 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.6 | 2.8 | GO:0089701 | U2AF(GO:0089701) |
0.6 | 3.4 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.6 | 1.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.6 | 11.9 | GO:0034451 | centriolar satellite(GO:0034451) |
0.6 | 1.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.6 | 2.8 | GO:0005638 | lamin filament(GO:0005638) |
0.5 | 2.2 | GO:0061574 | ASAP complex(GO:0061574) |
0.5 | 2.1 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.5 | 3.7 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.5 | 10.6 | GO:0097228 | sperm principal piece(GO:0097228) |
0.5 | 1.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.5 | 2.6 | GO:0031527 | filopodium membrane(GO:0031527) |
0.5 | 0.5 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.5 | 3.1 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.5 | 1.6 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.5 | 2.6 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.5 | 0.5 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.5 | 1.5 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.5 | 2.0 | GO:0051286 | cell tip(GO:0051286) |
0.5 | 3.5 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.5 | 1.5 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.5 | 3.0 | GO:0005771 | multivesicular body(GO:0005771) |
0.5 | 4.5 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
0.5 | 8.8 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.5 | 0.5 | GO:0035061 | interchromatin granule(GO:0035061) |
0.5 | 21.1 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
0.5 | 4.8 | GO:0031011 | Ino80 complex(GO:0031011) |
0.5 | 3.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.5 | 2.8 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.5 | 1.9 | GO:0071797 | LUBAC complex(GO:0071797) |
0.5 | 4.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.5 | 1.4 | GO:0031417 | NatC complex(GO:0031417) |
0.5 | 8.3 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.5 | 4.6 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.5 | 2.3 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.5 | 3.2 | GO:0031931 | TORC1 complex(GO:0031931) |
0.5 | 3.6 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.5 | 1.4 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
0.5 | 3.2 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.4 | 3.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.4 | 1.8 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.4 | 5.3 | GO:0001891 | phagocytic cup(GO:0001891) |
0.4 | 0.4 | GO:0098576 | lumenal side of membrane(GO:0098576) |
0.4 | 1.3 | GO:0097427 | microtubule bundle(GO:0097427) |
0.4 | 1.8 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.4 | 2.2 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.4 | 2.6 | GO:0031415 | NatA complex(GO:0031415) |
0.4 | 3.5 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.4 | 8.2 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.4 | 0.4 | GO:0005686 | U2 snRNP(GO:0005686) |
0.4 | 3.9 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.4 | 1.3 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.4 | 6.4 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.4 | 1.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.4 | 1.7 | GO:0005687 | U4 snRNP(GO:0005687) |
0.4 | 1.7 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.4 | 1.2 | GO:0071817 | MMXD complex(GO:0071817) |
0.4 | 73.4 | GO:0030424 | axon(GO:0030424) |
0.4 | 1.6 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.4 | 37.8 | GO:0072562 | blood microparticle(GO:0072562) |
0.4 | 4.0 | GO:0097060 | synaptic membrane(GO:0097060) |
0.4 | 3.6 | GO:0000124 | SAGA complex(GO:0000124) |
0.4 | 24.7 | GO:0043204 | perikaryon(GO:0043204) |
0.4 | 0.4 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.4 | 1.2 | GO:0030689 | Noc complex(GO:0030689) |
0.4 | 1.6 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.4 | 4.3 | GO:0035102 | PRC1 complex(GO:0035102) |
0.4 | 3.9 | GO:0034709 | methylosome(GO:0034709) |
0.4 | 0.8 | GO:0070852 | cell body fiber(GO:0070852) |
0.4 | 15.0 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.4 | 0.4 | GO:0097542 | ciliary tip(GO:0097542) |
0.4 | 1.5 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.4 | 3.3 | GO:0005682 | U5 snRNP(GO:0005682) |
0.4 | 3.6 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.4 | 1.8 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.3 | 1.4 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.3 | 3.8 | GO:0010369 | chromocenter(GO:0010369) |
0.3 | 0.3 | GO:0071564 | npBAF complex(GO:0071564) |
0.3 | 5.1 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.3 | 3.4 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.3 | 7.0 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.3 | 60.0 | GO:0043025 | neuronal cell body(GO:0043025) |
0.3 | 3.6 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.3 | 1.0 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.3 | 4.6 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.3 | 2.9 | GO:0016580 | Sin3 complex(GO:0016580) |
0.3 | 5.5 | GO:0030904 | retromer complex(GO:0030904) |
0.3 | 1.3 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.3 | 1.3 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.3 | 1.6 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.3 | 2.6 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.3 | 2.2 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.3 | 0.9 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.3 | 1.9 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.3 | 2.8 | GO:0070382 | exocytic vesicle(GO:0070382) |
0.3 | 0.6 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.3 | 1.2 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.3 | 1.2 | GO:0005796 | Golgi lumen(GO:0005796) |
0.3 | 1.8 | GO:0030315 | T-tubule(GO:0030315) |
0.3 | 57.2 | GO:0043005 | neuron projection(GO:0043005) |
0.3 | 1.8 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.3 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
0.3 | 1.5 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.3 | 0.9 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.3 | 2.6 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.3 | 1.7 | GO:0034704 | calcium channel complex(GO:0034704) |
0.3 | 1.4 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.3 | 0.9 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.3 | 2.6 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.3 | 0.9 | GO:0070552 | BRISC complex(GO:0070552) |
0.3 | 1.4 | GO:0031901 | early endosome membrane(GO:0031901) |
0.3 | 9.0 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.3 | 0.8 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.3 | 0.6 | GO:0055087 | Ski complex(GO:0055087) |
0.3 | 3.6 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.3 | 3.6 | GO:0000145 | exocyst(GO:0000145) |
0.3 | 0.8 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.3 | 0.5 | GO:0033010 | paranodal junction(GO:0033010) |
0.3 | 14.0 | GO:0005643 | nuclear pore(GO:0005643) |
0.3 | 4.0 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.3 | 0.8 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.3 | 1.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.3 | 0.5 | GO:0097255 | R2TP complex(GO:0097255) |
0.3 | 1.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.3 | 2.6 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.3 | 1.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.3 | 0.8 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.3 | 11.6 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.3 | 2.8 | GO:0032587 | ruffle membrane(GO:0032587) |
0.3 | 0.5 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.3 | 0.3 | GO:0097526 | spliceosomal tri-snRNP complex(GO:0097526) |
0.2 | 3.5 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.2 | 1.0 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.2 | 0.5 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.2 | 2.0 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.2 | 1.0 | GO:1990745 | EARP complex(GO:1990745) |
0.2 | 1.5 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.2 | 2.5 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.2 | 0.7 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.2 | 0.7 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.2 | 2.0 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.2 | 1.7 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.2 | 0.5 | GO:1990923 | PET complex(GO:1990923) |
0.2 | 1.0 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.2 | 0.2 | GO:0030891 | VCB complex(GO:0030891) |
0.2 | 0.9 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.2 | 0.5 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.2 | 3.5 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.2 | 0.7 | GO:0042599 | lamellar body(GO:0042599) |
0.2 | 0.7 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.2 | 0.7 | GO:0070822 | Sin3-type complex(GO:0070822) |
0.2 | 20.1 | GO:0005802 | trans-Golgi network(GO:0005802) |
0.2 | 0.9 | GO:0055037 | recycling endosome(GO:0055037) |
0.2 | 4.7 | GO:0015030 | Cajal body(GO:0015030) |
0.2 | 0.7 | GO:0000811 | GINS complex(GO:0000811) |
0.2 | 1.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.2 | 0.9 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.2 | 12.5 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.2 | 3.5 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.2 | 1.3 | GO:0000801 | central element(GO:0000801) |
0.2 | 0.6 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.2 | 1.3 | GO:0042581 | specific granule(GO:0042581) |
0.2 | 0.6 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.2 | 1.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.2 | 1.7 | GO:0070938 | contractile ring(GO:0070938) |
0.2 | 1.3 | GO:0001939 | female pronucleus(GO:0001939) |
0.2 | 1.0 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.2 | 1.2 | GO:0097346 | Swr1 complex(GO:0000812) INO80-type complex(GO:0097346) |
0.2 | 2.6 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.2 | 0.4 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.2 | 0.4 | GO:0045240 | dihydrolipoyl dehydrogenase complex(GO:0045240) |
0.2 | 1.2 | GO:0070187 | telosome(GO:0070187) |
0.2 | 4.6 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.2 | 0.2 | GO:0005767 | secondary lysosome(GO:0005767) |
0.2 | 0.2 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.2 | 0.6 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.2 | 0.6 | GO:0072487 | MSL complex(GO:0072487) |
0.2 | 1.0 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.2 | 1.4 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.2 | 1.7 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.2 | 0.8 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.2 | 1.5 | GO:0045120 | pronucleus(GO:0045120) |
0.2 | 8.2 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.2 | 1.5 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.2 | 0.7 | GO:0070695 | FHF complex(GO:0070695) |
0.2 | 12.7 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.2 | 0.4 | GO:0051233 | spindle midzone(GO:0051233) |
0.2 | 0.5 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.2 | 6.1 | GO:0016592 | mediator complex(GO:0016592) |
0.2 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
0.2 | 5.4 | GO:0045171 | intercellular bridge(GO:0045171) |
0.2 | 0.3 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.2 | 1.9 | GO:0031519 | PcG protein complex(GO:0031519) |
0.2 | 1.5 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.2 | 0.9 | GO:0031209 | SCAR complex(GO:0031209) |
0.2 | 2.7 | GO:1990204 | oxidoreductase complex(GO:1990204) |
0.2 | 0.2 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
0.2 | 0.5 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.2 | 2.3 | GO:0016235 | aggresome(GO:0016235) |
0.2 | 1.5 | GO:0008278 | cohesin complex(GO:0008278) |
0.2 | 0.3 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.2 | 1.4 | GO:0001741 | XY body(GO:0001741) |
0.2 | 6.9 | GO:0000502 | proteasome complex(GO:0000502) |
0.2 | 1.9 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.2 | 7.3 | GO:0016363 | nuclear matrix(GO:0016363) |
0.2 | 0.5 | GO:0005955 | calcineurin complex(GO:0005955) |
0.2 | 3.3 | GO:0030175 | filopodium(GO:0030175) |
0.2 | 1.7 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.2 | 1.5 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
0.2 | 0.5 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.2 | 0.3 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.2 | 0.9 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.1 | 0.4 | GO:0071546 | pi-body(GO:0071546) |
0.1 | 0.6 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.1 | 0.1 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) |
0.1 | 1.5 | GO:0030914 | STAGA complex(GO:0030914) |
0.1 | 2.0 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.1 | 0.9 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.1 | 0.9 | GO:0010008 | endosome membrane(GO:0010008) |
0.1 | 2.3 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.1 | 1.6 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.1 | 0.6 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.1 | 0.3 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.1 | 0.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 1.0 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.1 | 1.4 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 0.3 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 0.4 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.1 | 0.7 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 0.3 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.1 | 0.5 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.1 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.1 | 0.1 | GO:0000785 | chromatin(GO:0000785) |
0.1 | 0.8 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.1 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.1 | 0.4 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 1.1 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
0.1 | 0.7 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.1 | 0.7 | GO:0034719 | SMN complex(GO:0032797) SMN-Sm protein complex(GO:0034719) |
0.1 | 2.0 | GO:0030139 | endocytic vesicle(GO:0030139) |
0.1 | 1.4 | GO:0034399 | nuclear periphery(GO:0034399) |
0.1 | 0.1 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.1 | 0.4 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 0.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.1 | 0.7 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.1 | 1.0 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 0.3 | GO:0001772 | immunological synapse(GO:0001772) |
0.1 | 0.2 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.1 | 4.3 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.1 | 0.7 | GO:0030008 | TRAPP complex(GO:0030008) |
0.1 | 0.2 | GO:0060170 | ciliary membrane(GO:0060170) |
0.1 | 1.3 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.1 | 0.5 | GO:0070461 | SAGA-type complex(GO:0070461) |
0.1 | 0.5 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.1 | 0.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.6 | GO:0016234 | inclusion body(GO:0016234) |
0.1 | 0.1 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 0.9 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.1 | 0.4 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.1 | 2.9 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.1 | 0.7 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.1 | 10.3 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.1 | 0.2 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.1 | 0.4 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.1 | 1.9 | GO:0032040 | small-subunit processome(GO:0032040) |
0.1 | 2.0 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 7.9 | GO:0043209 | myelin sheath(GO:0043209) |
0.1 | 0.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 0.6 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.1 | 0.9 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.1 | 0.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 25.9 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.1 | 0.4 | GO:0072687 | meiotic spindle(GO:0072687) |
0.1 | 0.1 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.1 | 0.7 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.1 | 17.9 | GO:0005874 | microtubule(GO:0005874) |
0.1 | 0.3 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 1.8 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.1 | 0.1 | GO:0002139 | stereocilia coupling link(GO:0002139) |
0.1 | 0.1 | GO:0032421 | stereocilium bundle(GO:0032421) |
0.1 | 0.3 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.1 | 0.7 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.1 | 0.7 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 37.0 | GO:0005794 | Golgi apparatus(GO:0005794) |
0.1 | 0.7 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.2 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.1 | 0.3 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.2 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.1 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.1 | 0.5 | GO:0098793 | presynapse(GO:0098793) |
0.1 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 0.6 | GO:1990752 | microtubule end(GO:1990752) |
0.1 | 2.4 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.1 | 0.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.1 | 1.8 | GO:0005776 | autophagosome(GO:0005776) |
0.1 | 0.3 | GO:0019814 | immunoglobulin complex(GO:0019814) |
0.1 | 0.2 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.1 | 0.1 | GO:0030427 | site of polarized growth(GO:0030427) |
0.1 | 0.4 | GO:0071986 | Ragulator complex(GO:0071986) |
0.1 | 10.2 | GO:0005840 | ribosome(GO:0005840) |
0.1 | 0.3 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 1.5 | GO:0031514 | motile cilium(GO:0031514) |
0.1 | 0.4 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.1 | 4.9 | GO:0005681 | spliceosomal complex(GO:0005681) |
0.1 | 0.9 | GO:0000786 | nucleosome(GO:0000786) |
0.1 | 0.6 | GO:1902555 | endoribonuclease complex(GO:1902555) |
0.1 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
0.1 | 1.5 | GO:0099572 | postsynaptic density(GO:0014069) postsynaptic specialization(GO:0099572) |
0.1 | 0.6 | GO:0033391 | chromatoid body(GO:0033391) |
0.1 | 0.1 | GO:0042585 | germinal vesicle(GO:0042585) |
0.1 | 0.2 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.1 | 0.2 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 0.2 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.1 | 0.1 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.1 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.1 | 0.5 | GO:0042555 | MCM complex(GO:0042555) |
0.1 | 1.2 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.1 | 0.3 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.1 | 0.2 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.2 | GO:0044194 | cytolytic granule(GO:0044194) |
0.1 | 1.1 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.1 | 0.8 | GO:1990391 | DNA repair complex(GO:1990391) |
0.1 | 0.2 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.1 | 0.3 | GO:0002177 | manchette(GO:0002177) |
0.0 | 3.4 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.4 | GO:0030894 | replisome(GO:0030894) |
0.0 | 1.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 1.1 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
0.0 | 0.4 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.0 | 1.2 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.0 | 0.3 | GO:0044297 | cell body(GO:0044297) |
0.0 | 0.2 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.7 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.0 | 0.5 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 0.0 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 2.7 | GO:0045202 | synapse(GO:0045202) |
0.0 | 1.4 | GO:0048471 | perinuclear region of cytoplasm(GO:0048471) |
0.0 | 145.3 | GO:0005634 | nucleus(GO:0005634) |
0.0 | 0.4 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 0.0 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 9.8 | GO:0005829 | cytosol(GO:0005829) |
0.0 | 0.2 | GO:0005770 | late endosome(GO:0005770) |
0.0 | 0.0 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.0 | 0.0 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.0 | 1.2 | GO:0005768 | endosome(GO:0005768) |
0.0 | 61.4 | GO:0031224 | intrinsic component of membrane(GO:0031224) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
5.5 | 16.6 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
5.5 | 16.5 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
5.5 | 16.4 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
4.3 | 21.3 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
3.4 | 17.0 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
3.0 | 11.9 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
2.8 | 11.1 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
2.7 | 10.8 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
2.5 | 12.7 | GO:0004985 | opioid receptor activity(GO:0004985) |
2.5 | 10.2 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
2.4 | 4.8 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
2.4 | 18.9 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
2.4 | 14.1 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
2.3 | 7.0 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
2.2 | 6.7 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
2.2 | 6.6 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
2.2 | 17.6 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
2.2 | 8.7 | GO:0032051 | clathrin light chain binding(GO:0032051) |
2.0 | 5.9 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
1.9 | 5.8 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
1.8 | 14.6 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
1.8 | 21.8 | GO:0048156 | tau protein binding(GO:0048156) |
1.8 | 7.1 | GO:0031720 | haptoglobin binding(GO:0031720) |
1.8 | 5.3 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
1.8 | 5.3 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
1.7 | 51.2 | GO:0030507 | spectrin binding(GO:0030507) |
1.6 | 8.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
1.6 | 4.7 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
1.6 | 39.2 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
1.6 | 10.9 | GO:0003680 | AT DNA binding(GO:0003680) |
1.5 | 4.6 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
1.5 | 18.1 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
1.5 | 4.4 | GO:0030350 | iron-responsive element binding(GO:0030350) |
1.4 | 4.2 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
1.4 | 14.0 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
1.4 | 5.6 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
1.4 | 19.5 | GO:0045295 | gamma-catenin binding(GO:0045295) |
1.4 | 16.7 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
1.4 | 6.9 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
1.4 | 4.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
1.4 | 4.1 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
1.4 | 5.4 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
1.3 | 5.4 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
1.3 | 4.0 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
1.3 | 25.4 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
1.3 | 27.6 | GO:0017091 | AU-rich element binding(GO:0017091) |
1.3 | 3.9 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
1.3 | 10.3 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
1.3 | 5.2 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
1.3 | 3.8 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
1.2 | 3.7 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
1.2 | 3.7 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
1.2 | 3.7 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
1.2 | 11.9 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
1.2 | 3.6 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
1.2 | 5.9 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
1.2 | 8.2 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
1.1 | 6.9 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
1.1 | 15.8 | GO:0030506 | ankyrin binding(GO:0030506) |
1.1 | 13.5 | GO:0043176 | amine binding(GO:0043176) |
1.1 | 10.1 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
1.1 | 4.5 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
1.1 | 3.3 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
1.1 | 11.7 | GO:0042043 | neurexin family protein binding(GO:0042043) |
1.1 | 2.1 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
1.0 | 3.1 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
1.0 | 3.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
1.0 | 5.2 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
1.0 | 1.0 | GO:0015172 | acidic amino acid transmembrane transporter activity(GO:0015172) |
1.0 | 3.0 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
1.0 | 6.0 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
1.0 | 5.0 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
1.0 | 3.0 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
1.0 | 3.0 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
1.0 | 3.9 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
1.0 | 2.9 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
1.0 | 3.9 | GO:0015265 | urea channel activity(GO:0015265) |
1.0 | 1.9 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
0.9 | 3.8 | GO:0015232 | heme transporter activity(GO:0015232) |
0.9 | 4.7 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.9 | 20.6 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.9 | 10.2 | GO:0005522 | profilin binding(GO:0005522) |
0.9 | 11.1 | GO:0031005 | filamin binding(GO:0031005) |
0.9 | 8.3 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.9 | 3.7 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.9 | 2.7 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.9 | 4.5 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.9 | 3.6 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.9 | 4.4 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.9 | 2.6 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.9 | 2.6 | GO:0030911 | TPR domain binding(GO:0030911) |
0.9 | 6.0 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.9 | 2.6 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.9 | 2.6 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.9 | 9.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.8 | 2.5 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.8 | 2.5 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.8 | 3.3 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.8 | 5.0 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.8 | 6.6 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.8 | 3.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.8 | 2.5 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.8 | 4.9 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
0.8 | 2.4 | GO:0019862 | IgA binding(GO:0019862) |
0.8 | 3.2 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.8 | 5.5 | GO:0043495 | protein anchor(GO:0043495) |
0.8 | 6.9 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.8 | 1.5 | GO:0034618 | arginine binding(GO:0034618) |
0.8 | 5.3 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.8 | 2.3 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.8 | 13.6 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.8 | 8.3 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.8 | 6.8 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.7 | 3.7 | GO:0033265 | choline binding(GO:0033265) |
0.7 | 2.2 | GO:0042731 | PH domain binding(GO:0042731) |
0.7 | 15.5 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.7 | 6.6 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.7 | 2.2 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.7 | 5.1 | GO:0033691 | sialic acid binding(GO:0033691) |
0.7 | 3.6 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.7 | 8.7 | GO:0035198 | miRNA binding(GO:0035198) |
0.7 | 2.2 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.7 | 3.6 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.7 | 3.6 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.7 | 7.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.7 | 2.8 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.7 | 0.7 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.7 | 4.2 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.7 | 3.5 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.7 | 2.8 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.7 | 2.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.7 | 11.0 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.7 | 5.5 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.7 | 4.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.7 | 1.4 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.7 | 2.0 | GO:0050692 | DBD domain binding(GO:0050692) |
0.7 | 3.4 | GO:0005499 | vitamin D binding(GO:0005499) |
0.7 | 7.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.7 | 0.7 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.7 | 2.0 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.7 | 2.6 | GO:0004952 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) dopamine neurotransmitter receptor activity(GO:0004952) |
0.7 | 1.3 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.6 | 3.9 | GO:0043559 | insulin binding(GO:0043559) |
0.6 | 1.9 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.6 | 6.4 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.6 | 1.3 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.6 | 1.9 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.6 | 0.6 | GO:0016429 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
0.6 | 3.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.6 | 4.9 | GO:0008430 | selenium binding(GO:0008430) |
0.6 | 4.9 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.6 | 1.2 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.6 | 1.8 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.6 | 15.4 | GO:0045502 | dynein binding(GO:0045502) |
0.6 | 1.8 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.6 | 4.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.6 | 2.9 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.6 | 1.7 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.6 | 2.9 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.6 | 8.6 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.6 | 1.7 | GO:0008066 | glutamate receptor activity(GO:0008066) |
0.6 | 2.3 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.6 | 2.8 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.6 | 4.0 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.6 | 2.3 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.6 | 1.7 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.6 | 0.6 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.6 | 1.7 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.6 | 3.4 | GO:0048495 | Roundabout binding(GO:0048495) |
0.6 | 10.6 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.6 | 2.8 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.6 | 5.5 | GO:0030955 | potassium ion binding(GO:0030955) |
0.5 | 1.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.5 | 1.6 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.5 | 0.5 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.5 | 0.5 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
0.5 | 1.6 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.5 | 1.6 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.5 | 1.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.5 | 2.7 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.5 | 1.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.5 | 6.9 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.5 | 2.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.5 | 15.3 | GO:0019894 | kinesin binding(GO:0019894) |
0.5 | 1.6 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.5 | 6.8 | GO:0030275 | LRR domain binding(GO:0030275) |
0.5 | 2.6 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.5 | 2.6 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.5 | 2.0 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.5 | 7.1 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.5 | 2.5 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.5 | 0.5 | GO:0005416 | cation:amino acid symporter activity(GO:0005416) |
0.5 | 2.5 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.5 | 4.0 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.5 | 1.5 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.5 | 4.5 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
0.5 | 3.5 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.5 | 1.5 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.5 | 7.4 | GO:0022842 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
0.5 | 1.0 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.5 | 5.9 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.5 | 1.0 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.5 | 1.5 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.5 | 0.5 | GO:0016595 | glutamate binding(GO:0016595) |
0.5 | 1.5 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.5 | 8.3 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.5 | 1.5 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.5 | 1.4 | GO:0035197 | siRNA binding(GO:0035197) |
0.5 | 1.9 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.5 | 2.8 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.5 | 6.5 | GO:0005521 | lamin binding(GO:0005521) |
0.5 | 1.4 | GO:0035240 | dopamine binding(GO:0035240) |
0.5 | 4.6 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.5 | 8.7 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.5 | 2.8 | GO:0004064 | arylesterase activity(GO:0004064) |
0.5 | 1.4 | GO:0055100 | adiponectin binding(GO:0055100) |
0.5 | 2.7 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.5 | 2.3 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.5 | 2.3 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.5 | 1.4 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.5 | 0.5 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.5 | 0.9 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.4 | 3.6 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.4 | 1.3 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.4 | 1.8 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.4 | 3.6 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.4 | 1.8 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.4 | 2.2 | GO:0016594 | glycine binding(GO:0016594) |
0.4 | 1.3 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.4 | 2.6 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.4 | 0.9 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.4 | 1.3 | GO:0031433 | telethonin binding(GO:0031433) |
0.4 | 9.6 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.4 | 2.6 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.4 | 12.6 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.4 | 1.3 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) |
0.4 | 56.9 | GO:0003729 | mRNA binding(GO:0003729) |
0.4 | 1.7 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.4 | 1.3 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.4 | 10.6 | GO:0015179 | L-amino acid transmembrane transporter activity(GO:0015179) |
0.4 | 2.5 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.4 | 4.6 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.4 | 0.8 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.4 | 1.3 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.4 | 0.8 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.4 | 0.4 | GO:0038191 | neuropilin binding(GO:0038191) |
0.4 | 3.7 | GO:0031386 | protein tag(GO:0031386) |
0.4 | 9.0 | GO:0050699 | WW domain binding(GO:0050699) |
0.4 | 1.2 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.4 | 1.2 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.4 | 3.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.4 | 1.2 | GO:0016303 | 1-phosphatidylinositol-3-kinase activity(GO:0016303) |
0.4 | 0.4 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.4 | 3.2 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.4 | 0.8 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.4 | 6.0 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.4 | 4.0 | GO:0016208 | AMP binding(GO:0016208) |
0.4 | 6.0 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.4 | 0.8 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.4 | 1.6 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.4 | 1.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.4 | 3.5 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.4 | 1.6 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.4 | 1.9 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.4 | 3.1 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.4 | 0.8 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.4 | 0.8 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.4 | 1.9 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.4 | 3.8 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.4 | 0.8 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.4 | 1.5 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.4 | 1.5 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.4 | 1.5 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.4 | 0.7 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.4 | 3.7 | GO:0005272 | sodium channel activity(GO:0005272) |
0.4 | 1.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.4 | 7.7 | GO:0033558 | protein deacetylase activity(GO:0033558) |
0.4 | 1.5 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.4 | 0.4 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.4 | 2.2 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.4 | 0.7 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.4 | 5.7 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.4 | 1.1 | GO:0016151 | nickel cation binding(GO:0016151) |
0.4 | 3.9 | GO:0010181 | FMN binding(GO:0010181) |
0.4 | 1.8 | GO:0016803 | ether hydrolase activity(GO:0016803) |
0.4 | 1.8 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.3 | 5.9 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.3 | 1.4 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.3 | 2.4 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.3 | 1.0 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.3 | 1.0 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.3 | 0.3 | GO:0046921 | alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
0.3 | 0.3 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.3 | 6.8 | GO:0003785 | actin monomer binding(GO:0003785) |
0.3 | 4.1 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.3 | 3.7 | GO:0070402 | NADPH binding(GO:0070402) |
0.3 | 2.7 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.3 | 1.0 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.3 | 8.9 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.3 | 4.9 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.3 | 2.0 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.3 | 0.7 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.3 | 1.3 | GO:0008494 | translation activator activity(GO:0008494) |
0.3 | 5.8 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.3 | 1.6 | GO:0070728 | leucine binding(GO:0070728) |
0.3 | 1.3 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.3 | 7.6 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.3 | 4.7 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.3 | 0.3 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.3 | 0.9 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.3 | 0.3 | GO:0003896 | DNA primase activity(GO:0003896) |
0.3 | 1.5 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.3 | 0.9 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.3 | 0.6 | GO:0097001 | ceramide binding(GO:0097001) |
0.3 | 3.9 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.3 | 2.4 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.3 | 1.5 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.3 | 3.3 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.3 | 0.9 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.3 | 0.3 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.3 | 8.7 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.3 | 0.3 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.3 | 0.3 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.3 | 7.1 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.3 | 5.6 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.3 | 5.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.3 | 0.9 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.3 | 15.5 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.3 | 0.9 | GO:0016015 | morphogen activity(GO:0016015) |
0.3 | 0.6 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.3 | 9.2 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.3 | 2.0 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.3 | 0.6 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.3 | 0.3 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.3 | 2.3 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.3 | 7.1 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.3 | 0.9 | GO:0019961 | interferon binding(GO:0019961) |
0.3 | 3.1 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.3 | 0.8 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.3 | 0.3 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.3 | 3.1 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.3 | 0.6 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.3 | 2.5 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.3 | 2.0 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
0.3 | 0.8 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.3 | 1.4 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.3 | 0.8 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.3 | 0.5 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.3 | 0.3 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.3 | 1.1 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.3 | 12.6 | GO:0005262 | calcium channel activity(GO:0005262) |
0.3 | 0.3 | GO:0016531 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) superoxide dismutase copper chaperone activity(GO:0016532) |
0.3 | 0.8 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.3 | 1.3 | GO:0005113 | patched binding(GO:0005113) |
0.3 | 2.4 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
0.3 | 1.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.3 | 4.5 | GO:0043531 | ADP binding(GO:0043531) |
0.3 | 1.0 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.3 | 0.5 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.3 | 0.3 | GO:0000339 | RNA cap binding(GO:0000339) |
0.3 | 0.5 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.3 | 0.8 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.3 | 15.5 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
0.3 | 4.5 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.3 | 0.8 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.3 | 0.8 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.2 | 2.2 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.2 | 25.7 | GO:0042393 | histone binding(GO:0042393) |
0.2 | 10.7 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
0.2 | 0.7 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.2 | 0.7 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.2 | 2.9 | GO:0019825 | oxygen binding(GO:0019825) |
0.2 | 3.2 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.2 | 0.5 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.2 | 1.9 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.2 | 4.6 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.2 | 1.2 | GO:0017040 | ceramidase activity(GO:0017040) |
0.2 | 2.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.2 | 4.5 | GO:0042165 | neurotransmitter binding(GO:0042165) |
0.2 | 0.5 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.2 | 0.7 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.2 | 2.1 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.2 | 0.9 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.2 | 0.7 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.2 | 0.7 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.2 | 6.2 | GO:0030276 | clathrin binding(GO:0030276) |
0.2 | 0.7 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.2 | 0.5 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.2 | 2.3 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.2 | 0.5 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.2 | 1.4 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.2 | 0.7 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.2 | 1.1 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.2 | 0.5 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.2 | 0.7 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.2 | 0.9 | GO:0008199 | ferric iron binding(GO:0008199) |
0.2 | 0.4 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.2 | 1.6 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.2 | 0.9 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.2 | 0.7 | GO:0034452 | dynactin binding(GO:0034452) |
0.2 | 6.6 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.2 | 1.1 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.2 | 1.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.2 | 8.9 | GO:0051117 | ATPase binding(GO:0051117) |
0.2 | 0.6 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.2 | 0.6 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.2 | 1.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.2 | 0.9 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.2 | 4.3 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.2 | 0.4 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.2 | 1.3 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.2 | 3.8 | GO:0052634 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.2 | 0.2 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
0.2 | 0.4 | GO:0034046 | poly(G) binding(GO:0034046) |
0.2 | 1.3 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.2 | 5.6 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.2 | 9.3 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
0.2 | 0.2 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
0.2 | 5.6 | GO:0043022 | ribosome binding(GO:0043022) |
0.2 | 1.9 | GO:0005249 | voltage-gated potassium channel activity(GO:0005249) |
0.2 | 1.0 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.2 | 1.0 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.2 | 1.2 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.2 | 2.6 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.2 | 0.8 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.2 | 0.6 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.2 | 1.2 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.2 | 0.6 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.2 | 1.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.2 | 0.6 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.2 | 0.4 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.2 | 2.2 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.2 | 0.8 | GO:0035473 | lipase binding(GO:0035473) |
0.2 | 0.8 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.2 | 1.6 | GO:0035254 | glutamate receptor binding(GO:0035254) |
0.2 | 0.8 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.2 | 0.4 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.2 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.2 | 1.2 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.2 | 2.5 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.2 | 0.8 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.2 | 0.8 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.2 | 0.8 | GO:0002054 | nucleobase binding(GO:0002054) |
0.2 | 30.6 | GO:0015631 | tubulin binding(GO:0015631) |
0.2 | 0.6 | GO:0089720 | caspase binding(GO:0089720) |
0.2 | 0.6 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.2 | 1.1 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.2 | 0.9 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
0.2 | 2.1 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.2 | 0.7 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
0.2 | 0.4 | GO:0015248 | sterol transporter activity(GO:0015248) |
0.2 | 3.5 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.2 | 11.6 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.2 | 0.7 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.2 | 0.7 | GO:0050733 | RS domain binding(GO:0050733) |
0.2 | 1.3 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.2 | 0.5 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.2 | 2.7 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.2 | 1.8 | GO:0004568 | chitinase activity(GO:0004568) |
0.2 | 0.2 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.2 | 0.5 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.2 | 2.3 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.2 | 0.2 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.2 | 3.2 | GO:0005537 | mannose binding(GO:0005537) |
0.2 | 0.7 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.2 | 0.4 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.2 | 0.5 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.2 | 0.3 | GO:0036033 | mediator complex binding(GO:0036033) |
0.2 | 0.3 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.2 | 0.5 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.2 | 0.5 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.2 | 0.5 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.2 | 0.9 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.2 | 0.7 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.2 | 0.5 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.2 | 1.7 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.2 | 1.9 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.2 | 0.3 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.2 | 2.0 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.2 | 0.3 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.2 | 0.5 | GO:0019808 | polyamine binding(GO:0019808) |
0.2 | 0.2 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.2 | 0.7 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
0.2 | 0.6 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.2 | 0.3 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.2 | 9.5 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.2 | 0.8 | GO:0070628 | proteasome binding(GO:0070628) |
0.2 | 1.0 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.2 | 1.1 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
0.2 | 0.2 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.2 | 1.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.2 | 0.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.2 | 0.8 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.2 | 6.5 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
0.2 | 1.4 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.2 | 7.1 | GO:0051087 | chaperone binding(GO:0051087) |
0.2 | 1.6 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
0.2 | 1.7 | GO:0001618 | virus receptor activity(GO:0001618) |
0.2 | 3.3 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.2 | 0.5 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.2 | 0.3 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.2 | 0.5 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.2 | 0.5 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.2 | 1.4 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.2 | 1.1 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.2 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.2 | 0.6 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.1 | 0.7 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.1 | 0.4 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.1 | 3.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.1 | 0.1 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.1 | 1.9 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.1 | 1.3 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.1 | 1.3 | GO:0030331 | estrogen receptor binding(GO:0030331) |
0.1 | 1.6 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
0.1 | 1.0 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.1 | 0.1 | GO:0010857 | calcium-dependent protein kinase activity(GO:0010857) |
0.1 | 0.3 | GO:0043139 | 5'-3' DNA helicase activity(GO:0043139) |
0.1 | 40.2 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
0.1 | 0.4 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 5.6 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.1 | 2.0 | GO:0005057 | receptor signaling protein activity(GO:0005057) |
0.1 | 0.8 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 3.6 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.1 | 3.5 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.1 | 0.5 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.1 | 0.4 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 2.8 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.5 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.1 | 1.6 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.1 | 0.5 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.1 | 0.1 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.1 | 0.5 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 0.4 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.1 | 1.8 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.1 | 0.6 | GO:0015926 | glucosidase activity(GO:0015926) |
0.1 | 0.8 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.1 | 2.2 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.1 | 2.5 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) |
0.1 | 2.5 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.1 | 2.8 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.1 | 1.0 | GO:0052773 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
0.1 | 4.9 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.1 | 0.9 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) lysophospholipid acyltransferase activity(GO:0071617) |
0.1 | 1.1 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.1 | 3.8 | GO:0018732 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.1 | 0.1 | GO:0070061 | fructose binding(GO:0070061) |
0.1 | 0.4 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.1 | 0.4 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.1 | 0.7 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.1 | 0.4 | GO:0030345 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
0.1 | 0.2 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
0.1 | 1.3 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.1 | 0.2 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.1 | 0.5 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.1 | 0.6 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.1 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.1 | 5.1 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
0.1 | 0.4 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
0.1 | 0.1 | GO:0019863 | IgE binding(GO:0019863) |
0.1 | 3.1 | GO:0015485 | cholesterol binding(GO:0015485) |
0.1 | 0.4 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.1 | 3.3 | GO:0070330 | aromatase activity(GO:0070330) |
0.1 | 0.6 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.1 | 0.4 | GO:0008373 | sialyltransferase activity(GO:0008373) |
0.1 | 1.6 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.1 | 0.2 | GO:0070815 | procollagen-lysine 5-dioxygenase activity(GO:0008475) peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.1 | 5.7 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.1 | 0.8 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.1 | 0.6 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
0.1 | 0.1 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.1 | 0.1 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.1 | 0.4 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.1 | 0.3 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.1 | 0.8 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.1 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.1 | 5.1 | GO:0000149 | SNARE binding(GO:0000149) |
0.1 | 0.8 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.1 | 1.1 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
0.1 | 1.0 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.1 | 0.3 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 0.7 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.1 | 2.4 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.1 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.1 | 0.2 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 5.1 | GO:0003724 | RNA helicase activity(GO:0003724) |
0.1 | 0.2 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.1 | 0.5 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.1 | 0.3 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.1 | 0.1 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 1.6 | GO:0097110 | scaffold protein binding(GO:0097110) |
0.1 | 6.2 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.1 | 0.3 | GO:0099528 | G-protein coupled acetylcholine receptor activity(GO:0016907) G-protein coupled neurotransmitter receptor activity(GO:0099528) |
0.1 | 0.8 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.1 | 0.5 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.1 | 0.3 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 3.1 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
0.1 | 0.2 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 2.2 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.1 | 0.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.3 | GO:0019213 | deacetylase activity(GO:0019213) |
0.1 | 1.4 | GO:0030145 | manganese ion binding(GO:0030145) |
0.1 | 2.4 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
0.1 | 0.3 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.1 | 0.5 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.1 | 0.2 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.1 | 0.4 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) oxidoreductase activity, acting on the CH-CH group of donors, with a flavin as acceptor(GO:0052890) |
0.1 | 0.9 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.1 | 0.8 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.1 | 0.3 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.1 | 1.1 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.1 | 0.6 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.1 | 0.3 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 0.6 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.1 | 0.2 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.1 | 1.4 | GO:0048365 | Rac GTPase binding(GO:0048365) |
0.1 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.1 | 0.1 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.1 | 1.1 | GO:0000049 | tRNA binding(GO:0000049) |
0.1 | 0.8 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.1 | 0.1 | GO:0016414 | O-octanoyltransferase activity(GO:0016414) |
0.1 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.1 | 0.9 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.1 | 0.3 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.1 | 0.6 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.2 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.1 | 0.4 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.1 | 2.1 | GO:0044325 | ion channel binding(GO:0044325) |
0.1 | 0.9 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.1 | 1.2 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
0.1 | 1.7 | GO:0043621 | protein self-association(GO:0043621) |
0.1 | 1.4 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.1 | 1.2 | GO:0016769 | transferase activity, transferring nitrogenous groups(GO:0016769) |
0.1 | 0.1 | GO:0008556 | potassium-transporting ATPase activity(GO:0008556) |
0.1 | 6.7 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.1 | 0.1 | GO:0070492 | disaccharide binding(GO:0048030) oligosaccharide binding(GO:0070492) |
0.1 | 0.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 40.8 | GO:0003723 | RNA binding(GO:0003723) |
0.1 | 0.5 | GO:0016667 | oxidoreductase activity, acting on a sulfur group of donors(GO:0016667) |
0.1 | 0.4 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.1 | 1.3 | GO:0051219 | phosphoprotein binding(GO:0051219) |
0.1 | 0.1 | GO:0004935 | adrenergic receptor activity(GO:0004935) |
0.1 | 0.8 | GO:0005504 | fatty acid binding(GO:0005504) |
0.1 | 0.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.1 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.1 | 0.2 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.1 | 9.1 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 0.3 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 0.3 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.1 | 0.1 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.1 | 0.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.1 | 0.3 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.1 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.1 | 3.2 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.1 | 2.1 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 0.0 | GO:0032564 | dATP binding(GO:0032564) |
0.0 | 0.1 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 1.9 | GO:0016820 | hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances(GO:0016820) |
0.0 | 1.0 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.0 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
0.0 | 3.9 | GO:0003924 | GTPase activity(GO:0003924) |
0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.0 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.9 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.0 | 0.8 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 0.1 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.3 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 1.1 | GO:0008527 | taste receptor activity(GO:0008527) |
0.0 | 0.1 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.4 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.0 | GO:0031404 | chloride ion binding(GO:0031404) |
0.0 | 0.0 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.0 | 0.0 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.0 | 2.5 | GO:0005550 | pheromone binding(GO:0005550) |
0.0 | 0.0 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.1 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.2 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.2 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
0.0 | 0.0 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.3 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.2 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.0 | 0.1 | GO:0005549 | odorant binding(GO:0005549) |
0.0 | 0.0 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
0.0 | 0.4 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.1 | GO:0050780 | dopamine receptor binding(GO:0050780) |
0.0 | 0.1 | GO:0097617 | annealing helicase activity(GO:0036310) annealing activity(GO:0097617) |
0.0 | 4.3 | GO:0004674 | protein serine/threonine kinase activity(GO:0004674) |
0.0 | 0.3 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.4 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 18.9 | GO:0004984 | olfactory receptor activity(GO:0004984) |
0.0 | 0.3 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.3 | GO:0016651 | oxidoreductase activity, acting on NAD(P)H(GO:0016651) |
0.0 | 0.1 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.0 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.0 | 0.2 | GO:0016503 | pheromone receptor activity(GO:0016503) |
0.0 | 0.1 | GO:0070405 | ammonium ion binding(GO:0070405) |
0.0 | 0.0 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.0 | GO:0019789 | SUMO transferase activity(GO:0019789) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 25.7 | PID REELIN PATHWAY | Reelin signaling pathway |
0.7 | 1.5 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.7 | 21.6 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.6 | 1.2 | ST GAQ PATHWAY | G alpha q Pathway |
0.6 | 3.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.6 | 7.3 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.6 | 2.2 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.5 | 0.5 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.5 | 14.3 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.5 | 19.6 | PID LKB1 PATHWAY | LKB1 signaling events |
0.4 | 6.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.4 | 1.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.4 | 4.0 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.4 | 5.6 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.4 | 0.8 | PID IGF1 PATHWAY | IGF1 pathway |
0.4 | 3.0 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.4 | 4.7 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.4 | 5.8 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.4 | 4.0 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.4 | 8.2 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.3 | 5.2 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.3 | 5.1 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.3 | 2.6 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.3 | 17.8 | PID CDC42 PATHWAY | CDC42 signaling events |
0.3 | 5.2 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.3 | 6.2 | PID ARF 3PATHWAY | Arf1 pathway |
0.3 | 9.4 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.3 | 7.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.3 | 16.4 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.3 | 1.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.3 | 0.6 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.3 | 8.6 | PID ARF6 PATHWAY | Arf6 signaling events |
0.3 | 0.3 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.3 | 8.3 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.3 | 1.8 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.3 | 0.8 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.3 | 4.1 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.2 | 1.2 | PID MYC PATHWAY | C-MYC pathway |
0.2 | 1.2 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.2 | 4.1 | PID RHOA PATHWAY | RhoA signaling pathway |
0.2 | 4.5 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.2 | 3.1 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.2 | 1.2 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.2 | 3.5 | PID AURORA A PATHWAY | Aurora A signaling |
0.2 | 3.2 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.2 | 8.5 | PID P53 REGULATION PATHWAY | p53 pathway |
0.2 | 0.5 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.2 | 13.3 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.2 | 3.7 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.2 | 0.2 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.2 | 0.6 | PID IFNG PATHWAY | IFN-gamma pathway |
0.2 | 8.2 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.2 | 0.8 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.2 | 0.2 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.2 | 5.5 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.2 | 2.6 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.2 | 2.2 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.2 | 1.8 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.2 | 2.0 | PID BARD1 PATHWAY | BARD1 signaling events |
0.2 | 1.0 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.2 | 1.5 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.2 | 1.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.2 | 0.6 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.2 | 1.4 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.1 | 1.3 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.1 | 3.7 | PID ATR PATHWAY | ATR signaling pathway |
0.1 | 2.4 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.1 | 1.5 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 1.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.1 | 1.0 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 0.5 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.1 | 3.2 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.1 | 2.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.1 | 1.4 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.1 | 0.3 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 1.3 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.1 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 1.7 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.1 | 0.7 | PID ATM PATHWAY | ATM pathway |
0.1 | 1.8 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.1 | 0.2 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 1.2 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.1 | 0.8 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.1 | 1.6 | PID PLK1 PATHWAY | PLK1 signaling events |
0.1 | 0.2 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.1 | 2.0 | PID P73PATHWAY | p73 transcription factor network |
0.1 | 0.3 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.1 | 0.5 | PID EPO PATHWAY | EPO signaling pathway |
0.1 | 1.6 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.1 | 0.2 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 0.4 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.1 | 0.5 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.3 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.1 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.1 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 1.0 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.7 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.4 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 1.1 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.1 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.4 | 40.0 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
2.0 | 29.9 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
1.7 | 21.8 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
1.6 | 22.0 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
1.5 | 20.7 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
1.4 | 29.7 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
1.4 | 19.7 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
1.4 | 22.5 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
1.3 | 14.0 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
1.2 | 24.8 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
1.2 | 1.2 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
1.2 | 5.9 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
1.2 | 13.0 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
1.2 | 1.2 | REACTOME OPIOID SIGNALLING | Genes involved in Opioid Signalling |
1.1 | 3.3 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
1.1 | 4.3 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
1.0 | 1.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.9 | 8.4 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.9 | 13.0 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.8 | 6.7 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.8 | 10.0 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.8 | 13.0 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.8 | 8.5 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.7 | 0.7 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.7 | 2.2 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.7 | 5.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.7 | 0.7 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.7 | 6.6 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.7 | 9.1 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.6 | 8.4 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.6 | 26.1 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.6 | 6.9 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.6 | 4.4 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.6 | 25.5 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.6 | 7.9 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.6 | 18.7 | REACTOME ION CHANNEL TRANSPORT | Genes involved in Ion channel transport |
0.6 | 4.0 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.6 | 7.8 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.6 | 6.1 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.5 | 5.4 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.5 | 10.6 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.5 | 6.9 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.5 | 3.7 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.5 | 5.2 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.5 | 1.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.5 | 7.5 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.5 | 5.4 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.5 | 4.3 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.5 | 1.4 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.5 | 7.7 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.5 | 0.5 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.5 | 16.8 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.5 | 10.7 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.5 | 1.4 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.4 | 8.4 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.4 | 15.8 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.4 | 5.7 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.4 | 1.3 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.4 | 2.6 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.4 | 0.4 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.4 | 7.4 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.4 | 17.5 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.4 | 4.7 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.4 | 5.5 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.4 | 8.0 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.4 | 6.4 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.4 | 0.8 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
0.4 | 16.7 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.4 | 1.5 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
0.4 | 5.1 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.4 | 8.0 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.4 | 0.4 | REACTOME TRAF6 MEDIATED INDUCTION OF NFKB AND MAP KINASES UPON TLR7 8 OR 9 ACTIVATION | Genes involved in TRAF6 mediated induction of NFkB and MAP kinases upon TLR7/8 or 9 activation |
0.4 | 0.7 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.3 | 2.1 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.3 | 5.9 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.3 | 15.2 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.3 | 3.4 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
0.3 | 6.5 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.3 | 1.7 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.3 | 3.7 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.3 | 0.7 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.3 | 6.6 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.3 | 0.7 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.3 | 6.5 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
0.3 | 1.0 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.3 | 2.9 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.3 | 2.9 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.3 | 3.4 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.3 | 0.6 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.3 | 2.3 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.3 | 2.9 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.3 | 0.3 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.3 | 3.4 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.3 | 12.6 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.3 | 2.8 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.3 | 6.1 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.3 | 3.0 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.3 | 0.8 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.3 | 2.4 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.3 | 3.7 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.3 | 6.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.3 | 2.8 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.3 | 0.5 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.2 | 3.7 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.2 | 10.9 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.2 | 3.9 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.2 | 1.0 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.2 | 0.5 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
0.2 | 1.9 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.2 | 3.8 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.2 | 1.4 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.2 | 2.1 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.2 | 2.5 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.2 | 3.7 | REACTOME TRANSMISSION ACROSS CHEMICAL SYNAPSES | Genes involved in Transmission across Chemical Synapses |
0.2 | 5.9 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.2 | 0.7 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.2 | 1.6 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.2 | 1.1 | REACTOME RNA POL III TRANSCRIPTION | Genes involved in RNA Polymerase III Transcription |
0.2 | 5.9 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.2 | 4.8 | REACTOME KINESINS | Genes involved in Kinesins |
0.2 | 3.4 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.2 | 2.3 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.2 | 4.0 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.2 | 12.0 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
0.2 | 3.3 | REACTOME NEURONAL SYSTEM | Genes involved in Neuronal System |
0.2 | 3.8 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.2 | 12.6 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.2 | 2.6 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.2 | 4.3 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.2 | 0.2 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.2 | 1.5 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.2 | 0.6 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
0.2 | 2.4 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.2 | 0.7 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.2 | 1.3 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.2 | 1.6 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.2 | 0.7 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.2 | 2.6 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.2 | 1.0 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.2 | 3.2 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
0.2 | 3.2 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.2 | 1.0 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.2 | 1.7 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.2 | 4.3 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
0.2 | 2.5 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.2 | 2.9 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
0.2 | 0.5 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.2 | 0.3 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.1 | 1.9 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.1 | 3.9 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.1 | 2.0 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 0.1 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.1 | 1.3 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
0.1 | 1.8 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
0.1 | 1.4 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 1.4 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.1 | 1.9 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.1 | 1.6 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.1 | 0.6 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.1 | 2.0 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
0.1 | 0.1 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
0.1 | 2.4 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
0.1 | 0.2 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 4.9 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 0.1 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.1 | 0.1 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
0.1 | 10.3 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.1 | 2.8 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.1 | 0.7 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.1 | 2.0 | REACTOME MEIOSIS | Genes involved in Meiosis |
0.1 | 4.9 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.1 | 3.4 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.1 | 1.4 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 1.3 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.1 | 0.5 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 12.3 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.1 | 0.6 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.1 | 11.8 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
0.1 | 1.3 | REACTOME TELOMERE MAINTENANCE | Genes involved in Telomere Maintenance |
0.1 | 1.0 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.1 | 1.0 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.1 | 0.7 | REACTOME ASSEMBLY OF THE PRE REPLICATIVE COMPLEX | Genes involved in Assembly of the pre-replicative complex |
0.1 | 1.3 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.1 | 1.4 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 0.2 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
0.1 | 0.2 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.1 | 0.8 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.1 | 0.3 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.1 | 1.0 | REACTOME BASE EXCISION REPAIR | Genes involved in Base Excision Repair |
0.1 | 0.7 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.1 | 0.6 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.1 | 0.7 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.1 | 1.3 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
0.1 | 0.3 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.1 | 1.0 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.1 | 0.6 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.1 | 0.5 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.1 | 0.5 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.1 | 0.1 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
0.1 | 0.8 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 0.3 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 1.2 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.1 | 0.2 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.1 | 0.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 3.7 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 2.0 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.0 | 0.4 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.4 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.6 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
0.0 | 0.9 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
0.0 | 1.1 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
0.0 | 0.4 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
0.0 | 2.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.0 | 0.4 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.4 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
0.0 | 0.5 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.3 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.0 | 0.8 | REACTOME TRANSLATION | Genes involved in Translation |
0.0 | 0.6 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.0 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.0 | 0.6 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.2 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.0 | 0.0 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |