| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Mef2b
|
ENSMUSG00000079033.3 | myocyte enhancer factor 2B |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr8_70150622_70150773 | Mef2b | 2081 | 0.150604 | -0.31 | 1.7e-02 | Click! |
| chr8_70158565_70159188 | Mef2b | 6095 | 0.091403 | -0.23 | 8.3e-02 | Click! |
| chr8_70159313_70159464 | Mef2b | 6607 | 0.090043 | -0.18 | 1.7e-01 | Click! |
| chr8_70158326_70158547 | Mef2b | 5655 | 0.092853 | -0.14 | 2.7e-01 | Click! |
| chr8_70147386_70147537 | Mef2b | 5317 | 0.089532 | -0.13 | 3.4e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr2_76805862_76806506 | 34.80 |
Ttn |
titin |
20358 |
0.22 |
| chr10_53338934_53339122 | 30.95 |
Pln |
phospholamban |
1323 |
0.32 |
| chr9_101198368_101199080 | 29.70 |
Ppp2r3a |
protein phosphatase 2, regulatory subunit B'', alpha |
127 |
0.94 |
| chr10_33083961_33084356 | 28.80 |
Trdn |
triadin |
597 |
0.81 |
| chr7_128205575_128206445 | 28.29 |
Cox6a2 |
cytochrome c oxidase subunit 6A2 |
377 |
0.67 |
| chr16_4522019_4522667 | 27.21 |
Srl |
sarcalumenin |
720 |
0.62 |
| chr12_40198308_40199492 | 26.19 |
Gm17056 |
predicted gene 17056 |
244 |
0.64 |
| chrX_157700177_157700800 | 24.74 |
Smpx |
small muscle protein, X-linked |
1228 |
0.39 |
| chr18_4995747_4996610 | 23.44 |
Svil |
supervillin |
1242 |
0.62 |
| chr4_140580764_140581885 | 23.24 |
Arhgef10l |
Rho guanine nucleotide exchange factor (GEF) 10-like |
478 |
0.83 |
| chr9_110765100_110765787 | 22.29 |
Myl3 |
myosin, light polypeptide 3 |
418 |
0.74 |
| chr17_81735907_81736099 | 22.01 |
Slc8a1 |
solute carrier family 8 (sodium/calcium exchanger), member 1 |
2374 |
0.4 |
| chr17_71019478_71020561 | 21.73 |
Myom1 |
myomesin 1 |
428 |
0.76 |
| chr13_113662906_113663717 | 21.70 |
Hspb3 |
heat shock protein 3 |
365 |
0.85 |
| chr1_131232374_131233673 | 21.59 |
Rassf5 |
Ras association (RalGDS/AF-6) domain family member 5 |
552 |
0.67 |
| chr8_48511120_48511677 | 21.49 |
Tenm3 |
teneurin transmembrane protein 3 |
43915 |
0.19 |
| chrX_100740800_100741075 | 21.48 |
Gm14866 |
predicted gene 14866 |
8 |
0.66 |
| chr8_109105027_109105682 | 21.31 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
30109 |
0.23 |
| chr17_81737002_81738450 | 20.93 |
Slc8a1 |
solute carrier family 8 (sodium/calcium exchanger), member 1 |
651 |
0.81 |
| chr7_19411651_19412289 | 20.32 |
Ckm |
creatine kinase, muscle |
907 |
0.3 |
| chr10_3368375_3368998 | 20.05 |
Ppp1r14c |
protein phosphatase 1, regulatory inhibitor subunit 14C |
2142 |
0.36 |
| chr13_113661831_113661982 | 19.90 |
Hspb3 |
heat shock protein 3 |
1770 |
0.32 |
| chr17_10311671_10311978 | 19.89 |
Qk |
quaking |
7537 |
0.24 |
| chr5_23251641_23252335 | 19.15 |
Gm28022 |
predicted gene, 28022 |
27923 |
0.16 |
| chr9_24766430_24766801 | 19.01 |
Tbx20 |
T-box 20 |
3065 |
0.25 |
| chrX_95477898_95478308 | 18.83 |
Asb12 |
ankyrin repeat and SOCS box-containing 12 |
26 |
0.98 |
| chr16_85268964_85269179 | 18.83 |
App |
amyloid beta (A4) precursor protein |
95305 |
0.07 |
| chr8_48380171_48380442 | 18.75 |
Tenm3 |
teneurin transmembrane protein 3 |
80207 |
0.1 |
| chr9_85090484_85090658 | 18.54 |
Gm28070 |
predicted gene 28070 |
14194 |
0.25 |
| chr2_155611238_155612364 | 18.09 |
Myh7b |
myosin, heavy chain 7B, cardiac muscle, beta |
589 |
0.53 |
| chr12_34527603_34529023 | 17.93 |
Hdac9 |
histone deacetylase 9 |
9 |
0.99 |
| chr12_73846939_73847247 | 17.78 |
Gm15283 |
predicted gene 15283 |
22519 |
0.15 |
| chr12_86360988_86362126 | 17.73 |
Esrrb |
estrogen related receptor, beta |
440 |
0.84 |
| chr17_63317765_63318290 | 17.72 |
4930405O22Rik |
RIKEN cDNA 4930405O22 gene |
5054 |
0.23 |
| chr6_147506132_147507107 | 17.51 |
4933406L23Rik |
RIKEN cDNA 4933406L23 gene |
24690 |
0.17 |
| chr10_5068684_5068926 | 17.38 |
Syne1 |
spectrin repeat containing, nuclear envelope 1 |
108 |
0.81 |
| chr1_178486812_178487110 | 17.38 |
Efcab2 |
EF-hand calcium binding domain 2 |
38177 |
0.14 |
| chr19_53697235_53698547 | 17.16 |
Rbm20 |
RNA binding motif protein 20 |
20585 |
0.17 |
| chr13_103097993_103098207 | 16.93 |
Mast4 |
microtubule associated serine/threonine kinase family member 4 |
1255 |
0.59 |
| chr2_90964960_90965890 | 16.86 |
Celf1 |
CUGBP, Elav-like family member 1 |
333 |
0.83 |
| chr4_134315034_134315974 | 16.82 |
Trim63 |
tripartite motif-containing 63 |
292 |
0.83 |
| chr13_12033129_12034063 | 16.81 |
Gm47493 |
predicted gene, 47493 |
18459 |
0.21 |
| chr13_44228598_44229389 | 16.69 |
Gm47781 |
predicted gene, 47781 |
3405 |
0.22 |
| chr17_48430526_48430734 | 16.54 |
Apobec2 |
apolipoprotein B mRNA editing enzyme, catalytic polypeptide 2 |
1988 |
0.21 |
| chr9_67428325_67429235 | 16.45 |
Tln2 |
talin 2 |
23 |
0.98 |
| chr9_91101784_91102289 | 16.21 |
Gm5620 |
predicted gene 5620 |
4887 |
0.24 |
| chr12_34517205_34517468 | 15.92 |
Hdac9 |
histone deacetylase 9 |
10968 |
0.3 |
| chr5_113137394_113137718 | 15.84 |
2900026A02Rik |
RIKEN cDNA 2900026A02 gene |
430 |
0.72 |
| chr5_29363493_29363769 | 15.79 |
Lmbr1 |
limb region 1 |
2541 |
0.25 |
| chr10_69529318_69529556 | 15.43 |
Ank3 |
ankyrin 3, epithelial |
4335 |
0.28 |
| chr9_67670151_67670404 | 15.37 |
Gm47110 |
predicted gene, 47110 |
29904 |
0.15 |
| chr2_140202844_140203194 | 15.15 |
Ndufaf5 |
NADH:ubiquinone oxidoreductase complex assembly factor 5 |
31989 |
0.15 |
| chr3_123115774_123116765 | 14.97 |
Synpo2 |
synaptopodin 2 |
783 |
0.59 |
| chr3_144759885_144761021 | 14.78 |
Clca3a1 |
chloride channel accessory 3A1 |
388 |
0.78 |
| chr10_58394969_58395625 | 14.78 |
Lims1 |
LIM and senescent cell antigen-like domains 1 |
909 |
0.6 |
| chr13_30345563_30346006 | 14.76 |
Agtr1a |
angiotensin II receptor, type 1a |
243 |
0.93 |
| chr9_107596489_107597170 | 14.71 |
Lsmem2 |
leucine-rich single-pass membrane protein 2 |
246 |
0.73 |
| chr1_75374828_75376320 | 14.35 |
Speg |
SPEG complex locus |
277 |
0.67 |
| chr9_99682029_99682717 | 14.34 |
Gm16004 |
predicted gene 16004 |
26026 |
0.13 |
| chr5_88935530_88935799 | 14.31 |
Slc4a4 |
solute carrier family 4 (anion exchanger), member 4 |
1092 |
0.62 |
| chr14_55575537_55576846 | 14.29 |
Gm15932 |
predicted gene 15932 |
200 |
0.69 |
| chr11_77800451_77802048 | 14.25 |
Myo18a |
myosin XVIIIA |
49 |
0.97 |
| chr10_63203190_63203876 | 14.16 |
Mypn |
myopalladin |
419 |
0.79 |
| chr7_126248023_126249285 | 14.11 |
Sbk1 |
SH3-binding kinase 1 |
208 |
0.69 |
| chr10_37988715_37989307 | 14.10 |
Gm24710 |
predicted gene, 24710 |
57331 |
0.15 |
| chr15_40665481_40666389 | 14.08 |
Zfpm2 |
zinc finger protein, multitype 2 |
945 |
0.71 |
| chr14_32683140_32683919 | 14.05 |
3425401B19Rik |
RIKEN cDNA 3425401B19 gene |
1743 |
0.31 |
| chr11_70657209_70658413 | 13.91 |
Eno3 |
enolase 3, beta muscle |
15 |
0.91 |
| chr3_116801528_116801893 | 13.86 |
Agl |
amylo-1,6-glucosidase, 4-alpha-glucanotransferase |
5707 |
0.14 |
| chr16_18229406_18230609 | 13.85 |
Zdhhc8 |
zinc finger, DHHC domain containing 8 |
5129 |
0.08 |
| chr11_120647315_120648501 | 13.60 |
Myadml2 |
myeloid-associated differentiation marker-like 2 |
202 |
0.49 |
| chr6_55132964_55133311 | 13.49 |
Crhr2 |
corticotropin releasing hormone receptor 2 |
121 |
0.96 |
| chrX_59585692_59586195 | 13.33 |
Fgf13 |
fibroblast growth factor 13 |
17872 |
0.27 |
| chr3_127914005_127914684 | 13.32 |
9830132P13Rik |
RIKEN cDNA 9830132P13 gene |
1828 |
0.27 |
| chr14_105589341_105590435 | 13.31 |
9330188P03Rik |
RIKEN cDNA 9330188P03 gene |
169 |
0.95 |
| chr5_135887594_135889390 | 13.27 |
Hspb1 |
heat shock protein 1 |
474 |
0.68 |
| chr8_64871497_64872077 | 13.23 |
Klhl2 |
kelch-like 2, Mayven |
21770 |
0.12 |
| chr15_25940423_25941291 | 13.17 |
Retreg1 |
reticulophagy regulator 1 |
30 |
0.98 |
| chr14_110618529_110619008 | 13.11 |
Gm25670 |
predicted gene, 25670 |
21046 |
0.22 |
| chrX_164437901_164438208 | 13.06 |
Asb11 |
ankyrin repeat and SOCS box-containing 11 |
4 |
0.97 |
| chr14_101886478_101886651 | 13.03 |
Lmo7 |
LIM domain only 7 |
2445 |
0.4 |
| chr1_176124274_176124802 | 12.88 |
Gm37916 |
predicted gene, 37916 |
54663 |
0.12 |
| chr14_55004102_55004452 | 12.87 |
Myh7 |
myosin, heavy polypeptide 7, cardiac muscle, beta |
9651 |
0.07 |
| chr16_22564404_22564629 | 12.80 |
Gm15651 |
predicted gene 15651 |
15963 |
0.11 |
| chr7_69891593_69891960 | 12.79 |
Gm44690 |
predicted gene 44690 |
7416 |
0.25 |
| chr7_65097741_65098112 | 12.76 |
Fam189a1 |
family with sequence similarity 189, member A1 |
58490 |
0.12 |
| chr12_99544472_99544924 | 12.68 |
Foxn3 |
forkhead box N3 |
18810 |
0.13 |
| chr16_89830219_89830776 | 12.68 |
Tiam1 |
T cell lymphoma invasion and metastasis 1 |
7378 |
0.3 |
| chr5_96630053_96630403 | 12.67 |
Fras1 |
Fraser extracellular matrix complex subunit 1 |
109 |
0.98 |
| chr5_100214874_100215472 | 12.66 |
2310034O05Rik |
RIKEN cDNA 2310034O05 gene |
4465 |
0.21 |
| chr9_24763396_24763680 | 12.65 |
Tbx20 |
T-box 20 |
6142 |
0.2 |
| chr17_69181287_69182092 | 12.64 |
Epb41l3 |
erythrocyte membrane protein band 4.1 like 3 |
24831 |
0.23 |
| chr2_169520418_169520706 | 12.59 |
Gm14249 |
predicted gene 14249 |
39945 |
0.16 |
| chr10_119979578_119980292 | 12.58 |
Grip1 |
glutamate receptor interacting protein 1 |
12785 |
0.25 |
| chr13_113657225_113657681 | 12.56 |
Hspb3 |
heat shock protein 3 |
6223 |
0.18 |
| chr12_24963377_24963763 | 12.56 |
Kidins220 |
kinase D-interacting substrate 220 |
11355 |
0.18 |
| chr10_123360436_123360805 | 12.50 |
Gm22958 |
predicted gene, 22958 |
71946 |
0.1 |
| chr19_24046811_24047201 | 12.44 |
Fam189a2 |
family with sequence similarity 189, member A2 |
15987 |
0.16 |
| chr15_25942778_25943455 | 12.44 |
Retreg1 |
reticulophagy regulator 1 |
437 |
0.83 |
| chr18_77742321_77742943 | 12.41 |
A330094K24Rik |
RIKEN cDNA A330094K24 gene |
9893 |
0.13 |
| chr1_21963069_21963530 | 12.27 |
Kcnq5 |
potassium voltage-gated channel, subfamily Q, member 5 |
1357 |
0.56 |
| chr3_123324467_123324631 | 12.26 |
Sec24d |
Sec24 related gene family, member D (S. cerevisiae) |
10277 |
0.18 |
| chr14_36918744_36919600 | 12.22 |
Ccser2 |
coiled-coil serine rich 2 |
161 |
0.97 |
| chr8_33925892_33926043 | 12.09 |
Rbpms |
RNA binding protein gene with multiple splicing |
3309 |
0.23 |
| chr9_67046002_67046745 | 11.97 |
Tpm1 |
tropomyosin 1, alpha |
2411 |
0.27 |
| chr16_59516995_59517715 | 11.94 |
Crybg3 |
beta-gamma crystallin domain containing 3 |
8259 |
0.18 |
| chr2_70901174_70901930 | 11.90 |
Gm13632 |
predicted gene 13632 |
23723 |
0.18 |
| chr12_107930390_107931544 | 11.89 |
Bcl11b |
B cell leukemia/lymphoma 11B |
72447 |
0.11 |
| chr3_60576768_60577034 | 11.87 |
Mbnl1 |
muscleblind like splicing factor 1 |
18740 |
0.19 |
| chr3_136700532_136700930 | 11.86 |
Gm42822 |
predicted gene 42822 |
480 |
0.84 |
| chr19_11969491_11969880 | 11.80 |
Osbp |
oxysterol binding protein |
3744 |
0.12 |
| chr15_55897322_55897847 | 11.78 |
Sntb1 |
syntrophin, basic 1 |
8726 |
0.18 |
| chr6_85371815_85372854 | 11.74 |
Rab11fip5 |
RAB11 family interacting protein 5 (class I) |
2230 |
0.24 |
| chr13_12614576_12614839 | 11.72 |
Gpr137b-ps |
G protein-coupled receptor 137B, pseudogene |
3118 |
0.17 |
| chr2_163284998_163285464 | 11.70 |
Tox2 |
TOX high mobility group box family member 2 |
35147 |
0.15 |
| chr18_38095872_38096634 | 11.68 |
Gm30093 |
predicted gene, 30093 |
72724 |
0.06 |
| chr16_24347714_24348435 | 11.57 |
Gm41434 |
predicted gene, 41434 |
22158 |
0.16 |
| chr15_66559076_66559686 | 11.57 |
Tmem71 |
transmembrane protein 71 |
1722 |
0.39 |
| chr1_83345575_83345998 | 11.57 |
Gm37517 |
predicted gene, 37517 |
13200 |
0.18 |
| chr15_93698224_93698894 | 11.56 |
Gm41386 |
predicted gene, 41386 |
14210 |
0.19 |
| chr6_71261026_71261496 | 11.53 |
Smyd1 |
SET and MYND domain containing 1 |
971 |
0.38 |
| chr8_57333046_57334560 | 11.53 |
Gm34030 |
predicted gene, 34030 |
584 |
0.59 |
| chr2_79511072_79511365 | 11.49 |
Cerkl |
ceramide kinase-like |
54433 |
0.13 |
| chr4_109147263_109147688 | 11.45 |
Osbpl9 |
oxysterol binding protein-like 9 |
9135 |
0.22 |
| chr2_94122572_94123070 | 11.41 |
Hsd17b12 |
hydroxysteroid (17-beta) dehydrogenase 12 |
35072 |
0.14 |
| chr9_29595031_29595329 | 11.41 |
Gm15521 |
predicted gene 15521 |
2670 |
0.43 |
| chr11_102217551_102219283 | 11.41 |
Hdac5 |
histone deacetylase 5 |
511 |
0.62 |
| chr5_51412320_51412698 | 11.40 |
Gm42614 |
predicted gene 42614 |
71796 |
0.1 |
| chr11_65365883_65366034 | 11.29 |
Gm12295 |
predicted gene 12295 |
160 |
0.97 |
| chr5_122499512_122499696 | 11.26 |
Atp2a2 |
ATPase, Ca++ transporting, cardiac muscle, slow twitch 2 |
2013 |
0.17 |
| chr12_99356575_99356926 | 11.13 |
Foxn3 |
forkhead box N3 |
269 |
0.87 |
| chr13_44788792_44789241 | 11.12 |
Gm22213 |
predicted gene, 22213 |
49267 |
0.14 |
| chr9_75777739_75778295 | 11.09 |
Bmp5 |
bone morphogenetic protein 5 |
2653 |
0.3 |
| chr6_116072470_116073176 | 10.99 |
Tmcc1 |
transmembrane and coiled coil domains 1 |
333 |
0.88 |
| chr1_34326350_34326979 | 10.93 |
Gm37958 |
predicted gene, 37958 |
3643 |
0.16 |
| chr9_47650354_47650592 | 10.92 |
Cadm1 |
cell adhesion molecule 1 |
120100 |
0.05 |
| chr18_65348348_65348930 | 10.90 |
Gm41757 |
predicted gene, 41757 |
518 |
0.56 |
| chr1_21829558_21830565 | 10.86 |
Gm38243 |
predicted gene, 38243 |
10453 |
0.24 |
| chr19_18648291_18648697 | 10.86 |
Nmrk1 |
nicotinamide riboside kinase 1 |
16496 |
0.15 |
| chr8_24215728_24216031 | 10.84 |
Gm45163 |
predicted gene 45163 |
4631 |
0.28 |
| chr4_57846607_57847875 | 10.79 |
Pakap |
paralemmin A kinase anchor protein |
1993 |
0.34 |
| chr9_25201672_25202276 | 10.76 |
Gm8031 |
predicted gene 8031 |
27095 |
0.14 |
| chr3_69438903_69439406 | 10.74 |
Gm17213 |
predicted gene 17213 |
6786 |
0.23 |
| chr1_43159364_43159948 | 10.68 |
Fhl2 |
four and a half LIM domains 2 |
4305 |
0.2 |
| chr4_32430676_32431345 | 10.65 |
Bach2 |
BTB and CNC homology, basic leucine zipper transcription factor 2 |
13575 |
0.26 |
| chr12_97455677_97456192 | 10.62 |
Gm23558 |
predicted gene, 23558 |
84821 |
0.09 |
| chr2_116095997_116096383 | 10.61 |
2810405F15Rik |
RIKEN cDNA 2810405F15 gene |
20094 |
0.17 |
| chr10_81194028_81195075 | 10.59 |
Atcayos |
ataxia, cerebellar, Cayman type, opposite strand |
58 |
0.92 |
| chr6_145182603_145182959 | 10.58 |
Gm15543 |
predicted gene 15543 |
506 |
0.68 |
| chr3_109476510_109476690 | 10.57 |
Vav3 |
vav 3 oncogene |
18184 |
0.28 |
| chr14_87745657_87745886 | 10.57 |
Gm48922 |
predicted gene, 48922 |
108301 |
0.07 |
| chr3_155055105_155055726 | 10.54 |
Tnni3k |
TNNI3 interacting kinase |
8 |
0.98 |
| chr2_174343518_174344642 | 10.52 |
Gnas |
GNAS (guanine nucleotide binding protein, alpha stimulating) complex locus |
232 |
0.9 |
| chr4_134319201_134319375 | 10.48 |
Trim63 |
tripartite motif-containing 63 |
700 |
0.52 |
| chr5_5211247_5211442 | 10.47 |
Cdk14 |
cyclin-dependent kinase 14 |
15989 |
0.18 |
| chr10_95970803_95971600 | 10.43 |
Eea1 |
early endosome antigen 1 |
30444 |
0.15 |
| chr4_151851614_151852005 | 10.42 |
Camta1 |
calmodulin binding transcription activator 1 |
9841 |
0.22 |
| chr1_166126774_166128045 | 10.40 |
Dusp27 |
dual specificity phosphatase 27 (putative) |
487 |
0.76 |
| chr14_101532225_101532447 | 10.38 |
Tbc1d4 |
TBC1 domain family, member 4 |
25010 |
0.19 |
| chr16_85038261_85038430 | 10.36 |
App |
amyloid beta (A4) precursor protein |
10720 |
0.17 |
| chr15_66559688_66560010 | 10.27 |
Tmem71 |
transmembrane protein 71 |
1254 |
0.49 |
| chr4_151096574_151097326 | 10.27 |
Gm13090 |
predicted gene 13090 |
7380 |
0.18 |
| chr5_101040433_101040707 | 10.24 |
Gm36793 |
predicted gene, 36793 |
126863 |
0.05 |
| chr13_47649673_47650328 | 10.12 |
4930471G24Rik |
RIKEN cDNA 4930471G24 gene |
17550 |
0.28 |
| chr2_24556634_24556885 | 10.10 |
Gm13417 |
predicted gene 13417 |
9938 |
0.14 |
| chr12_73948429_73948713 | 10.09 |
Gm15283 |
predicted gene 15283 |
1214 |
0.37 |
| chr11_111066211_111067013 | 10.08 |
Kcnj2 |
potassium inwardly-rectifying channel, subfamily J, member 2 |
448 |
0.89 |
| chr13_88828286_88828886 | 10.04 |
Edil3 |
EGF-like repeats and discoidin I-like domains 3 |
6944 |
0.33 |
| chr15_41076262_41076625 | 10.04 |
Gm49524 |
predicted gene, 49524 |
78483 |
0.1 |
| chr6_115586482_115586733 | 10.03 |
Mkrn2os |
makorin, ring finger protein 2, opposite strand |
5942 |
0.12 |
| chr15_37733930_37734441 | 10.00 |
Gm49397 |
predicted gene, 49397 |
150 |
0.54 |
| chr15_37617143_37617487 | 9.98 |
Gm24833 |
predicted gene, 24833 |
13781 |
0.19 |
| chr9_31980332_31980739 | 9.93 |
Gm47465 |
predicted gene, 47465 |
24925 |
0.13 |
| chr18_65133306_65133475 | 9.92 |
Nedd4l |
neural precursor cell expressed, developmentally down-regulated gene 4-like |
10168 |
0.24 |
| chr1_33363022_33363265 | 9.92 |
Gm7933 |
predicted gene 7933 |
8188 |
0.2 |
| chr15_40656769_40657228 | 9.91 |
Zfpm2 |
zinc finger protein, multitype 2 |
1647 |
0.51 |
| chr18_69414486_69414889 | 9.82 |
Tcf4 |
transcription factor 4 |
1210 |
0.61 |
| chr11_7056096_7056584 | 9.81 |
Adcy1 |
adenylate cyclase 1 |
7149 |
0.27 |
| chr8_68882551_68883304 | 9.78 |
Lpl |
lipoprotein lipase |
2270 |
0.33 |
| chr12_94066455_94066915 | 9.75 |
Gm18749 |
predicted gene, 18749 |
6984 |
0.29 |
| chr5_66323220_66323858 | 9.74 |
Gm43790 |
predicted gene 43790 |
522 |
0.71 |
| chr2_80036063_80037075 | 9.72 |
Pde1a |
phosphodiesterase 1A, calmodulin-dependent |
2460 |
0.41 |
| chr17_79451074_79451933 | 9.68 |
Cdc42ep3 |
CDC42 effector protein (Rho GTPase binding) 3 |
96412 |
0.07 |
| chr19_50374825_50375211 | 9.66 |
Sorcs1 |
sortilin-related VPS10 domain containing receptor 1 |
122340 |
0.06 |
| chr1_187999916_188000681 | 9.62 |
Esrrg |
estrogen-related receptor gamma |
2430 |
0.35 |
| chr8_45901486_45902198 | 9.60 |
Pdlim3 |
PDZ and LIM domain 3 |
13190 |
0.12 |
| chr10_13974281_13974896 | 9.56 |
Hivep2 |
human immunodeficiency virus type I enhancer binding protein 2 |
7564 |
0.2 |
| chr8_61901693_61901844 | 9.55 |
Palld |
palladin, cytoskeletal associated protein |
901 |
0.56 |
| chr1_131228421_131229280 | 9.55 |
Rassf5 |
Ras association (RalGDS/AF-6) domain family member 5 |
4725 |
0.14 |
| chr7_76410464_76410976 | 9.53 |
Agbl1 |
ATP/GTP binding protein-like 1 |
342 |
0.94 |
| chr10_117042261_117042774 | 9.50 |
Gm10747 |
predicted gene 10747 |
1229 |
0.34 |
| chr17_81740504_81740752 | 9.50 |
Slc8a1 |
solute carrier family 8 (sodium/calcium exchanger), member 1 |
2251 |
0.41 |
| chr3_51788525_51789785 | 9.48 |
Maml3 |
mastermind like transcriptional coactivator 3 |
7381 |
0.13 |
| chr11_111068351_111069422 | 9.48 |
Kcnj2 |
potassium inwardly-rectifying channel, subfamily J, member 2 |
2722 |
0.38 |
| chr5_117546764_117547263 | 9.45 |
Gm42550 |
predicted gene 42550 |
26314 |
0.21 |
| chr7_38224544_38225145 | 9.39 |
Plekhf1 |
pleckstrin homology domain containing, family F (with FYVE domain) member 1 |
3172 |
0.18 |
| chr5_75975002_75975424 | 9.38 |
Kdr |
kinase insert domain protein receptor |
3245 |
0.23 |
| chr17_10304085_10304696 | 9.37 |
Qk |
quaking |
14971 |
0.23 |
| chr10_80940549_80941081 | 9.36 |
Gadd45b |
growth arrest and DNA-damage-inducible 45 beta |
10003 |
0.09 |
| chr2_68377869_68378115 | 9.35 |
Stk39 |
serine/threonine kinase 39 |
8689 |
0.27 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 9.0 | 27.0 | GO:0007525 | somatic muscle development(GO:0007525) |
| 8.4 | 16.9 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
| 8.1 | 24.2 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
| 6.9 | 20.6 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 6.8 | 13.7 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
| 6.8 | 34.2 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
| 5.9 | 11.9 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 5.3 | 15.8 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 5.0 | 15.0 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 4.7 | 14.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 4.4 | 13.3 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
| 4.4 | 13.1 | GO:0030421 | defecation(GO:0030421) |
| 3.1 | 18.8 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 3.0 | 9.1 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
| 2.9 | 20.5 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 2.8 | 8.5 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 2.8 | 8.4 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 2.8 | 8.3 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
| 2.7 | 8.2 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 2.6 | 13.2 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
| 2.5 | 10.1 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 2.5 | 14.8 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
| 2.5 | 7.4 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 2.4 | 21.6 | GO:0086069 | bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 2.4 | 9.5 | GO:0032345 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 2.4 | 2.4 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 2.3 | 7.0 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 2.3 | 7.0 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 2.3 | 9.1 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
| 2.2 | 6.7 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 2.2 | 6.5 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 2.1 | 4.2 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
| 2.0 | 4.1 | GO:0010535 | positive regulation of activation of JAK2 kinase activity(GO:0010535) |
| 2.0 | 6.1 | GO:0061356 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
| 2.0 | 12.1 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
| 1.9 | 7.8 | GO:0030035 | microspike assembly(GO:0030035) |
| 1.9 | 11.2 | GO:1990000 | amyloid fibril formation(GO:1990000) |
| 1.8 | 7.1 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 1.8 | 1.8 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 1.7 | 3.4 | GO:2000566 | positive regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000566) |
| 1.7 | 6.8 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 1.7 | 5.1 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 1.6 | 9.5 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 1.5 | 1.5 | GO:0042520 | positive regulation of tyrosine phosphorylation of Stat4 protein(GO:0042520) |
| 1.4 | 4.3 | GO:0021564 | vagus nerve development(GO:0021564) |
| 1.4 | 8.6 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 1.4 | 4.3 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 1.4 | 25.4 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
| 1.4 | 5.5 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 1.4 | 4.1 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 1.4 | 11.0 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
| 1.3 | 4.0 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 1.3 | 5.3 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 1.3 | 5.2 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 1.3 | 7.7 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 1.3 | 1.3 | GO:0098911 | regulation of ventricular cardiac muscle cell action potential(GO:0098911) |
| 1.2 | 3.7 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 1.2 | 1.2 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 1.2 | 5.9 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 1.2 | 3.5 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 1.2 | 12.8 | GO:1902547 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902547) |
| 1.2 | 3.5 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 1.1 | 12.5 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 1.1 | 7.8 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 1.1 | 3.2 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 1.1 | 3.2 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
| 1.1 | 4.3 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 1.1 | 14.0 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 1.1 | 3.2 | GO:1902947 | regulation of tau-protein kinase activity(GO:1902947) neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
| 1.0 | 3.1 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 1.0 | 4.0 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 1.0 | 8.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 1.0 | 21.9 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 1.0 | 4.0 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
| 1.0 | 3.0 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.9 | 1.9 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
| 0.9 | 3.7 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.9 | 18.4 | GO:0055013 | cardiac muscle cell development(GO:0055013) |
| 0.9 | 9.1 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.9 | 0.9 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
| 0.9 | 8.2 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.9 | 1.8 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| 0.9 | 6.3 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.9 | 3.6 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.9 | 2.7 | GO:0003284 | septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
| 0.9 | 2.7 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.9 | 4.4 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.9 | 3.5 | GO:0045341 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.9 | 16.6 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 0.9 | 1.7 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.9 | 2.6 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.9 | 4.3 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.8 | 0.8 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.8 | 2.5 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.8 | 5.0 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.8 | 5.9 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.8 | 0.8 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
| 0.8 | 3.2 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.8 | 8.9 | GO:0001553 | luteinization(GO:0001553) |
| 0.8 | 1.6 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
| 0.8 | 3.2 | GO:0030578 | PML body organization(GO:0030578) |
| 0.8 | 9.5 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
| 0.8 | 2.3 | GO:0072092 | ureteric bud invasion(GO:0072092) |
| 0.8 | 2.3 | GO:0009838 | abscission(GO:0009838) |
| 0.8 | 4.6 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
| 0.8 | 1.5 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.7 | 16.4 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.7 | 3.0 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.7 | 4.4 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.7 | 2.2 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
| 0.7 | 4.4 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.7 | 2.2 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.7 | 1.4 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
| 0.7 | 0.7 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
| 0.7 | 1.4 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
| 0.7 | 4.2 | GO:0071404 | cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
| 0.7 | 2.7 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
| 0.7 | 0.7 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.7 | 4.1 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
| 0.7 | 2.0 | GO:0072107 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
| 0.7 | 1.3 | GO:0003166 | bundle of His development(GO:0003166) |
| 0.7 | 2.7 | GO:0072102 | glomerulus morphogenesis(GO:0072102) |
| 0.7 | 2.6 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.7 | 6.6 | GO:0007614 | short-term memory(GO:0007614) |
| 0.7 | 2.6 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.7 | 2.6 | GO:2000739 | regulation of mesenchymal stem cell differentiation(GO:2000739) positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.7 | 2.0 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.6 | 1.9 | GO:0003176 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
| 0.6 | 0.6 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) positive regulation of actin filament-based movement(GO:1903116) |
| 0.6 | 1.9 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.6 | 1.3 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 0.6 | 2.5 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
| 0.6 | 2.5 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.6 | 1.9 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.6 | 0.6 | GO:2001016 | positive regulation of skeletal muscle cell differentiation(GO:2001016) |
| 0.6 | 3.7 | GO:0090042 | tubulin deacetylation(GO:0090042) regulation of tubulin deacetylation(GO:0090043) |
| 0.6 | 0.6 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.6 | 4.9 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.6 | 0.6 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.6 | 1.8 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.6 | 3.0 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.6 | 1.2 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
| 0.6 | 14.7 | GO:0045214 | sarcomere organization(GO:0045214) |
| 0.6 | 1.2 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.6 | 2.9 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
| 0.6 | 4.0 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.6 | 4.0 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.6 | 1.1 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.6 | 0.6 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
| 0.6 | 3.9 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.6 | 1.1 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.6 | 1.7 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 0.5 | 2.2 | GO:0070874 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.5 | 2.2 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.5 | 1.6 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.5 | 6.4 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
| 0.5 | 0.5 | GO:0010560 | positive regulation of glycoprotein biosynthetic process(GO:0010560) |
| 0.5 | 1.0 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.5 | 0.5 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.5 | 1.6 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.5 | 2.1 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.5 | 1.0 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.5 | 1.6 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.5 | 4.6 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 0.5 | 0.5 | GO:0086029 | Purkinje myocyte action potential(GO:0086017) Purkinje myocyte to ventricular cardiac muscle cell signaling(GO:0086029) Purkinje myocyte to ventricular cardiac muscle cell communication(GO:0086068) |
| 0.5 | 4.1 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
| 0.5 | 2.5 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.5 | 0.5 | GO:0098903 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) regulation of membrane repolarization during action potential(GO:0098903) |
| 0.5 | 1.5 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.5 | 19.5 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
| 0.5 | 3.0 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 0.5 | 4.4 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
| 0.5 | 2.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.5 | 2.4 | GO:0060613 | fat pad development(GO:0060613) |
| 0.5 | 1.9 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.5 | 0.5 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.5 | 1.4 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.5 | 1.4 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.5 | 0.5 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.5 | 0.9 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.5 | 2.7 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.5 | 0.9 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.5 | 0.9 | GO:1903521 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.5 | 2.7 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
| 0.5 | 0.5 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.4 | 0.4 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.4 | 3.5 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.4 | 0.9 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.4 | 1.3 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.4 | 5.2 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.4 | 4.3 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.4 | 1.7 | GO:0008272 | sulfate transport(GO:0008272) |
| 0.4 | 0.8 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.4 | 0.4 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
| 0.4 | 0.4 | GO:0051657 | maintenance of organelle location(GO:0051657) |
| 0.4 | 0.8 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.4 | 0.8 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
| 0.4 | 0.8 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.4 | 2.9 | GO:0097531 | mast cell migration(GO:0097531) |
| 0.4 | 1.2 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.4 | 1.2 | GO:0035482 | gastric motility(GO:0035482) |
| 0.4 | 0.8 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
| 0.4 | 1.2 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.4 | 1.2 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.4 | 0.4 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
| 0.4 | 0.8 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.4 | 1.2 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.4 | 0.4 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.4 | 0.8 | GO:0007494 | midgut development(GO:0007494) |
| 0.4 | 9.9 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.4 | 1.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.4 | 1.2 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.4 | 2.0 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.4 | 0.8 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.4 | 0.8 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.4 | 0.4 | GO:0046697 | decidualization(GO:0046697) |
| 0.4 | 1.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.4 | 1.9 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.4 | 1.5 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.4 | 0.4 | GO:1903392 | negative regulation of adherens junction organization(GO:1903392) |
| 0.4 | 1.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.4 | 3.0 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.4 | 12.0 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
| 0.4 | 0.4 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.4 | 3.0 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.4 | 0.7 | GO:0006901 | vesicle coating(GO:0006901) |
| 0.4 | 1.1 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.4 | 0.7 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.4 | 1.1 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.4 | 0.7 | GO:0032439 | endosome localization(GO:0032439) |
| 0.4 | 0.4 | GO:1903416 | response to glycoside(GO:1903416) |
| 0.4 | 0.4 | GO:0015755 | fructose transport(GO:0015755) |
| 0.4 | 1.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.4 | 3.6 | GO:0030947 | regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030947) |
| 0.4 | 1.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.4 | 1.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.4 | 0.7 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
| 0.4 | 1.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.3 | 1.4 | GO:0086005 | ventricular cardiac muscle cell action potential(GO:0086005) |
| 0.3 | 0.3 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.3 | 0.7 | GO:0031269 | pseudopodium assembly(GO:0031269) |
| 0.3 | 1.0 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.3 | 0.7 | GO:1902065 | response to L-glutamate(GO:1902065) |
| 0.3 | 2.8 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.3 | 38.0 | GO:0007266 | Rho protein signal transduction(GO:0007266) |
| 0.3 | 1.0 | GO:0060676 | ureteric bud formation(GO:0060676) |
| 0.3 | 0.3 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.3 | 2.0 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.3 | 1.0 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
| 0.3 | 0.7 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
| 0.3 | 3.0 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
| 0.3 | 0.7 | GO:0070099 | regulation of chemokine-mediated signaling pathway(GO:0070099) |
| 0.3 | 2.3 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.3 | 1.7 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.3 | 0.3 | GO:0002158 | osteoclast proliferation(GO:0002158) |
| 0.3 | 0.3 | GO:0090178 | regulation of establishment of planar polarity involved in neural tube closure(GO:0090178) |
| 0.3 | 2.0 | GO:0002667 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.3 | 1.0 | GO:0006983 | ER overload response(GO:0006983) |
| 0.3 | 1.3 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.3 | 1.0 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.3 | 1.6 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.3 | 1.3 | GO:0043312 | neutrophil degranulation(GO:0043312) |
| 0.3 | 1.0 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.3 | 1.0 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.3 | 1.3 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.3 | 0.6 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
| 0.3 | 0.9 | GO:0030070 | insulin processing(GO:0030070) |
| 0.3 | 0.9 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.3 | 0.9 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.3 | 2.5 | GO:0048541 | mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
| 0.3 | 1.8 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.3 | 4.0 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
| 0.3 | 0.6 | GO:0003253 | cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
| 0.3 | 0.9 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
| 0.3 | 1.5 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.3 | 2.4 | GO:0032230 | positive regulation of synaptic transmission, GABAergic(GO:0032230) |
| 0.3 | 0.3 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.3 | 0.6 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.3 | 0.9 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.3 | 0.9 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.3 | 1.5 | GO:0046541 | saliva secretion(GO:0046541) |
| 0.3 | 0.9 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.3 | 0.9 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.3 | 0.6 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.3 | 0.6 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
| 0.3 | 0.3 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.3 | 0.6 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.3 | 1.4 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.3 | 0.6 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
| 0.3 | 0.3 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.3 | 0.9 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
| 0.3 | 1.4 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.3 | 1.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.3 | 1.7 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.3 | 0.8 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.3 | 1.7 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.3 | 0.8 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 0.3 | 3.1 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
| 0.3 | 1.9 | GO:0034626 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.3 | 0.6 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.3 | 1.4 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.3 | 1.7 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.3 | 0.8 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.3 | 0.6 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.3 | 0.5 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.3 | 12.9 | GO:0007229 | integrin-mediated signaling pathway(GO:0007229) |
| 0.3 | 0.5 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.3 | 3.0 | GO:0080111 | DNA demethylation(GO:0080111) |
| 0.3 | 0.5 | GO:0042322 | negative regulation of circadian sleep/wake cycle, REM sleep(GO:0042322) |
| 0.3 | 1.4 | GO:0042637 | catagen(GO:0042637) |
| 0.3 | 1.9 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.3 | 0.3 | GO:0006573 | valine metabolic process(GO:0006573) |
| 0.3 | 0.3 | GO:0098901 | regulation of cardiac muscle cell action potential(GO:0098901) |
| 0.3 | 2.7 | GO:0070168 | negative regulation of biomineral tissue development(GO:0070168) |
| 0.3 | 0.3 | GO:2000726 | negative regulation of cardiac muscle cell differentiation(GO:2000726) |
| 0.3 | 0.5 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
| 0.3 | 0.3 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
| 0.3 | 1.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.3 | 0.5 | GO:2001212 | regulation of vasculogenesis(GO:2001212) |
| 0.3 | 0.3 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
| 0.3 | 0.5 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.3 | 1.1 | GO:0007412 | axon target recognition(GO:0007412) |
| 0.3 | 0.5 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.3 | 0.8 | GO:0033084 | regulation of immature T cell proliferation in thymus(GO:0033084) |
| 0.3 | 0.5 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
| 0.3 | 2.3 | GO:0072539 | T-helper 17 cell differentiation(GO:0072539) |
| 0.3 | 0.8 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
| 0.3 | 0.5 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
| 0.3 | 1.3 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.3 | 0.3 | GO:0042523 | positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
| 0.3 | 2.0 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
| 0.3 | 0.8 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.3 | 1.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.3 | 2.5 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.3 | 8.3 | GO:0009268 | response to pH(GO:0009268) |
| 0.3 | 0.8 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.3 | 1.0 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.2 | 0.7 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.2 | 1.0 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.2 | 0.7 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.2 | 0.5 | GO:0031017 | exocrine pancreas development(GO:0031017) |
| 0.2 | 0.7 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.2 | 0.2 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.2 | 0.7 | GO:0061117 | negative regulation of cardiac muscle tissue growth(GO:0055022) negative regulation of heart growth(GO:0061117) |
| 0.2 | 4.2 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.2 | 3.9 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.2 | 0.7 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.2 | 1.5 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.2 | 0.2 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
| 0.2 | 2.4 | GO:0045103 | intermediate filament-based process(GO:0045103) |
| 0.2 | 0.5 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.2 | 0.5 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.2 | 0.5 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 0.2 | 0.5 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.2 | 2.9 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.2 | 1.4 | GO:2000400 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
| 0.2 | 0.5 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.2 | 0.5 | GO:1903984 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.2 | 1.9 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.2 | 2.4 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.2 | 2.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.2 | 0.7 | GO:0003383 | apical constriction(GO:0003383) |
| 0.2 | 0.2 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
| 0.2 | 0.2 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.2 | 0.2 | GO:1903802 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
| 0.2 | 0.2 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.2 | 0.7 | GO:0030222 | eosinophil differentiation(GO:0030222) |
| 0.2 | 1.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.2 | 0.2 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.2 | 0.5 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.2 | 0.7 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
| 0.2 | 0.9 | GO:0032621 | interleukin-18 production(GO:0032621) |
| 0.2 | 0.4 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
| 0.2 | 0.7 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
| 0.2 | 0.2 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.2 | 0.9 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.2 | 3.1 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
| 0.2 | 0.7 | GO:0009173 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.2 | 0.7 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.2 | 2.4 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.2 | 0.4 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.2 | 0.7 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.2 | 1.1 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
| 0.2 | 0.2 | GO:0034392 | negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
| 0.2 | 3.5 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.2 | 2.2 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.2 | 0.4 | GO:0051462 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) |
| 0.2 | 1.7 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.2 | 3.9 | GO:0045109 | intermediate filament organization(GO:0045109) |
| 0.2 | 1.5 | GO:0090218 | positive regulation of lipid kinase activity(GO:0090218) |
| 0.2 | 0.2 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
| 0.2 | 0.2 | GO:0034650 | cortisol metabolic process(GO:0034650) |
| 0.2 | 0.6 | GO:0014028 | notochord formation(GO:0014028) |
| 0.2 | 0.9 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.2 | 29.0 | GO:0006936 | muscle contraction(GO:0006936) |
| 0.2 | 0.2 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.2 | 0.8 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
| 0.2 | 1.3 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.2 | 0.6 | GO:0045624 | positive regulation of T-helper cell differentiation(GO:0045624) |
| 0.2 | 0.4 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.2 | 2.9 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.2 | 1.5 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.2 | 1.3 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
| 0.2 | 1.0 | GO:0051444 | negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.2 | 0.8 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
| 0.2 | 0.8 | GO:0051775 | response to redox state(GO:0051775) |
| 0.2 | 0.6 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.2 | 2.9 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
| 0.2 | 0.8 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.2 | 0.6 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.2 | 0.4 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 0.2 | 1.2 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
| 0.2 | 4.5 | GO:0034340 | response to type I interferon(GO:0034340) |
| 0.2 | 0.6 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.2 | 1.0 | GO:0021559 | trigeminal nerve development(GO:0021559) |
| 0.2 | 0.2 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.2 | 3.4 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.2 | 0.8 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.2 | 0.4 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 | 0.2 | GO:0072125 | negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
| 0.2 | 0.2 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
| 0.2 | 0.8 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.2 | 0.2 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.2 | 1.0 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.2 | 0.4 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.2 | 2.0 | GO:0016572 | histone phosphorylation(GO:0016572) |
| 0.2 | 0.6 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.2 | 0.2 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.2 | 2.7 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.2 | 0.4 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.2 | 0.6 | GO:1901163 | regulation of trophoblast cell migration(GO:1901163) positive regulation of trophoblast cell migration(GO:1901165) |
| 0.2 | 19.6 | GO:0071805 | potassium ion transmembrane transport(GO:0071805) |
| 0.2 | 4.6 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.2 | 0.6 | GO:0010755 | regulation of plasminogen activation(GO:0010755) |
| 0.2 | 0.4 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.2 | 0.4 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.2 | 0.4 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.2 | 0.2 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.2 | 1.7 | GO:0030032 | lamellipodium assembly(GO:0030032) |
| 0.2 | 0.4 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.2 | 0.6 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.2 | 1.1 | GO:0042749 | regulation of circadian sleep/wake cycle(GO:0042749) |
| 0.2 | 0.6 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.2 | 0.2 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.2 | 0.4 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 0.2 | 5.0 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
| 0.2 | 0.6 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
| 0.2 | 1.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.2 | 4.4 | GO:0007044 | cell-substrate junction assembly(GO:0007044) |
| 0.2 | 0.7 | GO:0042748 | circadian sleep/wake cycle, non-REM sleep(GO:0042748) |
| 0.2 | 0.5 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.2 | 1.3 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
| 0.2 | 1.1 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.2 | 0.2 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.2 | 2.0 | GO:0060612 | adipose tissue development(GO:0060612) |
| 0.2 | 0.5 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.2 | 0.9 | GO:0042148 | strand invasion(GO:0042148) |
| 0.2 | 0.7 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
| 0.2 | 0.5 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.2 | 0.9 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 | 0.2 | GO:0030801 | positive regulation of cyclic nucleotide metabolic process(GO:0030801) |
| 0.2 | 0.2 | GO:0010511 | regulation of phosphatidylinositol biosynthetic process(GO:0010511) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 0.2 | 1.6 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.2 | 0.9 | GO:0032099 | negative regulation of appetite(GO:0032099) |
| 0.2 | 1.4 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.2 | 0.5 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
| 0.2 | 0.5 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.2 | 0.3 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.2 | 0.7 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.2 | 0.2 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.2 | 2.1 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.2 | 1.2 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
| 0.2 | 0.3 | GO:0006551 | leucine metabolic process(GO:0006551) |
| 0.2 | 0.2 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.2 | 0.3 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.2 | 1.0 | GO:0030575 | nuclear body organization(GO:0030575) |
| 0.2 | 0.5 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.2 | 0.5 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.2 | 1.2 | GO:0002349 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.2 | 2.3 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.2 | 2.7 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.2 | 0.2 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.2 | 1.8 | GO:0048535 | lymph node development(GO:0048535) |
| 0.2 | 0.7 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.2 | 0.3 | GO:0043589 | skin morphogenesis(GO:0043589) |
| 0.2 | 0.5 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.2 | 0.2 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.2 | 0.2 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.2 | 0.2 | GO:1903751 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.2 | 1.9 | GO:0046039 | GTP metabolic process(GO:0046039) |
| 0.2 | 7.6 | GO:0006096 | glycolytic process(GO:0006096) |
| 0.2 | 0.2 | GO:0034136 | negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
| 0.2 | 0.5 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.2 | 2.6 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.2 | 0.2 | GO:0002890 | negative regulation of B cell mediated immunity(GO:0002713) negative regulation of immunoglobulin mediated immune response(GO:0002890) |
| 0.2 | 0.5 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.2 | 0.3 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.2 | 0.8 | GO:1904871 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 0.2 | 0.3 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.2 | 2.7 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.2 | 0.2 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.2 | 5.4 | GO:0018107 | peptidyl-threonine phosphorylation(GO:0018107) |
| 0.2 | 0.8 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.2 | 0.5 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.2 | 9.5 | GO:0031398 | positive regulation of protein ubiquitination(GO:0031398) |
| 0.2 | 0.5 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.2 | 0.5 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.2 | 1.3 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.2 | 0.8 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.2 | 1.2 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.2 | 0.5 | GO:0003198 | epithelial to mesenchymal transition involved in endocardial cushion formation(GO:0003198) |
| 0.2 | 0.5 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
| 0.2 | 0.2 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
| 0.2 | 1.4 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
| 0.2 | 0.8 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.2 | 0.8 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.2 | 0.2 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.2 | 0.3 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.2 | 2.0 | GO:0044126 | regulation of growth of symbiont in host(GO:0044126) modulation of growth of symbiont involved in interaction with host(GO:0044144) |
| 0.2 | 5.6 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
| 0.2 | 0.5 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.2 | 0.5 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.2 | 0.2 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.2 | 0.5 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.2 | 0.5 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
| 0.2 | 0.5 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.1 | 1.6 | GO:0070527 | platelet aggregation(GO:0070527) |
| 0.1 | 0.3 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
| 0.1 | 3.4 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.1 | 0.6 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.1 | 0.9 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
| 0.1 | 2.4 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
| 0.1 | 3.7 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
| 0.1 | 0.4 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.1 | 0.3 | GO:0035455 | response to interferon-alpha(GO:0035455) |
| 0.1 | 0.4 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
| 0.1 | 0.1 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.1 | 0.1 | GO:0060601 | lateral sprouting from an epithelium(GO:0060601) |
| 0.1 | 0.1 | GO:0032096 | negative regulation of response to food(GO:0032096) |
| 0.1 | 0.4 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.1 | 0.4 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.1 | 2.3 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.1 | 2.3 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.1 | 0.6 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.1 | 0.3 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.1 | 2.0 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
| 0.1 | 3.3 | GO:0090559 | regulation of membrane permeability(GO:0090559) |
| 0.1 | 5.0 | GO:0003073 | regulation of systemic arterial blood pressure(GO:0003073) |
| 0.1 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.1 | 0.1 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
| 0.1 | 0.3 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
| 0.1 | 0.6 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 0.1 | 0.6 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 | 0.3 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.1 | 0.1 | GO:0060143 | positive regulation of syncytium formation by plasma membrane fusion(GO:0060143) |
| 0.1 | 0.3 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.1 | 1.8 | GO:2000036 | regulation of stem cell population maintenance(GO:2000036) |
| 0.1 | 0.3 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.1 | 0.4 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.1 | 0.3 | GO:1903242 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
| 0.1 | 0.1 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.1 | 0.7 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.1 | 0.1 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
| 0.1 | 0.5 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.1 | 0.5 | GO:0045651 | regulation of macrophage differentiation(GO:0045649) positive regulation of macrophage differentiation(GO:0045651) |
| 0.1 | 3.1 | GO:0003015 | heart process(GO:0003015) |
| 0.1 | 0.1 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
| 0.1 | 0.8 | GO:1901185 | negative regulation of ERBB signaling pathway(GO:1901185) |
| 0.1 | 1.1 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
| 0.1 | 0.3 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.1 | 0.3 | GO:0015846 | polyamine transport(GO:0015846) polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.1 | 0.3 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.1 | 0.3 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.1 | 0.4 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
| 0.1 | 0.8 | GO:0007379 | segment specification(GO:0007379) |
| 0.1 | 0.8 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| 0.1 | 1.2 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.1 | 0.6 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.1 | 1.0 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
| 0.1 | 0.5 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
| 0.1 | 2.1 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.1 | 0.4 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.8 | GO:0044827 | modulation by host of viral genome replication(GO:0044827) |
| 0.1 | 0.3 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.1 | 0.6 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.1 | 0.5 | GO:0051155 | positive regulation of striated muscle cell differentiation(GO:0051155) |
| 0.1 | 3.3 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
| 0.1 | 1.7 | GO:0010595 | positive regulation of endothelial cell migration(GO:0010595) |
| 0.1 | 0.1 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.1 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 | 0.3 | GO:0006907 | pinocytosis(GO:0006907) |
| 0.1 | 0.4 | GO:0031639 | plasminogen activation(GO:0031639) |
| 0.1 | 0.1 | GO:1900040 | regulation of interleukin-2 secretion(GO:1900040) |
| 0.1 | 0.4 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.1 | 0.3 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.1 | 1.0 | GO:0070233 | negative regulation of T cell apoptotic process(GO:0070233) |
| 0.1 | 0.5 | GO:0070197 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.1 | 0.5 | GO:0042738 | exogenous drug catabolic process(GO:0042738) |
| 0.1 | 0.5 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.1 | 0.5 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.1 | 0.1 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 0.1 | 0.5 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.1 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.1 | 0.5 | GO:0051818 | disruption of cells of other organism involved in symbiotic interaction(GO:0051818) killing of cells in other organism involved in symbiotic interaction(GO:0051883) neutrophil mediated killing of bacterium(GO:0070944) |
| 0.1 | 0.7 | GO:1901678 | iron coordination entity transport(GO:1901678) |
| 0.1 | 0.1 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
| 0.1 | 0.4 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 | 3.9 | GO:0010811 | positive regulation of cell-substrate adhesion(GO:0010811) |
| 0.1 | 2.4 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.1 | 0.1 | GO:0036118 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.1 | 1.2 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.8 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.1 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.1 | 0.4 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.1 | 0.1 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.1 | 0.1 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) response to hydrostatic pressure(GO:0051599) |
| 0.1 | 0.2 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 0.4 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.1 | 0.1 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.1 | 0.8 | GO:0055021 | regulation of cardiac muscle tissue growth(GO:0055021) |
| 0.1 | 0.2 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.1 | 0.8 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.1 | 0.4 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.1 | 0.1 | GO:0060421 | positive regulation of heart growth(GO:0060421) |
| 0.1 | 0.4 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.1 | 0.6 | GO:1904353 | regulation of telomere capping(GO:1904353) positive regulation of telomere capping(GO:1904355) |
| 0.1 | 0.2 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.1 | 1.1 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.1 | 0.4 | GO:0007567 | parturition(GO:0007567) |
| 0.1 | 0.1 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.1 | 0.2 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.1 | 0.1 | GO:0072077 | renal vesicle morphogenesis(GO:0072077) |
| 0.1 | 3.3 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
| 0.1 | 1.3 | GO:0051642 | centrosome localization(GO:0051642) |
| 0.1 | 0.1 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
| 0.1 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.1 | 5.9 | GO:0061041 | regulation of wound healing(GO:0061041) |
| 0.1 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 | 0.1 | GO:0098739 | import across plasma membrane(GO:0098739) |
| 0.1 | 0.2 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.1 | 0.1 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.1 | 0.3 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.1 | 0.2 | GO:0043267 | negative regulation of potassium ion transport(GO:0043267) |
| 0.1 | 0.1 | GO:0002517 | T cell tolerance induction(GO:0002517) |
| 0.1 | 0.9 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.1 | 0.3 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.1 | 0.1 | GO:0032730 | positive regulation of interleukin-1 alpha production(GO:0032730) |
| 0.1 | 0.3 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.1 | 0.1 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
| 0.1 | 0.3 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.1 | 0.3 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.1 | 0.4 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 | 0.3 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.1 | 0.2 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 | 0.7 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.1 | 0.3 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.1 | 0.1 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.1 | 0.5 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.1 | 0.5 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.1 | 2.2 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.1 | 1.3 | GO:0019363 | pyridine nucleotide biosynthetic process(GO:0019363) |
| 0.1 | 0.7 | GO:1903861 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
| 0.1 | 1.6 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.1 | 0.5 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
| 0.1 | 0.5 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.1 | 0.5 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.1 | 0.7 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.1 | 0.4 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.1 | 0.8 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.1 | 0.2 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.1 | 0.1 | GO:1900024 | regulation of substrate adhesion-dependent cell spreading(GO:1900024) |
| 0.1 | 0.2 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
| 0.1 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.1 | 0.4 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.1 | 0.2 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.1 | 1.0 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) |
| 0.1 | 0.3 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.1 | 0.2 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.1 | 0.5 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.1 | 0.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 | 0.4 | GO:0009415 | response to water deprivation(GO:0009414) response to water(GO:0009415) |
| 0.1 | 0.2 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.1 | 0.2 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.1 | 0.3 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
| 0.1 | 0.3 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.1 | 2.0 | GO:0015991 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.1 | 1.1 | GO:0032292 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
| 0.1 | 0.1 | GO:0051665 | membrane raft localization(GO:0051665) |
| 0.1 | 0.2 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
| 0.1 | 0.1 | GO:0072393 | microtubule anchoring at microtubule organizing center(GO:0072393) |
| 0.1 | 0.4 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.1 | 0.1 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
| 0.1 | 0.2 | GO:1901201 | regulation of extracellular matrix assembly(GO:1901201) |
| 0.1 | 0.1 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.1 | 0.5 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.1 | 0.8 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.1 | 0.3 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.1 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.4 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.1 | 0.3 | GO:0050872 | white fat cell differentiation(GO:0050872) |
| 0.1 | 0.5 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.1 | 0.1 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
| 0.1 | 1.7 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.1 | 0.1 | GO:0030815 | negative regulation of cAMP metabolic process(GO:0030815) |
| 0.1 | 0.2 | GO:0006112 | energy reserve metabolic process(GO:0006112) |
| 0.1 | 0.3 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
| 0.1 | 1.7 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.1 | 1.4 | GO:0009250 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.1 | 0.3 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.1 | 0.1 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.1 | 0.3 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.1 | 1.0 | GO:0035879 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.1 | 1.1 | GO:0061001 | regulation of dendritic spine morphogenesis(GO:0061001) |
| 0.1 | 0.2 | GO:0034505 | tooth mineralization(GO:0034505) |
| 0.1 | 0.7 | GO:0046688 | response to copper ion(GO:0046688) |
| 0.1 | 0.5 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.1 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.1 | 1.2 | GO:0051058 | negative regulation of small GTPase mediated signal transduction(GO:0051058) |
| 0.1 | 0.3 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.1 | 0.8 | GO:0032693 | negative regulation of interleukin-10 production(GO:0032693) |
| 0.1 | 0.2 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 | 0.1 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.1 | 0.1 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
| 0.1 | 0.3 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 | 0.3 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.1 | 0.3 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.1 | 0.4 | GO:0044247 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.1 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.1 | 0.2 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.1 | 0.2 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.1 | 0.3 | GO:0002645 | positive regulation of tolerance induction(GO:0002645) |
| 0.1 | 0.1 | GO:0060027 | convergent extension involved in gastrulation(GO:0060027) |
| 0.1 | 0.5 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 1.1 | GO:0006073 | glycogen metabolic process(GO:0005977) cellular glucan metabolic process(GO:0006073) glucan metabolic process(GO:0044042) |
| 0.1 | 0.1 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
| 0.1 | 0.3 | GO:0014898 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
| 0.1 | 0.2 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
| 0.1 | 1.1 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.1 | 0.1 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.1 | 0.1 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 | 0.1 | GO:2000345 | regulation of hepatocyte proliferation(GO:2000345) |
| 0.1 | 0.2 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.1 | 0.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.1 | 0.6 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.1 | 0.3 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 | 0.7 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.1 | 0.3 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.1 | 0.7 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.1 | 0.2 | GO:0048617 | embryonic foregut morphogenesis(GO:0048617) |
| 0.1 | 0.3 | GO:0045141 | meiotic telomere clustering(GO:0045141) |
| 0.1 | 0.2 | GO:0044805 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) single-organism membrane invagination(GO:1902534) |
| 0.1 | 0.3 | GO:0060037 | pharyngeal system development(GO:0060037) |
| 0.1 | 0.2 | GO:0010454 | negative regulation of cell fate commitment(GO:0010454) |
| 0.1 | 0.1 | GO:0051299 | centrosome separation(GO:0051299) |
| 0.1 | 1.7 | GO:0008088 | axo-dendritic transport(GO:0008088) |
| 0.1 | 0.2 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.1 | 0.4 | GO:0010623 | programmed cell death involved in cell development(GO:0010623) |
| 0.1 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.1 | 0.4 | GO:0015871 | choline transport(GO:0015871) |
| 0.1 | 0.2 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.1 | 0.4 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.1 | 0.1 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.1 | 0.5 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.1 | 0.4 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.1 | 1.1 | GO:0040036 | regulation of fibroblast growth factor receptor signaling pathway(GO:0040036) |
| 0.1 | 1.6 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
| 0.1 | 0.6 | GO:0045197 | establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
| 0.1 | 0.1 | GO:0060460 | left lung morphogenesis(GO:0060460) |
| 0.1 | 0.2 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.1 | 0.2 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
| 0.1 | 0.4 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.1 | 0.2 | GO:0002507 | tolerance induction(GO:0002507) |
| 0.1 | 0.2 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.1 | 0.4 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.1 | 0.4 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.1 | 0.1 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.1 | 0.1 | GO:0008078 | mesodermal cell migration(GO:0008078) |
| 0.1 | 0.1 | GO:0001660 | fever generation(GO:0001660) |
| 0.1 | 0.1 | GO:0032196 | transposition(GO:0032196) |
| 0.1 | 0.1 | GO:1902990 | telomere maintenance via semi-conservative replication(GO:0032201) mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.1 | 0.6 | GO:0045776 | negative regulation of blood pressure(GO:0045776) |
| 0.1 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.1 | 0.3 | GO:0002024 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 0.1 | 0.2 | GO:0010155 | regulation of proton transport(GO:0010155) |
| 0.1 | 0.7 | GO:0030048 | actin filament-based movement(GO:0030048) |
| 0.1 | 0.1 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.1 | 0.6 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
| 0.1 | 0.2 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.1 | 0.3 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.1 | 0.1 | GO:0030038 | contractile actin filament bundle assembly(GO:0030038) stress fiber assembly(GO:0043149) |
| 0.1 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.1 | 0.4 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.1 | 0.7 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.1 | 0.1 | GO:1902175 | regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902175) |
| 0.1 | 0.2 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.1 | 0.8 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.1 | 0.4 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.1 | 0.4 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.1 | 0.1 | GO:0038066 | p38MAPK cascade(GO:0038066) |
| 0.1 | 0.1 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.1 | 0.4 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.1 | 0.2 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 0.1 | 0.1 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
| 0.1 | 0.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.1 | 0.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 0.1 | GO:1902308 | regulation of peptidyl-serine dephosphorylation(GO:1902308) |
| 0.1 | 1.0 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.1 | 0.3 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.1 | 0.2 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.1 | 0.1 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.1 | 0.1 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
| 0.1 | 0.3 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.1 | 0.9 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.1 | 0.1 | GO:0035994 | response to muscle stretch(GO:0035994) |
| 0.1 | 0.1 | GO:0098801 | regulation of renal system process(GO:0098801) |
| 0.1 | 0.3 | GO:0032239 | regulation of nucleobase-containing compound transport(GO:0032239) regulation of RNA export from nucleus(GO:0046831) |
| 0.1 | 0.4 | GO:0048662 | negative regulation of smooth muscle cell proliferation(GO:0048662) |
| 0.1 | 0.2 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.1 | 0.9 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
| 0.1 | 0.6 | GO:0097186 | amelogenesis(GO:0097186) |
| 0.1 | 0.9 | GO:0006301 | postreplication repair(GO:0006301) |
| 0.1 | 0.1 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 0.1 | 0.3 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
| 0.1 | 0.6 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.1 | 0.1 | GO:0042362 | fat-soluble vitamin biosynthetic process(GO:0042362) |
| 0.1 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 | 0.1 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.1 | 0.3 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.1 | 0.1 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.1 | 0.1 | GO:1905155 | positive regulation of phagocytosis, engulfment(GO:0060100) positive regulation of membrane invagination(GO:1905155) |
| 0.1 | 0.2 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.1 | 1.4 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
| 0.1 | 0.3 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) telomere maintenance in response to DNA damage(GO:0043247) |
| 0.1 | 2.0 | GO:0006171 | cAMP biosynthetic process(GO:0006171) |
| 0.1 | 0.2 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.1 | 0.3 | GO:0021554 | optic nerve development(GO:0021554) |
| 0.1 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.1 | 0.3 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.1 | 0.1 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.1 | 0.3 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 0.1 | 0.1 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 | 0.1 | GO:0035733 | hepatic stellate cell activation(GO:0035733) |
| 0.1 | 0.1 | GO:0042161 | plasma lipoprotein particle oxidation(GO:0034441) lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
| 0.1 | 0.1 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.1 | 0.1 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.1 | 1.4 | GO:0019935 | cyclic-nucleotide-mediated signaling(GO:0019935) |
| 0.1 | 0.4 | GO:0006596 | polyamine biosynthetic process(GO:0006596) |
| 0.1 | 0.2 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.1 | 0.1 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.1 | 0.4 | GO:0009081 | branched-chain amino acid metabolic process(GO:0009081) |
| 0.1 | 1.9 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.1 | 0.2 | GO:0036230 | granulocyte activation(GO:0036230) |
| 0.1 | 0.1 | GO:0060544 | regulation of necroptotic process(GO:0060544) negative regulation of necroptotic process(GO:0060546) |
| 0.1 | 0.5 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
| 0.1 | 0.1 | GO:0034333 | adherens junction assembly(GO:0034333) |
| 0.1 | 0.1 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
| 0.1 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.1 | 0.3 | GO:0030903 | notochord development(GO:0030903) |
| 0.1 | 0.7 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.1 | 0.3 | GO:0043276 | anoikis(GO:0043276) |
| 0.1 | 0.5 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.1 | 0.2 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
| 0.1 | 0.7 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.1 | 0.2 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
| 0.1 | 0.3 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.1 | 0.2 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
| 0.1 | 0.2 | GO:0023019 | signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.1 | 0.3 | GO:0033687 | osteoblast proliferation(GO:0033687) |
| 0.1 | 0.2 | GO:0051181 | cofactor transport(GO:0051181) |
| 0.1 | 0.6 | GO:0030890 | positive regulation of B cell proliferation(GO:0030890) |
| 0.1 | 0.2 | GO:0043330 | response to exogenous dsRNA(GO:0043330) |
| 0.1 | 0.3 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.1 | 0.2 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.1 | 1.4 | GO:0002224 | toll-like receptor signaling pathway(GO:0002224) |
| 0.1 | 0.5 | GO:0030593 | neutrophil chemotaxis(GO:0030593) |
| 0.1 | 0.2 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.1 | 0.1 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.1 | 0.3 | GO:0007274 | neuromuscular synaptic transmission(GO:0007274) |
| 0.1 | 0.2 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 0.3 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.1 | 0.3 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 | 0.1 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.1 | 0.2 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.1 | 0.2 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.1 | 3.6 | GO:0018105 | peptidyl-serine phosphorylation(GO:0018105) |
| 0.1 | 0.3 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.1 | 0.1 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.1 | 0.1 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.1 | 0.2 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.1 | 0.1 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.1 | 0.2 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.1 | 0.1 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.1 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.1 | 0.5 | GO:1902572 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.1 | 0.1 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
| 0.1 | 0.1 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
| 0.1 | 0.1 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.1 | GO:0035524 | proline transmembrane transport(GO:0035524) |
| 0.0 | 0.1 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.0 | 0.1 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.0 | 0.2 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.0 | 1.1 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
| 0.0 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.0 | GO:0006757 | ATP generation from ADP(GO:0006757) |
| 0.0 | 1.1 | GO:0009166 | nucleotide catabolic process(GO:0009166) |
| 0.0 | 0.1 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.0 | 0.2 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.0 | 0.0 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.0 | 0.1 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.0 | 0.7 | GO:1901184 | regulation of ERBB signaling pathway(GO:1901184) |
| 0.0 | 0.1 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.0 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.3 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
| 0.0 | 0.1 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
| 0.0 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
| 0.0 | 0.1 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
| 0.0 | 0.4 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
| 0.0 | 0.2 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.0 | 0.1 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.0 | 0.0 | GO:0021648 | vestibulocochlear nerve morphogenesis(GO:0021648) |
| 0.0 | 0.1 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.0 | 0.3 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.0 | 0.2 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
| 0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.0 | 0.2 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.0 | 0.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.2 | GO:0000054 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.0 | 0.2 | GO:0097581 | lamellipodium organization(GO:0097581) |
| 0.0 | 0.2 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.0 | 0.2 | GO:0032098 | regulation of appetite(GO:0032098) |
| 0.0 | 0.0 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.0 | 0.1 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.0 | 0.3 | GO:0043029 | T cell homeostasis(GO:0043029) |
| 0.0 | 0.1 | GO:0010573 | vascular endothelial growth factor production(GO:0010573) |
| 0.0 | 0.0 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.0 | 0.2 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.0 | 0.2 | GO:0038202 | TORC1 signaling(GO:0038202) regulation of TORC1 signaling(GO:1903432) negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 0.0 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.0 | 0.1 | GO:0010766 | negative regulation of sodium ion transport(GO:0010766) |
| 0.0 | 0.1 | GO:0032275 | luteinizing hormone secretion(GO:0032275) |
| 0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
| 0.0 | 0.3 | GO:0033273 | response to vitamin(GO:0033273) |
| 0.0 | 0.1 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.0 | 0.0 | GO:0003161 | cardiac conduction system development(GO:0003161) |
| 0.0 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 | 0.1 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
| 0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 | 0.0 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.0 | 0.1 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.0 | 0.0 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.0 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
| 0.0 | 0.2 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 0.0 | GO:0007418 | ventral midline development(GO:0007418) floor plate morphogenesis(GO:0033505) |
| 0.0 | 0.1 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.0 | 0.1 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.0 | 0.6 | GO:0033344 | cholesterol efflux(GO:0033344) |
| 0.0 | 0.6 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.0 | 0.1 | GO:0043129 | surfactant homeostasis(GO:0043129) |
| 0.0 | 0.2 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.1 | GO:0007184 | SMAD protein import into nucleus(GO:0007184) |
| 0.0 | 0.2 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.0 | 0.1 | GO:0018214 | protein carboxylation(GO:0018214) |
| 0.0 | 0.0 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.0 | 0.5 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
| 0.0 | 0.0 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.0 | 0.0 | GO:0034698 | response to gonadotropin(GO:0034698) |
| 0.0 | 0.0 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 | 0.2 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.0 | 0.0 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
| 0.0 | 0.2 | GO:0007588 | excretion(GO:0007588) |
| 0.0 | 0.2 | GO:0043535 | regulation of blood vessel endothelial cell migration(GO:0043535) |
| 0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.1 | GO:0045777 | positive regulation of blood pressure(GO:0045777) |
| 0.0 | 0.3 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.2 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 | 0.0 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
| 0.0 | 0.0 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.0 | 0.0 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.0 | 0.0 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.0 | 0.1 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.0 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.0 | 0.0 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
| 0.0 | 0.0 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.0 | 0.1 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.0 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.0 | 0.1 | GO:0030299 | intestinal cholesterol absorption(GO:0030299) |
| 0.0 | 0.1 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.0 | 0.1 | GO:0044598 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 | 0.0 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
| 0.0 | 0.0 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 | 0.1 | GO:0060347 | heart trabecula formation(GO:0060347) |
| 0.0 | 0.6 | GO:0071453 | cellular response to decreased oxygen levels(GO:0036294) cellular response to oxygen levels(GO:0071453) |
| 0.0 | 3.9 | GO:0048515 | spermatid differentiation(GO:0048515) |
| 0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.0 | 0.0 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.0 | 0.1 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
| 0.0 | 0.0 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
| 0.0 | 0.0 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.0 | 0.1 | GO:0051382 | kinetochore assembly(GO:0051382) |
| 0.0 | 0.2 | GO:0060972 | left/right pattern formation(GO:0060972) |
| 0.0 | 0.1 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.0 | 0.1 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.0 | 0.0 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
| 0.0 | 0.1 | GO:0070341 | fat cell proliferation(GO:0070341) regulation of fat cell proliferation(GO:0070344) |
| 0.0 | 0.4 | GO:0008347 | glial cell migration(GO:0008347) |
| 0.0 | 0.0 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.0 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 0.1 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.0 | 0.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.1 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.0 | 0.0 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.0 | 0.1 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.0 | 0.1 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.0 | 0.1 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.0 | 0.3 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
| 0.0 | 0.0 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.3 | GO:0001779 | natural killer cell differentiation(GO:0001779) |
| 0.0 | 0.0 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
| 0.0 | 0.6 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
| 0.0 | 0.0 | GO:0001969 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
| 0.0 | 0.1 | GO:1901722 | regulation of cell proliferation involved in kidney development(GO:1901722) |
| 0.0 | 0.2 | GO:0034311 | sphingosine metabolic process(GO:0006670) diol metabolic process(GO:0034311) |
| 0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.0 | 0.1 | GO:0008217 | regulation of blood pressure(GO:0008217) |
| 0.0 | 0.1 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.0 | 0.0 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.0 | 0.0 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
| 0.0 | 0.0 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
| 0.0 | 0.0 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.2 | GO:0033692 | cellular polysaccharide biosynthetic process(GO:0033692) |
| 0.0 | 0.4 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
| 0.0 | 0.0 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
| 0.0 | 0.1 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 0.0 | 0.3 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.0 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
| 0.0 | 0.1 | GO:0051931 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
| 0.0 | 0.1 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
| 0.0 | 0.1 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
| 0.0 | 0.0 | GO:0009642 | response to light intensity(GO:0009642) |
| 0.0 | 0.1 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.0 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
| 0.0 | 0.0 | GO:0031645 | negative regulation of neurological system process(GO:0031645) |
| 0.0 | 0.3 | GO:0042755 | eating behavior(GO:0042755) |
| 0.0 | 0.1 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
| 0.0 | 0.0 | GO:0060029 | convergent extension involved in organogenesis(GO:0060029) |
| 0.0 | 0.0 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
| 0.0 | 0.2 | GO:0007435 | salivary gland morphogenesis(GO:0007435) |
| 0.0 | 0.0 | GO:0002829 | negative regulation of type 2 immune response(GO:0002829) |
| 0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
| 0.0 | 0.0 | GO:0051284 | negative regulation of release of sequestered calcium ion into cytosol(GO:0051280) positive regulation of sequestering of calcium ion(GO:0051284) |
| 0.0 | 0.0 | GO:0010390 | histone monoubiquitination(GO:0010390) |
| 0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.0 | GO:0055119 | relaxation of cardiac muscle(GO:0055119) regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.0 | 0.2 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.0 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.0 | 0.2 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.0 | 0.0 | GO:0051043 | regulation of membrane protein ectodomain proteolysis(GO:0051043) |
| 0.0 | 0.1 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 | 0.4 | GO:0045766 | positive regulation of angiogenesis(GO:0045766) |
| 0.0 | 0.0 | GO:2001169 | regulation of ATP biosynthetic process(GO:2001169) |
| 0.0 | 0.4 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 | 0.0 | GO:0032692 | negative regulation of interleukin-1 production(GO:0032692) |
| 0.0 | 0.2 | GO:0050852 | T cell receptor signaling pathway(GO:0050852) |
| 0.0 | 0.1 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.0 | 0.2 | GO:0051492 | regulation of stress fiber assembly(GO:0051492) |
| 0.0 | 0.0 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.0 | 0.2 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.0 | 0.1 | GO:0014002 | astrocyte development(GO:0014002) |
| 0.0 | 0.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.0 | 0.1 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
| 0.0 | 0.1 | GO:0015813 | L-glutamate transport(GO:0015813) |
| 0.0 | 0.0 | GO:0051349 | positive regulation of lyase activity(GO:0051349) |
| 0.0 | 0.0 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.0 | 0.5 | GO:0031016 | pancreas development(GO:0031016) |
| 0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.0 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.0 | 0.0 | GO:2000515 | negative regulation of CD4-positive, alpha-beta T cell activation(GO:2000515) |
| 0.0 | 0.1 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.0 | 0.2 | GO:0034629 | cellular protein complex localization(GO:0034629) |
| 0.0 | 0.2 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.0 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.0 | 0.0 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
| 0.0 | 0.1 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.0 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
| 0.0 | 0.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.1 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.0 | 0.0 | GO:0006311 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
| 0.0 | 0.2 | GO:0014823 | response to activity(GO:0014823) |
| 0.0 | 0.2 | GO:0001570 | vasculogenesis(GO:0001570) |
| 0.0 | 0.0 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.0 | 0.1 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.0 | 0.0 | GO:1902713 | regulation of interferon-gamma secretion(GO:1902713) |
| 0.0 | 0.0 | GO:0097178 | ruffle assembly(GO:0097178) |
| 0.0 | 0.0 | GO:0032277 | negative regulation of gonadotropin secretion(GO:0032277) |
| 0.0 | 0.0 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
| 0.0 | 1.1 | GO:0043062 | extracellular structure organization(GO:0043062) |
| 0.0 | 0.0 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.0 | GO:0046066 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) glycoprotein transport(GO:0034436) dGDP metabolic process(GO:0046066) |
| 0.0 | 0.0 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
| 0.0 | 0.0 | GO:0043174 | nucleoside salvage(GO:0043174) |
| 0.0 | 0.1 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.0 | GO:0042226 | interleukin-6 biosynthetic process(GO:0042226) |
| 0.0 | 0.1 | GO:0032026 | response to magnesium ion(GO:0032026) |
| 0.0 | 0.0 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.0 | 0.0 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
| 0.0 | 0.0 | GO:0032714 | negative regulation of interleukin-13 production(GO:0032696) negative regulation of interleukin-5 production(GO:0032714) |
| 0.0 | 0.0 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.0 | 0.0 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
| 0.0 | 0.0 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.0 | 0.0 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
| 0.0 | 0.2 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.0 | 0.0 | GO:0042097 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 0.0 | 0.1 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.0 | 0.0 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.0 | 0.0 | GO:0050857 | positive regulation of antigen receptor-mediated signaling pathway(GO:0050857) |
| 0.0 | 0.0 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
| 0.0 | 0.0 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.0 | 0.0 | GO:0048011 | neurotrophin TRK receptor signaling pathway(GO:0048011) |
| 0.0 | 0.0 | GO:0061009 | common bile duct development(GO:0061009) |
| 0.0 | 0.0 | GO:0008631 | intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.0 | 0.0 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.0 | 0.0 | GO:0046520 | sphingoid biosynthetic process(GO:0046520) |
| 0.0 | 0.0 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.0 | 0.0 | GO:0009624 | response to nematode(GO:0009624) |
| 0.0 | 0.0 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.0 | 0.1 | GO:0018209 | peptidyl-serine modification(GO:0018209) |
| 0.0 | 0.0 | GO:0031529 | ruffle organization(GO:0031529) |
| 0.0 | 0.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.0 | 0.0 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.1 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.0 | 0.0 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 | 0.1 | GO:0021984 | adenohypophysis development(GO:0021984) |
| 0.0 | 0.0 | GO:0044264 | cellular polysaccharide metabolic process(GO:0044264) |
| 0.0 | 0.1 | GO:0019441 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
| 0.0 | 0.0 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.0 | 0.1 | GO:0006071 | glycerol metabolic process(GO:0006071) |
| 0.0 | 0.0 | GO:0032225 | regulation of synaptic transmission, dopaminergic(GO:0032225) |
| 0.0 | 0.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.0 | 0.1 | GO:0010719 | negative regulation of epithelial to mesenchymal transition(GO:0010719) |
| 0.0 | 0.0 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
| 0.0 | 0.1 | GO:0002886 | regulation of myeloid leukocyte mediated immunity(GO:0002886) |
| 0.0 | 0.0 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.0 | 0.0 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.0 | 0.0 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.0 | 0.0 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.0 | 0.1 | GO:0001562 | response to protozoan(GO:0001562) |
| 0.0 | 0.5 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.0 | 0.0 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.0 | 0.1 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
| 0.0 | 0.0 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.0 | 0.0 | GO:0000270 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.0 | 0.0 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.0 | 0.0 | GO:0044851 | anagen(GO:0042640) hair cycle phase(GO:0044851) |
| 0.0 | 0.1 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.0 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.0 | 0.3 | GO:0007566 | embryo implantation(GO:0007566) |
| 0.0 | 0.0 | GO:0051281 | positive regulation of release of sequestered calcium ion into cytosol(GO:0051281) |
| 0.0 | 0.0 | GO:0007431 | salivary gland development(GO:0007431) |
| 0.0 | 0.0 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.0 | 0.0 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.0 | 0.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.1 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.0 | 0.0 | GO:0051788 | response to misfolded protein(GO:0051788) |
| 0.0 | 0.0 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 6.1 | 18.3 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 4.2 | 12.7 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 4.1 | 20.7 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 3.2 | 25.9 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 2.6 | 33.7 | GO:0031430 | M band(GO:0031430) |
| 2.5 | 22.4 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 2.5 | 14.8 | GO:0031983 | vesicle lumen(GO:0031983) |
| 2.4 | 29.2 | GO:0005916 | fascia adherens(GO:0005916) |
| 2.4 | 21.8 | GO:0043034 | costamere(GO:0043034) |
| 1.7 | 8.7 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 1.7 | 5.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 1.6 | 24.1 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 1.5 | 11.7 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 1.4 | 11.2 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 1.4 | 130.9 | GO:0031674 | I band(GO:0031674) |
| 1.4 | 8.2 | GO:0005915 | zonula adherens(GO:0005915) |
| 1.2 | 13.0 | GO:0070852 | cell body fiber(GO:0070852) |
| 1.1 | 4.6 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 1.1 | 10.7 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 1.0 | 3.1 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 1.0 | 3.1 | GO:0097443 | sorting endosome(GO:0097443) |
| 1.0 | 2.0 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 1.0 | 2.9 | GO:1990357 | terminal web(GO:1990357) |
| 1.0 | 2.9 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 1.0 | 1.9 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.9 | 0.9 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.9 | 2.6 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.9 | 3.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.8 | 15.0 | GO:0002102 | podosome(GO:0002102) |
| 0.8 | 6.6 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.7 | 2.2 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.7 | 2.1 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.7 | 0.7 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.7 | 2.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.7 | 13.0 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.7 | 13.0 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.6 | 10.3 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.6 | 1.9 | GO:0031417 | NatC complex(GO:0031417) |
| 0.6 | 29.0 | GO:0043292 | contractile fiber(GO:0043292) |
| 0.6 | 14.5 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.5 | 1.6 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.5 | 9.8 | GO:0005922 | connexon complex(GO:0005922) |
| 0.5 | 23.5 | GO:0042641 | actomyosin(GO:0042641) |
| 0.5 | 1.5 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.5 | 2.9 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.5 | 2.9 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.5 | 4.8 | GO:0060091 | kinocilium(GO:0060091) |
| 0.5 | 1.4 | GO:0036396 | MIS complex(GO:0036396) |
| 0.5 | 4.8 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.5 | 1.9 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.5 | 1.9 | GO:0044308 | axonal spine(GO:0044308) |
| 0.5 | 3.2 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
| 0.4 | 2.2 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.4 | 3.5 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.4 | 1.3 | GO:0032982 | myosin filament(GO:0032982) |
| 0.4 | 1.2 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.4 | 3.5 | GO:0033270 | paranode region of axon(GO:0033270) |
| 0.4 | 3.1 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.4 | 5.3 | GO:0043205 | fibril(GO:0043205) |
| 0.4 | 6.8 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.4 | 1.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.4 | 3.7 | GO:0005921 | gap junction(GO:0005921) |
| 0.4 | 0.4 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.4 | 2.2 | GO:0016011 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
| 0.4 | 2.8 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.4 | 3.9 | GO:0042627 | chylomicron(GO:0042627) |
| 0.3 | 1.0 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.3 | 6.5 | GO:0014704 | intercalated disc(GO:0014704) |
| 0.3 | 5.5 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.3 | 1.6 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.3 | 1.3 | GO:0072487 | MSL complex(GO:0072487) |
| 0.3 | 2.2 | GO:0090543 | Flemming body(GO:0090543) |
| 0.3 | 4.1 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.3 | 8.3 | GO:0008305 | integrin complex(GO:0008305) |
| 0.3 | 4.1 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.3 | 1.2 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.3 | 3.8 | GO:0000800 | lateral element(GO:0000800) |
| 0.3 | 4.1 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.3 | 1.9 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.3 | 1.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.3 | 8.8 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.3 | 2.2 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.3 | 5.0 | GO:0005605 | basal lamina(GO:0005605) |
| 0.3 | 1.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.3 | 14.8 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.3 | 0.8 | GO:0098636 | protein complex involved in cell adhesion(GO:0098636) |
| 0.3 | 1.5 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.3 | 16.0 | GO:0005604 | basement membrane(GO:0005604) |
| 0.3 | 0.5 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.2 | 0.7 | GO:0000811 | GINS complex(GO:0000811) |
| 0.2 | 5.9 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.2 | 1.2 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.2 | 0.7 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.2 | 0.7 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.2 | 0.7 | GO:0043511 | inhibin complex(GO:0043511) |
| 0.2 | 1.3 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.2 | 1.1 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.2 | 1.3 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.2 | 5.4 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.2 | 13.1 | GO:0005901 | caveola(GO:0005901) |
| 0.2 | 0.2 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
| 0.2 | 1.4 | GO:0070187 | telosome(GO:0070187) |
| 0.2 | 1.8 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.2 | 0.4 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.2 | 3.2 | GO:0030057 | desmosome(GO:0030057) |
| 0.2 | 1.3 | GO:0045179 | apical cortex(GO:0045179) |
| 0.2 | 0.6 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
| 0.2 | 49.6 | GO:0070161 | anchoring junction(GO:0070161) |
| 0.2 | 0.8 | GO:0016528 | sarcoplasm(GO:0016528) |
| 0.2 | 2.7 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.2 | 0.9 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.2 | 0.5 | GO:0044853 | plasma membrane raft(GO:0044853) |
| 0.2 | 0.4 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
| 0.2 | 0.5 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.2 | 0.2 | GO:0031523 | Myb complex(GO:0031523) |
| 0.2 | 0.5 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.2 | 9.5 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.2 | 0.5 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.2 | 0.8 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.2 | 1.4 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.2 | 0.8 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.2 | 0.5 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 1.2 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.1 | 0.3 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.1 | 1.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 0.7 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.1 | 0.7 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.1 | 0.8 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.1 | 0.3 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.1 | 0.8 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.1 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 6.1 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.1 | 1.6 | GO:0036038 | MKS complex(GO:0036038) |
| 0.1 | 0.3 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 0.9 | GO:0030681 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
| 0.1 | 10.3 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.1 | 1.3 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
| 0.1 | 0.1 | GO:0005594 | FACIT collagen trimer(GO:0005593) collagen type IX trimer(GO:0005594) |
| 0.1 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 0.5 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.1 | 1.0 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 3.1 | GO:0042383 | sarcolemma(GO:0042383) |
| 0.1 | 0.4 | GO:0097413 | Lewy body(GO:0097413) |
| 0.1 | 0.4 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.1 | 0.9 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 0.2 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.1 | 0.5 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 1.2 | GO:0030315 | T-tubule(GO:0030315) |
| 0.1 | 13.1 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.1 | 1.6 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.1 | 2.1 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.1 | 1.2 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.1 | 0.2 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.1 | 0.9 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.1 | 1.5 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.1 | 0.4 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 12.1 | GO:0005938 | cell cortex(GO:0005938) |
| 0.1 | 0.8 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.1 | 2.7 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.1 | 1.1 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.1 | 1.0 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.1 | 1.5 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.1 | 0.4 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
| 0.1 | 3.0 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.1 | 3.9 | GO:0005776 | autophagosome(GO:0005776) |
| 0.1 | 0.3 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.1 | 3.7 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
| 0.1 | 0.2 | GO:0071437 | invadopodium(GO:0071437) |
| 0.1 | 1.2 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.1 | 5.1 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.1 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 1.2 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.1 | 0.2 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 2.8 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.1 | 0.3 | GO:0035838 | growing cell tip(GO:0035838) |
| 0.1 | 0.3 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.1 | 0.7 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.1 | 0.4 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.1 | 0.8 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.1 | 0.6 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 0.5 | GO:0010369 | chromocenter(GO:0010369) |
| 0.1 | 0.8 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 1.5 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 0.3 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
| 0.1 | 0.2 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.1 | 0.2 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.1 | 0.9 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.1 | 3.3 | GO:0001726 | ruffle(GO:0001726) |
| 0.1 | 0.5 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 0.9 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 2.5 | GO:0005902 | microvillus(GO:0005902) |
| 0.1 | 0.3 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.1 | 0.4 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.1 | 0.2 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 0.4 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.1 | 0.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.1 | 0.6 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.1 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.1 | 0.2 | GO:0043293 | apoptosome(GO:0043293) |
| 0.1 | 0.1 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.1 | 0.2 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.1 | 0.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.1 | 0.5 | GO:0034464 | BBSome(GO:0034464) |
| 0.1 | 0.5 | GO:0034704 | calcium channel complex(GO:0034704) |
| 0.1 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.1 | 12.1 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
| 0.1 | 0.2 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.1 | 0.7 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.1 | 0.2 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.1 | 0.5 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 0.1 | 0.4 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.1 | 0.4 | GO:0045178 | basal part of cell(GO:0045178) |
| 0.1 | 0.5 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.1 | 1.3 | GO:0030027 | lamellipodium(GO:0030027) |
| 0.1 | 2.5 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.1 | 0.4 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.1 | 1.8 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.1 | 1.1 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.1 | 0.4 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.1 | 0.9 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.1 | 0.8 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.1 | 2.1 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.1 | 2.9 | GO:0016605 | PML body(GO:0016605) |
| 0.1 | 1.0 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.1 | 0.2 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.1 | 0.4 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.1 | 0.2 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.1 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 1.4 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.0 | 0.2 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 0.0 | GO:0043219 | lateral loop(GO:0043219) |
| 0.0 | 6.0 | GO:0015629 | actin cytoskeleton(GO:0015629) |
| 0.0 | 0.2 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.6 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.0 | 1.0 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.0 | 0.1 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.0 | 0.4 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.1 | GO:0044299 | C-fiber(GO:0044299) |
| 0.0 | 0.0 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.1 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 3.8 | GO:0005765 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
| 0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.1 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.6 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.1 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 1.1 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.0 | 0.1 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 0.2 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.0 | 1.1 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 12.0 | GO:0005768 | endosome(GO:0005768) |
| 0.0 | 0.6 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 1.8 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 0.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.0 | 0.1 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.0 | 0.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.0 | 0.1 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 0.0 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.0 | 0.1 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 1.7 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
| 0.0 | 0.0 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.5 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
| 0.0 | 0.2 | GO:0035859 | Seh1-associated complex(GO:0035859) |
| 0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 0.2 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.1 | GO:0033176 | proton-transporting V-type ATPase complex(GO:0033176) |
| 0.0 | 2.5 | GO:0005911 | cell-cell junction(GO:0005911) |
| 0.0 | 0.1 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.0 | 0.2 | GO:0044298 | cell body membrane(GO:0044298) |
| 0.0 | 0.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 2.6 | GO:0000139 | Golgi membrane(GO:0000139) |
| 0.0 | 0.0 | GO:0002141 | stereocilia ankle link(GO:0002141) USH2 complex(GO:1990696) |
| 0.0 | 0.1 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 2.2 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.0 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.0 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.0 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.2 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 0.4 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.0 | GO:0043203 | axon hillock(GO:0043203) |
| 0.0 | 0.6 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 0.0 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 0.0 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 0.0 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 0.0 | GO:0043218 | compact myelin(GO:0043218) |
| 0.0 | 0.8 | GO:0031225 | anchored component of membrane(GO:0031225) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 5.9 | 29.5 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 5.6 | 44.5 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 4.7 | 14.0 | GO:0051373 | FATZ binding(GO:0051373) |
| 4.6 | 13.8 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 4.0 | 16.0 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 3.7 | 11.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 3.3 | 22.8 | GO:0031432 | titin binding(GO:0031432) |
| 2.7 | 5.5 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 2.6 | 7.8 | GO:0070538 | oleic acid binding(GO:0070538) |
| 2.5 | 12.7 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 2.4 | 7.1 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 2.1 | 10.7 | GO:0031013 | troponin I binding(GO:0031013) |
| 2.1 | 12.8 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 2.1 | 6.3 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 2.0 | 8.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 2.0 | 20.2 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 1.9 | 5.8 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 1.9 | 5.7 | GO:0055100 | adiponectin binding(GO:0055100) |
| 1.8 | 10.8 | GO:0034790 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
| 1.6 | 1.6 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
| 1.5 | 10.2 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 1.4 | 2.9 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 1.4 | 2.8 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 1.4 | 10.8 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 1.3 | 3.9 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 1.3 | 6.4 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 1.2 | 24.4 | GO:0003785 | actin monomer binding(GO:0003785) |
| 1.2 | 6.0 | GO:0043426 | MRF binding(GO:0043426) |
| 1.2 | 2.3 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 1.1 | 23.7 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 1.1 | 9.6 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 1.1 | 15.8 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
| 1.0 | 3.1 | GO:0051425 | PTB domain binding(GO:0051425) |
| 1.0 | 58.9 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 1.0 | 5.1 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 1.0 | 2.9 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 1.0 | 4.9 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 1.0 | 10.5 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.9 | 6.6 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.9 | 7.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.9 | 13.2 | GO:0005521 | lamin binding(GO:0005521) |
| 0.9 | 2.6 | GO:0019976 | interleukin-2 binding(GO:0019976) |
| 0.9 | 1.7 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
| 0.9 | 3.4 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.8 | 1.7 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.8 | 7.6 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.8 | 2.5 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.8 | 6.6 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.8 | 2.4 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.8 | 8.4 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.8 | 14.3 | GO:0042805 | actinin binding(GO:0042805) |
| 0.7 | 2.2 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.7 | 6.6 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.7 | 6.6 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.7 | 2.2 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.7 | 2.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.7 | 12.0 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.7 | 9.2 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.7 | 3.5 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.7 | 3.5 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.7 | 2.1 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.7 | 4.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.7 | 4.0 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.7 | 9.2 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.7 | 1.3 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.7 | 1.3 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.6 | 10.3 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.6 | 1.9 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.6 | 4.2 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.6 | 1.7 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.6 | 5.7 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.6 | 1.7 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.6 | 1.7 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.6 | 5.0 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.5 | 1.6 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.5 | 1.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.5 | 2.2 | GO:0009374 | biotin binding(GO:0009374) |
| 0.5 | 4.8 | GO:0015922 | aspartate oxidase activity(GO:0015922) |
| 0.5 | 2.1 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.5 | 1.6 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.5 | 0.5 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.5 | 2.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.5 | 4.1 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.5 | 3.6 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.5 | 2.5 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.5 | 2.0 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.5 | 1.0 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.5 | 2.9 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.5 | 2.8 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.5 | 25.9 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.5 | 19.2 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.5 | 6.1 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.5 | 1.4 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.5 | 1.8 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.5 | 4.1 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.5 | 2.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.5 | 1.4 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.5 | 9.9 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.4 | 12.5 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.4 | 8.9 | GO:0070717 | poly-purine tract binding(GO:0070717) |
| 0.4 | 9.3 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
| 0.4 | 0.4 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.4 | 0.4 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.4 | 1.3 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.4 | 9.6 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.4 | 1.7 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.4 | 5.3 | GO:0030955 | potassium ion binding(GO:0030955) |
| 0.4 | 0.4 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.4 | 1.6 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.4 | 1.6 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.4 | 2.4 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.4 | 1.2 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.4 | 0.4 | GO:0016675 | oxidoreductase activity, acting on a heme group of donors(GO:0016675) |
| 0.4 | 0.4 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.4 | 2.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.4 | 1.5 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.4 | 13.1 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.4 | 1.1 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
| 0.4 | 1.5 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.4 | 1.8 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.4 | 11.0 | GO:0043531 | ADP binding(GO:0043531) |
| 0.4 | 1.5 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.4 | 0.4 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.4 | 4.0 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.4 | 1.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.3 | 8.0 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.3 | 6.9 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.3 | 1.7 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
| 0.3 | 2.0 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.3 | 2.7 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.3 | 4.3 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.3 | 1.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.3 | 1.9 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.3 | 0.3 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
| 0.3 | 1.0 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.3 | 2.2 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.3 | 3.5 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.3 | 23.7 | GO:0030674 | protein binding, bridging(GO:0030674) |
| 0.3 | 1.9 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.3 | 2.5 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
| 0.3 | 1.5 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.3 | 1.8 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.3 | 1.2 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.3 | 1.2 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.3 | 0.9 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.3 | 1.8 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.3 | 1.2 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.3 | 2.7 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.3 | 0.9 | GO:0005522 | profilin binding(GO:0005522) |
| 0.3 | 0.9 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.3 | 1.2 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.3 | 3.2 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.3 | 0.6 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.3 | 1.4 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.3 | 1.4 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.3 | 0.8 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.3 | 1.9 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.3 | 1.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.3 | 1.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.3 | 11.0 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.3 | 1.4 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.3 | 3.5 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.3 | 2.9 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.3 | 1.6 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.3 | 2.1 | GO:0016307 | phosphatidylinositol phosphate kinase activity(GO:0016307) |
| 0.3 | 14.4 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.3 | 0.8 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.3 | 3.1 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.3 | 2.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.3 | 1.8 | GO:0018634 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
| 0.3 | 1.5 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.3 | 0.8 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.3 | 5.3 | GO:0004950 | G-protein coupled chemoattractant receptor activity(GO:0001637) chemokine receptor activity(GO:0004950) |
| 0.3 | 0.8 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.3 | 0.3 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.2 | 1.0 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.2 | 1.0 | GO:0051429 | corticotropin-releasing hormone receptor binding(GO:0051429) corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
| 0.2 | 5.7 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.2 | 60.9 | GO:0003779 | actin binding(GO:0003779) |
| 0.2 | 1.2 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.2 | 0.2 | GO:0002046 | opsin binding(GO:0002046) |
| 0.2 | 0.5 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.2 | 1.0 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.2 | 0.2 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.2 | 0.9 | GO:0070728 | leucine binding(GO:0070728) |
| 0.2 | 19.9 | GO:0005496 | steroid binding(GO:0005496) |
| 0.2 | 1.4 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.2 | 0.7 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.2 | 9.1 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.2 | 0.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.2 | 19.8 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.2 | 4.9 | GO:0004118 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.2 | 0.7 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.2 | 0.9 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.2 | 0.9 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.2 | 1.8 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.2 | 0.9 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.2 | 0.2 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.2 | 0.6 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.2 | 5.6 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.2 | 0.9 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.2 | 1.7 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.2 | 1.5 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.2 | 7.1 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.2 | 1.9 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.2 | 0.6 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.2 | 1.0 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.2 | 0.2 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.2 | 0.6 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.2 | 0.6 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.2 | 0.6 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.2 | 0.8 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.2 | 1.4 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.2 | 2.2 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.2 | 0.4 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
| 0.2 | 2.5 | GO:0047419 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
| 0.2 | 0.4 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.2 | 4.7 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.2 | 0.9 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.2 | 0.8 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.2 | 0.4 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.2 | 1.7 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
| 0.2 | 0.7 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.2 | 5.9 | GO:0005518 | collagen binding(GO:0005518) |
| 0.2 | 3.3 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.2 | 1.1 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.2 | 2.4 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.2 | 0.5 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.2 | 2.7 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.2 | 5.0 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.2 | 1.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.2 | 2.5 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
| 0.2 | 0.5 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.2 | 7.7 | GO:0051219 | phosphoprotein binding(GO:0051219) |
| 0.2 | 0.5 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.2 | 0.2 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.2 | 0.3 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.2 | 1.9 | GO:0019841 | retinol binding(GO:0019841) |
| 0.2 | 0.7 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.2 | 10.4 | GO:0044325 | ion channel binding(GO:0044325) |
| 0.2 | 1.2 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.2 | 3.2 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.2 | 0.2 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.2 | 0.3 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
| 0.2 | 0.6 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.2 | 4.8 | GO:0043849 | Ras palmitoyltransferase activity(GO:0043849) |
| 0.2 | 0.6 | GO:0016723 | oxidoreductase activity, oxidizing metal ions(GO:0016722) oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
| 0.2 | 0.5 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
| 0.2 | 0.5 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.2 | 9.3 | GO:0005178 | integrin binding(GO:0005178) |
| 0.2 | 0.6 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.2 | 0.5 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.2 | 0.3 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.2 | 0.5 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.2 | 1.1 | GO:0098505 | single-stranded telomeric DNA binding(GO:0043047) G-rich strand telomeric DNA binding(GO:0098505) |
| 0.2 | 0.3 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.2 | 1.7 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.2 | 1.7 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.2 | 0.3 | GO:0019961 | interferon binding(GO:0019961) |
| 0.2 | 0.5 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.1 | 0.7 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
| 0.1 | 0.1 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
| 0.1 | 0.4 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.1 | 3.9 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.1 | 0.4 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.1 | 0.9 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.1 | 0.9 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.1 | 9.3 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.1 | 4.6 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.1 | 2.2 | GO:0008375 | acetylglucosaminyltransferase activity(GO:0008375) |
| 0.1 | 0.6 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.1 | 0.4 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 1.5 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.1 | 0.1 | GO:0016429 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.1 | 0.6 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.1 | 0.7 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.1 | 0.5 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.1 | 0.5 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.1 | 0.4 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.1 | 1.3 | GO:0022821 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) potassium ion antiporter activity(GO:0022821) |
| 0.1 | 1.9 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 2.5 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
| 0.1 | 0.3 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.1 | 0.5 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.1 | 1.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.4 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.1 | 0.3 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.1 | 1.8 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.1 | 0.5 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.1 | 0.4 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.1 | 0.6 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.7 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.1 | 0.6 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.1 | 0.4 | GO:0019002 | GMP binding(GO:0019002) |
| 0.1 | 0.1 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.1 | 0.5 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.1 | 4.3 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.1 | 1.8 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.1 | 0.6 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.1 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
| 0.1 | 0.4 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.1 | 2.0 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.1 | 0.1 | GO:0035276 | ethanol binding(GO:0035276) |
| 0.1 | 0.2 | GO:0098631 | protein binding involved in cell adhesion(GO:0098631) |
| 0.1 | 0.9 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.1 | 0.6 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 0.3 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.1 | 8.5 | GO:0000149 | SNARE binding(GO:0000149) |
| 0.1 | 0.5 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.1 | 0.2 | GO:0005534 | galactose binding(GO:0005534) |
| 0.1 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 0.5 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.1 | 5.9 | GO:0044824 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
| 0.1 | 0.7 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.1 | 0.7 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.1 | 0.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.1 | 0.3 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.1 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 0.2 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.1 | 0.1 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.1 | 0.5 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.1 | 2.2 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.1 | 0.4 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.1 | 0.8 | GO:0045502 | dynein binding(GO:0045502) |
| 0.1 | 0.3 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.2 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.1 | 0.2 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.1 | 0.2 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.1 | 0.7 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.1 | 1.0 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.1 | 0.5 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.1 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 0.8 | GO:0034868 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
| 0.1 | 0.6 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 4.3 | GO:0019003 | GDP binding(GO:0019003) |
| 0.1 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.1 | 0.7 | GO:0035250 | UDP-galactosyltransferase activity(GO:0035250) |
| 0.1 | 0.4 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 0.4 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
| 0.1 | 0.6 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.1 | 0.2 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.1 | 0.3 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.1 | 0.3 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.1 | 2.4 | GO:0016814 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amidines(GO:0016814) |
| 0.1 | 0.3 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.1 | 1.7 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.1 | 0.3 | GO:0019862 | IgA binding(GO:0019862) |
| 0.1 | 0.9 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.2 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.1 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.1 | 0.2 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.1 | 0.8 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.1 | 0.2 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.1 | 0.1 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.1 | 0.5 | GO:0008932 | lytic endotransglycosylase activity(GO:0008932) |
| 0.1 | 0.3 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.1 | 0.5 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 2.3 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.1 | 0.5 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.1 | 0.4 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.1 | 0.3 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.1 | 0.4 | GO:0045125 | bioactive lipid receptor activity(GO:0045125) |
| 0.1 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.1 | 0.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.1 | 0.9 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.1 | 0.3 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.1 | 1.3 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.1 | 0.3 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.1 | 0.3 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 0.1 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
| 0.1 | 0.1 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.1 | 0.3 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.1 | 0.2 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.1 | 0.5 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.1 | 0.2 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.1 | 0.2 | GO:0016859 | cis-trans isomerase activity(GO:0016859) |
| 0.1 | 0.2 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.1 | 0.3 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.1 | 0.5 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.1 | 0.2 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.1 | 0.2 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.1 | 0.7 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.1 | 0.2 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.1 | 0.2 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.1 | 0.7 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.1 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
| 0.1 | 0.3 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.1 | 3.4 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.1 | 0.3 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.1 | 0.3 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.1 | 0.4 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.1 | 0.4 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.1 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.2 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.1 | 0.3 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.1 | 0.3 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 0.3 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 0.2 | GO:0018573 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
| 0.1 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.1 | 0.2 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.1 | 0.3 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.1 | 0.2 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.1 | 0.1 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.1 | 4.3 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.1 | 0.2 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.1 | 0.3 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.1 | 0.1 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
| 0.1 | 0.1 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.1 | 0.2 | GO:0015526 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.1 | 0.4 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.1 | 1.0 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.1 | 0.1 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) peptide transmembrane transporter activity(GO:1904680) |
| 0.1 | 1.0 | GO:0003774 | motor activity(GO:0003774) |
| 0.1 | 0.1 | GO:0022829 | wide pore channel activity(GO:0022829) |
| 0.1 | 0.3 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.1 | 0.3 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
| 0.1 | 0.6 | GO:0009975 | cyclase activity(GO:0009975) |
| 0.1 | 1.4 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.1 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 1.3 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 0.5 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.1 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.1 | 0.3 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 1.3 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.1 | 0.4 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.1 | 0.4 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
| 0.1 | 0.2 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 0.4 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.1 | 0.2 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.1 | 1.9 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.1 | 0.7 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.1 | 0.1 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.1 | 0.1 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.1 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.1 | 0.5 | GO:0048038 | quinone binding(GO:0048038) |
| 0.1 | 0.2 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 0.1 | GO:0051380 | norepinephrine binding(GO:0051380) |
| 0.1 | 10.6 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.1 | 0.2 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.1 | 0.8 | GO:0022840 | leak channel activity(GO:0022840) potassium ion leak channel activity(GO:0022841) narrow pore channel activity(GO:0022842) |
| 0.1 | 0.2 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.1 | 0.6 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.1 | 1.0 | GO:0042166 | acetylcholine binding(GO:0042166) |
| 0.1 | 0.1 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.1 | 0.3 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.2 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
| 0.1 | 0.1 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
| 0.1 | 0.1 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.1 | 2.0 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.1 | 0.3 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.1 | 0.2 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 0.1 | 0.4 | GO:0043139 | 5'-3' DNA helicase activity(GO:0043139) |
| 0.1 | 0.2 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.1 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 0.4 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
| 0.1 | 0.1 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
| 0.1 | 0.2 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.1 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.1 | 0.2 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 0.2 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.1 | 0.1 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.1 | 0.1 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.1 | 0.2 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.1 | 0.3 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 0.3 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.1 | 0.4 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
| 0.1 | 1.0 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.1 | 0.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.1 | 1.2 | GO:0033764 | steroid dehydrogenase activity, acting on the CH-OH group of donors, NAD or NADP as acceptor(GO:0033764) |
| 0.0 | 0.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.4 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.0 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.0 | 3.0 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.0 | 0.3 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 0.1 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
| 0.0 | 3.3 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.0 | 0.1 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.0 | 8.5 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.0 | 0.4 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.0 | 0.0 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.0 | 0.2 | GO:0016454 | C-palmitoyltransferase activity(GO:0016454) |
| 0.0 | 0.3 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.0 | 0.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
| 0.0 | 0.0 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.0 | 0.2 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.0 | 0.4 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.0 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.0 | 0.5 | GO:0008236 | serine-type peptidase activity(GO:0008236) |
| 0.0 | 0.3 | GO:0034869 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
| 0.0 | 0.0 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.0 | 3.3 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.0 | 2.5 | GO:0046527 | glucosyltransferase activity(GO:0046527) |
| 0.0 | 0.3 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.1 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.0 | 0.1 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.0 | 0.4 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.2 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.0 | 0.2 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.3 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.6 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.0 | 0.4 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
| 0.0 | 0.0 | GO:0071813 | lipoprotein particle binding(GO:0071813) protein-lipid complex binding(GO:0071814) |
| 0.0 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.0 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 8.1 | GO:0005525 | GTP binding(GO:0005525) |
| 0.0 | 3.8 | GO:0000287 | magnesium ion binding(GO:0000287) |
| 0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 1.3 | GO:0008757 | S-adenosylmethionine-dependent methyltransferase activity(GO:0008757) |
| 0.0 | 0.2 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.1 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.0 | 0.0 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.0 | 0.3 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
| 0.0 | 0.4 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.1 | GO:0015464 | acetylcholine receptor activity(GO:0015464) |
| 0.0 | 0.3 | GO:0042562 | hormone binding(GO:0042562) |
| 0.0 | 0.3 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.0 | 0.1 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
| 0.0 | 0.1 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.0 | 0.1 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
| 0.0 | 0.4 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
| 0.0 | 0.1 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
| 0.0 | 0.2 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.0 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.0 | 0.1 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
| 0.0 | 11.0 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
| 0.0 | 0.3 | GO:1905030 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 1.2 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.7 | GO:0015297 | antiporter activity(GO:0015297) |
| 0.0 | 0.4 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.2 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) |
| 0.0 | 0.1 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
| 0.0 | 0.1 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.0 | 0.2 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.0 | 0.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 0.1 | GO:0051861 | glycolipid binding(GO:0051861) |
| 0.0 | 0.1 | GO:0034595 | phosphatidylinositol phosphate 5-phosphatase activity(GO:0034595) |
| 0.0 | 0.0 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.0 | 0.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.0 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
| 0.0 | 0.0 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.0 | 0.1 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.0 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.0 | 0.0 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
| 0.0 | 0.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.0 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.0 | 0.0 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.0 | 0.0 | GO:0016751 | S-succinyltransferase activity(GO:0016751) |
| 0.0 | 0.1 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.0 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.1 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.0 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.1 | GO:0016208 | AMP binding(GO:0016208) |
| 0.0 | 0.2 | GO:0005272 | sodium channel activity(GO:0005272) |
| 0.0 | 0.1 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.0 | 0.3 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.0 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.0 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.0 | 0.1 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 0.0 | 0.0 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.3 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.0 | 0.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.0 | 0.7 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
| 0.0 | 0.1 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.0 | 0.1 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.0 | 0.0 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.0 | 0.0 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.0 | 0.1 | GO:0048019 | receptor inhibitor activity(GO:0030547) receptor antagonist activity(GO:0048019) |
| 0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 0.1 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.0 | 1.4 | GO:0008234 | cysteine-type peptidase activity(GO:0008234) |
| 0.0 | 2.6 | GO:0030414 | peptidase inhibitor activity(GO:0030414) |
| 0.0 | 0.1 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
| 0.0 | 0.1 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
| 0.0 | 0.0 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.1 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
| 0.0 | 0.0 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.0 | 0.1 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.0 | 0.1 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 0.0 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
| 0.0 | 0.3 | GO:0045543 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
| 0.0 | 0.0 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 1.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.0 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.0 | 0.1 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
| 0.0 | 0.0 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.0 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
| 0.0 | 0.0 | GO:0004112 | cyclic-nucleotide phosphodiesterase activity(GO:0004112) |
| 0.0 | 0.0 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 0.0 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.0 | 0.2 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.0 | 0.2 | GO:0005186 | pheromone activity(GO:0005186) |
| 0.0 | 0.0 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 3.3 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.7 | 22.9 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.7 | 37.2 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.6 | 11.1 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.6 | 10.4 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.6 | 3.0 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.6 | 23.5 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.6 | 26.3 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.6 | 6.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.5 | 9.5 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.5 | 9.9 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.5 | 25.3 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.5 | 9.6 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.5 | 15.9 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.5 | 1.4 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.5 | 2.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.4 | 17.6 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.4 | 3.7 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.4 | 9.5 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.4 | 1.2 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.4 | 9.9 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.4 | 3.2 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.4 | 5.8 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.4 | 7.6 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.4 | 4.4 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.4 | 5.7 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.4 | 2.1 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.3 | 3.0 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.3 | 1.7 | PID ATM PATHWAY | ATM pathway |
| 0.3 | 2.9 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.3 | 1.3 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.3 | 4.7 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.3 | 3.6 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.3 | 3.0 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.3 | 1.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.3 | 2.3 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.3 | 3.7 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.3 | 1.4 | PID EPO PATHWAY | EPO signaling pathway |
| 0.3 | 12.6 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.3 | 4.8 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.3 | 1.3 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.3 | 2.1 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.3 | 4.9 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.3 | 10.3 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.2 | 2.7 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.2 | 0.7 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.2 | 4.3 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.2 | 1.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.2 | 1.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.2 | 2.2 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.2 | 2.7 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.2 | 1.2 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.2 | 1.7 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.2 | 2.0 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.2 | 0.9 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.2 | 3.6 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.2 | 2.4 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.2 | 1.2 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.2 | 0.7 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.2 | 1.9 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.2 | 5.0 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.2 | 0.6 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.2 | 0.5 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.2 | 1.7 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.2 | 4.9 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.2 | 1.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.1 | 3.9 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.1 | 0.6 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 2.7 | PID FGF PATHWAY | FGF signaling pathway |
| 0.1 | 2.2 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.1 | 2.1 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.1 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.1 | 2.4 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.1 | 1.9 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.1 | 0.3 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.1 | 0.9 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.1 | 2.5 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.1 | 1.2 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.1 | 0.6 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.1 | 1.2 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.1 | 3.4 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.1 | 0.4 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.1 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 1.0 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.1 | 2.3 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.1 | 0.4 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.1 | 0.9 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.1 | 0.3 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.1 | 13.1 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.1 | 0.7 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.1 | 1.0 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.1 | 0.9 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.1 | 0.6 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.1 | 1.1 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.1 | 1.7 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.1 | 0.6 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 0.5 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.2 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.0 | 1.3 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.5 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 0.1 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 5.0 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.9 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.0 | 0.0 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.6 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.2 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.7 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 4.4 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.7 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.0 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.4 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.0 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 0.1 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 0.1 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.1 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.0 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 0.0 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 0.1 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.0 | 0.1 | NABA CORE MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
| 0.0 | 0.1 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 30.6 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 1.7 | 44.7 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 1.5 | 8.9 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.9 | 10.4 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.8 | 14.8 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.7 | 9.4 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.7 | 30.5 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.7 | 5.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.6 | 10.1 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.6 | 0.6 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.6 | 3.5 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.5 | 8.4 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.5 | 5.9 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.4 | 12.6 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.4 | 7.1 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.4 | 40.4 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.4 | 0.9 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
| 0.4 | 3.8 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.4 | 1.3 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.4 | 5.6 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.4 | 8.4 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.4 | 2.4 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
| 0.4 | 4.7 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.4 | 8.3 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.4 | 10.6 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.4 | 2.7 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.4 | 15.3 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.4 | 3.0 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
| 0.4 | 5.5 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.4 | 4.0 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.4 | 0.4 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.3 | 5.2 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
| 0.3 | 3.8 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.3 | 3.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.3 | 8.6 | REACTOME CD28 CO STIMULATION | Genes involved in CD28 co-stimulation |
| 0.3 | 3.3 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.3 | 8.1 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.3 | 3.6 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.3 | 10.2 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.3 | 5.7 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.3 | 3.5 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.3 | 1.9 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.3 | 1.5 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.3 | 31.9 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
| 0.3 | 11.4 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.3 | 2.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.3 | 1.2 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.3 | 2.0 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.3 | 0.3 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF CYCLIN B | Genes involved in APC/C:Cdc20 mediated degradation of Cyclin B |
| 0.3 | 2.4 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.3 | 2.4 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.3 | 0.8 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.3 | 2.5 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.2 | 0.7 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
| 0.2 | 2.7 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.2 | 2.9 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.2 | 6.1 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.2 | 2.4 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.2 | 1.9 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.2 | 1.7 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.2 | 47.7 | REACTOME CLASS I MHC MEDIATED ANTIGEN PROCESSING PRESENTATION | Genes involved in Class I MHC mediated antigen processing & presentation |
| 0.2 | 1.7 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.2 | 0.7 | REACTOME CLASS A1 RHODOPSIN LIKE RECEPTORS | Genes involved in Class A/1 (Rhodopsin-like receptors) |
| 0.2 | 1.3 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.2 | 0.8 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.2 | 2.9 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.2 | 0.8 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.2 | 0.2 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.2 | 0.4 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.2 | 0.8 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.2 | 16.9 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.2 | 3.2 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.2 | 0.4 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.2 | 1.5 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.2 | 0.7 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.2 | 9.7 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.2 | 0.9 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.2 | 1.2 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.2 | 0.3 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.2 | 0.5 | REACTOME OPIOID SIGNALLING | Genes involved in Opioid Signalling |
| 0.2 | 1.0 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.2 | 2.0 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.2 | 1.6 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.2 | 1.4 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
| 0.2 | 1.1 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.2 | 0.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.2 | 0.9 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 1.0 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
| 0.1 | 1.0 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.1 | 3.3 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.1 | 0.7 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.1 | 1.6 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 1.0 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 1.7 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 4.2 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.1 | 1.6 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.1 | 6.2 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.1 | 1.9 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.1 | 1.0 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.1 | 1.9 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.1 | 1.2 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.1 | 2.4 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.1 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.1 | 1.1 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.1 | 0.8 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.1 | 4.9 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.1 | 1.2 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.1 | 0.9 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 2.8 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 1.1 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.1 | 0.4 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
| 0.1 | 2.5 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.1 | 0.9 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 1.9 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.1 | 0.5 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
| 0.1 | 0.6 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.1 | 2.2 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.1 | 0.3 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.1 | 0.9 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.1 | 5.1 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
| 0.1 | 0.6 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
| 0.1 | 3.4 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 2.0 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.1 | 1.1 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.1 | 0.2 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.1 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.1 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.1 | 1.3 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.1 | 0.2 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 0.8 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 0.1 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.1 | 0.3 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.1 | 1.6 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.1 | 0.2 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.1 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
| 0.1 | 0.2 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
| 0.1 | 0.7 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 0.6 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.1 | 0.9 | REACTOME ACETYLCHOLINE BINDING AND DOWNSTREAM EVENTS | Genes involved in Acetylcholine Binding And Downstream Events |
| 0.1 | 0.4 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.1 | 2.9 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.1 | 2.0 | REACTOME RNA POL III TRANSCRIPTION | Genes involved in RNA Polymerase III Transcription |
| 0.1 | 0.8 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 0.6 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.1 | 0.4 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.1 | 2.0 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 0.6 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.1 | 0.3 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.1 | 5.3 | REACTOME GASTRIN CREB SIGNALLING PATHWAY VIA PKC AND MAPK | Genes involved in Gastrin-CREB signalling pathway via PKC and MAPK |
| 0.1 | 0.2 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.1 | 0.1 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.1 | 0.2 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
| 0.1 | 0.1 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.1 | 0.6 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.1 | 0.3 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.1 | 0.5 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.1 | 0.3 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.0 | 0.4 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.9 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.3 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.0 | 0.6 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.5 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.0 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
| 0.0 | 0.1 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.0 | 0.7 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.3 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
| 0.0 | 0.6 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 0.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.1 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.1 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 0.0 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.0 | 0.4 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.0 | 0.2 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 0.1 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.0 | 0.4 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.4 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.1 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.0 | 0.2 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.0 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.6 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.3 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
| 0.0 | 0.2 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.4 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.3 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.4 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 0.1 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 0.0 | 0.1 | REACTOME CLEAVAGE OF GROWING TRANSCRIPT IN THE TERMINATION REGION | Genes involved in Cleavage of Growing Transcript in the Termination Region |
| 0.0 | 0.3 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.0 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
| 0.0 | 0.0 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.0 | 0.1 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.0 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.0 | 0.1 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.0 | 0.1 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 0.3 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.0 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.1 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.0 | 0.6 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.1 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.0 | 0.0 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.1 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.8 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.3 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.0 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
| 0.0 | 0.1 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |