Gene Symbol | Gene ID | Gene Info |
---|---|---|
Gmeb1
|
ENSMUSG00000028901.7 | Gmeb1 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Gmeb1 | chr4_132245713_132245864 | 280 | 0.610069 | -0.42 | 9.3e-04 | Click! |
Gmeb1 | chr4_132254385_132254679 | 280 | 0.757282 | -0.41 | 9.8e-04 | Click! |
Gmeb1 | chr4_132260499_132261267 | 638 | 0.429043 | 0.39 | 1.8e-03 | Click! |
Gmeb1 | chr4_132261601_132262055 | 226 | 0.800648 | 0.28 | 3.2e-02 | Click! |
Gmeb1 | chr4_132263303_132263454 | 1776 | 0.130047 | 0.04 | 7.9e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr6_6880959_6882181 | 2.58 |
Dlx5 |
distal-less homeobox 5 |
498 |
0.71 |
chr7_112681736_112682136 | 2.48 |
2310014F06Rik |
RIKEN cDNA 2310014F06 gene |
1855 |
0.27 |
chr9_95407637_95407788 | 2.18 |
Gm37805 |
predicted gene, 37805 |
251 |
0.83 |
chr7_130260560_130262022 | 2.14 |
Fgfr2 |
fibroblast growth factor receptor 2 |
566 |
0.84 |
chr3_84219870_84221146 | 2.10 |
Trim2 |
tripartite motif-containing 2 |
337 |
0.91 |
chr12_49386003_49386299 | 2.05 |
Gm43517 |
predicted gene 43517 |
977 |
0.42 |
chr12_15813034_15813970 | 1.94 |
Trib2 |
tribbles pseudokinase 2 |
3283 |
0.19 |
chr9_66004589_66004841 | 1.93 |
Csnk1g1 |
casein kinase 1, gamma 1 |
3025 |
0.23 |
chr10_22273651_22274398 | 1.87 |
H60b |
histocompatibility 60b |
678 |
0.55 |
chr9_60521098_60521612 | 1.82 |
Thsd4 |
thrombospondin, type I, domain containing 4 |
691 |
0.6 |
chrX_57503221_57504242 | 1.81 |
Gpr101 |
G protein-coupled receptor 101 |
26 |
0.98 |
chr1_77516527_77516993 | 1.81 |
Gm28386 |
predicted gene 28386 |
1480 |
0.33 |
chr1_42681969_42682181 | 1.77 |
Pantr1 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 1 |
11018 |
0.14 |
chr1_129273098_129274282 | 1.76 |
Thsd7b |
thrombospondin, type I, domain containing 7B |
205 |
0.95 |
chr14_44988583_44989939 | 1.75 |
Gm49364 |
predicted gene, 49364 |
363 |
0.45 |
chr7_130262055_130263206 | 1.73 |
Fgfr2 |
fibroblast growth factor receptor 2 |
773 |
0.75 |
chr12_86681553_86682494 | 1.69 |
Vash1 |
vasohibin 1 |
3323 |
0.18 |
chr2_35662845_35663372 | 1.67 |
Dab2ip |
disabled 2 interacting protein |
1489 |
0.47 |
chr3_52510208_52510569 | 1.62 |
Gm30173 |
predicted gene, 30173 |
6576 |
0.26 |
chr9_58156326_58158409 | 1.61 |
Islr |
immunoglobulin superfamily containing leucine-rich repeat |
1178 |
0.35 |
chr6_148046801_148048056 | 1.60 |
Far2 |
fatty acyl CoA reductase 2 |
12 |
0.57 |
chr9_49796955_49797154 | 1.60 |
Ncam1 |
neural cell adhesion molecule 1 |
1704 |
0.45 |
chr13_103109833_103110089 | 1.56 |
Mast4 |
microtubule associated serine/threonine kinase family member 4 |
13116 |
0.26 |
chr1_63272952_63273296 | 1.55 |
Gm11608 |
predicted gene 11608 |
4 |
0.54 |
chr13_59769950_59770463 | 1.51 |
Etohd2 |
ethanol decreased 2 |
240 |
0.61 |
chr17_8800963_8801589 | 1.51 |
Pde10a |
phosphodiesterase 10A |
417 |
0.88 |
chr3_57846307_57846818 | 1.50 |
Pfn2 |
profilin 2 |
583 |
0.72 |
chr10_112929095_112929329 | 1.49 |
Atxn7l3b |
ataxin 7-like 3B |
211 |
0.82 |
chr2_160366262_160367088 | 1.49 |
Mafb |
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein B (avian) |
390 |
0.9 |
chr12_49381569_49381963 | 1.49 |
Gm34304 |
predicted gene, 34304 |
119 |
0.91 |
chr10_73099097_73100287 | 1.45 |
Pcdh15 |
protocadherin 15 |
239 |
0.94 |
chr7_139086002_139087206 | 1.45 |
Dpysl4 |
dihydropyrimidinase-like 4 |
576 |
0.74 |
chr10_88885537_88886772 | 1.43 |
Slc5a8 |
solute carrier family 5 (iodide transporter), member 8 |
162 |
0.96 |
chr14_120477923_120478205 | 1.42 |
Rap2a |
RAS related protein 2a |
380 |
0.91 |
chr13_97243599_97244237 | 1.41 |
Enc1 |
ectodermal-neural cortex 1 |
2813 |
0.23 |
chr1_155145694_155146060 | 1.40 |
Mr1 |
major histocompatibility complex, class I-related |
906 |
0.52 |
chr4_155344717_155346023 | 1.40 |
Prkcz |
protein kinase C, zeta |
12 |
0.96 |
chr1_91802377_91802910 | 1.39 |
Gm29100 |
predicted gene 29100 |
294 |
0.84 |
chr4_148130089_148131325 | 1.39 |
Draxin |
dorsal inhibitory axon guidance protein |
9 |
0.72 |
chr12_41023755_41024036 | 1.39 |
Immp2l |
IMP2 inner mitochondrial membrane peptidase-like (S. cerevisiae) |
195 |
0.94 |
chr19_8990872_8991023 | 1.38 |
Ahnak |
AHNAK nucleoprotein (desmoyokin) |
1652 |
0.21 |
chr4_133250837_133251842 | 1.38 |
Map3k6 |
mitogen-activated protein kinase kinase kinase 6 |
490 |
0.68 |
chr12_108327442_108328787 | 1.37 |
4930478K11Rik |
RIKEN cDNA 4930478K11 gene |
84 |
0.96 |
chr14_84446582_84446935 | 1.37 |
Pcdh17 |
protocadherin 17 |
1749 |
0.43 |
chr12_112148166_112148317 | 1.37 |
Kif26a |
kinesin family member 26A |
2033 |
0.24 |
chr12_26903255_26904072 | 1.35 |
4933409F18Rik |
RIKEN cDNA 4933409F18 gene |
68790 |
0.13 |
chr14_65326240_65326874 | 1.35 |
Gm48433 |
predicted gene, 48433 |
226 |
0.92 |
chr4_65126426_65126851 | 1.34 |
Pappa |
pregnancy-associated plasma protein A |
2464 |
0.44 |
chr18_45269269_45269613 | 1.32 |
Kcnn2 |
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 2 |
436 |
0.85 |
chr17_56007547_56008092 | 1.31 |
Mpnd |
MPN domain containing |
1382 |
0.2 |
chr3_89322074_89322814 | 1.30 |
Efna3 |
ephrin A3 |
443 |
0.59 |
chr5_151060689_151060840 | 1.30 |
Stard13 |
StAR-related lipid transfer (START) domain containing 13 |
28498 |
0.19 |
chr11_112140820_112140971 | 1.29 |
Gm11680 |
predicted gene 11680 |
33457 |
0.23 |
chr6_67534365_67535798 | 1.28 |
Tacstd2 |
tumor-associated calcium signal transducer 2 |
715 |
0.56 |
chr7_34653043_34653418 | 1.28 |
Gm12781 |
predicted gene 12781 |
46 |
0.53 |
chr13_83720833_83721451 | 1.27 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
239 |
0.89 |
chr10_86778304_86778897 | 1.27 |
Nt5dc3 |
5'-nucleotidase domain containing 3 |
405 |
0.75 |
chr6_77244368_77244955 | 1.27 |
Lrrtm1 |
leucine rich repeat transmembrane neuronal 1 |
1739 |
0.46 |
chr10_96622833_96623426 | 1.26 |
Btg1 |
BTG anti-proliferation factor 1 |
5575 |
0.22 |
chr8_12926230_12928559 | 1.26 |
Mcf2l |
mcf.2 transforming sequence-like |
762 |
0.52 |
chr8_47345612_47345906 | 1.26 |
Stox2 |
storkhead box 2 |
6589 |
0.26 |
chr16_91597918_91598133 | 1.26 |
Tmem50b |
transmembrane protein 50B |
225 |
0.87 |
chrX_98149736_98151206 | 1.24 |
Ar |
androgen receptor |
1702 |
0.52 |
chr14_11556261_11556718 | 1.24 |
Ptprg |
protein tyrosine phosphatase, receptor type, G |
2908 |
0.29 |
chr1_95667614_95668292 | 1.23 |
St8sia4 |
ST8 alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase 4 |
382 |
0.87 |
chr16_87128194_87128870 | 1.23 |
Gm32865 |
predicted gene, 32865 |
93 |
0.98 |
chr5_37716516_37717529 | 1.22 |
Stk32b |
serine/threonine kinase 32B |
149 |
0.96 |
chr2_19554051_19554670 | 1.22 |
4921504E06Rik |
RIKEN cDNA 4921504E06 gene |
446 |
0.82 |
chr17_17373828_17374165 | 1.21 |
AC154200.1 |
novel transcript |
210 |
0.61 |
chr11_73018629_73018915 | 1.21 |
4732414G09Rik |
RIKEN cDNA 4732414G09 gene |
32 |
0.75 |
chr1_170644482_170644736 | 1.20 |
Olfml2b |
olfactomedin-like 2B |
77 |
0.97 |
chr11_43528807_43529627 | 1.20 |
Ccnjl |
cyclin J-like |
29 |
0.97 |
chr4_152338491_152338691 | 1.19 |
Chd5 |
chromodomain helicase DNA binding protein 5 |
60 |
0.96 |
chr18_77046807_77047036 | 1.19 |
Katnal2 |
katanin p60 subunit A-like 2 |
322 |
0.9 |
chr6_54332468_54332619 | 1.18 |
9130019P16Rik |
RIKEN cDNA 9130019P16 gene |
5202 |
0.19 |
chr3_38884145_38884427 | 1.18 |
Fat4 |
FAT atypical cadherin 4 |
2654 |
0.31 |
chr4_156058523_156059788 | 1.17 |
Ttll10 |
tubulin tyrosine ligase-like family, member 10 |
189 |
0.76 |
chr7_139213267_139213703 | 1.16 |
Stk32c |
serine/threonine kinase 32C |
178 |
0.42 |
chr10_102488339_102488885 | 1.16 |
Nts |
neurotensin |
1874 |
0.3 |
chrX_75874639_75875146 | 1.16 |
Pls3 |
plastin 3 (T-isoform) |
207 |
0.93 |
chr11_87470697_87471331 | 1.15 |
Rnu3b2 |
U3B small nuclear RNA 2 |
354 |
0.75 |
chr9_60794497_60795420 | 1.15 |
Uaca |
uveal autoantigen with coiled-coil domains and ankyrin repeats |
333 |
0.88 |
chr17_85691735_85693137 | 1.14 |
CJ186046Rik |
Riken cDNA CJ186046 gene |
1193 |
0.46 |
chr10_121865641_121866015 | 1.14 |
Gm48804 |
predicted gene, 48804 |
33770 |
0.16 |
chr11_120186805_120187341 | 1.14 |
2810410L24Rik |
RIKEN cDNA 2810410L24 gene |
1678 |
0.23 |
chr2_69646770_69647140 | 1.14 |
Bbs5 |
Bardet-Biedl syndrome 5 (human) |
216 |
0.93 |
chr8_54078767_54079427 | 1.14 |
Vegfc |
vascular endothelial growth factor C |
1318 |
0.62 |
chr11_55033508_55033732 | 1.13 |
Anxa6 |
annexin A6 |
175 |
0.94 |
chr4_54945891_54946424 | 1.13 |
Zfp462 |
zinc finger protein 462 |
1109 |
0.63 |
chr19_61226246_61226725 | 1.12 |
Csf2ra |
colony stimulating factor 2 receptor, alpha, low-affinity (granulocyte-macrophage) |
198 |
0.91 |
chr2_131159308_131160020 | 1.11 |
Gm14232 |
predicted gene 14232 |
127 |
0.74 |
chr3_13472022_13472431 | 1.11 |
Gm2464 |
predicted gene 2464 |
397 |
0.59 |
chr4_48045374_48045835 | 1.11 |
Nr4a3 |
nuclear receptor subfamily 4, group A, member 3 |
373 |
0.89 |
chrX_143664015_143665455 | 1.11 |
Pak3 |
p21 (RAC1) activated kinase 3 |
156 |
0.98 |
chr11_19760689_19760940 | 1.11 |
Gm12028 |
predicted gene 12028 |
10748 |
0.19 |
chr1_118481967_118482873 | 1.11 |
Clasp1 |
CLIP associating protein 1 |
381 |
0.8 |
chr11_59661874_59662036 | 1.10 |
Mprip |
myosin phosphatase Rho interacting protein |
540 |
0.71 |
chr4_42666707_42667292 | 1.08 |
Il11ra2 |
interleukin 11 receptor, alpha chain 2 |
1236 |
0.34 |
chr10_100018617_100019159 | 1.08 |
Kitl |
kit ligand |
2972 |
0.27 |
chr16_74407688_74408034 | 1.08 |
Robo2 |
roundabout guidance receptor 2 |
3051 |
0.35 |
chr9_105826968_105827453 | 1.07 |
Col6a6 |
collagen, type VI, alpha 6 |
875 |
0.64 |
chr8_47240952_47241121 | 1.07 |
Stox2 |
storkhead box 2 |
1301 |
0.49 |
chr8_87958280_87959003 | 1.06 |
Zfp423 |
zinc finger protein 423 |
954 |
0.67 |
chr3_66220509_66221438 | 1.06 |
Ptx3 |
pentraxin related gene |
728 |
0.68 |
chrX_114473948_114474959 | 1.05 |
Klhl4 |
kelch-like 4 |
120 |
0.97 |
chr19_9283268_9283605 | 1.05 |
Pcna-ps2 |
proliferating cell nuclear antigen pseudogene 2 |
56 |
0.98 |
chrX_50537181_50537575 | 1.05 |
Gm14620 |
predicted gene 14620 |
5406 |
0.25 |
chr17_87142136_87142409 | 1.05 |
Socs5 |
suppressor of cytokine signaling 5 |
34414 |
0.12 |
chr1_111634025_111634195 | 1.05 |
Gm8173 |
predicted gene 8173 |
173665 |
0.03 |
chr10_58812359_58813662 | 1.05 |
Gm9987 |
predicted gene 9987 |
132 |
0.76 |
chr11_87461713_87462247 | 1.05 |
Rnu3b4 |
U3B small nuclear RNA 4 |
306 |
0.78 |
chr7_112954380_112955414 | 1.05 |
Rassf10 |
Ras association (RalGDS/AF-6) domain family (N-terminal) member 10 |
935 |
0.58 |
chr14_12343518_12345314 | 1.05 |
Fezf2 |
Fez family zinc finger 2 |
1428 |
0.3 |
chr1_54556759_54557629 | 1.04 |
Pgap1 |
post-GPI attachment to proteins 1 |
433 |
0.82 |
chr12_4509528_4510297 | 1.04 |
2900045O20Rik |
RIKEN cDNA 2900045O20 gene |
595 |
0.68 |
chr8_4325268_4325664 | 1.04 |
Elavl1 |
ELAV (embryonic lethal, abnormal vision)-like 1 (Hu antigen R) |
53 |
0.72 |
chr2_152092835_152093321 | 1.04 |
Scrt2 |
scratch family zinc finger 2 |
11549 |
0.13 |
chr13_78202666_78203848 | 1.03 |
A830082K12Rik |
RIKEN cDNA A830082K12 gene |
470 |
0.74 |
chr12_108757537_108757974 | 1.03 |
Gm33682 |
predicted gene, 33682 |
5215 |
0.12 |
chr9_55511636_55512109 | 1.03 |
Etfa |
electron transferring flavoprotein, alpha polypeptide |
64 |
0.97 |
chr6_126642968_126643950 | 1.02 |
Kcna1 |
potassium voltage-gated channel, shaker-related subfamily, member 1 |
1337 |
0.47 |
chr2_42652202_42653456 | 1.02 |
Lrp1b |
low density lipoprotein-related protein 1B |
97 |
0.98 |
chr5_124351883_124352230 | 1.02 |
Cdk2ap1 |
CDK2 (cyclin-dependent kinase 2)-associated protein 1 |
177 |
0.91 |
chr14_103650211_103650540 | 1.02 |
Slain1 |
SLAIN motif family, member 1 |
147 |
0.55 |
chr16_46495706_46496214 | 1.02 |
Nectin3 |
nectin cell adhesion molecule 3 |
812 |
0.73 |
chr1_69685193_69686001 | 1.02 |
Ikzf2 |
IKAROS family zinc finger 2 |
224 |
0.94 |
chr15_25842706_25843278 | 1.01 |
Retreg1 |
reticulophagy regulator 1 |
188 |
0.94 |
chr2_37703515_37703881 | 1.01 |
Strbp |
spermatid perinuclear RNA binding protein |
161 |
0.95 |
chr7_41393313_41393464 | 1.01 |
AI987944 |
expressed sequence AI987944 |
9 |
0.81 |
chr3_52088121_52088372 | 1.01 |
5430420F09Rik |
RIKEN cDNA 5430420F09 gene |
14859 |
0.13 |
chr7_62376325_62378263 | 1.01 |
Magel2 |
melanoma antigen, family L, 2 |
284 |
0.9 |
chr18_75402042_75402196 | 1.00 |
Smad7 |
SMAD family member 7 |
27205 |
0.18 |
chr16_94526992_94527394 | 1.00 |
Vps26c |
VPS26 endosomal protein sorting factor C |
363 |
0.86 |
chr11_3761400_3762113 | 1.00 |
Osbp2 |
oxysterol binding protein 2 |
12033 |
0.14 |
chr15_39076678_39077964 | 1.00 |
Cthrc1 |
collagen triple helix repeat containing 1 |
240 |
0.88 |
chr8_122335750_122336915 | 1.00 |
Zfpm1 |
zinc finger protein, multitype 1 |
1701 |
0.24 |
chr5_135868095_135869024 | 1.00 |
Srrm3 |
serine/arginine repetitive matrix 3 |
1942 |
0.19 |
chr8_123559366_123559660 | 0.99 |
n-R5s112 |
nuclear encoded rRNA 5S 112 |
194 |
0.61 |
chr11_94936296_94937158 | 0.99 |
Col1a1 |
collagen, type I, alpha 1 |
503 |
0.69 |
chr12_40038027_40038410 | 0.99 |
Arl4aos |
ADP-ribosylation factor-like 4A, opposite strand |
119 |
0.61 |
chr14_64592702_64592949 | 0.99 |
Mir3078 |
microRNA 3078 |
1640 |
0.28 |
chr18_57059412_57059908 | 0.99 |
Gm18739 |
predicted gene, 18739 |
57620 |
0.11 |
chr16_14705845_14706609 | 0.99 |
Snai2 |
snail family zinc finger 2 |
375 |
0.9 |
chr5_39641102_39641253 | 0.99 |
Hs3st1 |
heparan sulfate (glucosamine) 3-O-sulfotransferase 1 |
3420 |
0.26 |
chr1_134362144_134362379 | 0.99 |
Tmem183a |
transmembrane protein 183A |
282 |
0.86 |
chr10_79793540_79794726 | 0.98 |
Palm |
paralemmin |
466 |
0.4 |
chr14_54360639_54360790 | 0.98 |
Oxa1l |
oxidase assembly 1-like |
120 |
0.92 |
chr8_123547433_123547713 | 0.98 |
n-R5s105 |
nuclear encoded rRNA 5S 105 |
190 |
0.63 |
chr2_173276417_173277291 | 0.98 |
Pmepa1os |
prostate transmembrane protein, androgen induced 1, opposite strand |
156 |
0.71 |
chr12_54719337_54719793 | 0.98 |
Gm25679 |
predicted gene, 25679 |
239 |
0.78 |
chr8_123605112_123605397 | 0.98 |
n-R5s139 |
nuclear encoded rRNA 5S 139 |
188 |
0.62 |
chr2_65668146_65668550 | 0.98 |
Scn2a |
sodium channel, voltage-gated, type II, alpha |
338 |
0.92 |
chr4_84672299_84672957 | 0.98 |
Bnc2 |
basonuclin 2 |
2368 |
0.35 |
chr13_38204619_38204822 | 0.98 |
Snrnp48 |
small nuclear ribonucleoprotein 48 (U11/U12) |
218 |
0.93 |
chr8_123552527_123552840 | 0.97 |
n-R5s108 |
nuclear encoded rRNA 5S 108 |
201 |
0.61 |
chr8_56706582_56707422 | 0.97 |
Gm6503 |
predicted gene 6503 |
6047 |
0.28 |
chr8_90954934_90955389 | 0.97 |
Chd9 |
chromodomain helicase DNA binding protein 9 |
109 |
0.96 |
chr12_54729134_54729599 | 0.97 |
Gm26444 |
predicted gene, 26444 |
236 |
0.79 |
chr7_68064715_68064866 | 0.97 |
Igf1r |
insulin-like growth factor I receptor |
83800 |
0.09 |
chr8_123566133_123566429 | 0.96 |
Gm25018 |
predicted gene, 25018 |
194 |
0.6 |
chrX_152768814_152769671 | 0.96 |
Shroom2 |
shroom family member 2 |
219 |
0.94 |
chr2_170731776_170732705 | 0.96 |
Dok5 |
docking protein 5 |
433 |
0.88 |
chr8_123549165_123549456 | 0.96 |
n-R5s106 |
nuclear encoded rRNA 5S 106 |
236 |
0.56 |
chr15_84064898_84065422 | 0.96 |
Efcab6 |
EF-hand calcium binding domain 6 |
189 |
0.93 |
chr8_123581324_123581630 | 0.96 |
n-R5s125 |
nuclear encoded rRNA 5S 125 |
204 |
0.58 |
chr14_8002612_8003877 | 0.96 |
Abhd6 |
abhydrolase domain containing 6 |
278 |
0.9 |
chr8_123542357_123542659 | 0.95 |
n-R5s102 |
nuclear encoded rRNA 5S 102 |
212 |
0.61 |
chr8_123579689_123579899 | 0.95 |
n-R5s124 |
nuclear encoded rRNA 5S 124 |
226 |
0.55 |
chr5_30711890_30712870 | 0.95 |
Dpysl5 |
dihydropyrimidinase-like 5 |
479 |
0.75 |
chr6_65778597_65779814 | 0.95 |
Gm16838 |
predicted gene, 16838 |
44 |
0.57 |
chr13_72198379_72198834 | 0.95 |
Gm4052 |
predicted gene 4052 |
151615 |
0.04 |
chrX_11887398_11887968 | 0.94 |
Rpl23a-ps13 |
ribosomal protein L23A, pseudogene 13 |
20418 |
0.18 |
chr8_123571241_123571465 | 0.94 |
n-R5s119 |
nuclear encoded rRNA 5S 119 |
234 |
0.54 |
chr8_123588125_123588418 | 0.94 |
n-R5s129 |
nuclear encoded rRNA 5S 129 |
194 |
0.6 |
chr2_66179905_66180187 | 0.94 |
Gm13618 |
predicted gene 13618 |
7790 |
0.19 |
chr18_67133061_67134333 | 0.94 |
Gnal |
guanine nucleotide binding protein, alpha stimulating, olfactory type |
53 |
0.96 |
chr6_101198088_101199306 | 0.94 |
Gm26911 |
predicted gene, 26911 |
39 |
0.89 |
chr2_66180321_66180653 | 0.94 |
Gm13618 |
predicted gene 13618 |
7349 |
0.19 |
chr15_66891047_66892576 | 0.94 |
Ccn4 |
cellular communication network factor 4 |
303 |
0.9 |
chr15_50997236_50997884 | 0.94 |
Gm48913 |
predicted gene, 48913 |
99921 |
0.08 |
chr15_28181738_28182178 | 0.94 |
Gm49234 |
predicted gene, 49234 |
10164 |
0.17 |
chr2_152093418_152094022 | 0.94 |
Srxn1 |
sulfiredoxin 1 homolog (S. cerevisiae) |
11796 |
0.13 |
chr13_89742774_89742925 | 0.93 |
Vcan |
versican |
340 |
0.89 |
chr1_37299560_37299784 | 0.93 |
1700074A21Rik |
RIKEN cDNA 1700074A21 gene |
25 |
0.71 |
chr6_64649585_64650116 | 0.93 |
Grid2 |
glutamate receptor, ionotropic, delta 2 |
13338 |
0.27 |
chr5_81021302_81022876 | 0.93 |
Adgrl3 |
adhesion G protein-coupled receptor L3 |
279 |
0.95 |
chr6_128124087_128124499 | 0.93 |
Tspan9 |
tetraspanin 9 |
23 |
0.97 |
chr8_12947702_12949640 | 0.93 |
Mcf2l |
mcf.2 transforming sequence-like |
718 |
0.37 |
chr6_96113009_96113380 | 0.93 |
Tafa1 |
TAFA chemokine like family member 1 |
40 |
0.98 |
chr4_49845853_49846048 | 0.93 |
Grin3a |
glutamate receptor ionotropic, NMDA3A |
206 |
0.96 |
chr16_59639197_59639744 | 0.93 |
Arl6 |
ADP-ribosylation factor-like 6 |
79 |
0.74 |
chr1_22268705_22269143 | 0.93 |
Gm28239 |
predicted gene 28239 |
31075 |
0.21 |
chr11_110398842_110399028 | 0.93 |
Map2k6 |
mitogen-activated protein kinase kinase 6 |
187 |
0.97 |
chr19_57610714_57610865 | 0.93 |
Atrnl1 |
attractin like 1 |
245 |
0.93 |
chr18_73863569_73864469 | 0.93 |
Mro |
maestro |
347 |
0.9 |
chr5_8819936_8820306 | 0.93 |
Abcb1b |
ATP-binding cassette, sub-family B (MDR/TAP), member 1B |
5169 |
0.17 |
chr17_25809082_25810175 | 0.93 |
Fbxl16 |
F-box and leucine-rich repeat protein 16 |
543 |
0.42 |
chr9_74975571_74976062 | 0.93 |
Fam214a |
family with sequence similarity 214, member A |
295 |
0.91 |
chr5_142961791_142962040 | 0.93 |
Fscn1 |
fascin actin-bundling protein 1 |
1038 |
0.49 |
chr13_63273798_63275383 | 0.93 |
Gm47585 |
predicted gene, 47585 |
990 |
0.28 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.4 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.7 | 2.1 | GO:0060166 | olfactory pit development(GO:0060166) |
0.6 | 0.6 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.5 | 3.2 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.5 | 1.0 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
0.5 | 1.4 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.4 | 1.3 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.4 | 1.8 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.4 | 1.3 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.4 | 1.3 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.4 | 1.1 | GO:0001757 | somite specification(GO:0001757) |
0.4 | 0.7 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
0.4 | 1.1 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.4 | 1.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.4 | 1.1 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
0.4 | 1.1 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.4 | 2.5 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.4 | 0.7 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.3 | 1.7 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
0.3 | 1.0 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.3 | 1.0 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.3 | 1.0 | GO:0033058 | directional locomotion(GO:0033058) |
0.3 | 1.3 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.3 | 1.0 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.3 | 0.9 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.3 | 1.9 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.3 | 0.6 | GO:0061346 | non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
0.3 | 0.9 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.3 | 1.8 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.3 | 0.6 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.3 | 1.5 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.3 | 0.9 | GO:0086043 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.3 | 0.3 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.3 | 1.2 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.3 | 0.9 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.3 | 1.4 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.3 | 1.1 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.3 | 0.8 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.3 | 0.8 | GO:0052422 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.3 | 0.5 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.3 | 1.3 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.3 | 1.1 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.3 | 0.8 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.3 | 0.5 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.3 | 0.8 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.3 | 1.8 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.3 | 1.3 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
0.3 | 0.8 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.2 | 0.2 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.2 | 0.5 | GO:1903972 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
0.2 | 0.7 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.2 | 0.7 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.2 | 2.2 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.2 | 0.7 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.2 | 1.2 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.2 | 0.2 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.2 | 0.7 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
0.2 | 0.9 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.2 | 1.6 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
0.2 | 0.7 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.2 | 0.9 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.2 | 0.2 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.2 | 1.8 | GO:2000794 | regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
0.2 | 0.7 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.2 | 0.7 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.2 | 1.3 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.2 | 2.0 | GO:0055119 | relaxation of cardiac muscle(GO:0055119) |
0.2 | 0.7 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.2 | 5.0 | GO:0001964 | startle response(GO:0001964) |
0.2 | 1.5 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
0.2 | 0.6 | GO:0034476 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
0.2 | 0.6 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.2 | 2.1 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.2 | 0.6 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.2 | 0.4 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.2 | 0.6 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.2 | 1.4 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.2 | 0.6 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.2 | 0.2 | GO:0021586 | pons maturation(GO:0021586) |
0.2 | 0.4 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.2 | 1.6 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.2 | 0.4 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.2 | 0.6 | GO:0015888 | thiamine transport(GO:0015888) |
0.2 | 0.8 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.2 | 0.2 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.2 | 0.6 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.2 | 0.6 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.2 | 1.0 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
0.2 | 0.2 | GO:0038089 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
0.2 | 0.6 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.2 | 0.4 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.2 | 0.8 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.2 | 0.4 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.2 | 0.2 | GO:0071504 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.2 | 0.8 | GO:0001927 | exocyst assembly(GO:0001927) |
0.2 | 0.7 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.2 | 0.6 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.2 | 0.6 | GO:0035106 | operant conditioning(GO:0035106) |
0.2 | 0.6 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.2 | 0.7 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.2 | 1.5 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.2 | 0.5 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.2 | 0.7 | GO:0046909 | intermembrane transport(GO:0046909) |
0.2 | 0.7 | GO:0018214 | protein carboxylation(GO:0018214) |
0.2 | 0.7 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.2 | 0.7 | GO:0009414 | response to water deprivation(GO:0009414) |
0.2 | 0.9 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
0.2 | 0.7 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.2 | 0.9 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
0.2 | 1.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.2 | 0.5 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.2 | 0.7 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.2 | 0.3 | GO:0021826 | substrate-independent telencephalic tangential migration(GO:0021826) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
0.2 | 0.3 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
0.2 | 0.5 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.2 | 0.2 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.2 | 0.7 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.2 | 0.5 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.2 | 0.5 | GO:0033505 | floor plate morphogenesis(GO:0033505) |
0.2 | 0.3 | GO:0070384 | Harderian gland development(GO:0070384) |
0.2 | 0.5 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.2 | 0.5 | GO:0098828 | modulation of inhibitory postsynaptic potential(GO:0098828) |
0.2 | 0.5 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.2 | 1.1 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.2 | 0.5 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.2 | 0.2 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.2 | 0.6 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.2 | 0.5 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.2 | 0.5 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.1 | 0.3 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.1 | 0.6 | GO:0044849 | estrous cycle(GO:0044849) |
0.1 | 0.1 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.1 | 1.5 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.1 | 0.6 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.1 | 0.7 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.1 | 0.1 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.1 | 0.4 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 0.4 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.1 | 0.3 | GO:0061110 | dense core granule biogenesis(GO:0061110) |
0.1 | 0.7 | GO:0014052 | regulation of gamma-aminobutyric acid secretion(GO:0014052) |
0.1 | 0.9 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.1 | 0.9 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
0.1 | 1.3 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
0.1 | 0.4 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.1 | 0.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.1 | 0.1 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.1 | 0.4 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.1 | 0.4 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
0.1 | 0.4 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.1 | 0.4 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 0.3 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
0.1 | 1.0 | GO:0007614 | short-term memory(GO:0007614) |
0.1 | 1.1 | GO:0031000 | response to caffeine(GO:0031000) |
0.1 | 0.4 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.1 | 0.5 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.1 | 0.5 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.1 | 0.4 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.1 | 0.5 | GO:0060440 | trachea formation(GO:0060440) |
0.1 | 0.4 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.1 | 0.6 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.1 | 0.1 | GO:0007619 | courtship behavior(GO:0007619) female courtship behavior(GO:0008050) |
0.1 | 0.6 | GO:0051775 | response to redox state(GO:0051775) |
0.1 | 0.4 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.1 | 1.7 | GO:0097320 | membrane tubulation(GO:0097320) |
0.1 | 0.4 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.1 | 0.3 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.1 | 0.4 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.1 | 1.0 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.1 | 0.4 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.1 | 1.0 | GO:0032060 | bleb assembly(GO:0032060) |
0.1 | 0.2 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.1 | 0.5 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.1 | 0.4 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.1 | 0.1 | GO:0070295 | renal water absorption(GO:0070295) |
0.1 | 0.9 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.1 | 0.4 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.1 | 0.4 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.1 | 0.6 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.1 | 0.4 | GO:0021590 | cerebellum maturation(GO:0021590) cerebellar cortex maturation(GO:0021699) |
0.1 | 0.4 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 0.2 | GO:0042297 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.1 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.6 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.4 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.1 | 0.7 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.1 | 0.8 | GO:0097264 | self proteolysis(GO:0097264) |
0.1 | 0.5 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.1 | 2.3 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.1 | 0.5 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.1 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.1 | 0.2 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.1 | 0.9 | GO:0090177 | establishment of planar polarity involved in neural tube closure(GO:0090177) |
0.1 | 0.5 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.1 | 0.6 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.1 | 0.2 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) regulation of ventricular cardiac muscle cell action potential(GO:0098911) |
0.1 | 0.3 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.3 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.1 | 0.3 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.1 | 0.3 | GO:0048865 | stem cell fate commitment(GO:0048865) |
0.1 | 0.1 | GO:0032306 | regulation of prostaglandin secretion(GO:0032306) |
0.1 | 0.9 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.1 | 1.0 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
0.1 | 0.3 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.1 | 0.2 | GO:0034727 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.1 | 1.7 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.1 | 0.4 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.1 | 0.3 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.1 | 0.2 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.1 | 0.4 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.1 | 0.5 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.1 | 0.4 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
0.1 | 0.7 | GO:0002934 | desmosome organization(GO:0002934) |
0.1 | 1.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.1 | 0.3 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.2 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.1 | 0.1 | GO:1901656 | glycoside transport(GO:1901656) |
0.1 | 0.4 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.1 | 0.6 | GO:0034350 | regulation of glial cell apoptotic process(GO:0034350) |
0.1 | 0.4 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.1 | 0.5 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.1 | 0.4 | GO:0061743 | motor learning(GO:0061743) |
0.1 | 0.2 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.1 | 0.2 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.1 | 0.3 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.1 | 0.6 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
0.1 | 0.2 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.1 | 0.3 | GO:0071316 | cellular response to nicotine(GO:0071316) |
0.1 | 0.2 | GO:0007379 | segment specification(GO:0007379) |
0.1 | 0.3 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 0.3 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
0.1 | 1.4 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.1 | 0.3 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.1 | 0.4 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 0.3 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.1 | 0.2 | GO:0061004 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.1 | 0.1 | GO:0052042 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
0.1 | 0.3 | GO:0042713 | sperm ejaculation(GO:0042713) |
0.1 | 1.0 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.1 | 0.7 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.4 | GO:2001023 | regulation of response to drug(GO:2001023) |
0.1 | 0.5 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.1 | 0.8 | GO:0034776 | response to histamine(GO:0034776) |
0.1 | 0.2 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.1 | 0.3 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.1 | 1.1 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.1 | 0.2 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 0.6 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.1 | 0.2 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.1 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.3 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.1 | 0.5 | GO:0035989 | tendon development(GO:0035989) |
0.1 | 0.8 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.1 | 0.5 | GO:0060179 | male mating behavior(GO:0060179) |
0.1 | 0.3 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.1 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
0.1 | 0.3 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.1 | 0.4 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.1 | 0.6 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.1 | 1.0 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.1 | 0.5 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.1 | 0.9 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.1 | 0.3 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.1 | 0.5 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.2 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.1 | 0.3 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.1 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
0.1 | 0.4 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.1 | 1.0 | GO:0045056 | transcytosis(GO:0045056) |
0.1 | 0.6 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.1 | 0.4 | GO:0032570 | response to progesterone(GO:0032570) |
0.1 | 0.4 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.1 | 0.3 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.1 | 0.3 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.1 | 0.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.1 | 0.3 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
0.1 | 0.2 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
0.1 | 0.2 | GO:0010535 | positive regulation of activation of JAK2 kinase activity(GO:0010535) |
0.1 | 0.8 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
0.1 | 0.5 | GO:0070977 | ossification involved in bone maturation(GO:0043931) bone maturation(GO:0070977) |
0.1 | 0.2 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.1 | 0.1 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
0.1 | 0.4 | GO:0051095 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
0.1 | 0.1 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.1 | 0.9 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 1.5 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.1 | 0.2 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.1 | 0.3 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.1 | 0.3 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
0.1 | 0.2 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.1 | 0.3 | GO:0072402 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.1 | 0.4 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.1 | 0.3 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.1 | 0.4 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.1 | 0.3 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.1 | 0.2 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.1 | 0.3 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
0.1 | 0.2 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.1 | 0.2 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
0.1 | 0.5 | GO:0030432 | peristalsis(GO:0030432) |
0.1 | 0.2 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.1 | 0.2 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 0.3 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.1 | 0.2 | GO:0003032 | detection of oxygen(GO:0003032) |
0.1 | 0.2 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.1 | 0.2 | GO:0010766 | negative regulation of sodium ion transport(GO:0010766) |
0.1 | 0.2 | GO:0060831 | smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:0060831) |
0.1 | 0.2 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.1 | 0.3 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.1 | 0.2 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.1 | 0.2 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.1 | 0.6 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.1 | 0.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.1 | 0.1 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
0.1 | 0.2 | GO:0009757 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.1 | 0.2 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.1 | 0.4 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.1 | 0.5 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.1 | 0.2 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 0.5 | GO:0001967 | suckling behavior(GO:0001967) |
0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 1.0 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.1 | 0.5 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
0.1 | 0.2 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.1 | 0.1 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.1 | 0.2 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.1 | 0.2 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.1 | 0.1 | GO:0090500 | endocardial cushion to mesenchymal transition(GO:0090500) |
0.1 | 0.2 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.1 | 0.1 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
0.1 | 0.1 | GO:0097503 | sialylation(GO:0097503) |
0.1 | 0.3 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.1 | 0.2 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.1 | 0.2 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.1 | 0.1 | GO:0048382 | mesendoderm development(GO:0048382) |
0.1 | 0.5 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.1 | 0.6 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.1 | 0.5 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.1 | 0.4 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
0.1 | 0.4 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.1 | 2.5 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
0.1 | 0.1 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
0.1 | 0.2 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.1 | 0.2 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.1 | 0.1 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.1 | 0.1 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
0.1 | 0.2 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.7 | GO:0035510 | DNA dealkylation(GO:0035510) |
0.1 | 0.2 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
0.1 | 0.2 | GO:0042416 | dopamine biosynthetic process(GO:0042416) |
0.1 | 0.6 | GO:0030825 | positive regulation of cGMP metabolic process(GO:0030825) positive regulation of cGMP biosynthetic process(GO:0030828) |
0.1 | 0.2 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.1 | 0.1 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.1 | 0.5 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
0.1 | 0.1 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.1 | 0.9 | GO:0014850 | response to muscle activity(GO:0014850) |
0.1 | 0.4 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) |
0.1 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.1 | 0.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.1 | 0.2 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.1 | 0.1 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
0.1 | 0.1 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.1 | 0.6 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.1 | 2.1 | GO:0030517 | negative regulation of axon extension(GO:0030517) |
0.1 | 0.3 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.1 | 0.3 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.1 | 0.2 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.1 | 0.2 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.1 | 0.5 | GO:0015791 | polyol transport(GO:0015791) |
0.1 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.6 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
0.1 | 0.1 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.1 | 0.5 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
0.1 | 0.1 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.1 | 0.4 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.1 | 0.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.1 | 0.3 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.1 | 0.1 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.1 | 0.2 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 1.0 | GO:0060292 | long term synaptic depression(GO:0060292) |
0.1 | 0.9 | GO:0001963 | synaptic transmission, dopaminergic(GO:0001963) |
0.1 | 0.3 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.1 | 0.5 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 0.2 | GO:0014045 | establishment of endothelial blood-brain barrier(GO:0014045) |
0.1 | 0.1 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.1 | 0.4 | GO:1904417 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.1 | 0.1 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.1 | 0.1 | GO:1901321 | positive regulation of heart induction(GO:1901321) |
0.1 | 0.2 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.1 | 0.5 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.1 | 0.1 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.1 | 0.1 | GO:2000053 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
0.1 | 0.1 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 0.3 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.3 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.1 | 0.2 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.1 | 0.2 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.1 | 0.1 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 0.5 | GO:0010388 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.1 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.2 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.1 | 0.2 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.1 | 0.1 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.1 | 0.1 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
0.1 | 0.4 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.1 | 0.1 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.1 | 0.6 | GO:0007603 | phototransduction, visible light(GO:0007603) |
0.1 | 0.2 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.1 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.1 | GO:0050713 | negative regulation of interleukin-1 beta secretion(GO:0050713) |
0.1 | 0.6 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
0.1 | 0.1 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.1 | 0.2 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.1 | 0.1 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
0.1 | 0.4 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.1 | 0.2 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.1 | 0.1 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 0.8 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
0.1 | 0.1 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
0.1 | 0.1 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
0.1 | 0.1 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.1 | 0.1 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.1 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.1 | 0.2 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.1 | 0.2 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.1 | 0.1 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.1 | 0.8 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.1 | 0.5 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.1 | 0.1 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.1 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 0.2 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.1 | 0.1 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
0.1 | 0.2 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.1 | 0.1 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.1 | 0.2 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.1 | 0.3 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.1 | 0.1 | GO:1902075 | cellular response to salt(GO:1902075) |
0.1 | 0.1 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.1 | 0.6 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.1 | 0.3 | GO:1902308 | regulation of peptidyl-serine dephosphorylation(GO:1902308) |
0.1 | 0.2 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.1 | 0.2 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.1 | 0.5 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.1 | 0.1 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.1 | 0.3 | GO:0015871 | choline transport(GO:0015871) |
0.1 | 0.2 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
0.1 | 0.4 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 0.3 | GO:0014824 | tonic smooth muscle contraction(GO:0014820) artery smooth muscle contraction(GO:0014824) |
0.1 | 0.5 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.1 | 0.1 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.1 | 0.1 | GO:0042701 | progesterone secretion(GO:0042701) regulation of progesterone secretion(GO:2000870) |
0.1 | 0.2 | GO:0046078 | dUMP metabolic process(GO:0046078) |
0.1 | 0.2 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.1 | 1.3 | GO:0010107 | potassium ion import(GO:0010107) |
0.1 | 0.4 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 0.4 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.1 | 0.1 | GO:1904468 | negative regulation of tumor necrosis factor secretion(GO:1904468) |
0.1 | 0.2 | GO:0061623 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.1 | 0.3 | GO:0042637 | catagen(GO:0042637) |
0.1 | 0.2 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.1 | 0.1 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.1 | 0.2 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 0.2 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.1 | 0.3 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 0.2 | GO:0003139 | secondary heart field specification(GO:0003139) |
0.1 | 0.8 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.1 | 0.2 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.1 | 0.3 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.1 | 0.4 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.1 | 0.5 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.1 | 0.2 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.1 | 0.6 | GO:0070528 | protein kinase C signaling(GO:0070528) |
0.1 | 0.8 | GO:0032620 | interleukin-17 production(GO:0032620) |
0.1 | 0.3 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.1 | 0.2 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.1 | 0.3 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.3 | GO:0050957 | equilibrioception(GO:0050957) |
0.0 | 0.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.1 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.0 | 0.1 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
0.0 | 0.3 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.6 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.0 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.1 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
0.0 | 0.2 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.3 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.0 | 0.0 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.0 | 0.0 | GO:0061428 | peptidyl-aspartic acid modification(GO:0018197) negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.0 | 0.2 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.2 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.3 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
0.0 | 0.1 | GO:0050665 | hydrogen peroxide biosynthetic process(GO:0050665) |
0.0 | 0.3 | GO:0001765 | membrane raft assembly(GO:0001765) |
0.0 | 0.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.0 | 0.2 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.0 | 0.2 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.0 | 0.1 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.0 | 0.1 | GO:0071440 | regulation of histone H3-K14 acetylation(GO:0071440) positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.0 | 0.2 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) |
0.0 | 0.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.0 | 3.2 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 0.3 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 0.8 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.1 | GO:1902996 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.0 | 0.3 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.0 | 0.2 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.0 | 0.6 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.1 | GO:0032095 | regulation of response to food(GO:0032095) |
0.0 | 0.1 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.0 | 0.6 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.0 | 0.1 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.0 | 0.2 | GO:0030049 | muscle filament sliding(GO:0030049) |
0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.3 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.0 | 0.1 | GO:0060353 | regulation of cell adhesion molecule production(GO:0060353) positive regulation of cell adhesion molecule production(GO:0060355) |
0.0 | 0.2 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
0.0 | 0.1 | GO:1905048 | regulation of metallopeptidase activity(GO:1905048) |
0.0 | 0.2 | GO:2000765 | regulation of cytoplasmic translation(GO:2000765) |
0.0 | 0.3 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
0.0 | 0.2 | GO:0070253 | somatostatin secretion(GO:0070253) |
0.0 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.0 | 0.3 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.0 | 1.1 | GO:0008542 | visual learning(GO:0008542) |
0.0 | 0.2 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.0 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.0 | GO:0045472 | response to ether(GO:0045472) |
0.0 | 0.4 | GO:0051642 | centrosome localization(GO:0051642) |
0.0 | 0.3 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
0.0 | 0.2 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.0 | 1.7 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.0 | 0.6 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.0 | 0.2 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.0 | 0.0 | GO:0070671 | response to interleukin-12(GO:0070671) |
0.0 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.2 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.0 | 0.5 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
0.0 | 0.1 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.0 | 0.4 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.0 | 0.3 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.4 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
0.0 | 0.1 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.0 | 0.1 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 0.1 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.2 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.0 | 0.2 | GO:0051645 | Golgi localization(GO:0051645) |
0.0 | 0.2 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
0.0 | 0.3 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.1 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.0 | 0.1 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
0.0 | 0.1 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.0 | 0.0 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.0 | 0.0 | GO:0086042 | cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) |
0.0 | 0.2 | GO:0033028 | myeloid cell apoptotic process(GO:0033028) |
0.0 | 0.3 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.0 | 1.1 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.8 | GO:0003341 | cilium movement(GO:0003341) |
0.0 | 0.2 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
0.0 | 0.0 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.0 | 0.1 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
0.0 | 0.3 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.4 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.2 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.0 | 0.1 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.0 | 0.1 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.0 | 0.3 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.1 | GO:0072366 | regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
0.0 | 0.2 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
0.0 | 0.2 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.1 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.0 | 0.1 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.0 | 0.2 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.0 | 0.2 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.1 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.2 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.0 | 0.2 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.0 | 0.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.0 | 0.2 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.0 | 0.4 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
0.0 | 0.2 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.0 | 0.0 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.0 | 0.2 | GO:0019321 | pentose metabolic process(GO:0019321) |
0.0 | 0.1 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.0 | 0.1 | GO:0009437 | carnitine metabolic process(GO:0009437) |
0.0 | 0.4 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
0.0 | 0.1 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.0 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
0.0 | 0.3 | GO:0097369 | sodium ion import(GO:0097369) |
0.0 | 0.1 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.0 | 0.2 | GO:0060056 | mammary gland involution(GO:0060056) |
0.0 | 0.3 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
0.0 | 0.1 | GO:0072143 | mesangial cell differentiation(GO:0072007) glomerular mesangial cell differentiation(GO:0072008) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) pericyte cell differentiation(GO:1904238) |
0.0 | 0.2 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.0 | 0.7 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.0 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.0 | 0.1 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.0 | 0.1 | GO:0017085 | response to insecticide(GO:0017085) |
0.0 | 0.1 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.0 | 0.3 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
0.0 | 0.4 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
0.0 | 0.2 | GO:0060442 | branching involved in prostate gland morphogenesis(GO:0060442) |
0.0 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.0 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.0 | 0.1 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.0 | 0.1 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.0 | 0.0 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) positive regulation of hh target transcription factor activity(GO:0007228) |
0.0 | 0.3 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
0.0 | 0.1 | GO:0018126 | protein hydroxylation(GO:0018126) |
0.0 | 0.0 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.0 | 0.0 | GO:0061046 | regulation of branching involved in lung morphogenesis(GO:0061046) |
0.0 | 0.4 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
0.0 | 0.3 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.0 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
0.0 | 0.0 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
0.0 | 0.2 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.0 | 0.0 | GO:0048617 | foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
0.0 | 0.0 | GO:0072610 | interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) |
0.0 | 0.0 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.0 | 0.1 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.0 | 0.1 | GO:0001302 | replicative cell aging(GO:0001302) |
0.0 | 0.3 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.0 | 0.2 | GO:0015874 | norepinephrine transport(GO:0015874) |
0.0 | 0.1 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 0.2 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.1 | GO:0008355 | olfactory learning(GO:0008355) |
0.0 | 0.1 | GO:0002076 | osteoblast development(GO:0002076) |
0.0 | 0.6 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
0.0 | 0.0 | GO:1902837 | amino acid import into cell(GO:1902837) |
0.0 | 0.3 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.0 | 0.1 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.0 | 0.1 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.0 | 0.1 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.0 | 2.5 | GO:0010921 | regulation of phosphatase activity(GO:0010921) |
0.0 | 0.0 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.0 | 0.0 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
0.0 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.0 | 0.3 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.0 | 0.7 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.1 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
0.0 | 0.2 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
0.0 | 0.7 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
0.0 | 0.1 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.0 | 0.2 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.0 | GO:0021892 | cerebral cortex GABAergic interneuron differentiation(GO:0021892) |
0.0 | 0.1 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.0 | 0.2 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.0 | GO:0043307 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
0.0 | 1.0 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
0.0 | 0.6 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.0 | GO:0002351 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
0.0 | 0.1 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.0 | 0.1 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
0.0 | 0.2 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.5 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) |
0.0 | 0.1 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.1 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.0 | 0.3 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
0.0 | 0.1 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.0 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.0 | 0.1 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
0.0 | 0.1 | GO:0002827 | positive regulation of T-helper 1 type immune response(GO:0002827) |
0.0 | 0.2 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.0 | 0.9 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.1 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.0 | 0.4 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.0 | 0.3 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.0 | 0.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.0 | 0.0 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.0 | 0.5 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
0.0 | 0.0 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.1 | GO:0090559 | regulation of membrane permeability(GO:0090559) |
0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.1 | GO:0048239 | protection from non-homologous end joining at telomere(GO:0031848) negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
0.0 | 0.5 | GO:0042755 | eating behavior(GO:0042755) |
0.0 | 0.0 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
0.0 | 0.1 | GO:0019336 | phenol-containing compound catabolic process(GO:0019336) |
0.0 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.0 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.0 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.0 | 0.5 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.0 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.2 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.0 | 0.1 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.0 | 0.2 | GO:0010972 | negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
0.0 | 0.1 | GO:0006706 | steroid catabolic process(GO:0006706) |
0.0 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.0 | 0.6 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.0 | 0.0 | GO:0071025 | RNA surveillance(GO:0071025) |
0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.0 | 0.1 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.3 | GO:1900015 | regulation of cytokine production involved in inflammatory response(GO:1900015) |
0.0 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.0 | 0.1 | GO:0002360 | T cell lineage commitment(GO:0002360) |
0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.0 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.3 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.2 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
0.0 | 0.2 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.0 | 0.0 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.0 | 0.2 | GO:0051904 | pigment granule transport(GO:0051904) |
0.0 | 0.1 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.0 | 0.2 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
0.0 | 0.1 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.0 | 0.5 | GO:0035690 | cellular response to drug(GO:0035690) |
0.0 | 0.0 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.0 | 0.0 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
0.0 | 0.2 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
0.0 | 0.2 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.1 | GO:2000505 | regulation of energy homeostasis(GO:2000505) |
0.0 | 0.0 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.0 | 0.1 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.0 | 0.1 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
0.0 | 0.0 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.0 | 0.2 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
0.0 | 0.0 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
0.0 | 0.0 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.0 | 0.2 | GO:0060972 | left/right pattern formation(GO:0060972) |
0.0 | 0.3 | GO:0014911 | positive regulation of smooth muscle cell migration(GO:0014911) |
0.0 | 0.2 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.0 | 0.2 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.0 | 0.3 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.0 | 0.2 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
0.0 | 0.1 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 0.2 | GO:0090220 | chromosome localization to nuclear envelope involved in homologous chromosome segregation(GO:0090220) |
0.0 | 0.0 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.0 | 0.2 | GO:0016233 | telomere capping(GO:0016233) |
0.0 | 0.2 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.0 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.0 | 0.4 | GO:0002088 | lens development in camera-type eye(GO:0002088) |
0.0 | 0.0 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.0 | 0.6 | GO:0009206 | purine ribonucleoside triphosphate biosynthetic process(GO:0009206) |
0.0 | 0.0 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
0.0 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.0 | 0.2 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.0 | 0.6 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.0 | 0.0 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.0 | 0.0 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.0 | 0.3 | GO:0018208 | peptidyl-proline modification(GO:0018208) |
0.0 | 0.2 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
0.0 | 0.2 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.9 | GO:0010811 | positive regulation of cell-substrate adhesion(GO:0010811) |
0.0 | 0.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.1 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.0 | 0.0 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.0 | 0.0 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.0 | 0.0 | GO:2000409 | T cell extravasation(GO:0072683) regulation of T cell extravasation(GO:2000407) positive regulation of T cell extravasation(GO:2000409) |
0.0 | 0.1 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
0.0 | 0.0 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.0 | 0.0 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.0 | 0.0 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.0 | 0.0 | GO:0003072 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
0.0 | 0.2 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.0 | 0.1 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.0 | 0.0 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.0 | 0.0 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.1 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
0.0 | 0.1 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
0.0 | 0.8 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.0 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.1 | GO:0060749 | mammary gland alveolus development(GO:0060749) mammary gland lobule development(GO:0061377) |
0.0 | 0.1 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.0 | 0.4 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.0 | 0.3 | GO:0045197 | establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
0.0 | 1.1 | GO:0032874 | positive regulation of stress-activated MAPK cascade(GO:0032874) |
0.0 | 0.1 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.2 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.0 | 0.0 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
0.0 | 0.1 | GO:0032048 | cardiolipin metabolic process(GO:0032048) |
0.0 | 0.3 | GO:0050798 | activated T cell proliferation(GO:0050798) |
0.0 | 0.0 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.0 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.1 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 0.4 | GO:1901998 | toxin transport(GO:1901998) |
0.0 | 0.2 | GO:0002717 | positive regulation of natural killer cell mediated immunity(GO:0002717) |
0.0 | 0.3 | GO:0046834 | lipid phosphorylation(GO:0046834) |
0.0 | 0.1 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.0 | 0.0 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
0.0 | 0.2 | GO:1901663 | quinone biosynthetic process(GO:1901663) |
0.0 | 0.2 | GO:0051294 | establishment of spindle orientation(GO:0051294) |
0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.0 | 0.1 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.0 | 0.0 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.0 | 0.0 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.0 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.0 | 0.0 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.0 | 0.1 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.1 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.0 | 0.1 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.0 | 0.0 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.0 | 0.0 | GO:0033278 | cell proliferation in midbrain(GO:0033278) |
0.0 | 0.1 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.0 | 0.0 | GO:1903624 | regulation of DNA catabolic process(GO:1903624) |
0.0 | 0.3 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.1 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.0 | 0.3 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 1.2 | GO:0002230 | positive regulation of defense response to virus by host(GO:0002230) |
0.0 | 0.0 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.0 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 0.0 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
0.0 | 0.1 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.0 | 0.0 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.0 | 0.0 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.0 | GO:0044321 | response to leptin(GO:0044321) |
0.0 | 0.2 | GO:0051281 | positive regulation of release of sequestered calcium ion into cytosol(GO:0051281) |
0.0 | 0.3 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.2 | GO:0001836 | release of cytochrome c from mitochondria(GO:0001836) |
0.0 | 0.0 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.0 | 0.0 | GO:0072584 | caveolin-mediated endocytosis(GO:0072584) |
0.0 | 0.0 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
0.0 | 0.0 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.0 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.0 | 0.0 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
0.0 | 0.0 | GO:0045922 | negative regulation of fatty acid metabolic process(GO:0045922) |
0.0 | 0.1 | GO:2000757 | negative regulation of peptidyl-lysine acetylation(GO:2000757) |
0.0 | 0.0 | GO:0051140 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.0 | 0.3 | GO:0001779 | natural killer cell differentiation(GO:0001779) |
0.0 | 0.0 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.0 | 0.1 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.0 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
0.0 | 0.0 | GO:0060005 | vestibular reflex(GO:0060005) |
0.0 | 0.2 | GO:0071624 | positive regulation of granulocyte chemotaxis(GO:0071624) |
0.0 | 0.0 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.0 | 0.0 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.0 | 0.0 | GO:0097384 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.0 | 0.0 | GO:0032770 | positive regulation of monooxygenase activity(GO:0032770) |
0.0 | 0.0 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.0 | 0.1 | GO:0009081 | branched-chain amino acid metabolic process(GO:0009081) |
0.0 | 0.0 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.0 | GO:0015884 | folic acid transport(GO:0015884) |
0.0 | 0.1 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.0 | 0.4 | GO:0008637 | apoptotic mitochondrial changes(GO:0008637) |
0.0 | 0.0 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.0 | 0.0 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.0 | 0.0 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.0 | 0.1 | GO:0009650 | UV protection(GO:0009650) |
0.0 | 0.1 | GO:0051546 | keratinocyte migration(GO:0051546) |
0.0 | 0.0 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.2 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.0 | 0.1 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.0 | 0.0 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
0.0 | 0.0 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
0.0 | 0.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.0 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
0.0 | 0.0 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.0 | 0.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.0 | 0.0 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.0 | 0.0 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.5 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 0.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.0 | 0.0 | GO:0045738 | negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
0.0 | 0.0 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.2 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
0.0 | 0.0 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.0 | 0.0 | GO:0060029 | convergent extension involved in organogenesis(GO:0060029) |
0.0 | 0.0 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.0 | 0.1 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
0.0 | 0.1 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
0.0 | 0.0 | GO:1902624 | positive regulation of neutrophil migration(GO:1902624) |
0.0 | 0.1 | GO:0048311 | mitochondrion distribution(GO:0048311) |
0.0 | 0.0 | GO:0070570 | regulation of neuron projection regeneration(GO:0070570) |
0.0 | 0.0 | GO:0008038 | neuron recognition(GO:0008038) |
0.0 | 0.0 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.0 | 0.0 | GO:0033127 | regulation of histone phosphorylation(GO:0033127) |
0.0 | 0.0 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.0 | 0.0 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.0 | 0.0 | GO:0048340 | paraxial mesoderm morphogenesis(GO:0048340) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.0 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.0 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.0 | 0.1 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.0 | GO:0046070 | dGTP metabolic process(GO:0046070) |
0.0 | 0.1 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.0 | 0.0 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.0 | 0.0 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.0 | 0.1 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.0 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.0 | 0.0 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 0.1 | GO:0042269 | regulation of natural killer cell mediated cytotoxicity(GO:0042269) |
0.0 | 0.0 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
0.0 | 0.0 | GO:0051593 | response to folic acid(GO:0051593) |
0.0 | 0.0 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.0 | 0.1 | GO:0006071 | glycerol metabolic process(GO:0006071) |
0.0 | 0.1 | GO:0010669 | epithelial structure maintenance(GO:0010669) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.8 | GO:0044393 | microspike(GO:0044393) |
0.6 | 1.7 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.4 | 1.3 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.4 | 2.0 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.4 | 1.1 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.3 | 1.0 | GO:0043293 | apoptosome(GO:0043293) |
0.3 | 0.9 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.3 | 2.4 | GO:0043203 | axon hillock(GO:0043203) |
0.3 | 0.9 | GO:0097513 | myosin II filament(GO:0097513) |
0.3 | 1.2 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.3 | 0.6 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.2 | 0.7 | GO:0032280 | symmetric synapse(GO:0032280) |
0.2 | 0.7 | GO:0072534 | perineuronal net(GO:0072534) |
0.2 | 1.2 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.2 | 0.5 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.2 | 0.7 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.2 | 2.0 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.2 | 1.1 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.2 | 0.5 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.2 | 1.2 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.4 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.4 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 1.9 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.1 | 2.1 | GO:0043205 | fibril(GO:0043205) |
0.1 | 0.4 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 0.1 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
0.1 | 1.2 | GO:0097470 | ribbon synapse(GO:0097470) |
0.1 | 0.4 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.3 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.1 | 0.5 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 0.4 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.1 | 0.5 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.1 | 0.9 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 0.5 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.4 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.1 | 0.1 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 1.2 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.1 | 1.7 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.1 | 0.6 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 0.9 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.1 | 0.4 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.1 | 1.0 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.1 | 0.5 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.1 | 0.4 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 2.6 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 0.2 | GO:0043194 | axon initial segment(GO:0043194) |
0.1 | 1.1 | GO:0071564 | npBAF complex(GO:0071564) |
0.1 | 0.4 | GO:0042583 | chromaffin granule(GO:0042583) |
0.1 | 0.3 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.4 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.1 | 1.6 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.1 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
0.1 | 0.3 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.1 | 0.3 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.1 | 0.3 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.5 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.1 | 1.5 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.1 | 0.3 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.1 | 2.4 | GO:0008328 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.1 | 0.6 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.1 | 0.5 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.2 | GO:1990635 | proximal dendrite(GO:1990635) |
0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 0.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 0.7 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 0.2 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 4.6 | GO:0034705 | potassium channel complex(GO:0034705) |
0.1 | 0.4 | GO:0070187 | telosome(GO:0070187) |
0.1 | 1.8 | GO:0044295 | axonal growth cone(GO:0044295) |
0.1 | 0.4 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.1 | 0.2 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 1.6 | GO:0030057 | desmosome(GO:0030057) |
0.1 | 0.3 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.1 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 0.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 0.3 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.4 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 1.3 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.1 | 0.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.8 | GO:0016580 | Sin3 complex(GO:0016580) |
0.1 | 2.0 | GO:0005921 | gap junction(GO:0005921) |
0.1 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.1 | 1.5 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.1 | 0.5 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 0.4 | GO:0072687 | meiotic spindle(GO:0072687) |
0.1 | 0.3 | GO:0030870 | Mre11 complex(GO:0030870) |
0.1 | 0.3 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 1.6 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.1 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.1 | 0.3 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.1 | 0.6 | GO:0031527 | filopodium membrane(GO:0031527) |
0.1 | 0.3 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.1 | 0.4 | GO:0001940 | male pronucleus(GO:0001940) |
0.1 | 0.3 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.1 | 0.2 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 0.2 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.1 | 0.4 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.5 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 0.7 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 0.2 | GO:0071953 | elastic fiber(GO:0071953) |
0.1 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.1 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 0.6 | GO:0031528 | microvillus membrane(GO:0031528) |
0.1 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.1 | 0.2 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.1 | 1.4 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.1 | 0.3 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 0.2 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 1.4 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.1 | 0.6 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.1 | 0.5 | GO:0043218 | compact myelin(GO:0043218) |
0.1 | 0.3 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.1 | 0.7 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.1 | 0.4 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.3 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.1 | GO:0001939 | female pronucleus(GO:0001939) |
0.1 | 17.2 | GO:0031012 | extracellular matrix(GO:0031012) |
0.1 | 0.6 | GO:0005652 | nuclear lamina(GO:0005652) |
0.0 | 1.4 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 3.0 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.5 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.8 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 0.4 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.2 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.6 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 1.1 | GO:0031902 | late endosome membrane(GO:0031902) |
0.0 | 0.5 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.5 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.0 | 0.7 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.7 | GO:0031231 | intrinsic component of peroxisomal membrane(GO:0031231) |
0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.2 | GO:0097433 | dense body(GO:0097433) |
0.0 | 0.2 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.0 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.3 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.4 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.5 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 0.1 | GO:0034706 | sodium channel complex(GO:0034706) |
0.0 | 0.0 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.1 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.0 | 0.7 | GO:0030286 | dynein complex(GO:0030286) |
0.0 | 0.4 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.4 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.9 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.6 | GO:0090568 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) nuclear transcriptional repressor complex(GO:0090568) |
0.0 | 0.2 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.0 | 0.7 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.3 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 1.1 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 0.4 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 2.3 | GO:0043195 | terminal bouton(GO:0043195) |
0.0 | 0.7 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.3 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 1.6 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.4 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.3 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.1 | GO:0030677 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.0 | 0.4 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.2 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 4.7 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.0 | 1.3 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.4 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 0.2 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.5 | GO:0031082 | BLOC complex(GO:0031082) |
0.0 | 0.0 | GO:0071437 | invadopodium(GO:0071437) |
0.0 | 0.2 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.0 | 0.9 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.1 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.0 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 1.2 | GO:0044291 | cell-cell contact zone(GO:0044291) |
0.0 | 0.9 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.2 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.0 | 0.8 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 0.2 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.0 | 3.4 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.3 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.6 | GO:0042611 | MHC protein complex(GO:0042611) |
0.0 | 0.2 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 0.1 | GO:0000235 | astral microtubule(GO:0000235) aster(GO:0005818) |
0.0 | 0.2 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 1.9 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.0 | 0.6 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.6 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.1 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.0 | 0.0 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.7 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.2 | GO:0005861 | troponin complex(GO:0005861) |
0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.2 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.0 | 0.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.4 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.2 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 1.5 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.0 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.1 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.8 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.0 | 0.0 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.0 | 0.2 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 1.9 | GO:0030027 | lamellipodium(GO:0030027) |
0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.2 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.0 | 0.0 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.0 | 5.1 | GO:0070161 | anchoring junction(GO:0070161) |
0.0 | 0.4 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.0 | 0.1 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.1 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.0 | 0.2 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.1 | GO:0034704 | calcium channel complex(GO:0034704) |
0.0 | 0.2 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.0 | 1.0 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 0.4 | GO:0022624 | proteasome accessory complex(GO:0022624) |
0.0 | 2.7 | GO:0043235 | receptor complex(GO:0043235) |
0.0 | 0.3 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.1 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 0.2 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 1.3 | GO:0072372 | primary cilium(GO:0072372) |
0.0 | 1.8 | GO:0005911 | cell-cell junction(GO:0005911) |
0.0 | 0.0 | GO:0032838 | cell projection cytoplasm(GO:0032838) |
0.0 | 0.5 | GO:0044306 | neuron projection terminus(GO:0044306) |
0.0 | 0.1 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.0 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 1.8 | GO:0044455 | mitochondrial membrane part(GO:0044455) |
0.0 | 0.1 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.3 | GO:0034702 | ion channel complex(GO:0034702) |
0.0 | 0.2 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.0 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.0 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.2 | GO:0033202 | DNA helicase complex(GO:0033202) |
0.0 | 0.0 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.7 | GO:0005903 | brush border(GO:0005903) |
0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.0 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.0 | 0.2 | GO:0042588 | zymogen granule(GO:0042588) |
0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.5 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.2 | GO:0043073 | germ cell nucleus(GO:0043073) |
0.0 | 0.0 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.1 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.0 | GO:0030127 | COPII vesicle coat(GO:0030127) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 3.7 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.4 | 1.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.4 | 1.1 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.3 | 0.7 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.3 | 1.0 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.3 | 1.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.3 | 1.0 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.3 | 1.5 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.3 | 1.7 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.3 | 1.6 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.3 | 0.8 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.2 | 0.7 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.2 | 2.2 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.2 | 0.7 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.2 | 0.7 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.2 | 0.5 | GO:0050780 | dopamine receptor binding(GO:0050780) |
0.2 | 4.3 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
0.2 | 0.9 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.2 | 0.9 | GO:0043515 | kinetochore binding(GO:0043515) |
0.2 | 1.5 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.2 | 0.4 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.2 | 0.8 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.2 | 0.8 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.2 | 1.4 | GO:0018637 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.2 | 1.8 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.2 | 0.6 | GO:2001070 | starch binding(GO:2001070) |
0.2 | 0.8 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.2 | 0.6 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.2 | 0.6 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.2 | 0.4 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.2 | 1.2 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.2 | 1.2 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.2 | 0.4 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.2 | 1.5 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.2 | 0.7 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.2 | 4.6 | GO:0004120 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.2 | 0.4 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.2 | 0.9 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.2 | 0.9 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.2 | 0.5 | GO:0035939 | microsatellite binding(GO:0035939) |
0.2 | 0.5 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.2 | 0.5 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.2 | 0.6 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.2 | 0.8 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.2 | 0.6 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.2 | 0.6 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.1 | 0.4 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 0.4 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 0.6 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.1 | 0.4 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.1 | 0.4 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.1 | 0.6 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 0.7 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 0.6 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.1 | 0.5 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.1 | 1.0 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.1 | 0.4 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.1 | 0.1 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.1 | 0.7 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.1 | 0.7 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.1 | 2.0 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.1 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.1 | 0.5 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 0.9 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.1 | 0.1 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
0.1 | 0.5 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 0.5 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 0.3 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.1 | 2.3 | GO:0031489 | myosin V binding(GO:0031489) |
0.1 | 0.4 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.1 | 2.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 0.5 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.1 | 0.4 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.1 | 0.6 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.4 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.1 | 0.5 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.1 | 0.3 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.1 | 0.5 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.1 | 0.3 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.3 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.1 | 0.5 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.1 | 0.8 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.1 | 0.3 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.1 | 1.5 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.1 | 1.1 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.1 | 0.4 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 0.4 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.1 | 1.3 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.6 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.1 | 0.2 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.1 | 1.0 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 0.3 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.1 | 0.4 | GO:0052796 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.1 | 0.5 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.1 | 2.6 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.1 | 0.3 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.1 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.1 | 0.3 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.1 | 0.6 | GO:0048495 | Roundabout binding(GO:0048495) |
0.1 | 0.3 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.1 | 1.0 | GO:0031996 | thioesterase binding(GO:0031996) |
0.1 | 0.4 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.3 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.5 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.1 | 0.3 | GO:0070840 | dynein complex binding(GO:0070840) |
0.1 | 0.8 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.2 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.1 | 0.5 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 0.3 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.1 | 0.4 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 0.3 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.1 | 0.3 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.1 | 0.6 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.1 | 0.4 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.4 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.1 | 1.0 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.1 | 1.0 | GO:0051378 | serotonin binding(GO:0051378) |
0.1 | 1.1 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.1 | 0.4 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 0.3 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.1 | 1.9 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 0.6 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.1 | 0.3 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.1 | 0.5 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.1 | 0.3 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.1 | 0.8 | GO:0048156 | tau protein binding(GO:0048156) |
0.1 | 0.9 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.1 | 2.6 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.1 | 0.4 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.4 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.3 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.1 | 0.6 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 1.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.1 | 0.6 | GO:0050544 | arachidonic acid binding(GO:0050544) |
0.1 | 0.3 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.1 | 0.3 | GO:0030519 | snoRNP binding(GO:0030519) |
0.1 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 0.3 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
0.1 | 1.1 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.1 | 0.4 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 0.3 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 0.3 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.1 | 0.3 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.1 | 1.0 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.1 | 0.8 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.1 | 0.3 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.3 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.1 | 0.9 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.1 | 0.3 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.1 | 0.4 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 0.3 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.1 | 0.7 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.1 | 0.4 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.1 | 0.2 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.1 | 0.9 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 0.2 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.1 | 0.6 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.1 | 0.3 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.1 | 0.2 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 0.4 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.9 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.1 | 1.2 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.1 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.1 | 0.2 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.1 | 0.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.2 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.1 | 0.3 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.1 | 0.4 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 0.3 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.1 | 0.2 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.1 | 0.5 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.1 | 0.3 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 0.3 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.1 | 1.1 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.1 | 0.4 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.2 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.1 | 1.1 | GO:0016917 | GABA receptor activity(GO:0016917) |
0.1 | 0.3 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 0.5 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.1 | 0.8 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.1 | 2.3 | GO:0017022 | myosin binding(GO:0017022) |
0.1 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
0.1 | 0.5 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.1 | 0.2 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 0.3 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.6 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.2 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.1 | 0.5 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.1 | 0.3 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.1 | 0.2 | GO:0044548 | S100 protein binding(GO:0044548) |
0.1 | 0.2 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.1 | 0.4 | GO:0031402 | sodium ion binding(GO:0031402) |
0.1 | 0.6 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.1 | 0.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 0.2 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.1 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.1 | 0.3 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.1 | 0.3 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.1 | 0.7 | GO:0030955 | potassium ion binding(GO:0030955) |
0.1 | 0.8 | GO:0048038 | quinone binding(GO:0048038) |
0.1 | 0.1 | GO:0043786 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.1 | 0.5 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.4 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.1 | 0.2 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.1 | 0.2 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.1 | 0.7 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 1.2 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.2 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.1 | 0.3 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 0.4 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.1 | 0.5 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.1 | 0.3 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.1 | 1.3 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.1 | 0.7 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
0.1 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.1 | 0.2 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.1 | 0.4 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.1 | 5.8 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.1 | 0.3 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.2 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.1 | 0.6 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.1 | 0.2 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
0.1 | 0.2 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 0.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.1 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.1 | 0.3 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.1 | 0.4 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
0.1 | 0.3 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 0.7 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.1 | 0.7 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.1 | 0.2 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.1 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.1 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.1 | 0.2 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.1 | 1.0 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.1 | 0.4 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.1 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.1 | 0.5 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.1 | 0.2 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.1 | 0.5 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.1 | GO:0005119 | smoothened binding(GO:0005119) |
0.1 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 0.2 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.5 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.1 | 0.2 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.1 | 1.3 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.1 | 0.3 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.1 | 0.1 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.0 | 0.1 | GO:0048019 | receptor antagonist activity(GO:0048019) |
0.0 | 0.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.0 | 0.9 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.8 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.2 | GO:0034841 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.7 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.3 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.0 | 1.5 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.0 | 1.3 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.0 | 0.1 | GO:0070990 | snRNP binding(GO:0070990) |
0.0 | 0.2 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.0 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.0 | 0.3 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.0 | 0.6 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.8 | GO:0052890 | oxidoreductase activity, acting on the CH-CH group of donors, with a flavin as acceptor(GO:0052890) |
0.0 | 0.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.3 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.3 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
0.0 | 0.4 | GO:0022829 | wide pore channel activity(GO:0022829) |
0.0 | 0.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.0 | 0.2 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.0 | 0.2 | GO:0038132 | neuregulin binding(GO:0038132) |
0.0 | 0.3 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.0 | 0.3 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.4 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 1.2 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.2 | GO:0004954 | prostanoid receptor activity(GO:0004954) |
0.0 | 0.1 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.0 | 0.7 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.2 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.0 | 0.6 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
0.0 | 0.3 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 1.0 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.0 | 0.3 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.3 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.0 | 0.6 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.3 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.0 | 1.1 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 1.3 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.5 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.4 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.4 | GO:0032813 | tumor necrosis factor receptor superfamily binding(GO:0032813) |
0.0 | 0.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.7 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.8 | GO:0005537 | mannose binding(GO:0005537) |
0.0 | 0.1 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.0 | 0.6 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.0 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.1 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.0 | 0.2 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 1.1 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.2 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.0 | 1.7 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.8 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.0 | 0.6 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.9 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.2 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.0 | 0.8 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.2 | GO:1990459 | transferrin receptor binding(GO:1990459) |
0.0 | 0.2 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 0.7 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.0 | 0.0 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.1 | GO:0004953 | icosanoid receptor activity(GO:0004953) |
0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.0 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.6 | GO:0050661 | NADP binding(GO:0050661) |
0.0 | 0.2 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.3 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.0 | 0.2 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.0 | 0.1 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.1 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.0 | 0.3 | GO:0034979 | NAD-dependent protein deacetylase activity(GO:0034979) |
0.0 | 0.1 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.0 | 0.9 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.4 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.0 | 1.2 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.1 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.1 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.0 | 0.2 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.4 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.0 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.0 | 0.3 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.0 | 0.1 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.0 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.0 | 0.4 | GO:0016918 | retinal binding(GO:0016918) |
0.0 | 0.1 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.1 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
0.0 | 0.2 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.0 | 0.5 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.1 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.0 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.1 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 1.8 | GO:0019955 | cytokine binding(GO:0019955) |
0.0 | 0.2 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.2 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.0 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.0 | 0.1 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.0 | 2.8 | GO:0003774 | motor activity(GO:0003774) |
0.0 | 0.1 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
0.0 | 0.2 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.1 | GO:0031014 | troponin T binding(GO:0031014) |
0.0 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.0 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.0 | 0.4 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.2 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.9 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.0 | GO:0071814 | lipoprotein particle binding(GO:0071813) protein-lipid complex binding(GO:0071814) |
0.0 | 0.9 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 1.2 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 1.1 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.1 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.0 | 0.5 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.2 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.0 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 2.1 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.5 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
0.0 | 0.0 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.0 | 0.0 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.4 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.0 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.5 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.0 | 0.9 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 0.2 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.0 | 0.8 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.0 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.4 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.2 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.0 | 0.3 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.3 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.1 | GO:0102344 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.0 | 0.1 | GO:0015278 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
0.0 | 0.3 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.1 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.1 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
0.0 | 0.3 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.2 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.1 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.0 | GO:0048185 | activin binding(GO:0048185) |
0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.6 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.0 | 0.0 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.2 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.7 | GO:0070330 | aromatase activity(GO:0070330) |
0.0 | 0.1 | GO:0047074 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 0.1 | GO:0046625 | sphingolipid binding(GO:0046625) |
0.0 | 0.0 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.0 | 0.1 | GO:0035671 | enone reductase activity(GO:0035671) |
0.0 | 0.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.0 | GO:0034593 | phosphatidylinositol bisphosphate phosphatase activity(GO:0034593) |
0.0 | 0.3 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.0 | 0.4 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.6 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.7 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.3 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.2 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.0 | 0.1 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.0 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.1 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.0 | 0.5 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.3 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 1.0 | GO:0018723 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) heparan sulfate 2-O-sulfotransferase activity(GO:0004394) HNK-1 sulfotransferase activity(GO:0016232) heparan sulfate 6-O-sulfotransferase activity(GO:0017095) trans-9R,10R-dihydrodiolphenanthrene sulfotransferase activity(GO:0018721) 1-phenanthrol sulfotransferase activity(GO:0018722) 3-phenanthrol sulfotransferase activity(GO:0018723) 4-phenanthrol sulfotransferase activity(GO:0018724) trans-3,4-dihydrodiolphenanthrene sulfotransferase activity(GO:0018725) 9-phenanthrol sulfotransferase activity(GO:0018726) 2-phenanthrol sulfotransferase activity(GO:0018727) phenanthrol sulfotransferase activity(GO:0019111) 1-hydroxypyrene sulfotransferase activity(GO:0034930) proteoglycan sulfotransferase activity(GO:0050698) cholesterol sulfotransferase activity(GO:0051922) hydroxyjasmonate sulfotransferase activity(GO:0080131) |
0.0 | 0.6 | GO:0005507 | copper ion binding(GO:0005507) |
0.0 | 0.4 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.6 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.0 | 0.0 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 0.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.0 | 0.4 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.0 | 0.3 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.3 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.2 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.0 | 0.2 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.7 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
0.0 | 0.0 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.2 | GO:0071949 | FAD binding(GO:0071949) |
0.0 | 0.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.1 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.0 | 0.0 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.7 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 0.2 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.2 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 0.8 | GO:0017124 | SH3 domain binding(GO:0017124) |
0.0 | 0.1 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.0 | 0.2 | GO:0051183 | vitamin transporter activity(GO:0051183) |
0.0 | 0.1 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.1 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.0 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.0 | 0.0 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 7.4 | GO:0005509 | calcium ion binding(GO:0005509) |
0.0 | 0.0 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.0 | 0.1 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.0 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.0 | 0.7 | GO:0044824 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.0 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.3 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 0.1 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.2 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.4 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.1 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 0.1 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.0 | 0.2 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 0.1 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 0.2 | GO:0072349 | modified amino acid transmembrane transporter activity(GO:0072349) |
0.0 | 0.4 | GO:0016675 | oxidoreductase activity, acting on a heme group of donors(GO:0016675) |
0.0 | 0.1 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.0 | 3.3 | GO:0003779 | actin binding(GO:0003779) |
0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 0.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 1.2 | GO:0005516 | calmodulin binding(GO:0005516) |
0.0 | 0.4 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.0 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.0 | 0.5 | GO:0016620 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, NAD or NADP as acceptor(GO:0016620) |
0.0 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 1.3 | GO:0050839 | cell adhesion molecule binding(GO:0050839) |
0.0 | 0.0 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.0 | 0.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.0 | 0.0 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 0.0 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.0 | 0.1 | GO:0010181 | FMN binding(GO:0010181) |
0.0 | 0.0 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.0 | 0.3 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.0 | 0.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.3 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.1 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) |
0.0 | 0.0 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.2 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.0 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.1 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 2.8 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.0 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.0 | 0.6 | GO:0001948 | glycoprotein binding(GO:0001948) |
0.0 | 0.1 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.0 | 0.0 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.0 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.1 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.0 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.0 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 1.4 | GO:0003924 | GTPase activity(GO:0003924) |
0.0 | 0.0 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.0 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.0 | 0.0 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.2 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.0 | 0.0 | GO:0034889 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.0 | 0.0 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.0 | 0.0 | GO:0032356 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.0 | 0.0 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.0 | 0.1 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.0 | GO:0050543 | icosatetraenoic acid binding(GO:0050543) |
0.0 | 0.2 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) |
0.0 | 0.2 | GO:0070063 | RNA polymerase binding(GO:0070063) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 4.0 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.2 | 2.4 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 0.6 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.1 | 2.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 1.8 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 3.5 | PID RAS PATHWAY | Regulation of Ras family activation |
0.1 | 1.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 4.9 | PID FGF PATHWAY | FGF signaling pathway |
0.1 | 3.4 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.1 | 4.1 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 1.0 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.1 | 2.6 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.1 | 2.4 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 3.0 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.1 | 1.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.1 | 1.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 2.9 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.1 | 1.3 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 1.1 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.1 | 1.5 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.1 | 0.8 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.1 | 0.8 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.1 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.1 | 0.8 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 1.8 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.1 | 0.8 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 0.1 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.1 | 0.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 0.1 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.1 | 0.4 | PID IGF1 PATHWAY | IGF1 pathway |
0.1 | 1.0 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.1 | 0.8 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.1 | 0.3 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.1 | 0.8 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.1 | 0.3 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.1 | 0.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.1 | 0.9 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 0.8 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.1 | 0.1 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.3 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.6 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.6 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 2.3 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.2 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 2.4 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.2 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.6 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.5 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.2 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.3 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.0 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 1.0 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 1.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.3 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 1.0 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 5.2 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.5 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.4 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 0.7 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.4 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.4 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.6 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.3 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.2 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.2 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.0 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.5 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.0 | 0.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.2 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 2.8 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.6 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.0 | 0.2 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.8 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.3 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.3 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.0 | 0.3 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.0 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.1 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.3 | NABA CORE MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
0.0 | 0.2 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.2 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.4 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.0 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.5 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.1 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.3 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.0 | 2.4 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.3 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.4 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.5 | 0.5 | REACTOME NEUROTRANSMITTER RECEPTOR BINDING AND DOWNSTREAM TRANSMISSION IN THE POSTSYNAPTIC CELL | Genes involved in Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell |
0.3 | 0.3 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.3 | 3.5 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.3 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.2 | 0.2 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.2 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.2 | 1.8 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.2 | 2.4 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.2 | 2.1 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.2 | 2.4 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.2 | 2.5 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.2 | 0.2 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.2 | 0.6 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
0.2 | 1.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 1.2 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.1 | 3.2 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.1 | 1.3 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 3.6 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 1.2 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.1 | 1.0 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.1 | 2.9 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.1 | 1.0 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.1 | 1.7 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 1.9 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.1 | 1.0 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 1.0 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.1 | 2.7 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.1 | 1.8 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 3.8 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.1 | 1.7 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.1 | 0.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 2.9 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 1.1 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.1 | 0.2 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.1 | 0.9 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 1.0 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.1 | 1.2 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.1 | 1.0 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 0.3 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.1 | 1.2 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.1 | 0.9 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 3.6 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 1.3 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 0.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 0.8 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 0.6 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.1 | 0.4 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 0.7 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.1 | 0.4 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 1.0 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.1 | 0.8 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.1 | 1.1 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.1 | 0.5 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 0.5 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.1 | 0.9 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 0.1 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
0.1 | 0.4 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.1 | 0.6 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 0.2 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 0.2 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
0.1 | 2.8 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.1 | 1.1 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 1.9 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.1 | 0.7 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.1 | 0.5 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.1 | 1.0 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.1 | 0.1 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.1 | 1.1 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 0.4 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.1 | 0.1 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.1 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
0.1 | 0.7 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 1.0 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.0 | 1.1 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.8 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.5 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.0 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.0 | 0.6 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 1.9 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.1 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.2 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.3 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.0 | 0.6 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.6 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.0 | 0.8 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 1.1 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 1.0 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.0 | 0.4 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.2 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 0.6 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.3 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.5 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
0.0 | 0.8 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.0 | 0.8 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.6 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.5 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
0.0 | 0.1 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.0 | 0.3 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.0 | 0.7 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
0.0 | 0.1 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.0 | 0.8 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
0.0 | 0.2 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.0 | 0.4 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.0 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.0 | 0.1 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.0 | 0.3 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 1.1 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.3 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.0 | 0.4 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.3 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.2 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.3 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 0.7 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.1 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.0 | 1.0 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.2 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.3 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.0 | 0.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.1 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 0.3 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 0.4 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.1 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 0.1 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.0 | 1.3 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.3 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.4 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.2 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.0 | 0.2 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.0 | 3.0 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.0 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.0 | 0.9 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 0.4 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 0.1 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.0 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 1.4 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.0 | 0.1 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.0 | 0.0 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.0 | 0.1 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.0 | 0.8 | REACTOME AUTODEGRADATION OF CDH1 BY CDH1 APC C | Genes involved in Autodegradation of Cdh1 by Cdh1:APC/C |
0.0 | 0.2 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.0 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.0 | 0.3 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.0 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.0 | 0.3 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.2 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
0.0 | 0.1 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |