Gene Symbol | Gene ID | Gene Info |
---|---|---|
Hoxd1
|
ENSMUSG00000042448.4 | homeobox D1 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
chr2_74762507_74763726 | Hoxd1 | 136 | 0.590247 | 0.39 | 1.9e-03 | Click! |
chr2_74765700_74765851 | Hoxd1 | 2795 | 0.103987 | 0.20 | 1.3e-01 | Click! |
chr2_74794283_74794434 | Hoxd1 | 31378 | 0.068679 | -0.13 | 3.4e-01 | Click! |
chr2_74764308_74764459 | Hoxd1 | 1403 | 0.176280 | 0.09 | 4.7e-01 | Click! |
chr2_74764463_74764614 | Hoxd1 | 1558 | 0.160382 | -0.01 | 9.4e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr13_102957440_102958679 | 2.30 |
Mast4 |
microtubule associated serine/threonine kinase family member 4 |
287 |
0.95 |
chr13_71961770_71962476 | 2.06 |
Irx1 |
Iroquois homeobox 1 |
1407 |
0.5 |
chr10_33083500_33083959 | 1.83 |
Trdn |
triadin |
168 |
0.97 |
chr3_30010716_30011762 | 1.71 |
Mecom |
MDS1 and EVI1 complex locus |
200 |
0.91 |
chr15_40656769_40657228 | 1.69 |
Zfpm2 |
zinc finger protein, multitype 2 |
1647 |
0.51 |
chr16_43504464_43505047 | 1.69 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
1058 |
0.61 |
chr19_56388806_56389568 | 1.57 |
Nrap |
nebulin-related anchoring protein |
690 |
0.66 |
chr3_66976156_66976605 | 1.57 |
Shox2 |
short stature homeobox 2 |
2067 |
0.29 |
chr17_11664263_11665109 | 1.56 |
Gm10513 |
predicted gene 10513 |
67659 |
0.13 |
chr3_42111234_42111590 | 1.55 |
Gm37846 |
predicted gene, 37846 |
52453 |
0.16 |
chr9_79976568_79977294 | 1.55 |
Filip1 |
filamin A interacting protein 1 |
728 |
0.66 |
chr18_10787357_10787713 | 1.55 |
Mir133a-1hg |
Mir133a-1, Mir1b and Mir1a-2 host gene |
1652 |
0.2 |
chr14_32684282_32684433 | 1.54 |
3425401B19Rik |
RIKEN cDNA 3425401B19 gene |
915 |
0.46 |
chr14_57034020_57034491 | 1.53 |
B020004C17Rik |
RIKEN cDNA B020004C17 gene |
19121 |
0.15 |
chr12_89815214_89815490 | 1.46 |
Nrxn3 |
neurexin III |
2869 |
0.41 |
chr18_43436329_43436751 | 1.46 |
Dpysl3 |
dihydropyrimidinase-like 3 |
1746 |
0.35 |
chr8_92353342_92354327 | 1.45 |
Crnde |
colorectal neoplasia differentially expressed (non-protein coding) |
1930 |
0.3 |
chr2_172937060_172938226 | 1.45 |
Bmp7 |
bone morphogenetic protein 7 |
2449 |
0.28 |
chr7_136007847_136008710 | 1.44 |
Gm9341 |
predicted gene 9341 |
55480 |
0.13 |
chr4_32486662_32487238 | 1.43 |
Bach2 |
BTB and CNC homology, basic leucine zipper transcription factor 2 |
14555 |
0.23 |
chr2_107292125_107293014 | 1.40 |
Kcna4 |
potassium voltage-gated channel, shaker-related subfamily, member 4 |
1174 |
0.64 |
chr8_57317953_57318771 | 1.37 |
Hand2os1 |
Hand2, opposite strand 1 |
462 |
0.73 |
chr8_128361057_128361799 | 1.36 |
Nrp1 |
neuropilin 1 |
2031 |
0.32 |
chr11_117482269_117483090 | 1.35 |
Gm34418 |
predicted gene, 34418 |
82 |
0.95 |
chr2_62681523_62681738 | 1.34 |
Gca |
grancalcin |
4568 |
0.22 |
chr13_46420548_46420948 | 1.34 |
Rbm24 |
RNA binding motif protein 24 |
197 |
0.96 |
chr8_92361507_92362918 | 1.33 |
Irx5 |
Iroquois homeobox 5 |
4463 |
0.2 |
chr5_13280340_13280537 | 1.31 |
Sema3a |
sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3A |
116346 |
0.06 |
chr16_43503039_43503193 | 1.29 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
498 |
0.85 |
chr2_138277835_138280637 | 1.28 |
Btbd3 |
BTB (POZ) domain containing 3 |
743 |
0.81 |
chr13_31810556_31811961 | 1.27 |
Foxc1 |
forkhead box C1 |
4625 |
0.19 |
chr8_61901693_61901844 | 1.25 |
Palld |
palladin, cytoskeletal associated protein |
901 |
0.56 |
chr3_79180505_79180656 | 1.24 |
Rapgef2 |
Rap guanine nucleotide exchange factor (GEF) 2 |
760 |
0.66 |
chr1_194621653_194621902 | 1.23 |
Plxna2 |
plexin A2 |
1952 |
0.34 |
chr3_19646421_19646748 | 1.22 |
Trim55 |
tripartite motif-containing 55 |
2076 |
0.26 |
chr17_71021282_71021597 | 1.21 |
Myom1 |
myomesin 1 |
1848 |
0.24 |
chr13_104289921_104290286 | 1.20 |
Adamts6 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 6 |
2128 |
0.35 |
chr6_17170071_17171190 | 1.20 |
Gm4876 |
predicted gene 4876 |
835 |
0.65 |
chr4_5724213_5725550 | 1.19 |
Fam110b |
family with sequence similarity 110, member B |
569 |
0.81 |
chr2_45001616_45002114 | 1.18 |
Zeb2 |
zinc finger E-box binding homeobox 2 |
21050 |
0.19 |
chr10_39165752_39166209 | 1.17 |
Ccn6 |
cellular communication network factor 6 |
2186 |
0.23 |
chr1_140182332_140182724 | 1.14 |
Cfh |
complement component factor h |
752 |
0.73 |
chr9_74977325_74977617 | 1.14 |
Fam214a |
family with sequence similarity 214, member A |
1360 |
0.45 |
chr6_146500226_146500471 | 1.13 |
Itpr2 |
inositol 1,4,5-triphosphate receptor 2 |
1530 |
0.4 |
chr13_44842150_44842855 | 1.13 |
Jarid2 |
jumonji, AT rich interactive domain 2 |
1719 |
0.39 |
chr11_65266805_65267363 | 1.12 |
Myocd |
myocardin |
2770 |
0.29 |
chr3_60530332_60531570 | 1.11 |
Mbnl1 |
muscleblind like splicing factor 1 |
1320 |
0.48 |
chr5_57723598_57724600 | 1.11 |
Gm42635 |
predicted gene 42635 |
294 |
0.83 |
chr3_55782023_55782190 | 1.09 |
Mab21l1 |
mab-21-like 1 |
404 |
0.8 |
chr10_3368375_3368998 | 1.09 |
Ppp1r14c |
protein phosphatase 1, regulatory inhibitor subunit 14C |
2142 |
0.36 |
chr11_21368743_21368957 | 1.09 |
Gm12043 |
predicted gene 12043 |
1550 |
0.26 |
chr7_112156320_112156682 | 1.09 |
Dkk3 |
dickkopf WNT signaling pathway inhibitor 3 |
2556 |
0.36 |
chr11_75013917_75014204 | 1.08 |
Smg6 |
Smg-6 homolog, nonsense mediated mRNA decay factor (C. elegans) |
20207 |
0.11 |
chr19_29470979_29471199 | 1.07 |
Pdcd1lg2 |
programmed cell death 1 ligand 2 |
49030 |
0.1 |
chr18_4636274_4636995 | 1.06 |
Jcad |
junctional cadherin 5 associated |
1756 |
0.43 |
chr7_29071185_29072068 | 1.06 |
Gm26604 |
predicted gene, 26604 |
11 |
0.87 |
chr17_10314038_10315183 | 1.05 |
Qk |
quaking |
4751 |
0.26 |
chr6_138708519_138709263 | 1.04 |
Igbp1b |
immunoglobulin (CD79A) binding protein 1b |
50347 |
0.16 |
chr3_110022906_110023531 | 1.04 |
Ntng1 |
netrin G1 |
112250 |
0.06 |
chr4_49842278_49843034 | 1.04 |
Grin3a |
glutamate receptor ionotropic, NMDA3A |
2893 |
0.36 |
chr2_14823792_14824714 | 1.02 |
Cacnb2 |
calcium channel, voltage-dependent, beta 2 subunit |
161 |
0.94 |
chr9_83663941_83664341 | 1.02 |
Gm36120 |
predicted gene, 36120 |
23384 |
0.17 |
chr5_75975434_75975824 | 1.01 |
Kdr |
kinase insert domain protein receptor |
2829 |
0.25 |
chr1_131232374_131233673 | 1.00 |
Rassf5 |
Ras association (RalGDS/AF-6) domain family member 5 |
552 |
0.67 |
chr3_82070010_82070288 | 1.00 |
Gucy1b1 |
guanylate cyclase 1, soluble, beta 1 |
4524 |
0.22 |
chr11_65269494_65270784 | 0.99 |
Myocd |
myocardin |
150 |
0.96 |
chr11_47377104_47378325 | 0.98 |
Sgcd |
sarcoglycan, delta (dystrophin-associated glycoprotein) |
1808 |
0.52 |
chr13_72629730_72632045 | 0.98 |
Irx2 |
Iroquois homeobox 2 |
1062 |
0.51 |
chr14_61043748_61044093 | 0.97 |
Tnfrsf19 |
tumor necrosis factor receptor superfamily, member 19 |
2549 |
0.3 |
chr8_13253140_13253419 | 0.97 |
Adprhl1 |
ADP-ribosylhydrolase like 1 |
792 |
0.46 |
chr8_61899020_61899541 | 0.97 |
Palld |
palladin, cytoskeletal associated protein |
3389 |
0.22 |
chr9_52277982_52278255 | 0.96 |
Gm25562 |
predicted gene, 25562 |
13081 |
0.22 |
chr2_76979769_76980006 | 0.96 |
Ttn |
titin |
295 |
0.93 |
chr5_112894973_112895548 | 0.96 |
Myo18b |
myosin XVIIIb |
1102 |
0.54 |
chr13_109581263_109581782 | 0.96 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
117 |
0.98 |
chr5_150261018_150262108 | 0.95 |
Fry |
FRY microtubule binding protein |
1796 |
0.34 |
chr9_41377643_41378358 | 0.94 |
Mir100hg |
Mir100 Mirlet7a-2 Mir125b-1 cluster host gene |
1439 |
0.4 |
chr11_66911831_66911982 | 0.94 |
Pirt |
phosphoinositide-interacting regulator of transient receptor potential channels |
75 |
0.97 |
chr9_59033803_59034249 | 0.94 |
Neo1 |
neogenin |
2399 |
0.36 |
chr12_95737341_95737790 | 0.94 |
Gm48015 |
predicted gene, 48015 |
3455 |
0.24 |
chr5_138608490_138608879 | 0.94 |
Zfp68 |
zinc finger protein 68 |
1627 |
0.2 |
chr8_49486046_49486197 | 0.93 |
4930555F03Rik |
RIKEN cDNA 4930555F03 gene |
640 |
0.68 |
chr8_40331087_40331414 | 0.93 |
Fgf20 |
fibroblast growth factor 20 |
22919 |
0.16 |
chr4_91312988_91313420 | 0.92 |
Elavl2 |
ELAV like RNA binding protein 1 |
199 |
0.96 |
chr9_71894609_71895239 | 0.90 |
Tcf12 |
transcription factor 12 |
1061 |
0.37 |
chr11_26806712_26807274 | 0.90 |
Gm12070 |
predicted gene 12070 |
20360 |
0.19 |
chr10_63203190_63203876 | 0.89 |
Mypn |
myopalladin |
419 |
0.79 |
chr2_74207544_74207807 | 0.88 |
Gm13667 |
predicted gene 13667 |
71918 |
0.09 |
chr12_71048832_71049275 | 0.88 |
Arid4a |
AT rich interactive domain 4A (RBP1-like) |
712 |
0.65 |
chr14_19760606_19760757 | 0.88 |
Nid2 |
nidogen 2 |
7556 |
0.17 |
chr3_79144294_79146166 | 0.87 |
Rapgef2 |
Rap guanine nucleotide exchange factor (GEF) 2 |
253 |
0.94 |
chr5_147723576_147724353 | 0.86 |
Flt1 |
FMS-like tyrosine kinase 1 |
2024 |
0.35 |
chr1_153330166_153330548 | 0.86 |
Lamc1 |
laminin, gamma 1 |
2429 |
0.26 |
chr19_27218532_27219076 | 0.86 |
Vldlr |
very low density lipoprotein receptor |
1346 |
0.46 |
chr4_114842209_114842913 | 0.86 |
Gm23230 |
predicted gene, 23230 |
2556 |
0.25 |
chr8_66697150_66698637 | 0.86 |
Npy1r |
neuropeptide Y receptor Y1 |
471 |
0.82 |
chr5_43339085_43339475 | 0.86 |
Gm43020 |
predicted gene 43020 |
15979 |
0.18 |
chr4_84278398_84278938 | 0.85 |
Bnc2 |
basonuclin 2 |
13089 |
0.28 |
chr3_126599850_126600378 | 0.85 |
Gm43011 |
predicted gene 43011 |
85 |
0.96 |
chr13_110396048_110396669 | 0.85 |
Plk2 |
polo like kinase 2 |
346 |
0.91 |
chrX_106921477_106921682 | 0.84 |
Lpar4 |
lysophosphatidic acid receptor 4 |
954 |
0.64 |
chr18_11060814_11061287 | 0.84 |
Gata6 |
GATA binding protein 6 |
2003 |
0.37 |
chr19_53557067_53557881 | 0.83 |
Gm50394 |
predicted gene, 50394 |
27819 |
0.11 |
chr3_52271315_52271942 | 0.83 |
Gm20402 |
predicted gene 20402 |
2193 |
0.21 |
chr7_143108491_143109591 | 0.83 |
Kcnq1 |
potassium voltage-gated channel, subfamily Q, member 1 |
153 |
0.92 |
chr5_116420481_116421179 | 0.83 |
Hspb8 |
heat shock protein 8 |
2034 |
0.22 |
chr19_53680794_53681963 | 0.82 |
Rbm20 |
RNA binding motif protein 20 |
4072 |
0.23 |
chr14_64589664_64590503 | 0.82 |
Mir124a-1hg |
Mir124-1 host gene (non-protein coding) |
388 |
0.55 |
chr3_134330789_134331989 | 0.82 |
Gm43558 |
predicted gene 43558 |
25903 |
0.15 |
chr6_4509490_4509713 | 0.82 |
Gm43921 |
predicted gene, 43921 |
3514 |
0.18 |
chr1_81593421_81594539 | 0.81 |
Gm6198 |
predicted gene 6198 |
36497 |
0.2 |
chrX_53267645_53268215 | 0.80 |
Fam122b |
family with sequence similarity 122, member B |
1090 |
0.45 |
chr9_77344708_77344864 | 0.80 |
Mlip |
muscular LMNA-interacting protein |
3007 |
0.22 |
chr7_19334746_19334897 | 0.80 |
Gm44698 |
predicted gene 44698 |
1692 |
0.15 |
chr1_188001052_188001305 | 0.80 |
Esrrg |
estrogen-related receptor gamma |
3310 |
0.3 |
chr4_48586297_48586448 | 0.80 |
Tmeff1 |
transmembrane protein with EGF-like and two follistatin-like domains 1 |
821 |
0.65 |
chr12_34529024_34529175 | 0.80 |
Hdac9 |
histone deacetylase 9 |
225 |
0.96 |
chr12_117200442_117200898 | 0.80 |
Gm10421 |
predicted gene 10421 |
49019 |
0.16 |
chr1_89750503_89751328 | 0.80 |
Agap1 |
ArfGAP with GTPase domain, ankyrin repeat and PH domain 1 |
38248 |
0.16 |
chr7_109255495_109256046 | 0.79 |
Gm45024 |
predicted gene 45024 |
31570 |
0.17 |
chr9_25483755_25485057 | 0.79 |
Eepd1 |
endonuclease/exonuclease/phosphatase family domain containing 1 |
1539 |
0.42 |
chr13_46424530_46424922 | 0.79 |
Rbm24 |
RNA binding motif protein 24 |
2904 |
0.31 |
chr13_81944263_81944829 | 0.79 |
F830210D05Rik |
RIKEN cDNA F830210D05 gene |
14859 |
0.26 |
chr5_138609015_138609166 | 0.79 |
Gm15497 |
predicted gene 15497 |
1649 |
0.2 |
chr2_152436557_152436921 | 0.78 |
6820408C15Rik |
RIKEN cDNA 6820408C15 gene |
9077 |
0.08 |
chr2_170731376_170731729 | 0.78 |
Dok5 |
docking protein 5 |
255 |
0.95 |
chr12_52854803_52855496 | 0.78 |
Akap6 |
A kinase (PRKA) anchor protein 6 |
59313 |
0.14 |
chr5_76859778_76859929 | 0.78 |
C530008M17Rik |
RIKEN cDNA C530008M17 gene |
1011 |
0.52 |
chr7_109191327_109192334 | 0.78 |
Lmo1 |
LIM domain only 1 |
16623 |
0.17 |
chr15_59876437_59876598 | 0.78 |
Gm7708 |
predicted gene 7708 |
53773 |
0.13 |
chr2_64092860_64093848 | 0.78 |
Fign |
fidgetin |
4634 |
0.37 |
chr4_133040034_133040455 | 0.78 |
Ahdc1 |
AT hook, DNA binding motif, containing 1 |
751 |
0.67 |
chr8_109250884_109251908 | 0.77 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
1530 |
0.52 |
chr2_57616644_57617156 | 0.77 |
Gm13532 |
predicted gene 13532 |
12328 |
0.21 |
chr1_89583286_89583521 | 0.77 |
Agap1 |
ArfGAP with GTPase domain, ankyrin repeat and PH domain 1 |
3167 |
0.24 |
chr17_15826761_15827329 | 0.76 |
Rgmb |
repulsive guidance molecule family member B |
459 |
0.77 |
chr2_80445635_80445896 | 0.76 |
Frzb |
frizzled-related protein |
1860 |
0.34 |
chrX_103184741_103184892 | 0.76 |
Nap1l2 |
nucleosome assembly protein 1-like 2 |
1824 |
0.25 |
chr5_119841347_119842608 | 0.76 |
Tbx5 |
T-box 5 |
5822 |
0.19 |
chr7_112956295_112957421 | 0.76 |
Rassf10 |
Ras association (RalGDS/AF-6) domain family (N-terminal) member 10 |
2896 |
0.26 |
chr12_90946452_90946639 | 0.75 |
Gm47688 |
predicted gene, 47688 |
8163 |
0.18 |
chr6_87333037_87333530 | 0.75 |
Gm44414 |
predicted gene, 44414 |
1577 |
0.23 |
chr6_16316653_16317675 | 0.75 |
Gm3148 |
predicted gene 3148 |
79537 |
0.1 |
chr12_98577628_98578516 | 0.75 |
Kcnk10 |
potassium channel, subfamily K, member 10 |
238 |
0.9 |
chr11_88840326_88840785 | 0.75 |
Akap1 |
A kinase (PRKA) anchor protein 1 |
985 |
0.51 |
chr6_145748240_145748391 | 0.75 |
Rassf8 |
Ras association (RalGDS/AF-6) domain family (N-terminal) member 8 |
1567 |
0.35 |
chr1_40806618_40806769 | 0.74 |
Tmem182 |
transmembrane protein 182 |
1092 |
0.48 |
chr6_53986510_53986917 | 0.74 |
4921529L05Rik |
RIKEN cDNA 4921529L05 gene |
7984 |
0.2 |
chr18_25694097_25694278 | 0.74 |
0710001A04Rik |
RIKEN cDNA 0710001A04 gene |
19583 |
0.23 |
chr5_131855295_131855771 | 0.74 |
4930563F08Rik |
RIKEN cDNA 4930563F08 gene |
24736 |
0.14 |
chr2_70315394_70315699 | 0.73 |
Rpl9-ps7 |
ribosomal protein L9, pseudogene 7 |
143436 |
0.04 |
chrX_101642899_101643454 | 0.73 |
Ogt |
O-linked N-acetylglucosamine (GlcNAc) transferase (UDP-N-acetylglucosamine:polypeptide-N-acetylglucosaminyl transferase) |
3036 |
0.21 |
chr5_47988429_47989444 | 0.73 |
Slit2 |
slit guidance ligand 2 |
1094 |
0.46 |
chr8_58990051_58990202 | 0.73 |
Galntl6 |
UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase-like 6 |
77486 |
0.1 |
chr13_12334039_12334447 | 0.73 |
Actn2 |
actinin alpha 2 |
6481 |
0.18 |
chr19_24859802_24860526 | 0.73 |
Pgm5 |
phosphoglucomutase 5 |
1488 |
0.33 |
chr5_143293458_143294037 | 0.73 |
Zfp853 |
zinc finger protein 853 |
124 |
0.91 |
chr6_98525524_98525718 | 0.72 |
4930595L18Rik |
RIKEN cDNA 4930595L18 gene |
26486 |
0.26 |
chr10_42613700_42614446 | 0.72 |
Ostm1 |
osteopetrosis associated transmembrane protein 1 |
30235 |
0.16 |
chr15_79262644_79262795 | 0.72 |
Baiap2l2 |
BAI1-associated protein 2-like 2 |
1422 |
0.24 |
chr1_46970388_46970697 | 0.72 |
Gm28527 |
predicted gene 28527 |
73663 |
0.09 |
chr6_125111593_125111744 | 0.72 |
Chd4 |
chromodomain helicase DNA binding protein 4 |
1873 |
0.14 |
chr9_79716392_79716582 | 0.72 |
Col12a1 |
collagen, type XII, alpha 1 |
2007 |
0.31 |
chr15_63302526_63302677 | 0.72 |
Gm49014 |
predicted gene, 49014 |
46648 |
0.15 |
chr2_137112378_137113208 | 0.72 |
Jag1 |
jagged 1 |
3851 |
0.33 |
chr1_170771379_170771924 | 0.72 |
Gm23523 |
predicted gene, 23523 |
19828 |
0.14 |
chr14_118080663_118081120 | 0.72 |
Dct |
dopachrome tautomerase |
28647 |
0.15 |
chr4_83049767_83049918 | 0.71 |
Frem1 |
Fras1 related extracellular matrix protein 1 |
2325 |
0.33 |
chr11_98349783_98350285 | 0.71 |
Ppp1r1b |
protein phosphatase 1, regulatory inhibitor subunit 1B |
38 |
0.94 |
chr1_187999444_187999905 | 0.71 |
Esrrg |
estrogen-related receptor gamma |
1806 |
0.42 |
chr4_80864501_80865110 | 0.71 |
Tyrp1 |
tyrosinase-related protein 1 |
18217 |
0.24 |
chr18_20742242_20742496 | 0.71 |
B4galt6 |
UDP-Gal:betaGlcNAc beta 1,4-galactosyltransferase, polypeptide 6 |
4035 |
0.24 |
chr13_73262153_73264451 | 0.71 |
Irx4 |
Iroquois homeobox 4 |
2805 |
0.22 |
chr13_8211692_8211843 | 0.71 |
Adarb2 |
adenosine deaminase, RNA-specific, B2 |
8845 |
0.18 |
chr1_172616477_172616957 | 0.71 |
Fcrl6 |
Fc receptor-like 6 |
14166 |
0.12 |
chr9_102721179_102722320 | 0.70 |
Amotl2 |
angiomotin-like 2 |
567 |
0.65 |
chr9_80165771_80166222 | 0.70 |
Myo6 |
myosin VI |
769 |
0.65 |
chr15_11741805_11742688 | 0.70 |
Gm41271 |
predicted gene, 41271 |
38543 |
0.18 |
chr14_75963198_75963625 | 0.70 |
Kctd4 |
potassium channel tetramerisation domain containing 4 |
8402 |
0.18 |
chr2_126036157_126037467 | 0.70 |
Fgf7 |
fibroblast growth factor 7 |
1839 |
0.43 |
chr10_24597252_24598120 | 0.70 |
Gm15270 |
predicted gene 15270 |
578 |
0.69 |
chr8_128362179_128363441 | 0.70 |
Nrp1 |
neuropilin 1 |
3413 |
0.27 |
chr16_63863108_63864179 | 0.70 |
Epha3 |
Eph receptor A3 |
230 |
0.96 |
chr14_49781809_49781962 | 0.69 |
Armh4 |
armadillo-like helical domain containing 4 |
1486 |
0.3 |
chrX_114477444_114477705 | 0.69 |
Klhl4 |
kelch-like 4 |
2970 |
0.31 |
chr11_44696670_44697193 | 0.69 |
Gm12158 |
predicted gene 12158 |
34255 |
0.18 |
chr4_154630838_154632339 | 0.69 |
Prdm16 |
PR domain containing 16 |
5209 |
0.14 |
chr16_37778838_37779104 | 0.69 |
Fstl1 |
follistatin-like 1 |
1819 |
0.36 |
chr4_44663567_44664953 | 0.69 |
Gm12462 |
predicted gene 12462 |
155 |
0.94 |
chr2_92529541_92530024 | 0.69 |
Gm13817 |
predicted gene 13817 |
11198 |
0.14 |
chr2_74732545_74733279 | 0.68 |
Hoxd3 |
homeobox D3 |
1 |
0.92 |
chr16_96205810_96206739 | 0.68 |
Sh3bgr |
SH3-binding domain glutamic acid-rich protein |
369 |
0.83 |
chr3_55786102_55786728 | 0.68 |
Nbea |
neurobeachin |
487 |
0.8 |
chr8_81856300_81856587 | 0.68 |
Inpp4b |
inositol polyphosphate-4-phosphatase, type II |
75 |
0.98 |
chr4_87359673_87359861 | 0.68 |
Gm12600 |
predicted gene 12600 |
61405 |
0.13 |
chr16_4448299_4448450 | 0.68 |
Adcy9 |
adenylate cyclase 9 |
27876 |
0.16 |
chr10_58394969_58395625 | 0.68 |
Lims1 |
LIM and senescent cell antigen-like domains 1 |
909 |
0.6 |
chrX_73775534_73775749 | 0.68 |
Srpk3 |
serine/arginine-rich protein specific kinase 3 |
1236 |
0.26 |
chr1_19213854_19215338 | 0.68 |
Tfap2b |
transcription factor AP-2 beta |
717 |
0.69 |
chr7_44472607_44472821 | 0.68 |
5430431A17Rik |
RIKEN cDNA 5430431A17 gene |
824 |
0.31 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 2.5 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.7 | 2.0 | GO:0033058 | directional locomotion(GO:0033058) |
0.6 | 1.8 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
0.5 | 1.6 | GO:1903375 | cerebral cortex tangential migration using cell-axon interactions(GO:0021824) gonadotrophin-releasing hormone neuronal migration to the hypothalamus(GO:0021828) hypothalamic tangential migration using cell-axon interactions(GO:0021856) facioacoustic ganglion development(GO:1903375) |
0.5 | 1.5 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.5 | 1.5 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.4 | 1.2 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.4 | 2.1 | GO:0003175 | tricuspid valve development(GO:0003175) |
0.4 | 2.2 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.4 | 1.1 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.3 | 1.0 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.3 | 1.3 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.3 | 0.9 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.3 | 0.3 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
0.3 | 0.9 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.3 | 0.9 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
0.3 | 0.6 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.3 | 0.8 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.2 | 0.7 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.2 | 0.2 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.2 | 1.0 | GO:0051794 | regulation of catagen(GO:0051794) |
0.2 | 0.7 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.2 | 0.2 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
0.2 | 0.9 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.2 | 0.9 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.2 | 0.6 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.2 | 0.6 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.2 | 0.4 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.2 | 0.8 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.2 | 0.8 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.2 | 0.6 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
0.2 | 0.7 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.2 | 0.9 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
0.2 | 0.5 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.2 | 0.7 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.2 | 0.5 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.2 | 0.7 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.2 | 0.7 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.2 | 0.8 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.2 | 1.0 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
0.2 | 0.2 | GO:0072050 | S-shaped body morphogenesis(GO:0072050) |
0.2 | 0.5 | GO:2001016 | positive regulation of skeletal muscle cell differentiation(GO:2001016) |
0.2 | 0.5 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.2 | 0.7 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.2 | 1.1 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.2 | 0.5 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.2 | 0.6 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.2 | 0.6 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.2 | 1.6 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.2 | 0.8 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.2 | 0.5 | GO:0035564 | regulation of kidney size(GO:0035564) |
0.2 | 0.5 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.2 | 0.3 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.2 | 0.5 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.2 | 0.9 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.2 | 0.5 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.1 | 0.7 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.1 | 0.4 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.1 | 0.7 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.1 | 0.6 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.1 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.1 | 0.3 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.1 | 0.8 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.1 | 0.4 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.1 | 0.7 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.1 | 0.4 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.1 | 0.3 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.1 | 0.4 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.1 | 0.4 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.1 | 0.6 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.9 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.1 | 1.0 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.1 | 0.5 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.1 | 0.2 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.1 | 0.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.1 | 1.0 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.1 | 0.5 | GO:0032345 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.1 | 0.2 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.1 | 0.4 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.1 | 0.2 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.1 | 0.4 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.5 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.1 | 0.2 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.1 | 0.2 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.1 | 0.3 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.3 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.1 | 0.3 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.1 | 0.6 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.1 | 0.4 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.1 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.1 | 0.5 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.1 | 0.3 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.1 | 0.3 | GO:0048793 | pronephros development(GO:0048793) |
0.1 | 0.2 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.1 | 0.2 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.1 | 0.1 | GO:0072553 | terminal button organization(GO:0072553) |
0.1 | 1.4 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 0.3 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.1 | 0.3 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
0.1 | 0.1 | GO:0008050 | female courtship behavior(GO:0008050) |
0.1 | 0.2 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.1 | 0.3 | GO:0030035 | microspike assembly(GO:0030035) |
0.1 | 1.2 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.1 | 0.2 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.1 | 0.2 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
0.1 | 1.2 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.1 | 0.2 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.1 | 0.6 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.1 | 0.2 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.1 | 0.7 | GO:0097264 | self proteolysis(GO:0097264) |
0.1 | 0.2 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.1 | 0.2 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.1 | 0.1 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
0.1 | 0.5 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.1 | 0.5 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.1 | 1.1 | GO:0001553 | luteinization(GO:0001553) |
0.1 | 0.1 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.1 | 0.2 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.1 | 0.2 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.1 | 0.5 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.1 | 0.7 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.1 | 1.0 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 0.4 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.1 | 0.4 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.1 | 0.4 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.1 | 0.1 | GO:0097688 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.1 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 0.5 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.1 | 0.3 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.1 | 0.2 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
0.1 | 0.3 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 0.7 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 0.3 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.1 | 0.2 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
0.1 | 0.6 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
0.1 | 0.3 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.1 | 0.5 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.4 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.1 | 0.1 | GO:2001054 | negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
0.1 | 0.6 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.1 | 0.2 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.1 | 0.5 | GO:0015884 | folic acid transport(GO:0015884) |
0.1 | 0.2 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.1 | 0.2 | GO:0060618 | nipple development(GO:0060618) |
0.1 | 0.1 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.1 | 0.9 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.1 | 0.2 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.1 | 0.2 | GO:0003253 | cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
0.1 | 0.2 | GO:0048842 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
0.1 | 0.1 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.1 | 0.1 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.1 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 0.5 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.1 | 0.8 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
0.1 | 0.5 | GO:0071625 | vocalization behavior(GO:0071625) |
0.1 | 0.3 | GO:0060601 | lateral sprouting from an epithelium(GO:0060601) |
0.1 | 0.2 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.1 | 0.5 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
0.1 | 0.2 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.1 | 0.1 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
0.1 | 0.7 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.1 | 0.1 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
0.1 | 0.1 | GO:0002911 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
0.1 | 0.1 | GO:0060486 | Clara cell differentiation(GO:0060486) |
0.1 | 0.3 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 0.4 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
0.1 | 0.2 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.1 | 0.7 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.4 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.1 | 0.2 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.1 | 0.6 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.1 | 0.3 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.1 | 0.8 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
0.1 | 0.3 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.1 | 0.3 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.1 | 0.2 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.1 | 0.5 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 0.2 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.1 | 0.2 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.1 | 0.3 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.1 | 0.2 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.1 | 0.2 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
0.1 | 0.1 | GO:0045914 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.1 | 0.1 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.1 | 0.5 | GO:0060074 | synapse maturation(GO:0060074) |
0.1 | 0.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.1 | 0.4 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
0.1 | 0.1 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.1 | 0.2 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
0.1 | 0.1 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.1 | 0.3 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.1 | 0.1 | GO:0042693 | muscle cell fate commitment(GO:0042693) |
0.1 | 0.4 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.1 | 0.1 | GO:0072199 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.1 | 0.2 | GO:0003161 | cardiac conduction system development(GO:0003161) |
0.1 | 0.2 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.1 | 0.3 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.1 | 0.4 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.1 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
0.1 | 0.3 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.1 | 0.1 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.2 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.1 | 0.2 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.1 | 0.2 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.1 | 0.3 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.1 | 0.2 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.1 | 0.2 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.1 | 0.1 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.1 | 0.2 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.1 | 1.1 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.1 | 0.2 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
0.1 | 0.5 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.1 | 0.1 | GO:0001757 | somite specification(GO:0001757) |
0.1 | 0.7 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.1 | 0.1 | GO:1900238 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.1 | 0.2 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.1 | 0.1 | GO:0061110 | dense core granule biogenesis(GO:0061110) |
0.1 | 0.3 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.1 | 0.3 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.1 | 0.2 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.1 | 0.1 | GO:0002118 | aggressive behavior(GO:0002118) |
0.1 | 0.1 | GO:0010635 | regulation of mitochondrial fusion(GO:0010635) |
0.1 | 0.3 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.1 | 0.1 | GO:0021569 | rhombomere 3 development(GO:0021569) |
0.1 | 0.1 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
0.1 | 0.1 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.1 | 0.1 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) |
0.1 | 0.3 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.1 | 1.5 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.1 | 0.3 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.1 | 0.5 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.1 | 1.1 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
0.1 | 0.1 | GO:0060435 | bronchiole development(GO:0060435) |
0.1 | 0.2 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.1 | 0.2 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.1 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.1 | 0.2 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 0.7 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.2 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.1 | 0.3 | GO:0036233 | glycine import(GO:0036233) |
0.1 | 0.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.1 | 0.1 | GO:0021612 | facial nerve structural organization(GO:0021612) |
0.1 | 0.3 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.1 | 0.1 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
0.1 | 1.5 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
0.1 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
0.0 | 0.2 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.1 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.0 | 0.1 | GO:0032364 | oxygen homeostasis(GO:0032364) |
0.0 | 0.0 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.0 | 0.1 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.0 | 0.0 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.0 | 0.0 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.0 | 0.1 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
0.0 | 0.2 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.2 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.0 | 0.7 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
0.0 | 0.0 | GO:0021855 | hypothalamus cell migration(GO:0021855) |
0.0 | 0.4 | GO:0007625 | grooming behavior(GO:0007625) |
0.0 | 0.1 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.0 | 0.7 | GO:0001696 | gastric acid secretion(GO:0001696) |
0.0 | 0.1 | GO:0060290 | transdifferentiation(GO:0060290) |
0.0 | 0.9 | GO:0001964 | startle response(GO:0001964) |
0.0 | 0.2 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.4 | GO:0086069 | bundle of His cell to Purkinje myocyte communication(GO:0086069) |
0.0 | 0.0 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.0 | 0.0 | GO:0032097 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
0.0 | 0.2 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.0 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.0 | 0.2 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.5 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.0 | 0.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.5 | GO:0003416 | endochondral bone growth(GO:0003416) |
0.0 | 0.0 | GO:2000320 | negative regulation of T-helper 17 type immune response(GO:2000317) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
0.0 | 0.0 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
0.0 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.2 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
0.0 | 0.3 | GO:0031000 | response to caffeine(GO:0031000) |
0.0 | 0.1 | GO:0014738 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.0 | 0.1 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.0 | 0.4 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) |
0.0 | 0.0 | GO:0061047 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.0 | 0.3 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.1 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.0 | 0.6 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.2 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.0 | 0.2 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
0.0 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.0 | 0.1 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.0 | 0.1 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.0 | 0.0 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.0 | 0.1 | GO:0072161 | mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
0.0 | 0.9 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
0.0 | 0.2 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.7 | GO:0048843 | negative regulation of axon extension involved in axon guidance(GO:0048843) |
0.0 | 0.9 | GO:0035329 | hippo signaling(GO:0035329) |
0.0 | 0.1 | GO:1901629 | regulation of presynaptic membrane organization(GO:1901629) regulation of synaptic vesicle clustering(GO:2000807) |
0.0 | 0.0 | GO:0072071 | mesangial cell differentiation(GO:0072007) glomerular mesangial cell differentiation(GO:0072008) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) |
0.0 | 0.1 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.0 | 0.3 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.1 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.0 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
0.0 | 0.2 | GO:0071295 | cellular response to vitamin(GO:0071295) |
0.0 | 0.2 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.0 | 0.1 | GO:0014819 | regulation of skeletal muscle contraction(GO:0014819) |
0.0 | 0.1 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.0 | 0.4 | GO:0005979 | regulation of glycogen biosynthetic process(GO:0005979) regulation of glucan biosynthetic process(GO:0010962) |
0.0 | 0.5 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.0 | 0.0 | GO:0043307 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
0.0 | 0.1 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.0 | 0.4 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.0 | 0.6 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.0 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.0 | 0.2 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.0 | 0.1 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.0 | 0.1 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.0 | 0.2 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.0 | 0.3 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
0.0 | 0.2 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.0 | 0.0 | GO:0060596 | mammary placode formation(GO:0060596) |
0.0 | 0.3 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.0 | 0.1 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.0 | 0.0 | GO:0006868 | glutamine transport(GO:0006868) |
0.0 | 0.1 | GO:0042640 | anagen(GO:0042640) |
0.0 | 0.0 | GO:0030578 | PML body organization(GO:0030578) |
0.0 | 0.3 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.0 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
0.0 | 0.1 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.0 | 0.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.0 | 0.1 | GO:0033278 | cell proliferation in midbrain(GO:0033278) |
0.0 | 0.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.0 | 0.1 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.0 | 0.2 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
0.0 | 0.1 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.0 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.0 | 0.2 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.0 | 0.0 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.0 | 0.0 | GO:0090427 | activation of meiosis(GO:0090427) |
0.0 | 0.2 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.1 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.0 | 0.1 | GO:0021854 | hypothalamus development(GO:0021854) |
0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.0 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.0 | 0.1 | GO:1900620 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.0 | 0.0 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.0 | 0.1 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
0.0 | 0.4 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.0 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.0 | 0.1 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.0 | 0.2 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.0 | 0.2 | GO:0043416 | regulation of skeletal muscle tissue regeneration(GO:0043416) |
0.0 | 0.3 | GO:0002053 | positive regulation of mesenchymal cell proliferation(GO:0002053) |
0.0 | 0.1 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.0 | 0.1 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
0.0 | 2.4 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 0.2 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 0.1 | GO:0015755 | fructose transport(GO:0015755) |
0.0 | 0.1 | GO:0007412 | axon target recognition(GO:0007412) |
0.0 | 0.0 | GO:1902548 | negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
0.0 | 0.1 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.0 | 0.3 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.0 | 0.4 | GO:0014829 | vascular smooth muscle contraction(GO:0014829) |
0.0 | 0.0 | GO:0003211 | cardiac ventricle formation(GO:0003211) |
0.0 | 0.2 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.0 | 0.3 | GO:0097531 | mast cell migration(GO:0097531) |
0.0 | 0.1 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.0 | 0.1 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.0 | 0.0 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.2 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.2 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.0 | 0.1 | GO:1900084 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.0 | 0.1 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.0 | 0.1 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
0.0 | 0.1 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.1 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.0 | 0.1 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.0 | 0.2 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.0 | 0.4 | GO:0045187 | regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
0.0 | 0.2 | GO:0044793 | negative regulation by host of viral process(GO:0044793) |
0.0 | 0.0 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.1 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
0.0 | 0.1 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.0 | 0.2 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.4 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
0.0 | 0.0 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.0 | 0.1 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.0 | 0.2 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.2 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.4 | GO:0030449 | regulation of complement activation(GO:0030449) |
0.0 | 0.3 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.0 | 0.0 | GO:1903753 | negative regulation of p38MAPK cascade(GO:1903753) |
0.0 | 0.5 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
0.0 | 0.1 | GO:0060841 | venous blood vessel development(GO:0060841) |
0.0 | 0.1 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.0 | 0.5 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
0.0 | 0.2 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
0.0 | 0.1 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.1 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.0 | 0.1 | GO:0070842 | aggresome assembly(GO:0070842) |
0.0 | 0.1 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.0 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.1 | GO:0042637 | catagen(GO:0042637) |
0.0 | 0.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.0 | 0.1 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.0 | 0.1 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.1 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
0.0 | 0.1 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
0.0 | 0.2 | GO:0001711 | endodermal cell fate commitment(GO:0001711) |
0.0 | 0.0 | GO:0021955 | central nervous system neuron axonogenesis(GO:0021955) |
0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.0 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.0 | 0.3 | GO:1990403 | embryonic brain development(GO:1990403) |
0.0 | 0.0 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.0 | 0.1 | GO:0046909 | intermembrane transport(GO:0046909) |
0.0 | 0.0 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.0 | 0.0 | GO:0072177 | mesonephric duct development(GO:0072177) |
0.0 | 0.0 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.0 | 0.1 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.0 | 0.1 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.0 | 0.1 | GO:0048570 | notochord morphogenesis(GO:0048570) |
0.0 | 0.1 | GO:1902267 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.0 | 0.1 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.0 | 0.1 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.0 | 0.1 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
0.0 | 0.3 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
0.0 | 0.1 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.0 | 0.1 | GO:0000237 | leptotene(GO:0000237) |
0.0 | 0.1 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.0 | 0.1 | GO:0021800 | cerebral cortex tangential migration(GO:0021800) |
0.0 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.0 | 0.1 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
0.0 | 0.3 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.0 | 0.1 | GO:0048485 | sympathetic nervous system development(GO:0048485) |
0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.1 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.0 | 0.1 | GO:0035878 | nail development(GO:0035878) |
0.0 | 0.0 | GO:0007619 | courtship behavior(GO:0007619) |
0.0 | 2.7 | GO:0071804 | cellular potassium ion transport(GO:0071804) potassium ion transmembrane transport(GO:0071805) |
0.0 | 0.0 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.0 | 0.1 | GO:0042505 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.0 | 0.1 | GO:0032621 | interleukin-18 production(GO:0032621) |
0.0 | 0.4 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.2 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.0 | 0.1 | GO:0001946 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.0 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.0 | 0.3 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.0 | 0.4 | GO:0001658 | branching involved in ureteric bud morphogenesis(GO:0001658) |
0.0 | 0.1 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.0 | 0.1 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.1 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.0 | 0.0 | GO:0045989 | positive regulation of striated muscle contraction(GO:0045989) |
0.0 | 0.1 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.0 | 0.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.0 | 0.1 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.0 | 0.1 | GO:0060539 | diaphragm development(GO:0060539) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.1 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.0 | 0.0 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.0 | 0.0 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
0.0 | 0.2 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.0 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.0 | 0.0 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.0 | 0.2 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.0 | 0.1 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 0.3 | GO:0001706 | endoderm formation(GO:0001706) |
0.0 | 0.1 | GO:0032328 | alanine transport(GO:0032328) |
0.0 | 0.2 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.0 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.0 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
0.0 | 0.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.2 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
0.0 | 0.1 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.0 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.0 | 0.2 | GO:0046130 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.0 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.1 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.0 | 0.0 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.0 | 0.0 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.0 | 0.1 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.0 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.0 | 0.1 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.0 | 0.0 | GO:0014045 | establishment of endothelial blood-brain barrier(GO:0014045) |
0.0 | 0.1 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.0 | 0.0 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
0.0 | 0.1 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
0.0 | 0.1 | GO:0021895 | cerebral cortex neuron differentiation(GO:0021895) |
0.0 | 0.2 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.0 | 0.0 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.0 | 0.1 | GO:0060749 | mammary gland alveolus development(GO:0060749) mammary gland lobule development(GO:0061377) |
0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.0 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
0.0 | 0.0 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.0 | 0.0 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.0 | 0.0 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
0.0 | 0.3 | GO:0046677 | response to antibiotic(GO:0046677) |
0.0 | 0.0 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.0 | 0.1 | GO:0097154 | GABAergic neuron differentiation(GO:0097154) |
0.0 | 0.0 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.0 | 0.1 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.0 | 0.2 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.0 | 0.0 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.1 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.0 | 0.1 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.0 | 0.1 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.0 | 0.2 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.0 | 0.1 | GO:1903748 | negative regulation of protein targeting to mitochondrion(GO:1903215) negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
0.0 | 0.0 | GO:1902996 | regulation of tau-protein kinase activity(GO:1902947) neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.0 | 0.0 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.0 | 0.2 | GO:0051642 | centrosome localization(GO:0051642) |
0.0 | 0.1 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
0.0 | 0.0 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.0 | 0.0 | GO:0071608 | macrophage inflammatory protein-1 alpha production(GO:0071608) |
0.0 | 0.0 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.0 | 0.0 | GO:0009093 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.0 | 0.1 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.0 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.1 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.0 | 0.0 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.0 | 0.0 | GO:0048846 | axon extension involved in axon guidance(GO:0048846) neuron projection extension involved in neuron projection guidance(GO:1902284) |
0.0 | 0.4 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.0 | 0.1 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.3 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
0.0 | 0.1 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.0 | 0.2 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
0.0 | 0.2 | GO:0014002 | astrocyte development(GO:0014002) |
0.0 | 0.4 | GO:0042832 | defense response to protozoan(GO:0042832) |
0.0 | 0.2 | GO:0060292 | long term synaptic depression(GO:0060292) |
0.0 | 0.1 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.1 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.0 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.0 | 0.1 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.0 | 0.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.0 | 0.8 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.2 | GO:0003323 | type B pancreatic cell development(GO:0003323) |
0.0 | 0.1 | GO:0002076 | osteoblast development(GO:0002076) |
0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.1 | GO:0090383 | phagosome acidification(GO:0090383) |
0.0 | 0.1 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.0 | 0.0 | GO:0070459 | prolactin secretion(GO:0070459) |
0.0 | 0.0 | GO:0032353 | negative regulation of hormone biosynthetic process(GO:0032353) |
0.0 | 0.0 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.0 | 0.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.0 | 0.0 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.0 | 0.8 | GO:0007416 | synapse assembly(GO:0007416) |
0.0 | 0.1 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
0.0 | 0.0 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.0 | 0.4 | GO:0048536 | spleen development(GO:0048536) |
0.0 | 0.0 | GO:0072578 | neurotransmitter-gated ion channel clustering(GO:0072578) |
0.0 | 0.3 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
0.0 | 0.1 | GO:0002865 | negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) |
0.0 | 0.0 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.0 | 0.1 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.0 | 0.0 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.0 | 0.0 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.0 | 0.0 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) |
0.0 | 0.0 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.0 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.0 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
0.0 | 0.2 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.0 | 0.0 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.0 | 0.1 | GO:0045601 | regulation of endothelial cell differentiation(GO:0045601) |
0.0 | 0.2 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.0 | 0.0 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.1 | GO:0046697 | decidualization(GO:0046697) |
0.0 | 0.0 | GO:0019228 | neuronal action potential(GO:0019228) |
0.0 | 0.0 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.0 | 0.0 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.0 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.1 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.0 | 0.0 | GO:0060005 | vestibular reflex(GO:0060005) |
0.0 | 0.1 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.0 | 0.1 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.0 | 0.1 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
0.0 | 0.1 | GO:0045909 | positive regulation of vasodilation(GO:0045909) |
0.0 | 0.0 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.0 | 0.1 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.0 | 0.0 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 0.0 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.0 | GO:0061623 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.0 | 0.1 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.0 | 0.0 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.0 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
0.0 | 0.0 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.0 | 0.1 | GO:0030575 | nuclear body organization(GO:0030575) |
0.0 | 0.0 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.0 | 0.0 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.3 | GO:0060047 | heart contraction(GO:0060047) |
0.0 | 0.0 | GO:0015817 | histidine transport(GO:0015817) |
0.0 | 0.0 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.0 | 0.0 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.0 | 0.0 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
0.0 | 0.0 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.0 | 0.0 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.0 | 0.0 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.0 | 0.0 | GO:0072173 | metanephric tubule development(GO:0072170) metanephric tubule morphogenesis(GO:0072173) |
0.0 | 0.1 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.0 | 0.0 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.0 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.0 | 0.0 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 0.0 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.0 | 0.0 | GO:0010963 | regulation of amino acid import(GO:0010958) regulation of L-arginine import(GO:0010963) |
0.0 | 0.0 | GO:2000553 | positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
0.0 | 0.1 | GO:0061085 | regulation of histone H3-K27 methylation(GO:0061085) |
0.0 | 0.1 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.0 | GO:0034091 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
0.0 | 0.0 | GO:0072319 | vesicle uncoating(GO:0072319) |
0.0 | 0.0 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.0 | 0.1 | GO:0032924 | activin receptor signaling pathway(GO:0032924) |
0.0 | 0.2 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.0 | 0.0 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.0 | 0.0 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.0 | 0.0 | GO:0071504 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.0 | 0.0 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.0 | GO:0060179 | male mating behavior(GO:0060179) |
0.0 | 0.0 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
0.0 | 0.0 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.0 | GO:0007207 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.0 | 0.0 | GO:0042891 | antibiotic transport(GO:0042891) |
0.0 | 0.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.0 | 0.0 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.0 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.0 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.0 | 0.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.0 | GO:0060033 | anatomical structure regression(GO:0060033) |
0.0 | 0.1 | GO:0071320 | cellular response to cAMP(GO:0071320) |
0.0 | 0.4 | GO:0007566 | embryo implantation(GO:0007566) |
0.0 | 0.0 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.0 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.0 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 0.2 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.0 | 0.1 | GO:0051930 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
0.0 | 0.1 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.0 | 0.1 | GO:0051281 | positive regulation of release of sequestered calcium ion into cytosol(GO:0051281) |
0.0 | 0.0 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.0 | 0.0 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.0 | 0.0 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.0 | 0.8 | GO:0006936 | muscle contraction(GO:0006936) |
0.0 | 0.0 | GO:0070873 | regulation of glycogen metabolic process(GO:0070873) |
0.0 | 0.2 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.2 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.5 | 1.4 | GO:0097443 | sorting endosome(GO:0097443) |
0.3 | 1.4 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.2 | 2.0 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.2 | 0.7 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.2 | 0.6 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.2 | 0.6 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.2 | 0.5 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.2 | 1.0 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.2 | 0.2 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.2 | 0.6 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.2 | 0.5 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 0.5 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.1 | 0.8 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.1 | 0.9 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 0.4 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 1.0 | GO:0005861 | troponin complex(GO:0005861) |
0.1 | 0.4 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 1.3 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.1 | 3.2 | GO:0016235 | aggresome(GO:0016235) |
0.1 | 1.0 | GO:0043194 | axon initial segment(GO:0043194) |
0.1 | 1.0 | GO:0031430 | M band(GO:0031430) |
0.1 | 0.9 | GO:0001527 | microfibril(GO:0001527) |
0.1 | 2.5 | GO:0031941 | filamentous actin(GO:0031941) |
0.1 | 0.3 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.1 | 0.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.1 | 1.2 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 1.4 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.1 | 0.5 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.9 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.2 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.1 | 0.8 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 0.3 | GO:0032584 | growth cone membrane(GO:0032584) |
0.1 | 1.1 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.3 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.1 | 0.5 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
0.1 | 1.2 | GO:0098644 | complex of collagen trimers(GO:0098644) |
0.1 | 0.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 3.8 | GO:0030018 | Z disc(GO:0030018) |
0.1 | 0.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 0.2 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 0.2 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 1.5 | GO:0044295 | axonal growth cone(GO:0044295) |
0.1 | 0.2 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.1 | 0.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.6 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.1 | 3.1 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.0 | 0.4 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 1.0 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.0 | 0.2 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.5 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.0 | 0.8 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.7 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 0.3 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.2 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.5 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.5 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.0 | 0.1 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.0 | 0.3 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.3 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.0 | 0.3 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.3 | GO:0045240 | dihydrolipoyl dehydrogenase complex(GO:0045240) |
0.0 | 0.4 | GO:0031527 | filopodium membrane(GO:0031527) |
0.0 | 0.0 | GO:1990696 | USH2 complex(GO:1990696) |
0.0 | 1.2 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.0 | 0.2 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 0.2 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
0.0 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.6 | GO:0008305 | integrin complex(GO:0008305) |
0.0 | 5.7 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.0 | 0.2 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.2 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.3 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.0 | 0.1 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 2.1 | GO:0005604 | basement membrane(GO:0005604) |
0.0 | 0.3 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.0 | 0.7 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.5 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.0 | 2.3 | GO:0005923 | bicellular tight junction(GO:0005923) |
0.0 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.1 | GO:0043296 | apical junction complex(GO:0043296) |
0.0 | 0.7 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.2 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 0.0 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 0.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.1 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.1 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.0 | 1.1 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 0.3 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.1 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.1 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.1 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.0 | 0.2 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.0 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.1 | GO:0000235 | astral microtubule(GO:0000235) |
0.0 | 0.5 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 0.1 | GO:0060091 | kinocilium(GO:0060091) |
0.0 | 0.5 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.0 | 0.0 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.0 | 0.1 | GO:0071439 | clathrin complex(GO:0071439) |
0.0 | 0.0 | GO:0030891 | VCB complex(GO:0030891) |
0.0 | 0.0 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 5.1 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.2 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.0 | 0.1 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.1 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.7 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.0 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.4 | GO:0030175 | filopodium(GO:0030175) |
0.0 | 0.0 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.0 | 0.0 | GO:0035838 | growing cell tip(GO:0035838) |
0.0 | 0.2 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.1 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.0 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.8 | GO:0030427 | site of polarized growth(GO:0030427) |
0.0 | 0.0 | GO:0097433 | dense body(GO:0097433) |
0.0 | 0.1 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.0 | 0.0 | GO:1903349 | omegasome membrane(GO:1903349) |
0.0 | 0.5 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 2.1 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 0.8 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.0 | GO:0034705 | potassium channel complex(GO:0034705) |
0.0 | 0.1 | GO:0036379 | striated muscle thin filament(GO:0005865) myofilament(GO:0036379) |
0.0 | 0.1 | GO:0098878 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.0 | 0.0 | GO:1990716 | axonemal central apparatus(GO:1990716) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 2.4 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.6 | 2.3 | GO:0031433 | telethonin binding(GO:0031433) |
0.3 | 2.2 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.3 | 1.9 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.3 | 0.9 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.3 | 0.9 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.3 | 0.8 | GO:0030172 | troponin C binding(GO:0030172) |
0.3 | 0.8 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.2 | 0.7 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.2 | 0.7 | GO:0070538 | oleic acid binding(GO:0070538) |
0.2 | 0.6 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.2 | 0.6 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.2 | 1.3 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.2 | 0.5 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.2 | 0.7 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.2 | 0.5 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.2 | 0.3 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.2 | 1.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.1 | 0.4 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 0.7 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.1 | 0.4 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.1 | 0.4 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.4 | GO:0035939 | microsatellite binding(GO:0035939) |
0.1 | 0.4 | GO:0048030 | disaccharide binding(GO:0048030) |
0.1 | 0.9 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.1 | 1.1 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.1 | 0.9 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.1 | 0.5 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 0.6 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 0.4 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 0.4 | GO:0051373 | FATZ binding(GO:0051373) |
0.1 | 0.5 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.1 | 1.1 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.1 | 0.3 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.1 | 1.2 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.1 | 0.2 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.1 | 1.3 | GO:0001846 | opsonin binding(GO:0001846) |
0.1 | 0.9 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.4 | GO:0070052 | collagen V binding(GO:0070052) |
0.1 | 0.4 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.1 | 0.5 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.1 | 0.4 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.3 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 0.5 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.1 | 0.5 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.1 | 0.3 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.1 | 0.9 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.1 | 0.3 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.1 | 0.4 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.1 | 0.2 | GO:0031013 | troponin I binding(GO:0031013) |
0.1 | 0.3 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.1 | 2.2 | GO:0052714 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.1 | 0.9 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 1.1 | GO:0030955 | potassium ion binding(GO:0030955) |
0.1 | 0.9 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.1 | 0.5 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.1 | 0.2 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.1 | 0.9 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 0.4 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.1 | 0.2 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 0.4 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.1 | 0.2 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.1 | 0.4 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.7 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.1 | 0.3 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 0.3 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.1 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.1 | 0.3 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
0.1 | 0.4 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.1 | 0.4 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.1 | 0.3 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.1 | 0.3 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 0.5 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.1 | 0.8 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.1 | 0.3 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.1 | 0.2 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.4 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 0.5 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.1 | 0.2 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.1 | 0.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.3 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.1 | 0.2 | GO:0046428 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.1 | 0.2 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.1 | 0.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.1 | 0.7 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.1 | 0.2 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.1 | 0.2 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.1 | 0.3 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.1 | 0.2 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 0.4 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.1 | 0.3 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.1 | 0.2 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.2 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.1 | 0.3 | GO:0033265 | choline binding(GO:0033265) |
0.1 | 0.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 0.3 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 0.3 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 1.0 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.1 | 1.3 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.1 | 0.2 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.1 | 0.9 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.1 | 2.0 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.1 | 0.5 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.1 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 0.9 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.0 | 0.2 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.2 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.0 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.5 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.7 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.0 | 1.3 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 5.1 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.0 | 0.4 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.3 | GO:0004952 | dopamine neurotransmitter receptor activity(GO:0004952) |
0.0 | 1.2 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.2 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.3 | GO:0031402 | sodium ion binding(GO:0031402) |
0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.0 | 0.5 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.0 | 0.0 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.0 | 0.6 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.0 | 0.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.0 | 0.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 0.5 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.0 | 0.0 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) |
0.0 | 0.2 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.2 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.0 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.1 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.0 | 0.2 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.0 | GO:0030487 | inositol-4,5-bisphosphate 5-phosphatase activity(GO:0030487) |
0.0 | 0.3 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.1 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.0 | 0.8 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.8 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.2 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.2 | GO:0038132 | neuregulin binding(GO:0038132) |
0.0 | 0.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.0 | 0.4 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 0.3 | GO:0018655 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.0 | 0.1 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.0 | 0.2 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.0 | 0.1 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.1 | GO:0032356 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.0 | 0.5 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.0 | 1.1 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.1 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
0.0 | 0.5 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 0.5 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.3 | GO:0015197 | peptide transporter activity(GO:0015197) |
0.0 | 0.1 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.2 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.9 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.1 | GO:0080130 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.1 | GO:0036033 | mediator complex binding(GO:0036033) |
0.0 | 0.1 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.0 | 0.2 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.0 | 0.2 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 0.7 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.3 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.1 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.0 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.0 | 0.2 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.0 | 0.6 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.0 | 1.1 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 0.4 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.1 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.0 | 2.2 | GO:0044325 | ion channel binding(GO:0044325) |
0.0 | 0.4 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.5 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.0 | 0.0 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.1 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.4 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.0 | 0.2 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.3 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.0 | 0.0 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.2 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.0 | 0.4 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.0 | 0.0 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.1 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.0 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.0 | 0.2 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.4 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.2 | GO:0044213 | intronic transcription regulatory region DNA binding(GO:0044213) |
0.0 | 0.4 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.1 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.5 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.0 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.1 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.1 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.1 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 1.1 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.0 | 0.3 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.1 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.0 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.1 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.0 | 0.2 | GO:0022821 | potassium ion antiporter activity(GO:0022821) |
0.0 | 0.0 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.1 | GO:0046030 | inositol trisphosphate phosphatase activity(GO:0046030) |
0.0 | 0.8 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.0 | 0.2 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.0 | 0.0 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.0 | 0.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.2 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.0 | 0.1 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.1 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.1 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.0 | 0.3 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.1 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.1 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.1 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.0 | 0.0 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.0 | 0.3 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 0.0 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.0 | 0.0 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.0 | GO:0018566 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 0.2 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.0 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.7 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.0 | 0.0 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.0 | 0.2 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.0 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.0 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.5 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.0 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.0 | 0.3 | GO:0016675 | oxidoreductase activity, acting on a heme group of donors(GO:0016675) |
0.0 | 0.2 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.1 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.0 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.0 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.0 | 0.0 | GO:0034857 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.0 | 0.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.1 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 0.3 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.2 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.0 | 0.0 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
0.0 | 0.1 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.0 | 0.0 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.0 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.0 | 0.1 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.0 | 0.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.1 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.0 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.0 | 0.0 | GO:1990188 | euchromatin binding(GO:1990188) |
0.0 | 0.0 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.2 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.4 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.0 | 0.2 | GO:0005272 | sodium channel activity(GO:0005272) |
0.0 | 0.0 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.0 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
0.0 | 0.1 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.0 | 0.1 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.8 | GO:0005262 | calcium channel activity(GO:0005262) |
0.0 | 0.1 | GO:0045125 | bioactive lipid receptor activity(GO:0045125) |
0.0 | 0.2 | GO:0055106 | ligase regulator activity(GO:0055103) ubiquitin-protein transferase regulator activity(GO:0055106) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.1 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.1 | GO:0008061 | chitin binding(GO:0008061) |
0.0 | 0.0 | GO:0005148 | prolactin receptor binding(GO:0005148) |
0.0 | 0.2 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.8 | GO:0017124 | SH3 domain binding(GO:0017124) |
0.0 | 0.2 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
0.0 | 0.0 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 2.1 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.2 | 0.2 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.1 | 1.0 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 0.8 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 1.9 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.1 | 0.6 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 1.5 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.1 | 0.4 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 1.2 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 1.4 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 1.3 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.2 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.0 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 1.1 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.0 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 0.9 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 1.3 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.5 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.6 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.5 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 1.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.9 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 1.4 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.0 | 0.5 | PID INSULIN PATHWAY | Insulin Pathway |
0.0 | 0.3 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.0 | 1.4 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.9 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.0 | PID IGF1 PATHWAY | IGF1 pathway |
0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.4 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.8 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 1.1 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.7 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 1.3 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.0 | 0.2 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.5 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
0.0 | 0.3 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.0 | 0.3 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.4 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 0.6 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.6 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.3 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.3 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.0 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.3 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.0 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.2 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.2 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.8 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.2 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.4 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.3 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.6 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 0.2 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 2.1 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.3 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.6 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.2 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.0 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.0 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.1 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 2.7 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.1 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 1.5 | NABA CORE MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
0.0 | 0.1 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.0 | 0.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.2 | 1.9 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 1.8 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 0.7 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.1 | 0.4 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.1 | 2.9 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 1.6 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 1.9 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 3.5 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 2.1 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 0.1 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.1 | 0.2 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
0.1 | 0.8 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 0.3 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.1 | 0.9 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 0.3 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
0.1 | 1.9 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 0.1 | REACTOME CELL CELL COMMUNICATION | Genes involved in Cell-Cell communication |
0.1 | 0.6 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 0.8 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 0.8 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.1 | 2.7 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 0.9 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.1 | 1.0 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
0.1 | 0.9 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 0.7 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 0.4 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.1 | 1.3 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 0.5 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.1 | 1.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 0.6 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.1 | 0.2 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 2.0 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.1 | 0.5 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.1 | 0.2 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.0 | 0.9 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.5 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.4 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.4 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.0 | 0.7 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.6 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.4 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.0 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.5 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.7 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.0 | 0.3 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.4 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.4 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.4 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 1.1 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.2 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.2 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.4 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.2 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.3 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.0 | 0.4 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 2.3 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.5 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 0.6 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.0 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
0.0 | 0.6 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.2 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.0 | 0.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 1.6 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.2 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.0 | 0.3 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.0 | 1.2 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.0 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 0.0 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.1 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.0 | 0.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.0 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.3 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.0 | 0.0 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.5 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.0 | 0.6 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
0.0 | 0.1 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.0 | 0.1 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.1 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.3 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |