Gene Symbol | Gene ID | Gene Info |
---|---|---|
Hoxc9
|
ENSMUSG00000036139.6 | Hoxc9 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Hoxc9 | chr15_102975543_102976244 | 546 | 0.530301 | 0.79 | 8.4e-14 | Click! |
Hoxc9 | chr15_102982562_102982758 | 5628 | 0.082696 | 0.78 | 1.5e-13 | Click! |
Hoxc9 | chr15_102983048_102983651 | 6317 | 0.080554 | 0.76 | 1.7e-12 | Click! |
Hoxc9 | chr15_102981032_102982455 | 4711 | 0.086879 | 0.76 | 2.4e-12 | Click! |
Hoxc9 | chr15_102978767_102979348 | 2025 | 0.141570 | 0.76 | 2.8e-12 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr10_44499711_44500302 | 7.49 |
Prdm1 |
PR domain containing 1, with ZNF domain |
28495 |
0.15 |
chr6_52174920_52176658 | 7.17 |
Hoxaas3 |
Hoxa cluster antisense RNA 3 |
554 |
0.41 |
chr15_103060010_103061759 | 7.10 |
5730585A16Rik |
RIKEN cDNA 5730585A16 gene |
1578 |
0.23 |
chr4_97707423_97707989 | 6.93 |
E130114P18Rik |
RIKEN cDNA E130114P18 gene |
16970 |
0.23 |
chr2_74697508_74699145 | 6.71 |
Hoxd9 |
homeobox D9 |
599 |
0.31 |
chr2_74696421_74697223 | 5.76 |
Gm28793 |
predicted gene 28793 |
764 |
0.23 |
chr11_96254952_96255978 | 5.58 |
Gm53 |
predicted gene 53 |
2933 |
0.11 |
chr2_74745819_74748448 | 5.55 |
Hoxd3 |
homeobox D3 |
1411 |
0.17 |
chr7_36016816_36017552 | 5.50 |
Gm38991 |
predicted gene, 38991 |
80194 |
0.09 |
chr12_84847341_84847683 | 5.26 |
D030025P21Rik |
RIKEN cDNA D030025P21 gene |
28257 |
0.11 |
chr8_23404395_23404605 | 5.25 |
Sfrp1 |
secreted frizzled-related protein 1 |
7002 |
0.26 |
chr11_96253803_96254020 | 5.24 |
Gm53 |
predicted gene 53 |
1379 |
0.21 |
chr14_74811620_74811973 | 4.74 |
Lrch1 |
leucine-rich repeats and calponin homology (CH) domain containing 1 |
5738 |
0.26 |
chr11_96331807_96334248 | 4.57 |
Hoxb3 |
homeobox B3 |
4965 |
0.08 |
chr9_77427165_77428361 | 4.36 |
Lrrc1 |
leucine rich repeat containing 1 |
14432 |
0.17 |
chr9_71217320_71217974 | 4.33 |
Aldh1a2 |
aldehyde dehydrogenase family 1, subfamily A2 |
1858 |
0.36 |
chr2_169178799_169179344 | 4.27 |
9430093N23Rik |
RIKEN cDNA 9430093N23 gene |
55920 |
0.13 |
chr4_34234262_34234523 | 4.26 |
Gm12753 |
predicted gene 12753 |
103538 |
0.06 |
chr18_69794164_69795233 | 4.14 |
Tcf4 |
transcription factor 4 |
112318 |
0.06 |
chr15_27786588_27788615 | 4.14 |
Trio |
triple functional domain (PTPRF interacting) |
1037 |
0.6 |
chr14_98746974_98747412 | 4.11 |
Gm27034 |
predicted gene, 27034 |
32380 |
0.21 |
chr7_24391017_24391531 | 4.11 |
Kcnn4 |
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 4 |
8220 |
0.09 |
chr15_103058659_103059955 | 4.04 |
5730585A16Rik |
RIKEN cDNA 5730585A16 gene |
1 |
0.95 |
chr5_89147415_89147735 | 4.01 |
Slc4a4 |
solute carrier family 4 (anion exchanger), member 4 |
119483 |
0.06 |
chr3_131738069_131738640 | 4.01 |
Gm29865 |
predicted gene, 29865 |
21451 |
0.25 |
chr6_52176961_52178435 | 4.01 |
5730596B20Rik |
RIKEN cDNA 5730596B20 gene |
200 |
0.79 |
chr2_74685728_74685879 | 3.82 |
Gm28309 |
predicted gene 28309 |
2357 |
0.09 |
chr1_178531534_178532270 | 3.78 |
Kif26b |
kinesin family member 26B |
2777 |
0.33 |
chr12_108010279_108010430 | 3.66 |
Bcl11b |
B cell leukemia/lymphoma 11B |
6752 |
0.29 |
chr13_97928129_97928508 | 3.48 |
Arhgef28 |
Rho guanine nucleotide exchange factor (GEF) 28 |
18609 |
0.21 |
chr18_74966819_74967388 | 3.45 |
Lipg |
lipase, endothelial |
5840 |
0.1 |
chr19_16061459_16061955 | 3.41 |
Rpl37-ps1 |
ribosomal protein 37, pseudogene 1 |
36256 |
0.15 |
chr10_102513522_102514467 | 3.41 |
Rassf9 |
Ras association (RalGDS/AF-6) domain family (N-terminal) member 9 |
1738 |
0.36 |
chr11_96347886_96350398 | 3.38 |
Hoxb3os |
homeobox B3 and homeobox B2, opposite strand |
1219 |
0.21 |
chr6_144398200_144398472 | 3.30 |
Sox5os2 |
SRY (sex determining region Y)-box 5, opposite strand 2 |
82889 |
0.1 |
chr6_52254269_52254420 | 3.26 |
9530018H14Rik |
RIKEN cDNA 9530018H14 gene |
3116 |
0.08 |
chr5_74432839_74433381 | 3.25 |
Gm43167 |
predicted gene 43167 |
2005 |
0.32 |
chr2_74683473_74684503 | 3.25 |
Gm28309 |
predicted gene 28309 |
542 |
0.43 |
chr5_119137444_119138294 | 3.23 |
1700081H04Rik |
RIKEN cDNA 1700081H04 gene |
29635 |
0.2 |
chr16_93272287_93272901 | 3.22 |
1810053B23Rik |
RIKEN cDNA 1810053B23 gene |
80595 |
0.09 |
chr13_37492180_37492424 | 3.19 |
Gm47732 |
predicted gene, 47732 |
9917 |
0.1 |
chr18_81091160_81091406 | 3.15 |
Gm50423 |
predicted gene, 50423 |
8219 |
0.2 |
chr8_91148385_91148693 | 3.09 |
Gm45665 |
predicted gene 45665 |
3668 |
0.14 |
chr7_36710059_36710756 | 3.00 |
Gm37452 |
predicted gene, 37452 |
233 |
0.9 |
chr6_52202371_52204739 | 2.99 |
Hoxa5 |
homeobox A5 |
1032 |
0.2 |
chr3_54358382_54359181 | 2.99 |
Postn |
periostin, osteoblast specific factor |
2328 |
0.42 |
chr4_98106191_98107304 | 2.98 |
Gm12691 |
predicted gene 12691 |
39852 |
0.19 |
chr6_147232816_147232967 | 2.97 |
Gm15767 |
predicted gene 15767 |
10902 |
0.16 |
chr7_130190460_130190864 | 2.96 |
Fgfr2 |
fibroblast growth factor receptor 2 |
5695 |
0.31 |
chr4_105205550_105205795 | 2.94 |
Plpp3 |
phospholipid phosphatase 3 |
48325 |
0.17 |
chr15_81554564_81555260 | 2.91 |
1110025M09Rik |
RIKEN cDNA 1110025M09 gene |
30116 |
0.09 |
chr4_114842209_114842913 | 2.89 |
Gm23230 |
predicted gene, 23230 |
2556 |
0.25 |
chr13_39979317_39979823 | 2.89 |
Gm47316 |
predicted gene, 47316 |
95189 |
0.08 |
chr5_88796132_88796502 | 2.88 |
Gm42912 |
predicted gene 42912 |
2421 |
0.23 |
chr18_80979092_80979917 | 2.83 |
Sall3 |
spalt like transcription factor 3 |
4473 |
0.16 |
chr11_71429806_71430038 | 2.80 |
Gm16013 |
predicted gene 16013 |
6258 |
0.25 |
chr16_55470793_55471235 | 2.79 |
Mir5118 |
microRNA 5118 |
23717 |
0.25 |
chr19_58970759_58971082 | 2.78 |
Eno4 |
enolase 4 |
15464 |
0.17 |
chr2_69560037_69560188 | 2.76 |
Lrp2 |
low density lipoprotein receptor-related protein 2 |
25917 |
0.19 |
chr5_120454576_120454844 | 2.75 |
Sdsl |
serine dehydratase-like |
12650 |
0.11 |
chr2_74705003_74706025 | 2.73 |
Hoxd8 |
homeobox D8 |
362 |
0.61 |
chr5_102768473_102769767 | 2.70 |
Arhgap24 |
Rho GTPase activating protein 24 |
349 |
0.93 |
chr15_5009632_5010034 | 2.69 |
Gm25652 |
predicted gene, 25652 |
25527 |
0.15 |
chr7_127368307_127368458 | 2.69 |
Zfp747 |
zinc finger protein 747 |
7631 |
0.07 |
chr1_178532360_178532899 | 2.68 |
Kif26b |
kinesin family member 26B |
3504 |
0.3 |
chr10_69925300_69927130 | 2.66 |
Ank3 |
ankyrin 3, epithelial |
82 |
0.99 |
chr6_125803223_125804196 | 2.65 |
Ano2 |
anoctamin 2 |
11825 |
0.23 |
chr9_89497806_89497957 | 2.64 |
Gm47403 |
predicted gene, 47403 |
62503 |
0.11 |
chr12_16731274_16731620 | 2.63 |
Greb1 |
gene regulated by estrogen in breast cancer protein |
8681 |
0.18 |
chr7_119640933_119641086 | 2.62 |
Gm19950 |
predicted gene, 19950 |
1351 |
0.3 |
chr6_52185190_52185742 | 2.60 |
Hoxa3 |
homeobox A3 |
592 |
0.39 |
chr6_99469204_99469432 | 2.59 |
Gm22328 |
predicted gene, 22328 |
15384 |
0.18 |
chr3_40398069_40398661 | 2.59 |
1700017G19Rik |
RIKEN cDNA 1700017G19 gene |
111409 |
0.06 |
chr2_93625091_93625242 | 2.57 |
Alx4 |
aristaless-like homeobox 4 |
17218 |
0.23 |
chr3_84269007_84269293 | 2.56 |
Trim2 |
tripartite motif-containing 2 |
1641 |
0.47 |
chr12_104814713_104814864 | 2.53 |
Clmn |
calmin |
33917 |
0.15 |
chr13_40727690_40728914 | 2.53 |
Gm26688 |
predicted gene, 26688 |
494 |
0.48 |
chr4_151367038_151367189 | 2.53 |
4930589P08Rik |
RIKEN cDNA 4930589P08 gene |
9357 |
0.3 |
chr1_37612000_37612364 | 2.52 |
4930556I23Rik |
RIKEN cDNA 4930556I23 gene |
2077 |
0.29 |
chr9_59189343_59189641 | 2.48 |
Gm7589 |
predicted gene 7589 |
43282 |
0.15 |
chr6_52193539_52194370 | 2.47 |
Hoxa4 |
homeobox A4 |
2201 |
0.09 |
chr5_4912153_4912532 | 2.46 |
Cdk14 |
cyclin-dependent kinase 14 |
23430 |
0.15 |
chr1_185481839_185482593 | 2.42 |
5033404E19Rik |
RIKEN cDNA 5033404E19 gene |
5078 |
0.16 |
chr15_102250326_102250587 | 2.41 |
Rarg |
retinoic acid receptor, gamma |
110 |
0.93 |
chr11_58868459_58868610 | 2.40 |
2810021J22Rik |
RIKEN cDNA 2810021J22 gene |
1267 |
0.21 |
chr16_93558150_93558964 | 2.38 |
Setd4 |
SET domain containing 4 |
25451 |
0.12 |
chr7_64771313_64771576 | 2.35 |
Fam189a1 |
family with sequence similarity 189, member A1 |
2208 |
0.36 |
chr4_137128142_137128457 | 2.34 |
Gm13001 |
predicted gene 13001 |
10156 |
0.14 |
chr2_165195356_165196211 | 2.34 |
Cdh22 |
cadherin 22 |
14324 |
0.16 |
chr15_103013757_103015908 | 2.31 |
Mir615 |
microRNA 615 |
78 |
0.91 |
chr8_26622194_26622994 | 2.27 |
Gm32050 |
predicted gene, 32050 |
4886 |
0.19 |
chr15_103032048_103033557 | 2.27 |
Hoxc4 |
homeobox C4 |
1593 |
0.21 |
chr18_83973876_83974421 | 2.24 |
Gm50421 |
predicted gene, 50421 |
13847 |
0.22 |
chr2_74739700_74741193 | 2.23 |
Hoxd3 |
homeobox D3 |
827 |
0.31 |
chr10_40750729_40751332 | 2.22 |
Mettl24 |
methyltransferase like 24 |
67748 |
0.1 |
chr11_4604503_4604654 | 2.22 |
Mtmr3 |
myotubularin related protein 3 |
9715 |
0.14 |
chr19_37790493_37791115 | 2.19 |
Gm9067 |
predicted gene 9067 |
6538 |
0.23 |
chr3_85348373_85348686 | 2.16 |
1700036G14Rik |
RIKEN cDNA 1700036G14 gene |
31010 |
0.19 |
chr10_121507042_121507245 | 2.15 |
Gm35696 |
predicted gene, 35696 |
520 |
0.63 |
chr5_104111427_104113181 | 2.12 |
Sparcl1 |
SPARC-like 1 |
1135 |
0.33 |
chr1_66897360_66897511 | 2.11 |
Gm25832 |
predicted gene, 25832 |
30638 |
0.09 |
chr16_93292107_93292579 | 2.11 |
1810053B23Rik |
RIKEN cDNA 1810053B23 gene |
60846 |
0.11 |
chr7_71471596_71472579 | 2.11 |
Gm29328 |
predicted gene 29328 |
101754 |
0.07 |
chr6_52211753_52213405 | 2.11 |
Hoxa3 |
homeobox A3 |
536 |
0.36 |
chr10_8213906_8214393 | 2.10 |
Gm30906 |
predicted gene, 30906 |
38018 |
0.2 |
chr5_64917720_64918002 | 2.09 |
Tlr1 |
toll-like receptor 1 |
14900 |
0.13 |
chr18_17383617_17383861 | 2.08 |
4921533I20Rik |
Riken cDNA 4921533I20 gene |
64009 |
0.15 |
chr2_68404386_68405552 | 2.08 |
Stk39 |
serine/threonine kinase 39 |
18288 |
0.23 |
chr2_69629066_69629557 | 2.07 |
Bbs5 |
Bardet-Biedl syndrome 5 (human) |
17860 |
0.16 |
chr3_116923152_116923435 | 2.06 |
Gm42892 |
predicted gene 42892 |
21037 |
0.12 |
chr16_73530171_73530440 | 2.06 |
Gm49680 |
predicted gene, 49680 |
45448 |
0.16 |
chr8_121118797_121121438 | 2.05 |
Foxc2 |
forkhead box C2 |
3946 |
0.14 |
chr16_38773036_38773467 | 2.05 |
Upk1b |
uroplakin 1B |
7092 |
0.14 |
chr2_125620640_125620847 | 2.04 |
Cep152 |
centrosomal protein 152 |
4370 |
0.25 |
chr11_96318060_96319501 | 2.04 |
Hoxb4 |
homeobox B4 |
513 |
0.51 |
chr10_92162169_92163486 | 2.04 |
Rmst |
rhabdomyosarcoma 2 associated transcript (non-coding RNA) |
66 |
0.98 |
chr1_62647919_62648262 | 2.03 |
Gm11600 |
predicted gene 11600 |
9698 |
0.18 |
chr16_18185862_18186013 | 2.01 |
Mir6366 |
microRNA 6366 |
20767 |
0.08 |
chr2_169749612_169749862 | 2.00 |
Tshz2 |
teashirt zinc finger family member 2 |
116061 |
0.06 |
chr15_75705955_75706272 | 1.99 |
Rhpn1 |
rhophilin, Rho GTPase binding protein 1 |
1719 |
0.25 |
chr13_40737564_40738904 | 1.99 |
Tfap2a |
transcription factor AP-2, alpha |
142 |
0.85 |
chr6_143918358_143918951 | 1.98 |
Sox5 |
SRY (sex determining region Y)-box 5 |
28434 |
0.22 |
chr3_37906898_37907049 | 1.97 |
Gm20755 |
predicted gene, 20755 |
8160 |
0.18 |
chr2_174200789_174200940 | 1.96 |
Gm10714 |
predicted gene 10714 |
16946 |
0.16 |
chr6_31159413_31159909 | 1.96 |
Lncpint |
long non-protein coding RNA, Trp53 induced transcript |
6855 |
0.14 |
chr12_79898403_79898554 | 1.95 |
9430078K24Rik |
RIKEN cDNA 9430078K24 gene |
26255 |
0.19 |
chr9_51875651_51875947 | 1.94 |
Arhgap20os |
Rho GTPase activating protein 20, opposite strand |
4 |
0.98 |
chr10_120369622_120370109 | 1.94 |
1700006J14Rik |
RIKEN cDNA 1700006J14 gene |
5652 |
0.18 |
chr3_58158331_58159098 | 1.93 |
1700007F19Rik |
RIKEN cDNA 1700007F19 gene |
5093 |
0.2 |
chr9_107698472_107700491 | 1.93 |
Sema3f |
sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3F |
6075 |
0.1 |
chr15_99332366_99332785 | 1.92 |
Fmnl3 |
formin-like 3 |
3152 |
0.13 |
chr17_34325316_34325467 | 1.91 |
H2-Eb2 |
histocompatibility 2, class II antigen E beta2 |
274 |
0.8 |
chr11_97282164_97282315 | 1.90 |
Npepps |
aminopeptidase puromycin sensitive |
1601 |
0.25 |
chr13_55750854_55751005 | 1.89 |
Pcbd2 |
pterin 4 alpha carbinolamine dehydratase/dimerization cofactor of hepatocyte nuclear factor 1 alpha (TCF1) 2 |
23561 |
0.11 |
chr18_83185054_83185604 | 1.89 |
1700095A13Rik |
RIKEN cDNA 1700095A13 gene |
77439 |
0.09 |
chr2_126034531_126036034 | 1.89 |
Fgf7 |
fibroblast growth factor 7 |
309 |
0.93 |
chr14_21891593_21892043 | 1.88 |
4931407E12Rik |
RIKEN cDNA 4931407E12 gene |
2052 |
0.26 |
chr2_65934036_65934599 | 1.88 |
Csrnp3 |
cysteine-serine-rich nuclear protein 3 |
2452 |
0.32 |
chr2_115813161_115813800 | 1.87 |
Meis2 |
Meis homeobox 2 |
55387 |
0.16 |
chr1_38439659_38440010 | 1.87 |
Gm34727 |
predicted gene, 34727 |
47685 |
0.14 |
chr14_22892431_22892727 | 1.86 |
Gm47601 |
predicted gene, 47601 |
35347 |
0.22 |
chr11_96282426_96282794 | 1.86 |
Hoxb8 |
homeobox B8 |
54 |
0.92 |
chr15_103301850_103302555 | 1.86 |
Gm49482 |
predicted gene, 49482 |
1137 |
0.31 |
chr5_67641015_67641166 | 1.85 |
Gm15478 |
predicted gene 15478 |
1311 |
0.32 |
chr5_134050971_134051243 | 1.85 |
1700030N18Rik |
RIKEN cDNA 1700030N18 gene |
40344 |
0.13 |
chr7_51888288_51888545 | 1.84 |
Gas2 |
growth arrest specific 2 |
498 |
0.77 |
chr12_76645221_76645758 | 1.84 |
Sptb |
spectrin beta, erythrocytic |
61403 |
0.09 |
chr19_29924851_29925655 | 1.84 |
Il33 |
interleukin 33 |
121 |
0.97 |
chr2_68171370_68171521 | 1.83 |
Stk39 |
serine/threonine kinase 39 |
51881 |
0.14 |
chr2_64074730_64075670 | 1.83 |
Fign |
fidgetin |
22788 |
0.29 |
chr2_166518151_166518308 | 1.83 |
Gm14267 |
predicted gene 14267 |
1863 |
0.39 |
chr4_137142499_137142693 | 1.82 |
Gm13003 |
predicted gene 13003 |
22470 |
0.11 |
chr2_75485301_75485452 | 1.82 |
Gm13660 |
predicted gene 13660 |
20588 |
0.19 |
chr1_17603650_17603961 | 1.81 |
Pi15 |
peptidase inhibitor 15 |
1904 |
0.38 |
chr2_105132016_105133665 | 1.81 |
Wt1 |
Wilms tumor 1 homolog |
1957 |
0.31 |
chr13_96011066_96011437 | 1.81 |
Sv2c |
synaptic vesicle glycoprotein 2c |
21025 |
0.19 |
chr8_107827802_107827973 | 1.80 |
Gm23646 |
predicted gene, 23646 |
13070 |
0.19 |
chr1_163358681_163359585 | 1.80 |
Gm24940 |
predicted gene, 24940 |
43150 |
0.12 |
chr3_126611441_126612035 | 1.79 |
Gm43011 |
predicted gene 43011 |
11709 |
0.12 |
chr6_117130561_117131249 | 1.79 |
Gm43930 |
predicted gene, 43930 |
13420 |
0.19 |
chr2_72093295_72094205 | 1.79 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
38765 |
0.15 |
chr6_17465495_17465672 | 1.78 |
Met |
met proto-oncogene |
1476 |
0.44 |
chr12_73521450_73522039 | 1.77 |
Gm34016 |
predicted gene, 34016 |
13074 |
0.15 |
chrX_21484558_21485279 | 1.76 |
Agtr2 |
angiotensin II receptor, type 2 |
196 |
0.94 |
chr4_82605015_82605284 | 1.76 |
Gm11267 |
predicted gene 11267 |
17830 |
0.2 |
chr8_117684622_117684773 | 1.75 |
Gm38416 |
predicted gene, 38416 |
2847 |
0.18 |
chr16_94007185_94007543 | 1.75 |
Cldn14 |
claudin 14 |
1473 |
0.3 |
chr10_120246974_120247580 | 1.75 |
Llph |
LLP homolog, long-term synaptic facilitation (Aplysia) |
20091 |
0.13 |
chr3_68283428_68284024 | 1.74 |
Gm10292 |
predicted gene 10292 |
49470 |
0.17 |
chr11_25288195_25288807 | 1.74 |
Gm12069 |
predicted gene 12069 |
12762 |
0.23 |
chr2_166187526_166188057 | 1.73 |
Gm22687 |
predicted gene, 22687 |
1906 |
0.27 |
chr18_34379958_34380733 | 1.72 |
Reep5 |
receptor accessory protein 5 |
6275 |
0.18 |
chr3_130737739_130738025 | 1.71 |
Gm42997 |
predicted gene 42997 |
7281 |
0.12 |
chr19_45230983_45235468 | 1.71 |
Lbx1 |
ladybird homeobox 1 |
2587 |
0.27 |
chr5_48181765_48182444 | 1.71 |
Slit2 |
slit guidance ligand 2 |
2 |
0.98 |
chr7_137301031_137302046 | 1.70 |
Ebf3 |
early B cell factor 3 |
12378 |
0.19 |
chr16_88559706_88559988 | 1.70 |
Cldn8 |
claudin 8 |
3336 |
0.19 |
chr9_47467868_47468019 | 1.70 |
Gm47160 |
predicted gene, 47160 |
6975 |
0.21 |
chr2_115510507_115510658 | 1.69 |
3110099E03Rik |
RIKEN cDNA 3110099E03 gene |
1619 |
0.47 |
chr16_94714721_94714872 | 1.69 |
Gm41504 |
predicted gene, 41504 |
893 |
0.59 |
chr2_169634807_169634993 | 1.69 |
Tshz2 |
teashirt zinc finger family member 2 |
1224 |
0.5 |
chr11_96279294_96280222 | 1.69 |
Hoxb8 |
homeobox B8 |
2147 |
0.12 |
chr5_149909383_149909534 | 1.67 |
Gm36241 |
predicted gene, 36241 |
794 |
0.59 |
chr15_102949603_102949939 | 1.67 |
Hotair |
HOX transcript antisense RNA (non-protein coding) |
2041 |
0.15 |
chr10_121243880_121244097 | 1.66 |
Gm35404 |
predicted gene, 35404 |
986 |
0.51 |
chr6_52160071_52161455 | 1.64 |
Hotairm1 |
Hoxa transcript antisense RNA, myeloid-specific 1 |
2239 |
0.09 |
chr1_71837628_71838128 | 1.61 |
Gm37217 |
predicted gene, 37217 |
8732 |
0.21 |
chr5_147235974_147236125 | 1.61 |
Pdx1 |
pancreatic and duodenal homeobox 1 |
33910 |
0.09 |
chr16_73869523_73869996 | 1.60 |
Robo2 |
roundabout guidance receptor 2 |
30126 |
0.23 |
chr4_125911667_125911818 | 1.60 |
2610028E06Rik |
RIKEN cDNA 2610028E06 gene |
5429 |
0.27 |
chr2_9874123_9875699 | 1.60 |
Gata3 |
GATA binding protein 3 |
488 |
0.68 |
chr14_54639729_54639983 | 1.60 |
Gm17606 |
predicted gene, 17606 |
1096 |
0.22 |
chr14_84450287_84451113 | 1.59 |
Pcdh17 |
protocadherin 17 |
2193 |
0.37 |
chr7_109156032_109156190 | 1.58 |
Gm44781 |
predicted gene 44781 |
13224 |
0.16 |
chr11_118069022_118069192 | 1.58 |
Dnah17 |
dynein, axonemal, heavy chain 17 |
20087 |
0.15 |
chr13_98365751_98366918 | 1.57 |
Foxd1 |
forkhead box D1 |
12092 |
0.14 |
chr14_121696785_121697153 | 1.56 |
Dock9 |
dedicator of cytokinesis 9 |
1448 |
0.52 |
chr9_63979996_63981369 | 1.55 |
Smad6 |
SMAD family member 6 |
36305 |
0.12 |
chr18_83491439_83492086 | 1.53 |
Gm50415 |
predicted gene, 50415 |
1348 |
0.37 |
chr4_153018259_153019185 | 1.53 |
Gm25779 |
predicted gene, 25779 |
5138 |
0.33 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 6.0 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
1.1 | 4.4 | GO:0035564 | regulation of kidney size(GO:0035564) |
1.1 | 3.2 | GO:0021570 | rhombomere 4 development(GO:0021570) |
1.0 | 2.1 | GO:0060435 | bronchiole development(GO:0060435) |
0.9 | 3.7 | GO:0021557 | oculomotor nerve development(GO:0021557) |
0.9 | 2.7 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.9 | 2.7 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.9 | 2.7 | GO:0035799 | ureter maturation(GO:0035799) |
0.9 | 2.6 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.8 | 2.4 | GO:0070384 | Harderian gland development(GO:0070384) |
0.7 | 1.4 | GO:0021569 | rhombomere 3 development(GO:0021569) |
0.7 | 2.7 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
0.6 | 2.5 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.6 | 1.8 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.6 | 1.8 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.6 | 1.1 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.6 | 1.7 | GO:2000041 | regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
0.5 | 0.5 | GO:0061004 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.4 | 1.6 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.4 | 1.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.4 | 0.8 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.4 | 3.4 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.4 | 0.4 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.4 | 1.4 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.3 | 1.0 | GO:0072050 | S-shaped body morphogenesis(GO:0072050) |
0.3 | 2.0 | GO:0048539 | bone marrow development(GO:0048539) |
0.3 | 0.7 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.3 | 0.7 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.3 | 1.8 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.3 | 3.6 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.3 | 0.8 | GO:0070340 | detection of bacterial lipopeptide(GO:0070340) |
0.3 | 0.8 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.3 | 0.8 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.3 | 0.8 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.2 | 0.5 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.2 | 1.2 | GO:0033153 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
0.2 | 0.7 | GO:0007525 | somatic muscle development(GO:0007525) |
0.2 | 0.5 | GO:0090427 | activation of meiosis(GO:0090427) |
0.2 | 1.1 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.2 | 0.7 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.2 | 0.6 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.2 | 0.6 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.2 | 0.4 | GO:0043587 | tongue morphogenesis(GO:0043587) |
0.2 | 0.8 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.2 | 0.6 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
0.2 | 1.3 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.2 | 0.5 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.2 | 0.5 | GO:0003253 | cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
0.2 | 0.9 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.2 | 17.9 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
0.2 | 0.4 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.2 | 0.3 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.2 | 0.5 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.2 | 0.7 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.2 | 0.5 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.2 | 0.5 | GO:0061309 | cardiac neural crest cell development involved in outflow tract morphogenesis(GO:0061309) |
0.2 | 0.5 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.2 | 0.9 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.2 | 0.3 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.1 | 0.4 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.1 | 0.4 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.1 | 0.3 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
0.1 | 1.0 | GO:2000343 | positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
0.1 | 1.0 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.1 | 1.1 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.1 | 0.6 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.1 | 0.4 | GO:0060526 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
0.1 | 0.4 | GO:1900094 | nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
0.1 | 0.4 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.1 | 0.4 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.1 | 0.3 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.1 | 0.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.1 | 0.5 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.7 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.1 | GO:0072191 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
0.1 | 0.4 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.1 | 0.4 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.1 | 0.1 | GO:0072106 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
0.1 | 1.5 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.1 | 0.5 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
0.1 | 0.1 | GO:0072162 | metanephric mesenchymal cell differentiation(GO:0072162) |
0.1 | 0.7 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.1 | 0.4 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.1 | 0.5 | GO:0097491 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
0.1 | 0.5 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.1 | 0.3 | GO:0060023 | soft palate development(GO:0060023) |
0.1 | 0.3 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.1 | 1.4 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
0.1 | 0.4 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.1 | 0.3 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.1 | 0.2 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.1 | 0.3 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.1 | 0.6 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.1 | 1.1 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.1 | 0.6 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 0.3 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.1 | 0.2 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.1 | 0.4 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 0.4 | GO:0060005 | vestibular reflex(GO:0060005) |
0.1 | 0.1 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.1 | 0.8 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.1 | 0.4 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.1 | 0.1 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.1 | 1.0 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.1 | 0.5 | GO:0002076 | osteoblast development(GO:0002076) |
0.1 | 0.1 | GO:0072180 | mesonephric duct morphogenesis(GO:0072180) |
0.1 | 0.4 | GO:0009642 | response to light intensity(GO:0009642) |
0.1 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.2 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.6 | GO:0061085 | regulation of histone H3-K27 methylation(GO:0061085) |
0.1 | 0.3 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.1 | 0.5 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.1 | 0.2 | GO:0009732 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.1 | 0.4 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 0.5 | GO:0002692 | negative regulation of cellular extravasation(GO:0002692) |
0.1 | 1.0 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.1 | 0.4 | GO:0042488 | positive regulation of odontogenesis of dentin-containing tooth(GO:0042488) |
0.1 | 0.2 | GO:0006868 | glutamine transport(GO:0006868) |
0.1 | 0.7 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.1 | 0.1 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
0.1 | 0.2 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.1 | 0.7 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
0.1 | 0.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.1 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.2 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.1 | 0.2 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.1 | 0.1 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.1 | 0.2 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.1 | 0.5 | GO:0006563 | L-serine metabolic process(GO:0006563) |
0.1 | 0.4 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.1 | 0.1 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
0.1 | 0.1 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.1 | 0.3 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.1 | 0.1 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 0.3 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.1 | 0.3 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 0.6 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
0.1 | 0.1 | GO:0007494 | midgut development(GO:0007494) |
0.1 | 0.1 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
0.1 | 0.2 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.1 | 0.2 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.1 | 0.1 | GO:0010159 | specification of organ position(GO:0010159) |
0.1 | 0.4 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.1 | 0.7 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.1 | 0.6 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.1 | 0.2 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
0.1 | 0.3 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.1 | 0.4 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.1 | 0.1 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.1 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.1 | 0.2 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 0.6 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.1 | 1.0 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.2 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.1 | 0.7 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.1 | 0.8 | GO:0034389 | lipid particle organization(GO:0034389) |
0.1 | 0.5 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.1 | 0.2 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.1 | 0.3 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.1 | 0.6 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
0.1 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.1 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
0.1 | 0.1 | GO:0070253 | somatostatin secretion(GO:0070253) |
0.1 | 0.6 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.1 | 0.3 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.1 | 0.2 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
0.1 | 0.3 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.1 | 0.6 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.1 | 0.2 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.1 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.1 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.1 | 0.2 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.1 | 0.2 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.1 | 0.2 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) negative regulation of DNA damage checkpoint(GO:2000002) |
0.1 | 0.5 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
0.1 | 0.5 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.1 | 0.2 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.1 | 0.1 | GO:0014858 | positive regulation of skeletal muscle cell proliferation(GO:0014858) |
0.1 | 0.2 | GO:0060592 | mammary gland formation(GO:0060592) |
0.1 | 0.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.1 | 0.4 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.1 | 0.4 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.1 | 0.1 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.1 | 0.2 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.1 | 0.2 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.1 | 0.2 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.0 | 0.3 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.1 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.0 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.0 | 0.1 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.0 | 0.0 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.0 | 0.2 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.0 | 0.2 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
0.0 | 0.2 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.0 | 0.3 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.0 | 0.2 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.1 | GO:0009157 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
0.0 | 0.1 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
0.0 | 0.0 | GO:2000019 | negative regulation of male gonad development(GO:2000019) |
0.0 | 0.1 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.0 | 0.2 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.0 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.0 | 0.1 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
0.0 | 1.0 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.0 | 0.4 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
0.0 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.0 | 0.1 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.0 | 0.1 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.0 | 0.2 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.0 | 0.1 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.0 | 0.4 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.0 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.0 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.0 | 0.0 | GO:0072497 | mesenchymal stem cell differentiation(GO:0072497) |
0.0 | 0.3 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.1 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.0 | 0.2 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.0 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.0 | 0.2 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.0 | 0.1 | GO:0070831 | basement membrane assembly(GO:0070831) |
0.0 | 0.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.1 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.0 | 0.6 | GO:0045986 | negative regulation of smooth muscle contraction(GO:0045986) |
0.0 | 0.1 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
0.0 | 0.1 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.0 | 0.3 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.3 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.0 | 0.2 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.3 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.0 | 0.4 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
0.0 | 0.1 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
0.0 | 0.3 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
0.0 | 0.0 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.0 | 0.2 | GO:1903333 | negative regulation of protein folding(GO:1903333) |
0.0 | 0.1 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.0 | 0.5 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
0.0 | 0.3 | GO:0032986 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.0 | 0.0 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
0.0 | 0.1 | GO:1900084 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) |
0.0 | 0.1 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.0 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.3 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.2 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.0 | 0.1 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 0.1 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.0 | 0.1 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.0 | 0.2 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.0 | 0.1 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.0 | 0.1 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.0 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.0 | 0.3 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.0 | 0.3 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.0 | 0.2 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.0 | 0.1 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.1 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.0 | 0.3 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.0 | 0.1 | GO:0002001 | renin secretion into blood stream(GO:0002001) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.2 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
0.0 | 0.0 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.0 | 0.2 | GO:0042045 | epithelial fluid transport(GO:0042045) |
0.0 | 0.2 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.0 | 0.3 | GO:0008210 | estrogen metabolic process(GO:0008210) |
0.0 | 0.1 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.0 | 0.3 | GO:0060325 | face morphogenesis(GO:0060325) |
0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.1 | GO:0072553 | terminal button organization(GO:0072553) |
0.0 | 0.3 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.0 | 0.1 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
0.0 | 0.1 | GO:0042297 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.0 | 0.2 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.0 | 0.1 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.0 | 0.1 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.0 | 0.1 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.0 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
0.0 | 0.2 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
0.0 | 0.1 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 0.2 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.2 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.0 | 2.3 | GO:0048705 | skeletal system morphogenesis(GO:0048705) |
0.0 | 0.2 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.0 | 0.1 | GO:0072178 | nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
0.0 | 0.1 | GO:2000121 | regulation of removal of superoxide radicals(GO:2000121) |
0.0 | 0.0 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
0.0 | 0.1 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
0.0 | 0.1 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) positive regulation of osteoclast proliferation(GO:0090290) |
0.0 | 0.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.0 | 0.1 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.0 | 0.1 | GO:1902170 | cellular response to reactive nitrogen species(GO:1902170) |
0.0 | 0.5 | GO:0060074 | synapse maturation(GO:0060074) |
0.0 | 0.1 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.0 | 0.1 | GO:0001842 | neural fold formation(GO:0001842) |
0.0 | 0.2 | GO:0040019 | positive regulation of embryonic development(GO:0040019) |
0.0 | 0.2 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.0 | 0.1 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.0 | 0.1 | GO:0006235 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
0.0 | 2.3 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
0.0 | 1.2 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
0.0 | 0.1 | GO:0060914 | heart formation(GO:0060914) |
0.0 | 0.2 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.0 | 0.1 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.0 | 0.2 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.0 | 0.1 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.0 | 0.0 | GO:0075136 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.0 | 0.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.0 | 0.5 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.0 | GO:0007228 | signal transduction downstream of smoothened(GO:0007227) positive regulation of hh target transcription factor activity(GO:0007228) |
0.0 | 0.1 | GO:0072017 | distal tubule development(GO:0072017) |
0.0 | 0.1 | GO:0015822 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.0 | 0.2 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.0 | 0.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.0 | 0.2 | GO:0006265 | DNA topological change(GO:0006265) |
0.0 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.0 | 0.0 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.0 | 0.1 | GO:0000019 | regulation of mitotic recombination(GO:0000019) negative regulation of mitotic recombination(GO:0045950) |
0.0 | 0.0 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
0.0 | 0.1 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.0 | 0.1 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
0.0 | 0.1 | GO:0048368 | lateral mesoderm development(GO:0048368) |
0.0 | 0.1 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.1 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.0 | 0.2 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.0 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.1 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.0 | 0.3 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
0.0 | 0.1 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.0 | 0.1 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.0 | 2.8 | GO:0071241 | cellular response to inorganic substance(GO:0071241) |
0.0 | 0.0 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.0 | 0.2 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.0 | 0.1 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
0.0 | 0.0 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.0 | 0.1 | GO:0008054 | negative regulation of cyclin-dependent protein serine/threonine kinase by cyclin degradation(GO:0008054) |
0.0 | 0.0 | GO:0033860 | regulation of NAD(P)H oxidase activity(GO:0033860) |
0.0 | 0.2 | GO:0099623 | regulation of cardiac muscle cell membrane repolarization(GO:0099623) |
0.0 | 0.1 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.0 | 0.1 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.0 | 0.0 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.0 | 0.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.0 | 0.1 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
0.0 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.2 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.1 | GO:0019478 | D-amino acid catabolic process(GO:0019478) D-amino acid metabolic process(GO:0046416) |
0.0 | 0.0 | GO:0072007 | mesangial cell differentiation(GO:0072007) glomerular mesangial cell differentiation(GO:0072008) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) |
0.0 | 0.0 | GO:0060174 | limb bud formation(GO:0060174) |
0.0 | 0.2 | GO:0035743 | CD4-positive, alpha-beta T cell cytokine production(GO:0035743) |
0.0 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.0 | 0.0 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.0 | 0.1 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.0 | 0.1 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.0 | 0.4 | GO:0042733 | embryonic digit morphogenesis(GO:0042733) |
0.0 | 0.1 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.0 | 0.1 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.0 | 0.1 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.1 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.0 | 0.1 | GO:1903672 | positive regulation of sprouting angiogenesis(GO:1903672) |
0.0 | 0.1 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.0 | 0.1 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.0 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.0 | 0.1 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.0 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.0 | 0.0 | GO:0009756 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.0 | 0.0 | GO:1904181 | positive regulation of membrane depolarization(GO:1904181) |
0.0 | 0.0 | GO:1903416 | response to glycoside(GO:1903416) |
0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.1 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.0 | 0.0 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.0 | 0.0 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.0 | 0.2 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 0.7 | GO:0042073 | intraciliary transport(GO:0042073) |
0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.0 | 0.0 | GO:0006562 | proline catabolic process(GO:0006562) |
0.0 | 0.0 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
0.0 | 0.2 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
0.0 | 0.2 | GO:0098762 | meiotic prophase I(GO:0007128) prophase(GO:0051324) meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
0.0 | 0.0 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.1 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.0 | 0.8 | GO:0007040 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
0.0 | 0.0 | GO:0006862 | nucleotide transport(GO:0006862) |
0.0 | 1.0 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.0 | 0.0 | GO:1904749 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.0 | 0.1 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.0 | 0.3 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.0 | 0.1 | GO:0002176 | male germ cell proliferation(GO:0002176) |
0.0 | 0.2 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
0.0 | 0.0 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
0.0 | 0.0 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.1 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) |
0.0 | 0.0 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.0 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.0 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.0 | 0.1 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.5 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
0.0 | 0.1 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.0 | 0.0 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.0 | 0.2 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.0 | 0.1 | GO:0002726 | positive regulation of T cell cytokine production(GO:0002726) |
0.0 | 0.2 | GO:0071398 | cellular response to fatty acid(GO:0071398) |
0.0 | 0.1 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.1 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.0 | GO:0021855 | hypothalamus cell migration(GO:0021855) |
0.0 | 0.0 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.0 | 0.0 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.0 | 0.0 | GO:0060536 | cartilage morphogenesis(GO:0060536) |
0.0 | 0.2 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.0 | 0.1 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.0 | 0.1 | GO:0032291 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
0.0 | 0.1 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
0.0 | 0.0 | GO:0021861 | forebrain radial glial cell differentiation(GO:0021861) |
0.0 | 0.1 | GO:0042640 | anagen(GO:0042640) |
0.0 | 0.1 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.1 | GO:0046909 | intermembrane transport(GO:0046909) |
0.0 | 0.2 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.0 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.0 | 0.2 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.1 | GO:0061365 | positive regulation of triglyceride lipase activity(GO:0061365) |
0.0 | 0.1 | GO:0071493 | cellular response to UV-B(GO:0071493) |
0.0 | 0.0 | GO:0060872 | semicircular canal development(GO:0060872) |
0.0 | 0.0 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.1 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.0 | 0.1 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
0.0 | 0.0 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.0 | 0.0 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.0 | 0.1 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.1 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.0 | 0.1 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.0 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.0 | 0.1 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.2 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.4 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.0 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.0 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.0 | 0.1 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
0.0 | 0.1 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.0 | 0.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.0 | 0.1 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
0.0 | 0.2 | GO:0032330 | regulation of chondrocyte differentiation(GO:0032330) |
0.0 | 0.2 | GO:0002718 | regulation of cytokine production involved in immune response(GO:0002718) |
0.0 | 0.1 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.1 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
0.0 | 0.3 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
0.0 | 0.9 | GO:0030317 | sperm motility(GO:0030317) |
0.0 | 0.0 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.0 | 0.0 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.0 | 0.1 | GO:0008209 | androgen metabolic process(GO:0008209) |
0.0 | 0.1 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
0.0 | 0.0 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.0 | 0.0 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
0.0 | 0.1 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.0 | 0.0 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
0.0 | 0.0 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.0 | 0.1 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.1 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.0 | 0.1 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 0.0 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.0 | 0.1 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 0.1 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.0 | 0.1 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.0 | 0.1 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.0 | GO:0002835 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
0.0 | 0.0 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.0 | 0.0 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.0 | 0.0 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.0 | 0.0 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.2 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.0 | 0.3 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.0 | GO:0009221 | pyrimidine deoxyribonucleotide biosynthetic process(GO:0009221) |
0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.0 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.0 | 0.1 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.0 | 0.0 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.0 | 0.0 | GO:0021586 | pons maturation(GO:0021586) |
0.0 | 0.0 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.0 | 0.1 | GO:0034390 | smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) |
0.0 | 0.1 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.0 | 0.1 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 0.2 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
0.0 | 0.0 | GO:0044793 | negative regulation by host of viral process(GO:0044793) |
0.0 | 0.0 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.0 | 0.0 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.0 | 0.0 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.0 | 0.8 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.0 | 0.0 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.0 | 0.4 | GO:0030888 | regulation of B cell proliferation(GO:0030888) |
0.0 | 0.0 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.0 | 0.0 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.4 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.0 | 0.1 | GO:1905038 | regulation of sphingolipid biosynthetic process(GO:0090153) regulation of membrane lipid metabolic process(GO:1905038) regulation of ceramide biosynthetic process(GO:2000303) |
0.0 | 0.0 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.0 | 0.2 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
0.0 | 0.0 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.0 | 0.1 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.0 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.0 | 0.1 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.0 | 0.0 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
0.0 | 0.0 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.0 | 0.1 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.0 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.0 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
0.0 | 0.0 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.0 | 0.1 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.0 | 0.1 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
0.0 | 0.0 | GO:1904177 | regulation of adipose tissue development(GO:1904177) |
0.0 | 0.0 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.0 | 0.1 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.0 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) regulation of respiratory burst involved in inflammatory response(GO:0060264) |
0.0 | 0.0 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.0 | 0.0 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.0 | 0.0 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.0 | 0.0 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.0 | 0.2 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
0.0 | 0.0 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.0 | 0.0 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.0 | 0.0 | GO:1900620 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.0 | 0.2 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.0 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
0.0 | 0.1 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.0 | 0.0 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
0.0 | 0.1 | GO:0060669 | embryonic placenta morphogenesis(GO:0060669) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0046618 | drug export(GO:0046618) |
0.0 | 0.0 | GO:0045357 | interferon-beta biosynthetic process(GO:0045350) regulation of interferon-beta biosynthetic process(GO:0045357) |
0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.0 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.0 | 0.1 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 0.0 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.0 | 0.0 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.0 | 0.0 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.0 | 0.1 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.0 | 0.0 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.0 | 0.0 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
0.0 | 0.1 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.0 | 0.1 | GO:0061001 | regulation of dendritic spine morphogenesis(GO:0061001) |
0.0 | 0.0 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.0 | 0.0 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.0 | 0.1 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.0 | 0.2 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.1 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.0 | 0.0 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.0 | GO:0034375 | high-density lipoprotein particle remodeling(GO:0034375) |
0.0 | 0.0 | GO:0018202 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
0.0 | 0.1 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.0 | 0.0 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.0 | 0.1 | GO:0001771 | immunological synapse formation(GO:0001771) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 2.6 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.3 | 0.8 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.2 | 0.8 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.2 | 1.0 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.2 | 0.5 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 0.5 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 0.4 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.1 | 0.4 | GO:0016939 | kinesin II complex(GO:0016939) |
0.1 | 0.7 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 0.5 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 0.3 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.1 | 0.4 | GO:0070695 | FHF complex(GO:0070695) |
0.1 | 1.2 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 2.9 | GO:0016235 | aggresome(GO:0016235) |
0.1 | 0.6 | GO:0045180 | basal cortex(GO:0045180) |
0.1 | 0.3 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 2.0 | GO:0034451 | centriolar satellite(GO:0034451) |
0.1 | 0.4 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.1 | 0.8 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 0.1 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.1 | 0.4 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.1 | 0.4 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.7 | GO:0070938 | contractile ring(GO:0070938) |
0.1 | 0.5 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.1 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.2 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 0.2 | GO:1990696 | USH2 complex(GO:1990696) |
0.1 | 0.6 | GO:0043194 | axon initial segment(GO:0043194) |
0.1 | 0.2 | GO:1990423 | RZZ complex(GO:1990423) |
0.0 | 1.5 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.2 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.0 | 0.2 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 1.5 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.3 | GO:0016342 | catenin complex(GO:0016342) |
0.0 | 0.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.4 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 0.8 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.4 | GO:0060091 | kinocilium(GO:0060091) |
0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.2 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.0 | 0.5 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.5 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 1.1 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.0 | 0.1 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.0 | 0.2 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.6 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.6 | GO:0030673 | axolemma(GO:0030673) |
0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.1 | GO:0097433 | dense body(GO:0097433) |
0.0 | 0.3 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.1 | GO:0000235 | astral microtubule(GO:0000235) |
0.0 | 0.3 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 10.1 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.0 | 0.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.1 | GO:0042585 | germinal vesicle(GO:0042585) |
0.0 | 0.1 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.0 | 0.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 1.1 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.2 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 0.6 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.0 | 0.7 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.4 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 0.3 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.1 | GO:0033268 | node of Ranvier(GO:0033268) |
0.0 | 8.2 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.2 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.1 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.0 | 0.1 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.1 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.0 | 0.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.0 | 0.7 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.1 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.0 | 0.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.0 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.0 | 0.2 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.0 | 0.3 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.0 | 0.2 | GO:0000243 | commitment complex(GO:0000243) |
0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.3 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.0 | 0.1 | GO:0001939 | female pronucleus(GO:0001939) |
0.0 | 0.1 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.0 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
0.0 | 0.1 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
0.0 | 1.7 | GO:0043296 | apical junction complex(GO:0043296) |
0.0 | 2.1 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.7 | GO:0032587 | ruffle membrane(GO:0032587) |
0.0 | 0.0 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
0.0 | 0.1 | GO:0071437 | invadopodium(GO:0071437) |
0.0 | 0.0 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.0 | 0.1 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.0 | 0.1 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.3 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.3 | GO:0008305 | integrin complex(GO:0008305) |
0.0 | 0.8 | GO:0031526 | brush border membrane(GO:0031526) |
0.0 | 0.0 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.0 | 0.1 | GO:1990246 | uniplex complex(GO:1990246) |
0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.1 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.0 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.0 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.0 | 1.2 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 0.4 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
0.0 | 0.0 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.7 | GO:0016363 | nuclear matrix(GO:0016363) |
0.0 | 0.0 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
0.0 | 0.0 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.3 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 0.1 | GO:0005883 | neurofilament(GO:0005883) |
0.0 | 0.0 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.2 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 0.8 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.0 | GO:1990923 | PET complex(GO:1990923) |
0.0 | 0.1 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.1 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.2 | GO:0000145 | exocyst(GO:0000145) |
0.0 | 0.0 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.0 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.1 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.0 | 0.1 | GO:0099738 | cell cortex region(GO:0099738) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 2.8 | GO:0048495 | Roundabout binding(GO:0048495) |
0.4 | 1.8 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.3 | 1.7 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.3 | 2.4 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.3 | 1.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.3 | 1.9 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.3 | 0.8 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.2 | 0.7 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.2 | 1.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.2 | 0.6 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.2 | 0.6 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.2 | 1.6 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.2 | 0.6 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.2 | 0.7 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.2 | 1.5 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.2 | 2.3 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.2 | 0.9 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.2 | 0.5 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.2 | 0.5 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.1 | 0.5 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.1 | 2.9 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.6 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.1 | 0.4 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.1 | 0.5 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.1 | 0.9 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.1 | 0.4 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.4 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 0.4 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 0.5 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.3 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.7 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.1 | 0.5 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 2.0 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 0.3 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.1 | 0.3 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.3 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 0.5 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.1 | 0.3 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.1 | 0.8 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.1 | 0.4 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.1 | 0.4 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.1 | 0.4 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 0.4 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.1 | 0.3 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.5 | GO:0030249 | guanylate cyclase regulator activity(GO:0030249) |
0.1 | 0.3 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 0.8 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.5 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.1 | 2.6 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.3 | GO:0015265 | urea channel activity(GO:0015265) |
0.1 | 0.1 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.1 | 0.2 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.1 | 1.8 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.1 | 0.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.5 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.1 | 0.8 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 0.2 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.1 | 4.6 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.1 | 0.7 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.1 | 0.2 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.8 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.1 | 0.7 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 0.7 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.1 | 0.2 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.1 | 0.7 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.1 | 1.0 | GO:0043274 | phospholipase binding(GO:0043274) |
0.1 | 0.2 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.1 | 0.3 | GO:0000295 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.1 | 0.6 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.1 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.1 | 0.3 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.3 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.1 | 0.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.1 | 0.2 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.1 | 46.5 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
0.1 | 0.2 | GO:0009374 | biotin binding(GO:0009374) |
0.1 | 0.2 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.1 | 0.7 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.1 | 0.2 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.1 | 0.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.1 | 0.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.1 | 0.2 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.1 | 0.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.0 | 0.2 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.0 | 0.1 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.0 | 0.1 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.0 | 0.2 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.0 | 0.3 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.0 | 0.2 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.0 | 0.2 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.0 | 0.2 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.2 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.0 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.2 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 1.2 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.2 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.1 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.0 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.3 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.2 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.0 | 0.6 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.0 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.0 | 0.6 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.0 | 0.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.0 | 0.1 | GO:0032564 | dATP binding(GO:0032564) |
0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.0 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.0 | 0.0 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.0 | 0.3 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 0.4 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.0 | 0.3 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.6 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.5 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.4 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.8 | GO:0001968 | fibronectin binding(GO:0001968) |
0.0 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.0 | 0.2 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.2 | GO:0070061 | fructose binding(GO:0070061) |
0.0 | 0.2 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.0 | 0.0 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.1 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.0 | 0.2 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.0 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 0.4 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.3 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.4 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.3 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.3 | GO:0031402 | sodium ion binding(GO:0031402) |
0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.8 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.0 | 0.1 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.4 | GO:0001047 | core promoter binding(GO:0001047) |
0.0 | 0.6 | GO:0000252 | C-3 sterol dehydrogenase (C-4 sterol decarboxylase) activity(GO:0000252) mevaldate reductase activity(GO:0004495) gluconate dehydrogenase activity(GO:0008875) epoxide dehydrogenase activity(GO:0018451) 5-exo-hydroxycamphor dehydrogenase activity(GO:0018452) 2-hydroxytetrahydrofuran dehydrogenase activity(GO:0018453) acetoin dehydrogenase activity(GO:0019152) phenylcoumaran benzylic ether reductase activity(GO:0032442) D-xylose:NADP reductase activity(GO:0032866) L-arabinose:NADP reductase activity(GO:0032867) D-arabinitol dehydrogenase, D-ribulose forming (NADP+) activity(GO:0033709) (R)-(-)-1,2,3,4-tetrahydronaphthol dehydrogenase activity(GO:0034831) 3-hydroxymenthone dehydrogenase activity(GO:0034840) very long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0035380) dihydrotestosterone 17-beta-dehydrogenase activity(GO:0035410) (R)-2-hydroxyisocaproate dehydrogenase activity(GO:0043713) L-arabinose 1-dehydrogenase (NADP+) activity(GO:0044103) L-xylulose reductase (NAD+) activity(GO:0044105) 3-ketoglucose-reductase activity(GO:0048258) D-arabinitol dehydrogenase, D-xylulose forming (NADP+) activity(GO:0052677) |
0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.1 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.0 | 0.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.0 | 1.0 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 0.1 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
0.0 | 0.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.0 | 0.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.0 | 0.5 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.1 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.8 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.5 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.4 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.0 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.0 | 0.1 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.0 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.0 | 0.2 | GO:0046790 | virion binding(GO:0046790) |
0.0 | 0.1 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.1 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.0 | 0.0 | GO:0043398 | HLH domain binding(GO:0043398) |
0.0 | 0.0 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.0 | 0.1 | GO:0030172 | troponin C binding(GO:0030172) |
0.0 | 0.1 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.0 | 2.2 | GO:0008201 | heparin binding(GO:0008201) |
0.0 | 0.1 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.1 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.0 | 0.1 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.0 | 0.1 | GO:0033265 | choline binding(GO:0033265) |
0.0 | 0.0 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.0 | 0.0 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.2 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
0.0 | 0.1 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.0 | 0.1 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.0 | 0.1 | GO:0048156 | tau protein binding(GO:0048156) |
0.0 | 0.2 | GO:0043236 | laminin binding(GO:0043236) |
0.0 | 0.2 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.0 | 0.1 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.0 | 0.0 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.1 | GO:0102345 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.0 | 0.1 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.0 | 0.2 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.2 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.1 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.0 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.5 | GO:0004118 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.0 | 0.3 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.0 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.0 | 0.2 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.0 | 0.1 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.0 | 0.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.1 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.0 | 0.1 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.1 | GO:0030546 | receptor activator activity(GO:0030546) |
0.0 | 0.0 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.0 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.3 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.0 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.0 | 0.3 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.0 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.0 | 0.1 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.1 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.0 | 0.1 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.0 | 0.0 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.2 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.0 | 0.1 | GO:0002054 | nucleobase binding(GO:0002054) |
0.0 | 0.0 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.0 | 0.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.5 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.1 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.0 | 0.3 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.0 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.0 | 0.2 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.0 | 0.0 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.0 | 0.0 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.0 | 0.3 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.0 | 0.0 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.0 | 0.0 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.0 | 1.0 | GO:0030674 | protein binding, bridging(GO:0030674) |
0.0 | 0.3 | GO:0052769 | dextrin alpha-glucosidase activity(GO:0044653) starch alpha-glucosidase activity(GO:0044654) beta-glucanase activity(GO:0052736) beta-6-sulfate-N-acetylglucosaminidase activity(GO:0052769) glucan endo-1,4-beta-glucosidase activity(GO:0052859) |
0.0 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.1 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.0 | 0.0 | GO:0030275 | LRR domain binding(GO:0030275) |
0.0 | 0.0 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.4 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.2 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 0.2 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.0 | GO:0018558 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 0.2 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
0.0 | 0.0 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.1 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.0 | 0.4 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.1 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.0 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
0.0 | 0.2 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.2 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.1 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.1 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.0 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.0 | 0.2 | GO:0004787 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
0.0 | 0.1 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.0 | 0.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.1 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.1 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
0.0 | 0.0 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.0 | 0.0 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.1 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.1 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
0.0 | 0.0 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.0 | 0.0 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.3 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.0 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.0 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.0 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.0 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.1 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.0 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.0 | 0.0 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.0 | 0.1 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.0 | 0.0 | GO:0002046 | opsin binding(GO:0002046) |
0.0 | 0.0 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.0 | 0.0 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
0.0 | 0.0 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.0 | 0.2 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
0.0 | 0.1 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.0 | 0.0 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.0 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.0 | 0.0 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.0 | 0.1 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.0 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.1 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.0 | 0.0 | GO:0001223 | transcription coactivator binding(GO:0001223) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.6 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 2.5 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.1 | 0.4 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.1 | 0.4 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.1 | 2.9 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.1 | 1.2 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.1 | 3.5 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.1 | 0.3 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.1 | 1.5 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.1 | 0.9 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 0.4 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.1 | 2.2 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.1 | 0.2 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.1 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 1.2 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.1 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 0.3 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.9 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.6 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 1.2 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 1.7 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.2 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.6 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 1.4 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.4 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.8 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 5.1 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 1.2 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 1.1 | NABA CORE MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
0.0 | 0.6 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 1.0 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 1.0 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.6 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.2 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.7 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.4 | ST GAQ PATHWAY | G alpha q Pathway |
0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.0 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.9 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.3 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.4 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.9 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 0.4 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.3 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.2 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.1 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 0.2 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.3 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.0 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 0.4 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.2 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 0.3 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.5 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 0.1 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 0.5 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.0 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.1 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.0 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 1.0 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.2 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.2 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.1 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 3.0 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.2 | 2.2 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.2 | 2.9 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
0.2 | 1.6 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 2.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 1.2 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 0.2 | REACTOME TRANSMISSION ACROSS CHEMICAL SYNAPSES | Genes involved in Transmission across Chemical Synapses |
0.1 | 0.1 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.1 | 1.0 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.1 | 0.8 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.8 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.1 | 1.6 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 0.1 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.1 | 1.4 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 0.1 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.1 | 0.3 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.1 | 1.1 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.1 | 2.0 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.1 | 0.1 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.1 | 0.3 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.2 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.7 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 0.4 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.0 | 0.6 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.9 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.4 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 1.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 1.5 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 1.1 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
0.0 | 0.4 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.0 | 1.0 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 1.0 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.0 | 0.4 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.8 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.2 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.6 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.3 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 0.3 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
0.0 | 0.3 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 1.0 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 2.6 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 1.7 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 1.2 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.2 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 0.1 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 0.1 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.0 | 0.5 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.3 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.0 | 0.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.2 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.0 | 0.8 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.0 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 0.3 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.4 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.6 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.2 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.4 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
0.0 | 0.3 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.0 | 0.1 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.3 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.2 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.0 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.1 | REACTOME SIGNALLING BY NGF | Genes involved in Signalling by NGF |
0.0 | 0.0 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.2 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.0 | 0.7 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 0.1 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.1 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.2 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.1 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.0 | 0.2 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.3 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
0.0 | 0.2 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.2 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 2.0 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.0 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.0 | 0.0 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
0.0 | 0.1 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.2 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.0 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.0 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.0 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.0 | 0.0 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.0 | 0.1 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.1 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 0.2 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.1 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 0.1 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |