Gene Symbol | Gene ID | Gene Info |
---|---|---|
Hmx2
|
ENSMUSG00000050100.7 | Hmx2 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Hmx2 | chr7_131552378_131552914 | 1415 | 0.320388 | 0.42 | 7.2e-04 | Click! |
Hmx2 | chr7_131553617_131555069 | 282 | 0.868206 | 0.36 | 4.3e-03 | Click! |
Hmx2 | chr7_131546290_131546782 | 2237 | 0.208803 | 0.30 | 2.2e-02 | Click! |
Hmx2 | chr7_131551867_131552018 | 2119 | 0.225931 | 0.26 | 4.1e-02 | Click! |
Hmx2 | chr7_131545970_131546282 | 2647 | 0.183918 | 0.24 | 7.0e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr10_29143400_29144848 | 5.94 |
Soga3 |
SOGA family member 3 |
65 |
0.5 |
chr13_83740463_83741042 | 5.60 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
1889 |
0.2 |
chr8_94995272_94995731 | 5.08 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
160 |
0.93 |
chrX_49272929_49273965 | 4.68 |
Enox2 |
ecto-NOX disulfide-thiol exchanger 2 |
14765 |
0.24 |
chr12_118852808_118853969 | 4.36 |
Sp8 |
trans-acting transcription factor 8 |
5802 |
0.24 |
chr15_25415436_25415919 | 3.97 |
Gm48957 |
predicted gene, 48957 |
614 |
0.58 |
chr1_42691569_42692627 | 3.71 |
Pantr1 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 1 |
995 |
0.42 |
chr8_109248831_109249717 | 3.69 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
592 |
0.83 |
chr13_83735558_83735982 | 3.68 |
Gm33366 |
predicted gene, 33366 |
2765 |
0.16 |
chr9_108824114_108825614 | 3.67 |
Gm35025 |
predicted gene, 35025 |
3 |
0.87 |
chr2_6881874_6882908 | 3.51 |
Gm13389 |
predicted gene 13389 |
1879 |
0.3 |
chr2_18042311_18043883 | 3.36 |
Skida1 |
SKI/DACH domain containing 1 |
1475 |
0.25 |
chr1_78186833_78187893 | 3.30 |
Pax3 |
paired box 3 |
9475 |
0.23 |
chr2_65566848_65567533 | 3.27 |
Scn3a |
sodium channel, voltage-gated, type III, alpha |
302 |
0.92 |
chr16_77420100_77420782 | 3.24 |
9430053O09Rik |
RIKEN cDNA 9430053O09 gene |
1379 |
0.28 |
chr2_65620767_65621991 | 3.23 |
Scn2a |
sodium channel, voltage-gated, type II, alpha |
568 |
0.82 |
chrX_75577044_75577513 | 3.19 |
Rab39b |
RAB39B, member RAS oncogene family |
953 |
0.4 |
chr2_116056837_116059755 | 3.12 |
Meis2 |
Meis homeobox 2 |
546 |
0.75 |
chr10_92160735_92161461 | 3.10 |
Rmst |
rhabdomyosarcoma 2 associated transcript (non-coding RNA) |
1663 |
0.4 |
chr18_84082718_84083733 | 3.09 |
Tshz1 |
teashirt zinc finger family member 1 |
1850 |
0.29 |
chr10_92161472_92161916 | 3.09 |
Rmst |
rhabdomyosarcoma 2 associated transcript (non-coding RNA) |
1067 |
0.55 |
chr4_110285468_110287125 | 3.03 |
Elavl4 |
ELAV like RNA binding protein 4 |
320 |
0.94 |
chr9_4794566_4795419 | 2.99 |
Gria4 |
glutamate receptor, ionotropic, AMPA4 (alpha 4) |
527 |
0.88 |
chr9_91404809_91406365 | 2.98 |
Gm29478 |
predicted gene 29478 |
1113 |
0.42 |
chr4_91380440_91381612 | 2.97 |
Elavl2 |
ELAV like RNA binding protein 1 |
4530 |
0.22 |
chr9_91366433_91367646 | 2.95 |
Zic1 |
zinc finger protein of the cerebellum 1 |
1229 |
0.26 |
chr13_15466077_15468087 | 2.95 |
Gli3 |
GLI-Kruppel family member GLI3 |
3102 |
0.22 |
chr3_31097203_31098928 | 2.92 |
Skil |
SKI-like |
1232 |
0.48 |
chr2_65847409_65848267 | 2.92 |
Csrnp3 |
cysteine-serine-rich nuclear protein 3 |
1983 |
0.36 |
chr1_12988619_12989682 | 2.86 |
Slco5a1 |
solute carrier organic anion transporter family, member 5A1 |
1764 |
0.4 |
chr3_88208985_88210116 | 2.81 |
Gm3764 |
predicted gene 3764 |
78 |
0.92 |
chr8_41054160_41054452 | 2.74 |
Mtus1 |
mitochondrial tumor suppressor 1 |
477 |
0.69 |
chr10_80298461_80300404 | 2.71 |
Apc2 |
APC regulator of WNT signaling pathway 2 |
341 |
0.69 |
chr12_49387532_49388566 | 2.68 |
3110039M20Rik |
RIKEN cDNA 3110039M20 gene |
1603 |
0.26 |
chr2_181767278_181768191 | 2.63 |
Myt1 |
myelin transcription factor 1 |
222 |
0.91 |
chr14_122480308_122481080 | 2.62 |
Zic2 |
zinc finger protein of the cerebellum 2 |
2594 |
0.16 |
chr18_80984086_80984990 | 2.59 |
Sall3 |
spalt like transcription factor 3 |
1998 |
0.23 |
chr4_109342938_109343450 | 2.59 |
Eps15 |
epidermal growth factor receptor pathway substrate 15 |
59 |
0.97 |
chr13_84063384_84064052 | 2.59 |
Gm17750 |
predicted gene, 17750 |
1054 |
0.58 |
chr1_50925047_50926055 | 2.56 |
Tmeff2 |
transmembrane protein with EGF-like and two follistatin-like domains 2 |
1968 |
0.38 |
chr4_54950838_54951442 | 2.53 |
Zfp462 |
zinc finger protein 462 |
3164 |
0.35 |
chr9_91363064_91363717 | 2.50 |
Zic1 |
zinc finger protein of the cerebellum 1 |
336 |
0.72 |
chr2_45158033_45158832 | 2.46 |
Gm28643 |
predicted gene 28643 |
1507 |
0.46 |
chr19_41741896_41742047 | 2.45 |
Slit1 |
slit guidance ligand 1 |
1515 |
0.43 |
chr6_54565340_54565491 | 2.45 |
Scrn1 |
secernin 1 |
1074 |
0.49 |
chr15_75634671_75635033 | 2.44 |
Gm46519 |
predicted gene, 46519 |
1058 |
0.36 |
chr6_8955848_8957226 | 2.42 |
Nxph1 |
neurexophilin 1 |
6861 |
0.32 |
chr1_19213854_19215338 | 2.41 |
Tfap2b |
transcription factor AP-2 beta |
717 |
0.69 |
chr1_177449667_177450314 | 2.40 |
Zbtb18 |
zinc finger and BTB domain containing 18 |
4169 |
0.18 |
chr7_137306984_137307575 | 2.39 |
Ebf3 |
early B cell factor 3 |
6637 |
0.2 |
chr1_168426195_168428871 | 2.38 |
Pbx1 |
pre B cell leukemia homeobox 1 |
3971 |
0.3 |
chr17_78508180_78509392 | 2.32 |
Vit |
vitrin |
614 |
0.7 |
chr15_25753053_25753722 | 2.26 |
Myo10 |
myosin X |
408 |
0.88 |
chr2_6874299_6875742 | 2.25 |
Celf2 |
CUGBP, Elav-like family member 2 |
2423 |
0.29 |
chr10_57784547_57786586 | 2.24 |
Fabp7 |
fatty acid binding protein 7, brain |
643 |
0.68 |
chr1_158364281_158364968 | 2.23 |
Astn1 |
astrotactin 1 |
2074 |
0.31 |
chr8_54957303_54957776 | 2.23 |
Gm45263 |
predicted gene 45263 |
2280 |
0.24 |
chr13_78196283_78196791 | 2.20 |
Nr2f1 |
nuclear receptor subfamily 2, group F, member 1 |
164 |
0.91 |
chr14_93883900_93884713 | 2.19 |
Pcdh9 |
protocadherin 9 |
1442 |
0.55 |
chr14_122468327_122469715 | 2.19 |
Zic5 |
zinc finger protein of the cerebellum 5 |
3344 |
0.14 |
chr2_52038470_52039720 | 2.19 |
Tnfaip6 |
tumor necrosis factor alpha induced protein 6 |
1086 |
0.54 |
chr10_23345710_23346907 | 2.18 |
Eya4 |
EYA transcriptional coactivator and phosphatase 4 |
3579 |
0.36 |
chr6_23382210_23383537 | 2.17 |
Cadps2 |
Ca2+-dependent activator protein for secretion 2 |
26954 |
0.22 |
chr12_46817370_46817521 | 2.16 |
Nova1 |
NOVA alternative splicing regulator 1 |
485 |
0.82 |
chr7_78885666_78887958 | 2.16 |
Mir7-2 |
microRNA 7-2 |
1465 |
0.28 |
chr16_77418973_77419718 | 2.13 |
9430053O09Rik |
RIKEN cDNA 9430053O09 gene |
2475 |
0.17 |
chr4_97584366_97584872 | 2.13 |
E130114P18Rik |
RIKEN cDNA E130114P18 gene |
1 |
0.98 |
chr10_24834926_24836693 | 2.12 |
Enpp3 |
ectonucleotide pyrophosphatase/phosphodiesterase 3 |
304 |
0.9 |
chr14_122484799_122486138 | 2.09 |
Gm10837 |
predicted gene 10837 |
5118 |
0.12 |
chr8_33747278_33748028 | 2.08 |
Smim18 |
small integral membrane protein 18 |
117 |
0.95 |
chr3_67892808_67893503 | 2.08 |
Iqschfp |
Iqcj and Schip1 fusion protein |
923 |
0.42 |
chr5_88583963_88584847 | 2.08 |
Rufy3 |
RUN and FYVE domain containing 3 |
611 |
0.7 |
chr10_90830503_90831025 | 2.07 |
Anks1b |
ankyrin repeat and sterile alpha motif domain containing 1B |
921 |
0.56 |
chrX_166348094_166348432 | 2.06 |
Gpm6b |
glycoprotein m6b |
3421 |
0.29 |
chr11_77485097_77486316 | 2.05 |
Ankrd13b |
ankyrin repeat domain 13b |
3960 |
0.14 |
chr2_18044333_18044941 | 2.03 |
Skida1 |
SKI/DACH domain containing 1 |
65 |
0.95 |
chr13_78178635_78180138 | 2.02 |
Gm38604 |
predicted gene, 38604 |
3773 |
0.16 |
chr4_22484307_22484937 | 2.02 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
3744 |
0.2 |
chr10_34299043_34301066 | 2.00 |
Tspyl4 |
TSPY-like 4 |
798 |
0.4 |
chr5_5664640_5664930 | 1.99 |
Cfap69 |
cilia and flagella associated protein 69 |
546 |
0.74 |
chr10_34316245_34317506 | 1.96 |
Nt5dc1 |
5'-nucleotidase domain containing 1 |
3192 |
0.16 |
chr3_80803066_80803253 | 1.94 |
Gria2 |
glutamate receptor, ionotropic, AMPA2 (alpha 2) |
324 |
0.92 |
chr1_6733530_6734383 | 1.88 |
St18 |
suppression of tumorigenicity 18 |
914 |
0.7 |
chr13_83736071_83736534 | 1.88 |
Gm33366 |
predicted gene, 33366 |
2233 |
0.18 |
chr1_89071813_89072578 | 1.85 |
Sh3bp4 |
SH3-domain binding protein 4 |
1742 |
0.35 |
chr8_109249737_109249899 | 1.84 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
48 |
0.99 |
chr3_156559836_156560180 | 1.84 |
4930570G19Rik |
RIKEN cDNA 4930570G19 gene |
1574 |
0.35 |
chr4_126465012_126466992 | 1.83 |
Ago1 |
argonaute RISC catalytic subunit 1 |
2419 |
0.18 |
chr3_4796861_4798079 | 1.83 |
1110015O18Rik |
RIKEN cDNA 1110015O18 gene |
88 |
0.98 |
chr3_66746318_66747483 | 1.83 |
Gm6555 |
predicted gene 6555 |
135450 |
0.05 |
chrX_95163813_95164963 | 1.82 |
Arhgef9 |
CDC42 guanine nucleotide exchange factor (GEF) 9 |
1437 |
0.48 |
chr13_81631617_81632017 | 1.82 |
Adgrv1 |
adhesion G protein-coupled receptor V1 |
1322 |
0.45 |
chr13_97248475_97250229 | 1.81 |
Enc1 |
ectodermal-neural cortex 1 |
8247 |
0.17 |
chrX_58035695_58035913 | 1.80 |
Zic3 |
zinc finger protein of the cerebellum 3 |
4794 |
0.29 |
chr4_150284018_150284403 | 1.80 |
Rere |
arginine glutamic acid dipeptide (RE) repeats |
2398 |
0.24 |
chrX_133682515_133683917 | 1.78 |
Pcdh19 |
protocadherin 19 |
1775 |
0.49 |
chr13_83715222_83716973 | 1.78 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
5284 |
0.15 |
chrX_166346941_166347276 | 1.78 |
Gpm6b |
glycoprotein m6b |
2266 |
0.36 |
chr1_78193153_78194695 | 1.78 |
Pax3 |
paired box 3 |
2914 |
0.3 |
chr2_83814030_83814462 | 1.77 |
Fam171b |
family with sequence similarity 171, member B |
1610 |
0.34 |
chr8_108536302_108537095 | 1.77 |
Gm39244 |
predicted gene, 39244 |
249 |
0.95 |
chr2_38826084_38826547 | 1.77 |
Nr6a1os |
nuclear receptor subfamily 6, group A, member 1, opposite strand |
2974 |
0.15 |
chr9_91372507_91373295 | 1.76 |
Zic4 |
zinc finger protein of the cerebellum 4 |
1551 |
0.25 |
chr13_83719687_83720586 | 1.76 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
1245 |
0.36 |
chr6_122765812_122766405 | 1.75 |
Slc2a3 |
solute carrier family 2 (facilitated glucose transporter), member 3 |
13849 |
0.11 |
chr7_63445472_63445728 | 1.74 |
Otud7a |
OTU domain containing 7A |
823 |
0.5 |
chr4_22835212_22836357 | 1.72 |
Gm24078 |
predicted gene, 24078 |
88653 |
0.09 |
chr6_16994941_16995163 | 1.72 |
Gm5721 |
predicted gene 5721 |
69821 |
0.09 |
chr2_48424016_48424809 | 1.71 |
Gm13481 |
predicted gene 13481 |
32833 |
0.17 |
chr1_155414821_155416000 | 1.70 |
Xpr1 |
xenotropic and polytropic retrovirus receptor 1 |
1919 |
0.42 |
chr4_82915737_82916950 | 1.69 |
Frem1 |
Fras1 related extracellular matrix protein 1 |
1909 |
0.38 |
chr13_78177509_78178575 | 1.68 |
Gm38604 |
predicted gene, 38604 |
5117 |
0.14 |
chr16_75446825_75447522 | 1.68 |
Gm49678 |
predicted gene, 49678 |
120 |
0.98 |
chr4_72382466_72383150 | 1.68 |
Gm11235 |
predicted gene 11235 |
159858 |
0.04 |
chr15_102965066_102967702 | 1.67 |
Hoxc10 |
homeobox C10 |
412 |
0.6 |
chr2_159002562_159003405 | 1.67 |
Gm44319 |
predicted gene, 44319 |
66880 |
0.12 |
chr14_60382521_60383103 | 1.65 |
Amer2 |
APC membrane recruitment 2 |
4526 |
0.25 |
chr9_91360032_91360505 | 1.65 |
Zic4 |
zinc finger protein of the cerebellum 4 |
2145 |
0.17 |
chr9_35423074_35423780 | 1.65 |
Cdon |
cell adhesion molecule-related/down-regulated by oncogenes |
161 |
0.95 |
chr9_43746633_43747189 | 1.64 |
Gm30015 |
predicted gene, 30015 |
811 |
0.54 |
chr5_98182267_98183697 | 1.63 |
Prdm8 |
PR domain containing 8 |
2004 |
0.26 |
chr2_22624675_22625045 | 1.61 |
Gad2 |
glutamic acid decarboxylase 2 |
1556 |
0.29 |
chr1_109984209_109985108 | 1.60 |
Cdh7 |
cadherin 7, type 2 |
921 |
0.74 |
chr9_75681964_75682559 | 1.60 |
Scg3 |
secretogranin III |
1326 |
0.37 |
chr3_68573207_68574269 | 1.59 |
Schip1 |
schwannomin interacting protein 1 |
1493 |
0.45 |
chr14_98171778_98173085 | 1.59 |
Dach1 |
dachshund family transcription factor 1 |
2666 |
0.35 |
chr6_53880545_53881917 | 1.59 |
Gm22910 |
predicted gene, 22910 |
9083 |
0.21 |
chr10_109008310_109009456 | 1.59 |
Syt1 |
synaptotagmin I |
217 |
0.96 |
chr13_44841435_44841934 | 1.59 |
Jarid2 |
jumonji, AT rich interactive domain 2 |
901 |
0.61 |
chr12_118842631_118843755 | 1.57 |
Sp8 |
trans-acting transcription factor 8 |
3136 |
0.28 |
chr10_111247804_111248910 | 1.57 |
Osbpl8 |
oxysterol binding protein-like 8 |
289 |
0.91 |
chrX_60146958_60147936 | 1.56 |
Mcf2 |
mcf.2 transforming sequence |
196 |
0.96 |
chr2_34368351_34369364 | 1.54 |
Pbx3 |
pre B cell leukemia homeobox 3 |
1989 |
0.33 |
chr10_69705909_69707430 | 1.54 |
Ank3 |
ankyrin 3, epithelial |
191 |
0.97 |
chr16_42337545_42337696 | 1.53 |
Gap43 |
growth associated protein 43 |
3031 |
0.33 |
chr11_80622213_80623518 | 1.52 |
C030013C21Rik |
RIKEN cDNA C030013C21 gene |
113759 |
0.05 |
chr2_57613916_57615034 | 1.52 |
Gm13532 |
predicted gene 13532 |
14753 |
0.2 |
chr17_90088736_90088977 | 1.52 |
Nrxn1 |
neurexin I |
456 |
0.9 |
chr8_47283638_47284158 | 1.52 |
Stox2 |
storkhead box 2 |
5464 |
0.26 |
chr10_69707438_69707835 | 1.51 |
Ank3 |
ankyrin 3, epithelial |
1158 |
0.65 |
chr2_168763687_168764691 | 1.51 |
Sall4 |
spalt like transcription factor 4 |
1057 |
0.46 |
chrX_38596072_38596657 | 1.51 |
Mcts1 |
malignant T cell amplified sequence 1 |
4214 |
0.21 |
chr8_108716860_108718878 | 1.50 |
Zfhx3 |
zinc finger homeobox 3 |
3225 |
0.3 |
chr4_134017045_134017463 | 1.50 |
Gm13061 |
predicted gene 13061 |
893 |
0.36 |
chr9_110053895_110054422 | 1.50 |
Map4 |
microtubule-associated protein 4 |
2106 |
0.22 |
chr19_38348426_38349048 | 1.50 |
Gm50150 |
predicted gene, 50150 |
6123 |
0.16 |
chr11_63889023_63889728 | 1.50 |
Hs3st3b1 |
heparan sulfate (glucosamine) 3-O-sulfotransferase 3B1 |
32915 |
0.16 |
chr14_60533746_60534006 | 1.49 |
Gm29266 |
predicted gene 29266 |
48668 |
0.13 |
chr2_146833594_146834056 | 1.48 |
Gm14114 |
predicted gene 14114 |
5907 |
0.24 |
chr7_94042433_94043470 | 1.48 |
Gm32647 |
predicted gene, 32647 |
199 |
0.97 |
chr4_15880938_15882113 | 1.48 |
Calb1 |
calbindin 1 |
259 |
0.9 |
chr6_15196934_15197697 | 1.48 |
Foxp2 |
forkhead box P2 |
351 |
0.94 |
chr15_25026077_25026585 | 1.48 |
Gm2824 |
predicted gene 2824 |
1006 |
0.65 |
chr5_120426818_120428597 | 1.48 |
Lhx5 |
LIM homeobox protein 5 |
3992 |
0.15 |
chr3_13946382_13947629 | 1.47 |
Ralyl |
RALY RNA binding protein-like |
594 |
0.84 |
chr10_90577565_90578158 | 1.47 |
Anks1b |
ankyrin repeat and sterile alpha motif domain containing 1B |
869 |
0.72 |
chr12_52700044_52701597 | 1.47 |
Akap6 |
A kinase (PRKA) anchor protein 6 |
1437 |
0.46 |
chr18_60065050_60065533 | 1.47 |
Gm23576 |
predicted gene, 23576 |
109026 |
0.06 |
chr19_53460190_53461095 | 1.47 |
4833407H14Rik |
RIKEN cDNA 4833407H14 gene |
20 |
0.97 |
chr2_136711813_136712965 | 1.46 |
Snap25 |
synaptosomal-associated protein 25 |
1064 |
0.55 |
chr2_38697401_38697970 | 1.46 |
Nr5a1 |
nuclear receptor subfamily 5, group A, member 1 |
13503 |
0.11 |
chr11_50028927_50029438 | 1.46 |
Rnf130 |
ring finger protein 130 |
3834 |
0.21 |
chr1_128589259_128590263 | 1.46 |
Cxcr4 |
chemokine (C-X-C motif) receptor 4 |
2529 |
0.3 |
chr14_98164357_98165375 | 1.46 |
Dach1 |
dachshund family transcription factor 1 |
4677 |
0.28 |
chr18_25751839_25752425 | 1.46 |
Celf4 |
CUGBP, Elav-like family member 4 |
560 |
0.81 |
chr13_83732205_83734272 | 1.46 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
672 |
0.58 |
chr2_136062179_136062393 | 1.46 |
Lamp5 |
lysosomal-associated membrane protein family, member 5 |
2855 |
0.3 |
chr16_77598670_77599917 | 1.46 |
Mir99a |
microRNA 99a |
357 |
0.44 |
chr3_5222045_5223052 | 1.45 |
Zfhx4 |
zinc finger homeodomain 4 |
1043 |
0.46 |
chr13_40727690_40728914 | 1.45 |
Gm26688 |
predicted gene, 26688 |
494 |
0.48 |
chr5_131532921_131534054 | 1.45 |
Auts2 |
autism susceptibility candidate 2 |
910 |
0.58 |
chr16_81202167_81203211 | 1.45 |
Ncam2 |
neural cell adhesion molecule 2 |
1932 |
0.44 |
chr1_25830818_25831017 | 1.44 |
Gm9884 |
predicted gene 9884 |
260 |
0.82 |
chr6_13837266_13838183 | 1.44 |
Gpr85 |
G protein-coupled receptor 85 |
483 |
0.82 |
chr5_30106299_30106676 | 1.43 |
3110082J24Rik |
RIKEN cDNA 3110082J24 gene |
401 |
0.71 |
chr2_66177971_66179189 | 1.43 |
Gm13618 |
predicted gene 13618 |
9256 |
0.18 |
chr2_51087513_51088026 | 1.42 |
Rnd3 |
Rho family GTPase 3 |
61325 |
0.13 |
chr10_19354370_19355680 | 1.41 |
Olig3 |
oligodendrocyte transcription factor 3 |
1508 |
0.47 |
chr17_85394123_85395241 | 1.41 |
Rpl31-ps16 |
ribosomal protein L31, pseudogene 16 |
103951 |
0.07 |
chr14_108909489_108909909 | 1.41 |
Slitrk1 |
SLIT and NTRK-like family, member 1 |
4459 |
0.37 |
chr9_35424475_35426234 | 1.41 |
Cdon |
cell adhesion molecule-related/down-regulated by oncogenes |
1766 |
0.31 |
chr3_34659833_34662467 | 1.41 |
Gm42693 |
predicted gene 42693 |
3139 |
0.15 |
chr19_60015391_60016209 | 1.41 |
Csf1r-ps |
colony stimulating factor 1 receptor (granulocyte), pseudogene |
63632 |
0.1 |
chr11_112784278_112785462 | 1.40 |
Sox9 |
SRY (sex determining region Y)-box 9 |
2646 |
0.24 |
chrX_166344665_166345995 | 1.40 |
Gpm6b |
glycoprotein m6b |
488 |
0.85 |
chr8_57836387_57837596 | 1.40 |
Galntl6 |
UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase-like 6 |
6067 |
0.24 |
chr8_107871601_107872470 | 1.40 |
5033426E14Rik |
RIKEN cDNA 5033426E14 gene |
2350 |
0.31 |
chr19_22692617_22693990 | 1.40 |
Trpm3 |
transient receptor potential cation channel, subfamily M, member 3 |
481 |
0.87 |
chr8_54723932_54725109 | 1.39 |
Wdr17 |
WD repeat domain 17 |
16 |
0.98 |
chr10_6789275_6790095 | 1.39 |
Oprm1 |
opioid receptor, mu 1 |
586 |
0.81 |
chr16_52033807_52034820 | 1.38 |
Cblb |
Casitas B-lineage lymphoma b |
2096 |
0.39 |
chr5_24524174_24525676 | 1.38 |
Gbx1 |
gastrulation brain homeobox 1 |
2277 |
0.16 |
chr19_22138603_22139842 | 1.38 |
Trpm3 |
transient receptor potential cation channel, subfamily M, member 3 |
105 |
0.98 |
chr2_33637261_33637862 | 1.37 |
Lmx1b |
LIM homeobox transcription factor 1 beta |
2919 |
0.2 |
chr11_41999400_42000640 | 1.37 |
Gabrg2 |
gamma-aminobutyric acid (GABA) A receptor, subunit gamma 2 |
336 |
0.92 |
chrX_153501207_153502250 | 1.37 |
Ubqln2 |
ubiquilin 2 |
3501 |
0.22 |
chr4_21684238_21685103 | 1.37 |
Prdm13 |
PR domain containing 13 |
1111 |
0.49 |
chr10_115520184_115521212 | 1.37 |
A930009A15Rik |
RIKEN cDNA A930009A15 gene |
49288 |
0.12 |
chr1_189342678_189343152 | 1.37 |
Kcnk2 |
potassium channel, subfamily K, member 2 |
440 |
0.52 |
chr2_129573978_129575099 | 1.37 |
Gm14041 |
predicted gene 14041 |
8470 |
0.17 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.2 | GO:0046684 | response to pyrethroid(GO:0046684) |
1.1 | 1.1 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
1.0 | 9.0 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.9 | 2.6 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.8 | 2.5 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.7 | 2.6 | GO:0060594 | mammary gland specification(GO:0060594) |
0.6 | 3.8 | GO:0072017 | distal tubule development(GO:0072017) |
0.6 | 2.5 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.5 | 1.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.5 | 2.6 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.5 | 1.0 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
0.5 | 6.1 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.5 | 2.0 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.5 | 3.9 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.5 | 2.4 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.5 | 1.8 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.4 | 0.9 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.4 | 1.3 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.4 | 1.3 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.4 | 1.7 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.4 | 0.8 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.4 | 2.4 | GO:0042297 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.4 | 2.7 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.4 | 1.1 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.4 | 1.1 | GO:0002877 | regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
0.4 | 1.1 | GO:0032100 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
0.4 | 1.5 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.4 | 1.1 | GO:0022028 | tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
0.4 | 1.1 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.4 | 2.9 | GO:0071625 | vocalization behavior(GO:0071625) |
0.4 | 1.1 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.4 | 1.8 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.4 | 1.1 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.4 | 1.8 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.3 | 1.0 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.3 | 0.3 | GO:0072194 | kidney smooth muscle tissue development(GO:0072194) |
0.3 | 1.0 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.3 | 1.3 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.3 | 0.6 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
0.3 | 1.9 | GO:0021978 | telencephalon regionalization(GO:0021978) |
0.3 | 0.3 | GO:1904861 | excitatory synapse assembly(GO:1904861) |
0.3 | 0.9 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.3 | 1.9 | GO:0002591 | positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
0.3 | 1.1 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.3 | 0.8 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.3 | 0.8 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.3 | 0.8 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.3 | 1.0 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.3 | 1.3 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.3 | 0.8 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.3 | 1.3 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.3 | 4.3 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.2 | 1.2 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.2 | 0.7 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.2 | 2.0 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.2 | 3.4 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
0.2 | 2.2 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
0.2 | 1.0 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.2 | 1.0 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.2 | 0.7 | GO:0048880 | sensory system development(GO:0048880) |
0.2 | 0.5 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.2 | 6.1 | GO:0001964 | startle response(GO:0001964) |
0.2 | 2.1 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.2 | 0.9 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.2 | 1.6 | GO:0060539 | diaphragm development(GO:0060539) |
0.2 | 2.0 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.2 | 5.2 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
0.2 | 0.2 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.2 | 0.9 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.2 | 1.1 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
0.2 | 1.0 | GO:0060023 | soft palate development(GO:0060023) |
0.2 | 1.0 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.2 | 1.2 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.2 | 0.8 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.2 | 0.2 | GO:0021888 | hypothalamus gonadotrophin-releasing hormone neuron differentiation(GO:0021886) hypothalamus gonadotrophin-releasing hormone neuron development(GO:0021888) |
0.2 | 0.2 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.2 | 0.7 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.2 | 0.6 | GO:0090427 | activation of meiosis(GO:0090427) |
0.2 | 0.6 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.2 | 0.2 | GO:0042420 | dopamine catabolic process(GO:0042420) |
0.2 | 0.6 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.2 | 0.5 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.2 | 1.1 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.2 | 0.7 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.2 | 0.2 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.2 | 0.7 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.2 | 0.4 | GO:0061341 | non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
0.2 | 0.7 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) |
0.2 | 0.5 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.2 | 1.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.2 | 2.1 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.2 | 1.3 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.2 | 0.8 | GO:0008354 | germ cell migration(GO:0008354) |
0.2 | 0.5 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.2 | 0.6 | GO:0007412 | axon target recognition(GO:0007412) |
0.2 | 0.3 | GO:0007632 | visual behavior(GO:0007632) |
0.2 | 1.1 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.2 | 0.6 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.2 | 0.6 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.2 | 0.6 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.2 | 1.3 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.2 | 0.3 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.2 | 0.5 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.2 | 0.6 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.2 | 0.5 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.2 | 0.5 | GO:0021871 | forebrain regionalization(GO:0021871) |
0.2 | 0.6 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.2 | 1.5 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.1 | 0.9 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 0.1 | GO:0071314 | cellular response to cocaine(GO:0071314) |
0.1 | 0.4 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
0.1 | 0.1 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.1 | 0.9 | GO:0006477 | protein sulfation(GO:0006477) |
0.1 | 0.7 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.1 | 0.3 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
0.1 | 0.6 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.1 | 0.1 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.1 | 3.3 | GO:0007616 | long-term memory(GO:0007616) |
0.1 | 0.3 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
0.1 | 1.1 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 1.5 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.1 | 0.5 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.1 | 0.1 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.1 | 0.3 | GO:0061198 | fungiform papilla formation(GO:0061198) |
0.1 | 0.4 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 1.1 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.1 | 1.8 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.1 | 3.0 | GO:0090659 | adult walking behavior(GO:0007628) walking behavior(GO:0090659) |
0.1 | 0.7 | GO:0015808 | L-alanine transport(GO:0015808) |
0.1 | 0.4 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.1 | 0.1 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.1 | 0.6 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.1 | 0.9 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.1 | 0.3 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
0.1 | 0.5 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 0.8 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.1 | 0.5 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.1 | 0.3 | GO:0060166 | olfactory pit development(GO:0060166) |
0.1 | 0.2 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.1 | 0.9 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
0.1 | 0.4 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.4 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.1 | 0.7 | GO:0097264 | self proteolysis(GO:0097264) |
0.1 | 0.2 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.1 | 0.5 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.1 | 0.6 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.1 | 0.4 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.1 | 0.5 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.1 | 0.8 | GO:0032291 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
0.1 | 1.2 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.1 | 0.5 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
0.1 | 0.8 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.1 | 0.1 | GO:1904023 | regulation of fermentation(GO:0043465) regulation of NAD metabolic process(GO:1902688) regulation of glucose catabolic process to lactate via pyruvate(GO:1904023) |
0.1 | 0.5 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.1 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.1 | 0.5 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 0.5 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.1 | 0.4 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.1 | 1.0 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.1 | 0.2 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.1 | 0.2 | GO:0061526 | acetylcholine secretion(GO:0061526) |
0.1 | 0.7 | GO:0060179 | male mating behavior(GO:0060179) |
0.1 | 0.3 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.1 | 0.2 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.1 | 0.2 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.1 | 0.1 | GO:0045472 | response to ether(GO:0045472) |
0.1 | 0.1 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.1 | 0.8 | GO:0042048 | olfactory behavior(GO:0042048) |
0.1 | 0.2 | GO:0060601 | lateral sprouting from an epithelium(GO:0060601) |
0.1 | 0.5 | GO:0022605 | oogenesis stage(GO:0022605) |
0.1 | 0.3 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.1 | 0.6 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.4 | GO:2001054 | negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
0.1 | 0.4 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
0.1 | 0.5 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.1 | 0.3 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
0.1 | 0.3 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.1 | 0.1 | GO:1902996 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.1 | 0.1 | GO:0045354 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
0.1 | 0.3 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.1 | 0.6 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.1 | 0.1 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) positive regulation of glucose mediated signaling pathway(GO:1902661) |
0.1 | 0.2 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.1 | 1.8 | GO:0021766 | hippocampus development(GO:0021766) |
0.1 | 1.4 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.1 | 0.6 | GO:0014894 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.1 | 0.3 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.1 | 0.3 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.1 | 0.4 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
0.1 | 0.5 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.1 | 0.5 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 7.2 | GO:0007612 | learning(GO:0007612) |
0.1 | 0.3 | GO:0014028 | notochord formation(GO:0014028) |
0.1 | 0.3 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.1 | 0.4 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.1 | 0.2 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.1 | 1.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 1.0 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.1 | 0.7 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.1 | 0.1 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.1 | 0.2 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.6 | GO:0051231 | spindle elongation(GO:0051231) |
0.1 | 0.3 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.1 | 0.3 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.1 | 0.3 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.1 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.1 | 0.9 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.1 | 0.3 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
0.1 | 0.3 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.1 | 0.6 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.1 | 0.3 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 0.3 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 2.2 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
0.1 | 0.3 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.1 | 0.6 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.1 | 0.8 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
0.1 | 0.1 | GO:0021877 | forebrain neuron fate commitment(GO:0021877) |
0.1 | 0.7 | GO:0034063 | stress granule assembly(GO:0034063) |
0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.3 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.1 | 0.3 | GO:0030035 | microspike assembly(GO:0030035) |
0.1 | 0.4 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.1 | 0.2 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.1 | 0.2 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.1 | 0.5 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
0.1 | 0.2 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.1 | 0.2 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.1 | 0.2 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.1 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.1 | 0.2 | GO:0021910 | smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021910) |
0.1 | 0.2 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.1 | 0.1 | GO:0008038 | neuron recognition(GO:0008038) |
0.1 | 0.5 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.1 | 0.3 | GO:0015816 | glycine transport(GO:0015816) |
0.1 | 0.2 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.1 | 0.2 | GO:0051176 | positive regulation of sulfur metabolic process(GO:0051176) |
0.1 | 0.2 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.1 | 1.4 | GO:0021954 | central nervous system neuron development(GO:0021954) |
0.1 | 0.2 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.1 | 0.3 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.1 | 0.8 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.1 | 0.2 | GO:0015755 | fructose transport(GO:0015755) |
0.1 | 0.5 | GO:0072112 | renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
0.1 | 1.6 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 0.1 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.1 | 0.2 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.1 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.1 | 5.5 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.1 | 0.3 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
0.1 | 0.1 | GO:1904587 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.1 | 0.2 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.1 | 0.2 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.1 | 0.2 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.1 | 0.3 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.1 | 0.4 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.1 | 0.3 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
0.1 | 0.2 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.1 | 0.4 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 1.9 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
0.1 | 0.1 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.1 | 0.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.1 | 0.2 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 0.1 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 0.2 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
0.1 | 0.3 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.1 | 0.9 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.1 | 0.2 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.1 | 0.1 | GO:0033122 | negative regulation of purine nucleotide catabolic process(GO:0033122) |
0.1 | 0.2 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.1 | 0.7 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
0.1 | 0.3 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.1 | 0.1 | GO:0065001 | specification of axis polarity(GO:0065001) |
0.1 | 0.2 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.1 | 0.2 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.1 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.1 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.1 | 0.2 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.1 | 0.5 | GO:0007625 | grooming behavior(GO:0007625) |
0.1 | 0.5 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.1 | 4.5 | GO:0050684 | regulation of mRNA processing(GO:0050684) |
0.1 | 0.1 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
0.1 | 1.6 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.1 | 0.1 | GO:1904238 | pericyte cell differentiation(GO:1904238) |
0.1 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.5 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.1 | 0.2 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.2 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.1 | 0.2 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.1 | 0.2 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.1 | 0.1 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.1 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
0.1 | 1.9 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 0.1 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.1 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
0.1 | 0.7 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.2 | GO:0030242 | pexophagy(GO:0030242) |
0.1 | 1.5 | GO:0051489 | regulation of filopodium assembly(GO:0051489) |
0.1 | 0.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.1 | 0.2 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.1 | 0.2 | GO:0035878 | nail development(GO:0035878) |
0.1 | 0.1 | GO:0021895 | cerebral cortex neuron differentiation(GO:0021895) |
0.1 | 0.1 | GO:1905049 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
0.1 | 0.3 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.1 | 0.2 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.1 | 0.1 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.1 | 0.4 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.1 | 0.4 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.1 | 0.5 | GO:0046847 | filopodium assembly(GO:0046847) |
0.1 | 0.1 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.1 | 1.2 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.1 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.1 | 0.3 | GO:0046836 | glycolipid transport(GO:0046836) |
0.1 | 0.2 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.1 | 0.2 | GO:0042160 | lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
0.1 | 0.1 | GO:0031498 | chromatin disassembly(GO:0031498) |
0.0 | 0.3 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.0 | 0.7 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.0 | 0.0 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.0 | 0.6 | GO:0097320 | membrane tubulation(GO:0097320) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.3 | GO:0060850 | regulation of transcription involved in cell fate commitment(GO:0060850) |
0.0 | 0.0 | GO:0030823 | regulation of cGMP metabolic process(GO:0030823) |
0.0 | 0.5 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.0 | GO:0071672 | negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
0.0 | 0.5 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.0 | 0.1 | GO:2001140 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
0.0 | 0.2 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.0 | 1.0 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.0 | 0.1 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
0.0 | 0.4 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 0.2 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.2 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.0 | GO:0060174 | limb bud formation(GO:0060174) |
0.0 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.2 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.0 | 0.3 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.1 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.0 | 0.5 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.0 | 0.1 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.0 | 0.0 | GO:0070432 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070432) |
0.0 | 0.3 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
0.0 | 0.1 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.0 | 2.0 | GO:0048704 | embryonic skeletal system morphogenesis(GO:0048704) |
0.0 | 0.2 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.1 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.0 | 0.1 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.0 | 0.6 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.3 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.0 | 0.2 | GO:1904415 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.0 | 0.1 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
0.0 | 0.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.0 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.0 | 0.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.0 | 0.1 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.0 | 0.2 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.0 | 0.1 | GO:0009996 | negative regulation of cell fate specification(GO:0009996) |
0.0 | 0.1 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.0 | 0.1 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.0 | 0.2 | GO:0006559 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.0 | 0.2 | GO:2001223 | negative regulation of neuron migration(GO:2001223) |
0.0 | 0.2 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.0 | 0.3 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.0 | 0.2 | GO:0010870 | positive regulation of receptor biosynthetic process(GO:0010870) |
0.0 | 0.4 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.2 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.0 | 0.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.0 | 0.2 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.2 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.0 | 0.0 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.0 | 0.2 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 0.2 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.0 | 0.2 | GO:0060290 | transdifferentiation(GO:0060290) |
0.0 | 0.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.0 | 0.5 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.0 | 0.2 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.0 | 0.4 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
0.0 | 0.1 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
0.0 | 0.1 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.0 | 0.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.1 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
0.0 | 0.1 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.0 | 0.2 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.0 | 0.2 | GO:0045006 | DNA deamination(GO:0045006) |
0.0 | 0.3 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.0 | 0.0 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.0 | 0.1 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.0 | 0.1 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.0 | 0.2 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
0.0 | 0.2 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
0.0 | 0.1 | GO:0002063 | chondrocyte development(GO:0002063) |
0.0 | 0.0 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.3 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.1 | GO:0030432 | peristalsis(GO:0030432) |
0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.0 | GO:1904688 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.0 | 0.0 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.0 | 0.0 | GO:0046137 | negative regulation of vitamin metabolic process(GO:0046137) |
0.0 | 0.5 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.0 | 0.0 | GO:0042713 | sperm ejaculation(GO:0042713) |
0.0 | 0.1 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.0 | 0.2 | GO:0014003 | oligodendrocyte development(GO:0014003) |
0.0 | 0.1 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
0.0 | 0.0 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.0 | 0.1 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
0.0 | 0.0 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.0 | 0.2 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.0 | 0.1 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.2 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.0 | 0.2 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.0 | 0.1 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.1 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.0 | 0.2 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.3 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.1 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.0 | 0.1 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.0 | 0.0 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.0 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.0 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.0 | 0.3 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.0 | 0.0 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.0 | 0.0 | GO:0051255 | spindle midzone assembly(GO:0051255) |
0.0 | 0.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.0 | 0.0 | GO:0009445 | putrescine metabolic process(GO:0009445) |
0.0 | 0.6 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
0.0 | 0.2 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.2 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.0 | 0.4 | GO:0008210 | estrogen metabolic process(GO:0008210) |
0.0 | 0.1 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.1 | GO:0021794 | thalamus development(GO:0021794) |
0.0 | 0.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.0 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.0 | 0.1 | GO:0072695 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
0.0 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 0.0 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.0 | 0.0 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.0 | 0.1 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.0 | 0.2 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.0 | 0.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.1 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
0.0 | 0.1 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.0 | 0.3 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.2 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
0.0 | 0.1 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.0 | 0.1 | GO:0040031 | snRNA modification(GO:0040031) |
0.0 | 0.0 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.0 | 0.2 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
0.0 | 0.1 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.0 | 0.0 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
0.0 | 0.1 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
0.0 | 0.1 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.0 | 0.2 | GO:0007097 | nuclear migration(GO:0007097) |
0.0 | 0.0 | GO:2000416 | regulation of eosinophil migration(GO:2000416) |
0.0 | 0.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.0 | 0.1 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.0 | 0.1 | GO:0015867 | ATP transport(GO:0015867) |
0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.0 | GO:1902991 | regulation of amyloid precursor protein catabolic process(GO:1902991) |
0.0 | 0.4 | GO:0046348 | amino sugar catabolic process(GO:0046348) |
0.0 | 0.2 | GO:1903313 | positive regulation of mRNA metabolic process(GO:1903313) |
0.0 | 0.0 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.0 | 0.0 | GO:0014874 | response to stimulus involved in regulation of muscle adaptation(GO:0014874) |
0.0 | 0.1 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.0 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
0.0 | 0.1 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
0.0 | 0.1 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.0 | 0.1 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.0 | 0.2 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.0 | 0.3 | GO:0001783 | B cell apoptotic process(GO:0001783) |
0.0 | 0.2 | GO:1903358 | regulation of Golgi organization(GO:1903358) |
0.0 | 0.1 | GO:0032202 | telomere assembly(GO:0032202) |
0.0 | 0.4 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.0 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.2 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.0 | 0.1 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.0 | 1.3 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.1 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.2 | GO:0060004 | reflex(GO:0060004) |
0.0 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.0 | 0.4 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.0 | 0.0 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.0 | 0.1 | GO:1901160 | primary amino compound metabolic process(GO:1901160) |
0.0 | 0.1 | GO:0014060 | regulation of epinephrine secretion(GO:0014060) |
0.0 | 0.1 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.0 | 0.0 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.0 | 0.1 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.0 | 0.1 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.0 | 0.1 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.0 | 0.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.0 | 0.1 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.0 | 0.1 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
0.0 | 0.0 | GO:0090191 | negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
0.0 | 0.3 | GO:0003016 | respiratory system process(GO:0003016) |
0.0 | 0.1 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.0 | 0.0 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.0 | GO:0052200 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.0 | 0.2 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
0.0 | 0.1 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
0.0 | 0.0 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.0 | 0.2 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.0 | 0.0 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
0.0 | 0.0 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
0.0 | 0.1 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.0 | 0.1 | GO:0007128 | meiotic prophase I(GO:0007128) prophase(GO:0051324) meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
0.0 | 0.1 | GO:1903624 | regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
0.0 | 0.0 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
0.0 | 0.1 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
0.0 | 0.0 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.0 | 0.3 | GO:0006415 | translational termination(GO:0006415) |
0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.0 | 0.1 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.0 | 0.0 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.0 | 0.1 | GO:0009642 | response to light intensity(GO:0009642) |
0.0 | 0.2 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.0 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.2 | GO:0042095 | interferon-gamma biosynthetic process(GO:0042095) |
0.0 | 0.2 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.0 | 0.1 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
0.0 | 1.1 | GO:0016079 | synaptic vesicle exocytosis(GO:0016079) |
0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.3 | GO:0019228 | neuronal action potential(GO:0019228) |
0.0 | 0.0 | GO:0031446 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
0.0 | 0.1 | GO:0014059 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
0.0 | 0.0 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.0 | 0.2 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.0 | 0.1 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.0 | 0.0 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.0 | 0.0 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.2 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.6 | GO:0015914 | phospholipid transport(GO:0015914) |
0.0 | 0.0 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.0 | 0.1 | GO:2000252 | negative regulation of feeding behavior(GO:2000252) |
0.0 | 0.1 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.0 | 0.3 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.0 | 0.1 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.5 | GO:0071300 | cellular response to retinoic acid(GO:0071300) |
0.0 | 0.0 | GO:0048069 | eye pigmentation(GO:0048069) |
0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.0 | GO:0010288 | response to lead ion(GO:0010288) |
0.0 | 0.2 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.1 | GO:1900271 | regulation of long-term synaptic potentiation(GO:1900271) |
0.0 | 0.0 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.0 | 0.0 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
0.0 | 0.1 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.0 | 0.1 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.0 | 0.1 | GO:0070417 | cellular response to cold(GO:0070417) |
0.0 | 0.4 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.0 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.0 | 0.1 | GO:0060384 | innervation(GO:0060384) |
0.0 | 0.1 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
0.0 | 0.1 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
0.0 | 0.0 | GO:0010255 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.0 | 0.0 | GO:0032661 | regulation of interleukin-18 production(GO:0032661) |
0.0 | 0.1 | GO:0042488 | positive regulation of odontogenesis of dentin-containing tooth(GO:0042488) positive regulation of enamel mineralization(GO:0070175) |
0.0 | 0.2 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
0.0 | 0.1 | GO:2000765 | regulation of cytoplasmic translation(GO:2000765) |
0.0 | 0.0 | GO:0022038 | corpus callosum development(GO:0022038) |
0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.0 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.0 | 0.1 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
0.0 | 0.0 | GO:0002485 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
0.0 | 0.2 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.0 | GO:0060022 | hard palate development(GO:0060022) |
0.0 | 0.0 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.0 | 0.0 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.0 | 0.0 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.0 | 0.1 | GO:0052428 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.0 | 0.0 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.0 | 0.2 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.0 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.0 | 0.1 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.0 | 0.0 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.0 | 0.1 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
0.0 | 0.0 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.0 | 0.0 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
0.0 | 0.1 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.0 | 0.1 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.0 | 0.2 | GO:0007617 | mating behavior(GO:0007617) multi-organism reproductive behavior(GO:0044705) |
0.0 | 0.1 | GO:0071493 | cellular response to UV-B(GO:0071493) |
0.0 | 0.1 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.0 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.0 | 0.0 | GO:1904849 | positive regulation of fat cell proliferation(GO:0070346) positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
0.0 | 0.0 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.0 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.0 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.0 | 0.1 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.0 | 0.0 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.0 | 0.0 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.0 | 0.0 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.0 | 0.1 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.0 | 0.0 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.0 | 0.1 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.0 | 0.1 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
0.0 | 0.0 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.0 | 0.1 | GO:0002158 | osteoclast proliferation(GO:0002158) |
0.0 | 0.0 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.1 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
0.0 | 0.1 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 0.0 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.3 | GO:0050806 | positive regulation of synaptic transmission(GO:0050806) |
0.0 | 0.1 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.0 | 0.0 | GO:0008054 | negative regulation of cyclin-dependent protein serine/threonine kinase by cyclin degradation(GO:0008054) |
0.0 | 0.0 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.0 | 0.3 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.0 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
0.0 | 0.0 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.3 | GO:0030901 | midbrain development(GO:0030901) |
0.0 | 0.0 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.0 | 0.0 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.1 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.0 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.1 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.0 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
0.0 | 0.0 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
0.0 | 0.0 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
0.0 | 0.1 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
0.0 | 0.0 | GO:0035290 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) neural crest cell migration involved in autonomic nervous system development(GO:1901166) |
0.0 | 0.0 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.0 | 0.2 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.0 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.0 | 0.1 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
0.0 | 0.0 | GO:0061511 | centriole elongation(GO:0061511) |
0.0 | 0.0 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.0 | 0.6 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 0.2 | GO:2000171 | negative regulation of dendrite development(GO:2000171) |
0.0 | 0.0 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.0 | 0.5 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.0 | GO:0090493 | catecholamine uptake(GO:0090493) dopamine uptake(GO:0090494) |
0.0 | 0.0 | GO:0060068 | vagina development(GO:0060068) |
0.0 | 0.0 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.0 | GO:0070316 | G0 to G1 transition(GO:0045023) regulation of G0 to G1 transition(GO:0070316) |
0.0 | 0.0 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.0 | 0.0 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.0 | 0.0 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.0 | 0.0 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.8 | GO:0035305 | negative regulation of dephosphorylation(GO:0035305) |
0.0 | 0.4 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.1 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.1 | GO:1901522 | positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
0.0 | 0.0 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.0 | GO:0002254 | kinin cascade(GO:0002254) |
0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
0.0 | 0.0 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.0 | 0.0 | GO:0031050 | dsRNA fragmentation(GO:0031050) production of small RNA involved in gene silencing by RNA(GO:0070918) |
0.0 | 0.0 | GO:0015879 | carnitine transport(GO:0015879) |
0.0 | 0.0 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.0 | 0.0 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.0 | 0.5 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
0.0 | 0.0 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.0 | 0.0 | GO:0034727 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.0 | 0.1 | GO:0000154 | rRNA modification(GO:0000154) |
0.0 | 0.1 | GO:0090151 | establishment of protein localization to mitochondrial membrane(GO:0090151) |
0.0 | 0.0 | GO:2001179 | regulation of interleukin-10 secretion(GO:2001179) |
0.0 | 0.0 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.0 | 0.0 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.0 | 0.3 | GO:0006836 | neurotransmitter transport(GO:0006836) |
0.0 | 0.0 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.0 | 0.0 | GO:0044845 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.1 | GO:0045821 | positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
0.0 | 0.0 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.0 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.0 | 0.0 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
0.0 | 0.1 | GO:0071242 | cellular response to ammonium ion(GO:0071242) |
0.0 | 0.0 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.0 | 0.0 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
0.0 | 0.0 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.0 | 0.0 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.0 | 0.0 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
0.0 | 0.0 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.0 | 0.0 | GO:0000087 | mitotic M phase(GO:0000087) |
0.0 | 0.0 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.0 | GO:0045990 | carbon catabolite regulation of transcription(GO:0045990) |
0.0 | 0.4 | GO:0035036 | sperm-egg recognition(GO:0035036) |
0.0 | 0.0 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.0 | 0.0 | GO:1903416 | response to glycoside(GO:1903416) |
0.0 | 0.0 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
0.0 | 0.0 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.0 | 0.0 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.0 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.0 | 0.0 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.0 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.6 | 4.8 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.7 | 3.6 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.5 | 4.3 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.4 | 3.2 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.4 | 2.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.4 | 4.3 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.3 | 1.0 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.3 | 2.3 | GO:0032584 | growth cone membrane(GO:0032584) |
0.3 | 1.0 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.2 | 0.7 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.2 | 1.0 | GO:1990696 | USH2 complex(GO:1990696) |
0.2 | 1.8 | GO:0071437 | invadopodium(GO:0071437) |
0.2 | 2.3 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.2 | 8.3 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.2 | 3.5 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.2 | 1.2 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.2 | 1.8 | GO:0043194 | axon initial segment(GO:0043194) |
0.2 | 0.7 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.2 | 1.6 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.2 | 7.0 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.1 | 0.3 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.6 | GO:0001739 | sex chromatin(GO:0001739) |
0.1 | 0.4 | GO:0033010 | paranodal junction(GO:0033010) |
0.1 | 1.6 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 2.0 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.1 | 0.7 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 0.5 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.5 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.1 | 0.4 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.1 | 0.7 | GO:0097449 | astrocyte projection(GO:0097449) |
0.1 | 0.3 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.1 | 1.3 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 1.2 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 0.7 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 0.3 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 0.3 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 1.5 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.1 | 0.3 | GO:0072534 | perineuronal net(GO:0072534) |
0.1 | 0.8 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.3 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 3.6 | GO:0043198 | dendritic shaft(GO:0043198) |
0.1 | 0.3 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 0.8 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.6 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.1 | 0.6 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.1 | 11.7 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.1 | 0.4 | GO:0097433 | dense body(GO:0097433) |
0.1 | 0.2 | GO:0097427 | microtubule bundle(GO:0097427) |
0.1 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.1 | 0.9 | GO:0071564 | npBAF complex(GO:0071564) |
0.1 | 0.2 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.1 | 1.8 | GO:0030175 | filopodium(GO:0030175) |
0.1 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 0.4 | GO:0001652 | granular component(GO:0001652) |
0.1 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.3 | GO:1990745 | EARP complex(GO:1990745) |
0.1 | 0.5 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.1 | 1.2 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.1 | 1.2 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.1 | 0.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 1.0 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 0.3 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 0.1 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.1 | 0.4 | GO:0031527 | filopodium membrane(GO:0031527) |
0.1 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.3 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.1 | 0.5 | GO:0036156 | inner dynein arm(GO:0036156) |
0.1 | 0.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 0.3 | GO:0030008 | TRAPP complex(GO:0030008) |
0.1 | 0.6 | GO:0005652 | nuclear lamina(GO:0005652) |
0.0 | 0.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.0 | 0.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.2 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.3 | GO:0043203 | axon hillock(GO:0043203) |
0.0 | 3.5 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.5 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.2 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.4 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.4 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.0 | 0.4 | GO:0031011 | Ino80 complex(GO:0031011) |
0.0 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 0.5 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.2 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.0 | 3.7 | GO:0030426 | growth cone(GO:0030426) |
0.0 | 0.1 | GO:0042585 | germinal vesicle(GO:0042585) |
0.0 | 1.9 | GO:0043195 | terminal bouton(GO:0043195) |
0.0 | 0.2 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.3 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.2 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.0 | 1.5 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.4 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.3 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 0.0 | GO:0016939 | kinesin II complex(GO:0016939) |
0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
0.0 | 0.0 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.2 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
0.0 | 0.6 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.5 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.0 | 0.2 | GO:0032797 | SMN complex(GO:0032797) |
0.0 | 0.2 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.2 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.3 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.0 | 1.1 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 0.4 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.0 | 0.7 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.3 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.1 | GO:0005775 | vacuolar lumen(GO:0005775) |
0.0 | 0.5 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.0 | GO:0005687 | U4 snRNP(GO:0005687) |
0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.1 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 2.0 | GO:0032993 | protein-DNA complex(GO:0032993) |
0.0 | 0.3 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.1 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 3.1 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.0 | 0.0 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.2 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.0 | 0.1 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.0 | 0.1 | GO:0033268 | node of Ranvier(GO:0033268) |
0.0 | 0.0 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.0 | 0.5 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 0.0 | GO:0033202 | DNA helicase complex(GO:0033202) |
0.0 | 0.0 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 1.2 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 1.4 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.0 | 0.0 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.1 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.2 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.2 | GO:0000974 | Prp19 complex(GO:0000974) |
0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.7 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 0.2 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.0 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.0 | 1.5 | GO:0001669 | acrosomal vesicle(GO:0001669) |
0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 0.3 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.1 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.0 | 0.1 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.0 | 0.4 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.0 | 0.0 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.1 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.4 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.2 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 0.4 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.1 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.1 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 1.0 | GO:0031513 | nonmotile primary cilium(GO:0031513) |
0.0 | 0.0 | GO:0097513 | myosin II filament(GO:0097513) |
0.0 | 0.0 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 4.0 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.3 | GO:0072372 | primary cilium(GO:0072372) |
0.0 | 0.0 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.6 | GO:0016363 | nuclear matrix(GO:0016363) |
0.0 | 0.0 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.0 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.0 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.1 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
0.0 | 0.0 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.1 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.0 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.1 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.1 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 5.3 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
1.2 | 3.6 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.8 | 2.5 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.8 | 3.9 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.7 | 2.0 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.5 | 1.6 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.4 | 1.2 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.3 | 2.0 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.3 | 2.0 | GO:0048495 | Roundabout binding(GO:0048495) |
0.3 | 2.0 | GO:0003680 | AT DNA binding(GO:0003680) |
0.3 | 1.0 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.3 | 0.3 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.3 | 0.8 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.3 | 1.3 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.3 | 1.6 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.3 | 2.3 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.2 | 3.4 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.2 | 1.4 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.2 | 0.7 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.2 | 4.5 | GO:1905030 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.2 | 1.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.2 | 0.7 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.2 | 1.6 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.2 | 1.3 | GO:0005499 | vitamin D binding(GO:0005499) |
0.2 | 2.4 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.2 | 1.5 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.2 | 2.3 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.2 | 0.8 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.2 | 0.6 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.2 | 1.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.2 | 4.4 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.2 | 0.9 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.2 | 4.3 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.2 | 0.7 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.2 | 0.6 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.2 | 3.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.2 | 0.6 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.2 | 1.2 | GO:0008430 | selenium binding(GO:0008430) |
0.2 | 0.5 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.1 | 0.3 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.1 | 0.6 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 1.1 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
0.1 | 2.8 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 1.5 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
0.1 | 0.4 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.1 | 1.6 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.7 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 1.2 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.1 | 1.6 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.1 | 1.7 | GO:0005272 | sodium channel activity(GO:0005272) |
0.1 | 0.5 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.4 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.1 | 0.5 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.1 | 0.4 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 0.7 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 0.9 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 0.3 | GO:0005119 | smoothened binding(GO:0005119) |
0.1 | 0.1 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.1 | 0.3 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.1 | 0.6 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
0.1 | 0.3 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 0.3 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.1 | 0.6 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.1 | 0.4 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.6 | GO:0043495 | protein anchor(GO:0043495) |
0.1 | 0.3 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.1 | 0.5 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.3 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.1 | 0.3 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.1 | 0.2 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.1 | 0.5 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.1 | 0.3 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.1 | 0.3 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.3 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.1 | 1.7 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.1 | 0.4 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.4 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) |
0.1 | 0.4 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.2 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.1 | 1.9 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.1 | 0.5 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 0.5 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.1 | 1.3 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.1 | 0.3 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.2 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.1 | 0.3 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.1 | 0.9 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 3.2 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.1 | 1.1 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 0.6 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 1.8 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.1 | 0.6 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.1 | 0.5 | GO:0043855 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
0.1 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.2 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.1 | 2.2 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.1 | 0.2 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.1 | 0.4 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 1.7 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.1 | 0.2 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.1 | 0.2 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.1 | 0.7 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.1 | 0.7 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 1.5 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 0.4 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.1 | 0.2 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.1 | 0.3 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.1 | 0.2 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.1 | 0.8 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.1 | 0.3 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.1 | 0.2 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 1.1 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.1 | 0.1 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.2 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 1.6 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.1 | 0.3 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.1 | 0.2 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.1 | 0.3 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.1 | 0.2 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.4 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 0.7 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.3 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 1.0 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.1 | 0.8 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.1 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.1 | 0.2 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.1 | 1.1 | GO:0031489 | myosin V binding(GO:0031489) |
0.1 | 0.1 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.1 | 0.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.1 | 0.2 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.1 | 0.7 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.1 | 1.6 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.1 | 1.6 | GO:0030507 | spectrin binding(GO:0030507) |
0.1 | 1.4 | GO:0045296 | cadherin binding(GO:0045296) |
0.1 | 0.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.1 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.6 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.1 | 0.2 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 0.2 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.1 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.1 | 1.1 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.1 | 0.4 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.5 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.1 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.1 | 0.4 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.1 | 2.5 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.1 | 0.4 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.1 | 0.2 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.1 | 0.3 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.1 | 0.3 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.1 | 0.2 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.1 | 0.2 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
0.1 | 0.3 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.1 | 0.1 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.1 | 0.1 | GO:0043398 | HLH domain binding(GO:0043398) |
0.1 | 0.4 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.1 | 0.3 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.1 | 0.2 | GO:0015265 | urea channel activity(GO:0015265) |
0.1 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.3 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.0 | 1.2 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.0 | 0.2 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.0 | 0.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.0 | 0.1 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 0.3 | GO:0004952 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) dopamine neurotransmitter receptor activity(GO:0004952) |
0.0 | 0.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.0 | 0.3 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.4 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.0 | 0.6 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.3 | GO:0099528 | G-protein coupled neurotransmitter receptor activity(GO:0099528) |
0.0 | 0.7 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 0.4 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.2 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.0 | 0.2 | GO:0032551 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.0 | 0.5 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 2.1 | GO:0008013 | beta-catenin binding(GO:0008013) |
0.0 | 0.2 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.8 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.0 | 0.2 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.0 | 0.3 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.1 | GO:0030519 | snoRNP binding(GO:0030519) |
0.0 | 0.3 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.0 | 0.2 | GO:0004083 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) |
0.0 | 0.0 | GO:0015556 | C4-dicarboxylate transmembrane transporter activity(GO:0015556) |
0.0 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.0 | 0.5 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.5 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.0 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.0 | 0.4 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.2 | GO:0034534 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.0 | 0.2 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.0 | 0.4 | GO:0051378 | serotonin binding(GO:0051378) |
0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.0 | 0.1 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.0 | 0.1 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
0.0 | 1.7 | GO:0008146 | sulfotransferase activity(GO:0008146) |
0.0 | 0.2 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.0 | 0.1 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.0 | 0.2 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.2 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.4 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.5 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.1 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.0 | 0.1 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.0 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 2.7 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.3 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.1 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.4 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.4 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.0 | 0.3 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.3 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 1.5 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 25.0 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
0.0 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.4 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.1 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.0 | 0.1 | GO:0035326 | enhancer binding(GO:0035326) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.1 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.1 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.4 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.2 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.5 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.2 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
0.0 | 0.0 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.2 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.5 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.1 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.2 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 0.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.0 | 0.2 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.3 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 0.1 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.5 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.0 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.0 | 0.2 | GO:0034784 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.0 | GO:0070061 | fructose binding(GO:0070061) |
0.0 | 0.0 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.1 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) cation:amino acid symporter activity(GO:0005416) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.1 | GO:0004487 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.0 | 0.2 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.3 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.2 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.1 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
0.0 | 0.1 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.2 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.0 | 0.4 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.2 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.0 | 0.3 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 0.1 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.0 | 0.0 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.0 | 0.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.0 | GO:0015172 | acidic amino acid transmembrane transporter activity(GO:0015172) |
0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.0 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.0 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.0 | 0.0 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.1 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.0 | 0.0 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.3 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.0 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.0 | GO:0001012 | RNA polymerase II regulatory region DNA binding(GO:0001012) |
0.0 | 0.0 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.0 | 0.2 | GO:0034944 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.3 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.3 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.0 | 0.1 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.0 | 0.0 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.2 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.3 | GO:0030515 | snoRNA binding(GO:0030515) |
0.0 | 0.1 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.0 | 0.0 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.0 | 0.0 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.0 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 0.0 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.0 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.1 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.0 | 5.1 | GO:0001071 | nucleic acid binding transcription factor activity(GO:0001071) transcription factor activity, sequence-specific DNA binding(GO:0003700) |
0.0 | 0.2 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.0 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.0 | 2.3 | GO:0003682 | chromatin binding(GO:0003682) |
0.0 | 0.0 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.0 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.0 | 0.2 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.0 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.0 | 0.2 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.0 | 0.0 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.0 | 0.0 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.1 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
0.0 | 0.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.1 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.0 | 0.4 | GO:0052770 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.1 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.0 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.0 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 0.1 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.2 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 0.0 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.0 | 0.0 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.0 | 0.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.0 | 0.1 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.4 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.0 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.0 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.0 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.0 | 0.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.0 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.0 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.0 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.1 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.0 | 0.3 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.0 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 1.3 | GO:0003729 | mRNA binding(GO:0003729) |
0.0 | 0.0 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.0 | 0.0 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.0 | 0.4 | GO:0052768 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 0.0 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.0 | 0.0 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.0 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.0 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.3 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.1 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.0 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.2 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.0 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.2 | 0.9 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 3.1 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 0.2 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.1 | 3.5 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 1.8 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.1 | 1.7 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 1.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 0.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 0.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.1 | 2.4 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 2.0 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.1 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 1.3 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 1.9 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 1.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.1 | 1.7 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.1 | 2.0 | PID LKB1 PATHWAY | LKB1 signaling events |
0.1 | 0.6 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 0.8 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 3.5 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.6 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 1.2 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.9 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.7 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.5 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.2 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.4 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.0 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.5 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.3 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.0 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.2 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.5 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.3 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.4 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.5 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.6 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.0 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 0.0 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.4 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.3 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.2 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.0 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 6.3 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.2 | 6.1 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.2 | 3.9 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.2 | 1.9 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.2 | 0.7 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.2 | 3.6 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.2 | 1.7 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.2 | 1.2 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 2.2 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 1.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 3.3 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 1.0 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 1.4 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.1 | 0.3 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
0.1 | 0.6 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 0.5 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 0.7 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 0.2 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.1 | 0.5 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.1 | 1.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.1 | 1.9 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.1 | 0.6 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.1 | 2.0 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.1 | 1.6 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 1.4 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.1 | 0.7 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.1 | 0.1 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 0.7 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 1.0 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.1 | 0.4 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
0.1 | 0.9 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 0.7 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.1 | 1.1 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.6 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.9 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.1 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.0 | 0.5 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.0 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
0.0 | 0.8 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 1.8 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 0.2 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 1.9 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.0 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.6 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
0.0 | 1.6 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.0 | 0.4 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
0.0 | 0.4 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.0 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.0 | 0.4 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.0 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.0 | 0.9 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.6 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.2 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
0.0 | 0.1 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.2 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.0 | 0.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.0 | 1.6 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.2 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.0 | 1.2 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 0.5 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 0.3 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
0.0 | 0.2 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.0 | 0.2 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.2 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.0 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.1 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 0.0 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.3 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.0 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 0.0 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.0 | 0.7 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.1 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 0.0 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.1 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.0 | 0.0 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.2 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.1 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.0 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.3 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 0.3 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.0 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
0.0 | 0.1 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.0 | 0.4 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |