Gene Symbol | Gene ID | Gene Info |
---|---|---|
Klf15
|
ENSMUSG00000030087.5 | Klf15 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Klf15 | chr6_90465318_90465848 | 279 | 0.833920 | -0.48 | 9.6e-05 | Click! |
Klf15 | chr6_90468133_90468353 | 1125 | 0.332615 | -0.39 | 2.2e-03 | Click! |
Klf15 | chr6_90462281_90463607 | 270 | 0.816140 | 0.38 | 2.7e-03 | Click! |
Klf15 | chr6_90467668_90468098 | 765 | 0.482272 | -0.36 | 4.8e-03 | Click! |
Klf15 | chr6_90466371_90466910 | 240 | 0.863262 | -0.30 | 2.1e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr17_46444584_46445824 | 3.47 |
Gm5093 |
predicted gene 5093 |
5107 |
0.11 |
chr8_61757074_61758475 | 3.43 |
Palld |
palladin, cytoskeletal associated protein |
2315 |
0.38 |
chr10_122911891_122912439 | 2.80 |
Ppm1h |
protein phosphatase 1H (PP2C domain containing) |
16797 |
0.2 |
chr5_75152837_75154692 | 2.74 |
Gm42802 |
predicted gene 42802 |
111 |
0.58 |
chr6_52259553_52259793 | 2.53 |
Hoxa13 |
homeobox A13 |
1129 |
0.2 |
chr5_127227734_127228696 | 2.51 |
Tmem132c |
transmembrane protein 132C |
13593 |
0.18 |
chr6_5641360_5641511 | 2.37 |
Dync1i1 |
dynein cytoplasmic 1 intermediate chain 1 |
84204 |
0.1 |
chr1_132167980_132168639 | 2.37 |
Lemd1 |
LEM domain containing 1 |
23122 |
0.1 |
chr11_85833878_85836704 | 2.34 |
Tbx2 |
T-box 2 |
2740 |
0.17 |
chr14_28508967_28511864 | 2.33 |
Wnt5a |
wingless-type MMTV integration site family, member 5A |
203 |
0.89 |
chr2_30902329_30903582 | 2.29 |
Ptges |
prostaglandin E synthase |
342 |
0.83 |
chr10_125967796_125968797 | 2.29 |
Lrig3 |
leucine-rich repeats and immunoglobulin-like domains 3 |
2043 |
0.45 |
chr3_107597191_107597974 | 2.21 |
Alx3 |
aristaless-like homeobox 3 |
2551 |
0.22 |
chr11_114542855_114543103 | 2.14 |
4932435O22Rik |
RIKEN cDNA 4932435O22 gene |
94119 |
0.07 |
chr18_60646910_60648302 | 2.12 |
Synpo |
synaptopodin |
666 |
0.69 |
chr8_57320946_57324000 | 2.09 |
Hand2os1 |
Hand2, opposite strand 1 |
1245 |
0.3 |
chr11_85831867_85832577 | 2.04 |
2610027K06Rik |
RIKEN cDNA 2610027K06 gene |
1 |
0.83 |
chr15_27777838_27778577 | 2.04 |
Trio |
triple functional domain (PTPRF interacting) |
10431 |
0.23 |
chr5_118877757_118878023 | 2.03 |
Gm43782 |
predicted gene 43782 |
425 |
0.87 |
chr12_33955777_33956381 | 1.98 |
Twist1 |
twist basic helix-loop-helix transcription factor 1 |
1592 |
0.42 |
chr14_55782680_55784401 | 1.95 |
Adcy4 |
adenylate cyclase 4 |
146 |
0.88 |
chr15_27786588_27788615 | 1.93 |
Trio |
triple functional domain (PTPRF interacting) |
1037 |
0.6 |
chr6_72233456_72234176 | 1.92 |
Atoh8 |
atonal bHLH transcription factor 8 |
721 |
0.64 |
chr7_142662290_142664788 | 1.91 |
Igf2os |
insulin-like growth factor 2, opposite strand |
1599 |
0.21 |
chr3_99254836_99255604 | 1.89 |
Tbx15 |
T-box 15 |
1460 |
0.36 |
chr11_85829139_85831432 | 1.86 |
2610027K06Rik |
RIKEN cDNA 2610027K06 gene |
1924 |
0.21 |
chr13_53469792_53470715 | 1.84 |
Msx2 |
msh homeobox 2 |
2821 |
0.27 |
chr15_102270519_102271755 | 1.80 |
Gm9918 |
predicted gene 9918 |
574 |
0.55 |
chr5_118876831_118877755 | 1.79 |
Gm43782 |
predicted gene 43782 |
172 |
0.96 |
chr13_38153771_38154277 | 1.79 |
Gm10129 |
predicted gene 10129 |
2232 |
0.25 |
chr4_58678122_58678796 | 1.74 |
Gm12580 |
predicted gene 12580 |
19867 |
0.2 |
chr4_57567646_57569018 | 1.69 |
Pakap |
paralemmin A kinase anchor protein |
2 |
0.99 |
chr11_57828974_57830688 | 1.67 |
Hand1 |
heart and neural crest derivatives expressed 1 |
2316 |
0.24 |
chr19_34253411_34255499 | 1.67 |
Acta2 |
actin, alpha 2, smooth muscle, aorta |
225 |
0.92 |
chr6_121462840_121463340 | 1.66 |
Iqsec3 |
IQ motif and Sec7 domain 3 |
10533 |
0.2 |
chr5_119834833_119836185 | 1.65 |
Tbx5 |
T-box 5 |
646 |
0.68 |
chr19_56873965_56875080 | 1.63 |
Vwa2 |
von Willebrand factor A domain containing 2 |
273 |
0.92 |
chr14_95354605_95355258 | 1.61 |
Gm48994 |
predicted gene, 48994 |
15301 |
0.19 |
chr14_66077675_66078015 | 1.61 |
Adam2 |
a disintegrin and metallopeptidase domain 2 |
112 |
0.96 |
chr7_139020697_139021233 | 1.58 |
Gm45613 |
predicted gene 45613 |
34 |
0.98 |
chr4_154237030_154237961 | 1.57 |
Megf6 |
multiple EGF-like-domains 6 |
30 |
0.97 |
chr5_137349923_137351747 | 1.56 |
Ephb4 |
Eph receptor B4 |
322 |
0.77 |
chr13_51412096_51412399 | 1.55 |
S1pr3 |
sphingosine-1-phosphate receptor 3 |
3608 |
0.23 |
chr5_135887594_135889390 | 1.55 |
Hspb1 |
heat shock protein 1 |
474 |
0.68 |
chr7_36076544_36076695 | 1.54 |
Gm38991 |
predicted gene, 38991 |
20759 |
0.22 |
chr1_56971945_56972114 | 1.53 |
Satb2 |
special AT-rich sequence binding protein 2 |
171 |
0.66 |
chr14_46389448_46390599 | 1.53 |
Bmp4 |
bone morphogenetic protein 4 |
512 |
0.7 |
chr6_99204059_99205669 | 1.53 |
Foxp1 |
forkhead box P1 |
41846 |
0.2 |
chr19_43729441_43730557 | 1.53 |
Entpd7 |
ectonucleoside triphosphate diphosphohydrolase 7 |
3632 |
0.16 |
chr9_56637355_56637957 | 1.53 |
Lingo1 |
leucine rich repeat and Ig domain containing 1 |
2028 |
0.33 |
chr10_127341028_127341996 | 1.52 |
Gli1 |
GLI-Kruppel family member GLI1 |
374 |
0.69 |
chr5_127241790_127242838 | 1.51 |
Tmem132c |
transmembrane protein 132C |
488 |
0.81 |
chr8_34325722_34326983 | 1.51 |
Gm4889 |
predicted gene 4889 |
1558 |
0.28 |
chr1_186703655_186704733 | 1.50 |
Tgfb2 |
transforming growth factor, beta 2 |
139 |
0.93 |
chr15_102256642_102257542 | 1.48 |
Rarg |
retinoic acid receptor, gamma |
257 |
0.83 |
chr13_54447506_54447657 | 1.48 |
Thoc3 |
THO complex 3 |
21207 |
0.14 |
chr10_103027884_103029519 | 1.45 |
Alx1 |
ALX homeobox 1 |
74 |
0.97 |
chr1_19240831_19241749 | 1.45 |
Gm28340 |
predicted gene 28340 |
1435 |
0.44 |
chr9_58128949_58130350 | 1.44 |
Stra6 |
stimulated by retinoic acid gene 6 |
148 |
0.93 |
chr2_32319437_32319745 | 1.44 |
Dnm1 |
dynamin 1 |
990 |
0.24 |
chr13_56582551_56582734 | 1.43 |
2010203P06Rik |
RIKEN cDNA 2010203P06 gene |
12895 |
0.17 |
chr15_102735847_102736980 | 1.43 |
Calcoco1 |
calcium binding and coiled coil domain 1 |
14235 |
0.14 |
chr10_22818712_22820254 | 1.42 |
Tcf21 |
transcription factor 21 |
676 |
0.65 |
chr13_118715747_118716385 | 1.40 |
Gm16263 |
predicted gene 16263 |
670 |
0.62 |
chr9_14612272_14612966 | 1.40 |
Amotl1 |
angiomotin-like 1 |
1967 |
0.22 |
chrX_58037918_58039258 | 1.39 |
Zic3 |
zinc finger protein of the cerebellum 3 |
7578 |
0.26 |
chr13_56295365_56296328 | 1.39 |
Cxcl14 |
chemokine (C-X-C motif) ligand 14 |
459 |
0.77 |
chr12_117807954_117808128 | 1.36 |
Cdca7l |
cell division cycle associated 7 like |
3752 |
0.26 |
chr7_112154827_112154978 | 1.35 |
Dkk3 |
dickkopf WNT signaling pathway inhibitor 3 |
4155 |
0.3 |
chr8_44933791_44934220 | 1.34 |
Gm9908 |
predicted gene 9908 |
1154 |
0.42 |
chr8_120425368_120425578 | 1.33 |
Gm22715 |
predicted gene, 22715 |
18076 |
0.18 |
chr14_24081803_24082589 | 1.32 |
AC163638.2 |
novel transcript, antisense to Dlg5 |
75 |
0.95 |
chr4_154632829_154634203 | 1.32 |
Prdm16 |
PR domain containing 16 |
3281 |
0.16 |
chr3_87947557_87949450 | 1.31 |
Crabp2 |
cellular retinoic acid binding protein II |
163 |
0.9 |
chr10_51589723_51590651 | 1.30 |
Fam162b |
family with sequence similarity 162, member B |
330 |
0.83 |
chr11_96372718_96372936 | 1.30 |
Hoxb1 |
homeobox B1 |
6569 |
0.09 |
chr9_58859032_58860034 | 1.30 |
Neo1 |
neogenin |
34401 |
0.17 |
chr14_27065908_27066587 | 1.30 |
Il17rd |
interleukin 17 receptor D |
1150 |
0.53 |
chr2_157974620_157975884 | 1.29 |
Tti1 |
TELO2 interacting protein 1 |
31960 |
0.14 |
chr5_37826544_37829286 | 1.29 |
Msx1 |
msh homeobox 1 |
3332 |
0.25 |
chr16_85803997_85804470 | 1.29 |
Adamts1 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 1 |
1120 |
0.57 |
chr11_95587691_95587842 | 1.28 |
Ngfr |
nerve growth factor receptor (TNFR superfamily, member 16) |
31 |
0.97 |
chr8_77717432_77717888 | 1.26 |
4933431K23Rik |
RIKEN cDNA 4933431K23 gene |
5924 |
0.19 |
chr11_112783635_112784177 | 1.26 |
Sox9 |
SRY (sex determining region Y)-box 9 |
1682 |
0.31 |
chr16_17797005_17798693 | 1.26 |
Scarf2 |
scavenger receptor class F, member 2 |
499 |
0.64 |
chr13_117203073_117203224 | 1.26 |
Emb |
embigin |
5388 |
0.21 |
chr8_57316775_57317469 | 1.26 |
Hand2os1 |
Hand2, opposite strand 1 |
1288 |
0.34 |
chr9_63959979_63960801 | 1.26 |
Gm36033 |
predicted gene, 36033 |
23269 |
0.16 |
chr15_96647319_96647833 | 1.25 |
Slc38a1 |
solute carrier family 38, member 1 |
4663 |
0.22 |
chr2_172934875_172936042 | 1.25 |
Bmp7 |
bone morphogenetic protein 7 |
4634 |
0.21 |
chr12_86076310_86077005 | 1.24 |
Gm48008 |
predicted gene, 48008 |
1987 |
0.23 |
chr1_12692796_12693687 | 1.24 |
Sulf1 |
sulfatase 1 |
709 |
0.67 |
chr12_85201241_85201754 | 1.24 |
Gm45930 |
predicted gene, 45930 |
13692 |
0.1 |
chr5_119680221_119681643 | 1.23 |
Tbx3 |
T-box 3 |
683 |
0.62 |
chr15_51502880_51503669 | 1.23 |
Gm2361 |
predicted gene 2361 |
45696 |
0.18 |
chr14_69994534_69995596 | 1.23 |
Gm33524 |
predicted gene, 33524 |
62302 |
0.09 |
chr12_108002604_108003246 | 1.22 |
Bcl11b |
B cell leukemia/lymphoma 11B |
489 |
0.87 |
chr7_24954055_24955590 | 1.22 |
Gm44970 |
predicted gene 44970 |
95 |
0.93 |
chr4_130865728_130865948 | 1.20 |
Gm22660 |
predicted gene, 22660 |
7958 |
0.15 |
chr1_38766937_38768045 | 1.20 |
2610300A13Rik |
RIKEN cDNA 2610300A13 gene |
307 |
0.91 |
chr4_148921954_148922804 | 1.20 |
Gm15969 |
predicted gene 15969 |
8055 |
0.16 |
chrX_106486432_106486627 | 1.19 |
Fndc3c1 |
fibronectin type III domain containing 3C1 |
1128 |
0.49 |
chr9_44501278_44502177 | 1.18 |
Bcl9l |
B cell CLL/lymphoma 9-like |
2455 |
0.11 |
chr2_180389757_180390438 | 1.18 |
Mir1a-1 |
microRNA 1a-1 |
1049 |
0.41 |
chr1_135799428_135800706 | 1.18 |
Tnni1 |
troponin I, skeletal, slow 1 |
234 |
0.9 |
chr13_40749305_40749613 | 1.18 |
Gm48107 |
predicted gene, 48107 |
5535 |
0.11 |
chr19_58968880_58969238 | 1.17 |
Eno4 |
enolase 4 |
13603 |
0.18 |
chr11_87777883_87779273 | 1.17 |
Tspoap1 |
TSPO associated protein 1 |
215 |
0.86 |
chr13_118716705_118716856 | 1.17 |
Gm16263 |
predicted gene 16263 |
1384 |
0.39 |
chr10_39532030_39532710 | 1.17 |
Fyn |
Fyn proto-oncogene |
900 |
0.6 |
chr11_96875503_96876180 | 1.17 |
Gm11523 |
predicted gene 11523 |
1887 |
0.17 |
chr11_94498570_94500249 | 1.17 |
Epn3 |
epsin 3 |
289 |
0.85 |
chr17_85679503_85681370 | 1.17 |
Six2 |
sine oculis-related homeobox 2 |
7818 |
0.18 |
chr10_90828879_90830154 | 1.16 |
Anks1b |
ankyrin repeat and sterile alpha motif domain containing 1B |
50 |
0.97 |
chr3_129220683_129222367 | 1.16 |
Gm43697 |
predicted gene 43697 |
4003 |
0.19 |
chr5_120321916_120323112 | 1.16 |
Gm42654 |
predicted gene 42654 |
20045 |
0.16 |
chr2_74678970_74680401 | 1.16 |
Hoxd11 |
homeobox D11 |
128 |
0.86 |
chr2_35851622_35851905 | 1.15 |
Gm10829 |
predicted gene 10829 |
7568 |
0.19 |
chr12_16799565_16799716 | 1.15 |
Greb1 |
gene regulated by estrogen in breast cancer protein |
1044 |
0.43 |
chr5_106784649_106785188 | 1.15 |
Gm8365 |
predicted gene 8365 |
46154 |
0.12 |
chr3_89830954_89832206 | 1.14 |
She |
src homology 2 domain-containing transforming protein E |
210 |
0.9 |
chr13_107246810_107247372 | 1.14 |
Gm2726 |
predicted gene 2726 |
33100 |
0.2 |
chr2_59599662_59600686 | 1.14 |
Tanc1 |
tetratricopeptide repeat, ankyrin repeat and coiled-coil containing 1 |
11868 |
0.23 |
chr2_18049253_18049809 | 1.14 |
Skida1 |
SKI/DACH domain containing 1 |
480 |
0.68 |
chr8_78054594_78054969 | 1.14 |
Gm29895 |
predicted gene, 29895 |
10771 |
0.25 |
chr12_117657998_117660727 | 1.13 |
Rapgef5 |
Rap guanine nucleotide exchange factor (GEF) 5 |
1328 |
0.51 |
chr5_117932814_117933064 | 1.13 |
Gm26995 |
predicted gene, 26995 |
6579 |
0.17 |
chr6_14903005_14903973 | 1.12 |
Foxp2 |
forkhead box P2 |
32 |
0.99 |
chr2_173577720_173578756 | 1.12 |
Ankrd60 |
ankyrin repeat domain 60 |
35 |
0.98 |
chr2_10296121_10296386 | 1.12 |
Sfmbt2 |
Scm-like with four mbt domains 2 |
74257 |
0.03 |
chr7_112807297_112807678 | 1.12 |
Tead1 |
TEA domain family member 1 |
32147 |
0.19 |
chr5_119673827_119675890 | 1.11 |
Tbx3 |
T-box 3 |
587 |
0.67 |
chr13_15464574_15464999 | 1.11 |
Gli3 |
GLI-Kruppel family member GLI3 |
806 |
0.46 |
chr15_89556682_89557457 | 1.11 |
Shank3 |
SH3 and multiple ankyrin repeat domains 3 |
367 |
0.8 |
chr10_22158248_22159850 | 1.11 |
H60b |
histocompatibility 60b |
463 |
0.42 |
chr2_71551375_71552379 | 1.10 |
Dlx2 |
distal-less homeobox 2 |
5123 |
0.16 |
chr18_25537637_25538405 | 1.10 |
Celf4 |
CUGBP, Elav-like family member 4 |
36782 |
0.19 |
chrX_107676489_107677347 | 1.10 |
Tbx22 |
T-box 22 |
406 |
0.9 |
chr8_8658850_8659001 | 1.10 |
Efnb2 |
ephrin B2 |
2314 |
0.15 |
chr10_127665742_127666771 | 1.09 |
Nab2 |
Ngfi-A binding protein 2 |
376 |
0.55 |
chr3_30219121_30220217 | 1.09 |
Gm38197 |
predicted gene, 38197 |
8025 |
0.18 |
chr15_83734436_83734715 | 1.09 |
Scube1 |
signal peptide, CUB domain, EGF-like 1 |
9554 |
0.22 |
chrX_138914621_138915112 | 1.08 |
Nrk |
Nik related kinase |
435 |
0.9 |
chr9_99993983_99995346 | 1.08 |
4930519F24Rik |
RIKEN cDNA 4930519F24 gene |
27636 |
0.17 |
chr12_49382714_49384085 | 1.08 |
Foxg1 |
forkhead box G1 |
392 |
0.72 |
chr14_8316025_8316853 | 1.08 |
Fam107a |
family with sequence similarity 107, member A |
1584 |
0.4 |
chr9_110742005_110742541 | 1.07 |
Myl3 |
myosin, light polypeptide 3 |
412 |
0.46 |
chr1_155243833_155245053 | 1.07 |
BC034090 |
cDNA sequence BC034090 |
1 |
0.97 |
chr11_102608091_102608242 | 1.07 |
Fzd2 |
frizzled class receptor 2 |
3770 |
0.12 |
chr18_36069509_36069871 | 1.06 |
Nrg2 |
neuregulin 2 |
1065 |
0.53 |
chr9_67046772_67047178 | 1.05 |
Tpm1 |
tropomyosin 1, alpha |
2143 |
0.29 |
chr14_22650546_22651065 | 1.05 |
Lrmda |
leucine rich melanocyte differentiation associated |
54292 |
0.15 |
chr10_80960844_80961038 | 1.05 |
Gm3828 |
predicted gene 3828 |
6231 |
0.1 |
chr5_113789223_113789559 | 1.05 |
Tmem119 |
transmembrane protein 119 |
11055 |
0.09 |
chr17_28345051_28346589 | 1.05 |
Tead3 |
TEA domain family member 3 |
4526 |
0.11 |
chr4_46665107_46665935 | 1.05 |
Tbc1d2 |
TBC1 domain family, member 2 |
15312 |
0.19 |
chr11_57828606_57828942 | 1.05 |
Hand1 |
heart and neural crest derivatives expressed 1 |
3373 |
0.19 |
chr4_127434882_127435196 | 1.05 |
Gm12947 |
predicted gene 12947 |
26241 |
0.16 |
chr7_37362184_37363004 | 1.05 |
6720469O03Rik |
RIKEN cDNA 6720469O03 gene |
4036 |
0.29 |
chrX_11491808_11492492 | 1.04 |
Gm14515 |
predicted gene 14515 |
109204 |
0.06 |
chr12_9573836_9576858 | 1.04 |
Osr1 |
odd-skipped related transcription factor 1 |
906 |
0.56 |
chr12_33956740_33957445 | 1.03 |
Twist1 |
twist basic helix-loop-helix transcription factor 1 |
579 |
0.78 |
chr17_70848457_70848608 | 1.03 |
Tgif1 |
TGFB-induced factor homeobox 1 |
1112 |
0.33 |
chr13_21848087_21848489 | 1.03 |
Hist1h2br |
histone cluster 1 H2br |
14530 |
0.05 |
chr10_61898411_61898967 | 1.03 |
Col13a1 |
collagen, type XIII, alpha 1 |
20297 |
0.19 |
chr11_35124953_35125193 | 1.03 |
Slit3 |
slit guidance ligand 3 |
3849 |
0.33 |
chr2_30719578_30720321 | 1.02 |
Gm14488 |
predicted gene 14488 |
108 |
0.94 |
chr14_31934286_31934676 | 1.02 |
D830044D21Rik |
RIKEN cDNA D830044D21 gene |
27953 |
0.16 |
chr4_109977456_109978751 | 1.02 |
Dmrta2 |
doublesex and mab-3 related transcription factor like family A2 |
50 |
0.8 |
chr2_132943595_132944461 | 1.02 |
Fermt1 |
fermitin family member 1 |
1601 |
0.32 |
chr5_119748253_119749492 | 1.02 |
Tbx3os2 |
T-box 3, opposite strand 2 |
57654 |
0.09 |
chr15_102248520_102249127 | 1.01 |
Rarg |
retinoic acid receptor, gamma |
1523 |
0.22 |
chr11_117275227_117275378 | 1.01 |
Septin9 |
septin 9 |
9056 |
0.18 |
chr16_28565205_28565362 | 1.01 |
Fgf12 |
fibroblast growth factor 12 |
332 |
0.93 |
chr4_126740288_126740466 | 1.00 |
Tfap2e |
transcription factor AP-2, epsilon |
4137 |
0.16 |
chr2_152626740_152627949 | 1.00 |
Rem1 |
rad and gem related GTP binding protein 1 |
391 |
0.68 |
chr8_92362973_92364962 | 1.00 |
Irx5 |
Iroquois homeobox 5 |
6218 |
0.19 |
chr11_102604334_102605731 | 1.00 |
Fzd2 |
frizzled class receptor 2 |
636 |
0.55 |
chr7_135853686_135854203 | 1.00 |
6330420H09Rik |
RIKEN cDNA 6330420H09 gene |
262 |
0.7 |
chr2_24521393_24522148 | 1.00 |
Gm13418 |
predicted gene 13418 |
27702 |
0.11 |
chr5_37825667_37826469 | 1.00 |
Msx1 |
msh homeobox 1 |
1485 |
0.42 |
chr2_164403990_164405371 | 1.00 |
Matn4 |
matrilin 4 |
66 |
0.93 |
chr8_27090091_27090740 | 0.99 |
Adgra2 |
adhesion G protein-coupled receptor A2 |
4817 |
0.13 |
chr13_63554202_63556305 | 0.99 |
Ptch1 |
patched 1 |
8562 |
0.14 |
chr11_85885788_85887022 | 0.99 |
Tbx4 |
T-box 4 |
17 |
0.97 |
chr11_96003142_96003707 | 0.98 |
Gm29202 |
predicted gene 29202 |
2465 |
0.13 |
chr3_109573935_109574620 | 0.98 |
Vav3 |
vav 3 oncogene |
370 |
0.93 |
chr1_91800905_91802284 | 0.98 |
Twist2 |
twist basic helix-loop-helix transcription factor 2 |
124 |
0.94 |
chr2_101754877_101755560 | 0.98 |
Prr5l |
proline rich 5 like |
42432 |
0.15 |
chr8_87836615_87837599 | 0.97 |
Zfp423 |
zinc finger protein 423 |
32668 |
0.22 |
chr10_76583951_76585206 | 0.97 |
Ftcd |
formiminotransferase cyclodeaminase |
2555 |
0.18 |
chr17_29794989_29795742 | 0.97 |
Gm50016 |
predicted gene, 50016 |
24022 |
0.14 |
chr5_130852220_130852448 | 0.97 |
Gm42894 |
predicted gene 42894 |
15503 |
0.22 |
chr7_114657035_114657419 | 0.97 |
Calca |
calcitonin/calcitonin-related polypeptide, alpha |
20870 |
0.16 |
chr10_103029624_103030791 | 0.97 |
Alx1 |
ALX homeobox 1 |
8 |
0.64 |
chr4_126150157_126151254 | 0.97 |
Eva1b |
eva-1 homolog B (C. elegans) |
2173 |
0.18 |
chr5_113799288_113800716 | 0.97 |
Tmem119 |
transmembrane protein 119 |
444 |
0.69 |
chr12_72944998_72946304 | 0.97 |
Gm26709 |
predicted gene, 26709 |
156 |
0.94 |
chr7_38074216_38075175 | 0.97 |
Gm30684 |
predicted gene, 30684 |
12995 |
0.15 |
chr2_167539777_167540513 | 0.96 |
Snai1 |
snail family zinc finger 1 |
1950 |
0.22 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.6 | 4.7 | GO:0010159 | specification of organ position(GO:0010159) |
1.5 | 4.5 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
1.3 | 3.9 | GO:0070384 | Harderian gland development(GO:0070384) |
1.3 | 3.8 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.9 | 3.7 | GO:0003253 | cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
0.9 | 2.8 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
0.8 | 2.5 | GO:0072275 | glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
0.8 | 2.3 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.8 | 3.0 | GO:0021938 | smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
0.7 | 2.0 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.6 | 1.3 | GO:0072198 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) |
0.6 | 1.3 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.6 | 1.3 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.6 | 1.9 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.6 | 0.6 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
0.6 | 3.6 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.6 | 1.7 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.5 | 1.1 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.5 | 1.6 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
0.5 | 1.6 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.5 | 1.6 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.5 | 1.6 | GO:0060596 | mammary placode formation(GO:0060596) |
0.5 | 1.6 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.5 | 1.0 | GO:0060166 | olfactory pit development(GO:0060166) |
0.5 | 1.5 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.5 | 1.4 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.4 | 1.3 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.4 | 0.4 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.4 | 3.2 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.4 | 1.2 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.4 | 0.8 | GO:0061004 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.4 | 0.8 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.4 | 1.2 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.4 | 1.1 | GO:0060592 | mammary gland formation(GO:0060592) mammary gland specification(GO:0060594) |
0.4 | 1.5 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.4 | 1.1 | GO:0072107 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
0.4 | 2.2 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
0.4 | 1.8 | GO:0090500 | endocardial cushion to mesenchymal transition(GO:0090500) |
0.4 | 0.7 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.4 | 1.4 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.4 | 0.7 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.4 | 1.4 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.4 | 1.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.4 | 1.8 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.3 | 1.0 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.3 | 0.7 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.3 | 0.7 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
0.3 | 2.0 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.3 | 1.0 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.3 | 0.7 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.3 | 2.3 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.3 | 1.0 | GO:0071415 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.3 | 1.9 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.3 | 1.0 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.3 | 1.0 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.3 | 0.9 | GO:0072093 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
0.3 | 2.4 | GO:0021877 | forebrain neuron fate commitment(GO:0021877) |
0.3 | 0.9 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.3 | 1.8 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.3 | 0.3 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.3 | 0.3 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.3 | 0.9 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.3 | 0.8 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.3 | 2.7 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.3 | 1.3 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) |
0.3 | 0.5 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.3 | 1.3 | GO:1901166 | neural crest cell migration involved in autonomic nervous system development(GO:1901166) |
0.3 | 0.5 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.2 | 0.5 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.2 | 1.5 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.2 | 1.5 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.2 | 0.2 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
0.2 | 2.2 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.2 | 0.7 | GO:0030421 | defecation(GO:0030421) |
0.2 | 0.5 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.2 | 0.2 | GO:0031446 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
0.2 | 0.5 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.2 | 0.5 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.2 | 1.2 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.2 | 1.4 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.2 | 0.7 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.2 | 0.5 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.2 | 0.7 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.2 | 0.7 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.2 | 1.1 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.2 | 0.7 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
0.2 | 0.5 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.2 | 0.7 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.2 | 0.7 | GO:0061623 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.2 | 0.7 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.2 | 0.2 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
0.2 | 1.8 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.2 | 0.7 | GO:0021564 | vagus nerve development(GO:0021564) |
0.2 | 0.7 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.2 | 0.4 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
0.2 | 0.9 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.2 | 3.2 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
0.2 | 0.2 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.2 | 1.3 | GO:0048385 | regulation of retinoic acid receptor signaling pathway(GO:0048385) |
0.2 | 0.4 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.2 | 0.6 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.2 | 0.2 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
0.2 | 0.8 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
0.2 | 0.8 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.2 | 0.6 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.2 | 1.0 | GO:0051775 | response to redox state(GO:0051775) |
0.2 | 0.8 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
0.2 | 0.4 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.2 | 0.2 | GO:0003180 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
0.2 | 0.4 | GO:0060023 | soft palate development(GO:0060023) |
0.2 | 0.2 | GO:0003166 | bundle of His development(GO:0003166) |
0.2 | 0.6 | GO:0001757 | somite specification(GO:0001757) |
0.2 | 0.2 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.2 | 0.8 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.2 | 0.6 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.2 | 0.4 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.2 | 0.6 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.2 | 0.4 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.2 | 1.3 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.2 | 0.4 | GO:0007494 | midgut development(GO:0007494) |
0.2 | 1.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.2 | 0.2 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.2 | 0.9 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.2 | 0.7 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.2 | 0.7 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
0.2 | 0.5 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.2 | 0.4 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.2 | 1.1 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.2 | 0.5 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.2 | 0.9 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.2 | 0.5 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.2 | 0.7 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.2 | 1.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.2 | 0.5 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
0.2 | 0.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.2 | 0.7 | GO:0032914 | transforming growth factor beta1 production(GO:0032905) regulation of transforming growth factor beta1 production(GO:0032908) positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.2 | 0.9 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.2 | 0.7 | GO:0030035 | microspike assembly(GO:0030035) |
0.2 | 0.7 | GO:0014028 | notochord formation(GO:0014028) |
0.2 | 0.3 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.2 | 0.8 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.2 | 0.3 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.2 | 0.3 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.2 | 0.5 | GO:0071608 | macrophage inflammatory protein-1 alpha production(GO:0071608) |
0.2 | 0.7 | GO:0032348 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.2 | 0.7 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.2 | 0.6 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
0.2 | 0.6 | GO:0035989 | tendon development(GO:0035989) |
0.2 | 0.2 | GO:0031944 | negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
0.2 | 0.3 | GO:0007442 | hindgut morphogenesis(GO:0007442) |
0.2 | 0.5 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.2 | 0.2 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
0.2 | 1.4 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.2 | 0.2 | GO:0033278 | cell proliferation in midbrain(GO:0033278) |
0.2 | 0.6 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.2 | 0.2 | GO:0043309 | regulation of eosinophil degranulation(GO:0043309) |
0.2 | 1.2 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.1 | 0.4 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
0.1 | 0.3 | GO:0051794 | regulation of catagen(GO:0051794) |
0.1 | 0.4 | GO:0006868 | glutamine transport(GO:0006868) |
0.1 | 0.4 | GO:0033504 | floor plate development(GO:0033504) |
0.1 | 0.4 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.1 | 0.4 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.1 | 0.6 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.1 | 2.5 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.1 | 0.3 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.1 | 0.4 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.1 | 0.6 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.1 | 0.6 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.1 | 1.0 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
0.1 | 0.9 | GO:0071910 | determination of liver left/right asymmetry(GO:0071910) |
0.1 | 0.4 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.1 | 0.3 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.1 | 0.9 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.1 | 0.6 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.1 | 0.4 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.1 | 0.3 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.1 | 0.4 | GO:0003032 | detection of oxygen(GO:0003032) |
0.1 | 0.5 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.1 | 0.4 | GO:0003184 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
0.1 | 0.5 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.1 | 1.2 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.1 | 1.4 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.1 | 0.6 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.1 | 0.3 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.1 | 0.1 | GO:0032344 | regulation of aldosterone metabolic process(GO:0032344) |
0.1 | 0.1 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) |
0.1 | 0.9 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.1 | 0.3 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.1 | 0.3 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.1 | 0.3 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.1 | 0.1 | GO:0021855 | hypothalamus cell migration(GO:0021855) |
0.1 | 0.5 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.1 | 0.4 | GO:0002339 | B cell selection(GO:0002339) |
0.1 | 1.1 | GO:0051546 | keratinocyte migration(GO:0051546) |
0.1 | 0.1 | GO:0060426 | lung vasculature development(GO:0060426) |
0.1 | 0.1 | GO:0061047 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.1 | 0.6 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.1 | 0.6 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.1 | 0.5 | GO:0099624 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
0.1 | 1.2 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 0.2 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.1 | 0.5 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.1 | 1.9 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
0.1 | 0.3 | GO:0048557 | embryonic digestive tract morphogenesis(GO:0048557) |
0.1 | 0.7 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
0.1 | 0.5 | GO:0036296 | cellular response to increased oxygen levels(GO:0036295) response to increased oxygen levels(GO:0036296) response to hyperoxia(GO:0055093) cellular response to hyperoxia(GO:0071455) |
0.1 | 0.3 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.1 | 0.7 | GO:0071468 | cellular response to acidic pH(GO:0071468) |
0.1 | 0.3 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.1 | 0.2 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.1 | 0.2 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.1 | 0.2 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
0.1 | 0.3 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 0.2 | GO:0061309 | cardiac neural crest cell development involved in outflow tract morphogenesis(GO:0061309) |
0.1 | 0.7 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.1 | 0.3 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.1 | 0.4 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.1 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.3 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.1 | 1.1 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
0.1 | 0.2 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.1 | 0.3 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.1 | 1.2 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.1 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.4 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.1 | 0.1 | GO:0090177 | establishment of planar polarity involved in neural tube closure(GO:0090177) |
0.1 | 0.4 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.1 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.1 | 1.8 | GO:0014829 | vascular smooth muscle contraction(GO:0014829) |
0.1 | 0.3 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.1 | 0.2 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.1 | 0.7 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
0.1 | 0.2 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.3 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 1.5 | GO:0035115 | embryonic forelimb morphogenesis(GO:0035115) |
0.1 | 0.2 | GO:2000412 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
0.1 | 0.2 | GO:0014900 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.1 | 0.5 | GO:0048368 | lateral mesoderm development(GO:0048368) |
0.1 | 0.4 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.1 | 1.8 | GO:0001516 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
0.1 | 0.3 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.1 | 0.1 | GO:0010002 | cardioblast differentiation(GO:0010002) |
0.1 | 0.4 | GO:0090179 | planar cell polarity pathway involved in neural tube closure(GO:0090179) |
0.1 | 0.1 | GO:0072191 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
0.1 | 1.9 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.1 | 0.1 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.1 | 0.4 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.1 | 1.0 | GO:0002052 | positive regulation of neuroblast proliferation(GO:0002052) |
0.1 | 0.1 | GO:0090032 | negative regulation of steroid hormone biosynthetic process(GO:0090032) |
0.1 | 0.3 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.1 | 0.4 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.1 | 0.4 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
0.1 | 0.5 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
0.1 | 0.2 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.1 | 0.3 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 0.2 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.1 | 0.8 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
0.1 | 0.2 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.1 | 2.6 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
0.1 | 0.5 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.1 | 0.3 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.1 | 0.4 | GO:0060056 | mammary gland involution(GO:0060056) |
0.1 | 0.4 | GO:0086011 | membrane repolarization during action potential(GO:0086011) |
0.1 | 0.3 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.1 | 0.1 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.1 | 0.2 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.3 | GO:0032196 | transposition(GO:0032196) |
0.1 | 3.7 | GO:0060021 | palate development(GO:0060021) |
0.1 | 0.2 | GO:0060462 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
0.1 | 0.2 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.1 | 0.6 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.1 | 0.3 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.1 | 0.2 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.1 | 0.1 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.1 | 0.1 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
0.1 | 0.2 | GO:0034287 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.1 | 1.0 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
0.1 | 0.2 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.1 | 0.1 | GO:0060579 | ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
0.1 | 0.2 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.3 | GO:0097154 | GABAergic neuron differentiation(GO:0097154) |
0.1 | 0.2 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.1 | 0.2 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.1 | 0.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.1 | 0.2 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.1 | 0.2 | GO:0033058 | directional locomotion(GO:0033058) |
0.1 | 0.6 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.1 | 0.6 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.1 | 0.1 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.1 | 0.2 | GO:0031296 | B cell costimulation(GO:0031296) |
0.1 | 0.6 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.1 | 0.6 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.1 | 0.1 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.1 | 0.6 | GO:1990118 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.1 | 0.5 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.1 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 0.3 | GO:0021895 | cerebral cortex neuron differentiation(GO:0021895) |
0.1 | 0.2 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.1 | 0.1 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.1 | 0.1 | GO:0021557 | oculomotor nerve development(GO:0021557) |
0.1 | 0.2 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.1 | 0.1 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
0.1 | 0.5 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.1 | 0.2 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.1 | 0.9 | GO:1990403 | embryonic brain development(GO:1990403) |
0.1 | 0.1 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.1 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 0.4 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.1 | 0.7 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.1 | 0.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.1 | 0.1 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 0.1 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.1 | 0.3 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.1 | 0.1 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.1 | 0.1 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.1 | 0.4 | GO:0002076 | osteoblast development(GO:0002076) |
0.1 | 0.1 | GO:0043584 | nose development(GO:0043584) |
0.1 | 0.1 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
0.1 | 0.3 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.1 | 0.1 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.1 | 0.3 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.1 | 0.3 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.1 | 0.2 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.1 | 0.2 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.1 | 0.5 | GO:0002024 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.1 | 0.1 | GO:0043587 | tongue morphogenesis(GO:0043587) |
0.1 | 0.1 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.1 | 0.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.1 | 0.2 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
0.1 | 0.1 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.3 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.1 | 0.3 | GO:0051451 | myoblast migration(GO:0051451) |
0.1 | 0.9 | GO:0032330 | regulation of chondrocyte differentiation(GO:0032330) |
0.1 | 0.3 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.1 | 0.6 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 0.2 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.1 | 0.3 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.1 | 0.2 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.1 | 0.1 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.1 | 0.7 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.1 | 0.1 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
0.1 | 0.2 | GO:1902669 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
0.1 | 0.1 | GO:0048548 | regulation of pinocytosis(GO:0048548) |
0.1 | 0.1 | GO:0034651 | cortisol biosynthetic process(GO:0034651) |
0.1 | 0.1 | GO:0070673 | response to interleukin-18(GO:0070673) cellular response to interleukin-18(GO:0071351) |
0.1 | 0.2 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.1 | 0.2 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.1 | 0.4 | GO:0002726 | positive regulation of T cell cytokine production(GO:0002726) |
0.1 | 0.1 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.1 | 0.2 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
0.1 | 0.1 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.1 | 0.2 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.1 | 0.3 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.1 | 0.1 | GO:0009080 | alanine catabolic process(GO:0006524) pyruvate family amino acid catabolic process(GO:0009080) |
0.1 | 0.1 | GO:0032594 | protein transport within lipid bilayer(GO:0032594) |
0.1 | 0.1 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.1 | 0.6 | GO:0033622 | integrin activation(GO:0033622) |
0.1 | 0.2 | GO:0035524 | proline transmembrane transport(GO:0035524) |
0.1 | 0.3 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
0.1 | 0.1 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.1 | 0.3 | GO:0032725 | positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
0.1 | 0.4 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.1 | 0.1 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.1 | 0.1 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
0.1 | 0.1 | GO:0032278 | positive regulation of gonadotropin secretion(GO:0032278) positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.1 | 0.4 | GO:0001977 | renal system process involved in regulation of blood volume(GO:0001977) |
0.1 | 0.2 | GO:0030578 | PML body organization(GO:0030578) |
0.1 | 0.4 | GO:0033574 | response to testosterone(GO:0033574) |
0.1 | 0.2 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.1 | 0.3 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.6 | GO:0071800 | podosome assembly(GO:0071800) |
0.1 | 1.5 | GO:0003341 | cilium movement(GO:0003341) |
0.1 | 0.2 | GO:0015744 | succinate transport(GO:0015744) |
0.1 | 0.3 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.1 | 0.2 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.1 | 0.5 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.1 | 0.2 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.1 | 0.2 | GO:0061384 | heart trabecula morphogenesis(GO:0061384) |
0.1 | 0.3 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
0.1 | 0.1 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.1 | 0.2 | GO:0032415 | regulation of sodium:proton antiporter activity(GO:0032415) |
0.0 | 0.5 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.0 | 0.1 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.0 | 0.1 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.0 | 0.0 | GO:0051182 | coenzyme transport(GO:0051182) |
0.0 | 0.8 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
0.0 | 0.4 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.3 | GO:0032328 | alanine transport(GO:0032328) |
0.0 | 0.2 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.0 | 0.1 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
0.0 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.2 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
0.0 | 0.3 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.0 | 0.2 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.0 | 0.3 | GO:0042523 | positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
0.0 | 0.1 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.0 | 0.0 | GO:1902226 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
0.0 | 0.1 | GO:0045601 | regulation of endothelial cell differentiation(GO:0045601) |
0.0 | 0.1 | GO:0035136 | forelimb morphogenesis(GO:0035136) |
0.0 | 0.1 | GO:0035625 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
0.0 | 0.2 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.5 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
0.0 | 1.2 | GO:0018208 | peptidyl-proline modification(GO:0018208) |
0.0 | 0.1 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
0.0 | 0.3 | GO:2001258 | negative regulation of cation channel activity(GO:2001258) |
0.0 | 0.1 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.0 | 0.3 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.2 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.0 | 0.3 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
0.0 | 0.1 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.0 | 0.4 | GO:0010560 | positive regulation of glycoprotein biosynthetic process(GO:0010560) |
0.0 | 0.1 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.0 | 0.2 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.0 | 0.2 | GO:0060947 | cardiac vascular smooth muscle cell differentiation(GO:0060947) |
0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.0 | 0.3 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.0 | 0.1 | GO:0007412 | axon target recognition(GO:0007412) |
0.0 | 0.7 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.0 | 0.6 | GO:0048011 | neurotrophin TRK receptor signaling pathway(GO:0048011) |
0.0 | 0.1 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.0 | 0.1 | GO:0007379 | segment specification(GO:0007379) |
0.0 | 0.5 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.0 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
0.0 | 0.1 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.0 | 0.1 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.0 | 0.2 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.0 | 0.1 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.0 | 0.0 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.0 | 0.0 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.0 | 0.1 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.0 | 0.1 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.0 | 0.1 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
0.0 | 0.1 | GO:0046102 | inosine metabolic process(GO:0046102) inosine biosynthetic process(GO:0046103) |
0.0 | 0.1 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
0.0 | 0.0 | GO:0035608 | protein deglutamylation(GO:0035608) |
0.0 | 0.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.1 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.0 | 0.2 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.0 | 0.2 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.0 | 0.1 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.0 | 0.1 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
0.0 | 0.1 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.0 | 0.2 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.0 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) |
0.0 | 0.2 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.0 | 0.2 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.0 | 0.2 | GO:0007144 | female meiosis I(GO:0007144) |
0.0 | 0.5 | GO:0006855 | drug transmembrane transport(GO:0006855) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.3 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.0 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.0 | 0.1 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.0 | 0.2 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.0 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.0 | 0.1 | GO:0036035 | osteoclast development(GO:0036035) |
0.0 | 0.1 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.0 | 0.2 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.0 | 0.2 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.0 | 0.1 | GO:0007512 | adult heart development(GO:0007512) |
0.0 | 0.1 | GO:0021571 | rhombomere 5 development(GO:0021571) |
0.0 | 0.1 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.0 | 0.1 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
0.0 | 0.1 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.0 | 0.0 | GO:0042520 | tyrosine phosphorylation of Stat4 protein(GO:0042504) regulation of tyrosine phosphorylation of Stat4 protein(GO:0042519) positive regulation of tyrosine phosphorylation of Stat4 protein(GO:0042520) |
0.0 | 0.1 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
0.0 | 0.1 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.0 | 0.1 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.1 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.0 | 0.1 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.0 | 0.1 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.0 | 0.1 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.0 | 0.1 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) |
0.0 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.0 | 0.2 | GO:0097421 | liver regeneration(GO:0097421) |
0.0 | 0.0 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.0 | 0.2 | GO:0070417 | cellular response to cold(GO:0070417) |
0.0 | 0.2 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.0 | 0.1 | GO:0034238 | macrophage fusion(GO:0034238) |
0.0 | 0.6 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.2 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
0.0 | 0.1 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
0.0 | 0.1 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.0 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.0 | 0.1 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.0 | 0.0 | GO:0043396 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) |
0.0 | 0.1 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.0 | 0.1 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
0.0 | 0.1 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.0 | 0.1 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.0 | 0.0 | GO:1903367 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
0.0 | 0.1 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.0 | 0.1 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.0 | 0.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.0 | 0.2 | GO:0033089 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
0.0 | 0.0 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
0.0 | 0.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.1 | GO:0014891 | striated muscle atrophy(GO:0014891) |
0.0 | 0.0 | GO:0002086 | diaphragm contraction(GO:0002086) |
0.0 | 0.3 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.0 | 0.1 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.1 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.0 | 0.1 | GO:0010818 | T cell chemotaxis(GO:0010818) |
0.0 | 0.1 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.0 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.0 | 0.1 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.0 | GO:2000407 | regulation of T cell extravasation(GO:2000407) positive regulation of T cell extravasation(GO:2000409) |
0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 0.4 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.0 | 0.1 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.0 | 0.2 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.1 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.0 | 0.2 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.0 | GO:0060312 | regulation of blood vessel remodeling(GO:0060312) |
0.0 | 0.4 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.0 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.0 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.0 | 0.3 | GO:0061512 | protein localization to cilium(GO:0061512) |
0.0 | 0.0 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.2 | GO:2000404 | regulation of T cell migration(GO:2000404) |
0.0 | 1.0 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
0.0 | 0.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.0 | 0.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.0 | 0.2 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
0.0 | 0.1 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.0 | 0.1 | GO:0035878 | nail development(GO:0035878) |
0.0 | 0.1 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
0.0 | 0.0 | GO:0070253 | somatostatin secretion(GO:0070253) |
0.0 | 0.5 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
0.0 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.0 | 0.1 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.1 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.0 | 0.1 | GO:1901628 | positive regulation of postsynaptic membrane organization(GO:1901628) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
0.0 | 0.1 | GO:0018158 | protein oxidation(GO:0018158) |
0.0 | 0.1 | GO:1903899 | positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
0.0 | 0.1 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
0.0 | 0.3 | GO:0070633 | transepithelial transport(GO:0070633) |
0.0 | 0.1 | GO:0031000 | response to caffeine(GO:0031000) |
0.0 | 0.3 | GO:0035329 | hippo signaling(GO:0035329) |
0.0 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.0 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.0 | 0.1 | GO:0015884 | folic acid transport(GO:0015884) |
0.0 | 1.2 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 0.2 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.0 | 0.0 | GO:0002351 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) |
0.0 | 0.0 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.0 | 0.1 | GO:1901724 | positive regulation of cell proliferation involved in kidney development(GO:1901724) |
0.0 | 0.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.0 | 0.1 | GO:0060914 | heart formation(GO:0060914) |
0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.0 | GO:0060920 | cardiac pacemaker cell differentiation(GO:0060920) |
0.0 | 0.0 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.0 | 0.6 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
0.0 | 0.1 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 0.0 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.0 | 0.3 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.0 | 0.1 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.0 | 0.0 | GO:0044243 | multicellular organism catabolic process(GO:0044243) |
0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.0 | 0.1 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.0 | 0.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.1 | GO:0051639 | actin filament network formation(GO:0051639) |
0.0 | 0.0 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.0 | 0.1 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.0 | 0.0 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
0.0 | 0.0 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.0 | 0.1 | GO:1901341 | positive regulation of store-operated calcium channel activity(GO:1901341) |
0.0 | 0.1 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.0 | 0.1 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.0 | 0.1 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.0 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.2 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.0 | 0.1 | GO:0070294 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
0.0 | 0.0 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.2 | GO:0060292 | long term synaptic depression(GO:0060292) |
0.0 | 0.1 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.0 | 0.1 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.0 | 0.0 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.1 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.1 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 0.0 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
0.0 | 0.0 | GO:0021910 | smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021910) negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.0 | 0.1 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.1 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.0 | 0.0 | GO:0009804 | coumarin metabolic process(GO:0009804) |
0.0 | 0.1 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
0.0 | 0.2 | GO:0034138 | toll-like receptor 3 signaling pathway(GO:0034138) |
0.0 | 0.1 | GO:0002158 | osteoclast proliferation(GO:0002158) |
0.0 | 0.0 | GO:0002468 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
0.0 | 0.2 | GO:0033273 | response to vitamin(GO:0033273) |
0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.0 | 0.1 | GO:0060325 | face morphogenesis(GO:0060325) |
0.0 | 0.0 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
0.0 | 0.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.0 | 0.0 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.0 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.0 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
0.0 | 0.0 | GO:0046618 | drug export(GO:0046618) |
0.0 | 0.1 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.0 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.3 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.0 | 0.0 | GO:0042891 | antibiotic transport(GO:0042891) |
0.0 | 0.1 | GO:0034776 | response to histamine(GO:0034776) cellular response to histamine(GO:0071420) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.0 | GO:0090594 | wound healing involved in inflammatory response(GO:0002246) inflammatory response to wounding(GO:0090594) |
0.0 | 0.0 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.0 | 0.0 | GO:0034650 | cortisol metabolic process(GO:0034650) |
0.0 | 0.0 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.0 | 0.1 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.0 | 0.2 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.0 | 0.1 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
0.0 | 0.3 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.0 | 0.0 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.0 | 0.1 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
0.0 | 0.0 | GO:1990123 | amino acid import into cell(GO:1902837) L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.0 | 0.0 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.0 | 0.1 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.1 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.1 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.0 | 0.1 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.0 | 0.1 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.0 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.0 | 0.1 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.0 | 0.0 | GO:0031635 | adenylate cyclase-inhibiting opioid receptor signaling pathway(GO:0031635) |
0.0 | 0.0 | GO:0042117 | monocyte activation(GO:0042117) |
0.0 | 0.0 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.0 | 0.0 | GO:0072530 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.0 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.0 | 0.0 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
0.0 | 0.2 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.0 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.0 | 0.0 | GO:0001539 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.0 | GO:0009996 | negative regulation of cell fate specification(GO:0009996) |
0.0 | 0.0 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.0 | 0.0 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.0 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.0 | GO:0051586 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.0 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.0 | 1.0 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
0.0 | 0.1 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.0 | 0.0 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.2 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.3 | GO:0009395 | phospholipid catabolic process(GO:0009395) |
0.0 | 0.0 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 0.1 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.0 | 0.1 | GO:0031295 | T cell costimulation(GO:0031295) |
0.0 | 0.0 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.0 | GO:0008355 | olfactory learning(GO:0008355) |
0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.0 | GO:0048478 | replication fork protection(GO:0048478) |
0.0 | 0.0 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.0 | 0.0 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.0 | 0.1 | GO:0090399 | replicative senescence(GO:0090399) |
0.0 | 0.1 | GO:0007207 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.0 | 0.0 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
0.0 | 0.0 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
0.0 | 0.0 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.0 | 0.0 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.0 | 0.7 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
0.0 | 0.0 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.0 | 0.5 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.0 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.0 | 0.0 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
0.0 | 0.0 | GO:0072603 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) regulation of interleukin-13 secretion(GO:2000665) |
0.0 | 0.1 | GO:0015893 | drug transport(GO:0015893) |
0.0 | 0.0 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.0 | 0.0 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.0 | 0.0 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.0 | 0.0 | GO:0072143 | mesangial cell differentiation(GO:0072007) glomerular mesangial cell differentiation(GO:0072008) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) |
0.0 | 0.0 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.0 | GO:0007567 | parturition(GO:0007567) |
0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.8 | GO:0030216 | keratinocyte differentiation(GO:0030216) |
0.0 | 0.0 | GO:0045829 | negative regulation of isotype switching(GO:0045829) negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.0 | 0.0 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.0 | 0.0 | GO:0001711 | endodermal cell fate commitment(GO:0001711) |
0.0 | 0.0 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.0 | 0.0 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.0 | 0.0 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.0 | 0.1 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.0 | 0.0 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.0 | 0.0 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.0 | 0.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.0 | GO:0070970 | interleukin-2 secretion(GO:0070970) |
0.0 | 0.0 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
0.0 | 0.0 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
0.0 | 0.1 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.0 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
0.0 | 0.0 | GO:0060307 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
0.0 | 0.0 | GO:0071224 | cellular response to peptidoglycan(GO:0071224) |
0.0 | 0.0 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.0 | 0.0 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.0 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.0 | GO:0048865 | stem cell fate commitment(GO:0048865) |
0.0 | 0.1 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.0 | 0.0 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.0 | 0.1 | GO:0071569 | protein ufmylation(GO:0071569) |
0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
0.0 | 0.0 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.1 | GO:0009209 | pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 2.1 | GO:0071953 | elastic fiber(GO:0071953) |
0.5 | 1.4 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.4 | 2.2 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.4 | 1.3 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.4 | 3.1 | GO:0005861 | troponin complex(GO:0005861) |
0.3 | 2.0 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.3 | 3.0 | GO:0097542 | ciliary tip(GO:0097542) |
0.3 | 3.8 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.3 | 0.6 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.3 | 0.8 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.3 | 0.8 | GO:0044393 | microspike(GO:0044393) |
0.2 | 2.4 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.2 | 0.7 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.2 | 0.7 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.2 | 0.5 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.1 | 0.6 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 1.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 0.6 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 0.4 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 0.4 | GO:0035838 | growing cell tip(GO:0035838) |
0.1 | 0.4 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 2.6 | GO:0005922 | connexon complex(GO:0005922) |
0.1 | 2.1 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.7 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 0.5 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.1 | 0.6 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 0.4 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.3 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.1 | 0.5 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.1 | 2.2 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.1 | 0.3 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.1 | 0.7 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 0.8 | GO:0036157 | outer dynein arm(GO:0036157) |
0.1 | 0.6 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.1 | 1.5 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 0.8 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 0.4 | GO:1990696 | USH2 complex(GO:1990696) |
0.1 | 0.3 | GO:0070552 | BRISC complex(GO:0070552) |
0.1 | 0.9 | GO:0001527 | microfibril(GO:0001527) |
0.1 | 0.4 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 0.3 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 0.2 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.1 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
0.1 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 0.5 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.1 | 1.3 | GO:0002102 | podosome(GO:0002102) |
0.1 | 0.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.2 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.6 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 4.3 | GO:0005581 | collagen trimer(GO:0005581) |
0.1 | 0.7 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 25.1 | GO:0005667 | transcription factor complex(GO:0005667) |
0.1 | 0.3 | GO:0005638 | lamin filament(GO:0005638) |
0.1 | 4.7 | GO:0005604 | basement membrane(GO:0005604) |
0.1 | 1.0 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 11.4 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.1 | 0.5 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.1 | 0.1 | GO:0032437 | cuticular plate(GO:0032437) |
0.1 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.5 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.1 | 0.4 | GO:0043203 | axon hillock(GO:0043203) |
0.1 | 0.2 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 0.3 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.1 | 0.2 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.1 | 0.2 | GO:0035363 | histone locus body(GO:0035363) |
0.1 | 0.1 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.1 | 0.8 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.1 | 0.6 | GO:0043657 | host(GO:0018995) host cell part(GO:0033643) host cell(GO:0043657) |
0.0 | 2.7 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.0 | 0.2 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.3 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.2 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.0 | 0.1 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.4 | GO:0005858 | axonemal dynein complex(GO:0005858) inner dynein arm(GO:0036156) |
0.0 | 0.4 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.3 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.7 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 1.0 | GO:0008305 | integrin complex(GO:0008305) |
0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 1.0 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.2 | GO:0005818 | astral microtubule(GO:0000235) aster(GO:0005818) |
0.0 | 0.2 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.4 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.3 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.8 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.1 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.0 | 0.1 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.0 | 0.2 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.1 | GO:0005767 | secondary lysosome(GO:0005767) |
0.0 | 0.1 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.0 | 0.2 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.7 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.0 | 1.2 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
0.0 | 0.4 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
0.0 | 0.1 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 0.1 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.1 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 2.1 | GO:0005923 | bicellular tight junction(GO:0005923) |
0.0 | 0.2 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.0 | 0.2 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 0.2 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.0 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.0 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
0.0 | 0.6 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 0.2 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.4 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.0 | 0.1 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.0 | 0.2 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.4 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.1 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.0 | 0.3 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 0.3 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.3 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.1 | GO:0000812 | Swr1 complex(GO:0000812) |
0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.0 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 0.2 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.0 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.0 | 0.8 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.0 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.0 | GO:0042827 | platelet dense granule(GO:0042827) |
0.0 | 0.0 | GO:1990423 | RZZ complex(GO:1990423) |
0.0 | 0.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.0 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 1.4 | GO:0001669 | acrosomal vesicle(GO:0001669) |
0.0 | 0.0 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.0 | 0.0 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.2 | GO:0000800 | lateral element(GO:0000800) |
0.0 | 0.0 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.5 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.1 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.0 | 0.0 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.0 | 0.0 | GO:0030689 | Noc complex(GO:0030689) |
0.0 | 0.1 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.0 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
0.0 | 0.1 | GO:0036128 | CatSper complex(GO:0036128) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.1 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.6 | 1.7 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.5 | 2.8 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.5 | 1.4 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.4 | 2.9 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.3 | 1.7 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.3 | 1.6 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.3 | 1.2 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.3 | 1.2 | GO:0031014 | troponin T binding(GO:0031014) |
0.3 | 1.5 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.3 | 0.9 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.3 | 2.3 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.3 | 1.3 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.3 | 2.4 | GO:0039706 | co-receptor binding(GO:0039706) |
0.3 | 0.8 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.2 | 1.4 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.2 | 2.8 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.2 | 2.3 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.2 | 0.9 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.2 | 2.0 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.2 | 0.9 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.2 | 0.6 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.2 | 1.0 | GO:0071253 | connexin binding(GO:0071253) |
0.2 | 0.6 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.2 | 1.2 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.2 | 2.5 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.2 | 1.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.2 | 2.4 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.2 | 0.6 | GO:0035939 | microsatellite binding(GO:0035939) |
0.2 | 1.3 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.2 | 0.9 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.2 | 0.5 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.2 | 0.5 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.2 | 1.0 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.2 | 0.7 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.2 | 1.4 | GO:0038191 | neuropilin binding(GO:0038191) |
0.2 | 0.2 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
0.2 | 5.7 | GO:0005109 | frizzled binding(GO:0005109) |
0.2 | 0.5 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.2 | 0.3 | GO:0030172 | troponin C binding(GO:0030172) |
0.2 | 0.2 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.2 | 0.6 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 0.6 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.9 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.4 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 2.2 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 0.6 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.4 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.1 | 0.5 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.1 | 0.4 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.5 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.1 | 1.7 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.5 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.1 | 0.4 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.1 | 0.9 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.1 | 0.5 | GO:0009374 | biotin binding(GO:0009374) |
0.1 | 0.5 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 0.4 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.8 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.1 | 0.5 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.1 | 0.3 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.1 | 0.6 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.1 | 2.7 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.1 | 0.2 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.1 | 1.1 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.1 | 2.2 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.3 | GO:0070052 | collagen V binding(GO:0070052) |
0.1 | 0.9 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.1 | 0.3 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.1 | 0.4 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.1 | 1.0 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.1 | 0.3 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.1 | 0.7 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.1 | 0.6 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.1 | 0.2 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.1 | 0.3 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.1 | 0.4 | GO:0005534 | galactose binding(GO:0005534) |
0.1 | 0.5 | GO:0048495 | Roundabout binding(GO:0048495) |
0.1 | 0.3 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.1 | 1.1 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.1 | 0.3 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.1 | 0.3 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 8.7 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.1 | 0.3 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.1 | 0.4 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.7 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.1 | 0.3 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.1 | 0.4 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.1 | 2.7 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.1 | 0.6 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.1 | 0.7 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.1 | 0.9 | GO:0030546 | receptor activator activity(GO:0030546) |
0.1 | 1.2 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
0.1 | 0.2 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.1 | 0.3 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 8.1 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.1 | 0.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.1 | 0.6 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.1 | 1.6 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.1 | 1.6 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.1 | 0.1 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.1 | 1.4 | GO:0051183 | vitamin transporter activity(GO:0051183) |
0.1 | 0.2 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.1 | 0.4 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.1 | 0.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.1 | 1.1 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.3 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.1 | 1.7 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.1 | 0.2 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.1 | 0.2 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.1 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.1 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 0.7 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.1 | 0.2 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.5 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.1 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 0.5 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.1 | 0.3 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 0.2 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.1 | 0.7 | GO:0048038 | quinone binding(GO:0048038) |
0.1 | 0.2 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 0.2 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.1 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 0.1 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.1 | 0.2 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.1 | 0.9 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.1 | 0.1 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.1 | 0.6 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.2 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.1 | 0.5 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.1 | 0.3 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.1 | 0.2 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.1 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.1 | 0.3 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.1 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.2 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.1 | 0.4 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.1 | 0.2 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.1 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 0.6 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.1 | 1.1 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.1 | 0.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.2 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 1.8 | GO:0008009 | chemokine activity(GO:0008009) |
0.0 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 2.2 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
0.0 | 0.4 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.6 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.0 | 0.2 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 2.6 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.4 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.0 | 0.2 | GO:0018812 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) |
0.0 | 0.6 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 12.5 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
0.0 | 0.1 | GO:0080084 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.0 | 0.5 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.2 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.0 | 0.5 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.2 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.1 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
0.0 | 0.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.2 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.1 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.0 | 0.7 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.0 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
0.0 | 0.3 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.0 | 0.0 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 1.1 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.7 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.0 | 0.0 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.0 | 0.5 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.2 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.0 | 0.9 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.0 | 0.1 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.8 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.5 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.2 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.7 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 0.3 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.0 | 1.6 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.0 | 0.2 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.0 | 0.5 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 1.5 | GO:0080131 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) heparan sulfate 2-O-sulfotransferase activity(GO:0004394) HNK-1 sulfotransferase activity(GO:0016232) heparan sulfate 6-O-sulfotransferase activity(GO:0017095) trans-9R,10R-dihydrodiolphenanthrene sulfotransferase activity(GO:0018721) 1-phenanthrol sulfotransferase activity(GO:0018722) 3-phenanthrol sulfotransferase activity(GO:0018723) 4-phenanthrol sulfotransferase activity(GO:0018724) trans-3,4-dihydrodiolphenanthrene sulfotransferase activity(GO:0018725) 9-phenanthrol sulfotransferase activity(GO:0018726) 2-phenanthrol sulfotransferase activity(GO:0018727) phenanthrol sulfotransferase activity(GO:0019111) 1-hydroxypyrene sulfotransferase activity(GO:0034930) proteoglycan sulfotransferase activity(GO:0050698) cholesterol sulfotransferase activity(GO:0051922) hydroxyjasmonate sulfotransferase activity(GO:0080131) |
0.0 | 0.1 | GO:0004027 | alcohol sulfotransferase activity(GO:0004027) |
0.0 | 0.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.0 | 0.1 | GO:0099604 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.1 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.0 | 0.1 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.0 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.0 | 0.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.0 | 0.3 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.4 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.0 | 0.1 | GO:0022821 | potassium ion antiporter activity(GO:0022821) |
0.0 | 0.2 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.1 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.1 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) xenobiotic transporter activity(GO:0042910) |
0.0 | 0.3 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.0 | 0.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.2 | GO:0016918 | retinal binding(GO:0016918) |
0.0 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.0 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.0 | 0.0 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 0.3 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.1 | GO:0016775 | phosphotransferase activity, nitrogenous group as acceptor(GO:0016775) |
0.0 | 0.8 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.0 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.1 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.0 | 0.0 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.0 | 0.3 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.0 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.0 | 0.1 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.1 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.0 | 0.1 | GO:0036122 | BMP binding(GO:0036122) |
0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.3 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.0 | 0.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.1 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.0 | 0.6 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.1 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.3 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.0 | 0.1 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.0 | 0.1 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.0 | 0.2 | GO:0008758 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
0.0 | 0.1 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.0 | GO:0019841 | retinol binding(GO:0019841) |
0.0 | 0.3 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.1 | GO:0016725 | oxidoreductase activity, acting on CH or CH2 groups(GO:0016725) |
0.0 | 0.0 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.1 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.3 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.0 | 0.1 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.0 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.0 | 0.1 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.0 | 0.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.1 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.8 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.0 | 0.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.1 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.2 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 0.1 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
0.0 | 0.1 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.5 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.0 | GO:0005148 | prolactin receptor binding(GO:0005148) |
0.0 | 0.4 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
0.0 | 0.2 | GO:0004954 | icosanoid receptor activity(GO:0004953) prostanoid receptor activity(GO:0004954) |
0.0 | 0.1 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.0 | 0.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.0 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.0 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.0 | 0.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 1.1 | GO:0005179 | hormone activity(GO:0005179) |
0.0 | 0.0 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.0 | 0.5 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.0 | 0.1 | GO:0004083 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) |
0.0 | 0.0 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.0 | 0.0 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.0 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
0.0 | 0.0 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.0 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.1 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.0 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.1 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.0 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.0 | 0.3 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.0 | 0.0 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.0 | 0.0 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.0 | GO:0035240 | dopamine binding(GO:0035240) |
0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.0 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.0 | 0.2 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
0.0 | 0.0 | GO:0035671 | enone reductase activity(GO:0035671) |
0.0 | 0.0 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.0 | 0.0 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.0 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
0.0 | 0.0 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.0 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.1 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.0 | 0.0 | GO:0038132 | neuregulin binding(GO:0038132) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.3 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.3 | 1.0 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.2 | 5.8 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.2 | 0.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.2 | 7.0 | NABA COLLAGENS | Genes encoding collagen proteins |
0.2 | 3.1 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 4.4 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.1 | 3.2 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.1 | 0.1 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 0.4 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.1 | 0.8 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 1.4 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 0.6 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 1.2 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.1 | 13.9 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.1 | 0.8 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 0.8 | PID IGF1 PATHWAY | IGF1 pathway |
0.1 | 1.5 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 2.5 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.1 | 3.0 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.1 | 1.6 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 2.9 | PID BMP PATHWAY | BMP receptor signaling |
0.1 | 1.0 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 1.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 0.6 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.1 | 2.4 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 4.5 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.1 | 0.7 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.1 | 1.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.1 | 1.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.1 | 0.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.1 | 1.0 | PID FGF PATHWAY | FGF signaling pathway |
0.1 | 0.2 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.4 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.2 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.0 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 1.6 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 1.7 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.6 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.3 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.8 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.5 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.9 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.5 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.8 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 8.3 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.4 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 1.4 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.8 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 1.0 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.4 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 5.2 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.0 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.0 | 0.0 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.6 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 0.5 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.4 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 0.2 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.2 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.2 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.2 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.0 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.1 | PID ALK1 PATHWAY | ALK1 signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 3.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.2 | 2.3 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.2 | 1.6 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.2 | 3.6 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.2 | 1.6 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.2 | 4.1 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 3.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 0.4 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.1 | 7.4 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.1 | 1.4 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.1 | 1.9 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 0.2 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.1 | 0.7 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
0.1 | 1.0 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 2.3 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.1 | 2.1 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
0.1 | 1.0 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.1 | 1.7 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.1 | 0.6 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.1 | 1.9 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 1.0 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.1 | 0.8 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.1 | 1.1 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.1 | 4.7 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.1 | 0.1 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.1 | 0.7 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.1 | 0.6 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.1 | 0.6 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.1 | 0.6 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.1 | 0.2 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.1 | 4.4 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.6 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.0 | 0.3 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.0 | 0.5 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.0 | 0.6 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.6 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 0.4 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.1 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.0 | 0.4 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.5 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.4 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.3 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.4 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 1.4 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.0 | 0.0 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.2 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 0.1 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.0 | 0.3 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.1 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.0 | 0.0 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.2 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.4 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.0 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
0.0 | 0.5 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.0 | 0.3 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.3 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 0.1 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.0 | 0.5 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.0 | 0.1 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 0.0 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.0 | 0.1 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.0 | 0.1 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.8 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
0.0 | 0.4 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.2 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.1 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 0.1 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.7 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.3 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.2 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.0 | 0.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.1 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.0 | 0.0 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.0 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.2 | REACTOME DNA STRAND ELONGATION | Genes involved in DNA strand elongation |
0.0 | 0.4 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
0.0 | 0.5 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.0 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.1 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.0 | 0.0 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 0.1 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 0.1 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.0 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |