| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Mtf1
|
ENSMUSG00000028890.7 | metal response element binding transcription factor 1 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr4_124807678_124807829 | Mtf1 | 5075 | 0.107140 | -0.44 | 4.8e-04 | Click! |
| chr4_124808440_124809072 | Mtf1 | 6078 | 0.102466 | -0.25 | 5.0e-02 | Click! |
| chr4_124804514_124804668 | Mtf1 | 1913 | 0.184581 | -0.25 | 5.9e-02 | Click! |
| chr4_124809838_124809989 | Mtf1 | 7235 | 0.098966 | -0.17 | 1.8e-01 | Click! |
| chr4_124802151_124802467 | Mtf1 | 205 | 0.873598 | 0.17 | 1.9e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr1_134865189_134865526 | 4.20 |
Ppp1r12b |
protein phosphatase 1, regulatory subunit 12B |
18937 |
0.14 |
| chr17_66364158_66364688 | 3.68 |
Mtcl1 |
microtubule crosslinking factor 1 |
10241 |
0.18 |
| chr7_99348638_99349529 | 2.09 |
Serpinh1 |
serine (or cysteine) peptidase inhibitor, clade H, member 1 |
3914 |
0.18 |
| chr6_93911862_93913573 | 1.89 |
Magi1 |
membrane associated guanylate kinase, WW and PDZ domain containing 1 |
213 |
0.95 |
| chr7_143830248_143830955 | 1.86 |
Dhcr7 |
7-dehydrocholesterol reductase |
343 |
0.82 |
| chr6_53288842_53289356 | 1.80 |
Creb5 |
cAMP responsive element binding protein 5 |
1324 |
0.55 |
| chrX_135210129_135210918 | 1.78 |
Tceal6 |
transcription elongation factor A (SII)-like 6 |
164 |
0.93 |
| chr3_7508212_7508727 | 1.78 |
Zc2hc1a |
zinc finger, C2HC-type containing 1A |
4983 |
0.2 |
| chr7_45093013_45094086 | 1.73 |
Rcn3 |
reticulocalbin 3, EF-hand calcium binding domain |
1328 |
0.13 |
| chrX_84076569_84077653 | 1.70 |
Dmd |
dystrophin, muscular dystrophy |
462 |
0.87 |
| chr8_44936013_44936398 | 1.62 |
Fat1 |
FAT atypical cadherin 1 |
758 |
0.52 |
| chr8_64691882_64692436 | 1.62 |
Cpe |
carboxypeptidase E |
895 |
0.57 |
| chr11_117233043_117233605 | 1.62 |
Septin9 |
septin 9 |
1039 |
0.52 |
| chr10_13060623_13061509 | 1.56 |
Plagl1 |
pleiomorphic adenoma gene-like 1 |
562 |
0.76 |
| chr15_98172171_98172428 | 1.56 |
Ccdc184 |
coiled-coil domain containing 184 |
5141 |
0.12 |
| chr13_98356794_98358725 | 1.56 |
Foxd1 |
forkhead box D1 |
3517 |
0.19 |
| chr7_54835204_54836499 | 1.55 |
Luzp2 |
leucine zipper protein 2 |
236 |
0.94 |
| chrX_137569718_137571626 | 1.53 |
Il1rapl2 |
interleukin 1 receptor accessory protein-like 2 |
64 |
0.98 |
| chr17_62879782_62880330 | 1.48 |
Efna5 |
ephrin A5 |
1088 |
0.68 |
| chr10_29148067_29148387 | 1.47 |
Soga3 |
SOGA family member 3 |
430 |
0.81 |
| chrX_66648975_66649257 | 1.45 |
Slitrk2 |
SLIT and NTRK-like family, member 2 |
202 |
0.94 |
| chr1_104768492_104769666 | 1.44 |
Cdh20 |
cadherin 20 |
550 |
0.79 |
| chr8_99415302_99416849 | 1.44 |
Cdh8 |
cadherin 8 |
244 |
0.77 |
| chrX_59566046_59566497 | 1.44 |
Fgf13 |
fibroblast growth factor 13 |
1201 |
0.64 |
| chr17_85691735_85693137 | 1.42 |
CJ186046Rik |
Riken cDNA CJ186046 gene |
1193 |
0.46 |
| chr7_140154045_140155011 | 1.38 |
Sprn |
shadow of prion protein |
349 |
0.75 |
| chr17_51534362_51535054 | 1.38 |
Gm31143 |
predicted gene, 31143 |
150 |
0.97 |
| chr16_75092043_75093126 | 1.37 |
Gm49676 |
predicted gene, 49676 |
54649 |
0.14 |
| chr3_127407787_127409013 | 1.34 |
Ank2 |
ankyrin 2, brain |
554 |
0.71 |
| chrX_161908690_161909336 | 1.30 |
Gm15202 |
predicted gene 15202 |
790 |
0.75 |
| chr14_12821743_12822443 | 1.28 |
Cadps |
Ca2+-dependent secretion activator |
952 |
0.63 |
| chr5_4756323_4756474 | 1.27 |
Fzd1 |
frizzled class receptor 1 |
1637 |
0.32 |
| chr18_35655953_35656104 | 1.27 |
Prob1 |
proline rich basic protein 1 |
790 |
0.4 |
| chr5_123075941_123076213 | 1.26 |
Tmem120b |
transmembrane protein 120B |
198 |
0.88 |
| chr5_128599826_128600673 | 1.26 |
Fzd10os |
frizzled class receptor 10, opposite strand |
405 |
0.58 |
| chr8_88455133_88455905 | 1.25 |
Gm45497 |
predicted gene 45497 |
64398 |
0.1 |
| chr3_107597191_107597974 | 1.24 |
Alx3 |
aristaless-like homeobox 3 |
2551 |
0.22 |
| chr16_52033807_52034820 | 1.22 |
Cblb |
Casitas B-lineage lymphoma b |
2096 |
0.39 |
| chr12_31266722_31266929 | 1.20 |
Lamb1 |
laminin B1 |
1528 |
0.28 |
| chr14_27039085_27040228 | 1.19 |
Il17rd |
interleukin 17 receptor D |
400 |
0.86 |
| chr3_153973293_153974141 | 1.18 |
Slc44a5 |
solute carrier family 44, member 5 |
281 |
0.88 |
| chr7_16875378_16876012 | 1.18 |
Dact3 |
dishevelled-binding antagonist of beta-catenin 3 |
378 |
0.61 |
| chr14_57132708_57133925 | 1.18 |
Gjb6 |
gap junction protein, beta 6 |
35 |
0.97 |
| chr11_68384940_68385629 | 1.16 |
Ntn1 |
netrin 1 |
1542 |
0.44 |
| chr3_107159679_107160452 | 1.16 |
Kcna10 |
potassium voltage-gated channel, shaker-related subfamily, member 10 |
22991 |
0.14 |
| chr8_13158661_13159002 | 1.16 |
Lamp1 |
lysosomal-associated membrane protein 1 |
330 |
0.79 |
| chr6_126739477_126740745 | 1.15 |
Kcna6 |
potassium voltage-gated channel, shaker-related, subfamily, member 6 |
40 |
0.97 |
| chr2_91115299_91116043 | 1.14 |
Mybpc3 |
myosin binding protein C, cardiac |
2473 |
0.18 |
| chr2_140394910_140395234 | 1.14 |
Macrod2 |
mono-ADP ribosylhydrolase 2 |
237 |
0.94 |
| chr4_17852918_17854978 | 1.14 |
Mmp16 |
matrix metallopeptidase 16 |
355 |
0.93 |
| chr7_43607187_43607861 | 1.11 |
Zfp819 |
zinc finger protein 819 |
299 |
0.79 |
| chr18_25621574_25622506 | 1.11 |
Gm3227 |
predicted gene 3227 |
24550 |
0.24 |
| chr6_128020920_128021071 | 1.11 |
Tspan9 |
tetraspanin 9 |
13597 |
0.18 |
| chr3_146220721_146222114 | 1.11 |
Lpar3 |
lysophosphatidic acid receptor 3 |
454 |
0.82 |
| chr11_36677328_36677972 | 1.11 |
Tenm2 |
teneurin transmembrane protein 2 |
95 |
0.98 |
| chr1_66386919_66387899 | 1.10 |
Map2 |
microtubule-associated protein 2 |
398 |
0.87 |
| chr2_93642502_93643772 | 1.10 |
Alx4 |
aristaless-like homeobox 4 |
749 |
0.73 |
| chr14_34585878_34586349 | 1.10 |
Ldb3 |
LIM domain binding 3 |
2368 |
0.19 |
| chr12_33956740_33957445 | 1.10 |
Twist1 |
twist basic helix-loop-helix transcription factor 1 |
579 |
0.78 |
| chr16_94124910_94125992 | 1.09 |
Sim2 |
single-minded family bHLH transcription factor 2 |
270 |
0.88 |
| chr4_154594523_154595149 | 1.07 |
Gm13134 |
predicted gene 13134 |
6361 |
0.17 |
| chr15_58215035_58215258 | 1.07 |
Fbxo32 |
F-box protein 32 |
214 |
0.82 |
| chr15_74487062_74488275 | 1.07 |
Adgrb1 |
adhesion G protein-coupled receptor B1 |
28527 |
0.16 |
| chr18_77564268_77564635 | 1.07 |
Rnf165 |
ring finger protein 165 |
158 |
0.96 |
| chr4_3870584_3871845 | 1.07 |
Mos |
Moloney sarcoma oncogene |
891 |
0.49 |
| chr7_76889140_76890193 | 1.07 |
Gm45210 |
predicted gene 45210 |
189949 |
0.03 |
| chr3_55782570_55784448 | 1.05 |
Nbea |
neurobeachin |
19 |
0.96 |
| chr13_59073511_59074258 | 1.05 |
Gm34245 |
predicted gene, 34245 |
4412 |
0.21 |
| chr2_31845659_31846019 | 1.05 |
Fibcd1 |
fibrinogen C domain containing 1 |
166 |
0.94 |
| chr7_128003842_128005372 | 1.05 |
Trim72 |
tripartite motif-containing 72 |
229 |
0.69 |
| chrX_96712746_96713886 | 1.04 |
Gpr165 |
G protein-coupled receptor 165 |
125 |
0.98 |
| chr5_142809290_142809906 | 1.04 |
Tnrc18 |
trinucleotide repeat containing 18 |
7782 |
0.18 |
| chr5_118422313_118422714 | 1.04 |
Gm26455 |
predicted gene, 26455 |
3695 |
0.24 |
| chr13_92793658_92795200 | 1.03 |
Thbs4 |
thrombospondin 4 |
389 |
0.88 |
| chr9_102505628_102506765 | 1.03 |
Ky |
kyphoscoliosis peptidase |
446 |
0.76 |
| chr9_95407637_95407788 | 1.02 |
Gm37805 |
predicted gene, 37805 |
251 |
0.83 |
| chrX_102252258_102252684 | 1.02 |
Gm14858 |
predicted gene 14858 |
51 |
0.79 |
| chr7_98837141_98837470 | 1.02 |
Wnt11 |
wingless-type MMTV integration site family, member 11 |
1540 |
0.35 |
| chr5_140383583_140384027 | 1.02 |
Snx8 |
sorting nexin 8 |
1072 |
0.42 |
| chr10_77515329_77515764 | 1.02 |
Fam207a |
family with sequence similarity 207, member A |
26 |
0.97 |
| chr2_70957412_70957563 | 1.01 |
Mettl8 |
methyltransferase like 8 |
15901 |
0.22 |
| chr12_56696306_56697413 | 1.01 |
Pax9 |
paired box 9 |
1130 |
0.43 |
| chr1_119033513_119034418 | 1.01 |
Gli2 |
GLI-Kruppel family member GLI2 |
19374 |
0.19 |
| chr4_58944015_58944496 | 1.00 |
Zkscan16 |
zinc finger with KRAB and SCAN domains 16 |
627 |
0.65 |
| chr1_82476331_82476482 | 1.00 |
Gm28940 |
predicted gene 28940 |
73660 |
0.08 |
| chr7_137303670_137304511 | 1.00 |
Ebf3 |
early B cell factor 3 |
9826 |
0.2 |
| chr8_64693021_64693260 | 0.99 |
Cpe |
carboxypeptidase E |
86 |
0.97 |
| chr1_111754310_111754466 | 0.99 |
Gm8173 |
predicted gene 8173 |
53387 |
0.15 |
| chr16_37780304_37780794 | 0.99 |
Fstl1 |
follistatin-like 1 |
3397 |
0.25 |
| chr15_23035608_23036941 | 0.98 |
Cdh18 |
cadherin 18 |
181 |
0.97 |
| chr5_26904124_26905425 | 0.98 |
Dpp6 |
dipeptidylpeptidase 6 |
79 |
0.98 |
| chr3_66220509_66221438 | 0.98 |
Ptx3 |
pentraxin related gene |
728 |
0.68 |
| chr15_32921720_32921871 | 0.97 |
Sdc2 |
syndecan 2 |
1072 |
0.66 |
| chr3_30226959_30227110 | 0.97 |
Gm38197 |
predicted gene, 38197 |
660 |
0.69 |
| chr11_69561237_69561500 | 0.96 |
Efnb3 |
ephrin B3 |
1163 |
0.24 |
| chr6_85125565_85126489 | 0.96 |
Gm5878 |
predicted gene 5878 |
98 |
0.92 |
| chr5_15934137_15934654 | 0.95 |
Cacna2d1 |
calcium channel, voltage-dependent, alpha2/delta subunit 1 |
296 |
0.81 |
| chr9_34485580_34486820 | 0.95 |
Kirrel3 |
kirre like nephrin family adhesion molecule 3 |
74 |
0.98 |
| chr11_88471993_88472144 | 0.95 |
Gm11510 |
predicted gene 11510 |
38554 |
0.16 |
| chr5_113799288_113800716 | 0.95 |
Tmem119 |
transmembrane protein 119 |
444 |
0.69 |
| chr15_76000604_76000808 | 0.95 |
Mapk15 |
mitogen-activated protein kinase 15 |
2335 |
0.12 |
| chrX_8205722_8206558 | 0.95 |
Porcn |
porcupine O-acyltransferase |
351 |
0.79 |
| chr11_98413510_98413723 | 0.95 |
Erbb2 |
erb-b2 receptor tyrosine kinase 2 |
1123 |
0.27 |
| chr16_97169746_97171103 | 0.94 |
Dscam |
DS cell adhesion molecule |
328 |
0.94 |
| chr15_35300127_35300802 | 0.94 |
Osr2 |
odd-skipped related 2 |
164 |
0.96 |
| chr13_52979287_52979774 | 0.94 |
Nfil3 |
nuclear factor, interleukin 3, regulated |
1543 |
0.37 |
| chr6_8352545_8353207 | 0.94 |
Gm16055 |
predicted gene 16055 |
11260 |
0.18 |
| chr13_34148530_34149640 | 0.94 |
Psmg4 |
proteasome (prosome, macropain) assembly chaperone 4 |
13879 |
0.11 |
| chr2_169621071_169621803 | 0.93 |
Gm34294 |
predicted gene, 34294 |
6881 |
0.21 |
| chrX_134295383_134296942 | 0.93 |
Tmem35a |
transmembrane protein 35A |
937 |
0.52 |
| chr4_102760289_102761654 | 0.93 |
Sgip1 |
SH3-domain GRB2-like (endophilin) interacting protein 1 |
446 |
0.87 |
| chr9_27301365_27301946 | 0.93 |
Igsf9b |
immunoglobulin superfamily, member 9B |
2427 |
0.29 |
| chr14_79768163_79769199 | 0.93 |
Gm9748 |
predicted gene 9748 |
1227 |
0.37 |
| chr3_102469696_102470976 | 0.93 |
Ngf |
nerve growth factor |
408 |
0.85 |
| chr11_33180535_33181290 | 0.92 |
Gm12115 |
predicted gene 12115 |
7993 |
0.14 |
| chr4_142909460_142909811 | 0.92 |
Gm37624 |
predicted gene, 37624 |
118827 |
0.06 |
| chr16_97165196_97166268 | 0.92 |
Dscam |
DS cell adhesion molecule |
5020 |
0.33 |
| chr19_47855022_47855868 | 0.92 |
Gsto1 |
glutathione S-transferase omega 1 |
313 |
0.86 |
| chr7_30293179_30293523 | 0.91 |
Clip3 |
CAP-GLY domain containing linker protein 3 |
1393 |
0.18 |
| chr17_48931592_48931796 | 0.91 |
Lrfn2 |
leucine rich repeat and fibronectin type III domain containing 2 |
685 |
0.8 |
| chr4_108879131_108880107 | 0.91 |
Rab3b |
RAB3B, member RAS oncogene family |
419 |
0.79 |
| chr8_26351790_26352322 | 0.91 |
Gm31784 |
predicted gene, 31784 |
39722 |
0.12 |
| chr5_114796198_114797306 | 0.91 |
Ankrd13a |
ankyrin repeat domain 13a |
1009 |
0.34 |
| chr9_78377654_78378912 | 0.90 |
Ooep |
oocyte expressed protein |
442 |
0.65 |
| chr4_82537238_82538846 | 0.90 |
Gm11266 |
predicted gene 11266 |
30026 |
0.16 |
| chrX_103013572_103014168 | 0.90 |
Pabpc1l2b-ps |
poly(A) binding protein, cytoplasmic 1-like 2B, pseudogene |
172 |
0.91 |
| chr9_56795792_56797095 | 0.89 |
Lingo1 |
leucine rich repeat and Ig domain containing 1 |
25 |
0.97 |
| chr16_72027587_72029370 | 0.89 |
Gm49667 |
predicted gene, 49667 |
149434 |
0.04 |
| chrX_103066797_103067364 | 0.89 |
Pabpc1l2a-ps |
poly(A) binding protein, cytoplasmic 1-like 2A, pseudogene |
100 |
0.94 |
| chr9_107378260_107378857 | 0.89 |
Cacna2d2 |
calcium channel, voltage-dependent, alpha 2/delta subunit 2 |
21054 |
0.09 |
| chr4_80864501_80865110 | 0.88 |
Tyrp1 |
tyrosinase-related protein 1 |
18217 |
0.24 |
| chr5_129225715_129226283 | 0.88 |
Rps16-ps2 |
ribosomal protein S16, pseudogene 2 |
97482 |
0.07 |
| chr9_35423074_35423780 | 0.87 |
Cdon |
cell adhesion molecule-related/down-regulated by oncogenes |
161 |
0.95 |
| chr18_58836090_58837117 | 0.87 |
Adamts19 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 19 |
64 |
0.98 |
| chr2_91118182_91118787 | 0.87 |
Mybpc3 |
myosin binding protein C, cardiac |
340 |
0.81 |
| chr18_81652536_81652944 | 0.86 |
Gm50414 |
predicted gene, 50414 |
3799 |
0.23 |
| chr15_76008932_76009458 | 0.86 |
Fam83h |
family with sequence similarity 83, member H |
303 |
0.65 |
| chr5_52626242_52626695 | 0.86 |
8030423F21Rik |
RIKEN cDNA 8030423F21 gene |
7456 |
0.17 |
| chr19_22303930_22304421 | 0.86 |
Gm22506 |
predicted gene, 22506 |
68557 |
0.12 |
| chr8_26979573_26979946 | 0.86 |
Gm45371 |
predicted gene 45371 |
242 |
0.84 |
| chr4_36952312_36953412 | 0.85 |
Gm12371 |
predicted gene 12371 |
104 |
0.95 |
| chr7_16944715_16945918 | 0.85 |
Pnmal2 |
PNMA-like 2 |
634 |
0.52 |
| chr12_36315313_36316308 | 0.85 |
Sostdc1 |
sclerostin domain containing 1 |
1671 |
0.31 |
| chrX_52163454_52163922 | 0.85 |
Gpc4 |
glypican 4 |
1564 |
0.53 |
| chr10_62500170_62500357 | 0.85 |
Srgn |
serglycin |
7492 |
0.14 |
| chr19_43385959_43387401 | 0.85 |
Hpse2 |
heparanase 2 |
1574 |
0.38 |
| chr15_89179563_89180686 | 0.84 |
Plxnb2 |
plexin B2 |
664 |
0.5 |
| chr1_72824497_72825693 | 0.84 |
Igfbp2 |
insulin-like growth factor binding protein 2 |
227 |
0.94 |
| chr12_111348219_111348370 | 0.84 |
Cdc42bpb |
CDC42 binding protein kinase beta |
29325 |
0.12 |
| chr15_18820164_18820708 | 0.84 |
Cdh10 |
cadherin 10 |
107 |
0.96 |
| chr13_55484574_55485692 | 0.83 |
Dbn1 |
drebrin 1 |
1164 |
0.26 |
| chr6_118196646_118197798 | 0.83 |
Ret |
ret proto-oncogene |
89 |
0.97 |
| chrX_99819763_99820518 | 0.83 |
Tmem28 |
transmembrane protein 28 |
881 |
0.67 |
| chr3_158559356_158560580 | 0.82 |
Lrrc7 |
leucine rich repeat containing 7 |
1368 |
0.57 |
| chr1_59256787_59257190 | 0.82 |
Cdk15 |
cyclin-dependent kinase 15 |
81 |
0.97 |
| chr18_60646910_60648302 | 0.82 |
Synpo |
synaptopodin |
666 |
0.69 |
| chr12_52700044_52701597 | 0.82 |
Akap6 |
A kinase (PRKA) anchor protein 6 |
1437 |
0.46 |
| chr2_110360491_110361293 | 0.82 |
Fibin |
fin bud initiation factor homolog (zebrafish) |
2291 |
0.34 |
| chr13_53284900_53286176 | 0.82 |
Ror2 |
receptor tyrosine kinase-like orphan receptor 2 |
11 |
0.99 |
| chr14_24508128_24508741 | 0.81 |
Rps24 |
ribosomal protein S24 |
17285 |
0.15 |
| chr7_136496225_136497028 | 0.81 |
Gm36849 |
predicted gene, 36849 |
143262 |
0.04 |
| chr11_94944762_94944984 | 0.81 |
Col1a1 |
collagen, type I, alpha 1 |
495 |
0.69 |
| chr15_66891047_66892576 | 0.81 |
Ccn4 |
cellular communication network factor 4 |
303 |
0.9 |
| chr5_146384940_146385730 | 0.81 |
Wasf3 |
WAS protein family, member 3 |
350 |
0.88 |
| chr19_4615156_4615780 | 0.81 |
Lrfn4 |
leucine rich repeat and fibronectin type III domain containing 4 |
34 |
0.96 |
| chr3_89226055_89227441 | 0.80 |
Mtx1 |
metaxin 1 |
304 |
0.42 |
| chr1_163308490_163310681 | 0.80 |
Gm37644 |
predicted gene, 37644 |
518 |
0.77 |
| chr15_94629079_94629906 | 0.80 |
Tmem117 |
transmembrane protein 117 |
242 |
0.94 |
| chr11_76435834_76437863 | 0.80 |
Abr |
active BCR-related gene |
372 |
0.87 |
| chr10_122887302_122887925 | 0.79 |
Ppm1h |
protein phosphatase 1H (PP2C domain containing) |
7755 |
0.23 |
| chr11_63889023_63889728 | 0.79 |
Hs3st3b1 |
heparan sulfate (glucosamine) 3-O-sulfotransferase 3B1 |
32915 |
0.16 |
| chr4_137578157_137578751 | 0.79 |
Ldlrad2 |
low density lipoprotein receptor class A domain containing 2 |
3274 |
0.19 |
| chr19_5741562_5742690 | 0.79 |
Ltbp3 |
latent transforming growth factor beta binding protein 3 |
231 |
0.8 |
| chr3_86547946_86548654 | 0.79 |
Mab21l2 |
mab-21-like 2 |
17 |
0.56 |
| chr12_11437979_11438398 | 0.79 |
4930511A02Rik |
RIKEN cDNA 4930511A02 gene |
39 |
0.96 |
| chr16_60605121_60606481 | 0.78 |
Gm9017 |
predicted gene 9017 |
46 |
0.78 |
| chr4_149675232_149676050 | 0.78 |
Pik3cd |
phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit delta |
16 |
0.97 |
| chr9_72925072_72926177 | 0.78 |
Pygo1 |
pygopus 1 |
21 |
0.95 |
| chr16_4594840_4595952 | 0.78 |
Glis2 |
GLIS family zinc finger 2 |
683 |
0.58 |
| chr10_73099097_73100287 | 0.78 |
Pcdh15 |
protocadherin 15 |
239 |
0.94 |
| chr10_83533259_83534384 | 0.78 |
Aldh1l2 |
aldehyde dehydrogenase 1 family, member L2 |
260 |
0.93 |
| chr6_94592745_94593176 | 0.78 |
Lrig1 |
leucine-rich repeats and immunoglobulin-like domains 1 |
12433 |
0.18 |
| chr16_44615706_44615857 | 0.78 |
Boc |
biregional cell adhesion molecule-related/down-regulated by oncogenes (Cdon) binding protein |
56884 |
0.11 |
| chr4_49844475_49845850 | 0.78 |
Grin3a |
glutamate receptor ionotropic, NMDA3A |
387 |
0.91 |
| chr5_122104473_122104883 | 0.77 |
Myl2 |
myosin, light polypeptide 2, regulatory, cardiac, slow |
765 |
0.56 |
| chr5_115475784_115476389 | 0.77 |
Sirt4 |
sirtuin 4 |
3852 |
0.1 |
| chr6_94678675_94678876 | 0.77 |
Lrig1 |
leucine-rich repeats and immunoglobulin-like domains 1 |
90 |
0.98 |
| chr11_117949174_117950164 | 0.76 |
Socs3 |
suppressor of cytokine signaling 3 |
19517 |
0.12 |
| chr5_126768981_126769769 | 0.76 |
Gm33347 |
predicted gene, 33347 |
42091 |
0.14 |
| chr5_74197172_74198949 | 0.76 |
Rasl11b |
RAS-like, family 11, member B |
169 |
0.94 |
| chr3_101161574_101162321 | 0.76 |
Gm12486 |
predicted gene 12486 |
45452 |
0.11 |
| chrX_52609028_52609293 | 0.76 |
Gpc3 |
glypican 3 |
4761 |
0.22 |
| chr1_5916517_5917959 | 0.76 |
Npbwr1 |
neuropeptides B/W receptor 1 |
160 |
0.97 |
| chr11_116918523_116918759 | 0.76 |
Mgat5b |
mannoside acetylglucosaminyltransferase 5, isoenzyme B |
222 |
0.92 |
| chr6_126752433_126752846 | 0.76 |
Kcna6 |
potassium voltage-gated channel, shaker-related, subfamily, member 6 |
11965 |
0.16 |
| chr1_37719928_37720522 | 0.75 |
2010300C02Rik |
RIKEN cDNA 2010300C02 gene |
140 |
0.96 |
| chr12_117688775_117690161 | 0.75 |
Rapgef5 |
Rap guanine nucleotide exchange factor (GEF) 5 |
512 |
0.83 |
| chr10_89872886_89874317 | 0.75 |
Anks1b |
ankyrin repeat and sterile alpha motif domain containing 1B |
37 |
0.98 |
| chr11_111068351_111069422 | 0.75 |
Kcnj2 |
potassium inwardly-rectifying channel, subfamily J, member 2 |
2722 |
0.38 |
| chr5_110543976_110545228 | 0.75 |
Galnt9 |
polypeptide N-acetylgalactosaminyltransferase 9 |
247 |
0.9 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.9 | GO:0030070 | insulin processing(GO:0030070) |
| 0.5 | 1.4 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.5 | 0.5 | GO:0072048 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
| 0.4 | 1.3 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.4 | 1.3 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.4 | 1.7 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.4 | 1.2 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.4 | 1.6 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
| 0.4 | 1.2 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.4 | 1.1 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
| 0.4 | 1.1 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.4 | 0.7 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.3 | 1.7 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
| 0.3 | 1.7 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.3 | 0.3 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
| 0.3 | 0.9 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.3 | 0.9 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.3 | 0.9 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.3 | 0.9 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.3 | 0.9 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.3 | 0.8 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
| 0.3 | 1.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.3 | 0.5 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
| 0.3 | 0.8 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.3 | 1.3 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.3 | 0.8 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 0.2 | 0.2 | GO:0060592 | mammary gland formation(GO:0060592) |
| 0.2 | 1.0 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
| 0.2 | 0.7 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.2 | 0.7 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.2 | 0.7 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.2 | 0.5 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.2 | 0.7 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
| 0.2 | 0.7 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.2 | 1.2 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.2 | 0.9 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.2 | 0.7 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
| 0.2 | 0.7 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.2 | 0.7 | GO:0052203 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.2 | 0.4 | GO:0071415 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
| 0.2 | 2.0 | GO:0021559 | trigeminal nerve development(GO:0021559) |
| 0.2 | 1.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.2 | 0.6 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
| 0.2 | 0.4 | GO:0061198 | fungiform papilla formation(GO:0061198) |
| 0.2 | 0.8 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.2 | 1.2 | GO:0014819 | regulation of skeletal muscle contraction(GO:0014819) |
| 0.2 | 0.4 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.2 | 0.2 | GO:0072197 | ureter morphogenesis(GO:0072197) |
| 0.2 | 0.6 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 0.2 | 0.2 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
| 0.2 | 0.6 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) |
| 0.2 | 0.6 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.2 | 1.7 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.2 | 1.9 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.2 | 0.6 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.2 | 0.8 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
| 0.2 | 0.9 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.2 | 0.4 | GO:0007403 | glial cell fate determination(GO:0007403) |
| 0.2 | 0.5 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.2 | 0.7 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.2 | 0.4 | GO:0043465 | regulation of fermentation(GO:0043465) regulation of NAD metabolic process(GO:1902688) regulation of glucose catabolic process to lactate via pyruvate(GO:1904023) |
| 0.2 | 0.5 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.2 | 0.5 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.2 | 0.9 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.2 | 1.2 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.2 | 1.2 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.2 | 0.7 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.2 | 0.5 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.2 | 0.6 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.2 | 1.6 | GO:0060013 | righting reflex(GO:0060013) |
| 0.2 | 0.8 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.2 | 0.3 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.2 | 0.5 | GO:0032097 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
| 0.1 | 0.6 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.1 | 0.3 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
| 0.1 | 0.4 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.1 | 1.0 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.1 | 0.4 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.1 | 0.8 | GO:1903012 | positive regulation of bone development(GO:1903012) |
| 0.1 | 0.4 | GO:0097107 | postsynaptic density organization(GO:0097106) postsynaptic density assembly(GO:0097107) |
| 0.1 | 0.4 | GO:0060174 | limb bud formation(GO:0060174) |
| 0.1 | 0.3 | GO:0086043 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 0.1 | 0.7 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.1 | 1.5 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.1 | 0.4 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
| 0.1 | 0.3 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.1 | 1.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.1 | 0.3 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
| 0.1 | 0.7 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
| 0.1 | 0.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.1 | 0.4 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
| 0.1 | 0.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.1 | 0.3 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
| 0.1 | 1.9 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.1 | 0.4 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
| 0.1 | 0.1 | GO:0060372 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
| 0.1 | 0.2 | GO:0010511 | regulation of phosphatidylinositol biosynthetic process(GO:0010511) |
| 0.1 | 0.5 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.1 | 0.4 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
| 0.1 | 1.3 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.1 | 0.5 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.1 | 0.2 | GO:0072107 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
| 0.1 | 0.4 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.1 | 0.2 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.1 | 0.4 | GO:0042628 | mating plug formation(GO:0042628) post-mating behavior(GO:0045297) |
| 0.1 | 0.2 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.1 | 0.6 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.1 | 0.8 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.1 | 0.1 | GO:0021586 | pons maturation(GO:0021586) |
| 0.1 | 0.2 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.1 | 0.5 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.1 | 0.5 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.1 | 0.5 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.1 | 0.3 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.1 | 0.3 | GO:0003383 | apical constriction(GO:0003383) |
| 0.1 | 0.8 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.1 | 0.4 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.1 | 0.3 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.1 | 1.9 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.1 | 0.3 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.1 | 1.0 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.1 | 0.4 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.1 | 0.6 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
| 0.1 | 0.9 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.1 | 0.7 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.1 | 0.2 | GO:0035989 | tendon development(GO:0035989) |
| 0.1 | 0.3 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.1 | 0.5 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.1 | 0.3 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
| 0.1 | 0.2 | GO:1903011 | negative regulation of bone development(GO:1903011) |
| 0.1 | 0.3 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.1 | 0.3 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.1 | 0.3 | GO:0048840 | otolith development(GO:0048840) |
| 0.1 | 0.2 | GO:2000053 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
| 0.1 | 1.5 | GO:0045540 | regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.1 | 0.3 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.1 | 0.5 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.3 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.1 | 0.6 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 0.2 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 | 0.8 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
| 0.1 | 0.3 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.1 | 1.2 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
| 0.1 | 0.2 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.1 | 0.6 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
| 0.1 | 0.3 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
| 0.1 | 0.3 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.1 | 0.2 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.1 | 0.4 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.1 | 0.4 | GO:2001023 | regulation of response to drug(GO:2001023) |
| 0.1 | 0.4 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.1 | 0.3 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
| 0.1 | 0.4 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
| 0.1 | 0.4 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.1 | 0.1 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
| 0.1 | 0.3 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.1 | 0.1 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
| 0.1 | 0.4 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.1 | 0.3 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 0.3 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.1 | 1.6 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.1 | 0.3 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
| 0.1 | 0.4 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.1 | 0.7 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.1 | 0.5 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.1 | 0.7 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.1 | 0.3 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
| 0.1 | 0.4 | GO:2001182 | regulation of interleukin-12 secretion(GO:2001182) |
| 0.1 | 0.6 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
| 0.1 | 0.2 | GO:1904395 | positive regulation of postsynaptic membrane organization(GO:1901628) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 0.1 | 0.3 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.1 | 0.2 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.1 | 0.2 | GO:0003051 | angiotensin-mediated drinking behavior(GO:0003051) |
| 0.1 | 0.3 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.1 | 0.2 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.1 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.1 | 0.3 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 | 0.2 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.1 | 0.2 | GO:1903207 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
| 0.1 | 0.2 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.1 | 0.3 | GO:0060502 | epithelial cell proliferation involved in lung morphogenesis(GO:0060502) |
| 0.1 | 0.2 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.1 | 0.5 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
| 0.1 | 0.2 | GO:0043622 | cortical microtubule organization(GO:0043622) |
| 0.1 | 0.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.1 | 0.3 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.1 | 0.5 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.1 | 0.2 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.1 | 0.1 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 | 1.0 | GO:0060384 | innervation(GO:0060384) |
| 0.1 | 0.1 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.1 | 0.2 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.1 | 0.3 | GO:0061743 | motor learning(GO:0061743) |
| 0.1 | 0.1 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.1 | 0.1 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
| 0.1 | 0.2 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.1 | 0.4 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.1 | 0.2 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.1 | 0.2 | GO:2000851 | positive regulation of glucocorticoid secretion(GO:2000851) |
| 0.1 | 0.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.1 | 0.2 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.1 | 5.8 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
| 0.1 | 0.2 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.1 | 0.3 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.1 | 0.4 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.1 | 0.2 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
| 0.1 | 0.2 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 | 0.9 | GO:0031643 | positive regulation of myelination(GO:0031643) |
| 0.1 | 0.4 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.1 | 0.3 | GO:0042637 | catagen(GO:0042637) |
| 0.1 | 0.5 | GO:0030825 | positive regulation of cGMP metabolic process(GO:0030825) |
| 0.1 | 0.3 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
| 0.1 | 0.1 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 0.1 | 0.2 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 0.1 | 0.1 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.1 | 0.1 | GO:0015744 | succinate transport(GO:0015744) |
| 0.1 | 0.3 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.1 | 0.1 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
| 0.1 | 0.2 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.1 | 0.2 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.1 | 0.2 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.1 | 0.2 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.1 | 0.4 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
| 0.1 | 0.1 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
| 0.1 | 0.2 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 0.1 | 0.1 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.1 | 0.2 | GO:0043584 | nose development(GO:0043584) |
| 0.1 | 0.2 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.1 | 0.2 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.1 | 0.1 | GO:0032811 | negative regulation of epinephrine secretion(GO:0032811) |
| 0.1 | 0.4 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.1 | 0.5 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 0.1 | 0.2 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.1 | 0.2 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.1 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.1 | 0.1 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.1 | 0.2 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.1 | 0.2 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.1 | 0.3 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.1 | 0.1 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.1 | 0.1 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.1 | 0.3 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.1 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 0.2 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.1 | 0.1 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.1 | 0.1 | GO:0090148 | membrane fission(GO:0090148) |
| 0.1 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.1 | 0.2 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 | 0.3 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.1 | 0.4 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
| 0.1 | 0.2 | GO:0010979 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.1 | 0.3 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 0.1 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
| 0.1 | 0.2 | GO:0046929 | negative regulation of neurotransmitter secretion(GO:0046929) |
| 0.1 | 0.2 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.1 | 0.1 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.1 | 0.1 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.1 | 0.7 | GO:0045056 | transcytosis(GO:0045056) |
| 0.1 | 0.9 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 0.4 | GO:1902287 | semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
| 0.1 | 0.5 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.1 | 0.3 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.1 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.1 | 0.1 | GO:1901321 | positive regulation of heart induction(GO:1901321) |
| 0.1 | 0.1 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
| 0.1 | 0.1 | GO:0002447 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
| 0.1 | 0.2 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.1 | 0.1 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
| 0.1 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 0.3 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
| 0.1 | 1.0 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.1 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 0.1 | 0.4 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 | 0.3 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.0 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.0 | 0.1 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 | 0.3 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
| 0.0 | 0.2 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 | 0.6 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
| 0.0 | 0.5 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.0 | 0.3 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 1.4 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.0 | 0.2 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.0 | 2.3 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
| 0.0 | 0.7 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
| 0.0 | 0.4 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 | 0.1 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.0 | 0.1 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.0 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.0 | 0.2 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.1 | GO:0071727 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
| 0.0 | 0.1 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.0 | 0.2 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.0 | 0.3 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.0 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 0.0 | 0.1 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
| 0.0 | 0.4 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.0 | 0.4 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.0 | 0.1 | GO:0072423 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) |
| 0.0 | 0.2 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.0 | 0.3 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.3 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
| 0.0 | 0.2 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.1 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.0 | 0.1 | GO:0002339 | B cell selection(GO:0002339) |
| 0.0 | 0.5 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.0 | 0.1 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
| 0.0 | 0.2 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
| 0.0 | 0.2 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.0 | 0.5 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.0 | 0.9 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.0 | 0.4 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
| 0.0 | 0.2 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.0 | 0.4 | GO:0001553 | luteinization(GO:0001553) |
| 0.0 | 0.2 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
| 0.0 | 1.1 | GO:0007528 | neuromuscular junction development(GO:0007528) |
| 0.0 | 0.3 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.0 | 0.0 | GO:0060594 | mammary gland specification(GO:0060594) |
| 0.0 | 0.5 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.0 | 0.1 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.0 | 0.5 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.0 | 0.2 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.0 | 0.3 | GO:0045738 | negative regulation of DNA repair(GO:0045738) |
| 0.0 | 0.3 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.0 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.0 | 0.2 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.0 | 0.0 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
| 0.0 | 0.2 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.0 | 0.7 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.0 | 0.0 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.0 | 0.0 | GO:0072199 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.0 | 0.1 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.0 | 0.2 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.0 | 0.1 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.0 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.0 | 0.2 | GO:0015871 | choline transport(GO:0015871) |
| 0.0 | 0.2 | GO:0010388 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
| 0.0 | 0.2 | GO:0042891 | antibiotic transport(GO:0042891) |
| 0.0 | 0.2 | GO:0046010 | positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
| 0.0 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.0 | 0.3 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.1 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
| 0.0 | 0.1 | GO:0003096 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.1 | GO:0032803 | low-density lipoprotein particle receptor catabolic process(GO:0032802) regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
| 0.0 | 0.0 | GO:0050705 | regulation of interleukin-1 alpha secretion(GO:0050705) |
| 0.0 | 0.1 | GO:0010446 | response to alkaline pH(GO:0010446) |
| 0.0 | 1.1 | GO:0060612 | adipose tissue development(GO:0060612) |
| 0.0 | 0.5 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.0 | 0.1 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.0 | 0.2 | GO:0031000 | response to caffeine(GO:0031000) |
| 0.0 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.0 | 0.1 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
| 0.0 | 0.3 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
| 0.0 | 0.0 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.0 | 0.1 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 | 0.3 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
| 0.0 | 0.1 | GO:0014721 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
| 0.0 | 0.1 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.0 | 0.5 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.1 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.0 | 0.0 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.0 | 0.6 | GO:0035088 | establishment or maintenance of apical/basal cell polarity(GO:0035088) establishment or maintenance of bipolar cell polarity(GO:0061245) |
| 0.0 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.0 | 0.2 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.0 | 0.1 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.0 | 0.2 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 0.4 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.1 | GO:0046865 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
| 0.0 | 0.1 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.0 | 0.1 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
| 0.0 | 0.1 | GO:0051140 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
| 0.0 | 0.1 | GO:0034350 | regulation of glial cell apoptotic process(GO:0034350) |
| 0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.0 | 0.0 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
| 0.0 | 0.3 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
| 0.0 | 0.2 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.0 | 0.1 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.0 | 0.2 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.0 | 0.1 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
| 0.0 | 0.1 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.0 | 0.1 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
| 0.0 | 0.6 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.0 | 0.4 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.3 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.0 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.0 | 0.7 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.3 | GO:0090103 | cochlea morphogenesis(GO:0090103) |
| 0.0 | 0.3 | GO:0043206 | extracellular fibril organization(GO:0043206) |
| 0.0 | 0.1 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 0.3 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.0 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.0 | 0.2 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.0 | 0.1 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.1 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.0 | 0.1 | GO:0060437 | lung growth(GO:0060437) |
| 0.0 | 0.2 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.0 | 0.2 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.0 | 0.3 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
| 0.0 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.0 | 0.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.0 | 0.2 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
| 0.0 | 0.0 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.0 | 0.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.0 | 0.1 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.0 | 0.2 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
| 0.0 | 0.1 | GO:1901626 | regulation of postsynaptic membrane organization(GO:1901626) |
| 0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.0 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.0 | 0.0 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.0 | 0.1 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.0 | 0.1 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
| 0.0 | 0.1 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
| 0.0 | 0.2 | GO:0090181 | regulation of cholesterol metabolic process(GO:0090181) |
| 0.0 | 0.6 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.1 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
| 0.0 | 0.1 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
| 0.0 | 0.0 | GO:0003140 | determination of left/right asymmetry in lateral mesoderm(GO:0003140) |
| 0.0 | 0.0 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
| 0.0 | 0.4 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.0 | 0.1 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.0 | 0.1 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.0 | 0.5 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
| 0.0 | 0.1 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.1 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.0 | 0.1 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.0 | 0.0 | GO:0003211 | cardiac ventricle formation(GO:0003211) |
| 0.0 | 0.6 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
| 0.0 | 0.1 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.2 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.0 | 0.3 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.0 | 0.1 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.0 | 0.0 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
| 0.0 | 0.2 | GO:0060965 | negative regulation of posttranscriptional gene silencing(GO:0060149) negative regulation of gene silencing by miRNA(GO:0060965) negative regulation of gene silencing by RNA(GO:0060967) |
| 0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.1 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
| 0.0 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.0 | 0.1 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.0 | 0.1 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 0.0 | 0.1 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 0.0 | GO:0090045 | positive regulation of deacetylase activity(GO:0090045) |
| 0.0 | 0.0 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.0 | 0.1 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.0 | 1.1 | GO:0001578 | microtubule bundle formation(GO:0001578) |
| 0.0 | 0.1 | GO:0018214 | protein carboxylation(GO:0018214) |
| 0.0 | 0.2 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.0 | 0.3 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.0 | 0.0 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
| 0.0 | 0.5 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.0 | 0.1 | GO:0030049 | muscle filament sliding(GO:0030049) |
| 0.0 | 0.4 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
| 0.0 | 0.5 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
| 0.0 | 0.2 | GO:1902224 | ketone body metabolic process(GO:1902224) |
| 0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
| 0.0 | 0.0 | GO:0071873 | response to norepinephrine(GO:0071873) |
| 0.0 | 0.2 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.1 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.0 | 1.2 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.0 | 0.5 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.0 | 0.1 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.0 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
| 0.0 | 0.6 | GO:0007019 | microtubule depolymerization(GO:0007019) |
| 0.0 | 0.0 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.1 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.0 | 0.1 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.0 | 0.0 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.0 | 0.4 | GO:0061005 | cell differentiation involved in kidney development(GO:0061005) |
| 0.0 | 0.2 | GO:0030033 | microvillus assembly(GO:0030033) |
| 0.0 | 0.2 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.1 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 0.0 | 0.3 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 0.0 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.0 | 0.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.0 | 0.1 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.1 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.0 | 0.1 | GO:0061083 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
| 0.0 | 0.1 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.2 | GO:1904867 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 0.0 | 0.2 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.0 | 0.1 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.0 | 0.1 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
| 0.0 | 0.0 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
| 0.0 | 0.1 | GO:0021910 | smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021910) |
| 0.0 | 0.0 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.0 | 0.1 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
| 0.0 | 0.1 | GO:0071866 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.0 | 0.2 | GO:1902803 | regulation of synaptic vesicle transport(GO:1902803) |
| 0.0 | 0.1 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.0 | 0.0 | GO:0044243 | multicellular organism catabolic process(GO:0044243) |
| 0.0 | 0.1 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.2 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.0 | 0.2 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.0 | 0.1 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
| 0.0 | 0.0 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
| 0.0 | 0.1 | GO:0051932 | synaptic transmission, GABAergic(GO:0051932) |
| 0.0 | 0.0 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 0.0 | 0.1 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.0 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.0 | 0.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
| 0.0 | 0.1 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.0 | 0.1 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.0 | 0.1 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.0 | 0.2 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
| 0.0 | 0.0 | GO:0072201 | negative regulation of mesenchymal cell proliferation(GO:0072201) |
| 0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.1 | GO:0045760 | positive regulation of action potential(GO:0045760) |
| 0.0 | 0.1 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.0 | 0.1 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.0 | 0.1 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
| 0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.1 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.0 | 0.1 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.0 | 0.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.0 | GO:0033275 | actin-myosin filament sliding(GO:0033275) |
| 0.0 | 0.0 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
| 0.0 | 0.1 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.0 | 0.0 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.0 | 0.0 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.0 | 0.0 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) |
| 0.0 | 0.3 | GO:0035249 | synaptic transmission, glutamatergic(GO:0035249) |
| 0.0 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.0 | 0.0 | GO:0021978 | telencephalon regionalization(GO:0021978) |
| 0.0 | 0.0 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.1 | GO:2000826 | regulation of heart morphogenesis(GO:2000826) |
| 0.0 | 0.1 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.0 | 0.2 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.0 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.0 | 0.0 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
| 0.0 | 0.2 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.1 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.0 | 0.0 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.0 | 0.0 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.0 | GO:0008334 | histone mRNA metabolic process(GO:0008334) histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.1 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.1 | GO:1904729 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
| 0.0 | 0.0 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.0 | 0.0 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.1 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.0 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 | 0.1 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
| 0.0 | 0.0 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.0 | 0.0 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.0 | 0.0 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.0 | 0.1 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.0 | 0.0 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.0 | 0.0 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.0 | 0.0 | GO:0003352 | regulation of cilium movement(GO:0003352) |
| 0.0 | 0.2 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.0 | 0.2 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
| 0.0 | 0.0 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
| 0.0 | 0.0 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
| 0.0 | 0.0 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.0 | 0.0 | GO:0002894 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.0 | 0.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 | 0.1 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 | 0.0 | GO:0009642 | response to light intensity(GO:0009642) |
| 0.0 | 0.0 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.0 | 0.1 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
| 0.0 | 0.0 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 0.0 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.0 | 0.2 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.0 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.0 | 0.0 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.0 | 0.3 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 | 0.0 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 | 0.0 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.0 | 0.2 | GO:0048265 | response to pain(GO:0048265) |
| 0.0 | 0.1 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.0 | 0.0 | GO:0072174 | metanephric tubule formation(GO:0072174) |
| 0.0 | 0.0 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.0 | 0.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.0 | 0.0 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.1 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.0 | 0.0 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.0 | 0.0 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.0 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.0 | 0.2 | GO:0030514 | negative regulation of BMP signaling pathway(GO:0030514) |
| 0.0 | 0.0 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
| 0.0 | 0.1 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.0 | 0.1 | GO:0014002 | astrocyte development(GO:0014002) |
| 0.0 | 0.1 | GO:0035994 | response to muscle stretch(GO:0035994) |
| 0.0 | 0.0 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.0 | 0.1 | GO:2000501 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.0 | 0.1 | GO:0035115 | embryonic forelimb morphogenesis(GO:0035115) |
| 0.0 | 0.0 | GO:0034331 | cell junction maintenance(GO:0034331) |
| 0.0 | 0.0 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.0 | 0.0 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.0 | 0.2 | GO:0061462 | protein localization to lysosome(GO:0061462) |
| 0.0 | 0.1 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 | 0.1 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
| 0.0 | 0.1 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.0 | 0.1 | GO:0051205 | protein insertion into membrane(GO:0051205) |
| 0.0 | 0.1 | GO:0007614 | short-term memory(GO:0007614) |
| 0.0 | 0.0 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.0 | 0.0 | GO:2000553 | positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
| 0.0 | 0.0 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.0 | 0.1 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.0 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
| 0.0 | 0.1 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
| 0.0 | 0.0 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.0 | 0.1 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.0 | 0.0 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
| 0.0 | 0.0 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.0 | 0.0 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
| 0.0 | 0.0 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.0 | 0.0 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.0 | 0.0 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
| 0.0 | 0.0 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 0.0 | 0.0 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.0 | 0.2 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.0 | 0.0 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
| 0.0 | 0.0 | GO:0072610 | interleukin-12 secretion(GO:0072610) |
| 0.0 | 0.1 | GO:0060055 | angiogenesis involved in wound healing(GO:0060055) |
| 0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.0 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.0 | 0.0 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.0 | 0.0 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 | 0.1 | GO:0042670 | retinal cone cell differentiation(GO:0042670) |
| 0.0 | 0.0 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
| 0.0 | 0.1 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.0 | 0.0 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.0 | 0.0 | GO:0002254 | kinin cascade(GO:0002254) |
| 0.0 | 0.0 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.0 | 0.1 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.0 | GO:1903416 | response to glycoside(GO:1903416) |
| 0.0 | 0.0 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.0 | 0.1 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
| 0.0 | 0.0 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.0 | 0.1 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 0.0 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.0 | 0.0 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.0 | 0.1 | GO:0051194 | positive regulation of nucleotide catabolic process(GO:0030813) positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.0 | 0.0 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.0 | 0.0 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.0 | 0.1 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.0 | GO:0044393 | microspike(GO:0044393) |
| 0.3 | 0.9 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.3 | 0.9 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.2 | 0.7 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.2 | 1.1 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.2 | 0.6 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.2 | 2.7 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.2 | 1.4 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.2 | 2.4 | GO:0031045 | dense core granule(GO:0031045) |
| 0.2 | 1.3 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 0.2 | 0.5 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.2 | 0.2 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.2 | 0.5 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.2 | 1.2 | GO:0005883 | neurofilament(GO:0005883) |
| 0.2 | 0.3 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.1 | 0.9 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.1 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.1 | 0.4 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.1 | 1.0 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.1 | 1.2 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 0.2 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
| 0.1 | 0.4 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.1 | 0.4 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.1 | 0.6 | GO:0000235 | astral microtubule(GO:0000235) |
| 0.1 | 1.4 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.1 | 0.8 | GO:0016342 | catenin complex(GO:0016342) |
| 0.1 | 2.3 | GO:0005922 | connexon complex(GO:0005922) |
| 0.1 | 0.2 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 0.4 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.1 | 1.3 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.1 | 0.8 | GO:0043219 | lateral loop(GO:0043219) |
| 0.1 | 0.5 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.1 | 0.5 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.1 | 0.7 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.1 | 0.5 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 0.5 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.1 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.1 | 0.3 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.1 | 0.3 | GO:0044308 | axonal spine(GO:0044308) |
| 0.1 | 0.3 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.1 | 0.1 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.1 | 1.3 | GO:0031430 | M band(GO:0031430) |
| 0.1 | 0.3 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.1 | 2.4 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.1 | 0.5 | GO:0016012 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
| 0.1 | 0.4 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.1 | 3.5 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.1 | 0.1 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.1 | 0.5 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 0.4 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.1 | 0.3 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 0.2 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.1 | 0.4 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.1 | 0.5 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.8 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.1 | 0.6 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.1 | 0.4 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 0.6 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.1 | 0.6 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.1 | 0.5 | GO:0005861 | troponin complex(GO:0005861) |
| 0.1 | 0.1 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.1 | 0.3 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.1 | 0.6 | GO:0005921 | gap junction(GO:0005921) |
| 0.1 | 0.2 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 0.8 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.1 | 3.6 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.1 | 1.2 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.1 | 0.4 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.1 | 0.3 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.1 | 0.2 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.1 | 0.1 | GO:0034705 | potassium channel complex(GO:0034705) |
| 0.1 | 0.3 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 0.1 | 0.5 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.1 | 2.3 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.1 | 0.5 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.1 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.1 | 0.2 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.1 | 0.3 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 0.1 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.0 | 3.4 | GO:0030018 | Z disc(GO:0030018) |
| 0.0 | 0.1 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.0 | 0.5 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.0 | 0.3 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
| 0.0 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.0 | 0.2 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.6 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.5 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 0.2 | GO:0043218 | compact myelin(GO:0043218) |
| 0.0 | 6.4 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.0 | 0.2 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.0 | 0.7 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.0 | 0.6 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.0 | 0.4 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
| 0.0 | 0.5 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.2 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 1.1 | GO:0016459 | myosin complex(GO:0016459) |
| 0.0 | 0.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.0 | 0.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.0 | 0.8 | GO:0014704 | intercalated disc(GO:0014704) |
| 0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
| 0.0 | 0.3 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 0.2 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.0 | 0.1 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.0 | 0.2 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.0 | 0.1 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.0 | 0.4 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
| 0.0 | 0.4 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.1 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.0 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
| 0.0 | 0.1 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.0 | 0.1 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.0 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 0.1 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.9 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 3.5 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 0.2 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.0 | 0.3 | GO:0005605 | basal lamina(GO:0005605) |
| 0.0 | 0.5 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 8.2 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.0 | 0.3 | GO:0030663 | COPI vesicle coat(GO:0030126) COPI-coated vesicle membrane(GO:0030663) |
| 0.0 | 0.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.0 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.0 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.0 | 0.3 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.0 | 0.3 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 0.2 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.0 | 0.2 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.3 | GO:0061702 | inflammasome complex(GO:0061702) |
| 0.0 | 0.0 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.0 | 0.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.1 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 0.2 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 0.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.4 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.1 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.0 | 1.4 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.0 | 0.7 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.3 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 0.2 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.3 | GO:0097060 | synaptic membrane(GO:0097060) |
| 0.0 | 0.1 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 0.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.3 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 0.1 | GO:0000243 | commitment complex(GO:0000243) |
| 0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.6 | GO:0030175 | filopodium(GO:0030175) |
| 0.0 | 0.2 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.4 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 0.0 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.0 | 1.1 | GO:0043204 | perikaryon(GO:0043204) |
| 0.0 | 0.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.0 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
| 0.0 | 0.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.2 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.1 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.3 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.0 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.0 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.0 | 0.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 0.0 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 0.1 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 0.8 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.2 | GO:0030315 | T-tubule(GO:0030315) |
| 0.0 | 1.3 | GO:0031513 | nonmotile primary cilium(GO:0031513) |
| 0.0 | 0.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 0.1 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.0 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.0 | 0.1 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.6 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.1 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.9 | GO:0005903 | brush border(GO:0005903) |
| 0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.2 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.0 | 0.1 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.0 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.0 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.0 | 0.3 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.0 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.1 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.0 | GO:0097441 | basilar dendrite(GO:0097441) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.3 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.4 | 1.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.4 | 1.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.3 | 0.6 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.3 | 1.9 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.2 | 1.2 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.2 | 0.7 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.2 | 0.7 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.2 | 1.5 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.2 | 1.8 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.2 | 0.7 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.2 | 1.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.2 | 0.6 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.2 | 0.6 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.2 | 0.6 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.2 | 0.6 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.2 | 0.6 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.2 | 0.8 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.2 | 1.1 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.2 | 0.6 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.2 | 0.6 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.2 | 0.7 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
| 0.2 | 0.5 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.2 | 0.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.1 | 0.7 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.1 | 1.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.1 | 0.6 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
| 0.1 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.1 | 0.4 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.1 | 0.3 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.1 | 0.7 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.1 | 1.0 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.1 | 0.9 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.6 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.1 | 0.4 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 0.8 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.1 | 2.4 | GO:0051393 | alpha-actinin binding(GO:0051393) |
| 0.1 | 0.6 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 0.2 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.1 | 3.5 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.1 | 0.5 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.1 | 1.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.1 | 0.6 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 1.0 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.1 | 0.6 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
| 0.1 | 0.1 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.1 | 0.4 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 0.3 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.1 | 1.2 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.1 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 0.9 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.1 | 0.7 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.1 | 0.7 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.1 | 0.6 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.1 | 0.3 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.1 | 0.5 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.1 | 1.4 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.1 | 0.3 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.1 | 0.6 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.5 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.1 | 0.5 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.1 | 0.4 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 2.1 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 0.1 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.1 | 0.3 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
| 0.1 | 0.8 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.1 | 0.6 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 1.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.1 | 0.3 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.1 | 1.2 | GO:0034576 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
| 0.1 | 0.2 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.1 | 1.1 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.1 | 1.0 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.1 | 0.4 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 0.6 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.1 | 0.4 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.1 | 0.4 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.1 | 0.2 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.1 | 0.2 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.1 | 0.2 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 0.4 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.1 | 1.0 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
| 0.1 | 0.5 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.1 | 0.2 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.1 | 0.2 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.1 | 1.3 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 0.2 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.1 | 1.2 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 0.2 | GO:0052623 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
| 0.1 | 0.2 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.1 | 0.7 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.1 | 0.2 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.1 | 0.3 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.1 | 0.2 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.7 | GO:0008061 | chitin binding(GO:0008061) |
| 0.1 | 0.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.1 | 2.4 | GO:0051018 | protein kinase A binding(GO:0051018) |
| 0.1 | 0.6 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.1 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.1 | 0.2 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.1 | 0.5 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.1 | 0.2 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.1 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.1 | 0.1 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
| 0.1 | 0.2 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.1 | 0.6 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.1 | 0.5 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.1 | 0.2 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.1 | 0.4 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.1 | 0.4 | GO:0034894 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
| 0.1 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 0.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.1 | 0.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.1 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.1 | 0.2 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.1 | 0.3 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.1 | 2.0 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.1 | 0.1 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.1 | 1.1 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.1 | 0.5 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 0.1 | GO:0001098 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
| 0.1 | 1.2 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.1 | 0.3 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.1 | 0.2 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
| 0.1 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.1 | 0.3 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.1 | 0.2 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.1 | 0.5 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 1.0 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 0.0 | 0.6 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 0.2 | GO:0052758 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
| 0.0 | 0.9 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.1 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.0 | 0.5 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 0.4 | GO:0015197 | peptide transporter activity(GO:0015197) |
| 0.0 | 1.5 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.0 | 1.3 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.0 | 0.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.0 | 0.4 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.1 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.0 | 0.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.0 | 0.1 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.0 | 0.2 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.0 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.0 | 0.5 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.4 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.0 | 0.2 | GO:0030619 | U1 snRNA binding(GO:0030619) |
| 0.0 | 1.2 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.3 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.0 | 0.1 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 0.5 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 0.4 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.8 | GO:0042923 | neuropeptide binding(GO:0042923) |
| 0.0 | 0.2 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.0 | 0.2 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.3 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.0 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.0 | 0.5 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 0.5 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.6 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
| 0.0 | 0.2 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.0 | GO:0016775 | phosphotransferase activity, nitrogenous group as acceptor(GO:0016775) |
| 0.0 | 0.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.0 | 1.6 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.0 | 0.0 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 0.1 | GO:0004083 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) |
| 0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.2 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 0.1 | GO:0102344 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
| 0.0 | 0.5 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
| 0.0 | 1.2 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.0 | 0.6 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.0 | 0.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.0 | 0.1 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 1.6 | GO:0005518 | collagen binding(GO:0005518) |
| 0.0 | 0.1 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.0 | 0.3 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.0 | 0.1 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.0 | 0.1 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
| 0.0 | 0.4 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.1 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.0 | 0.9 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.8 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 0.1 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.0 | 0.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.0 | 0.3 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.0 | 0.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.1 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.0 | 0.8 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.0 | 0.2 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
| 0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.1 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 1.0 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 0.1 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.0 | 0.7 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.2 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.1 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.0 | 0.0 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.6 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.0 | 0.3 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.4 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.1 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.0 | 0.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.5 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 2.4 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.3 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.0 | 0.1 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.0 | 0.0 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
| 0.0 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.0 | 0.2 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.0 | 0.7 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.4 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.0 | 0.7 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.4 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 0.1 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.1 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.0 | 0.2 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.0 | 0.2 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
| 0.0 | 0.2 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.0 | 0.5 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.2 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.1 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.0 | 0.2 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.0 | 0.1 | GO:0034889 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.0 | 0.0 | GO:0030548 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.0 | 0.1 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
| 0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.0 | 0.3 | GO:1905030 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.1 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.0 | 1.4 | GO:0030165 | PDZ domain binding(GO:0030165) |
| 0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.0 | 0.0 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.1 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 0.1 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.0 | 0.3 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.0 | 0.1 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.0 | 0.2 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.0 | 0.0 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.0 | 0.3 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.0 | 0.1 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.0 | 0.0 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
| 0.0 | 0.1 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.3 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.2 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.0 | 0.6 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.1 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.0 | 0.0 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.0 | 0.2 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.2 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.0 | GO:0001032 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
| 0.0 | 0.3 | GO:0042165 | neurotransmitter binding(GO:0042165) |
| 0.0 | 0.1 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.1 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.0 | 0.0 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
| 0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.3 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.0 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.0 | 1.2 | GO:0030674 | protein binding, bridging(GO:0030674) |
| 0.0 | 0.2 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.0 | 0.0 | GO:0018558 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
| 0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.8 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.6 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.0 | 0.0 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 0.0 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.0 | 0.2 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.0 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.0 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 0.1 | GO:0048256 | flap endonuclease activity(GO:0048256) |
| 0.0 | 0.0 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.0 | 0.2 | GO:0001848 | complement binding(GO:0001848) |
| 0.0 | 0.3 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.1 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) |
| 0.0 | 0.0 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 0.0 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
| 0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.1 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.0 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.0 | 0.1 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.0 | 0.1 | GO:0016723 | oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
| 0.0 | 0.2 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.1 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.0 | 0.1 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.1 | GO:0044213 | intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.0 | 0.0 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.0 | 0.1 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
| 0.0 | 0.1 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.3 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.1 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.0 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.0 | 0.4 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.0 | GO:0019002 | GMP binding(GO:0019002) |
| 0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.0 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.0 | 0.0 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.0 | 0.0 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.5 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.0 | 0.0 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.0 | 0.1 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.0 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.0 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.0 | 1.1 | GO:0003729 | mRNA binding(GO:0003729) |
| 0.0 | 0.0 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.0 | GO:0008147 | structural constituent of bone(GO:0008147) |
| 0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.1 | GO:0017136 | NAD-dependent histone deacetylase activity(GO:0017136) histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) NAD-dependent protein deacetylase activity(GO:0034979) |
| 0.0 | 0.0 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.4 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 2.6 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 1.3 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.1 | 0.7 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.1 | 1.4 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.1 | 3.2 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.1 | 1.9 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.1 | 1.4 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.1 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.1 | 0.9 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 1.9 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.1 | 1.3 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.1 | 0.2 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.1 | 0.3 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 2.3 | PID FGF PATHWAY | FGF signaling pathway |
| 0.1 | 0.2 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.1 | 0.7 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.1 | 1.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.5 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 2.9 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 1.5 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.6 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.0 | 1.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.7 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.4 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 1.1 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.0 | 1.9 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.0 | 0.6 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.4 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.3 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 1.5 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.0 | 0.5 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 1.4 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.0 | 0.4 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 0.7 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.4 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 0.4 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 0.7 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.0 | 1.1 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.2 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.9 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.2 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 0.2 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 0.0 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.0 | 0.2 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.1 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.0 | 2.8 | NABA CORE MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
| 0.0 | 0.2 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.2 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 3.4 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.5 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 0.1 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.0 | 0.1 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.1 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.1 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.0 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.1 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.1 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 0.2 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.0 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.0 | 0.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.6 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.2 | 1.9 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.2 | 3.7 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 0.4 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.1 | 2.1 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.1 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 0.4 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.1 | 0.1 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
| 0.1 | 1.9 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 0.7 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.1 | 0.3 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.1 | 1.0 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.1 | 0.9 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
| 0.1 | 0.7 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.1 | 2.0 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.1 | 1.3 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.1 | 2.1 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.1 | 2.2 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.1 | 1.0 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
| 0.1 | 0.7 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.1 | 1.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.1 | 1.1 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.1 | 0.6 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 3.6 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.1 | 1.5 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.1 | 1.2 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.1 | 1.3 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 0.7 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.1 | 0.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.1 | 0.2 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
| 0.1 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.1 | 0.4 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.1 | 1.5 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.1 | 0.7 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.1 | 2.3 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 0.4 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.1 | 0.5 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.1 | 0.6 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
| 0.1 | 0.8 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.3 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.6 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.0 | 0.6 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.9 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.5 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.7 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.0 | 0.1 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.0 | 0.5 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.2 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.6 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 2.7 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.3 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.6 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.4 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 0.3 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.0 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.0 | 2.2 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.0 | 0.2 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.2 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.0 | 0.1 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
| 0.0 | 0.6 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.0 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.0 | 0.2 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.0 | 0.2 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
| 0.0 | 0.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.0 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
| 0.0 | 0.0 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.0 | 0.5 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.0 | 0.1 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.0 | 0.1 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.0 | 0.4 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 1.0 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
| 0.0 | 0.8 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.0 | 0.1 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.0 | 0.3 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 0.2 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.1 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.0 | 0.0 | REACTOME M G1 TRANSITION | Genes involved in M/G1 Transition |
| 0.0 | 0.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 1.8 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
| 0.0 | 0.3 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.0 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.1 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
| 0.0 | 0.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.0 | 0.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.1 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.1 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 0.1 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.0 | 0.1 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.0 | 0.3 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
| 0.0 | 0.0 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.0 | 0.0 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.0 | 0.2 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.2 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.0 | 0.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.1 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.2 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.0 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.0 | 0.0 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.0 | 0.2 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |