Gene Symbol | Gene ID | Gene Info |
---|---|---|
Hoxa13
|
ENSMUSG00000038203.12 | Hoxa13 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Hoxa13 | chr6_52258879_52259437 | 1644 | 0.127303 | -0.14 | 2.8e-01 | Click! |
Hoxa13 | chr6_52259553_52259793 | 1129 | 0.202444 | -0.13 | 3.2e-01 | Click! |
Hoxa13 | chr6_52259871_52261414 | 160 | 0.843473 | -0.12 | 3.6e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr7_73554834_73555113 | 2.24 |
1810026B05Rik |
RIKEN cDNA 1810026B05 gene |
947 |
0.42 |
chr2_65929929_65930575 | 2.21 |
Csrnp3 |
cysteine-serine-rich nuclear protein 3 |
115 |
0.97 |
chr18_25751839_25752425 | 2.10 |
Celf4 |
CUGBP, Elav-like family member 4 |
560 |
0.81 |
chr15_18819772_18819999 | 1.86 |
Cdh10 |
cadherin 10 |
444 |
0.76 |
chr12_38783979_38784442 | 1.76 |
Etv1 |
ets variant 1 |
701 |
0.73 |
chr8_54957303_54957776 | 1.68 |
Gm45263 |
predicted gene 45263 |
2280 |
0.24 |
chr11_108607202_108607707 | 1.42 |
Cep112 |
centrosomal protein 112 |
2227 |
0.37 |
chr2_52557337_52558561 | 1.37 |
Cacnb4 |
calcium channel, voltage-dependent, beta 4 subunit |
611 |
0.74 |
chrX_23294952_23295287 | 1.37 |
Klhl13 |
kelch-like 13 |
1039 |
0.66 |
chr13_90091557_90091708 | 1.33 |
Tmem167 |
transmembrane protein 167 |
1870 |
0.27 |
chr1_66896075_66896827 | 1.30 |
Gm25832 |
predicted gene, 25832 |
29654 |
0.09 |
chr17_86170770_86170921 | 1.28 |
Prkce |
protein kinase C, epsilon |
2671 |
0.27 |
chr19_36735780_36736009 | 1.27 |
Ppp1r3c |
protein phosphatase 1, regulatory subunit 3C |
759 |
0.69 |
chr17_91090702_91091377 | 1.25 |
Nrxn1 |
neurexin I |
1694 |
0.28 |
chr8_128362179_128363441 | 1.24 |
Nrp1 |
neuropilin 1 |
3413 |
0.27 |
chr13_117603755_117604285 | 1.23 |
Hcn1 |
hyperpolarization activated cyclic nucleotide gated potassium channel 1 |
1540 |
0.54 |
chr16_76899025_76899244 | 1.22 |
1700041M19Rik |
RIKEN cDNA 1700041M19 gene |
9853 |
0.22 |
chr1_106174865_106175693 | 1.22 |
Phlpp1 |
PH domain and leucine rich repeat protein phosphatase 1 |
3527 |
0.22 |
chr16_42907917_42908393 | 1.20 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
503 |
0.78 |
chr5_150261018_150262108 | 1.20 |
Fry |
FRY microtubule binding protein |
1796 |
0.34 |
chr17_81667571_81668254 | 1.19 |
Slc8a1 |
solute carrier family 8 (sodium/calcium exchanger), member 1 |
2275 |
0.44 |
chrX_23294524_23294785 | 1.19 |
Klhl13 |
kelch-like 13 |
1504 |
0.53 |
chr12_31713469_31714088 | 1.17 |
Gpr22 |
G protein-coupled receptor 22 |
148 |
0.95 |
chr1_23275056_23275207 | 1.16 |
Mir30a |
microRNA 30a |
2862 |
0.17 |
chr15_50869258_50870050 | 1.15 |
Trps1 |
transcriptional repressor GATA binding 1 |
13152 |
0.21 |
chr5_43236032_43236320 | 1.15 |
Gm7854 |
predicted gene 7854 |
821 |
0.45 |
chr14_93881916_93882174 | 1.14 |
Pcdh9 |
protocadherin 9 |
3703 |
0.34 |
chr9_113792658_113793898 | 1.13 |
Clasp2 |
CLIP associating protein 2 |
48 |
0.98 |
chrX_82948955_82949290 | 1.13 |
Dmd |
dystrophin, muscular dystrophy |
219 |
0.97 |
chr6_17583744_17584496 | 1.12 |
Met |
met proto-oncogene |
37147 |
0.15 |
chr9_96728847_96729194 | 1.11 |
Zbtb38 |
zinc finger and BTB domain containing 38 |
16 |
0.97 |
chr13_32801335_32801777 | 1.10 |
Wrnip1 |
Werner helicase interacting protein 1 |
482 |
0.67 |
chr2_65566312_65566743 | 1.10 |
Scn3a |
sodium channel, voltage-gated, type III, alpha |
965 |
0.63 |
chr9_41584760_41585051 | 1.09 |
Mir100hg |
Mir100 Mirlet7a-2 Mir125b-1 cluster host gene |
2864 |
0.14 |
chr9_112232067_112232798 | 1.08 |
Arpp21 |
cyclic AMP-regulated phosphoprotein, 21 |
69 |
0.97 |
chr10_86490806_86491632 | 1.06 |
Syn3 |
synapsin III |
678 |
0.59 |
chr6_55678018_55678169 | 1.06 |
Neurod6 |
neurogenic differentiation 6 |
3170 |
0.29 |
chr3_82143132_82143283 | 1.06 |
Gucy1a1 |
guanylate cyclase 1, soluble, alpha 1 |
1866 |
0.39 |
chr16_77593272_77593433 | 1.04 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
476 |
0.66 |
chr8_85698168_85698436 | 1.04 |
Neto2 |
neuropilin (NRP) and tolloid (TLL)-like 2 |
2452 |
0.21 |
chr3_89521563_89522618 | 1.03 |
Kcnn3 |
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 3 |
1926 |
0.28 |
chr1_168425831_168426144 | 1.03 |
Pbx1 |
pre B cell leukemia homeobox 1 |
5517 |
0.27 |
chr10_17946128_17946709 | 1.02 |
Heca |
hdc homolog, cell cycle regulator |
1649 |
0.42 |
chr3_149443059_149443897 | 1.02 |
Gm30382 |
predicted gene, 30382 |
1798 |
0.48 |
chr16_77502046_77502387 | 1.01 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
1832 |
0.24 |
chr15_81936444_81938042 | 1.01 |
Csdc2 |
cold shock domain containing C2, RNA binding |
261 |
0.82 |
chr16_49857400_49857908 | 1.01 |
Cd47 |
CD47 antigen (Rh-related antigen, integrin-associated signal transducer) |
1867 |
0.46 |
chr5_150260534_150260992 | 1.00 |
Fry |
FRY microtubule binding protein |
996 |
0.55 |
chr2_65622009_65622167 | 1.00 |
Scn2a |
sodium channel, voltage-gated, type II, alpha |
1277 |
0.54 |
chr6_12260319_12260631 | 0.99 |
Thsd7a |
thrombospondin, type I, domain containing 7A |
57854 |
0.15 |
chr13_8212141_8212292 | 0.99 |
Adarb2 |
adenosine deaminase, RNA-specific, B2 |
9294 |
0.18 |
chr15_39391612_39392273 | 0.99 |
Rims2 |
regulating synaptic membrane exocytosis 2 |
142 |
0.97 |
chr8_94266327_94267391 | 0.98 |
Nup93 |
nucleoporin 93 |
12 |
0.96 |
chr2_106797594_106798094 | 0.98 |
Gm22813 |
predicted gene, 22813 |
11491 |
0.24 |
chr3_82073312_82073523 | 0.97 |
Gucy1b1 |
guanylate cyclase 1, soluble, beta 1 |
1256 |
0.46 |
chr2_22629047_22629444 | 0.95 |
Gad2 |
glutamic acid decarboxylase 2 |
5941 |
0.14 |
chr10_69536775_69537233 | 0.95 |
Ank3 |
ankyrin 3, epithelial |
2782 |
0.32 |
chr4_81564242_81564440 | 0.95 |
Gm11765 |
predicted gene 11765 |
102609 |
0.07 |
chr3_118432535_118432944 | 0.94 |
Gm26871 |
predicted gene, 26871 |
1058 |
0.3 |
chrX_82949777_82950054 | 0.94 |
Dmd |
dystrophin, muscular dystrophy |
1012 |
0.71 |
chr14_105328131_105329237 | 0.94 |
Ndfip2 |
Nedd4 family interacting protein 2 |
34138 |
0.13 |
chr6_17750183_17750783 | 0.93 |
St7 |
suppression of tumorigenicity 7 |
1091 |
0.38 |
chr16_77503379_77503945 | 0.93 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
3278 |
0.16 |
chrX_104198423_104198882 | 0.93 |
Nexmif |
neurite extension and migration factor |
2465 |
0.34 |
chr3_48846231_48846444 | 0.93 |
Gm37190 |
predicted gene, 37190 |
85388 |
0.1 |
chr7_87589539_87589734 | 0.92 |
Grm5 |
glutamate receptor, metabotropic 5 |
5238 |
0.32 |
chr17_78454131_78454627 | 0.92 |
Gm19399 |
predicted gene, 19399 |
4266 |
0.19 |
chr2_97470022_97470462 | 0.90 |
Lrrc4c |
leucine rich repeat containing 4C |
2153 |
0.46 |
chr13_89929582_89929846 | 0.90 |
Gm24498 |
predicted gene, 24498 |
2171 |
0.43 |
chr5_31453392_31453641 | 0.90 |
Zfp512 |
zinc finger protein 512 |
361 |
0.69 |
chr13_8205020_8205313 | 0.89 |
Adarb2 |
adenosine deaminase, RNA-specific, B2 |
2244 |
0.28 |
chr5_46443996_46444217 | 0.89 |
Gm7931 |
predicted pseudogene 7931 |
29762 |
0.23 |
chr6_50112292_50112445 | 0.89 |
Mpp6 |
membrane protein, palmitoylated 6 (MAGUK p55 subfamily member 6) |
1508 |
0.49 |
chr6_6005862_6006822 | 0.89 |
Dync1i1 |
dynein cytoplasmic 1 intermediate chain 1 |
276 |
0.94 |
chr2_39067508_39067825 | 0.89 |
Golga1 |
golgi autoantigen, golgin subfamily a, 1 |
2125 |
0.22 |
chr10_64086056_64086224 | 0.89 |
Lrrtm3 |
leucine rich repeat transmembrane neuronal 3 |
4107 |
0.36 |
chr10_93800134_93800430 | 0.88 |
Gm26239 |
predicted gene, 26239 |
7016 |
0.15 |
chr5_90339159_90340201 | 0.88 |
Ankrd17 |
ankyrin repeat domain 17 |
63 |
0.98 |
chr10_45483988_45484272 | 0.88 |
Lin28b |
lin-28 homolog B (C. elegans) |
1647 |
0.42 |
chr5_137533757_137533931 | 0.88 |
Gnb2 |
guanine nucleotide binding protein (G protein), beta 2 |
334 |
0.54 |
chr14_75964008_75964248 | 0.87 |
Gm25517 |
predicted gene, 25517 |
8491 |
0.18 |
chr13_46421773_46422087 | 0.87 |
Rbm24 |
RNA binding motif protein 24 |
108 |
0.98 |
chr17_87444292_87445035 | 0.87 |
Calm2 |
calmodulin 2 |
2185 |
0.19 |
chr9_71959747_71960081 | 0.87 |
Gm27152 |
predicted gene 27152 |
11035 |
0.11 |
chr2_35198789_35198962 | 0.87 |
Rab14 |
RAB14, member RAS oncogene family |
1914 |
0.28 |
chr6_103513736_103514218 | 0.87 |
Chl1 |
cell adhesion molecule L1-like |
2647 |
0.25 |
chr18_31445092_31445474 | 0.86 |
Syt4 |
synaptotagmin IV |
2123 |
0.26 |
chr1_97768143_97768479 | 0.86 |
Gin1 |
gypsy retrotransposon integrase 1 |
1861 |
0.3 |
chr13_28419787_28420291 | 0.86 |
Gm40841 |
predicted gene, 40841 |
27 |
0.98 |
chr14_64592702_64592949 | 0.86 |
Mir3078 |
microRNA 3078 |
1640 |
0.28 |
chr16_61171850_61172279 | 0.86 |
Gm17054 |
predicted gene 17054 |
66914 |
0.12 |
chr7_100708289_100708634 | 0.85 |
Fam168a |
family with sequence similarity 168, member A |
1602 |
0.28 |
chr5_57723598_57724600 | 0.85 |
Gm42635 |
predicted gene 42635 |
294 |
0.83 |
chr1_115687470_115687621 | 0.84 |
Cntnap5a |
contactin associated protein-like 5A |
2789 |
0.31 |
chr13_4662525_4663068 | 0.84 |
Gm40658 |
predicted gene, 40658 |
18889 |
0.18 |
chr15_58821491_58821943 | 0.84 |
Tmem65 |
transmembrane protein 65 |
1813 |
0.24 |
chr3_107039197_107039974 | 0.84 |
AI504432 |
expressed sequence AI504432 |
81 |
0.96 |
chr13_48263734_48264208 | 0.84 |
A330033J07Rik |
RIKEN cDNA A330033J07 gene |
1348 |
0.26 |
chrX_75576775_75576926 | 0.83 |
Rab39b |
RAB39B, member RAS oncogene family |
1381 |
0.29 |
chr12_46813712_46814094 | 0.83 |
Gm48542 |
predicted gene, 48542 |
2395 |
0.29 |
chr11_98743557_98743728 | 0.83 |
Thra |
thyroid hormone receptor alpha |
591 |
0.57 |
chr11_61231540_61231798 | 0.83 |
Aldh3a2 |
aldehyde dehydrogenase family 3, subfamily A2 |
19341 |
0.13 |
chr1_17095800_17096193 | 0.82 |
Jph1 |
junctophilin 1 |
1893 |
0.35 |
chr3_7368768_7369136 | 0.82 |
Pkia |
protein kinase inhibitor, alpha |
2282 |
0.37 |
chr8_115703571_115704016 | 0.82 |
Gm15655 |
predicted gene 15655 |
1285 |
0.49 |
chr3_84219260_84219630 | 0.82 |
Trim2 |
tripartite motif-containing 2 |
1400 |
0.49 |
chr1_146492868_146493351 | 0.82 |
Brinp3 |
bone morphogenetic protein/retinoic acid inducible neural specific 3 |
1651 |
0.31 |
chrX_164439818_164439969 | 0.81 |
Asb11 |
ankyrin repeat and SOCS box-containing 11 |
1835 |
0.31 |
chr6_21217917_21219303 | 0.81 |
Kcnd2 |
potassium voltage-gated channel, Shal-related family, member 2 |
3107 |
0.33 |
chr14_93885189_93885472 | 0.81 |
Pcdh9 |
protocadherin 9 |
418 |
0.9 |
chrX_127942350_127942501 | 0.81 |
Gm25061 |
predicted gene, 25061 |
35866 |
0.22 |
chr15_39392623_39392878 | 0.81 |
Rims2 |
regulating synaptic membrane exocytosis 2 |
950 |
0.68 |
chr1_143642293_143642622 | 0.81 |
Cdc73 |
cell division cycle 73, Paf1/RNA polymerase II complex component |
68 |
0.97 |
chr13_6646301_6646452 | 0.81 |
Pfkp |
phosphofructokinase, platelet |
2349 |
0.29 |
chr18_69599939_69600665 | 0.80 |
Tcf4 |
transcription factor 4 |
766 |
0.75 |
chr10_39370690_39371212 | 0.80 |
Fyn |
Fyn proto-oncogene |
1148 |
0.53 |
chr7_87589934_87590085 | 0.80 |
Grm5 |
glutamate receptor, metabotropic 5 |
5611 |
0.31 |
chr15_40657305_40658194 | 0.80 |
Zfpm2 |
zinc finger protein, multitype 2 |
2398 |
0.42 |
chr13_48264468_48265300 | 0.80 |
A330033J07Rik |
RIKEN cDNA A330033J07 gene |
2261 |
0.19 |
chr12_92824662_92824813 | 0.80 |
Gm47998 |
predicted gene, 47998 |
173414 |
0.04 |
chr6_30982279_30982797 | 0.80 |
Klf14 |
Kruppel-like factor 14 |
23460 |
0.14 |
chr12_70348805_70348996 | 0.80 |
Trim9 |
tripartite motif-containing 9 |
1286 |
0.36 |
chr19_7480743_7481025 | 0.79 |
Rtn3 |
reticulon 3 |
2318 |
0.22 |
chr3_57667227_57667681 | 0.79 |
BB187690 |
expressed sequence BB187690 |
11875 |
0.11 |
chr17_64329718_64329909 | 0.79 |
Pja2 |
praja ring finger ubiquitin ligase 2 |
2052 |
0.38 |
chr11_109995030_109996297 | 0.79 |
Abca8b |
ATP-binding cassette, sub-family A (ABC1), member 8b |
80 |
0.98 |
chr1_188006897_188007904 | 0.79 |
9330162B11Rik |
RIKEN cDNA 9330162B11 gene |
1590 |
0.45 |
chr5_104113204_104114091 | 0.79 |
Sparcl1 |
SPARC-like 1 |
86 |
0.71 |
chr11_64956791_64957700 | 0.79 |
Elac2 |
elaC ribonuclease Z 2 |
21793 |
0.21 |
chr17_83267468_83267914 | 0.78 |
Gm24240 |
predicted gene, 24240 |
2280 |
0.31 |
chr2_116201684_116201882 | 0.78 |
2810405F15Rik |
RIKEN cDNA 2810405F15 gene |
125687 |
0.05 |
chr12_15812207_15812700 | 0.78 |
Trib2 |
tribbles pseudokinase 2 |
4332 |
0.17 |
chr12_102702618_102703586 | 0.78 |
Itpk1 |
inositol 1,3,4-triphosphate 5/6 kinase |
1812 |
0.2 |
chr15_102594215_102594505 | 0.78 |
Atf7 |
activating transcription factor 7 |
30562 |
0.08 |
chr7_6735684_6736014 | 0.78 |
Usp29 |
ubiquitin specific peptidase 29 |
153 |
0.91 |
chr7_51124861_51125012 | 0.78 |
Gm21037 |
predicted gene, 21037 |
30488 |
0.18 |
chr2_89592453_89592604 | 0.78 |
Olfr1246 |
olfactory receptor 1246 |
598 |
0.59 |
chr14_61037227_61037932 | 0.77 |
Tnfrsf19 |
tumor necrosis factor receptor superfamily, member 19 |
312 |
0.56 |
chr4_78209143_78209724 | 0.77 |
Ptprd |
protein tyrosine phosphatase, receptor type, D |
2306 |
0.29 |
chr8_46209751_46210307 | 0.77 |
Slc25a4 |
solute carrier family 25 (mitochondrial carrier, adenine nucleotide translocator), member 4 |
1001 |
0.38 |
chr14_61555128_61555440 | 0.77 |
Spryd7 |
SPRY domain containing 7 |
1474 |
0.25 |
chrX_53641341_53641492 | 0.76 |
Rtl8a |
retrotransposon Gag like 8A |
2266 |
0.18 |
chr9_59483692_59484196 | 0.76 |
Arih1 |
ariadne RBR E3 ubiquitin protein ligase 1 |
2112 |
0.25 |
chr8_25752901_25753052 | 0.76 |
Ddhd2 |
DDHD domain containing 2 |
199 |
0.86 |
chr13_12103103_12103740 | 0.76 |
Ryr2 |
ryanodine receptor 2, cardiac |
3038 |
0.25 |
chr18_88244787_88244938 | 0.76 |
Gm50391 |
predicted gene, 50391 |
148312 |
0.04 |
chr2_160648764_160649101 | 0.76 |
Top1 |
topoisomerase (DNA) I |
2952 |
0.24 |
chr2_65565600_65566271 | 0.76 |
Scn3a |
sodium channel, voltage-gated, type III, alpha |
1557 |
0.45 |
chr14_49175333_49175628 | 0.76 |
Naa30 |
N(alpha)-acetyltransferase 30, NatC catalytic subunit |
2175 |
0.27 |
chr19_47583146_47583297 | 0.75 |
Slk |
STE20-like kinase |
3202 |
0.19 |
chr2_6874140_6874291 | 0.75 |
Celf2 |
CUGBP, Elav-like family member 2 |
1618 |
0.39 |
chr13_83742301_83742867 | 0.75 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
3721 |
0.15 |
chr10_81229656_81230911 | 0.75 |
Atcay |
ataxia, cerebellar, Cayman type |
502 |
0.53 |
chr15_85680534_85681451 | 0.75 |
Lncppara |
long noncoding RNA near Ppara |
22781 |
0.12 |
chr6_77245550_77245946 | 0.74 |
Lrrtm1 |
leucine rich repeat transmembrane neuronal 1 |
2826 |
0.35 |
chr11_81634965_81635201 | 0.74 |
Gm11418 |
predicted gene 11418 |
47722 |
0.16 |
chr3_63851016_63851674 | 0.74 |
Plch1 |
phospholipase C, eta 1 |
14 |
0.97 |
chr1_154882567_154882718 | 0.74 |
Cacna1e |
calcium channel, voltage-dependent, R type, alpha 1E subunit |
1382 |
0.56 |
chr16_13357876_13359918 | 0.74 |
Mrtfb |
myocardin related transcription factor B |
476 |
0.83 |
chrX_160992631_160993204 | 0.74 |
Cdkl5 |
cyclin-dependent kinase-like 5 |
1787 |
0.46 |
chr11_32002300_32002816 | 0.74 |
Nsg2 |
neuron specific gene family member 2 |
2056 |
0.35 |
chr6_88872932_88873571 | 0.74 |
Podxl2 |
podocalyxin-like 2 |
794 |
0.47 |
chr5_112574293_112574972 | 0.74 |
Sez6l |
seizure related 6 homolog like |
2236 |
0.24 |
chrX_95166552_95167109 | 0.74 |
Arhgef9 |
CDC42 guanine nucleotide exchange factor (GEF) 9 |
291 |
0.93 |
chr12_29537800_29538885 | 0.74 |
Myt1l |
myelin transcription factor 1-like |
3120 |
0.28 |
chr12_31711352_31711698 | 0.73 |
Gpr22 |
G protein-coupled receptor 22 |
2401 |
0.25 |
chr4_82592492_82592787 | 0.73 |
Gm11267 |
predicted gene 11267 |
5320 |
0.25 |
chr4_13757978_13758129 | 0.73 |
Runx1t1 |
RUNX1 translocation partner 1 |
6756 |
0.31 |
chr3_58417834_58418696 | 0.73 |
Tsc22d2 |
TSC22 domain family, member 2 |
781 |
0.64 |
chr17_42852465_42852618 | 0.73 |
Cd2ap |
CD2-associated protein |
21511 |
0.25 |
chr6_5110035_5110504 | 0.73 |
Ppp1r9a |
protein phosphatase 1, regulatory subunit 9A |
390 |
0.89 |
chr10_110454344_110454630 | 0.73 |
Nav3 |
neuron navigator 3 |
1717 |
0.42 |
chr5_70359538_70359689 | 0.73 |
Gm23067 |
predicted gene, 23067 |
172767 |
0.03 |
chr2_112268023_112268203 | 0.72 |
Slc12a6 |
solute carrier family 12, member 6 |
1294 |
0.28 |
chr1_169934022_169934472 | 0.72 |
Gm15852 |
predicted gene 15852 |
1 |
0.97 |
chr8_32881830_32882097 | 0.72 |
Nrg1 |
neuregulin 1 |
1899 |
0.46 |
chr7_44443183_44443767 | 0.72 |
Lrrc4b |
leucine rich repeat containing 4B |
738 |
0.4 |
chr1_54690497_54691039 | 0.72 |
Ankrd44 |
ankyrin repeat domain 44 |
179 |
0.62 |
chr8_8658122_8658842 | 0.72 |
Efnb2 |
ephrin B2 |
2757 |
0.13 |
chr3_28264634_28265464 | 0.72 |
Tnik |
TRAF2 and NCK interacting kinase |
1406 |
0.45 |
chr4_36949065_36949216 | 0.72 |
Lingo2 |
leucine rich repeat and Ig domain containing 2 |
1327 |
0.49 |
chr4_22485088_22485284 | 0.72 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
3180 |
0.21 |
chr4_125488664_125489133 | 0.72 |
Grik3 |
glutamate receptor, ionotropic, kainate 3 |
1802 |
0.36 |
chr18_65076749_65077022 | 0.72 |
Nedd4l |
neural precursor cell expressed, developmentally down-regulated gene 4-like |
546 |
0.83 |
chr2_72978014_72978165 | 0.71 |
Sp3 |
trans-acting transcription factor 3 |
1197 |
0.31 |
chr14_7774273_7774663 | 0.71 |
Gm10044 |
predicted gene 10044 |
329 |
0.85 |
chr7_139978745_139979435 | 0.71 |
Spef1l |
sperm flagellar 1 like |
335 |
0.7 |
chr4_49596056_49596258 | 0.71 |
Tmem246 |
transmembrane protein 246 |
1313 |
0.41 |
chr16_28751131_28751282 | 0.71 |
Fgf12 |
fibroblast growth factor 12 |
1862 |
0.48 |
chr10_33621658_33622333 | 0.71 |
Gm47911 |
predicted gene, 47911 |
286 |
0.85 |
chr9_4791870_4792180 | 0.71 |
Gria4 |
glutamate receptor, ionotropic, AMPA4 (alpha 4) |
3494 |
0.38 |
chr16_23989001_23989625 | 0.70 |
Bcl6 |
B cell leukemia/lymphoma 6 |
461 |
0.64 |
chr14_117895283_117895843 | 0.70 |
Mir6239 |
microRNA 6239 |
58284 |
0.14 |
chr1_26388093_26388357 | 0.70 |
Gm19123 |
predicted gene, 19123 |
78011 |
0.12 |
chrX_105389448_105389994 | 0.70 |
5330434G04Rik |
RIKEN cDNA 5330434G04 gene |
1807 |
0.32 |
chr8_61227047_61227224 | 0.70 |
Sh3rf1 |
SH3 domain containing ring finger 1 |
2891 |
0.27 |
chr5_74676974_74677904 | 0.70 |
Lnx1 |
ligand of numb-protein X 1 |
190 |
0.94 |
chr6_87009927_87010721 | 0.70 |
Nfu1 |
NFU1 iron-sulfur cluster scaffold |
321 |
0.85 |
chr8_25911399_25912280 | 0.70 |
Kcnu1 |
potassium channel, subfamily U, member 1 |
147 |
0.95 |
chr18_38804114_38805013 | 0.70 |
Gm8302 |
predicted gene 8302 |
32216 |
0.15 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.3 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
1.0 | 3.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.8 | 2.4 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.5 | 0.5 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.4 | 2.1 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.4 | 1.3 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.4 | 1.6 | GO:0060486 | Clara cell differentiation(GO:0060486) |
0.4 | 1.9 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.4 | 1.1 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
0.4 | 1.1 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.4 | 0.4 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.3 | 1.0 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.3 | 1.0 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
0.3 | 1.6 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.3 | 0.9 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.3 | 0.9 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.3 | 0.9 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.3 | 1.5 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.3 | 1.5 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.3 | 0.9 | GO:0007525 | somatic muscle development(GO:0007525) |
0.3 | 1.2 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
0.3 | 0.9 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.3 | 0.8 | GO:0090259 | regulation of retinal ganglion cell axon guidance(GO:0090259) |
0.3 | 1.1 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
0.3 | 1.4 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.3 | 0.8 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.3 | 1.6 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.3 | 0.8 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.3 | 2.9 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.3 | 0.5 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.3 | 1.0 | GO:0008228 | opsonization(GO:0008228) |
0.3 | 0.8 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.3 | 1.0 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.2 | 1.7 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.2 | 1.2 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.2 | 0.5 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.2 | 2.8 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.2 | 0.9 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
0.2 | 0.5 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
0.2 | 1.1 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
0.2 | 0.2 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.2 | 0.7 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.2 | 0.7 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.2 | 2.4 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.2 | 0.7 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.2 | 0.7 | GO:0010649 | regulation of cell communication by electrical coupling(GO:0010649) |
0.2 | 0.8 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.2 | 0.8 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.2 | 0.6 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.2 | 0.4 | GO:0046959 | habituation(GO:0046959) |
0.2 | 0.6 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.2 | 0.8 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.2 | 0.6 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.2 | 0.6 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.2 | 0.8 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.2 | 0.2 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.2 | 0.4 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.2 | 0.6 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.2 | 2.1 | GO:1902547 | regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902547) |
0.2 | 1.0 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.2 | 0.8 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.2 | 0.6 | GO:2000847 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.2 | 0.8 | GO:0080009 | mRNA methylation(GO:0080009) |
0.2 | 0.6 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.2 | 1.1 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.2 | 0.5 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.2 | 0.9 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.2 | 0.5 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.2 | 0.5 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.2 | 0.2 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
0.2 | 1.4 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.2 | 0.5 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.2 | 1.0 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.2 | 0.7 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
0.2 | 0.5 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.2 | 0.2 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.2 | 0.7 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.2 | 1.3 | GO:0071625 | vocalization behavior(GO:0071625) |
0.2 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.2 | 0.5 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
0.2 | 0.5 | GO:0060618 | nipple development(GO:0060618) |
0.2 | 1.6 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
0.2 | 0.5 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.2 | 0.5 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.2 | 0.5 | GO:0008050 | female courtship behavior(GO:0008050) |
0.2 | 0.6 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.2 | 0.6 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.2 | 0.5 | GO:1902996 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.2 | 0.6 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.2 | 0.9 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.4 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 0.3 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.1 | 0.4 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.1 | 0.4 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.1 | 0.9 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.1 | 0.7 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 0.6 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 0.4 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.1 | 0.4 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 1.1 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
0.1 | 0.4 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 0.3 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.1 | 0.4 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.1 | 0.4 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.1 | 0.6 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.1 | 0.3 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.1 | 1.2 | GO:0045176 | apical protein localization(GO:0045176) |
0.1 | 0.8 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 0.4 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.1 | 0.5 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.1 | 0.4 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.1 | 3.0 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.1 | 0.3 | GO:2000320 | negative regulation of T-helper 17 type immune response(GO:2000317) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
0.1 | 0.4 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.1 | 0.4 | GO:0015819 | lysine transport(GO:0015819) |
0.1 | 0.1 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
0.1 | 0.8 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.1 | 0.8 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
0.1 | 0.3 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.1 | 0.4 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.1 | 0.5 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.1 | 0.5 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.1 | 0.5 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.1 | 0.4 | GO:1902219 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.1 | 0.4 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.1 | 0.3 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.1 | 0.1 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
0.1 | 0.4 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 0.2 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
0.1 | 0.4 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.1 | 0.6 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.1 | 0.5 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.1 | 1.3 | GO:0006999 | nuclear pore organization(GO:0006999) |
0.1 | 0.6 | GO:0035826 | rubidium ion transport(GO:0035826) |
0.1 | 0.2 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.1 | 0.4 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.1 | 0.4 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.1 | 1.8 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 0.4 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.1 | 0.1 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.1 | 0.4 | GO:1903969 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
0.1 | 0.8 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.1 | 0.3 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.1 | 0.3 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.1 | 0.3 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.1 | 0.3 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 1.5 | GO:0006828 | manganese ion transport(GO:0006828) |
0.1 | 0.4 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 0.3 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.1 | 0.2 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.1 | 1.1 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.1 | 0.3 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.1 | 0.3 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
0.1 | 0.6 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.1 | 1.0 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.1 | 0.6 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.1 | 0.6 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.1 | 0.2 | GO:0033121 | regulation of purine nucleotide catabolic process(GO:0033121) |
0.1 | 0.6 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
0.1 | 0.2 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
0.1 | 0.2 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.1 | 0.2 | GO:0097048 | dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
0.1 | 0.2 | GO:1902661 | regulation of glucose mediated signaling pathway(GO:1902659) positive regulation of glucose mediated signaling pathway(GO:1902661) |
0.1 | 1.1 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.1 | 0.5 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.5 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.1 | 0.8 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.1 | 0.3 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.1 | 0.6 | GO:1902019 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
0.1 | 0.4 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
0.1 | 0.7 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
0.1 | 0.4 | GO:0030035 | microspike assembly(GO:0030035) |
0.1 | 0.2 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.1 | 3.2 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
0.1 | 0.8 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.1 | 0.3 | GO:0030242 | pexophagy(GO:0030242) |
0.1 | 0.2 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.1 | 0.3 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.6 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.3 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.1 | 0.4 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
0.1 | 0.2 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.1 | 0.4 | GO:0006057 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.1 | 1.2 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.1 | 1.5 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.1 | 0.4 | GO:0048478 | replication fork protection(GO:0048478) |
0.1 | 0.3 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.1 | 0.3 | GO:0003284 | septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
0.1 | 0.2 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.1 | 0.4 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.1 | 0.3 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.1 | 1.1 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.1 | 0.3 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.1 | 0.3 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.1 | 0.6 | GO:0008088 | axo-dendritic transport(GO:0008088) |
0.1 | 0.3 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.1 | 0.2 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.1 | 0.9 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.1 | 0.4 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.1 | 0.2 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.1 | 0.5 | GO:0015808 | L-alanine transport(GO:0015808) |
0.1 | 0.6 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.1 | 1.7 | GO:0060074 | synapse maturation(GO:0060074) |
0.1 | 0.3 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.1 | 0.3 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.1 | 1.0 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.1 | 0.3 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 0.7 | GO:0014072 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
0.1 | 0.1 | GO:0002093 | auditory receptor cell morphogenesis(GO:0002093) |
0.1 | 0.6 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.3 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 1.7 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.1 | 0.2 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 0.5 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.1 | 1.1 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
0.1 | 0.3 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.1 | 0.1 | GO:0052041 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.1 | 0.2 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.1 | 0.2 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.1 | 0.3 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.1 | 0.4 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.1 | 0.5 | GO:0015867 | ATP transport(GO:0015867) |
0.1 | 0.8 | GO:2001044 | regulation of integrin-mediated signaling pathway(GO:2001044) |
0.1 | 1.9 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
0.1 | 0.2 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.1 | 0.4 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.1 | 0.5 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.1 | 0.3 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.1 | 0.3 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.1 | 0.3 | GO:0061038 | uterus morphogenesis(GO:0061038) |
0.1 | 0.6 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.1 | 0.3 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.1 | 0.4 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.1 | 0.5 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.1 | 0.4 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.3 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
0.1 | 0.3 | GO:0032202 | telomere assembly(GO:0032202) |
0.1 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.1 | 0.4 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.1 | 0.4 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.3 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.1 | 0.5 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.1 | 0.1 | GO:0071047 | nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
0.1 | 0.3 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 0.7 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
0.1 | 0.8 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.1 | 0.3 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.1 | 0.4 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.1 | 0.5 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.1 | 0.1 | GO:0045829 | negative regulation of isotype switching(GO:0045829) |
0.1 | 0.3 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.1 | 0.2 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
0.1 | 0.4 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.1 | 0.3 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 0.8 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.1 | 0.2 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.1 | 0.2 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 0.1 | GO:2000121 | regulation of removal of superoxide radicals(GO:2000121) |
0.1 | 0.3 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.1 | 0.5 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.1 | 0.2 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.1 | 0.5 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.1 | 0.2 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.1 | 0.7 | GO:0097049 | motor neuron apoptotic process(GO:0097049) regulation of motor neuron apoptotic process(GO:2000671) |
0.1 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.1 | 0.3 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.1 | 0.7 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.1 | 0.5 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.1 | 0.2 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) |
0.1 | 0.2 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.1 | 0.6 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.1 | 0.1 | GO:0045760 | positive regulation of action potential(GO:0045760) |
0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.2 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.1 | 0.2 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.1 | 2.0 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.1 | 0.2 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
0.1 | 0.7 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.1 | 0.3 | GO:0000012 | single strand break repair(GO:0000012) |
0.1 | 0.5 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.1 | 0.2 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.1 | 0.1 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.1 | 0.2 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.1 | 0.1 | GO:0042416 | dopamine biosynthetic process(GO:0042416) |
0.1 | 0.2 | GO:0070384 | Harderian gland development(GO:0070384) |
0.1 | 0.2 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.1 | 0.2 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
0.1 | 0.7 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.1 | 0.4 | GO:0021756 | striatum development(GO:0021756) |
0.1 | 0.2 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.1 | 0.2 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.1 | 0.1 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.1 | 0.4 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
0.1 | 0.2 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.1 | 0.1 | GO:0014055 | acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
0.1 | 0.2 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.1 | 0.4 | GO:2001223 | negative regulation of neuron migration(GO:2001223) |
0.1 | 0.2 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.1 | 1.1 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.1 | 0.1 | GO:0098597 | observational learning(GO:0098597) |
0.1 | 0.2 | GO:0048842 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
0.1 | 0.4 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.1 | 0.1 | GO:0006868 | glutamine transport(GO:0006868) |
0.1 | 0.1 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.1 | 0.1 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.1 | 0.8 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.1 | 0.3 | GO:0051593 | response to folic acid(GO:0051593) |
0.1 | 0.4 | GO:0061591 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
0.1 | 0.1 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
0.1 | 0.4 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.1 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.1 | 0.2 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.1 | 0.1 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.2 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.1 | 4.1 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.1 | 0.3 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.1 | 0.5 | GO:0097264 | self proteolysis(GO:0097264) |
0.1 | 0.3 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 0.2 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.1 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.1 | 0.6 | GO:0007097 | nuclear migration(GO:0007097) |
0.1 | 0.3 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.1 | 0.1 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.1 | 0.1 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.1 | 0.1 | GO:0009188 | ribonucleoside diphosphate biosynthetic process(GO:0009188) |
0.1 | 0.4 | GO:0086011 | membrane repolarization during action potential(GO:0086011) |
0.1 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.4 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.1 | 0.3 | GO:0060353 | regulation of cell adhesion molecule production(GO:0060353) |
0.1 | 0.2 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.1 | 0.3 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.1 | 0.5 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.3 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.1 | 0.1 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.1 | 0.3 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.1 | GO:0070671 | response to interleukin-12(GO:0070671) |
0.1 | 0.1 | GO:0051645 | Golgi localization(GO:0051645) |
0.1 | 0.3 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
0.1 | 0.4 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.1 | 0.3 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 1.1 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.1 | 0.3 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.1 | 0.1 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.1 | 0.5 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.1 | 0.2 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.1 | 0.1 | GO:1901881 | positive regulation of microtubule depolymerization(GO:0031117) positive regulation of protein depolymerization(GO:1901881) |
0.1 | 0.6 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
0.1 | 0.2 | GO:0055119 | relaxation of cardiac muscle(GO:0055119) |
0.1 | 0.5 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.1 | 0.2 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.1 | 0.2 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.1 | 0.1 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.1 | 0.2 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.1 | 0.1 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.1 | 0.1 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.1 | 0.3 | GO:0060292 | long term synaptic depression(GO:0060292) |
0.1 | 0.1 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.1 | 0.1 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.1 | 0.3 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.1 | 0.2 | GO:0034351 | negative regulation of glial cell apoptotic process(GO:0034351) |
0.1 | 0.3 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.1 | 0.1 | GO:0007228 | signal transduction downstream of smoothened(GO:0007227) positive regulation of hh target transcription factor activity(GO:0007228) |
0.1 | 0.1 | GO:0035524 | proline transmembrane transport(GO:0035524) |
0.1 | 0.3 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.1 | 0.3 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 0.2 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.1 | 0.2 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.1 | 0.1 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.1 | 0.1 | GO:0030202 | heparin metabolic process(GO:0030202) |
0.1 | 0.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 0.8 | GO:0042407 | cristae formation(GO:0042407) |
0.1 | 0.2 | GO:0048254 | snoRNA localization(GO:0048254) |
0.1 | 0.2 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.1 | 0.2 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.1 | 0.1 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
0.1 | 0.2 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 0.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.1 | 0.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.1 | 0.2 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.1 | 0.4 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.1 | 0.7 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.1 | 0.3 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.1 | 0.1 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.1 | 0.1 | GO:0001806 | type IV hypersensitivity(GO:0001806) |
0.1 | 0.1 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.1 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.1 | 0.2 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.1 | 0.2 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.1 | 0.2 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
0.1 | 0.2 | GO:1900738 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.1 | 0.1 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.1 | 0.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 0.7 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.1 | 0.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.1 | 0.1 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.1 | 0.2 | GO:0002865 | negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) |
0.1 | 0.2 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.1 | 0.2 | GO:0046504 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.1 | 0.5 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
0.1 | 0.2 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.1 | 0.1 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.1 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.1 | 0.1 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
0.1 | 0.5 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.1 | 0.1 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.1 | 0.1 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.1 | 0.2 | GO:0072310 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
0.1 | 0.2 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.1 | 0.1 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.1 | 0.3 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.1 | 0.2 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.1 | 0.1 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
0.1 | 0.2 | GO:0045909 | positive regulation of vasodilation(GO:0045909) |
0.1 | 0.2 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
0.1 | 0.2 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.1 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.1 | 0.2 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.1 | 0.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.1 | 0.3 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.1 | 1.1 | GO:0019228 | neuronal action potential(GO:0019228) |
0.1 | 0.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.1 | 0.2 | GO:0030432 | peristalsis(GO:0030432) |
0.1 | 0.2 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.1 | 0.3 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.1 | 0.1 | GO:0051231 | spindle elongation(GO:0051231) |
0.1 | 0.2 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.2 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
0.1 | 0.4 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.1 | 0.2 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.1 | 0.3 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.1 | 0.2 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.1 | 0.3 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.1 | 0.3 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
0.1 | 1.2 | GO:0003254 | regulation of membrane depolarization(GO:0003254) |
0.1 | 0.2 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.1 | 0.1 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.1 | 0.2 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.1 | 0.8 | GO:0005980 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
0.1 | 0.4 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.1 | 1.1 | GO:0035249 | synaptic transmission, glutamatergic(GO:0035249) |
0.1 | 0.3 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.1 | 2.4 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.1 | 0.1 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
0.1 | 0.2 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.1 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.4 | GO:0043368 | positive T cell selection(GO:0043368) |
0.1 | 0.2 | GO:1903203 | neuron death in response to oxidative stress(GO:0036475) regulation of oxidative stress-induced neuron death(GO:1903203) |
0.1 | 0.8 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
0.1 | 1.4 | GO:0007032 | endosome organization(GO:0007032) |
0.1 | 0.4 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.1 | 0.2 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.1 | 0.1 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.1 | 0.2 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.1 | 0.2 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.1 | 0.2 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.1 | 0.3 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.1 | 0.3 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 0.5 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.1 | 0.1 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.1 | 0.1 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.1 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
0.1 | 0.4 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.1 | 0.3 | GO:0051775 | response to redox state(GO:0051775) |
0.1 | 0.3 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.1 | 0.2 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.1 | 0.1 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.1 | 0.6 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.1 | 0.4 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
0.1 | 0.9 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
0.1 | 0.1 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.1 | 0.2 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.1 | 0.1 | GO:0042938 | dipeptide transport(GO:0042938) |
0.1 | 0.1 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
0.1 | 0.5 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.1 | 0.3 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.1 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.1 | 0.2 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.1 | 0.1 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.1 | 0.3 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.1 | 0.1 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.1 | 0.3 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.1 | 0.1 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.1 | 0.2 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
0.1 | 0.2 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.1 | 0.2 | GO:0032960 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
0.1 | 0.6 | GO:0022410 | circadian sleep/wake cycle process(GO:0022410) |
0.1 | 0.4 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.1 | 0.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.1 | 0.1 | GO:1903273 | regulation of sodium ion export(GO:1903273) positive regulation of sodium ion export(GO:1903275) regulation of sodium ion export from cell(GO:1903276) positive regulation of sodium ion export from cell(GO:1903278) |
0.1 | 0.3 | GO:0006089 | lactate metabolic process(GO:0006089) |
0.1 | 0.3 | GO:1900040 | regulation of interleukin-2 secretion(GO:1900040) positive regulation of interleukin-2 secretion(GO:1900042) |
0.0 | 0.1 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.0 | 0.1 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.0 | 1.2 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
0.0 | 0.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.0 | 0.2 | GO:0019471 | 4-hydroxyproline metabolic process(GO:0019471) |
0.0 | 0.5 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 0.3 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.0 | 0.2 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
0.0 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.0 | 0.4 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
0.0 | 0.1 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
0.0 | 0.1 | GO:0031635 | adenylate cyclase-inhibiting opioid receptor signaling pathway(GO:0031635) |
0.0 | 0.1 | GO:0070295 | renal water absorption(GO:0070295) |
0.0 | 0.0 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.2 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.7 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
0.0 | 0.2 | GO:0030812 | negative regulation of nucleotide catabolic process(GO:0030812) negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
0.0 | 0.4 | GO:0060079 | excitatory postsynaptic potential(GO:0060079) |
0.0 | 0.1 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
0.0 | 0.0 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.0 | 0.2 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
0.0 | 0.2 | GO:0032230 | positive regulation of synaptic transmission, GABAergic(GO:0032230) |
0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.3 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.0 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
0.0 | 0.0 | GO:0034214 | protein hexamerization(GO:0034214) |
0.0 | 0.0 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.0 | 0.3 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
0.0 | 0.2 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.4 | GO:0097320 | membrane tubulation(GO:0097320) |
0.0 | 0.2 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.0 | 0.0 | GO:1902896 | terminal web assembly(GO:1902896) |
0.0 | 0.3 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.3 | GO:0010642 | negative regulation of platelet-derived growth factor receptor signaling pathway(GO:0010642) |
0.0 | 0.2 | GO:0019532 | oxalate transport(GO:0019532) |
0.0 | 1.0 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
0.0 | 0.1 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.5 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.0 | GO:0010359 | regulation of anion channel activity(GO:0010359) |
0.0 | 0.1 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.0 | 0.1 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.0 | 0.2 | GO:1901660 | calcium ion export(GO:1901660) |
0.0 | 0.3 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.0 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.1 | GO:2000389 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.2 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
0.0 | 0.3 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.0 | 0.2 | GO:0072610 | interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) |
0.0 | 0.1 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.0 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.0 | 1.5 | GO:0030032 | lamellipodium assembly(GO:0030032) |
0.0 | 0.0 | GO:0019346 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.0 | 0.2 | GO:0060078 | regulation of postsynaptic membrane potential(GO:0060078) |
0.0 | 0.1 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.0 | 0.1 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.0 | 0.1 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.0 | 0.3 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.0 | 0.4 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.0 | 0.3 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.0 | 0.2 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.0 | 0.1 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.0 | 0.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.1 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.0 | 0.2 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.2 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.0 | 0.0 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.1 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.0 | 0.2 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.1 | GO:0070842 | aggresome assembly(GO:0070842) |
0.0 | 0.1 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.0 | 0.1 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.0 | 0.4 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.2 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
0.0 | 0.4 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.0 | 0.1 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.0 | 0.2 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
0.0 | 0.2 | GO:0050432 | catecholamine secretion(GO:0050432) |
0.0 | 0.6 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
0.0 | 0.2 | GO:0097461 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.0 | 0.5 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.4 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
0.0 | 0.2 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.0 | 0.1 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.0 | 0.1 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.0 | 0.0 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.0 | 0.1 | GO:0032328 | alanine transport(GO:0032328) |
0.0 | 0.1 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.0 | 0.2 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.0 | GO:0061724 | lipophagy(GO:0061724) |
0.0 | 0.5 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.0 | 0.3 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
0.0 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.0 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.0 | 0.2 | GO:2000316 | regulation of T-helper 17 type immune response(GO:2000316) |
0.0 | 0.2 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.2 | GO:0022605 | oogenesis stage(GO:0022605) |
0.0 | 0.1 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.0 | 0.8 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
0.0 | 0.3 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.0 | 0.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.0 | 0.2 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.0 | 0.3 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.0 | 0.1 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.0 | 0.1 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.0 | 0.1 | GO:0015888 | thiamine transport(GO:0015888) |
0.0 | 0.0 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.0 | 0.2 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.1 | GO:0046606 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.0 | 0.0 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.0 | 0.9 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.2 | GO:0072538 | T-helper 17 type immune response(GO:0072538) |
0.0 | 0.3 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.0 | 0.3 | GO:0045652 | regulation of megakaryocyte differentiation(GO:0045652) |
0.0 | 0.1 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
0.0 | 0.2 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.0 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
0.0 | 0.0 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
0.0 | 0.2 | GO:0007207 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 2.7 | GO:0008033 | tRNA processing(GO:0008033) |
0.0 | 0.1 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.0 | 0.2 | GO:0001810 | regulation of type I hypersensitivity(GO:0001810) type I hypersensitivity(GO:0016068) |
0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.4 | GO:0045056 | transcytosis(GO:0045056) |
0.0 | 0.0 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) |
0.0 | 0.1 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 2.6 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 0.2 | GO:0060179 | male mating behavior(GO:0060179) |
0.0 | 0.5 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.0 | 0.3 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.0 | 0.1 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.0 | 0.1 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.0 | 0.0 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.0 | 0.4 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
0.0 | 0.1 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.0 | 0.4 | GO:0007616 | long-term memory(GO:0007616) |
0.0 | 0.2 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.0 | 0.2 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.1 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
0.0 | 0.1 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
0.0 | 0.3 | GO:0097178 | ruffle assembly(GO:0097178) |
0.0 | 0.1 | GO:0002349 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
0.0 | 0.2 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
0.0 | 0.1 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.0 | 0.0 | GO:0072711 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
0.0 | 0.0 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
0.0 | 0.2 | GO:0050850 | positive regulation of calcium-mediated signaling(GO:0050850) |
0.0 | 0.0 | GO:0072553 | terminal button organization(GO:0072553) |
0.0 | 0.0 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.0 | 0.2 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.0 | 0.3 | GO:0033198 | response to ATP(GO:0033198) |
0.0 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.1 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.0 | 0.3 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.0 | 0.1 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.0 | 0.0 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.0 | 0.1 | GO:0010511 | regulation of phosphatidylinositol biosynthetic process(GO:0010511) |
0.0 | 0.1 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.0 | 0.0 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.0 | 0.1 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.0 | 0.1 | GO:0035912 | dorsal aorta development(GO:0035907) dorsal aorta morphogenesis(GO:0035912) |
0.0 | 0.1 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.0 | 0.4 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.0 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.0 | 0.2 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.1 | GO:0060117 | auditory receptor cell development(GO:0060117) |
0.0 | 0.0 | GO:2000412 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
0.0 | 0.1 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.0 | 0.2 | GO:0040018 | positive regulation of multicellular organism growth(GO:0040018) |
0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.3 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.0 | 0.0 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.0 | 0.2 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.1 | GO:0002692 | negative regulation of cellular extravasation(GO:0002692) |
0.0 | 0.0 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.1 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.0 | 0.0 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.3 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.0 | 0.0 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.0 | 0.1 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.0 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.1 | GO:0043545 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.0 | 0.1 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.1 | GO:0002767 | immune response-inhibiting signal transduction(GO:0002765) immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
0.0 | 0.1 | GO:0030252 | growth hormone secretion(GO:0030252) |
0.0 | 0.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.0 | 0.9 | GO:0043266 | regulation of potassium ion transport(GO:0043266) |
0.0 | 0.1 | GO:0044381 | glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
0.0 | 0.0 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.0 | 0.1 | GO:0051452 | intracellular pH reduction(GO:0051452) |
0.0 | 0.2 | GO:1903077 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
0.0 | 0.0 | GO:1904124 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.0 | 0.1 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.0 | 0.5 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.0 | 1.0 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.1 | GO:1903624 | regulation of DNA catabolic process(GO:1903624) |
0.0 | 0.2 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.0 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.0 | GO:0098787 | mRNA cleavage involved in mRNA processing(GO:0098787) |
0.0 | 2.0 | GO:0043123 | positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
0.0 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.0 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.0 | 0.1 | GO:0002035 | regulation of blood volume by renin-angiotensin(GO:0002016) brain renin-angiotensin system(GO:0002035) |
0.0 | 0.1 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.0 | 0.0 | GO:0018377 | protein myristoylation(GO:0018377) |
0.0 | 0.1 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.0 | 0.6 | GO:0051591 | response to cAMP(GO:0051591) |
0.0 | 0.1 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.0 | 0.1 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.3 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
0.0 | 0.4 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
0.0 | 0.0 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.0 | 0.1 | GO:0046078 | dUMP metabolic process(GO:0046078) |
0.0 | 0.2 | GO:0001508 | action potential(GO:0001508) |
0.0 | 0.3 | GO:0009303 | rRNA transcription(GO:0009303) |
0.0 | 0.1 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.1 | GO:1902307 | positive regulation of sodium ion transmembrane transport(GO:1902307) |
0.0 | 0.2 | GO:0051383 | kinetochore assembly(GO:0051382) kinetochore organization(GO:0051383) |
0.0 | 0.2 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.0 | 0.1 | GO:0010737 | protein kinase A signaling(GO:0010737) |
0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.0 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
0.0 | 0.1 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.0 | 0.0 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.0 | 0.1 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.0 | 0.1 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.0 | 0.1 | GO:0014046 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
0.0 | 0.2 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.0 | 0.1 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
0.0 | 0.5 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.4 | GO:0046326 | positive regulation of glucose import(GO:0046326) |
0.0 | 0.1 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) |
0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.0 | 0.2 | GO:0006415 | translational termination(GO:0006415) |
0.0 | 0.3 | GO:0061512 | protein localization to cilium(GO:0061512) |
0.0 | 0.1 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.0 | 0.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.1 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.0 | 0.6 | GO:0099518 | vesicle cytoskeletal trafficking(GO:0099518) |
0.0 | 0.0 | GO:1903596 | regulation of gap junction assembly(GO:1903596) |
0.0 | 0.1 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.0 | 0.0 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.0 | 0.2 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
0.0 | 0.2 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.0 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.0 | 0.1 | GO:0002931 | response to ischemia(GO:0002931) |
0.0 | 0.5 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.0 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.2 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.1 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.0 | 0.1 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.0 | 0.4 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.0 | 0.4 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.0 | 0.1 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.0 | 0.1 | GO:0006984 | ER-nucleus signaling pathway(GO:0006984) |
0.0 | 0.1 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.2 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.4 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.7 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
0.0 | 0.0 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.0 | 0.1 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.0 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.0 | 0.1 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.0 | 0.1 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.0 | 1.9 | GO:0000910 | cytokinesis(GO:0000910) |
0.0 | 0.2 | GO:1901317 | regulation of sperm motility(GO:1901317) |
0.0 | 0.1 | GO:0006198 | cAMP catabolic process(GO:0006198) |
0.0 | 0.1 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.0 | 0.7 | GO:0070373 | negative regulation of ERK1 and ERK2 cascade(GO:0070373) |
0.0 | 0.2 | GO:0022010 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
0.0 | 0.1 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.0 | 0.1 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.0 | 0.2 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.0 | 0.1 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.0 | 2.1 | GO:0016358 | dendrite development(GO:0016358) |
0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.1 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.0 | 0.2 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
0.0 | 0.2 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.8 | GO:1902653 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
0.0 | 0.2 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
0.0 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.0 | 0.1 | GO:0015822 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.0 | 0.4 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
0.0 | 0.1 | GO:0090399 | replicative senescence(GO:0090399) |
0.0 | 0.0 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.0 | 0.1 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
0.0 | 0.1 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.0 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.0 | 0.1 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.0 | 0.2 | GO:0042773 | ATP synthesis coupled electron transport(GO:0042773) |
0.0 | 0.1 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.0 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.0 | 0.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.0 | 0.2 | GO:0022616 | DNA strand elongation involved in DNA replication(GO:0006271) DNA strand elongation(GO:0022616) |
0.0 | 1.4 | GO:0044839 | cell cycle G2/M phase transition(GO:0044839) |
0.0 | 0.3 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.0 | 0.3 | GO:0006301 | postreplication repair(GO:0006301) |
0.0 | 0.3 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.1 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.0 | 0.0 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
0.0 | 1.0 | GO:0008277 | regulation of G-protein coupled receptor protein signaling pathway(GO:0008277) |
0.0 | 0.5 | GO:0043631 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
0.0 | 0.0 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.5 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.3 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
0.0 | 0.0 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.6 | GO:0042461 | photoreceptor cell development(GO:0042461) |
0.0 | 0.1 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.0 | 0.0 | GO:0032239 | regulation of nucleobase-containing compound transport(GO:0032239) |
0.0 | 0.2 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.0 | 0.0 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
0.0 | 0.2 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.0 | 0.1 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
0.0 | 0.0 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.0 | 0.0 | GO:0031652 | positive regulation of fever generation(GO:0031622) regulation of heat generation(GO:0031650) positive regulation of heat generation(GO:0031652) |
0.0 | 0.1 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 0.3 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
0.0 | 0.0 | GO:0048102 | autophagic cell death(GO:0048102) |
0.0 | 0.2 | GO:0051281 | positive regulation of release of sequestered calcium ion into cytosol(GO:0051281) |
0.0 | 0.0 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.0 | 0.0 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.0 | 0.2 | GO:0046580 | negative regulation of Ras protein signal transduction(GO:0046580) negative regulation of small GTPase mediated signal transduction(GO:0051058) |
0.0 | 0.0 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
0.0 | 0.0 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.0 | 0.1 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.0 | 0.3 | GO:0007040 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
0.0 | 0.1 | GO:0030889 | negative regulation of B cell proliferation(GO:0030889) |
0.0 | 0.0 | GO:0042523 | positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
0.0 | 0.3 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.0 | 2.0 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
0.0 | 0.1 | GO:0051044 | regulation of membrane protein ectodomain proteolysis(GO:0051043) positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.0 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.0 | 0.1 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.0 | 0.2 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.0 | 0.1 | GO:0032570 | response to progesterone(GO:0032570) |
0.0 | 0.3 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.1 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.2 | GO:0007340 | acrosome reaction(GO:0007340) |
0.0 | 0.0 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.1 | GO:0090169 | regulation of spindle assembly(GO:0090169) |
0.0 | 0.0 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.0 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.0 | 0.0 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
0.0 | 0.3 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
0.0 | 0.0 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.0 | 0.1 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.0 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.0 | 0.0 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.0 | 0.0 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.0 | 0.2 | GO:0048240 | sperm capacitation(GO:0048240) |
0.0 | 0.1 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.0 | 0.0 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.0 | 0.4 | GO:0050798 | activated T cell proliferation(GO:0050798) |
0.0 | 0.0 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.0 | 0.1 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
0.0 | 0.2 | GO:0043113 | receptor clustering(GO:0043113) |
0.0 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
0.0 | 0.6 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
0.0 | 0.2 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.6 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.0 | 0.0 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.0 | 0.1 | GO:0000959 | mitochondrial RNA metabolic process(GO:0000959) |
0.0 | 0.6 | GO:0006749 | glutathione metabolic process(GO:0006749) |
0.0 | 0.1 | GO:0043537 | negative regulation of blood vessel endothelial cell migration(GO:0043537) |
0.0 | 0.7 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.1 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.0 | 0.1 | GO:0090181 | regulation of cholesterol metabolic process(GO:0090181) |
0.0 | 0.0 | GO:0010460 | positive regulation of heart rate(GO:0010460) |
0.0 | 0.4 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.1 | GO:0051602 | response to electrical stimulus(GO:0051602) |
0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.0 | 0.0 | GO:0048311 | mitochondrion distribution(GO:0048311) |
0.0 | 0.0 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.0 | 0.0 | GO:0052312 | modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
0.0 | 0.0 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
0.0 | 0.0 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
0.0 | 0.3 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
0.0 | 0.2 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
0.0 | 0.1 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.2 | GO:0033006 | regulation of mast cell activation involved in immune response(GO:0033006) regulation of mast cell degranulation(GO:0043304) |
0.0 | 0.7 | GO:0006906 | vesicle fusion(GO:0006906) |
0.0 | 0.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.0 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.0 | 0.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.4 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.0 | 0.2 | GO:0046039 | GTP metabolic process(GO:0046039) |
0.0 | 0.3 | GO:0045576 | mast cell activation(GO:0045576) |
0.0 | 0.0 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
0.0 | 0.1 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.0 | 0.0 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.0 | 0.0 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.1 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.0 | 0.8 | GO:0007269 | neurotransmitter secretion(GO:0007269) signal release from synapse(GO:0099643) |
0.0 | 0.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.0 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.0 | 0.1 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.0 | 0.0 | GO:0006598 | polyamine catabolic process(GO:0006598) |
0.0 | 0.0 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.0 | 0.0 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.1 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.0 | 0.0 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.0 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.0 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
0.0 | 0.0 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.0 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.0 | 0.1 | GO:0051350 | negative regulation of lyase activity(GO:0051350) |
0.0 | 0.0 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.0 | 0.1 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.0 | GO:0046931 | pore complex assembly(GO:0046931) |
0.0 | 0.0 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.0 | 0.0 | GO:0030815 | negative regulation of cAMP metabolic process(GO:0030815) |
0.0 | 0.2 | GO:0031114 | regulation of microtubule depolymerization(GO:0031114) |
0.0 | 0.0 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.0 | 0.1 | GO:0048520 | positive regulation of behavior(GO:0048520) |
0.0 | 0.2 | GO:0048011 | neurotrophin TRK receptor signaling pathway(GO:0048011) |
0.0 | 0.1 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.0 | 0.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 0.0 | GO:0050705 | regulation of interleukin-1 alpha secretion(GO:0050705) |
0.0 | 0.0 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.0 | 0.1 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.0 | 0.1 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
0.0 | 0.1 | GO:0046836 | glycolipid transport(GO:0046836) |
0.0 | 0.0 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.2 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) |
0.0 | 0.2 | GO:0009060 | aerobic respiration(GO:0009060) |
0.0 | 0.0 | GO:0002360 | T cell lineage commitment(GO:0002360) |
0.0 | 0.0 | GO:0010288 | response to iron(II) ion(GO:0010040) response to lead ion(GO:0010288) |
0.0 | 0.0 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.1 | GO:0000338 | protein deneddylation(GO:0000338) |
0.0 | 0.0 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.0 | 0.0 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) |
0.0 | 0.5 | GO:0006986 | response to unfolded protein(GO:0006986) |
0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
0.0 | 0.0 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.0 | 0.1 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
0.0 | 0.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.0 | 0.0 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.0 | 0.0 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.0 | 0.0 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.0 | 0.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.0 | GO:0007567 | parturition(GO:0007567) |
0.0 | 0.1 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.0 | GO:0032831 | positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.0 | 0.0 | GO:0070266 | necroptotic process(GO:0070266) |
0.0 | 0.0 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
0.0 | 0.0 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
0.0 | 0.1 | GO:0030449 | regulation of complement activation(GO:0030449) |
0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.0 | GO:1903301 | positive regulation of hexokinase activity(GO:1903301) |
0.0 | 0.2 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
0.0 | 0.1 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.0 | 0.0 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
0.0 | 0.0 | GO:0042488 | positive regulation of odontogenesis of dentin-containing tooth(GO:0042488) positive regulation of enamel mineralization(GO:0070175) |
0.0 | 0.0 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.3 | GO:0043039 | tRNA aminoacylation(GO:0043039) |
0.0 | 0.0 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.0 | 0.0 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.0 | 0.0 | GO:0031272 | regulation of pseudopodium assembly(GO:0031272) |
0.0 | 0.0 | GO:0042026 | protein refolding(GO:0042026) |
0.0 | 0.1 | GO:0002021 | response to dietary excess(GO:0002021) |
0.0 | 0.1 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.0 | 0.1 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.0 | 0.1 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.3 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.0 | GO:0006101 | citrate metabolic process(GO:0006101) |
0.0 | 0.1 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
0.0 | 0.1 | GO:0072348 | sulfur compound transport(GO:0072348) |
0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.0 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.1 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.0 | 0.3 | GO:0060047 | heart contraction(GO:0060047) |
0.0 | 0.1 | GO:0001675 | acrosome assembly(GO:0001675) |
0.0 | 0.0 | GO:1902170 | cellular response to reactive nitrogen species(GO:1902170) |
0.0 | 0.1 | GO:0048278 | vesicle docking(GO:0048278) |
0.0 | 0.1 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.0 | 0.0 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.0 | 0.1 | GO:0098739 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) import across plasma membrane(GO:0098739) sodium ion import into cell(GO:1990118) |
0.0 | 0.0 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.0 | 0.0 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.3 | GO:0000956 | nuclear-transcribed mRNA catabolic process(GO:0000956) |
0.0 | 0.1 | GO:0042119 | neutrophil activation(GO:0042119) |
0.0 | 0.0 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.0 | 0.3 | GO:0035383 | acyl-CoA metabolic process(GO:0006637) thioester metabolic process(GO:0035383) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.7 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.5 | 1.4 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.4 | 0.4 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.3 | 0.3 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.2 | 0.5 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.2 | 1.7 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.2 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
0.2 | 1.5 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.2 | 2.3 | GO:0097449 | astrocyte projection(GO:0097449) |
0.2 | 3.6 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.2 | 1.5 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.2 | 0.4 | GO:1990635 | proximal dendrite(GO:1990635) |
0.2 | 0.6 | GO:0036396 | MIS complex(GO:0036396) |
0.2 | 0.8 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.2 | 0.6 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.2 | 0.4 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.2 | 2.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.2 | 0.6 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.2 | 0.3 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.2 | 0.8 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.2 | 0.5 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.2 | 0.5 | GO:0097443 | sorting endosome(GO:0097443) |
0.2 | 0.6 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.2 | 1.2 | GO:0042587 | glycogen granule(GO:0042587) |
0.2 | 0.3 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.2 | 0.6 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.3 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 5.7 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.1 | 6.4 | GO:0043198 | dendritic shaft(GO:0043198) |
0.1 | 0.6 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.1 | 0.4 | GO:0097513 | myosin II filament(GO:0097513) |
0.1 | 4.4 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 1.3 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 1.1 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.1 | 2.1 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.7 | GO:0000235 | astral microtubule(GO:0000235) |
0.1 | 2.8 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 0.5 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.1 | 0.6 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 0.4 | GO:0016939 | kinesin II complex(GO:0016939) |
0.1 | 0.4 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.1 | 1.0 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.1 | 0.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 0.6 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 0.4 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.1 | 0.7 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.1 | 1.5 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.1 | 0.6 | GO:0051286 | cell tip(GO:0051286) |
0.1 | 0.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 0.4 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.1 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 0.3 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.1 | 0.4 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.1 | 1.0 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.1 | 0.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 1.4 | GO:0031430 | M band(GO:0031430) |
0.1 | 0.1 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.1 | 1.9 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.1 | 0.3 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 1.0 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.3 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.1 | 0.4 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.1 | 0.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.3 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 0.7 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 0.3 | GO:0031417 | NatC complex(GO:0031417) |
0.1 | 1.9 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.1 | 0.2 | GO:0044393 | microspike(GO:0044393) |
0.1 | 0.8 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 0.5 | GO:0070695 | FHF complex(GO:0070695) |
0.1 | 0.3 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 0.5 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 0.4 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 0.2 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 0.6 | GO:0043194 | axon initial segment(GO:0043194) |
0.1 | 3.1 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 0.6 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.1 | 0.2 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.1 | 0.4 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 1.5 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.1 | 0.3 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.1 | 0.2 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 0.6 | GO:0005869 | dynactin complex(GO:0005869) |
0.1 | 0.4 | GO:0061617 | MICOS complex(GO:0061617) |
0.1 | 1.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 0.7 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.1 | 4.7 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.1 | 0.2 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.2 | GO:0042585 | germinal vesicle(GO:0042585) |
0.1 | 0.2 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.1 | 1.0 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.1 | 0.5 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 0.6 | GO:0031209 | SCAR complex(GO:0031209) |
0.1 | 0.5 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.1 | 1.2 | GO:0005682 | U5 snRNP(GO:0005682) |
0.1 | 1.6 | GO:0044295 | axonal growth cone(GO:0044295) |
0.1 | 0.7 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.1 | 0.3 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 0.5 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 7.0 | GO:0099572 | postsynaptic density(GO:0014069) postsynaptic specialization(GO:0099572) |
0.1 | 0.4 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.1 | 0.1 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.1 | 0.2 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.4 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 0.2 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.1 | 0.7 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.2 | GO:0043511 | inhibin complex(GO:0043511) |
0.1 | 0.1 | GO:0005818 | aster(GO:0005818) |
0.1 | 0.2 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.1 | 9.8 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.1 | 0.2 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.1 | 0.3 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.3 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.1 | 1.8 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.1 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.1 | 0.2 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.1 | 0.4 | GO:0016589 | NURF complex(GO:0016589) |
0.1 | 0.7 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.1 | 0.2 | GO:0070820 | tertiary granule(GO:0070820) |
0.1 | 0.3 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.1 | 0.4 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.1 | 0.4 | GO:0031931 | TORC1 complex(GO:0031931) |
0.1 | 0.4 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 0.4 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.1 | 0.4 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 0.3 | GO:0097433 | dense body(GO:0097433) |
0.1 | 0.3 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.1 | 0.9 | GO:0030904 | retromer complex(GO:0030904) |
0.1 | 4.7 | GO:0030427 | site of polarized growth(GO:0030427) |
0.1 | 0.3 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 0.5 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 0.8 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.1 | 0.5 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 0.7 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 3.4 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 0.7 | GO:0005686 | U2 snRNP(GO:0005686) |
0.1 | 0.2 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.1 | 0.3 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.2 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.1 | 1.6 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.1 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.1 | 0.5 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
0.1 | 0.5 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.1 | 0.2 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 0.4 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.2 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.1 | 0.5 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 0.7 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.1 | 0.5 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.1 | 0.6 | GO:0001891 | phagocytic cup(GO:0001891) |
0.1 | 0.6 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.1 | 2.5 | GO:0005643 | nuclear pore(GO:0005643) |
0.1 | 0.3 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 0.7 | GO:0043205 | fibril(GO:0043205) |
0.1 | 0.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.1 | 0.3 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 0.1 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.1 | 0.2 | GO:0035363 | histone locus body(GO:0035363) |
0.1 | 0.2 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.1 | 0.5 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.1 | 0.5 | GO:0022624 | proteasome accessory complex(GO:0022624) |
0.1 | 0.5 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.0 | 0.3 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.6 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.0 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.1 | GO:0030897 | HOPS complex(GO:0030897) |
0.0 | 0.1 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
0.0 | 0.1 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.3 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 0.5 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.0 | 0.0 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 1.2 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.4 | GO:1902562 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 0.5 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.2 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.0 | 1.7 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 2.1 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.0 | 0.2 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.4 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.2 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 1.1 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.0 | 0.4 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.7 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.0 | 0.3 | GO:0000243 | commitment complex(GO:0000243) |
0.0 | 0.2 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.9 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.2 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 0.1 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 0.3 | GO:0044452 | nucleolar part(GO:0044452) |
0.0 | 0.1 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.0 | 0.2 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 1.5 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.7 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.2 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.0 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.4 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.2 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.4 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.2 | GO:0033503 | HULC complex(GO:0033503) |
0.0 | 0.2 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.2 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.2 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.3 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.4 | GO:1990752 | microtubule end(GO:1990752) |
0.0 | 0.8 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.1 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.0 | 0.2 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
0.0 | 0.1 | GO:1990462 | omegasome(GO:1990462) |
0.0 | 0.2 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.8 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.4 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
0.0 | 0.3 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 0.1 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.3 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.2 | GO:0070187 | telosome(GO:0070187) |
0.0 | 0.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 3.7 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.3 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
0.0 | 0.3 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 4.4 | GO:0043209 | myelin sheath(GO:0043209) |
0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.0 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.1 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.1 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.9 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.0 | 0.0 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.2 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.0 | 0.1 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.1 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.0 | 0.8 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 0.6 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 2.2 | GO:0030139 | endocytic vesicle(GO:0030139) |
0.0 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 0.3 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.6 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.0 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.0 | 0.3 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.2 | GO:0043679 | axon terminus(GO:0043679) |
0.0 | 0.2 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.7 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 0.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.2 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.0 | 0.0 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 1.4 | GO:0044853 | plasma membrane raft(GO:0044853) |
0.0 | 0.0 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
0.0 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.0 | 0.3 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 3.2 | GO:0005765 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
0.0 | 0.0 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.0 | 0.4 | GO:0045120 | pronucleus(GO:0045120) |
0.0 | 0.2 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.1 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.1 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.0 | 0.1 | GO:0070938 | contractile ring(GO:0070938) |
0.0 | 0.6 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 0.4 | GO:0031672 | A band(GO:0031672) |
0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 1.1 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
0.0 | 0.7 | GO:0044309 | neuron spine(GO:0044309) |
0.0 | 1.2 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.2 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.5 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.5 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.4 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.0 | 0.2 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.4 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 0.0 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.4 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.0 | 0.5 | GO:0014704 | intercalated disc(GO:0014704) |
0.0 | 0.1 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
0.0 | 0.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.2 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.0 | 0.2 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.0 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
0.0 | 0.0 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.0 | 0.2 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.0 | 2.2 | GO:0045202 | synapse(GO:0045202) |
0.0 | 0.1 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.0 | 0.1 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 2.0 | GO:0031965 | nuclear membrane(GO:0031965) |
0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 0.5 | GO:0042641 | actomyosin(GO:0042641) |
0.0 | 4.2 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.0 | 3.0 | GO:0030425 | dendrite(GO:0030425) |
0.0 | 1.9 | GO:0005769 | early endosome(GO:0005769) |
0.0 | 0.0 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.0 | 0.9 | GO:0070382 | exocytic vesicle(GO:0070382) |
0.0 | 0.0 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
0.0 | 0.6 | GO:0031674 | I band(GO:0031674) |
0.0 | 0.2 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.0 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.8 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.7 | GO:0030027 | lamellipodium(GO:0030027) |
0.0 | 0.3 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.0 | GO:0033176 | proton-transporting V-type ATPase complex(GO:0033176) |
0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 15.2 | GO:0005739 | mitochondrion(GO:0005739) |
0.0 | 0.2 | GO:0005774 | vacuolar membrane(GO:0005774) |
0.0 | 0.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.0 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.0 | 0.0 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.4 | GO:0032040 | small-subunit processome(GO:0032040) |
0.0 | 0.0 | GO:0005767 | secondary lysosome(GO:0005767) |
0.0 | 0.1 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.0 | 0.0 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.0 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.0 | 0.0 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.0 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.0 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.0 | 0.0 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 1.0 | GO:0030424 | axon(GO:0030424) |
0.0 | 0.6 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.2 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.0 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.0 | 0.3 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.0 | 0.5 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.0 | 0.1 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.9 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.0 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.0 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.1 | GO:0030894 | replisome(GO:0030894) |
0.0 | 3.0 | GO:0005768 | endosome(GO:0005768) |
0.0 | 0.1 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.1 | GO:0030686 | 90S preribosome(GO:0030686) |
0.0 | 0.1 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.3 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.0 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.0 | 0.1 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 0.1 | GO:0038201 | TOR complex(GO:0038201) |
0.0 | 0.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.2 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 0.4 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.8 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 0.1 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.0 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 0.6 | GO:0031967 | organelle envelope(GO:0031967) |
0.0 | 0.0 | GO:0005687 | U4 snRNP(GO:0005687) |
0.0 | 0.0 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 0.1 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.0 | GO:0033643 | host(GO:0018995) host cell part(GO:0033643) host cell(GO:0043657) |
0.0 | 0.9 | GO:0043005 | neuron projection(GO:0043005) |
0.0 | 0.0 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 0.0 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.0 | 0.0 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.0 | 0.0 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.1 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 2.5 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.6 | 1.2 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.6 | 5.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.5 | 1.4 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.4 | 0.8 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.4 | 1.7 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.4 | 1.2 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.4 | 2.7 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.3 | 0.9 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.3 | 2.7 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.3 | 0.6 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.3 | 2.5 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.3 | 0.8 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.3 | 0.8 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.3 | 0.8 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.3 | 0.8 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.2 | 0.7 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.2 | 0.9 | GO:0019808 | polyamine binding(GO:0019808) |
0.2 | 0.2 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.2 | 0.7 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.2 | 1.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.2 | 0.7 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.2 | 2.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.2 | 0.6 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.2 | 0.4 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.2 | 0.6 | GO:0030911 | TPR domain binding(GO:0030911) |
0.2 | 0.7 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.2 | 0.7 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.2 | 4.5 | GO:0004120 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.2 | 0.9 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.2 | 1.0 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.2 | 2.4 | GO:0031402 | sodium ion binding(GO:0031402) |
0.2 | 0.5 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.2 | 0.5 | GO:0051380 | norepinephrine binding(GO:0051380) |
0.2 | 0.6 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.2 | 0.5 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.2 | 2.0 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.2 | 0.6 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.4 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.4 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.1 | 0.4 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.1 | 1.5 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.6 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.7 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 0.4 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.1 | 0.7 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.4 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.1 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.1 | 0.7 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.1 | 0.4 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.1 | 0.7 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.5 | GO:0042731 | PH domain binding(GO:0042731) |
0.1 | 0.7 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.1 | 0.3 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.1 | 0.1 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.1 | 1.8 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.1 | 0.9 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 1.8 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.1 | 0.4 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.1 | 0.4 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.1 | 0.4 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.1 | 0.4 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.1 | 0.1 | GO:0032551 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.1 | 0.4 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.1 | 0.6 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.1 | 0.4 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.1 | 0.4 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.1 | 0.6 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.1 | 0.2 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.1 | 0.5 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 1.5 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 0.3 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.1 | 0.5 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.1 | 1.4 | GO:0030552 | cAMP binding(GO:0030552) |
0.1 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.1 | 0.2 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.1 | 0.6 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.1 | 0.4 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 0.3 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.4 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.1 | 0.9 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 0.3 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.5 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.1 | 0.1 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
0.1 | 0.7 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.1 | 0.2 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.1 | 0.5 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.4 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.1 | 0.3 | GO:0048030 | disaccharide binding(GO:0048030) |
0.1 | 0.3 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.4 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.1 | 0.5 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.1 | 0.5 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 0.5 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.1 | 1.1 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 1.0 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.1 | 0.3 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.1 | 1.1 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 0.8 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.1 | 0.3 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.1 | 1.6 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.1 | 0.8 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.1 | 0.4 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 0.4 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 0.5 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.1 | 0.7 | GO:0000339 | RNA cap binding(GO:0000339) |
0.1 | 1.7 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.1 | 0.7 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
0.1 | 0.4 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.1 | 0.2 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.1 | 0.3 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.1 | 0.6 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.1 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.5 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 0.4 | GO:0031013 | troponin I binding(GO:0031013) |
0.1 | 0.3 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.1 | 0.3 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.1 | 0.4 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.1 | 1.1 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 0.7 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.1 | 2.7 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.1 | 0.2 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.3 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.3 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.1 | 0.7 | GO:0070990 | snRNP binding(GO:0070990) |
0.1 | 1.5 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.1 | 0.3 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.1 | 0.3 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.5 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 0.2 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
0.1 | 0.4 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.4 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.5 | GO:0005057 | receptor signaling protein activity(GO:0005057) |
0.1 | 0.4 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.1 | 0.4 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.1 | 0.2 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.1 | 2.3 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.1 | 0.3 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.1 | 0.2 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.1 | 0.5 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.1 | 0.3 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.1 | 0.4 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.1 | 0.4 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.1 | 0.4 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 0.1 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
0.1 | 0.8 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.5 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 0.5 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 0.2 | GO:0001031 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.1 | 0.5 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.1 | 0.6 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.1 | 0.2 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.1 | 0.8 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.2 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.1 | 0.4 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.1 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.1 | 0.1 | GO:0016751 | S-succinyltransferase activity(GO:0016751) |
0.1 | 0.5 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.2 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.1 | 0.2 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.1 | 0.3 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.8 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.1 | 0.3 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.8 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.1 | 0.5 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.4 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 0.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.3 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.1 | 0.2 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.1 | 0.4 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 1.2 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.1 | 0.4 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 1.0 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.1 | 0.7 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.1 | 0.3 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 0.8 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.1 | 0.5 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.4 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.1 | 0.5 | GO:0034560 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 0.8 | GO:0044213 | intronic transcription regulatory region DNA binding(GO:0044213) |
0.1 | 0.1 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.1 | 0.2 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.1 | 0.1 | GO:0016414 | O-octanoyltransferase activity(GO:0016414) |
0.1 | 0.2 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.1 | 0.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 0.1 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.1 | 1.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.1 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
0.1 | 0.1 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
0.1 | 0.6 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.1 | 0.1 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
0.1 | 0.4 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.1 | 0.2 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.1 | 0.6 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 0.6 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.1 | 0.3 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 0.7 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.1 | 0.2 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.1 | 2.4 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.1 | 0.3 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.1 | 0.5 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 0.5 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.1 | 0.7 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.1 | 0.3 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.1 | 0.2 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.1 | 0.2 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
0.1 | 0.5 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.1 | 0.3 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.1 | 0.4 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.1 | 0.2 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.1 | 0.3 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 0.8 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 0.6 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.1 | 0.5 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.1 | 0.3 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.1 | 0.3 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.1 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.1 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
0.1 | 0.6 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.1 | 4.2 | GO:0044325 | ion channel binding(GO:0044325) |
0.1 | 0.3 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.1 | 0.3 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.1 | 0.2 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 1.2 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.1 | 0.4 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.1 | 0.2 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.5 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.1 | 1.2 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.2 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.1 | 0.3 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.1 | 0.1 | GO:0030519 | snoRNP binding(GO:0030519) |
0.1 | 0.2 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.1 | 0.5 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.1 | 0.5 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.1 | 0.2 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.1 | 0.4 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 0.5 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.1 | 0.2 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.1 | 0.4 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 0.6 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.1 | 0.4 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 0.2 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.1 | 0.2 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.1 | 0.3 | GO:0070513 | death domain binding(GO:0070513) |
0.1 | 0.3 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.1 | 0.2 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.1 | 0.5 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.1 | 1.2 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.1 | 0.2 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.1 | 0.3 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.1 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.1 | 0.6 | GO:0051378 | serotonin binding(GO:0051378) |
0.1 | 0.3 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.1 | 0.8 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.1 | 0.6 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.1 | 0.2 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.1 | 0.3 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.1 | 0.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 1.5 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.1 | 0.2 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.1 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.1 | 1.1 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 1.1 | GO:0042805 | actinin binding(GO:0042805) |
0.1 | 0.3 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.1 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.2 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
0.1 | 0.1 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.1 | 0.9 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.1 | 0.1 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 0.3 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.1 | 0.7 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.1 | 0.4 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.1 | 0.3 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 0.7 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.1 | 0.3 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 1.1 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 0.1 | GO:0003896 | DNA primase activity(GO:0003896) |
0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.0 | 0.2 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.3 | GO:0090079 | translation regulator activity, nucleic acid binding(GO:0090079) |
0.0 | 0.2 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.8 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.0 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 1.0 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.1 | GO:0018503 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.0 | 0.2 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.3 | GO:0042300 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
0.0 | 0.2 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 1.0 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.8 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.3 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 5.4 | GO:0003729 | mRNA binding(GO:0003729) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 1.6 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.0 | 0.2 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.7 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.4 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.8 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.0 | 0.1 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.0 | 0.3 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.1 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.0 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.0 | 0.2 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.0 | 0.6 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.2 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.0 | 0.2 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 1.4 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.2 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.0 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.6 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.6 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.6 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.0 | 0.2 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.2 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.1 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
0.0 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.0 | 0.2 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.1 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.0 | 0.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.2 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.0 | 0.1 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.0 | 0.4 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.0 | 0.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.2 | GO:0034711 | inhibin binding(GO:0034711) |
0.0 | 0.3 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 0.2 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.0 | 0.6 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.1 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.0 | 0.0 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
0.0 | 0.2 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.3 | GO:0070403 | NAD+ binding(GO:0070403) |
0.0 | 0.5 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.0 | 0.6 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.1 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
0.0 | 1.2 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.0 | GO:0097001 | ceramide binding(GO:0097001) |
0.0 | 2.0 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.1 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.1 | GO:0035173 | histone kinase activity(GO:0035173) |
0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.7 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.0 | 0.2 | GO:0004935 | adrenergic receptor activity(GO:0004935) |
0.0 | 0.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.0 | 0.1 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.3 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.1 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.0 | 0.2 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.3 | GO:0000150 | recombinase activity(GO:0000150) |
0.0 | 0.3 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.1 | GO:0030345 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
0.0 | 1.5 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.4 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.5 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.0 | 0.5 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 1.1 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.0 | 0.7 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 2.1 | GO:0019210 | kinase inhibitor activity(GO:0019210) |
0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.0 | 0.5 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.0 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.1 | GO:0019198 | transmembrane receptor protein phosphatase activity(GO:0019198) |
0.0 | 0.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 0.2 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.3 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.2 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) |
0.0 | 0.1 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 0.2 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.0 | 0.3 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
0.0 | 0.1 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.0 | 0.3 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.0 | 0.1 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.0 | 0.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.1 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.2 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.0 | 0.1 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
0.0 | 0.1 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.0 | 0.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.4 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.5 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.0 | 0.3 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.3 | GO:0032183 | SUMO binding(GO:0032183) |
0.0 | 6.1 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.0 | 0.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.0 | 0.2 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.3 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.0 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.6 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.0 | 0.5 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
0.0 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.3 | GO:0008329 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.0 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 1.5 | GO:0005262 | calcium channel activity(GO:0005262) |
0.0 | 0.1 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.0 | 3.8 | GO:0008017 | microtubule binding(GO:0008017) |
0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.4 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 0.4 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.0 | 0.7 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.0 | 0.2 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.3 | GO:0034869 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) acyl-CoA hydrolase activity(GO:0047617) |
0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.0 | 0.2 | GO:0099528 | G-protein coupled acetylcholine receptor activity(GO:0016907) G-protein coupled neurotransmitter receptor activity(GO:0099528) |
0.0 | 0.4 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
0.0 | 0.1 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.0 | 0.9 | GO:0015631 | tubulin binding(GO:0015631) |
0.0 | 0.6 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.0 | 3.3 | GO:0004386 | helicase activity(GO:0004386) |
0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.0 | 0.7 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.4 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.1 | GO:0008066 | glutamate receptor activity(GO:0008066) |
0.0 | 0.1 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.0 | 0.0 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.0 | 0.1 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.0 | 0.3 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.0 | 0.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.2 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.1 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.0 | 0.0 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.0 | 0.6 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
0.0 | 0.1 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.0 | 1.1 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 3.6 | GO:0003924 | GTPase activity(GO:0003924) |
0.0 | 0.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.4 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.2 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.0 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.4 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.3 | GO:0019843 | rRNA binding(GO:0019843) |
0.0 | 0.4 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.2 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.0 | 0.1 | GO:0070052 | collagen V binding(GO:0070052) |
0.0 | 0.3 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.0 | 0.3 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.1 | GO:0015211 | purine nucleoside transmembrane transporter activity(GO:0015211) |
0.0 | 0.2 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.2 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.0 | 0.3 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.0 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.3 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.0 | 0.2 | GO:0051861 | glycolipid binding(GO:0051861) |
0.0 | 0.1 | GO:1901682 | sulfur compound transmembrane transporter activity(GO:1901682) |
0.0 | 0.0 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 1.2 | GO:0047485 | protein N-terminus binding(GO:0047485) |
0.0 | 0.1 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.0 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 2.0 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.5 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.2 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.7 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.0 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
0.0 | 0.1 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.2 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.0 | 0.9 | GO:0008907 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.1 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.8 | GO:0019903 | protein phosphatase binding(GO:0019903) |
0.0 | 0.4 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.0 | 1.4 | GO:0017124 | SH3 domain binding(GO:0017124) |
0.0 | 0.1 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.1 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.0 | 0.3 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.3 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.0 | 0.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.0 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.3 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.5 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.1 | GO:0019534 | toxin transporter activity(GO:0019534) |
0.0 | 0.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.1 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.1 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.5 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.2 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 1.0 | GO:0005516 | calmodulin binding(GO:0005516) |
0.0 | 0.0 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.0 | 0.1 | GO:0050780 | dopamine receptor binding(GO:0050780) |
0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.4 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.0 | 0.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.0 | 0.0 | GO:0045182 | translation regulator activity(GO:0045182) |
0.0 | 0.2 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.3 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 4.0 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.0 | 0.4 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.7 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.0 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.2 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.0 | 2.1 | GO:0005525 | GTP binding(GO:0005525) |
0.0 | 0.8 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.0 | 4.3 | GO:0004674 | protein serine/threonine kinase activity(GO:0004674) |
0.0 | 0.0 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.0 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.0 | 0.0 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
0.0 | 0.3 | GO:0004532 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity(GO:0004532) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.0 | 0.1 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.0 | GO:0070538 | oleic acid binding(GO:0070538) |
0.0 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.0 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.1 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.0 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
0.0 | 0.4 | GO:0032813 | tumor necrosis factor receptor superfamily binding(GO:0032813) |
0.0 | 0.0 | GO:0015556 | succinate transmembrane transporter activity(GO:0015141) C4-dicarboxylate transmembrane transporter activity(GO:0015556) |
0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.3 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.1 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.0 | 0.0 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
0.0 | 0.0 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.0 | 0.5 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
0.0 | 0.0 | GO:0046625 | sphingolipid binding(GO:0046625) |
0.0 | 0.1 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.0 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.0 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.0 | 0.2 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.2 | GO:0005272 | sodium channel activity(GO:0005272) |
0.0 | 0.2 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.0 | 0.5 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
0.0 | 0.0 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.0 | GO:0016415 | octanoyltransferase activity(GO:0016415) |
0.0 | 0.0 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.3 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
0.0 | 0.1 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 2.6 | GO:0003779 | actin binding(GO:0003779) |
0.0 | 2.1 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
0.0 | 0.3 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 7.6 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.1 | GO:0034902 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.0 | 0.0 | GO:0043849 | Ras palmitoyltransferase activity(GO:0043849) |
0.0 | 0.1 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.1 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.8 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.0 | 0.0 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.0 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.1 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.0 | 0.0 | GO:1904680 | peptide transmembrane transporter activity(GO:1904680) |
0.0 | 0.0 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.1 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
0.0 | 0.3 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
0.0 | 0.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.0 | 0.0 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.0 | 0.0 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.3 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.0 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 0.0 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.0 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
0.0 | 0.1 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.0 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.0 | 0.9 | GO:0031625 | ubiquitin protein ligase binding(GO:0031625) |
0.0 | 0.1 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 0.1 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.1 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
0.0 | 0.1 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.1 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.0 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.0 | 0.0 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.0 | 0.0 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.1 | GO:0008061 | chitin binding(GO:0008061) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 2.0 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 1.1 | ST STAT3 PATHWAY | STAT3 Pathway |
0.1 | 3.3 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 2.2 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 0.5 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.1 | 0.7 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 2.0 | PID MYC PATHWAY | C-MYC pathway |
0.1 | 4.5 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.1 | 0.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.1 | 1.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 0.7 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 2.7 | PID AURORA B PATHWAY | Aurora B signaling |
0.1 | 0.9 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 1.0 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.1 | 0.7 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 1.7 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 0.8 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 0.7 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 1.5 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.1 | 1.0 | PID SHP2 PATHWAY | SHP2 signaling |
0.1 | 1.0 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.1 | 0.7 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.1 | 1.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 0.2 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 1.1 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.1 | 0.4 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.1 | 0.6 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.1 | 1.3 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.1 | 0.5 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.1 | 1.3 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.1 | 1.4 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.1 | 1.4 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 0.1 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 0.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.1 | 0.6 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.1 | 0.4 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 0.7 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.3 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.6 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.0 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 1.4 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.9 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.4 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 1.7 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.2 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.3 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.6 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.2 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.3 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.8 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.7 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.7 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.8 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.0 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.7 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 1.5 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.1 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 1.1 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 1.0 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.3 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.1 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.3 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.5 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.5 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.5 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.2 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.0 | PID EPO PATHWAY | EPO signaling pathway |
0.0 | 0.2 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.7 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.7 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.2 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.3 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.6 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.7 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.0 | 0.3 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.6 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.5 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.2 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.2 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.1 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.0 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
0.0 | 0.4 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.2 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.1 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.0 | 0.3 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.2 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.0 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.1 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.1 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.1 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 2.6 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.2 | 1.6 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.2 | 4.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.2 | 0.3 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.2 | 0.8 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.2 | 1.7 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 2.7 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 2.5 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 3.1 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 3.5 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 1.3 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 1.6 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 1.6 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 3.3 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.1 | 1.5 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 1.3 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.1 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.5 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 0.6 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.1 | 0.5 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.1 | 1.0 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.1 | 1.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 0.5 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 2.4 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.1 | 0.9 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.1 | 1.9 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 0.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 1.6 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.1 | 0.1 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
0.1 | 0.9 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 0.6 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.1 | 1.2 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.1 | 0.9 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.1 | 0.6 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 1.0 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.1 | 1.6 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.1 | 0.8 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.1 | 0.9 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 1.4 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.1 | 0.1 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.1 | 1.0 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.1 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 0.6 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.1 | 0.3 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.1 | 1.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 0.9 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 0.8 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 0.8 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.1 | 0.8 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 0.1 | REACTOME NEURONAL SYSTEM | Genes involved in Neuronal System |
0.1 | 0.7 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 0.7 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.1 | 1.2 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 0.2 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.1 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.1 | 0.3 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 0.8 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.1 | 0.5 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.1 | 0.6 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
0.1 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 0.7 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
0.1 | 0.3 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.1 | 0.8 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.1 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 0.2 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 0.5 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.1 | 0.4 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.1 | 0.1 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.1 | 1.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.1 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.1 | 1.4 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 0.7 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.1 | 0.9 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.1 | 0.5 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.1 | 1.0 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.1 | 0.6 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.1 | 1.0 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.8 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 1.8 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.2 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.0 | 0.4 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 4.4 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.4 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.1 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
0.0 | 0.3 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.5 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.0 | 0.3 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 1.0 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.0 | 0.8 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 2.6 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.0 | 0.2 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.0 | 0.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.1 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
0.0 | 0.8 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.9 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
0.0 | 0.4 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.0 | 0.1 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.7 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
0.0 | 0.6 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.0 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.3 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 0.0 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.0 | 0.5 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.0 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.0 | 0.1 | REACTOME MAPK TARGETS NUCLEAR EVENTS MEDIATED BY MAP KINASES | Genes involved in MAPK targets/ Nuclear events mediated by MAP kinases |
0.0 | 0.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.6 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 1.3 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
0.0 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.0 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.4 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.0 | 0.2 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.0 | 1.5 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 1.0 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 1.9 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.5 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.0 | 0.7 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.4 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.4 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 0.2 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.0 | 0.8 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.6 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 0.5 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.2 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.0 | 0.1 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.0 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
0.0 | 0.2 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 1.0 | REACTOME TRANSMISSION ACROSS CHEMICAL SYNAPSES | Genes involved in Transmission across Chemical Synapses |
0.0 | 0.2 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 0.4 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.6 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.1 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.0 | 0.6 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 3.3 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.7 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.1 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.2 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.0 | 0.1 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 1.7 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 0.0 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.0 | 0.0 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.6 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.0 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 0.3 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.0 | 0.3 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.0 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.0 | 0.2 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.0 | 1.3 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.3 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 0.2 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.7 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.0 | 0.8 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.0 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.0 | 0.2 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.0 | 0.1 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.0 | 0.3 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.9 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
0.0 | 0.8 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.1 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.2 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.0 | 0.4 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.0 | 0.1 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.0 | 0.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.0 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.0 | 0.0 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.0 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.0 | 0.2 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.0 | 0.1 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.0 | 0.1 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.0 | 1.2 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.0 | 0.2 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.0 | 0.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.2 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
0.0 | 0.0 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.1 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.0 | 0.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.1 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
0.0 | 0.0 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.0 | 0.3 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.0 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.0 | 0.1 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.2 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.0 | REACTOME SIGNALLING BY NGF | Genes involved in Signalling by NGF |
0.0 | 0.3 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
0.0 | 0.8 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
0.0 | 0.3 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.1 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |