| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Jun
|
ENSMUSG00000052684.3 | jun proto-oncogene |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr17_24643558_24645911 | 3.50 |
Slc9a3r2 |
solute carrier family 9 (sodium/hydrogen exchanger), member 3 regulator 2 |
223 |
0.82 |
| chr7_19082814_19086200 | 3.16 |
Dmpk |
dystrophia myotonica-protein kinase |
203 |
0.83 |
| chr19_56388806_56389568 | 2.42 |
Nrap |
nebulin-related anchoring protein |
690 |
0.66 |
| chr15_27405650_27406408 | 2.18 |
Gm19111 |
predicted gene, 19111 |
38090 |
0.15 |
| chr13_20433275_20433426 | 2.13 |
Elmo1 |
engulfment and cell motility 1 |
39376 |
0.14 |
| chr7_46097834_46098538 | 2.11 |
Kcnj11 |
potassium inwardly rectifying channel, subfamily J, member 11 |
240 |
0.86 |
| chr6_18171594_18171833 | 1.98 |
Cftr |
cystic fibrosis transmembrane conductance regulator |
889 |
0.55 |
| chr6_70871941_70872492 | 1.94 |
Eif2ak3 |
eukaryotic translation initiation factor 2 alpha kinase 3 |
6345 |
0.15 |
| chr5_122101429_122101581 | 1.87 |
Myl2 |
myosin, light polypeptide 2, regulatory, cardiac, slow |
75 |
0.96 |
| chr7_141338447_141340687 | 1.83 |
Eps8l2 |
EPS8-like 2 |
561 |
0.53 |
| chr6_50254699_50255186 | 1.77 |
Gsdme |
gasdermin E |
6805 |
0.24 |
| chr3_93505783_93506784 | 1.71 |
Gm36953 |
predicted gene, 36953 |
5983 |
0.11 |
| chr14_63271374_63271678 | 1.67 |
Gata4 |
GATA binding protein 4 |
166 |
0.95 |
| chr14_26440024_26440228 | 1.59 |
Slmap |
sarcolemma associated protein |
905 |
0.54 |
| chr11_43834010_43835381 | 1.58 |
Adra1b |
adrenergic receptor, alpha 1b |
1637 |
0.47 |
| chr17_81728265_81728416 | 1.56 |
Slc8a1 |
solute carrier family 8 (sodium/calcium exchanger), member 1 |
10037 |
0.28 |
| chr14_66257482_66258074 | 1.56 |
Ptk2b |
PTK2 protein tyrosine kinase 2 beta |
23204 |
0.16 |
| chr7_127800319_127801635 | 1.55 |
Hsd3b7 |
hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 7 |
36 |
0.92 |
| chr9_67045040_67045992 | 1.55 |
Tpm1 |
tropomyosin 1, alpha |
1554 |
0.38 |
| chr14_103840123_103841623 | 1.54 |
Ednrb |
endothelin receptor type B |
2822 |
0.37 |
| chr17_81735237_81735473 | 1.50 |
Slc8a1 |
solute carrier family 8 (sodium/calcium exchanger), member 1 |
3022 |
0.36 |
| chr5_77092587_77093501 | 1.48 |
Hopxos |
HOP homeobox, opposite strand |
1488 |
0.28 |
| chr19_36731761_36732283 | 1.47 |
Ppp1r3c |
protein phosphatase 1, regulatory subunit 3C |
4631 |
0.24 |
| chr13_103109833_103110089 | 1.46 |
Mast4 |
microtubule associated serine/threonine kinase family member 4 |
13116 |
0.26 |
| chr14_72869218_72869915 | 1.46 |
Gm4606 |
predicted gene 4606 |
6011 |
0.23 |
| chr8_56684414_56684756 | 1.44 |
Gm6503 |
predicted gene 6503 |
28464 |
0.2 |
| chr9_24768577_24769049 | 1.43 |
Tbx20 |
T-box 20 |
867 |
0.6 |
| chr13_72198379_72198834 | 1.43 |
Gm4052 |
predicted gene 4052 |
151615 |
0.04 |
| chr19_6384347_6385874 | 1.43 |
Pygm |
muscle glycogen phosphorylase |
695 |
0.45 |
| chr10_11229681_11229832 | 1.39 |
Gm16577 |
predicted gene 16577 |
16777 |
0.16 |
| chr14_46965863_46966367 | 1.38 |
Gm15562 |
predicted gene 15562 |
4675 |
0.16 |
| chr18_43436329_43436751 | 1.38 |
Dpysl3 |
dihydropyrimidinase-like 3 |
1746 |
0.35 |
| chr10_117023795_117024543 | 1.37 |
Gm10747 |
predicted gene 10747 |
19577 |
0.11 |
| chr10_110927145_110928031 | 1.36 |
Csrp2 |
cysteine and glycine-rich protein 2 |
3613 |
0.19 |
| chr6_112459682_112460792 | 1.35 |
Cav3 |
caveolin 3 |
732 |
0.65 |
| chr2_120242902_120243716 | 1.34 |
Pla2g4e |
phospholipase A2, group IVE |
1773 |
0.27 |
| chr19_40268243_40269148 | 1.33 |
Pdlim1 |
PDZ and LIM domain 1 (elfin) |
2921 |
0.2 |
| chr8_41099315_41099819 | 1.33 |
Mtus1 |
mitochondrial tumor suppressor 1 |
15100 |
0.18 |
| chr13_50958059_50958704 | 1.32 |
Gm19009 |
predicted gene, 19009 |
98225 |
0.07 |
| chr13_38153771_38154277 | 1.30 |
Gm10129 |
predicted gene 10129 |
2232 |
0.25 |
| chr1_43191201_43191415 | 1.29 |
Gm8210 |
predicted pseudogene 8210 |
2152 |
0.29 |
| chr11_98384535_98385075 | 1.29 |
Tcap |
titin-cap |
994 |
0.28 |
| chr17_72921491_72924008 | 1.28 |
Lbh |
limb-bud and heart |
1561 |
0.47 |
| chr3_43209729_43209880 | 1.27 |
Gm9723 |
predicted gene 9723 |
40583 |
0.22 |
| chr9_32645520_32646641 | 1.26 |
Ets1 |
E26 avian leukemia oncogene 1, 5' domain |
9832 |
0.16 |
| chr11_65263482_65263681 | 1.26 |
Myocd |
myocardin |
6273 |
0.22 |
| chr2_167690537_167691384 | 1.26 |
A530013C23Rik |
RIKEN cDNA A530013C23 gene |
217 |
0.84 |
| chr10_56582191_56582351 | 1.25 |
Gm9795 |
predicted pseudogene 9795 |
73923 |
0.1 |
| chr3_146766982_146767550 | 1.24 |
Prkacb |
protein kinase, cAMP dependent, catalytic, beta |
2696 |
0.25 |
| chr3_90614243_90615549 | 1.23 |
S100a6 |
S100 calcium binding protein A6 (calcyclin) |
1136 |
0.26 |
| chr1_187910901_187911320 | 1.23 |
Esrrg |
estrogen-related receptor gamma |
86717 |
0.09 |
| chr3_101286751_101286932 | 1.23 |
Cd2 |
CD2 antigen |
1038 |
0.44 |
| chr15_94045386_94045586 | 1.21 |
Gm30564 |
predicted gene, 30564 |
80778 |
0.1 |
| chr14_101510884_101511350 | 1.21 |
Tbc1d4 |
TBC1 domain family, member 4 |
3791 |
0.3 |
| chr5_24995023_24996226 | 1.21 |
Prkag2 |
protein kinase, AMP-activated, gamma 2 non-catalytic subunit |
129 |
0.96 |
| chr3_84563506_84563657 | 1.20 |
Gm38241 |
predicted gene, 38241 |
5794 |
0.17 |
| chr6_59022486_59023190 | 1.19 |
Fam13a |
family with sequence similarity 13, member A |
1502 |
0.36 |
| chr13_115098028_115098225 | 1.18 |
Gm49395 |
predicted gene, 49395 |
3498 |
0.16 |
| chr6_17170071_17171190 | 1.18 |
Gm4876 |
predicted gene 4876 |
835 |
0.65 |
| chr19_29271229_29271592 | 1.18 |
Jak2 |
Janus kinase 2 |
18969 |
0.16 |
| chr13_9191068_9191604 | 1.17 |
Larp4b |
La ribonucleoprotein domain family, member 4B |
22975 |
0.13 |
| chr3_82140994_82141753 | 1.17 |
Gucy1a1 |
guanylate cyclase 1, soluble, alpha 1 |
3700 |
0.27 |
| chr19_59541762_59542770 | 1.17 |
Gm18161 |
predicted gene, 18161 |
1815 |
0.38 |
| chr14_49792616_49792983 | 1.17 |
Gm22989 |
predicted gene, 22989 |
4515 |
0.15 |
| chr3_96093652_96093838 | 1.16 |
Gm43554 |
predicted gene 43554 |
6874 |
0.1 |
| chr16_35157395_35159144 | 1.15 |
Adcy5 |
adenylate cyclase 5 |
3392 |
0.29 |
| chr10_63457257_63458786 | 1.15 |
Ctnna3 |
catenin (cadherin associated protein), alpha 3 |
511 |
0.78 |
| chrX_7638310_7639997 | 1.15 |
Syp |
synaptophysin |
152 |
0.88 |
| chr2_180392416_180392871 | 1.15 |
Mir1a-1 |
microRNA 1a-1 |
3595 |
0.16 |
| chr15_76204231_76205350 | 1.14 |
Plec |
plectin |
1531 |
0.2 |
| chr10_79806462_79808470 | 1.14 |
Palm |
paralemmin |
785 |
0.35 |
| chr5_69541689_69541957 | 1.14 |
Yipf7 |
Yip1 domain family, member 7 |
766 |
0.59 |
| chr5_121833321_121834947 | 1.12 |
1700008B11Rik |
RIKEN cDNA 1700008B11 gene |
1061 |
0.33 |
| chr9_91101784_91102289 | 1.12 |
Gm5620 |
predicted gene 5620 |
4887 |
0.24 |
| chr13_49545394_49545652 | 1.12 |
Aspn |
asporin |
1036 |
0.47 |
| chr17_72275554_72276005 | 1.12 |
Gm19183 |
predicted gene, 19183 |
19521 |
0.28 |
| chrX_161635706_161636037 | 1.12 |
Rai2 |
retinoic acid induced 2 |
81198 |
0.11 |
| chr17_69105006_69106089 | 1.11 |
Epb41l3 |
erythrocyte membrane protein band 4.1 like 3 |
21453 |
0.26 |
| chr2_30995683_30996883 | 1.11 |
Usp20 |
ubiquitin specific peptidase 20 |
235 |
0.9 |
| chr8_32007143_32007294 | 1.11 |
Nrg1 |
neuregulin 1 |
1888 |
0.48 |
| chr13_110277692_110277997 | 1.10 |
Rab3c |
RAB3C, member RAS oncogene family |
2306 |
0.36 |
| chr5_140767889_140768293 | 1.10 |
Amz1 |
archaelysin family metallopeptidase 1 |
18808 |
0.18 |
| chr9_32225548_32226100 | 1.10 |
Arhgap32 |
Rho GTPase activating protein 32 |
1232 |
0.51 |
| chr10_25433050_25433310 | 1.10 |
Epb41l2 |
erythrocyte membrane protein band 4.1 like 2 |
564 |
0.78 |
| chr17_62687292_62687799 | 1.09 |
Efna5 |
ephrin A5 |
193599 |
0.03 |
| chr2_76982792_76983214 | 1.09 |
Ttn |
titin |
456 |
0.86 |
| chr6_115990945_115992684 | 1.09 |
Plxnd1 |
plexin D1 |
3191 |
0.2 |
| chr5_43236032_43236320 | 1.08 |
Gm7854 |
predicted gene 7854 |
821 |
0.45 |
| chr15_76197527_76199931 | 1.07 |
Plec |
plectin |
520 |
0.59 |
| chr15_75596786_75598413 | 1.07 |
Gpihbp1 |
GPI-anchored HDL-binding protein 1 |
931 |
0.43 |
| chr16_58512151_58512649 | 1.07 |
St3gal6 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 6 |
1784 |
0.35 |
| chr3_65635958_65636417 | 1.06 |
Gm38233 |
predicted gene, 38233 |
20013 |
0.12 |
| chr11_116105976_116108472 | 1.06 |
Trim47 |
tripartite motif-containing 47 |
141 |
0.91 |
| chr1_70621930_70622081 | 1.05 |
Gm23422 |
predicted gene, 23422 |
25190 |
0.22 |
| chr12_53146583_53147046 | 1.05 |
n-R5s58 |
nuclear encoded rRNA 5S 58 |
99988 |
0.08 |
| chr7_143016321_143016542 | 1.04 |
Tspan32 |
tetraspanin 32 |
978 |
0.42 |
| chrX_114477896_114478376 | 1.04 |
Klhl4 |
kelch-like 4 |
3532 |
0.28 |
| chr5_66323220_66323858 | 1.04 |
Gm43790 |
predicted gene 43790 |
522 |
0.71 |
| chr13_46571962_46572644 | 1.04 |
Cap2 |
CAP, adenylate cyclase-associated protein, 2 (yeast) |
37211 |
0.13 |
| chr18_36513738_36514679 | 1.04 |
Hbegf |
heparin-binding EGF-like growth factor |
1159 |
0.38 |
| chr9_103760391_103760657 | 1.04 |
Tmem108 |
transmembrane protein 108 |
1266 |
0.55 |
| chr8_25465369_25466413 | 1.03 |
Gm10689 |
predicted gene 10689 |
11618 |
0.11 |
| chr6_148442590_148443383 | 1.03 |
Tmtc1 |
transmembrane and tetratricopeptide repeat containing 1 |
1351 |
0.46 |
| chr3_116801918_116802092 | 1.03 |
Agl |
amylo-1,6-glucosidase, 4-alpha-glucanotransferase |
5412 |
0.14 |
| chr9_112214151_112214302 | 1.03 |
Arpp21 |
cyclic AMP-regulated phosphoprotein, 21 |
3035 |
0.26 |
| chr11_37117318_37117871 | 1.02 |
Tenm2 |
teneurin transmembrane protein 2 |
118288 |
0.07 |
| chr8_106606029_106606380 | 1.02 |
Cdh1 |
cadherin 1 |
2061 |
0.29 |
| chr2_59670162_59670906 | 1.02 |
Tanc1 |
tetratricopeptide repeat, ankyrin repeat and coiled-coil containing 1 |
23723 |
0.24 |
| chr13_49546384_49546863 | 1.02 |
Aspn |
asporin |
2136 |
0.26 |
| chr1_164461051_164462265 | 1.01 |
Gm32391 |
predicted gene, 32391 |
784 |
0.55 |
| chr6_108665481_108665937 | 1.00 |
Bhlhe40 |
basic helix-loop-helix family, member e40 |
2663 |
0.23 |
| chr16_49504032_49504433 | 1.00 |
Gm6931 |
predicted gene 6931 |
79426 |
0.1 |
| chr1_184675496_184676152 | 1.00 |
Gm38358 |
predicted gene, 38358 |
19210 |
0.14 |
| chr19_12475678_12475983 | 1.00 |
Mpeg1 |
macrophage expressed gene 1 |
15051 |
0.1 |
| chrX_19168686_19168837 | 0.99 |
Gm14636 |
predicted gene 14636 |
1520 |
0.4 |
| chr7_142477604_142479034 | 0.99 |
Lsp1 |
lymphocyte specific 1 |
1306 |
0.28 |
| chr11_19979229_19979820 | 0.99 |
Spred2 |
sprouty-related EVH1 domain containing 2 |
24954 |
0.23 |
| chr19_46628174_46628870 | 0.99 |
Wbp1l |
WW domain binding protein 1 like |
5121 |
0.15 |
| chr12_14315863_14316014 | 0.99 |
Gm16497 |
predicted gene 16497 |
54382 |
0.15 |
| chr1_39105360_39106003 | 0.98 |
Gm37091 |
predicted gene, 37091 |
22343 |
0.17 |
| chr10_17931342_17931493 | 0.98 |
Heca |
hdc homolog, cell cycle regulator |
16195 |
0.21 |
| chr18_42444794_42444945 | 0.98 |
Gm16415 |
predicted pseudogene 16415 |
3850 |
0.22 |
| chr1_134909462_134909916 | 0.98 |
Ppp1r12b |
protein phosphatase 1, regulatory subunit 12B |
46162 |
0.11 |
| chr4_141424966_141425636 | 0.98 |
Hspb7 |
heat shock protein family, member 7 (cardiovascular) |
4522 |
0.11 |
| chr19_53674535_53674796 | 0.98 |
Rbm20 |
RNA binding motif protein 20 |
2641 |
0.27 |
| chr5_119167663_119168042 | 0.98 |
Gm7538 |
predicted gene 7538 |
32166 |
0.19 |
| chr4_62620787_62622274 | 0.98 |
Rgs3 |
regulator of G-protein signaling 3 |
1948 |
0.3 |
| chr17_80148180_80148718 | 0.97 |
Galm |
galactose mutarotase |
3297 |
0.21 |
| chr4_47208070_47209133 | 0.97 |
Gm12426 |
predicted gene 12426 |
142 |
0.81 |
| chr6_145933944_145934978 | 0.97 |
Sspn |
sarcospan |
339 |
0.86 |
| chr1_93158817_93158968 | 0.97 |
Mab21l4 |
mab-21-like 4 |
1978 |
0.23 |
| chr17_15284796_15285072 | 0.97 |
Gm35576 |
predicted gene, 35576 |
424 |
0.83 |
| chr18_43391464_43391742 | 0.97 |
Dpysl3 |
dihydropyrimidinase-like 3 |
1774 |
0.41 |
| chr2_121549463_121549743 | 0.97 |
Frmd5 |
FERM domain containing 5 |
1748 |
0.27 |
| chr3_89277040_89278334 | 0.97 |
Efna1 |
ephrin A1 |
1954 |
0.13 |
| chr2_79983419_79983570 | 0.97 |
Pde1a |
phosphodiesterase 1A, calmodulin-dependent |
55535 |
0.16 |
| chr3_126661046_126661197 | 0.96 |
Gm43005 |
predicted gene 43005 |
1258 |
0.33 |
| chr5_35739626_35740210 | 0.96 |
Sh3tc1 |
SH3 domain and tetratricopeptide repeats 1 |
69 |
0.97 |
| chr9_102771363_102771813 | 0.96 |
Gm47416 |
predicted gene, 47416 |
93 |
0.95 |
| chr1_97974901_97975514 | 0.96 |
Pam |
peptidylglycine alpha-amidating monooxygenase |
1861 |
0.35 |
| chr2_19300759_19301059 | 0.96 |
4930447M23Rik |
RIKEN cDNA 4930447M23 gene |
43408 |
0.14 |
| chr14_38631557_38631708 | 0.96 |
Gm20641 |
predicted gene 20641 |
109583 |
0.08 |
| chr19_53794096_53794765 | 0.95 |
Rbm20 |
RNA binding motif protein 20 |
1122 |
0.48 |
| chr3_58434522_58434673 | 0.95 |
Tsc22d2 |
TSC22 domain family, member 2 |
17113 |
0.17 |
| chr1_17601856_17602960 | 0.95 |
Pi15 |
peptidase inhibitor 15 |
507 |
0.82 |
| chr3_155052033_155052416 | 0.95 |
Tnni3k |
TNNI3 interacting kinase |
3126 |
0.26 |
| chr18_69523224_69524043 | 0.94 |
Tcf4 |
transcription factor 4 |
1183 |
0.58 |
| chr3_36481601_36482189 | 0.94 |
1810062G17Rik |
RIKEN cDNA 1810062G17 gene |
5958 |
0.12 |
| chr9_48707476_48707706 | 0.94 |
Nnmt |
nicotinamide N-methyltransferase |
102438 |
0.06 |
| chrX_157700177_157700800 | 0.94 |
Smpx |
small muscle protein, X-linked |
1228 |
0.39 |
| chr19_20601993_20602392 | 0.94 |
Aldh1a1 |
aldehyde dehydrogenase family 1, subfamily A1 |
231 |
0.94 |
| chr8_25091391_25091542 | 0.94 |
Plekha2 |
pleckstrin homology domain-containing, family A (phosphoinositide binding specific) member 2 |
120 |
0.95 |
| chr11_113093995_113094146 | 0.94 |
2610035D17Rik |
RIKEN cDNA 2610035D17 gene |
79007 |
0.11 |
| chr10_12911640_12912555 | 0.94 |
B230208H11Rik |
RIKEN cDNA B230208H11 gene |
10993 |
0.19 |
| chr6_115463019_115463337 | 0.94 |
Gm44079 |
predicted gene, 44079 |
1812 |
0.34 |
| chr4_68948896_68949047 | 0.94 |
Brinp1 |
bone morphogenic protein/retinoic acid inducible neural specific 1 |
5426 |
0.35 |
| chr12_35503909_35504469 | 0.94 |
Ahr |
aryl-hydrocarbon receptor |
22590 |
0.16 |
| chr13_6646301_6646452 | 0.94 |
Pfkp |
phosphofructokinase, platelet |
2349 |
0.29 |
| chr14_114842221_114842586 | 0.93 |
4930524C18Rik |
RIKEN cDNA 4930524C18 gene |
10438 |
0.18 |
| chr18_14654793_14655162 | 0.93 |
Ss18 |
SS18, nBAF chromatin remodeling complex subunit |
3854 |
0.23 |
| chr15_101295037_101295188 | 0.93 |
Smim41 |
small integral membrane protein 41 |
1880 |
0.19 |
| chr8_64842172_64842438 | 0.93 |
Klhl2 |
kelch-like 2, Mayven |
108 |
0.96 |
| chr8_69384506_69384657 | 0.93 |
Gm10033 |
predicted gene 10033 |
10667 |
0.14 |
| chr8_4350870_4351356 | 0.92 |
Ccl25 |
chemokine (C-C motif) ligand 25 |
1525 |
0.26 |
| chrX_36113516_36113673 | 0.92 |
Il13ra1 |
interleukin 13 receptor, alpha 1 |
1484 |
0.45 |
| chr10_64076117_64076268 | 0.92 |
Lrrtm3 |
leucine rich repeat transmembrane neuronal 3 |
14055 |
0.3 |
| chr8_12926230_12928559 | 0.92 |
Mcf2l |
mcf.2 transforming sequence-like |
762 |
0.52 |
| chr6_141041812_141042550 | 0.91 |
Gm43927 |
predicted gene, 43927 |
33896 |
0.2 |
| chr8_121649714_121650258 | 0.91 |
Zcchc14 |
zinc finger, CCHC domain containing 14 |
2915 |
0.16 |
| chr13_9129008_9129174 | 0.91 |
Larp4b |
La ribonucleoprotein domain family, member 4B |
7124 |
0.16 |
| chr9_56864653_56866648 | 0.91 |
Cspg4 |
chondroitin sulfate proteoglycan 4 |
617 |
0.51 |
| chr4_120811318_120811473 | 0.91 |
Nfyc |
nuclear transcription factor-Y gamma |
4317 |
0.14 |
| chr4_82496866_82497618 | 0.91 |
Nfib |
nuclear factor I/B |
2074 |
0.34 |
| chr15_54572723_54573229 | 0.91 |
Mal2 |
mal, T cell differentiation protein 2 |
1784 |
0.45 |
| chr15_40475873_40476312 | 0.90 |
Gm16294 |
predicted gene 16294 |
51185 |
0.15 |
| chr17_23676215_23677428 | 0.90 |
Tnfrsf12a |
tumor necrosis factor receptor superfamily, member 12a |
268 |
0.72 |
| chr6_72926833_72927048 | 0.90 |
Gm26640 |
predicted gene, 26640 |
26296 |
0.12 |
| chr2_78059908_78060370 | 0.90 |
4930440I19Rik |
RIKEN cDNA 4930440I19 gene |
8916 |
0.28 |
| chr2_17730363_17731639 | 0.90 |
Nebl |
nebulette |
42 |
0.98 |
| chr18_49721866_49722244 | 0.90 |
Dtwd2 |
DTW domain containing 2 |
12051 |
0.22 |
| chr19_34253411_34255499 | 0.90 |
Acta2 |
actin, alpha 2, smooth muscle, aorta |
225 |
0.92 |
| chr8_121075870_121076400 | 0.89 |
Fendrr |
Foxf1 adjacent non-coding developmental regulatory RNA |
6897 |
0.13 |
| chr7_139833633_139836105 | 0.89 |
Adgra1 |
adhesion G protein-coupled receptor A1 |
93 |
0.96 |
| chr19_53014314_53014862 | 0.89 |
Xpnpep1 |
X-prolyl aminopeptidase (aminopeptidase P) 1, soluble |
752 |
0.62 |
| chr4_33261184_33261782 | 0.89 |
Pnrc1 |
proline-rich nuclear receptor coactivator 1 |
12973 |
0.16 |
| chr4_91058550_91058701 | 0.88 |
Gm12643 |
predicted gene 12643 |
20725 |
0.23 |
| chr16_94721948_94722518 | 0.88 |
Gm41505 |
predicted gene, 41505 |
339 |
0.89 |
| chr11_100394864_100395998 | 0.88 |
Jup |
junction plakoglobin |
2318 |
0.13 |
| chr2_125137851_125138149 | 0.88 |
Ctxn2 |
cortexin 2 |
1308 |
0.33 |
| chr1_130734221_130734966 | 0.88 |
AA986860 |
expressed sequence AA986860 |
2483 |
0.14 |
| chr17_73948968_73950593 | 0.88 |
Xdh |
xanthine dehydrogenase |
312 |
0.89 |
| chr11_108215040_108215274 | 0.87 |
Gm11655 |
predicted gene 11655 |
33307 |
0.2 |
| chr8_83737715_83738477 | 0.87 |
Adgre5 |
adhesion G protein-coupled receptor E5 |
3073 |
0.15 |
| chr18_40068567_40068718 | 0.87 |
Gm50395 |
predicted gene, 50395 |
41091 |
0.18 |
| chr3_19263556_19263786 | 0.87 |
Pde7a |
phosphodiesterase 7A |
1294 |
0.49 |
| chr10_81424113_81425703 | 0.86 |
Nfic |
nuclear factor I/C |
2206 |
0.11 |
| chr8_47027128_47027359 | 0.86 |
4930579M01Rik |
RIKEN cDNA 4930579M01 gene |
10934 |
0.18 |
| chr14_99631270_99631421 | 0.86 |
Gm9298 |
predicted gene 9298 |
679 |
0.73 |
| chr10_20546969_20547521 | 0.86 |
Pde7b |
phosphodiesterase 7B |
1083 |
0.56 |
| chr2_68378181_68378362 | 0.86 |
Stk39 |
serine/threonine kinase 39 |
8410 |
0.27 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 2.5 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.7 | 2.9 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.6 | 1.9 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
| 0.5 | 2.2 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
| 0.5 | 2.7 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.4 | 1.8 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.4 | 1.2 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
| 0.4 | 1.6 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
| 0.4 | 1.2 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.3 | 1.0 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
| 0.3 | 2.0 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.3 | 1.5 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.3 | 0.6 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.3 | 1.4 | GO:0015705 | iodide transport(GO:0015705) |
| 0.3 | 0.8 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
| 0.3 | 1.3 | GO:0071476 | cellular hypotonic response(GO:0071476) |
| 0.3 | 2.0 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
| 0.2 | 1.0 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
| 0.2 | 0.7 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.2 | 1.0 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.2 | 1.4 | GO:0060605 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.2 | 0.9 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.2 | 0.2 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.2 | 0.9 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.2 | 0.7 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.2 | 2.4 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.2 | 0.4 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.2 | 0.6 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.2 | 0.6 | GO:0072050 | S-shaped body morphogenesis(GO:0072050) |
| 0.2 | 0.6 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.2 | 0.8 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.2 | 0.8 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.2 | 0.6 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.2 | 0.4 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.2 | 0.7 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.2 | 0.5 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.2 | 0.7 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.2 | 0.4 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.2 | 0.7 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.2 | 0.9 | GO:0007494 | midgut development(GO:0007494) |
| 0.2 | 0.4 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.2 | 0.5 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.2 | 0.5 | GO:0034287 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.2 | 0.5 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.2 | 0.7 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.2 | 0.3 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.2 | 0.7 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.2 | 1.5 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.2 | 0.3 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
| 0.2 | 0.5 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 0.2 | 0.5 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.2 | 0.5 | GO:0002461 | tolerance induction dependent upon immune response(GO:0002461) |
| 0.2 | 0.5 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.1 | 0.4 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.1 | 0.4 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.1 | 0.4 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
| 0.1 | 0.6 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.1 | 0.1 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
| 0.1 | 0.4 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 | 0.4 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.1 | 0.7 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.1 | 0.4 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.1 | 1.0 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.1 | 0.4 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.1 | 0.5 | GO:0002513 | tolerance induction to self antigen(GO:0002513) |
| 0.1 | 0.4 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.1 | 0.8 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.1 | 0.6 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
| 0.1 | 0.3 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.1 | 0.5 | GO:0061743 | motor learning(GO:0061743) |
| 0.1 | 0.4 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.1 | 0.6 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.1 | 0.3 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.1 | 0.5 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
| 0.1 | 0.6 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.1 | 0.1 | GO:0098911 | regulation of ventricular cardiac muscle cell action potential(GO:0098911) |
| 0.1 | 1.1 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 | 0.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.1 | 1.3 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
| 0.1 | 0.1 | GO:1901256 | macrophage colony-stimulating factor production(GO:0036301) granulocyte colony-stimulating factor production(GO:0071611) regulation of granulocyte colony-stimulating factor production(GO:0071655) regulation of macrophage colony-stimulating factor production(GO:1901256) |
| 0.1 | 0.4 | GO:1902065 | response to L-glutamate(GO:1902065) |
| 0.1 | 0.4 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.1 | 0.4 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
| 0.1 | 0.4 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.1 | 0.4 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.8 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.1 | 0.3 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
| 0.1 | 0.3 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
| 0.1 | 0.1 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.1 | 0.2 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
| 0.1 | 1.1 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.1 | 0.3 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 0.1 | 0.1 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.1 | 0.6 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.1 | 0.5 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.1 | 0.3 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.1 | 0.2 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
| 0.1 | 0.4 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 | 0.2 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.1 | 0.3 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
| 0.1 | 0.3 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.1 | 0.9 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.1 | 0.2 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
| 0.1 | 0.3 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.1 | 0.7 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
| 0.1 | 0.6 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.1 | 0.3 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.1 | 1.2 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
| 0.1 | 1.0 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.1 | 0.3 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
| 0.1 | 0.4 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.1 | 0.7 | GO:0032530 | regulation of microvillus organization(GO:0032530) |
| 0.1 | 0.1 | GO:0072053 | renal inner medulla development(GO:0072053) |
| 0.1 | 0.2 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
| 0.1 | 0.5 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.1 | 0.2 | GO:0070666 | mast cell proliferation(GO:0070662) regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
| 0.1 | 0.2 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 0.9 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.1 | 0.7 | GO:0010880 | regulation of release of sequestered calcium ion into cytosol by sarcoplasmic reticulum(GO:0010880) |
| 0.1 | 0.5 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
| 0.1 | 0.3 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.1 | 0.3 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.1 | 0.6 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.1 | 0.1 | GO:0090259 | regulation of retinal ganglion cell axon guidance(GO:0090259) |
| 0.1 | 0.2 | GO:0070294 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.1 | 0.2 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.1 | 0.3 | GO:0036394 | amylase secretion(GO:0036394) |
| 0.1 | 0.6 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.1 | 0.6 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
| 0.1 | 0.1 | GO:0021826 | substrate-independent telencephalic tangential migration(GO:0021826) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
| 0.1 | 0.3 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.1 | 0.3 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.1 | 0.3 | GO:1904238 | pericyte cell differentiation(GO:1904238) |
| 0.1 | 2.1 | GO:0010107 | potassium ion import(GO:0010107) |
| 0.1 | 0.3 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.1 | 0.7 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.1 | 0.7 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.1 | 0.2 | GO:0048143 | astrocyte activation(GO:0048143) |
| 0.1 | 0.2 | GO:1904995 | negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.1 | 0.3 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.1 | 0.6 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.1 | 0.2 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.1 | 0.2 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.1 | 0.2 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.1 | 0.3 | GO:2000977 | regulation of forebrain neuron differentiation(GO:2000977) |
| 0.1 | 0.2 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
| 0.1 | 0.1 | GO:0002295 | T-helper cell lineage commitment(GO:0002295) CD4-positive, alpha-beta T cell lineage commitment(GO:0043373) |
| 0.1 | 0.5 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.1 | 0.4 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.1 | 0.1 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.1 | 0.3 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.1 | 0.3 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
| 0.1 | 0.3 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.1 | 0.3 | GO:0050904 | diapedesis(GO:0050904) |
| 0.1 | 0.3 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.1 | 0.1 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.1 | 0.1 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.1 | 0.2 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.1 | 0.2 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.1 | 1.3 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
| 0.1 | 0.6 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.1 | 0.4 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.1 | 0.4 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.1 | 0.3 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.1 | 0.1 | GO:0061642 | chemoattraction of axon(GO:0061642) |
| 0.1 | 0.2 | GO:0033153 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
| 0.1 | 0.1 | GO:0099612 | protein localization to axon(GO:0099612) |
| 0.1 | 0.3 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
| 0.1 | 0.8 | GO:0050872 | white fat cell differentiation(GO:0050872) |
| 0.1 | 0.3 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.1 | 0.3 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) |
| 0.1 | 0.2 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
| 0.1 | 0.5 | GO:0044557 | relaxation of smooth muscle(GO:0044557) relaxation of vascular smooth muscle(GO:0060087) |
| 0.1 | 0.1 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.1 | 0.1 | GO:0042520 | positive regulation of tyrosine phosphorylation of Stat4 protein(GO:0042520) |
| 0.1 | 0.2 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.1 | 0.2 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 0.1 | 0.5 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.1 | 0.1 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.1 | 0.3 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.4 | GO:0031000 | response to caffeine(GO:0031000) |
| 0.1 | 0.2 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.1 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 | 0.2 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.1 | 0.4 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.1 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
| 0.1 | 0.2 | GO:0086069 | bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 0.1 | 0.2 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
| 0.1 | 0.2 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.1 | 0.2 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.1 | 0.1 | GO:1903596 | regulation of gap junction assembly(GO:1903596) |
| 0.1 | 0.1 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070432) |
| 0.1 | 0.2 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.1 | 0.2 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.1 | 0.3 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.1 | 0.3 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
| 0.1 | 0.2 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.1 | 0.6 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.1 | 0.1 | GO:1901185 | negative regulation of ERBB signaling pathway(GO:1901185) |
| 0.1 | 0.2 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.1 | 0.2 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.1 | 0.1 | GO:0086068 | Purkinje myocyte action potential(GO:0086017) Purkinje myocyte to ventricular cardiac muscle cell signaling(GO:0086029) Purkinje myocyte to ventricular cardiac muscle cell communication(GO:0086068) |
| 0.1 | 0.1 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.1 | 1.3 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.1 | 0.3 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.2 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 0.2 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.1 | 0.1 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.1 | 0.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.1 | 0.3 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.1 | 0.5 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.1 | 0.2 | GO:0060618 | nipple development(GO:0060618) |
| 0.1 | 0.4 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 | 0.1 | GO:0046959 | habituation(GO:0046959) |
| 0.1 | 0.2 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.1 | 0.1 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.1 | 0.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.1 | 0.1 | GO:0001714 | endodermal cell fate specification(GO:0001714) |
| 0.1 | 0.3 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.1 | 0.6 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.1 | 0.2 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.1 | 0.1 | GO:1902287 | semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
| 0.0 | 0.1 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
| 0.0 | 0.0 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
| 0.0 | 0.1 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.0 | 1.0 | GO:0006110 | regulation of glycolytic process(GO:0006110) |
| 0.0 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.0 | 0.0 | GO:0061325 | cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
| 0.0 | 0.1 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.0 | 0.1 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.0 | 0.1 | GO:0003176 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
| 0.0 | 0.2 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.0 | 0.2 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.0 | 0.2 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
| 0.0 | 0.1 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.0 | 0.5 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.0 | 0.2 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.0 | 0.0 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
| 0.0 | 0.1 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.1 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.0 | 0.1 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
| 0.0 | 0.1 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
| 0.0 | 0.0 | GO:0060266 | regulation of respiratory burst involved in inflammatory response(GO:0060264) negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.0 | 0.3 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.0 | 0.4 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
| 0.0 | 0.0 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
| 0.0 | 0.2 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
| 0.0 | 0.1 | GO:0051280 | negative regulation of release of sequestered calcium ion into cytosol(GO:0051280) |
| 0.0 | 0.2 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.0 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 0.0 | 0.1 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.0 | 0.3 | GO:0060347 | heart trabecula formation(GO:0060347) |
| 0.0 | 0.7 | GO:0005980 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.0 | 0.1 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.0 | 0.1 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 0.0 | 0.1 | GO:0086005 | ventricular cardiac muscle cell action potential(GO:0086005) |
| 0.0 | 0.1 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.0 | 0.1 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.0 | 0.2 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 0.0 | 0.1 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
| 0.0 | 0.1 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.0 | 0.0 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
| 0.0 | 0.1 | GO:0086011 | membrane repolarization during action potential(GO:0086011) |
| 0.0 | 0.2 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.0 | 0.1 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.0 | 0.2 | GO:0021559 | trigeminal nerve development(GO:0021559) |
| 0.0 | 0.2 | GO:0060290 | transdifferentiation(GO:0060290) |
| 0.0 | 0.0 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
| 0.0 | 0.3 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.1 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.0 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.0 | 0.1 | GO:1903367 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.0 | 0.2 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.0 | 0.1 | GO:0032349 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) |
| 0.0 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.0 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.0 | 0.2 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.0 | 0.7 | GO:0001964 | startle response(GO:0001964) |
| 0.0 | 0.1 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.0 | 0.2 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.0 | 0.1 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.0 | 0.5 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.0 | 0.2 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.0 | 0.2 | GO:0071321 | cellular response to cGMP(GO:0071321) |
| 0.0 | 0.2 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.0 | 0.1 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.0 | 0.1 | GO:0001865 | NK T cell differentiation(GO:0001865) |
| 0.0 | 0.2 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.0 | 0.3 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.0 | 0.1 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.0 | 0.1 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.0 | 0.0 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
| 0.0 | 0.1 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
| 0.0 | 0.1 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
| 0.0 | 0.2 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.2 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.0 | 0.1 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 0.0 | 0.1 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.0 | 0.0 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.0 | 0.1 | GO:2000850 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.0 | 0.1 | GO:1905048 | regulation of metallopeptidase activity(GO:1905048) |
| 0.0 | 0.3 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.2 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.0 | 0.2 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.0 | 0.9 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
| 0.0 | 0.3 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.0 | 0.0 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.0 | 0.1 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.0 | 0.2 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
| 0.0 | 0.3 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.0 | 0.0 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.0 | 0.4 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.0 | 0.3 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.0 | 0.2 | GO:0034651 | cortisol biosynthetic process(GO:0034651) |
| 0.0 | 0.1 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
| 0.0 | 0.3 | GO:0048484 | enteric nervous system development(GO:0048484) |
| 0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 | 0.0 | GO:0043366 | beta selection(GO:0043366) |
| 0.0 | 0.3 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 | 0.1 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
| 0.0 | 0.0 | GO:0060437 | lung growth(GO:0060437) |
| 0.0 | 0.2 | GO:0036315 | cellular response to sterol(GO:0036315) |
| 0.0 | 0.0 | GO:0021855 | hypothalamus cell migration(GO:0021855) |
| 0.0 | 0.3 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.0 | 0.3 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.0 | 0.1 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.0 | 0.1 | GO:0010889 | regulation of sequestering of triglyceride(GO:0010889) |
| 0.0 | 0.1 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
| 0.0 | 0.0 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
| 0.0 | 0.1 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.0 | 0.2 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.0 | 0.2 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.0 | 0.1 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.0 | 0.1 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.0 | 0.1 | GO:0007412 | axon target recognition(GO:0007412) |
| 0.0 | 0.1 | GO:0032730 | positive regulation of interleukin-1 alpha production(GO:0032730) positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.0 | 0.2 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
| 0.0 | 0.1 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.0 | 0.1 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.1 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
| 0.0 | 0.0 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
| 0.0 | 0.1 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 0.0 | 0.7 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 | 0.2 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.0 | 0.2 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.0 | 0.0 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) |
| 0.0 | 0.1 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.0 | 0.1 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.0 | 0.1 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
| 0.0 | 0.2 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.0 | 0.4 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 | 0.0 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.0 | 0.2 | GO:0006983 | ER overload response(GO:0006983) |
| 0.0 | 0.3 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.0 | 0.2 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.0 | 0.2 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.0 | 0.0 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
| 0.0 | 0.2 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 | 0.3 | GO:0043084 | penile erection(GO:0043084) |
| 0.0 | 0.4 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.1 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.0 | 0.1 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.0 | 0.2 | GO:0060613 | fat pad development(GO:0060613) |
| 0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.0 | 0.1 | GO:0051775 | response to redox state(GO:0051775) |
| 0.0 | 0.2 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
| 0.0 | 0.1 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.0 | 0.1 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
| 0.0 | 0.1 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 0.2 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.0 | 0.1 | GO:0072393 | microtubule anchoring at microtubule organizing center(GO:0072393) |
| 0.0 | 0.1 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 | 0.1 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
| 0.0 | 0.1 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.0 | 0.1 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.0 | 0.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.0 | 0.1 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.0 | 0.1 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
| 0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.0 | 0.0 | GO:1904752 | vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) |
| 0.0 | 0.0 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 | 0.2 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.0 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.0 | 0.1 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.0 | 0.4 | GO:0031529 | ruffle organization(GO:0031529) |
| 0.0 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.0 | 0.1 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
| 0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.0 | 0.7 | GO:0007044 | cell-substrate junction assembly(GO:0007044) |
| 0.0 | 0.1 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.0 | 0.3 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.0 | 0.1 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
| 0.0 | 0.1 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.0 | 0.1 | GO:0045356 | positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
| 0.0 | 0.7 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.0 | 0.1 | GO:0014045 | establishment of endothelial blood-brain barrier(GO:0014045) |
| 0.0 | 0.1 | GO:0001705 | ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.0 | 0.1 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.2 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.0 | 0.1 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.0 | 0.2 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
| 0.0 | 0.1 | GO:0072610 | interleukin-12 secretion(GO:0072610) |
| 0.0 | 0.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 | 0.3 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 | 0.1 | GO:0003093 | regulation of glomerular filtration(GO:0003093) |
| 0.0 | 0.1 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
| 0.0 | 0.2 | GO:0003298 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.2 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.0 | 0.1 | GO:0003177 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
| 0.0 | 0.4 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.0 | 0.1 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.0 | 0.0 | GO:2000143 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.0 | 0.0 | GO:0070488 | neutrophil aggregation(GO:0070488) |
| 0.0 | 0.0 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.0 | 0.1 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.1 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 | 0.1 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.0 | 0.1 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 | 0.0 | GO:0014717 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
| 0.0 | 0.1 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) G-protein coupled purinergic receptor signaling pathway(GO:0035588) |
| 0.0 | 0.0 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.0 | 0.1 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 | 0.0 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.0 | 0.2 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 | 0.2 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.0 | 0.2 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.0 | 0.2 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.0 | 0.1 | GO:0034476 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
| 0.0 | 0.1 | GO:0042454 | purine nucleoside catabolic process(GO:0006152) ribonucleoside catabolic process(GO:0042454) purine ribonucleoside catabolic process(GO:0046130) |
| 0.0 | 0.0 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
| 0.0 | 0.4 | GO:0014829 | vascular smooth muscle contraction(GO:0014829) |
| 0.0 | 0.1 | GO:0021794 | thalamus development(GO:0021794) |
| 0.0 | 0.1 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.0 | 0.1 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.0 | 0.0 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.0 | 0.0 | GO:0010159 | specification of organ position(GO:0010159) |
| 0.0 | 0.1 | GO:0052203 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.0 | 0.0 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
| 0.0 | 0.1 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.0 | 0.2 | GO:2000178 | negative regulation of neural precursor cell proliferation(GO:2000178) |
| 0.0 | 0.2 | GO:0002024 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 0.0 | 0.1 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.0 | 0.0 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.0 | 0.1 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.0 | 0.0 | GO:0030826 | regulation of cGMP biosynthetic process(GO:0030826) |
| 0.0 | 0.0 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
| 0.0 | 0.4 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.0 | 0.1 | GO:0046909 | intermembrane transport(GO:0046909) |
| 0.0 | 0.0 | GO:0044381 | glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.0 | 0.1 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.0 | 0.1 | GO:0001696 | gastric acid secretion(GO:0001696) |
| 0.0 | 0.0 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.0 | 0.0 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.0 | 0.0 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.0 | 0.0 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
| 0.0 | 0.0 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.0 | 0.0 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.0 | 0.0 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.0 | 0.0 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.0 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.0 | 0.1 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
| 0.0 | 0.1 | GO:0010663 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.0 | 0.1 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
| 0.0 | 0.2 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
| 0.0 | 0.1 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
| 0.0 | 0.9 | GO:0007173 | epidermal growth factor receptor signaling pathway(GO:0007173) |
| 0.0 | 0.0 | GO:0072034 | renal vesicle induction(GO:0072034) ureter morphogenesis(GO:0072197) metanephric nephron tubule formation(GO:0072289) |
| 0.0 | 0.6 | GO:0008542 | visual learning(GO:0008542) |
| 0.0 | 0.1 | GO:0008054 | negative regulation of cyclin-dependent protein serine/threonine kinase by cyclin degradation(GO:0008054) |
| 0.0 | 0.1 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.0 | 0.1 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.0 | 0.0 | GO:0045986 | negative regulation of smooth muscle contraction(GO:0045986) |
| 0.0 | 0.1 | GO:0006704 | glucocorticoid biosynthetic process(GO:0006704) |
| 0.0 | 0.1 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 | 0.1 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
| 0.0 | 0.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.0 | 0.0 | GO:0017085 | response to insecticide(GO:0017085) |
| 0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.3 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 | 0.1 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.0 | 0.2 | GO:0021670 | lateral ventricle development(GO:0021670) |
| 0.0 | 0.4 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.0 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 | 0.0 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.1 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 0.0 | GO:0060677 | ureteric bud elongation(GO:0060677) |
| 0.0 | 0.0 | GO:0003228 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
| 0.0 | 0.0 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.0 | 0.1 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.0 | 0.0 | GO:0042504 | tyrosine phosphorylation of Stat4 protein(GO:0042504) regulation of tyrosine phosphorylation of Stat4 protein(GO:0042519) |
| 0.0 | 0.1 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.0 | 0.1 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.0 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 | 0.0 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.0 | 0.0 | GO:0061055 | myotome development(GO:0061055) |
| 0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.1 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.0 | 0.6 | GO:0010811 | positive regulation of cell-substrate adhesion(GO:0010811) |
| 0.0 | 0.0 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
| 0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.0 | 0.1 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.0 | 0.0 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.0 | 0.1 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
| 0.0 | 0.3 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 0.2 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
| 0.0 | 0.1 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
| 0.0 | 0.1 | GO:1902547 | regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902547) |
| 0.0 | 0.0 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.0 | 0.1 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
| 0.0 | 0.1 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.0 | 0.1 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.0 | 0.0 | GO:0051176 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of sulfur metabolic process(GO:0051176) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.0 | 0.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.0 | 0.0 | GO:0042420 | dopamine catabolic process(GO:0042420) |
| 0.0 | 0.1 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 | 0.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.0 | GO:0061074 | regulation of neural retina development(GO:0061074) |
| 0.0 | 0.0 | GO:0072695 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.0 | 0.0 | GO:2001054 | negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
| 0.0 | 0.0 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 0.1 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.2 | GO:0010669 | epithelial structure maintenance(GO:0010669) |
| 0.0 | 0.0 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.0 | 0.1 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
| 0.0 | 0.0 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.0 | 0.0 | GO:0014874 | response to stimulus involved in regulation of muscle adaptation(GO:0014874) |
| 0.0 | 0.0 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
| 0.0 | 0.0 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.0 | 0.0 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.0 | 0.0 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.0 | 0.0 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.0 | 0.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.0 | 0.1 | GO:0047497 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
| 0.0 | 0.0 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 | 0.0 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.0 | 0.1 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.0 | 0.1 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.0 | 0.0 | GO:0022615 | protein to membrane docking(GO:0022615) |
| 0.0 | 0.0 | GO:0042891 | antibiotic transport(GO:0042891) |
| 0.0 | 0.1 | GO:0060746 | parental behavior(GO:0060746) |
| 0.0 | 0.0 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.0 | 0.0 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
| 0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.2 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.0 | 0.3 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.0 | 0.2 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.0 | 0.0 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.0 | 0.1 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.0 | 0.1 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.0 | 0.1 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.0 | 0.0 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
| 0.0 | 0.0 | GO:1990000 | amyloid fibril formation(GO:1990000) |
| 0.0 | 0.0 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.2 | GO:1900003 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.0 | 0.0 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.0 | 0.1 | GO:0061590 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 0.0 | 0.0 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.0 | 0.1 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
| 0.0 | 0.1 | GO:0043545 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.0 | 0.0 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 0.0 | 0.0 | GO:0051088 | monocyte activation(GO:0042117) PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.0 | 0.0 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.0 | 0.3 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
| 0.0 | 0.0 | GO:0050703 | interleukin-1 alpha secretion(GO:0050703) |
| 0.0 | 0.0 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.1 | GO:0042523 | positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
| 0.0 | 0.0 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.0 | 0.2 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
| 0.0 | 0.0 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
| 0.0 | 0.1 | GO:0051256 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.0 | 0.0 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.0 | 0.1 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
| 0.0 | 0.1 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.0 | 0.0 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.0 | 0.1 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 0.0 | 0.0 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.0 | GO:0036314 | response to sterol(GO:0036314) |
| 0.0 | 0.0 | GO:0070989 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) oxidative demethylation(GO:0070989) |
| 0.0 | 0.0 | GO:0002538 | arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
| 0.0 | 0.0 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.1 | GO:2000505 | regulation of energy homeostasis(GO:2000505) |
| 0.0 | 0.0 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
| 0.0 | 0.1 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.1 | GO:0045056 | transcytosis(GO:0045056) |
| 0.0 | 0.1 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
| 0.0 | 0.0 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.0 | 0.5 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
| 0.0 | 0.0 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.0 | 0.0 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
| 0.0 | 0.0 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.0 | 0.0 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
| 0.0 | 0.2 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 | 0.0 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
| 0.0 | 0.0 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.0 | 0.2 | GO:0030514 | negative regulation of BMP signaling pathway(GO:0030514) |
| 0.0 | 0.0 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 | 0.0 | GO:0048241 | epinephrine transport(GO:0048241) |
| 0.0 | 0.1 | GO:1903961 | positive regulation of anion transmembrane transport(GO:1903961) |
| 0.0 | 0.0 | GO:0002838 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
| 0.0 | 0.0 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
| 0.0 | 0.0 | GO:0072319 | vesicle uncoating(GO:0072319) |
| 0.0 | 0.0 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.0 | 0.0 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.0 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
| 0.0 | 0.0 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.0 | 0.1 | GO:0009452 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.0 | 0.1 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.0 | 0.0 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.0 | 0.0 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.0 | 0.1 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.0 | 0.0 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
| 0.0 | 0.2 | GO:0045761 | regulation of adenylate cyclase activity(GO:0045761) |
| 0.0 | 0.2 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.0 | 0.0 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.0 | 0.0 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.0 | 0.0 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) |
| 0.0 | 0.0 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.0 | 0.0 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.0 | 0.0 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.0 | 0.0 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.8 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.5 | 2.3 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.3 | 2.3 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.3 | 3.3 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.3 | 1.3 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.2 | 0.7 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.2 | 1.0 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.2 | 0.5 | GO:0005914 | spot adherens junction(GO:0005914) |
| 0.2 | 0.7 | GO:1990357 | terminal web(GO:1990357) |
| 0.2 | 3.6 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.2 | 0.6 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.1 | 1.0 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.1 | 0.6 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.1 | 0.5 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.1 | 0.4 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.1 | 0.5 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 1.8 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.1 | 0.7 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.1 | 0.4 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.1 | 0.2 | GO:0044393 | microspike(GO:0044393) |
| 0.1 | 0.8 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.1 | 0.4 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 0.8 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 1.0 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.1 | 0.8 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.1 | 0.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 0.6 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.1 | 0.5 | GO:0016342 | catenin complex(GO:0016342) |
| 0.1 | 0.2 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.1 | 1.0 | GO:0043034 | costamere(GO:0043034) |
| 0.1 | 0.5 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 0.1 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 1.9 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.1 | 0.5 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 1.0 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.1 | 1.3 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.1 | 0.2 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.1 | 0.2 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.1 | 0.2 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.1 | 0.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 2.2 | GO:0014704 | intercalated disc(GO:0014704) |
| 0.1 | 0.7 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 0.9 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.1 | 2.7 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.1 | 2.5 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.1 | 0.3 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.1 | 2.4 | GO:0032420 | stereocilium(GO:0032420) |
| 0.1 | 0.3 | GO:0071437 | invadopodium(GO:0071437) |
| 0.1 | 0.3 | GO:0097433 | dense body(GO:0097433) |
| 0.1 | 1.8 | GO:0016459 | myosin complex(GO:0016459) |
| 0.1 | 0.5 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 0.9 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.1 | 0.4 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 0.3 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.0 | 0.1 | GO:0005775 | vacuolar lumen(GO:0005775) |
| 0.0 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.0 | 0.0 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
| 0.0 | 0.6 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.3 | GO:0033270 | paranode region of axon(GO:0033270) |
| 0.0 | 1.0 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.0 | 0.3 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.3 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.3 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 2.4 | GO:0030018 | Z disc(GO:0030018) |
| 0.0 | 0.1 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.0 | 0.5 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 0.4 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.0 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.0 | GO:1990696 | USH2 complex(GO:1990696) |
| 0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.0 | 0.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.0 | 0.3 | GO:0005861 | troponin complex(GO:0005861) |
| 0.0 | 0.1 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.0 | 1.3 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.0 | 0.0 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.0 | 0.0 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.0 | 0.4 | GO:0005605 | basal lamina(GO:0005605) |
| 0.0 | 1.0 | GO:0016528 | sarcoplasm(GO:0016528) |
| 0.0 | 0.3 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.0 | 0.2 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.0 | 0.0 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.0 | 0.5 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 0.2 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.4 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.0 | 0.3 | GO:0044291 | cell-cell contact zone(GO:0044291) |
| 0.0 | 0.4 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 0.8 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.7 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.0 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 1.6 | GO:0042383 | sarcolemma(GO:0042383) |
| 0.0 | 0.3 | GO:0098644 | complex of collagen trimers(GO:0098644) |
| 0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.0 | 0.1 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.0 | 0.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.0 | 0.3 | GO:0001527 | microfibril(GO:0001527) |
| 0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 0.1 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.0 | 0.2 | GO:0031674 | I band(GO:0031674) |
| 0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
| 0.0 | 0.0 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.2 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.0 | 0.1 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
| 0.0 | 2.1 | GO:0001726 | ruffle(GO:0001726) |
| 0.0 | 0.0 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.1 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.2 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 0.0 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.0 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 0.1 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
| 0.0 | 0.3 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.2 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 0.1 | GO:0043292 | contractile fiber(GO:0043292) |
| 0.0 | 0.6 | GO:0030016 | myofibril(GO:0030016) |
| 0.0 | 0.9 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.2 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.0 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 2.9 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.0 | 0.0 | GO:0043511 | inhibin complex(GO:0043511) |
| 0.0 | 0.3 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.0 | GO:0044449 | contractile fiber part(GO:0044449) |
| 0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 0.3 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.4 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.0 | 0.2 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.0 | 0.0 | GO:0042599 | lamellar body(GO:0042599) |
| 0.0 | 0.1 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 0.0 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.0 | 0.1 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.0 | 0.0 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.0 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.7 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 0.0 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.0 | 0.0 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.2 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.0 | 0.7 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.1 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.0 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.0 | 0.2 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.0 | 0.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.0 | 0.4 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.0 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.0 | 0.0 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 0.2 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 0.1 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.0 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.0 | 0.9 | GO:0060076 | excitatory synapse(GO:0060076) |
| 0.0 | 0.1 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.0 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.7 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.4 | 1.8 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.4 | 3.4 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.4 | 2.0 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.4 | 1.4 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.4 | 1.1 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.3 | 1.0 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.3 | 2.2 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.3 | 0.9 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.3 | 0.8 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.3 | 0.8 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.3 | 0.8 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.3 | 1.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.2 | 1.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.2 | 0.9 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.2 | 0.7 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.2 | 0.7 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.2 | 0.6 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.2 | 1.0 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.2 | 0.6 | GO:0071253 | connexin binding(GO:0071253) |
| 0.2 | 0.4 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
| 0.2 | 0.6 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
| 0.2 | 1.0 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.2 | 0.6 | GO:0035473 | lipase binding(GO:0035473) |
| 0.2 | 0.6 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.2 | 0.6 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.2 | 2.3 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.2 | 0.2 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.2 | 1.0 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.2 | 0.6 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.1 | 1.6 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.1 | 0.7 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.1 | 0.5 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.1 | 0.5 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.1 | 2.4 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.1 | 0.4 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 1.0 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.1 | 1.9 | GO:0044688 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.1 | 0.3 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.1 | 0.2 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.1 | 0.4 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.1 | 0.2 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.1 | 0.5 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.1 | 1.4 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 0.5 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.1 | 0.3 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.1 | 0.5 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.1 | 0.5 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.1 | 1.0 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.1 | 1.4 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.1 | 0.3 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.1 | 2.2 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 0.7 | GO:0031432 | titin binding(GO:0031432) |
| 0.1 | 0.4 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 0.3 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.1 | 1.9 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.1 | 0.2 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.1 | 0.7 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 0.5 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.1 | 0.3 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.1 | 0.2 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.1 | 0.3 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.1 | 0.2 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.1 | 0.8 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.1 | 1.2 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.1 | 0.5 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 0.3 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.1 | 0.3 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 0.3 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.1 | 0.3 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.1 | 0.3 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.1 | 0.3 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.1 | 0.8 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.1 | 0.4 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.1 | 0.3 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) |
| 0.1 | 0.3 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.1 | 0.1 | GO:0016726 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
| 0.1 | 0.3 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.1 | 2.5 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.1 | 0.2 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.1 | 0.3 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.1 | 0.4 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.1 | 0.4 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.1 | 0.5 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.1 | 0.2 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.1 | 0.4 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.1 | 1.1 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 0.2 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.1 | 0.4 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.1 | 0.4 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.1 | 0.3 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.1 | 0.2 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.1 | 0.2 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.1 | 0.1 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.1 | 0.8 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.1 | 0.4 | GO:0018499 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
| 0.1 | 0.3 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.1 | 0.3 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.1 | 0.3 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.1 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 0.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 0.1 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.1 | 1.0 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.1 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.1 | 0.7 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.1 | 0.2 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.1 | 0.2 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.1 | 0.3 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 0.3 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.1 | 0.1 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.1 | 0.4 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.1 | 1.0 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 0.6 | GO:0043236 | laminin binding(GO:0043236) |
| 0.1 | 0.6 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.1 | 0.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.1 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.1 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.1 | 0.3 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.1 | 0.4 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.1 | 0.2 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.1 | 0.4 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.1 | 0.5 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.1 | 0.4 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.1 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.1 | 0.2 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.1 | 0.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.1 | 0.3 | GO:0043338 | CTP:2,3-di-O-geranylgeranyl-sn-glycero-1-phosphate cytidyltransferase activity(GO:0043338) phospholactate guanylyltransferase activity(GO:0043814) ATP:coenzyme F420 adenylyltransferase activity(GO:0043910) UDP-N-acetylgalactosamine diphosphorylase activity(GO:0052630) |
| 0.1 | 0.3 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.2 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.3 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.0 | 0.6 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.1 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 0.2 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.0 | 0.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 0.2 | GO:0000295 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.0 | 0.4 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.2 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.0 | 0.5 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.1 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.0 | 0.2 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
| 0.0 | 0.3 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 0.1 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.0 | 0.3 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.0 | 0.4 | GO:0034817 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
| 0.0 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.3 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.0 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.0 | 0.0 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.0 | 1.9 | GO:0005518 | collagen binding(GO:0005518) |
| 0.0 | 0.2 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.0 | 0.1 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.0 | 0.1 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.1 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.0 | 0.1 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.0 | 0.1 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.0 | 0.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.0 | 0.1 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.0 | 0.2 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.0 | 1.9 | GO:0019888 | protein phosphatase regulator activity(GO:0019888) |
| 0.0 | 0.5 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.0 | 0.1 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.0 | 1.3 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.0 | 0.1 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.4 | GO:0001848 | complement binding(GO:0001848) |
| 0.0 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.0 | 0.1 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.1 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.0 | 0.5 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.2 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.2 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.0 | 0.2 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.0 | 0.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.0 | 0.3 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 0.0 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.0 | 0.0 | GO:0016775 | phosphotransferase activity, nitrogenous group as acceptor(GO:0016775) |
| 0.0 | 0.1 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.0 | 0.2 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.3 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.0 | 0.2 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.0 | 0.6 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.2 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.1 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
| 0.0 | 0.2 | GO:0018641 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
| 0.0 | 0.1 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.0 | 0.4 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.5 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 0.8 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.1 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
| 0.0 | 0.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.0 | 0.0 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.0 | 0.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.5 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.0 | 0.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.0 | 0.2 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.0 | 1.4 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.0 | 0.2 | GO:0016595 | glutamate binding(GO:0016595) |
| 0.0 | 0.3 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.2 | GO:0050544 | icosatetraenoic acid binding(GO:0050543) arachidonic acid binding(GO:0050544) |
| 0.0 | 0.1 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.2 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.6 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
| 0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 0.4 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.1 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.1 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.4 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.0 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.2 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 0.2 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.1 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.0 | 0.1 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.0 | 0.1 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.0 | 0.2 | GO:0008828 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
| 0.0 | 0.7 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.0 | 0.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.0 | 0.1 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 0.3 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.0 | 0.6 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.4 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 0.1 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.0 | 0.2 | GO:0046625 | sphingolipid binding(GO:0046625) |
| 0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.0 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.7 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.0 | 0.3 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.2 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.0 | 0.1 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
| 0.0 | 0.0 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.0 | 0.0 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.0 | 0.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.0 | 0.1 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.0 | 0.2 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.0 | 0.0 | GO:0051380 | norepinephrine binding(GO:0051380) |
| 0.0 | 0.2 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.3 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.0 | 0.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.2 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
| 0.0 | 0.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.1 | GO:0015278 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
| 0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.0 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 0.4 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.0 | 0.1 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
| 0.0 | 0.1 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.8 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.0 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
| 0.0 | 0.1 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.0 | 0.0 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.0 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 0.0 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.0 | 0.1 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) |
| 0.0 | 0.2 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.2 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.1 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.0 | 0.1 | GO:0051378 | serotonin binding(GO:0051378) |
| 0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.2 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.0 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
| 0.0 | 0.2 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.2 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.0 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.0 | 0.0 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.1 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
| 0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 0.1 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.0 | 0.2 | GO:0005343 | organic acid:sodium symporter activity(GO:0005343) |
| 0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.0 | 0.0 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.0 | 0.2 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.0 | 0.1 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
| 0.0 | 0.0 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) dopamine neurotransmitter receptor activity(GO:0004952) |
| 0.0 | 0.1 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.1 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.0 | 0.1 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.0 | 0.1 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.1 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.0 | 0.0 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.0 | 0.1 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
| 0.0 | 0.3 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.4 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.1 | GO:0036122 | BMP binding(GO:0036122) |
| 0.0 | 0.1 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.0 | 0.0 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.0 | 0.3 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.0 | 0.1 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.0 | 0.0 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.1 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.0 | 0.1 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.0 | 0.0 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.0 | 0.1 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.0 | 0.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.0 | 0.0 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.0 | 0.1 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.0 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 2.5 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 1.7 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 1.4 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.1 | 1.3 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.1 | 0.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.1 | 0.3 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.1 | 2.4 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.1 | 4.2 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.1 | 0.6 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 0.8 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 1.1 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.1 | 0.1 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.1 | 0.5 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 0.6 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.1 | 1.1 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.1 | 0.8 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.1 | 1.0 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.1 | 0.2 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.1 | 2.0 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.1 | 0.6 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.1 | 0.6 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 0.6 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.1 | 0.2 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.1 | 2.2 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 0.5 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 1.2 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.1 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.1 | 1.2 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.1 | 0.3 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.0 | 0.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 1.7 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.4 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 2.0 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.6 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 1.0 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.0 | 0.8 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 1.4 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.8 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 0.6 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.7 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.9 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.2 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.0 | 0.4 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.5 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.2 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 0.5 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.3 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 0.6 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 0.4 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.4 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.0 | 0.4 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.0 | 0.5 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.0 | 0.3 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.3 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.5 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 0.2 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.0 | 0.1 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 0.1 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.2 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.0 | 0.2 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.7 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 0.0 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 0.4 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.0 | 0.2 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 0.2 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.3 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.0 | 0.3 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.0 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.3 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.1 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.4 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 1.8 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 0.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 0.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.3 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.0 | 0.1 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.1 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 0.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 5.2 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.2 | 1.0 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.2 | 1.7 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.2 | 2.0 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 1.6 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 1.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 0.1 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.1 | 0.3 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.1 | 0.9 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.1 | 1.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.1 | 0.3 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.1 | 0.9 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.1 | 1.0 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.1 | 0.9 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 1.1 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.1 | 2.1 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
| 0.1 | 0.8 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 1.3 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.1 | 0.6 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.1 | 1.1 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.1 | 0.7 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.1 | 0.8 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.1 | 0.8 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.1 | 0.4 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.1 | 0.1 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.1 | 1.3 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 0.9 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.1 | 0.6 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 0.2 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
| 0.1 | 0.6 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.1 | 0.9 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.1 | 0.6 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.1 | 0.5 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.1 | 0.7 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.1 | 0.4 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 0.2 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.0 | 0.0 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.0 | 0.4 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.0 | 0.3 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.0 | 0.7 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.0 | 0.8 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.0 | 1.5 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.5 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 0.9 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.5 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.0 | 0.3 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 0.1 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.0 | 0.3 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.0 | 0.0 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.0 | 0.7 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.0 | 0.3 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.0 | 0.4 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
| 0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.0 | 0.7 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.2 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.1 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
| 0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.0 | 0.5 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.3 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.0 | 0.6 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.0 | 0.4 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
| 0.0 | 0.2 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.0 | 0.3 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.3 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 0.8 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 0.0 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.0 | 0.6 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 2.8 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.2 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.0 | 0.0 | REACTOME PI3K EVENTS IN ERBB2 SIGNALING | Genes involved in PI3K events in ERBB2 signaling |
| 0.0 | 0.3 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 0.1 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.0 | 0.7 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 0.1 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.0 | 0.1 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
| 0.0 | 0.4 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.4 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 0.0 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.2 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.0 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.0 | 0.2 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.8 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 1.0 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.3 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.0 | 0.8 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 0.3 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.6 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 0.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.1 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.9 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
| 0.0 | 0.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.1 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.0 | 0.1 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.0 | 0.1 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.3 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.1 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.0 | 0.6 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
| 0.0 | 0.1 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.0 | 0.3 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.0 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.0 | 0.0 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.0 | 0.0 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.0 | 0.2 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.3 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
| 0.0 | 0.4 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 0.1 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |