Gene Symbol | Gene ID | Gene Info |
---|---|---|
Myog
|
ENSMUSG00000026459.4 | myogenin |
Tcf12
|
ENSMUSG00000032228.10 | transcription factor 12 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
chr1_134292463_134292682 | Myog | 2583 | 0.193088 | -0.28 | 2.8e-02 | Click! |
chr1_134290398_134290606 | Myog | 513 | 0.705445 | -0.27 | 3.6e-02 | Click! |
chr1_134289731_134289882 | Myog | 183 | 0.920797 | -0.18 | 1.7e-01 | Click! |
chr1_134290135_134290286 | Myog | 221 | 0.901549 | -0.17 | 1.9e-01 | Click! |
chr1_134291968_134292119 | Myog | 2054 | 0.227825 | -0.15 | 2.7e-01 | Click! |
chr9_71895330_71895742 | Tcf12 | 449 | 0.717651 | -0.56 | 3.9e-06 | Click! |
chr9_71894609_71895239 | Tcf12 | 1061 | 0.374908 | -0.54 | 8.7e-06 | Click! |
chr9_71894270_71894567 | Tcf12 | 1567 | 0.256894 | -0.53 | 1.3e-05 | Click! |
chr9_71895839_71896117 | Tcf12 | 7 | 0.959876 | -0.52 | 1.9e-05 | Click! |
chr9_71892666_71893902 | Tcf12 | 2701 | 0.166825 | -0.50 | 4.9e-05 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr9_89879614_89881129 | 2.92 |
Rasgrf1 |
RAS protein-specific guanine nucleotide-releasing factor 1 |
29537 |
0.16 |
chr11_61685342_61685527 | 2.35 |
Fam83g |
family with sequence similarity 83, member G |
1015 |
0.5 |
chr18_35847749_35850271 | 2.33 |
Cxxc5 |
CXXC finger 5 |
5677 |
0.11 |
chr11_82845042_82846306 | 2.27 |
Rffl |
ring finger and FYVE like domain containing protein |
418 |
0.75 |
chr2_26485135_26488628 | 2.25 |
Notch1 |
notch 1 |
16383 |
0.09 |
chr4_154024246_154024397 | 2.15 |
Smim1 |
small integral membrane protein 1 |
2 |
0.95 |
chr8_105833568_105833870 | 2.09 |
Tsnaxip1 |
translin-associated factor X (Tsnax) interacting protein 1 |
5967 |
0.09 |
chr5_125056018_125058841 | 2.01 |
Gm42838 |
predicted gene 42838 |
412 |
0.71 |
chr9_106157450_106158063 | 1.90 |
Glyctk |
glycerate kinase |
354 |
0.7 |
chr13_107065067_107065474 | 1.82 |
Gm31452 |
predicted gene, 31452 |
1575 |
0.35 |
chr2_157026864_157027931 | 1.81 |
Soga1 |
suppressor of glucose, autophagy associated 1 |
75 |
0.96 |
chr1_160306832_160307632 | 1.78 |
Rabgap1l |
RAB GTPase activating protein 1-like |
107 |
0.95 |
chr1_172894740_172894971 | 1.73 |
Apcs |
serum amyloid P-component |
186 |
0.93 |
chr16_77028423_77029292 | 1.69 |
Usp25 |
ubiquitin specific peptidase 25 |
15070 |
0.21 |
chr10_128790937_128791411 | 1.60 |
Mmp19 |
matrix metallopeptidase 19 |
212 |
0.84 |
chr2_93456061_93456647 | 1.59 |
Gm10804 |
predicted gene 10804 |
3533 |
0.2 |
chr5_64159427_64160996 | 1.56 |
Tbc1d1 |
TBC1 domain family, member 1 |
0 |
0.97 |
chr1_173332160_173333204 | 1.55 |
Ackr1 |
atypical chemokine receptor 1 (Duffy blood group) |
820 |
0.54 |
chr2_58155475_58155905 | 1.49 |
Cytip |
cytohesin 1 interacting protein |
1107 |
0.51 |
chr9_21963175_21963912 | 1.43 |
Epor |
erythropoietin receptor |
37 |
0.94 |
chr7_19082814_19086200 | 1.41 |
Dmpk |
dystrophia myotonica-protein kinase |
203 |
0.83 |
chr3_89386729_89388779 | 1.35 |
Zbtb7b |
zinc finger and BTB domain containing 7B |
83 |
0.91 |
chr7_132775953_132776104 | 1.35 |
Fam53b |
family with sequence similarity 53, member B |
888 |
0.61 |
chr2_181081653_181082036 | 1.35 |
Kcnq2 |
potassium voltage-gated channel, subfamily Q, member 2 |
13577 |
0.13 |
chr7_29864922_29865471 | 1.31 |
Zfp420 |
zinc finger protein 420 |
5155 |
0.09 |
chr14_54710271_54711044 | 1.31 |
Cebpe |
CCAAT/enhancer binding protein (C/EBP), epsilon |
1517 |
0.22 |
chr6_7697635_7698104 | 1.27 |
Asns |
asparagine synthetase |
4615 |
0.24 |
chr5_107015466_107015939 | 1.25 |
Gm33474 |
predicted gene, 33474 |
33134 |
0.14 |
chr14_40962109_40963182 | 1.24 |
Tspan14 |
tetraspanin 14 |
4162 |
0.22 |
chr8_23027571_23028905 | 1.23 |
Ank1 |
ankyrin 1, erythroid |
6861 |
0.19 |
chr7_141654914_141655534 | 1.22 |
Muc6 |
mucin 6, gastric |
84 |
0.96 |
chr5_107873618_107874360 | 1.21 |
Evi5 |
ecotropic viral integration site 5 |
1055 |
0.35 |
chr8_13108255_13108617 | 1.20 |
Cul4a |
cullin 4A |
2500 |
0.14 |
chr13_55211864_55213064 | 1.20 |
Nsd1 |
nuclear receptor-binding SET-domain protein 1 |
78 |
0.96 |
chr5_35160468_35161280 | 1.20 |
Lrpap1 |
low density lipoprotein receptor-related protein associated protein 1 |
55108 |
0.11 |
chr14_41007005_41008239 | 1.19 |
Prxl2a |
peroxiredoxin like 2A |
644 |
0.68 |
chr14_63124817_63125155 | 1.19 |
Ctsb |
cathepsin B |
2472 |
0.2 |
chr5_24426725_24429282 | 1.18 |
Slc4a2 |
solute carrier family 4 (anion exchanger), member 2 |
205 |
0.83 |
chr11_117888569_117891164 | 1.18 |
Tha1 |
threonine aldolase 1 |
16385 |
0.1 |
chr2_35326527_35327124 | 1.17 |
Stom |
stomatin |
6320 |
0.14 |
chr19_4301696_4304008 | 1.17 |
Grk2 |
G protein-coupled receptor kinase 2 |
2356 |
0.14 |
chr7_141442950_141444299 | 1.16 |
Pidd1 |
p53 induced death domain protein 1 |
268 |
0.74 |
chr5_35159462_35159739 | 1.12 |
Lrpap1 |
low density lipoprotein receptor-related protein associated protein 1 |
53834 |
0.12 |
chr5_115949686_115950169 | 1.12 |
Cit |
citron |
1163 |
0.45 |
chr11_84822134_84823653 | 1.11 |
Mrm1 |
mitochondrial rRNA methyltransferase 1 |
3378 |
0.15 |
chr1_132366786_132367836 | 1.10 |
Tmcc2 |
transmembrane and coiled-coil domains 2 |
239 |
0.89 |
chr17_84185673_84188034 | 1.09 |
Zfp36l2 |
zinc finger protein 36, C3H type-like 2 |
1094 |
0.34 |
chr14_20793089_20794019 | 1.09 |
Camk2g |
calcium/calmodulin-dependent protein kinase II gamma |
412 |
0.6 |
chr12_4679833_4680757 | 1.09 |
Gm17541 |
predicted gene, 17541 |
9631 |
0.12 |
chr2_93461307_93461503 | 1.08 |
Cd82 |
CD82 antigen |
507 |
0.77 |
chr18_32555205_32555450 | 1.08 |
Gypc |
glycophorin C |
4653 |
0.23 |
chr5_115433807_115437237 | 1.08 |
Msi1 |
musashi RNA-binding protein 1 |
24 |
0.93 |
chr19_6856906_6858230 | 1.07 |
Ccdc88b |
coiled-coil domain containing 88B |
643 |
0.54 |
chr3_100488186_100489390 | 1.07 |
Tent5c |
terminal nucleotidyltransferase 5C |
406 |
0.68 |
chr12_99457193_99458078 | 1.06 |
Foxn3 |
forkhead box N3 |
7538 |
0.2 |
chr9_110988878_110989224 | 1.06 |
Gm10030 |
predicted gene 10030 |
448 |
0.46 |
chr19_5662426_5664007 | 1.06 |
Sipa1 |
signal-induced proliferation associated gene 1 |
404 |
0.63 |
chr12_24645782_24646298 | 1.05 |
Klf11 |
Kruppel-like factor 11 |
5234 |
0.16 |
chr17_30347260_30347726 | 1.05 |
Btbd9 |
BTB (POZ) domain containing 9 |
12537 |
0.18 |
chr3_60603716_60603948 | 1.04 |
Mbnl1 |
muscleblind like splicing factor 1 |
294 |
0.71 |
chr3_93445694_93447755 | 1.04 |
Tchh |
trichohyalin |
4394 |
0.1 |
chr7_100492685_100494805 | 1.03 |
Ucp2 |
uncoupling protein 2 (mitochondrial, proton carrier) |
50 |
0.95 |
chr16_85644290_85644772 | 1.03 |
Gm6278 |
predicted gene 6278 |
279 |
0.94 |
chr14_70625458_70627688 | 1.03 |
Dmtn |
dematin actin binding protein |
418 |
0.75 |
chrX_85613609_85614890 | 1.03 |
Gm44378 |
predicted gene, 44378 |
25272 |
0.18 |
chr13_57671510_57671732 | 1.03 |
Spock1 |
sparc/osteonectin, cwcv and kazal-like domains proteoglycan 1 |
235966 |
0.02 |
chr7_45047563_45050465 | 1.03 |
Prr12 |
proline rich 12 |
3867 |
0.07 |
chr4_152447653_152448768 | 1.01 |
Kcnab2 |
potassium voltage-gated channel, shaker-related subfamily, beta member 2 |
531 |
0.76 |
chr4_93583349_93584162 | 1.01 |
Gm12640 |
predicted gene 12640 |
15431 |
0.19 |
chr11_68768073_68768328 | 1.01 |
Myh10 |
myosin, heavy polypeptide 10, non-muscle |
15232 |
0.19 |
chr6_136854322_136855143 | 1.01 |
Art4 |
ADP-ribosyltransferase 4 |
3001 |
0.12 |
chr2_25290133_25293095 | 0.99 |
Grin1os |
glutamate receptor, ionotropic, NMDA1 (zeta 1), opposite strand |
394 |
0.57 |
chr13_107100937_107101851 | 0.99 |
Gm31452 |
predicted gene, 31452 |
37699 |
0.14 |
chr19_6132290_6133043 | 0.98 |
Snx15 |
sorting nexin 15 |
4362 |
0.07 |
chr14_20268836_20269194 | 0.98 |
Kcnk16 |
potassium channel, subfamily K, member 16 |
184 |
0.92 |
chr6_29700528_29701283 | 0.97 |
Tspan33 |
tetraspanin 33 |
6671 |
0.18 |
chr4_154541918_154542276 | 0.97 |
Gm13133 |
predicted gene 13133 |
8185 |
0.18 |
chr2_4557069_4557841 | 0.97 |
Frmd4a |
FERM domain containing 4A |
2299 |
0.32 |
chr5_122018591_122019443 | 0.96 |
Gm3970 |
predicted gene 3970 |
6313 |
0.16 |
chr8_121897389_121899362 | 0.96 |
Slc7a5 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 5 |
1873 |
0.2 |
chr2_102867441_102867713 | 0.96 |
Gm23731 |
predicted gene, 23731 |
30383 |
0.18 |
chr4_133261798_133263256 | 0.96 |
Sytl1 |
synaptotagmin-like 1 |
525 |
0.66 |
chr13_51975816_51976211 | 0.96 |
Gm26651 |
predicted gene, 26651 |
2799 |
0.32 |
chr11_103102696_103105788 | 0.96 |
Acbd4 |
acyl-Coenzyme A binding domain containing 4 |
463 |
0.7 |
chr15_97019074_97019955 | 0.95 |
Slc38a4 |
solute carrier family 38, member 4 |
437 |
0.89 |
chr2_163356404_163356958 | 0.94 |
Tox2 |
TOX high mobility group box family member 2 |
36303 |
0.11 |
chr2_84733750_84735007 | 0.94 |
Ypel4 |
yippee like 4 |
151 |
0.89 |
chr7_120842654_120844117 | 0.93 |
Eef2k |
eukaryotic elongation factor-2 kinase |
182 |
0.93 |
chr1_134072926_134073249 | 0.93 |
Btg2 |
BTG anti-proliferation factor 2 |
6033 |
0.14 |
chr5_114972239_114972459 | 0.93 |
Hnf1a |
HNF1 homeobox A |
1255 |
0.23 |
chr8_105833049_105833566 | 0.92 |
Tsnaxip1 |
translin-associated factor X (Tsnax) interacting protein 1 |
5555 |
0.09 |
chr12_110975345_110976350 | 0.92 |
Ankrd9 |
ankyrin repeat domain 9 |
2408 |
0.19 |
chr2_173026008_173027110 | 0.92 |
Rbm38 |
RNA binding motif protein 38 |
3509 |
0.16 |
chr14_33362281_33363618 | 0.92 |
Arhgap22 |
Rho GTPase activating protein 22 |
573 |
0.71 |
chr17_48300015_48301474 | 0.92 |
Treml2 |
triggering receptor expressed on myeloid cells-like 2 |
358 |
0.8 |
chr15_103256522_103256673 | 0.92 |
Nfe2 |
nuclear factor, erythroid derived 2 |
1158 |
0.31 |
chr11_117801710_117801952 | 0.92 |
6030468B19Rik |
RIKEN cDNA 6030468B19 gene |
4171 |
0.09 |
chr3_87982403_87983961 | 0.91 |
Bcan |
brevican |
11273 |
0.09 |
chr5_123131617_123134965 | 0.91 |
Rhof |
ras homolog family member F (in filopodia) |
599 |
0.36 |
chr14_70706940_70707491 | 0.91 |
Xpo7 |
exportin 7 |
820 |
0.57 |
chr4_118430166_118430495 | 0.90 |
Elovl1 |
elongation of very long chain fatty acids (FEN1/Elo2, SUR4/Elo3, yeast)-like 1 |
629 |
0.55 |
chr19_40812757_40814183 | 0.90 |
Ccnj |
cyclin J |
17809 |
0.16 |
chr17_45736053_45737200 | 0.90 |
F630040K05Rik |
RIKEN cDNA F630040K05 gene |
2120 |
0.22 |
chr5_137288990_137289710 | 0.90 |
Ache |
acetylcholinesterase |
103 |
0.86 |
chr12_86881882_86884741 | 0.89 |
Irf2bpl |
interferon regulatory factor 2 binding protein-like |
1487 |
0.4 |
chr4_154024404_154026596 | 0.89 |
Smim1 |
small integral membrane protein 1 |
116 |
0.93 |
chr1_133798392_133798998 | 0.89 |
Atp2b4 |
ATPase, Ca++ transporting, plasma membrane 4 |
2341 |
0.23 |
chr16_17208370_17209205 | 0.89 |
Rimbp3 |
RIMS binding protein 3 |
184 |
0.88 |
chr9_108110482_108111977 | 0.88 |
Bsn |
bassoon |
816 |
0.36 |
chr5_120138122_120139268 | 0.88 |
Gm10390 |
predicted gene 10390 |
566 |
0.77 |
chr9_106156833_106157412 | 0.88 |
Glyctk |
glycerate kinase |
128 |
0.86 |
chr7_25475075_25475415 | 0.87 |
Ceacam1 |
carcinoembryonic antigen-related cell adhesion molecule 1 |
1459 |
0.28 |
chr1_136966506_136966759 | 0.87 |
Nr5a2 |
nuclear receptor subfamily 5, group A, member 2 |
6184 |
0.24 |
chr11_72488700_72489702 | 0.86 |
Spns2 |
spinster homolog 2 |
703 |
0.61 |
chr18_67241729_67242343 | 0.86 |
Mppe1 |
metallophosphoesterase 1 |
3241 |
0.19 |
chr6_116358281_116358432 | 0.86 |
Marchf8 |
membrane associated ring-CH-type finger 8 |
7423 |
0.12 |
chr19_25052877_25053245 | 0.86 |
Dock8 |
dedicator of cytokinesis 8 |
448 |
0.87 |
chr11_69364290_69367679 | 0.86 |
Chd3 |
chromodomain helicase DNA binding protein 3 |
1205 |
0.24 |
chr18_82474995_82476226 | 0.86 |
Mbp |
myelin basic protein |
240 |
0.93 |
chr11_78074087_78074838 | 0.85 |
Mir451b |
microRNA 451b |
1221 |
0.18 |
chr6_55338294_55340060 | 0.85 |
Aqp1 |
aquaporin 1 |
2745 |
0.22 |
chr11_6623720_6624218 | 0.85 |
Tbrg4 |
transforming growth factor beta regulated gene 4 |
1490 |
0.2 |
chr6_87776091_87777171 | 0.85 |
Gm43904 |
predicted gene, 43904 |
488 |
0.55 |
chr5_137569837_137570642 | 0.85 |
Tfr2 |
transferrin receptor 2 |
370 |
0.67 |
chr6_120579351_120580579 | 0.84 |
Gm44124 |
predicted gene, 44124 |
211 |
0.9 |
chr4_136175795_136176646 | 0.84 |
E2f2 |
E2F transcription factor 2 |
3826 |
0.17 |
chr8_94182622_94183855 | 0.84 |
Gm39228 |
predicted gene, 39228 |
51 |
0.95 |
chr11_87729732_87730395 | 0.84 |
Rnf43 |
ring finger protein 43 |
689 |
0.49 |
chr11_96957122_96957607 | 0.84 |
Sp2 |
Sp2 transcription factor |
11301 |
0.08 |
chr10_41204598_41204966 | 0.84 |
Gm25526 |
predicted gene, 25526 |
11263 |
0.2 |
chr8_70699147_70700321 | 0.84 |
Gm11175 |
predicted gene 11175 |
45 |
0.9 |
chr11_96946068_96946479 | 0.83 |
D030028A08Rik |
RIKEN cDNA D030028A08 gene |
1961 |
0.15 |
chr5_107874374_107875235 | 0.83 |
Evi5 |
ecotropic viral integration site 5 |
240 |
0.86 |
chr1_132360703_132361187 | 0.83 |
Tmcc2 |
transmembrane and coiled-coil domains 2 |
4003 |
0.15 |
chr18_64539135_64539486 | 0.82 |
Atp8b1 |
ATPase, class I, type 8B, member 1 |
15890 |
0.15 |
chr8_88302236_88302488 | 0.82 |
Adcy7 |
adenylate cyclase 7 |
1983 |
0.33 |
chr8_119916288_119916982 | 0.82 |
Usp10 |
ubiquitin specific peptidase 10 |
5778 |
0.17 |
chr14_118816782_118817050 | 0.82 |
n-R5s51 |
nuclear encoded rRNA 5S 51 |
10115 |
0.16 |
chr10_25299797_25299965 | 0.82 |
Akap7 |
A kinase (PRKA) anchor protein 7 |
717 |
0.54 |
chr8_111573318_111574249 | 0.82 |
Znrf1 |
zinc and ring finger 1 |
11943 |
0.18 |
chr2_127371500_127371884 | 0.81 |
Adra2b |
adrenergic receptor, alpha 2b |
8406 |
0.14 |
chr11_75165245_75169157 | 0.81 |
Hic1 |
hypermethylated in cancer 1 |
945 |
0.35 |
chr13_55369785_55370435 | 0.81 |
Rgs14 |
regulator of G-protein signaling 14 |
339 |
0.78 |
chr2_167588684_167589456 | 0.81 |
Gm11475 |
predicted gene 11475 |
2325 |
0.19 |
chr4_136177602_136178758 | 0.81 |
E2f2 |
E2F transcription factor 2 |
2603 |
0.21 |
chr15_100421048_100421512 | 0.80 |
Gm5475 |
predicted gene 5475 |
867 |
0.4 |
chr13_95671197_95671708 | 0.80 |
Iqgap2 |
IQ motif containing GTPase activating protein 2 |
67 |
0.96 |
chr7_141216939_141217210 | 0.80 |
Rassf7 |
Ras association (RalGDS/AF-6) domain family (N-terminal) member 7 |
374 |
0.66 |
chr1_75215644_75216192 | 0.80 |
Tuba4a |
tubulin, alpha 4A |
1496 |
0.15 |
chr10_128344814_128345330 | 0.80 |
Gm23182 |
predicted gene, 23182 |
4169 |
0.07 |
chr12_83072442_83073418 | 0.79 |
Rgs6 |
regulator of G-protein signaling 6 |
25940 |
0.15 |
chr15_97824894_97826280 | 0.79 |
Hdac7 |
histone deacetylase 7 |
5882 |
0.17 |
chr8_119437065_119437967 | 0.79 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
327 |
0.86 |
chr12_71877779_71878331 | 0.79 |
Daam1 |
dishevelled associated activator of morphogenesis 1 |
11675 |
0.21 |
chrX_111462020_111463491 | 0.79 |
Rps6ka6 |
ribosomal protein S6 kinase polypeptide 6 |
116 |
0.98 |
chr14_30922203_30922538 | 0.79 |
Itih3 |
inter-alpha trypsin inhibitor, heavy chain 3 |
1179 |
0.33 |
chr11_69915606_69917001 | 0.79 |
Gps2 |
G protein pathway suppressor 2 |
262 |
0.72 |
chr15_99890238_99891314 | 0.79 |
Gm18890 |
predicted gene, 18890 |
7136 |
0.08 |
chr5_129006398_129007001 | 0.79 |
Stx2 |
syntaxin 2 |
1724 |
0.37 |
chr5_106964342_106965138 | 0.78 |
Cdc7 |
cell division cycle 7 (S. cerevisiae) |
179 |
0.95 |
chr2_130634489_130636508 | 0.78 |
Lzts3 |
leucine zipper, putative tumor suppressor family member 3 |
2597 |
0.15 |
chr1_130421898_130423113 | 0.78 |
Cd55b |
CD55 molecule, decay accelerating factor for complement B |
235 |
0.58 |
chr11_98446534_98448432 | 0.78 |
Grb7 |
growth factor receptor bound protein 7 |
415 |
0.68 |
chr4_150008109_150009367 | 0.77 |
H6pd |
hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) |
285 |
0.88 |
chr10_63061615_63061938 | 0.77 |
Pbld1 |
phenazine biosynthesis-like protein domain containing 1 |
194 |
0.88 |
chr11_115899671_115901427 | 0.76 |
Smim5 |
small integral membrane protein 5 |
347 |
0.75 |
chr5_115560973_115561124 | 0.75 |
Rplp0 |
ribosomal protein, large, P0 |
1425 |
0.24 |
chr2_127369697_127369951 | 0.75 |
Adra2b |
adrenergic receptor, alpha 2b |
6538 |
0.15 |
chr4_43522717_43524714 | 0.75 |
Tpm2 |
tropomyosin 2, beta |
50 |
0.93 |
chr2_180545211_180545584 | 0.75 |
Mrgbp |
MRG/MORF4L binding protein |
35907 |
0.1 |
chr1_75217265_75217807 | 0.75 |
Tuba4a |
tubulin, alpha 4A |
102 |
0.89 |
chr2_148043571_148045987 | 0.74 |
Foxa2 |
forkhead box A2 |
685 |
0.65 |
chr4_134868934_134869297 | 0.74 |
Rhd |
Rh blood group, D antigen |
4579 |
0.19 |
chr14_78276693_78276844 | 0.74 |
Gm23652 |
predicted gene, 23652 |
30457 |
0.14 |
chr7_99594627_99596228 | 0.74 |
Arrb1 |
arrestin, beta 1 |
804 |
0.48 |
chr1_87327055_87328055 | 0.74 |
Gigyf2 |
GRB10 interacting GYF protein 2 |
489 |
0.72 |
chr7_110862010_110862334 | 0.74 |
Lyve1 |
lymphatic vessel endothelial hyaluronan receptor 1 |
781 |
0.59 |
chr11_102364387_102365146 | 0.73 |
Slc4a1 |
solute carrier family 4 (anion exchanger), member 1 |
481 |
0.67 |
chr10_128524621_128526141 | 0.73 |
Gm29585 |
predicted gene 29585 |
53 |
0.85 |
chr17_47521370_47522648 | 0.73 |
Ccnd3 |
cyclin D3 |
16768 |
0.13 |
chr9_70420553_70420960 | 0.73 |
Ccnb2 |
cyclin B2 |
791 |
0.59 |
chr1_36921949_36922257 | 0.72 |
F830112A20Rik |
RIKEN cDNA F830112A20 gene |
4245 |
0.16 |
chr5_64364459_64364820 | 0.72 |
Gm43838 |
predicted gene 43838 |
4125 |
0.18 |
chr15_78597069_78597927 | 0.72 |
Cyth4 |
cytohesin 4 |
349 |
0.8 |
chr2_173037513_173037883 | 0.72 |
Gm14453 |
predicted gene 14453 |
3118 |
0.18 |
chr3_101551232_101552184 | 0.72 |
Atp1a1 |
ATPase, Na+/K+ transporting, alpha 1 polypeptide |
25852 |
0.16 |
chr17_87282789_87283581 | 0.72 |
Ttc7 |
tetratricopeptide repeat domain 7 |
234 |
0.63 |
chr12_32110815_32111210 | 0.72 |
5430401H09Rik |
RIKEN cDNA 5430401H09 gene |
12690 |
0.18 |
chr13_67810548_67810794 | 0.71 |
Gm9625 |
predicted gene 9625 |
425 |
0.69 |
chr6_42354027_42355114 | 0.71 |
Zyx |
zyxin |
567 |
0.55 |
chr8_121901506_121902885 | 0.71 |
Slc7a5 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 5 |
5499 |
0.11 |
chr2_30772547_30773023 | 0.71 |
1700001O22Rik |
RIKEN cDNA 1700001O22 gene |
23879 |
0.11 |
chr8_94172106_94173724 | 0.71 |
Mt2 |
metallothionein 2 |
55 |
0.87 |
chr2_167656344_167657144 | 0.71 |
Gm20431 |
predicted gene 20431 |
4752 |
0.11 |
chr15_58594635_58595816 | 0.71 |
Fer1l6 |
fer-1-like 6 (C. elegans) |
43280 |
0.17 |
chr7_30493583_30494737 | 0.70 |
Prodh2 |
proline dehydrogenase (oxidase) 2 |
380 |
0.63 |
chr5_107724563_107727169 | 0.70 |
Gfi1 |
growth factor independent 1 transcription repressor |
61 |
0.88 |
chr11_95805739_95806100 | 0.70 |
Phospho1 |
phosphatase, orphan 1 |
18580 |
0.1 |
chr9_109017453_109018022 | 0.70 |
Pfkfb4 |
6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 4 |
357 |
0.74 |
chr15_27871217_27871844 | 0.70 |
Gm20555 |
predicted gene, 20555 |
4299 |
0.22 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.8 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.6 | 1.8 | GO:0052422 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.4 | 1.2 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.3 | 1.7 | GO:0070627 | ferrous iron import(GO:0070627) |
0.3 | 1.3 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.3 | 1.0 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.3 | 1.2 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
0.3 | 0.9 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.2 | 0.7 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.2 | 1.0 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.2 | 1.0 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.2 | 1.7 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.2 | 0.2 | GO:0010535 | positive regulation of activation of JAK2 kinase activity(GO:0010535) |
0.2 | 0.5 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.2 | 0.9 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.2 | 0.7 | GO:0045472 | response to ether(GO:0045472) |
0.2 | 0.9 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.2 | 0.2 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
0.2 | 0.7 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.2 | 0.2 | GO:0046016 | positive regulation of transcription by glucose(GO:0046016) |
0.2 | 0.6 | GO:2000974 | negative regulation of pro-B cell differentiation(GO:2000974) |
0.2 | 0.4 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.2 | 0.6 | GO:2000561 | regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) |
0.2 | 0.6 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.2 | 1.8 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
0.2 | 0.6 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.2 | 1.2 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.2 | 1.0 | GO:0019695 | choline metabolic process(GO:0019695) |
0.2 | 0.8 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.2 | 0.8 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.2 | 0.6 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
0.2 | 0.6 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.2 | 0.7 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.2 | 0.6 | GO:0061511 | centriole elongation(GO:0061511) |
0.2 | 1.8 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.2 | 0.5 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.2 | 0.4 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.2 | 0.5 | GO:0033668 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.2 | 0.9 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.2 | 0.5 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
0.2 | 0.3 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.2 | 0.7 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.2 | 0.5 | GO:0008228 | opsonization(GO:0008228) |
0.2 | 0.5 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.2 | 1.2 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.2 | 0.3 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.2 | 0.7 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.2 | 0.5 | GO:0043366 | beta selection(GO:0043366) |
0.2 | 0.5 | GO:0000087 | mitotic M phase(GO:0000087) |
0.2 | 0.5 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.2 | 0.6 | GO:0035977 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
0.2 | 0.6 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.2 | 1.2 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.1 | 3.4 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.1 | 0.6 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.1 | 0.6 | GO:0018343 | protein farnesylation(GO:0018343) |
0.1 | 0.3 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.1 | 2.0 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
0.1 | 0.4 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.1 | 0.7 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.1 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
0.1 | 0.4 | GO:0042520 | positive regulation of tyrosine phosphorylation of Stat4 protein(GO:0042520) |
0.1 | 0.7 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.1 | 0.4 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.1 | 0.7 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.1 | 0.6 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.1 | 1.1 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.1 | 0.5 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.1 | 0.4 | GO:0006235 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
0.1 | 0.7 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.1 | 1.0 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
0.1 | 0.3 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 0.5 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.1 | 0.5 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.1 | 1.5 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.1 | 0.1 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.1 | 0.8 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
0.1 | 0.8 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
0.1 | 0.4 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.1 | 0.4 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.1 | 0.3 | GO:0036394 | amylase secretion(GO:0036394) |
0.1 | 0.4 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
0.1 | 0.5 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.1 | 0.4 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
0.1 | 0.4 | GO:0032910 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
0.1 | 0.7 | GO:0006559 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.1 | 0.5 | GO:0003096 | renal sodium ion transport(GO:0003096) |
0.1 | 0.9 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.1 | 0.9 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 0.2 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.1 | 0.2 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.1 | 0.5 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.1 | 0.8 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.1 | 0.4 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.1 | 1.8 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.1 | 0.2 | GO:0010915 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
0.1 | 0.2 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.1 | 0.7 | GO:0001842 | neural fold formation(GO:0001842) |
0.1 | 0.3 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
0.1 | 1.3 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
0.1 | 0.3 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.3 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.1 | 0.3 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.1 | 0.3 | GO:0070268 | cornification(GO:0070268) |
0.1 | 0.1 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
0.1 | 0.4 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
0.1 | 0.4 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
0.1 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.2 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.1 | 0.4 | GO:0090155 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
0.1 | 0.3 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.1 | 0.3 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.1 | 0.7 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.1 | 0.4 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.1 | 0.4 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.1 | 0.5 | GO:0021764 | amygdala development(GO:0021764) |
0.1 | 0.3 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.1 | 0.3 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
0.1 | 0.3 | GO:0035524 | proline transmembrane transport(GO:0035524) |
0.1 | 1.5 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.1 | 0.2 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.1 | 0.2 | GO:1902075 | cellular response to salt(GO:1902075) |
0.1 | 0.3 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.1 | 0.1 | GO:0097459 | iron ion import into cell(GO:0097459) |
0.1 | 0.2 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.1 | 0.2 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.1 | 0.3 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.1 | 0.3 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.1 | 0.9 | GO:0034063 | stress granule assembly(GO:0034063) |
0.1 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.1 | 0.3 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.1 | 0.3 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 0.1 | GO:0032349 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) |
0.1 | 0.4 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.1 | 1.7 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.1 | 0.6 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.1 | 0.2 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
0.1 | 0.2 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.1 | 0.3 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.1 | 0.2 | GO:0015677 | copper ion import(GO:0015677) |
0.1 | 0.9 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.1 | 0.3 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 0.2 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.1 | 0.4 | GO:0015879 | carnitine transport(GO:0015879) |
0.1 | 0.7 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.1 | 1.4 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.1 | 2.1 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.1 | 0.2 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.1 | 0.4 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.1 | 0.3 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.1 | 1.2 | GO:0015858 | nucleoside transport(GO:0015858) |
0.1 | 0.4 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.1 | 0.3 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 0.5 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.1 | 0.2 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.1 | 0.2 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 0.1 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.1 | 0.3 | GO:0060066 | oviduct development(GO:0060066) |
0.1 | 0.3 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.1 | 0.7 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
0.1 | 0.3 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.1 | 0.3 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.1 | 0.5 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.1 | 0.3 | GO:0002432 | granuloma formation(GO:0002432) |
0.1 | 0.5 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.1 | 1.3 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
0.1 | 0.9 | GO:0033194 | response to hydroperoxide(GO:0033194) |
0.1 | 0.2 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.1 | 0.2 | GO:0072108 | positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) |
0.1 | 0.1 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.1 | 0.2 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.1 | 0.1 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
0.1 | 0.2 | GO:0019530 | taurine metabolic process(GO:0019530) |
0.1 | 0.2 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.1 | 0.2 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.1 | 0.2 | GO:0001302 | replicative cell aging(GO:0001302) |
0.1 | 0.1 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.1 | 0.3 | GO:2000416 | regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
0.1 | 0.1 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.1 | 0.4 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 0.4 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.1 | 0.5 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.1 | 0.2 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.1 | 0.2 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.1 | 0.2 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.1 | 0.5 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 0.2 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
0.1 | 0.5 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.1 | 0.7 | GO:0070269 | pyroptosis(GO:0070269) |
0.1 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
0.1 | 0.3 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.1 | 0.2 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.1 | 0.2 | GO:1903286 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
0.1 | 0.1 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.1 | 0.1 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.1 | 0.8 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
0.1 | 0.4 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
0.1 | 0.2 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.1 | 0.3 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.1 | 0.1 | GO:0097066 | response to thyroid hormone(GO:0097066) |
0.1 | 0.3 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.1 | 0.2 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.2 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
0.1 | 0.5 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.1 | 0.2 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.1 | 0.5 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.1 | 0.2 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.1 | 0.3 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.1 | 0.5 | GO:0019441 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.1 | 0.1 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.1 | 0.5 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.1 | 0.1 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.1 | 0.4 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.1 | 0.2 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.1 | 0.1 | GO:0010985 | negative regulation of lipoprotein particle clearance(GO:0010985) |
0.1 | 0.3 | GO:0003072 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
0.1 | 0.1 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.1 | 0.3 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.1 | 0.1 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.1 | 0.5 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.1 | 0.3 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.5 | GO:0015816 | glycine transport(GO:0015816) |
0.1 | 0.5 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.1 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.1 | 0.1 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
0.1 | 0.1 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.1 | 0.2 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.1 | 0.4 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.1 | 0.1 | GO:2000489 | regulation of hepatic stellate cell activation(GO:2000489) |
0.1 | 0.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.1 | 0.2 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 0.2 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.1 | 0.2 | GO:0009597 | detection of virus(GO:0009597) |
0.1 | 0.4 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.1 | 0.2 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.1 | 0.1 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.1 | 0.2 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.1 | 0.2 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.1 | 0.5 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
0.1 | 0.5 | GO:0031571 | mitotic G1 DNA damage checkpoint(GO:0031571) |
0.1 | 0.5 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.1 | 0.4 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.1 | 0.2 | GO:0015825 | L-serine transport(GO:0015825) |
0.1 | 0.2 | GO:0042420 | dopamine catabolic process(GO:0042420) |
0.1 | 0.2 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.1 | 0.2 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
0.1 | 3.0 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.1 | 0.4 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.1 | 0.8 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
0.1 | 0.5 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.1 | 0.3 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
0.1 | 0.1 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.1 | 2.1 | GO:0006414 | translational elongation(GO:0006414) |
0.1 | 0.2 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.1 | 0.5 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.1 | 0.4 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.1 | 0.2 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.1 | 0.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.1 | 0.1 | GO:0097501 | stress response to metal ion(GO:0097501) |
0.1 | 0.2 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.1 | 0.1 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.1 | 0.2 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.1 | 0.3 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.1 | 0.4 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.1 | 0.5 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
0.1 | 0.3 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.1 | 0.3 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
0.1 | 0.4 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.1 | 0.7 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.1 | 0.7 | GO:0030252 | growth hormone secretion(GO:0030252) |
0.1 | 0.2 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.1 | 0.5 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.1 | 0.2 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
0.1 | 0.2 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.1 | 0.3 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
0.1 | 0.2 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.1 | 0.4 | GO:1903504 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
0.1 | 0.4 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
0.1 | 0.5 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
0.1 | 0.2 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.1 | 0.7 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
0.1 | 0.2 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.1 | 0.2 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.1 | 0.5 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
0.1 | 0.3 | GO:0030220 | platelet formation(GO:0030220) |
0.1 | 0.2 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.1 | 0.5 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.1 | 0.6 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
0.1 | 0.2 | GO:0015824 | proline transport(GO:0015824) |
0.1 | 0.4 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.1 | 0.2 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.1 | 0.1 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.1 | 0.4 | GO:0021670 | lateral ventricle development(GO:0021670) |
0.1 | 0.7 | GO:0031167 | rRNA methylation(GO:0031167) |
0.1 | 0.4 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.1 | 0.7 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
0.1 | 0.1 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.1 | 0.9 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
0.1 | 0.4 | GO:0021984 | adenohypophysis development(GO:0021984) |
0.1 | 0.2 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.1 | 0.2 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.1 | 0.4 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.7 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
0.0 | 0.7 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.3 | GO:0035608 | protein deglutamylation(GO:0035608) |
0.0 | 1.1 | GO:0042832 | defense response to protozoan(GO:0042832) |
0.0 | 0.1 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.1 | GO:0043144 | snoRNA metabolic process(GO:0016074) snoRNA processing(GO:0043144) |
0.0 | 0.4 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
0.0 | 0.2 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.0 | 0.2 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.2 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
0.0 | 0.1 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.0 | 0.1 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
0.0 | 0.2 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
0.0 | 0.7 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.0 | 0.2 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.0 | 0.2 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.3 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.0 | 0.6 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.0 | 0.2 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.0 | 0.0 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
0.0 | 0.1 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.0 | 0.2 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.6 | GO:0045672 | positive regulation of osteoclast differentiation(GO:0045672) |
0.0 | 0.1 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.0 | 0.1 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.0 | 0.2 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
0.0 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.2 | GO:0001905 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
0.0 | 0.0 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.0 | 0.6 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.3 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.0 | 1.0 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.0 | 0.9 | GO:0046834 | lipid phosphorylation(GO:0046834) |
0.0 | 0.2 | GO:0051639 | actin filament network formation(GO:0051639) |
0.0 | 0.3 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.0 | 0.4 | GO:0072364 | regulation of cellular ketone metabolic process by regulation of transcription from RNA polymerase II promoter(GO:0072364) |
0.0 | 0.1 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
0.0 | 0.1 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.0 | 0.2 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.4 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
0.0 | 0.1 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
0.0 | 0.6 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.0 | 0.1 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.0 | 0.0 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.0 | 0.2 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.0 | 0.2 | GO:0000237 | leptotene(GO:0000237) |
0.0 | 0.2 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.0 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.0 | 0.1 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.4 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.0 | 0.1 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.0 | 0.2 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.0 | 0.1 | GO:0044793 | negative regulation by host of viral process(GO:0044793) |
0.0 | 0.2 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.0 | 0.0 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.0 | 0.3 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.0 | 0.2 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.2 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.0 | 0.1 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
0.0 | 0.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.0 | 0.0 | GO:0009732 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.0 | 0.3 | GO:0002923 | regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002923) |
0.0 | 0.5 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.8 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.2 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.0 | 0.1 | GO:0090045 | positive regulation of deacetylase activity(GO:0090045) |
0.0 | 0.2 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.0 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.0 | 0.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.2 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.0 | 0.3 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
0.0 | 0.2 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.0 | 0.1 | GO:0070669 | response to interleukin-2(GO:0070669) |
0.0 | 0.2 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.0 | 0.1 | GO:0010988 | regulation of low-density lipoprotein particle clearance(GO:0010988) |
0.0 | 0.3 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.3 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.2 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
0.0 | 0.2 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.0 | 0.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.0 | 0.0 | GO:0032747 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) positive regulation of interleukin-23 production(GO:0032747) |
0.0 | 0.9 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.0 | 0.2 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
0.0 | 0.1 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.0 | 0.2 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) |
0.0 | 0.1 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.0 | 0.1 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.0 | 0.1 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.0 | 0.1 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.0 | 0.0 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
0.0 | 0.1 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.0 | 0.6 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.0 | 0.0 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.0 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.0 | 0.3 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.1 | GO:0033623 | regulation of integrin activation(GO:0033623) |
0.0 | 0.2 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.0 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.2 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.0 | 0.0 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.0 | 0.1 | GO:0034435 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
0.0 | 0.6 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.0 | 0.1 | GO:1903519 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
0.0 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.0 | 0.1 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.0 | 0.0 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
0.0 | 0.1 | GO:0006534 | cysteine metabolic process(GO:0006534) |
0.0 | 0.1 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
0.0 | 0.0 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.0 | 0.1 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
0.0 | 0.4 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.1 | GO:0042117 | monocyte activation(GO:0042117) |
0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.0 | 0.2 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.3 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.0 | 0.1 | GO:1903416 | response to glycoside(GO:1903416) |
0.0 | 0.6 | GO:0046348 | amino sugar catabolic process(GO:0046348) |
0.0 | 0.1 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
0.0 | 0.0 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
0.0 | 0.2 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.1 | GO:0090169 | regulation of spindle assembly(GO:0090169) regulation of mitotic spindle assembly(GO:1901673) |
0.0 | 0.2 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
0.0 | 0.1 | GO:0051036 | regulation of endosome size(GO:0051036) |
0.0 | 0.1 | GO:0043379 | memory T cell differentiation(GO:0043379) |
0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.0 | 0.4 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.0 | 0.2 | GO:0045408 | regulation of interleukin-6 biosynthetic process(GO:0045408) |
0.0 | 0.0 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 0.4 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.1 | GO:0060605 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.0 | 0.1 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.0 | 0.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.0 | 0.2 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.0 | 0.1 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.0 | 0.8 | GO:0044243 | multicellular organism catabolic process(GO:0044243) |
0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.2 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.0 | 1.5 | GO:0006611 | protein export from nucleus(GO:0006611) |
0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.7 | GO:0006301 | postreplication repair(GO:0006301) |
0.0 | 0.2 | GO:0018101 | protein citrullination(GO:0018101) |
0.0 | 0.0 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
0.0 | 0.1 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.0 | 0.2 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.1 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.0 | 0.1 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.2 | GO:0000154 | rRNA modification(GO:0000154) |
0.0 | 0.2 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.5 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.0 | 0.2 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.0 | 0.1 | GO:0072672 | neutrophil extravasation(GO:0072672) |
0.0 | 0.1 | GO:2000650 | negative regulation of sodium ion transmembrane transporter activity(GO:2000650) |
0.0 | 0.1 | GO:1990774 | regulation of tumor necrosis factor secretion(GO:1904467) positive regulation of tumor necrosis factor secretion(GO:1904469) tumor necrosis factor secretion(GO:1990774) |
0.0 | 0.0 | GO:0032632 | interleukin-3 production(GO:0032632) |
0.0 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.4 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.0 | 0.1 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.0 | 0.1 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.0 | 0.2 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.2 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
0.0 | 0.1 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.0 | 0.1 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.0 | 0.0 | GO:0044819 | mitotic G1/S transition checkpoint(GO:0044819) |
0.0 | 0.1 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
0.0 | 0.0 | GO:1902306 | negative regulation of sodium ion transmembrane transport(GO:1902306) |
0.0 | 0.1 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.2 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.0 | 0.1 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.0 | 0.3 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.0 | 0.0 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
0.0 | 0.7 | GO:0006040 | amino sugar metabolic process(GO:0006040) |
0.0 | 0.1 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
0.0 | 0.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.0 | 0.8 | GO:1902750 | negative regulation of cell cycle G2/M phase transition(GO:1902750) |
0.0 | 0.4 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.0 | 0.1 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.0 | 0.1 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.0 | 0.0 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.0 | 0.1 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.0 | 0.1 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.0 | 0.2 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 0.1 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
0.0 | 0.9 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.0 | 0.0 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
0.0 | 0.2 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.0 | GO:0071224 | cellular response to peptidoglycan(GO:0071224) |
0.0 | 0.0 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.0 | 0.1 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.1 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.0 | 0.0 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.0 | 0.0 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.0 | 0.1 | GO:0030578 | PML body organization(GO:0030578) |
0.0 | 0.1 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.0 | 0.7 | GO:0009651 | response to salt stress(GO:0009651) |
0.0 | 0.0 | GO:0001768 | establishment of lymphocyte polarity(GO:0001767) establishment of T cell polarity(GO:0001768) |
0.0 | 0.2 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.0 | 0.3 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) positive regulation of lipid kinase activity(GO:0090218) |
0.0 | 0.4 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 0.1 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.0 | 0.1 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.0 | 0.1 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.0 | 0.2 | GO:0046051 | UTP metabolic process(GO:0046051) |
0.0 | 0.1 | GO:2001140 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
0.0 | 0.1 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 0.1 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
0.0 | 0.0 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
0.0 | 0.1 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.0 | 0.1 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.0 | 0.0 | GO:0015819 | lysine transport(GO:0015819) |
0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
0.0 | 0.2 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.0 | 0.1 | GO:0007525 | somatic muscle development(GO:0007525) |
0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 0.2 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 0.1 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.0 | 0.0 | GO:0072584 | caveolin-mediated endocytosis(GO:0072584) |
0.0 | 0.1 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.0 | 0.1 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.2 | GO:1900048 | positive regulation of blood coagulation(GO:0030194) positive regulation of hemostasis(GO:1900048) |
0.0 | 0.1 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
0.0 | 0.1 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.0 | 0.1 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.0 | 0.1 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.0 | 0.1 | GO:0051697 | protein delipidation(GO:0051697) |
0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.1 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.0 | 0.0 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.0 | 0.1 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.1 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.0 | 0.3 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.0 | 0.3 | GO:0055069 | zinc ion homeostasis(GO:0055069) |
0.0 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.1 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.2 | GO:0036124 | histone H3-K9 trimethylation(GO:0036124) |
0.0 | 0.0 | GO:0009804 | coumarin metabolic process(GO:0009804) |
0.0 | 0.0 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.0 | 0.1 | GO:1901859 | negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
0.0 | 0.1 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.0 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.1 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.0 | 0.1 | GO:0061042 | vascular wound healing(GO:0061042) |
0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.0 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 0.1 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.0 | 0.7 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.0 | 0.0 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.0 | 0.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.0 | 0.0 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.0 | 0.1 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.0 | 0.0 | GO:0035087 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.0 | 0.0 | GO:2000109 | macrophage apoptotic process(GO:0071888) regulation of macrophage apoptotic process(GO:2000109) |
0.0 | 0.1 | GO:0031297 | replication fork processing(GO:0031297) |
0.0 | 0.6 | GO:1902653 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
0.0 | 0.2 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.3 | GO:0045022 | early endosome to late endosome transport(GO:0045022) vesicle-mediated transport between endosomal compartments(GO:0098927) |
0.0 | 0.0 | GO:0032329 | serine transport(GO:0032329) |
0.0 | 0.1 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.0 | 0.0 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
0.0 | 0.1 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.3 | GO:0097576 | vacuole fusion(GO:0097576) |
0.0 | 0.0 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.0 | 0.0 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
0.0 | 0.1 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.4 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.0 | 0.0 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.1 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
0.0 | 0.0 | GO:0006188 | IMP biosynthetic process(GO:0006188) |
0.0 | 0.1 | GO:0018904 | ether metabolic process(GO:0018904) |
0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.0 | 0.0 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.0 | 0.1 | GO:0090224 | regulation of mitotic spindle organization(GO:0060236) regulation of spindle organization(GO:0090224) |
0.0 | 0.4 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.6 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.1 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.0 | 0.0 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.0 | 0.1 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.0 | 0.1 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.0 | 0.1 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.0 | 0.1 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.0 | 0.1 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.0 | 0.1 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.0 | 0.0 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.2 | GO:0006560 | proline metabolic process(GO:0006560) |
0.0 | 0.0 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.0 | 0.1 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
0.0 | 0.0 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.8 | GO:0009060 | aerobic respiration(GO:0009060) |
0.0 | 0.1 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
0.0 | 0.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.0 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.0 | 0.0 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.0 | 0.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.0 | 0.2 | GO:0046916 | cellular transition metal ion homeostasis(GO:0046916) |
0.0 | 0.1 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.0 | 0.0 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
0.0 | 0.0 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.0 | 0.1 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
0.0 | 0.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.1 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.0 | 0.0 | GO:0009208 | pyrimidine ribonucleoside triphosphate metabolic process(GO:0009208) |
0.0 | 0.1 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.0 | 0.2 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) protein-lipid complex assembly(GO:0065005) |
0.0 | 0.0 | GO:0001787 | natural killer cell proliferation(GO:0001787) |
0.0 | 0.0 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.0 | 0.1 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.0 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.0 | 0.0 | GO:1901978 | positive regulation of cell cycle checkpoint(GO:1901978) |
0.0 | 0.1 | GO:0033622 | integrin activation(GO:0033622) |
0.0 | 0.0 | GO:0003383 | apical constriction(GO:0003383) |
0.0 | 0.1 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.0 | 0.1 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
0.0 | 0.2 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.0 | 0.1 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.0 | 0.0 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
0.0 | 0.1 | GO:0016075 | rRNA catabolic process(GO:0016075) |
0.0 | 0.1 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.0 | 0.0 | GO:0000052 | citrulline metabolic process(GO:0000052) |
0.0 | 0.1 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.1 | GO:0046836 | glycolipid transport(GO:0046836) |
0.0 | 0.2 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.0 | 0.0 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
0.0 | 0.2 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.0 | 0.0 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.0 | 0.0 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.0 | 0.0 | GO:0052646 | alditol phosphate metabolic process(GO:0052646) |
0.0 | 0.0 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.0 | 0.4 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
0.0 | 0.0 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.0 | 0.1 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
0.0 | 0.0 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.0 | 0.0 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
0.0 | 0.2 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
0.0 | 0.2 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.0 | 0.1 | GO:0007144 | female meiosis I(GO:0007144) |
0.0 | 0.0 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
0.0 | 0.1 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.0 | 0.0 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.0 | 0.0 | GO:1901524 | regulation of macromitophagy(GO:1901524) |
0.0 | 0.1 | GO:0030575 | nuclear body organization(GO:0030575) |
0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.0 | 0.1 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.0 | 0.1 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.0 | 0.0 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.1 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.0 | 0.0 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.0 | 0.0 | GO:0045047 | protein targeting to ER(GO:0045047) |
0.0 | 0.1 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 0.2 | GO:0001845 | phagolysosome assembly(GO:0001845) |
0.0 | 0.1 | GO:0006778 | porphyrin-containing compound metabolic process(GO:0006778) |
0.0 | 0.0 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.0 | 0.2 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
0.0 | 0.2 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
0.0 | 0.2 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.0 | 0.0 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.0 | 0.1 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.0 | 0.2 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.0 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
0.0 | 0.2 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.1 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.0 | 0.3 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.0 | 0.1 | GO:0070986 | left/right axis specification(GO:0070986) |
0.0 | 0.0 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.0 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.0 | 0.1 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.1 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.1 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.1 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
0.0 | 0.1 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
0.0 | 0.1 | GO:0010889 | regulation of sequestering of triglyceride(GO:0010889) positive regulation of sequestering of triglyceride(GO:0010890) sequestering of triglyceride(GO:0030730) |
0.0 | 0.0 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.0 | 0.1 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.0 | 0.1 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.0 | 0.0 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.1 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
0.0 | 0.1 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.0 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.0 | 0.1 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.0 | 0.3 | GO:0009813 | flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
0.0 | 0.1 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.0 | 0.1 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) telomere maintenance in response to DNA damage(GO:0043247) |
0.0 | 0.5 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.0 | 0.0 | GO:0019532 | oxalate transport(GO:0019532) |
0.0 | 0.0 | GO:1904124 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.0 | 0.0 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 0.0 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.2 | GO:0009142 | nucleoside triphosphate biosynthetic process(GO:0009142) |
0.0 | 0.0 | GO:0042772 | DNA damage response, signal transduction resulting in transcription(GO:0042772) |
0.0 | 0.0 | GO:0044351 | macropinocytosis(GO:0044351) |
0.0 | 0.0 | GO:0009445 | putrescine metabolic process(GO:0009445) |
0.0 | 0.1 | GO:0048664 | neuron fate determination(GO:0048664) |
0.0 | 0.2 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.0 | 0.5 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.0 | 0.0 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.0 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
0.0 | 0.0 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
0.0 | 0.0 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.0 | 0.0 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.0 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.0 | 0.3 | GO:0006284 | base-excision repair(GO:0006284) |
0.0 | 0.0 | GO:0070723 | response to cholesterol(GO:0070723) |
0.0 | 0.0 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.0 | 0.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.0 | 0.1 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.0 | 0.0 | GO:0097049 | motor neuron apoptotic process(GO:0097049) |
0.0 | 0.1 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
0.0 | 0.0 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.0 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.0 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.0 | 0.1 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
0.0 | 0.2 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.1 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
0.0 | 0.0 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
0.0 | 0.0 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.0 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
0.0 | 0.0 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.0 | 0.1 | GO:0006817 | phosphate ion transport(GO:0006817) |
0.0 | 0.0 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.0 | 0.0 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.0 | 0.1 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.0 | 0.2 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.1 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.0 | 0.0 | GO:0061010 | gall bladder development(GO:0061010) |
0.0 | 0.1 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.0 | GO:0019614 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
0.0 | 0.0 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.0 | 0.2 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.0 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.1 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.0 | 0.0 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.0 | 0.0 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
0.0 | 0.0 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.0 | 0.0 | GO:0010424 | DNA methylation on cytosine within a CG sequence(GO:0010424) DNA methylation on cytosine(GO:0032776) |
0.0 | 0.1 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.0 | 0.1 | GO:0002385 | organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
0.0 | 0.2 | GO:0002381 | immunoglobulin production involved in immunoglobulin mediated immune response(GO:0002381) |
0.0 | 0.0 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.0 | 0.0 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
0.0 | 0.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.1 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.4 | GO:0006446 | regulation of translational initiation(GO:0006446) |
0.0 | 0.1 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.0 | 0.3 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.0 | 0.1 | GO:0042088 | T-helper 1 type immune response(GO:0042088) |
0.0 | 0.0 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.0 | 0.1 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.0 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.0 | 0.0 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.0 | 0.0 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.0 | 0.0 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.0 | 0.0 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.0 | 0.1 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.0 | 0.4 | GO:0000086 | G2/M transition of mitotic cell cycle(GO:0000086) |
0.0 | 0.0 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.1 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
0.0 | 0.0 | GO:0046113 | nucleobase catabolic process(GO:0046113) |
0.0 | 0.0 | GO:2000019 | negative regulation of male gonad development(GO:2000019) |
0.0 | 0.0 | GO:1902268 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.0 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.0 | 0.1 | GO:0042508 | tyrosine phosphorylation of Stat1 protein(GO:0042508) |
0.0 | 0.0 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.0 | 0.0 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.0 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.0 | 0.1 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.1 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.0 | 0.0 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.0 | 0.0 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.0 | 0.0 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.0 | 0.0 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.0 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.0 | 0.2 | GO:0045840 | positive regulation of mitotic nuclear division(GO:0045840) |
0.0 | 0.1 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.0 | 0.0 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.0 | 0.1 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.0 | 0.0 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.0 | 0.0 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
0.0 | 0.1 | GO:0006855 | drug transmembrane transport(GO:0006855) |
0.0 | 0.0 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
0.0 | 0.0 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.0 | GO:0002580 | regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) |
0.0 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.0 | 0.0 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.3 | GO:0071346 | cellular response to interferon-gamma(GO:0071346) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.0 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
0.0 | 0.0 | GO:0000305 | response to oxygen radical(GO:0000305) |
0.0 | 0.1 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.0 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
0.0 | 0.1 | GO:0006968 | cellular defense response(GO:0006968) |
0.0 | 0.0 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.0 | 0.1 | GO:0000731 | DNA synthesis involved in DNA repair(GO:0000731) |
0.0 | 0.1 | GO:0006465 | signal peptide processing(GO:0006465) |
0.0 | 0.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.1 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.0 | GO:0071316 | cellular response to nicotine(GO:0071316) |
0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.0 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.0 | 0.0 | GO:0002838 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
0.0 | 0.0 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.6 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.3 | 1.0 | GO:0033269 | internode region of axon(GO:0033269) |
0.2 | 0.6 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.2 | 0.9 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.2 | 0.8 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.2 | 1.1 | GO:0002177 | manchette(GO:0002177) |
0.2 | 1.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 0.6 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 0.7 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 0.7 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 0.4 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.1 | 0.5 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.1 | 0.3 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.1 | 1.0 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.1 | 0.4 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.1 | 0.4 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 0.3 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.1 | 0.6 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 0.4 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.1 | 0.3 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 0.7 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.1 | 0.4 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.1 | 0.4 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 0.3 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.1 | 0.2 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 1.6 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.1 | 0.3 | GO:0035339 | SPOTS complex(GO:0035339) |
0.1 | 0.3 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 0.2 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 0.2 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.1 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 2.0 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
0.1 | 0.4 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.1 | 0.3 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.1 | 0.7 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.1 | 0.7 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
0.1 | 0.3 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
0.1 | 0.1 | GO:0032010 | phagolysosome(GO:0032010) |
0.1 | 1.0 | GO:0031528 | microvillus membrane(GO:0031528) |
0.1 | 0.4 | GO:0005818 | aster(GO:0005818) |
0.1 | 0.1 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.1 | 0.2 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.1 | 0.3 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.1 | 0.2 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.1 | 0.2 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.1 | 0.3 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 0.2 | GO:0016580 | Sin3 complex(GO:0016580) |
0.1 | 0.2 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 0.5 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 0.2 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 0.6 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.1 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 0.3 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.1 | 5.9 | GO:0072562 | blood microparticle(GO:0072562) |
0.1 | 0.4 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 0.2 | GO:1990130 | Iml1 complex(GO:1990130) |
0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 1.2 | GO:0034451 | centriolar satellite(GO:0034451) |
0.1 | 0.4 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 2.2 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.1 | 0.4 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.2 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.1 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
0.1 | 0.2 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.5 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.0 | 0.2 | GO:0070695 | FHF complex(GO:0070695) |
0.0 | 0.8 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 1.2 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.2 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.0 | 3.4 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.6 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.5 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.0 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.0 | 0.2 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.0 | 0.2 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.0 | 0.2 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.0 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.0 | 0.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.2 | GO:0030689 | Noc complex(GO:0030689) |
0.0 | 0.4 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.1 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.0 | 0.4 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.2 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.0 | 0.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.4 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.0 | 0.4 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
0.0 | 1.2 | GO:0008305 | integrin complex(GO:0008305) |
0.0 | 0.3 | GO:0070938 | contractile ring(GO:0070938) |
0.0 | 0.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.4 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.0 | 0.2 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.0 | 0.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.0 | 0.1 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.0 | 0.0 | GO:0098576 | lumenal side of membrane(GO:0098576) |
0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.0 | 0.4 | GO:0042581 | specific granule(GO:0042581) |
0.0 | 0.4 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.2 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.1 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.0 | 1.5 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.2 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.4 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.0 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.0 | 0.4 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 0.3 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 1.4 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.1 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.9 | GO:0031902 | late endosome membrane(GO:0031902) |
0.0 | 2.0 | GO:0005643 | nuclear pore(GO:0005643) |
0.0 | 0.8 | GO:0097228 | sperm principal piece(GO:0097228) |
0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.4 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.2 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 1.8 | GO:0042641 | actomyosin(GO:0042641) |
0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.0 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.0 | 0.2 | GO:0043203 | axon hillock(GO:0043203) |
0.0 | 0.8 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.8 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 0.4 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.3 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.8 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.0 | 0.2 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 2.5 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.0 | 0.5 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 1.0 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.0 | 0.2 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.4 | GO:0000145 | exocyst(GO:0000145) |
0.0 | 0.5 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.1 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.2 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.0 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
0.0 | 0.2 | GO:0036452 | ESCRT III complex(GO:0000815) ESCRT complex(GO:0036452) |
0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.0 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.2 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 0.3 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 0.5 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.4 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 1.1 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 0.2 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.8 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.9 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 1.8 | GO:0000922 | spindle pole(GO:0000922) |
0.0 | 0.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.0 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.0 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.0 | 0.0 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.6 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.0 | 0.0 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.7 | GO:0005657 | replication fork(GO:0005657) |
0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.0 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.7 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 0.5 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.1 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.4 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 1.4 | GO:0005770 | late endosome(GO:0005770) |
0.0 | 2.2 | GO:0098852 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
0.0 | 0.3 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.1 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.0 | 0.9 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.3 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.4 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.2 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 0.1 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.0 | 0.2 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.1 | GO:0042627 | chylomicron(GO:0042627) |
0.0 | 0.0 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.1 | GO:0071010 | prespliceosome(GO:0071010) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.0 | GO:0005914 | spot adherens junction(GO:0005914) |
0.0 | 0.1 | GO:0005587 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 0.5 | GO:0005776 | autophagosome(GO:0005776) |
0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.9 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.3 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.1 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 0.6 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.0 | 0.0 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.1 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.0 | 0.0 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.0 | 0.1 | GO:0032994 | protein-lipid complex(GO:0032994) |
0.0 | 0.2 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.1 | GO:0001741 | XY body(GO:0001741) |
0.0 | 0.0 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 0.1 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.2 | GO:0035267 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 0.0 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.0 | 0.1 | GO:0031011 | Ino80 complex(GO:0031011) |
0.0 | 0.1 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.0 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.0 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
0.0 | 0.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.5 | GO:0031985 | Golgi cisterna(GO:0031985) |
0.0 | 0.0 | GO:0031417 | NatC complex(GO:0031417) |
0.0 | 0.3 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.0 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.1 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.0 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.7 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.1 | GO:0030914 | STAGA complex(GO:0030914) |
0.0 | 0.1 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 0.2 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.0 | 0.1 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.9 | GO:1990204 | oxidoreductase complex(GO:1990204) |
0.0 | 0.2 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 3.2 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.0 | 0.5 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 0.0 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.0 | 0.5 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.0 | 0.5 | GO:0000776 | kinetochore(GO:0000776) |
0.0 | 0.5 | GO:0016605 | PML body(GO:0016605) |
0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.6 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 0.0 | GO:0000805 | X chromosome(GO:0000805) |
0.0 | 0.0 | GO:0033263 | CORVET complex(GO:0033263) |
0.0 | 0.1 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.0 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.0 | 2.0 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.0 | 0.5 | GO:0030496 | midbody(GO:0030496) |
0.0 | 0.2 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.0 | 0.0 | GO:0031082 | BLOC complex(GO:0031082) |
0.0 | 0.1 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.1 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.1 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.3 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.0 | GO:0000812 | Swr1 complex(GO:0000812) |
0.0 | 0.1 | GO:0005684 | U2-type spliceosomal complex(GO:0005684) |
0.0 | 0.6 | GO:0000793 | condensed chromosome(GO:0000793) |
0.0 | 0.0 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.0 | 0.0 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.0 | 0.1 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.0 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.3 | 0.8 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.3 | 0.8 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.3 | 1.8 | GO:0046790 | virion binding(GO:0046790) |
0.3 | 1.8 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.2 | 0.7 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
0.2 | 1.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.2 | 0.9 | GO:0015265 | urea channel activity(GO:0015265) |
0.2 | 0.7 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.2 | 0.6 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.2 | 0.8 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.2 | 1.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.2 | 0.8 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.2 | 0.5 | GO:2001070 | starch binding(GO:2001070) |
0.2 | 0.9 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.2 | 0.7 | GO:0042731 | PH domain binding(GO:0042731) |
0.2 | 0.5 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.2 | 0.6 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.2 | 0.5 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.2 | 0.8 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.2 | 0.9 | GO:0004064 | arylesterase activity(GO:0004064) |
0.1 | 0.4 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.1 | 0.6 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 0.6 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 0.6 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.1 | 0.6 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.1 | 0.4 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 2.6 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.1 | 0.4 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.1 | 0.5 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 0.4 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.1 | 0.4 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.1 | 0.4 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.1 | 0.9 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.1 | 0.8 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.1 | 0.8 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.3 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 0.3 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.1 | 1.1 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.1 | 0.7 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.1 | 0.3 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.1 | 0.4 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.1 | 0.7 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 0.3 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.1 | 0.5 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.4 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.4 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.1 | 0.6 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.1 | 2.8 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.1 | 1.0 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.1 | 0.5 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.1 | 0.8 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.6 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 0.3 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.1 | 1.3 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.1 | 0.6 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.1 | 0.3 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.1 | 0.4 | GO:0030984 | kininogen binding(GO:0030984) |
0.1 | 0.9 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
0.1 | 0.4 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.1 | 0.3 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 0.2 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 0.2 | GO:0048030 | disaccharide binding(GO:0048030) |
0.1 | 1.6 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.1 | 0.3 | GO:0032564 | dATP binding(GO:0032564) |
0.1 | 0.7 | GO:0019914 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
0.1 | 0.4 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.3 | GO:0015232 | heme transporter activity(GO:0015232) |
0.1 | 0.4 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.1 | 0.3 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.1 | 0.4 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 0.3 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.1 | 0.3 | GO:0052796 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.1 | 0.3 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.1 | 0.6 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.1 | 0.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.1 | 0.2 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.1 | 0.2 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.1 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.1 | 0.6 | GO:0051400 | BH domain binding(GO:0051400) |
0.1 | 0.3 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.1 | 0.2 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.1 | 0.1 | GO:0019956 | chemokine binding(GO:0019956) |
0.1 | 0.3 | GO:0030911 | TPR domain binding(GO:0030911) |
0.1 | 0.4 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
0.1 | 0.2 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.1 | 0.2 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.1 | 1.5 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.1 | 0.3 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.1 | 0.2 | GO:0018598 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.1 | 0.2 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.1 | 0.2 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.1 | 0.2 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.1 | 0.4 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.1 | 0.2 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.2 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.1 | 0.6 | GO:0045703 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.1 | 0.6 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.1 | 0.2 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.1 | 0.2 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.1 | 0.7 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.5 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 0.5 | GO:0016803 | ether hydrolase activity(GO:0016803) |
0.1 | 0.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.1 | 0.2 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.1 | 0.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.3 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.1 | 0.3 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.1 | 0.3 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.1 | 0.2 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.1 | 0.8 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.1 | 1.0 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.1 | 0.2 | GO:0034549 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
0.1 | 0.5 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.1 | 1.8 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.1 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 0.2 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.1 | 0.5 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.1 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.1 | 0.4 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 0.5 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 0.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.1 | 0.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.1 | 0.3 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.1 | 0.2 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.1 | 0.2 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.1 | 0.8 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.1 | 0.3 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.1 | 0.2 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.1 | 0.3 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.1 | 0.3 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 1.4 | GO:0043531 | ADP binding(GO:0043531) |
0.1 | 0.2 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.1 | 0.4 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.1 | 0.4 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.1 | 0.2 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.1 | 0.3 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.1 | 0.2 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.1 | 0.3 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.1 | 0.3 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.1 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 0.4 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 0.2 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.1 | 0.2 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.1 | 0.4 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.1 | 0.6 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.1 | 0.6 | GO:0030506 | ankyrin binding(GO:0030506) |
0.1 | 0.1 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.1 | 0.3 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.2 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.0 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.0 | 0.2 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.1 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.0 | 0.4 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.0 | 0.2 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.0 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.3 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.0 | 0.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.0 | 0.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.5 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.0 | GO:0036222 | dITP diphosphatase activity(GO:0035870) XTP diphosphatase activity(GO:0036222) |
0.0 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 1.4 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.0 | 0.2 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.2 | GO:0009374 | biotin binding(GO:0009374) |
0.0 | 0.1 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.0 | 0.2 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.0 | 0.7 | GO:0032183 | SUMO binding(GO:0032183) |
0.0 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 0.0 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.0 | 0.2 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.2 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.1 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.0 | 0.2 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.0 | 0.5 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.1 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.0 | 0.4 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.0 | 0.4 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.2 | GO:0051766 | inositol trisphosphate kinase activity(GO:0051766) |
0.0 | 2.7 | GO:0002039 | p53 binding(GO:0002039) |
0.0 | 0.4 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.0 | 0.1 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.0 | 0.6 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.3 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.1 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.0 | 0.9 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.0 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.3 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.2 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.0 | 0.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.0 | 0.4 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.1 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.0 | 0.1 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.3 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.1 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.3 | GO:0000150 | recombinase activity(GO:0000150) |
0.0 | 0.2 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.0 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.0 | 0.2 | GO:0001164 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.0 | 0.2 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.0 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.2 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.1 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 3.8 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.4 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.0 | 0.3 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.2 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.0 | 0.9 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.0 | 0.2 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.0 | 0.3 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.0 | GO:0003896 | DNA primase activity(GO:0003896) |
0.0 | 0.1 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.1 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.0 | 0.4 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.5 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 1.0 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.2 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.4 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.3 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 1.1 | GO:0061650 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.0 | 0.2 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.0 | 0.7 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.5 | GO:0015925 | galactosidase activity(GO:0015925) |
0.0 | 0.1 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.0 | 0.7 | GO:0045502 | dynein binding(GO:0045502) |
0.0 | 0.1 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.0 | 0.3 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.4 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.2 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.0 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.0 | 0.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.0 | 0.8 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.4 | GO:0010181 | FMN binding(GO:0010181) |
0.0 | 0.1 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.0 | 0.8 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 0.2 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.3 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.0 | 0.4 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.0 | 0.3 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.1 | GO:0051731 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
0.0 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.0 | 0.2 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.2 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.0 | 0.4 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.0 | 0.2 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.0 | 0.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.0 | 0.4 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.0 | 0.1 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.0 | 0.5 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.0 | 0.1 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.0 | 0.3 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.3 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.0 | 0.1 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.0 | 0.3 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.0 | 0.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.3 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.1 | GO:0015928 | fucosidase activity(GO:0015928) |
0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
0.0 | 0.2 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.3 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.3 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.7 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.2 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.0 | 0.2 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.7 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.0 | 0.9 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.0 | 0.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.0 | 0.1 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.0 | 0.0 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.0 | 0.2 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.1 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.0 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 0.2 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.1 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 0.2 | GO:0034869 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.0 | 0.1 | GO:1990459 | transferrin receptor binding(GO:1990459) |
0.0 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.0 | 0.5 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 1.0 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.2 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.0 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.0 | 0.0 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.0 | 0.6 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 0.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 1.5 | GO:0031072 | heat shock protein binding(GO:0031072) |
0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.1 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.2 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.0 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.0 | 0.0 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.1 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.0 | 0.4 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.0 | 0.3 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
0.0 | 0.1 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.0 | 0.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.2 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.0 | 2.4 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 1.5 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.0 | 0.1 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 0.0 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.5 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 1.2 | GO:0004896 | cytokine receptor activity(GO:0004896) |
0.0 | 0.0 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.9 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 0.3 | GO:0005537 | mannose binding(GO:0005537) |
0.0 | 0.7 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.1 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.4 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.0 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.0 | 0.1 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.0 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
0.0 | 0.1 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.1 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.0 | 0.4 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.5 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.1 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.0 | 0.0 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.0 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.0 | 0.0 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.1 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.1 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.1 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.0 | 0.0 | GO:0045309 | protein phosphorylated amino acid binding(GO:0045309) |
0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.0 | 0.0 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.0 | 0.1 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.1 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.0 | 0.1 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.0 | 0.1 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 0.2 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 2.8 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.1 | GO:0019863 | IgE binding(GO:0019863) |
0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.0 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.0 | 0.3 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.0 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.0 | 0.2 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.0 | 1.0 | GO:0032182 | ubiquitin-like protein binding(GO:0032182) |
0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.0 | GO:0003916 | DNA topoisomerase activity(GO:0003916) DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.4 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.0 | 0.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.1 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.0 | 0.1 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.0 | 0.0 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.0 | 0.0 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.0 | 0.7 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
0.0 | 0.1 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.1 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.2 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.0 | 0.0 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.0 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.6 | GO:0038024 | cargo receptor activity(GO:0038024) |
0.0 | 0.0 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.0 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.0 | GO:0008169 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
0.0 | 0.0 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.0 | 0.2 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.4 | GO:0046332 | SMAD binding(GO:0046332) |
0.0 | 0.6 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.0 | 0.1 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.0 | 0.2 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.0 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.0 | 0.1 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.0 | GO:0008199 | ferric iron binding(GO:0008199) |
0.0 | 0.4 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.0 | 0.1 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.0 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.1 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.0 | 0.1 | GO:0046977 | TAP binding(GO:0046977) |
0.0 | 0.0 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.0 | 0.1 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.0 | 0.2 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
0.0 | 0.3 | GO:0016620 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, NAD or NADP as acceptor(GO:0016620) |
0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.2 | GO:0019843 | rRNA binding(GO:0019843) |
0.0 | 0.3 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.0 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.0 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 1.6 | GO:0044389 | ubiquitin-like protein ligase binding(GO:0044389) |
0.0 | 0.0 | GO:0035173 | histone kinase activity(GO:0035173) |
0.0 | 0.3 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.0 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.0 | 0.1 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 2.2 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.0 | 0.9 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 1.9 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.0 | 0.1 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.0 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.0 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.0 | 0.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.0 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.0 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 0.1 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.0 | 0.0 | GO:0016414 | O-octanoyltransferase activity(GO:0016414) |
0.0 | 0.6 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
0.0 | 0.1 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.0 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.0 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
0.0 | 0.0 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.2 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.0 | 0.5 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.1 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.1 | GO:0016879 | ligase activity, forming carbon-nitrogen bonds(GO:0016879) |
0.0 | 0.0 | GO:0031013 | troponin I binding(GO:0031013) |
0.0 | 0.0 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.0 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.2 | PID INSULIN PATHWAY | Insulin Pathway |
0.1 | 4.0 | PID EPO PATHWAY | EPO signaling pathway |
0.1 | 1.2 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.1 | 1.8 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.1 | 0.5 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.1 | 2.4 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.1 | 3.2 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.1 | 0.9 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.1 | 2.8 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.1 | 3.2 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 0.6 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 0.8 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.1 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 2.1 | PID AURORA B PATHWAY | Aurora B signaling |
0.1 | 0.8 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.1 | 0.5 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.0 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 0.6 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.9 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.2 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.2 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 1.8 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.5 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 0.3 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.4 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.2 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.9 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.0 | 0.6 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 1.0 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.5 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.9 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 2.1 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.0 | 0.3 | ST GAQ PATHWAY | G alpha q Pathway |
0.0 | 0.4 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.0 | 0.3 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.5 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.6 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.3 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.0 | 0.5 | PID RHOA PATHWAY | RhoA signaling pathway |
0.0 | 0.5 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.0 | 0.3 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.1 | PID IGF1 PATHWAY | IGF1 pathway |
0.0 | 0.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 1.1 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.8 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.9 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 1.5 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.0 | 0.6 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 0.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.2 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.1 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 1.4 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.1 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.5 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.5 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.1 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.0 | 0.3 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.1 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 0.0 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.2 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.6 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.2 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.5 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.0 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.2 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 0.0 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.3 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.3 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.2 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.1 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.7 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.2 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.1 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.0 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.1 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.2 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.2 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.1 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 1.8 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.1 | 1.9 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.1 | 2.2 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.1 | 1.6 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 2.1 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 1.4 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.1 | 1.8 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.1 | 0.2 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.1 | 0.8 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.1 | 0.7 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.1 | 0.5 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.1 | 2.8 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.1 | 1.8 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.1 | 1.0 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 1.5 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.1 | 0.8 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.1 | 1.1 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.1 | 0.8 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.1 | 0.8 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.1 | 1.6 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.1 | 1.0 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.1 | 0.7 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.1 | 1.5 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.1 | 1.0 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 0.2 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 0.6 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 0.9 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.1 | 1.5 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.1 | 1.0 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.1 | 1.0 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.1 | 0.4 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 0.9 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.1 | 0.8 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 0.6 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.1 | 1.1 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 0.6 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.1 | 0.6 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 0.1 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.1 | 0.9 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 1.3 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.1 | 0.2 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 0.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.1 | 0.2 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.1 | 0.3 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.1 | 0.1 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.1 | 1.8 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.1 | 0.6 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.1 | REACTOME SIGNALING BY NOTCH | Genes involved in Signaling by NOTCH |
0.0 | 1.4 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 0.5 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.0 | 0.7 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.0 | 1.8 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.0 | 0.5 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.0 | 1.2 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.0 | 3.2 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.6 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 1.0 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.6 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.0 | 0.4 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 1.6 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.4 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 2.8 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 2.4 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.0 | 0.5 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.0 | 0.6 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.0 | 1.7 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.0 | 0.3 | REACTOME E2F MEDIATED REGULATION OF DNA REPLICATION | Genes involved in E2F mediated regulation of DNA replication |
0.0 | 0.8 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.1 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 0.3 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.4 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.0 | 1.0 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.2 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.3 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.0 | 0.3 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.3 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.7 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.3 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.0 | 0.0 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
0.0 | 0.3 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.5 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.0 | 0.5 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.3 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 0.0 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.0 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.0 | 0.6 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.3 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.1 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
0.0 | 0.7 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.1 | REACTOME G1 S TRANSITION | Genes involved in G1/S Transition |
0.0 | 0.4 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.4 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.1 | REACTOME PI3K CASCADE | Genes involved in PI3K Cascade |
0.0 | 0.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.3 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.2 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.1 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.0 | 0.5 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 0.7 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.1 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.1 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.0 | 1.5 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.0 | 0.0 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.2 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
0.0 | 2.1 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 0.7 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
0.0 | 0.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.3 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.3 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 0.1 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.0 | 0.3 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.0 | 1.0 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.0 | 0.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 1.6 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.0 | 0.3 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
0.0 | 0.2 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.3 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.0 | 0.1 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.0 | 0.3 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.3 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.0 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.0 | 0.0 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 0.0 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.0 | 0.0 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.0 | 0.1 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.0 | 0.1 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.4 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.1 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.0 | 0.6 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.0 | 0.4 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.0 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.2 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.6 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.1 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
0.0 | 0.1 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.1 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.1 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
0.0 | 0.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.3 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 0.1 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.0 | 0.1 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.2 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.0 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.0 | 0.2 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.0 | 0.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.1 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.1 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 0.8 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.3 | REACTOME TRANSLATION | Genes involved in Translation |