Gene Symbol | Gene ID | Gene Info |
---|---|---|
Nanog
|
ENSMUSG00000012396.6 | Nanog |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Nanog | chr6_122703391_122703581 | 4003 | 0.137782 | 0.06 | 6.6e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr1_14308374_14310407 | 3.43 |
Eya1 |
EYA transcriptional coactivator and phosphatase 1 |
446 |
0.88 |
chr2_74689028_74690409 | 3.35 |
Hoxd10 |
homeobox D10 |
2206 |
0.09 |
chr5_119673827_119675890 | 3.08 |
Tbx3 |
T-box 3 |
587 |
0.67 |
chr6_52229552_52230397 | 2.98 |
Mir196b |
microRNA 196b |
191 |
0.57 |
chr18_84831018_84831169 | 2.94 |
Gm17266 |
predicted gene, 17266 |
5623 |
0.17 |
chr2_57997628_57998772 | 2.88 |
Galnt5 |
polypeptide N-acetylgalactosaminyltransferase 5 |
316 |
0.9 |
chr3_66977838_66980287 | 2.77 |
Shox2 |
short stature homeobox 2 |
251 |
0.9 |
chr2_9882196_9886301 | 2.61 |
9230102O04Rik |
RIKEN cDNA 9230102O04 gene |
255 |
0.84 |
chr13_15466077_15468087 | 2.58 |
Gli3 |
GLI-Kruppel family member GLI3 |
3102 |
0.22 |
chr13_53281732_53283010 | 2.49 |
Ror2 |
receptor tyrosine kinase-like orphan receptor 2 |
3178 |
0.33 |
chr1_78186833_78187893 | 2.43 |
Pax3 |
paired box 3 |
9475 |
0.23 |
chr15_95652829_95653706 | 2.42 |
Dbx2 |
developing brain homeobox 2 |
2693 |
0.28 |
chr5_75148315_75152589 | 2.41 |
Pdgfra |
platelet derived growth factor receptor, alpha polypeptide |
1840 |
0.2 |
chr1_168426195_168428871 | 2.38 |
Pbx1 |
pre B cell leukemia homeobox 1 |
3971 |
0.3 |
chr19_44758783_44762005 | 2.36 |
Pax2 |
paired box 2 |
479 |
0.75 |
chr18_84832685_84832836 | 2.35 |
Gm17266 |
predicted gene, 17266 |
3956 |
0.18 |
chr2_74713120_74713846 | 2.28 |
Hoxd3os1 |
homeobox D3, opposite strand 1 |
957 |
0.21 |
chr6_23382210_23383537 | 2.17 |
Cadps2 |
Ca2+-dependent activator protein for secretion 2 |
26954 |
0.22 |
chr8_57326741_57329467 | 2.09 |
Hand2os1 |
Hand2, opposite strand 1 |
3871 |
0.15 |
chr14_28512745_28513804 | 2.08 |
Wnt5a |
wingless-type MMTV integration site family, member 5A |
1823 |
0.31 |
chr6_52224853_52226609 | 2.01 |
Hoxa9 |
homeobox A9 |
458 |
0.51 |
chr15_102972226_102973378 | 2.01 |
Mir196a-2 |
microRNA 196a-2 |
548 |
0.53 |
chr5_66968814_66970199 | 1.97 |
Gm43282 |
predicted gene 43282 |
77 |
0.88 |
chr1_19213854_19215338 | 1.95 |
Tfap2b |
transcription factor AP-2 beta |
717 |
0.69 |
chr10_99267189_99269284 | 1.94 |
Gm48089 |
predicted gene, 48089 |
340 |
0.78 |
chr2_174283563_174287177 | 1.93 |
Gnas |
GNAS (guanine nucleotide binding protein, alpha stimulating) complex locus |
12 |
0.53 |
chr2_74725879_74728683 | 1.92 |
Hoxd4 |
homeobox D4 |
207 |
0.67 |
chr9_35424475_35426234 | 1.88 |
Cdon |
cell adhesion molecule-related/down-regulated by oncogenes |
1766 |
0.31 |
chr5_139548537_139550176 | 1.84 |
Uncx |
UNC homeobox |
5458 |
0.19 |
chr9_10903843_10905236 | 1.83 |
Cntn5 |
contactin 5 |
90 |
0.65 |
chr5_128600778_128602300 | 1.81 |
Fzd10 |
frizzled class receptor 10 |
695 |
0.45 |
chr3_30010716_30011762 | 1.77 |
Mecom |
MDS1 and EVI1 complex locus |
200 |
0.91 |
chr18_54452409_54453689 | 1.77 |
Gm50361 |
predicted gene, 50361 |
23716 |
0.19 |
chr8_26665805_26666049 | 1.69 |
Gm32098 |
predicted gene, 32098 |
2379 |
0.27 |
chr8_87860974_87861490 | 1.69 |
Zfp423 |
zinc finger protein 423 |
34503 |
0.21 |
chr14_28514085_28515337 | 1.69 |
Wnt5a |
wingless-type MMTV integration site family, member 5A |
3260 |
0.25 |
chr4_40724876_40726660 | 1.66 |
Dnaja1 |
DnaJ heat shock protein family (Hsp40) member A1 |
1719 |
0.23 |
chr3_5214556_5215764 | 1.65 |
Gm10748 |
predicted gene 10748 |
397 |
0.84 |
chr17_17404544_17405433 | 1.64 |
Lix1 |
limb and CNS expressed 1 |
2316 |
0.23 |
chr3_129201620_129202526 | 1.63 |
Pitx2 |
paired-like homeodomain transcription factor 2 |
1874 |
0.31 |
chr15_102975543_102976244 | 1.61 |
Hoxc9 |
homeobox C9 |
546 |
0.53 |
chrX_52610922_52611739 | 1.59 |
Gpc3 |
glypican 3 |
2591 |
0.28 |
chr5_37818003_37820431 | 1.56 |
Msx1 |
msh homeobox 1 |
5365 |
0.21 |
chr11_85833878_85836704 | 1.56 |
Tbx2 |
T-box 2 |
2740 |
0.17 |
chr1_14303307_14303936 | 1.56 |
Eya1 |
EYA transcriptional coactivator and phosphatase 1 |
949 |
0.67 |
chr2_74696421_74697223 | 1.55 |
Gm28793 |
predicted gene 28793 |
764 |
0.23 |
chr2_72093295_72094205 | 1.54 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
38765 |
0.15 |
chr18_54125378_54126373 | 1.52 |
Gm8594 |
predicted gene 8594 |
94567 |
0.09 |
chr11_84520959_84524590 | 1.52 |
Lhx1 |
LIM homeobox protein 1 |
63 |
0.97 |
chr8_25521556_25521707 | 1.52 |
Fgfr1 |
fibroblast growth factor receptor 1 |
1794 |
0.24 |
chr1_19215607_19218714 | 1.51 |
Tfap2b |
transcription factor AP-2 beta |
3281 |
0.25 |
chr2_74713881_74716227 | 1.51 |
Hoxd3os1 |
homeobox D3, opposite strand 1 |
942 |
0.23 |
chr2_9880695_9881908 | 1.49 |
4930412O13Rik |
RIKEN cDNA 4930412O13 gene |
49 |
0.95 |
chr2_25577192_25580600 | 1.49 |
Ajm1 |
apical junction component 1 |
1001 |
0.25 |
chr6_52199825_52201748 | 1.48 |
Hoxaas3 |
Hoxa cluster antisense RNA 3 |
338 |
0.63 |
chr6_52234512_52235190 | 1.48 |
Hoxa10 |
homeobox A10 |
88 |
0.89 |
chr5_13127003_13127271 | 1.44 |
Sema3a |
sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3A |
1544 |
0.35 |
chr2_128714218_128714960 | 1.43 |
Mertk |
MER proto-oncogene tyrosine kinase |
15633 |
0.14 |
chr13_98356794_98358725 | 1.43 |
Foxd1 |
forkhead box D1 |
3517 |
0.19 |
chr10_125967599_125967789 | 1.42 |
Lrig3 |
leucine-rich repeats and immunoglobulin-like domains 3 |
1441 |
0.55 |
chr13_31812545_31814223 | 1.42 |
Foxc1 |
forkhead box C1 |
6751 |
0.18 |
chr17_85686512_85689764 | 1.40 |
Six2 |
sine oculis-related homeobox 2 |
116 |
0.96 |
chr1_162221739_162222251 | 1.39 |
Mir214 |
microRNA 214 |
1373 |
0.34 |
chr14_21984849_21986226 | 1.38 |
Zfp503 |
zinc finger protein 503 |
4064 |
0.17 |
chr2_165596319_165596667 | 1.37 |
Eya2 |
EYA transcriptional coactivator and phosphatase 2 |
1461 |
0.39 |
chr6_52256428_52256904 | 1.37 |
9530018H14Rik |
RIKEN cDNA 9530018H14 gene |
794 |
0.32 |
chr5_37826544_37829286 | 1.36 |
Msx1 |
msh homeobox 1 |
3332 |
0.25 |
chr3_55786777_55788366 | 1.35 |
Nbea |
neurobeachin |
374 |
0.87 |
chr18_84831504_84831655 | 1.35 |
Gm17266 |
predicted gene, 17266 |
5137 |
0.17 |
chr7_137321110_137323113 | 1.35 |
Ebf3 |
early B cell factor 3 |
7666 |
0.19 |
chr1_19211603_19212440 | 1.34 |
Tfap2b |
transcription factor AP-2 beta |
33 |
0.98 |
chr3_129216664_129219042 | 1.34 |
Pitx2 |
paired-like homeodomain transcription factor 2 |
3578 |
0.2 |
chr9_69669605_69671558 | 1.34 |
Gm47203 |
predicted gene, 47203 |
70827 |
0.09 |
chr14_28797698_28798516 | 1.33 |
Gm35217 |
predicted gene, 35217 |
314 |
0.93 |
chr9_47545421_47546373 | 1.33 |
Cadm1 |
cell adhesion molecule 1 |
15524 |
0.19 |
chr16_94227570_94228141 | 1.32 |
Hlcs |
holocarboxylase synthetase (biotin- [propriony-Coenzyme A-carboxylase (ATP-hydrolysing)] ligase) |
4738 |
0.15 |
chr11_78694313_78696159 | 1.31 |
Nlk |
nemo like kinase |
1258 |
0.39 |
chr12_76071969_76072878 | 1.30 |
Syne2 |
spectrin repeat containing, nuclear envelope 2 |
407 |
0.88 |
chr19_60015391_60016209 | 1.30 |
Csf1r-ps |
colony stimulating factor 1 receptor (granulocyte), pseudogene |
63632 |
0.1 |
chr19_56422948_56423195 | 1.29 |
Casp7 |
caspase 7 |
2614 |
0.26 |
chr3_55785322_55785653 | 1.29 |
Nbea |
neurobeachin |
1415 |
0.41 |
chr8_96455054_96456367 | 1.29 |
Gm32122 |
predicted gene, 32122 |
51848 |
0.14 |
chr12_9578132_9580204 | 1.29 |
Osr1 |
odd-skipped related transcription factor 1 |
4727 |
0.2 |
chr19_45230983_45235468 | 1.28 |
Lbx1 |
ladybird homeobox 1 |
2587 |
0.27 |
chr4_117392904_117393201 | 1.28 |
Rnf220 |
ring finger protein 220 |
17595 |
0.16 |
chr10_103026340_103027824 | 1.27 |
Alx1 |
ALX homeobox 1 |
1545 |
0.39 |
chr1_6729327_6730832 | 1.27 |
St18 |
suppression of tumorigenicity 18 |
9 |
0.99 |
chr3_35332632_35333522 | 1.27 |
Gm25442 |
predicted gene, 25442 |
7463 |
0.26 |
chr14_122367253_122367650 | 1.26 |
Gm25464 |
predicted gene, 25464 |
20709 |
0.17 |
chr2_50943168_50943631 | 1.26 |
Gm13498 |
predicted gene 13498 |
33715 |
0.23 |
chr10_23449342_23450574 | 1.26 |
Eya4 |
EYA transcriptional coactivator and phosphatase 4 |
99172 |
0.07 |
chr10_24224459_24225108 | 1.26 |
Moxd1 |
monooxygenase, DBH-like 1 |
1238 |
0.48 |
chr10_50895645_50896998 | 1.26 |
Sim1 |
single-minded family bHLH transcription factor 1 |
670 |
0.79 |
chr7_137309191_137310700 | 1.25 |
Ebf3 |
early B cell factor 3 |
3971 |
0.23 |
chr5_93096288_93097671 | 1.25 |
Septin11 |
septin 11 |
3408 |
0.15 |
chr18_84831725_84831876 | 1.25 |
Gm17266 |
predicted gene, 17266 |
4916 |
0.17 |
chr13_55962186_55963636 | 1.25 |
Gm47071 |
predicted gene, 47071 |
39354 |
0.14 |
chr7_110296987_110297779 | 1.25 |
Gm9132 |
predicted gene 9132 |
4618 |
0.2 |
chr7_139581551_139582997 | 1.24 |
Nkx6-2 |
NK6 homeobox 2 |
516 |
0.79 |
chr2_74732545_74733279 | 1.24 |
Hoxd3 |
homeobox D3 |
1 |
0.92 |
chrX_61116034_61117613 | 1.24 |
Cdr1os |
cerebellar degeneration related antigen 1, opposite strand |
425 |
0.47 |
chr7_84678794_84680323 | 1.23 |
Zfand6 |
zinc finger, AN1-type domain 6 |
162 |
0.95 |
chr14_21287960_21288255 | 1.23 |
Adk |
adenosine kinase |
30018 |
0.22 |
chr5_21543417_21545108 | 1.22 |
Lrrc17 |
leucine rich repeat containing 17 |
699 |
0.68 |
chr10_103030800_103031489 | 1.21 |
Gm17028 |
predicted gene 17028 |
800 |
0.46 |
chr1_163358681_163359585 | 1.21 |
Gm24940 |
predicted gene, 24940 |
43150 |
0.12 |
chr10_86824895_86825071 | 1.20 |
Nt5dc3 |
5'-nucleotidase domain containing 3 |
120 |
0.95 |
chr7_137318563_137320070 | 1.20 |
Ebf3 |
early B cell factor 3 |
4871 |
0.21 |
chr8_109360134_109360931 | 1.20 |
Gm1943 |
predicted gene 1943 |
19668 |
0.22 |
chr17_17490908_17491345 | 1.19 |
Gm5232 |
predicted gene 5232 |
9217 |
0.19 |
chr6_52231944_52233433 | 1.19 |
Hoxa10 |
homeobox A10 |
636 |
0.35 |
chr3_154331393_154332763 | 1.19 |
AI606473 |
expressed sequence AI606473 |
81 |
0.96 |
chr3_114033658_114034247 | 1.18 |
Col11a1 |
collagen, type XI, alpha 1 |
3318 |
0.39 |
chr18_21844716_21845646 | 1.18 |
Klhl14 |
kelch-like 14 |
190463 |
0.03 |
chr6_53267728_53268574 | 1.18 |
Creb5 |
cAMP responsive element binding protein 5 |
19119 |
0.22 |
chr11_96254039_96254881 | 1.18 |
Gm53 |
predicted gene 53 |
1928 |
0.15 |
chr2_154952743_154953354 | 1.18 |
a |
nonagouti |
1829 |
0.36 |
chr12_5319737_5319888 | 1.18 |
Klhl29 |
kelch-like 29 |
28431 |
0.2 |
chr8_91948462_91949309 | 1.17 |
Gm28515 |
predicted gene 28515 |
35819 |
0.12 |
chr6_52208128_52210195 | 1.16 |
Hoxa6 |
homeobox A6 |
439 |
0.52 |
chr7_30314557_30315674 | 1.15 |
Syne4 |
spectrin repeat containing, nuclear envelope family member 4 |
35 |
0.92 |
chr5_48003784_48004411 | 1.15 |
4930518C09Rik |
RIKEN cDNA 4930518C09 gene |
1610 |
0.28 |
chr1_136628472_136629668 | 1.15 |
Zfp281 |
zinc finger protein 281 |
4169 |
0.15 |
chr3_84219870_84221146 | 1.14 |
Trim2 |
tripartite motif-containing 2 |
337 |
0.91 |
chr2_33706293_33706762 | 1.14 |
9430024E24Rik |
RIKEN cDNA 9430024E24 gene |
12372 |
0.18 |
chr4_134709774_134709925 | 1.14 |
Man1c1 |
mannosidase, alpha, class 1C, member 1 |
5559 |
0.22 |
chr2_137111260_137112311 | 1.14 |
Jag1 |
jagged 1 |
4859 |
0.31 |
chr2_159002562_159003405 | 1.14 |
Gm44319 |
predicted gene, 44319 |
66880 |
0.12 |
chr5_112001842_112002220 | 1.14 |
Gm42488 |
predicted gene 42488 |
57796 |
0.13 |
chr2_33700973_33701272 | 1.12 |
9430024E24Rik |
RIKEN cDNA 9430024E24 gene |
17777 |
0.17 |
chr4_139829905_139830959 | 1.12 |
Pax7 |
paired box 7 |
2575 |
0.32 |
chr3_5222045_5223052 | 1.12 |
Zfhx4 |
zinc finger homeodomain 4 |
1043 |
0.46 |
chr7_73556739_73558411 | 1.12 |
1810026B05Rik |
RIKEN cDNA 1810026B05 gene |
398 |
0.76 |
chr2_74707355_74707963 | 1.12 |
Hoxd8 |
homeobox D8 |
2507 |
0.08 |
chr2_126034531_126036034 | 1.11 |
Fgf7 |
fibroblast growth factor 7 |
309 |
0.93 |
chr18_64699891_64700181 | 1.11 |
Gm50353 |
predicted gene, 50353 |
18 |
0.52 |
chr7_121736743_121737581 | 1.11 |
Scnn1g |
sodium channel, nonvoltage-gated 1 gamma |
2683 |
0.26 |
chr1_19212595_19213625 | 1.11 |
Tfap2b |
transcription factor AP-2 beta |
769 |
0.67 |
chr15_35295781_35297332 | 1.11 |
Osr2 |
odd-skipped related 2 |
445 |
0.83 |
chr6_113434269_113434444 | 1.11 |
Cidec |
cell death-inducing DFFA-like effector c |
257 |
0.78 |
chr8_92359084_92360805 | 1.11 |
Irx5 |
Iroquois homeobox 5 |
2195 |
0.28 |
chr2_29844754_29844905 | 1.10 |
Mir219b |
microRNA 219b |
818 |
0.32 |
chr6_52258879_52259437 | 1.10 |
Hoxa13 |
homeobox A13 |
1644 |
0.13 |
chr8_30822988_30823739 | 1.10 |
Gm45252 |
predicted gene 45252 |
180545 |
0.03 |
chr2_116972070_116973101 | 1.10 |
Gm29340 |
predicted gene 29340 |
3843 |
0.22 |
chr3_38892303_38893788 | 1.10 |
Fat4 |
FAT atypical cadherin 4 |
2103 |
0.36 |
chr10_60592735_60593275 | 1.10 |
Cdh23 |
cadherin 23 (otocadherin) |
60028 |
0.13 |
chr4_125534548_125534748 | 1.10 |
Mir692-2 |
microRNA 692-2 |
29899 |
0.17 |
chr4_84671699_84671986 | 1.09 |
Bnc2 |
basonuclin 2 |
3154 |
0.3 |
chr18_20625506_20625801 | 1.09 |
Gm16090 |
predicted gene 16090 |
39607 |
0.12 |
chr3_55532329_55532695 | 1.08 |
Dclk1 |
doublecortin-like kinase 1 |
4633 |
0.16 |
chr4_91380440_91381612 | 1.08 |
Elavl2 |
ELAV like RNA binding protein 1 |
4530 |
0.22 |
chr14_122479539_122479995 | 1.08 |
Zic2 |
zinc finger protein of the cerebellum 2 |
1667 |
0.23 |
chr3_55779960_55781204 | 1.08 |
Mab21l1 |
mab-21-like 1 |
1928 |
0.32 |
chr18_76336335_76337000 | 1.08 |
Gm50360 |
predicted gene, 50360 |
14843 |
0.24 |
chr2_154933274_154933673 | 1.07 |
a |
nonagouti |
17707 |
0.18 |
chr2_18042311_18043883 | 1.07 |
Skida1 |
SKI/DACH domain containing 1 |
1475 |
0.25 |
chr10_18470218_18471289 | 1.07 |
Nhsl1 |
NHS-like 1 |
772 |
0.72 |
chr13_73270819_73272466 | 1.07 |
Gm48000 |
predicted gene, 48000 |
1588 |
0.33 |
chr1_54906181_54907571 | 1.07 |
A130048G24Rik |
RIKEN cDNA A130048G24 gene |
9718 |
0.19 |
chr10_97566192_97567945 | 1.07 |
Lum |
lumican |
1940 |
0.32 |
chr2_168831451_168831913 | 1.06 |
Gm25214 |
predicted gene, 25214 |
50486 |
0.11 |
chr6_49210050_49211632 | 1.06 |
Igf2bp3 |
insulin-like growth factor 2 mRNA binding protein 3 |
3320 |
0.2 |
chr3_129223881_129225649 | 1.06 |
Gm43697 |
predicted gene 43697 |
763 |
0.61 |
chr2_74669806_74670194 | 1.06 |
Hoxd13 |
homeobox D13 |
1690 |
0.13 |
chr4_107436534_107437723 | 1.06 |
Glis1 |
GLIS family zinc finger 1 |
1870 |
0.28 |
chr11_96281341_96281893 | 1.06 |
Hoxb8 |
homeobox B8 |
288 |
0.75 |
chr5_67097111_67099075 | 1.06 |
Phox2b |
paired-like homeobox 2b |
964 |
0.51 |
chr6_140856475_140857747 | 1.05 |
Gm43925 |
predicted gene, 43925 |
72407 |
0.1 |
chr3_95498942_95500401 | 1.05 |
Ctsk |
cathepsin K |
415 |
0.72 |
chr8_92361507_92362918 | 1.05 |
Irx5 |
Iroquois homeobox 5 |
4463 |
0.2 |
chr5_136860922_136861924 | 1.05 |
Gm20485 |
predicted gene 20485 |
8299 |
0.14 |
chr5_102551021_102551598 | 1.05 |
1700013M08Rik |
RIKEN cDNA 1700013M08 gene |
68020 |
0.12 |
chr19_15339963_15340957 | 1.05 |
Gm24319 |
predicted gene, 24319 |
339544 |
0.01 |
chr5_124240985_124241805 | 1.04 |
Gm42425 |
predicted gene 42425 |
3671 |
0.13 |
chr8_88523833_88524755 | 1.03 |
Nkd1 |
naked cuticle 1 |
2940 |
0.29 |
chr17_52062168_52062642 | 1.03 |
Gm19585 |
predicted gene, 19585 |
34214 |
0.18 |
chr3_100711484_100711635 | 1.03 |
Gm43464 |
predicted gene 43464 |
18853 |
0.14 |
chr17_31000768_31000919 | 1.03 |
Umodl1 |
uromodulin-like 1 |
1102 |
0.38 |
chr9_106458457_106458919 | 1.03 |
Pcbp4 |
poly(rC) binding protein 4 |
1707 |
0.17 |
chr9_48538076_48539222 | 1.03 |
Gm23653 |
predicted gene, 23653 |
31589 |
0.13 |
chr10_99298673_99299618 | 1.02 |
B530045E10Rik |
RIKEN cDNA B530045E10 gene |
21 |
0.97 |
chr1_172024290_172024847 | 1.02 |
Vangl2 |
VANGL planar cell polarity 2 |
2143 |
0.23 |
chr1_69591491_69592135 | 1.02 |
Gm29112 |
predicted gene 29112 |
6709 |
0.24 |
chr8_89040887_89041038 | 1.01 |
Sall1 |
spalt like transcription factor 1 |
3200 |
0.29 |
chrX_133684830_133685971 | 1.00 |
Pcdh19 |
protocadherin 19 |
409 |
0.91 |
chr11_106266626_106268212 | 1.00 |
Smarcd2 |
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily d, member 2 |
64 |
0.94 |
chr15_76459776_76460415 | 1.00 |
Scx |
scleraxis |
2575 |
0.12 |
chr2_147451024_147451175 | 0.99 |
Gm14109 |
predicted gene 14109 |
47837 |
0.14 |
chr3_134629552_134630294 | 0.99 |
Gm26820 |
predicted gene, 26820 |
842 |
0.74 |
chr15_103021044_103022176 | 0.99 |
Hoxc4 |
homeobox C4 |
2676 |
0.13 |
chr12_72944998_72946304 | 0.99 |
Gm26709 |
predicted gene, 26709 |
156 |
0.94 |
chr11_80622213_80623518 | 0.99 |
C030013C21Rik |
RIKEN cDNA C030013C21 gene |
113759 |
0.05 |
chr11_117865993_117866234 | 0.98 |
Gm11725 |
predicted gene 11725 |
5137 |
0.1 |
chr16_88561792_88563295 | 0.98 |
Cldn8 |
claudin 8 |
640 |
0.64 |
chr6_119001063_119001214 | 0.98 |
Cacna1c |
calcium channel, voltage-dependent, L type, alpha 1C subunit |
78869 |
0.11 |
chr2_34106244_34107242 | 0.98 |
C230014O12Rik |
RIKEN cDNA C230014O12 gene |
986 |
0.58 |
chr14_121038667_121039148 | 0.98 |
Farp1 |
FERM, RhoGEF (Arhgef) and pleckstrin domain protein 1 (chondrocyte-derived) |
3343 |
0.35 |
chr5_128536639_128537375 | 0.98 |
Gm42499 |
predicted gene 42499 |
16786 |
0.15 |
chr2_18039562_18041859 | 0.98 |
A930004D18Rik |
RIKEN cDNA A930004D18 gene |
2973 |
0.14 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 7.4 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
1.4 | 4.1 | GO:0010159 | specification of organ position(GO:0010159) |
1.3 | 5.4 | GO:0061205 | paramesonephric duct development(GO:0061205) |
1.1 | 3.2 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
1.0 | 3.1 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
1.0 | 3.1 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
1.0 | 2.0 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
1.0 | 2.9 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.9 | 4.4 | GO:0072017 | distal tubule development(GO:0072017) |
0.8 | 8.9 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.8 | 0.8 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
0.8 | 2.4 | GO:0060594 | mammary gland specification(GO:0060594) |
0.8 | 2.3 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.7 | 2.2 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.7 | 5.1 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.7 | 1.4 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.7 | 2.1 | GO:0048880 | sensory system development(GO:0048880) |
0.6 | 1.9 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.6 | 1.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.6 | 2.3 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
0.6 | 1.7 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.6 | 1.7 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.6 | 1.7 | GO:0003253 | cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
0.5 | 2.2 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.5 | 3.2 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.5 | 1.1 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) |
0.5 | 1.5 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.5 | 1.0 | GO:0070384 | Harderian gland development(GO:0070384) |
0.5 | 1.0 | GO:0021855 | hypothalamus cell migration(GO:0021855) |
0.5 | 2.0 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.5 | 11.4 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
0.5 | 1.0 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.5 | 1.0 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.5 | 1.9 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.5 | 0.5 | GO:0065001 | specification of axis polarity(GO:0065001) |
0.5 | 1.4 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.5 | 2.3 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.4 | 2.2 | GO:0038031 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.4 | 0.4 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.4 | 0.8 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.4 | 2.5 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.4 | 0.8 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.4 | 0.8 | GO:0021593 | rhombomere morphogenesis(GO:0021593) |
0.4 | 0.8 | GO:0021569 | rhombomere 3 development(GO:0021569) |
0.4 | 1.2 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.4 | 1.2 | GO:0021546 | rhombomere development(GO:0021546) |
0.4 | 1.2 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.4 | 1.6 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.4 | 1.9 | GO:0035989 | tendon development(GO:0035989) |
0.4 | 1.5 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.4 | 0.8 | GO:0035564 | regulation of kidney size(GO:0035564) |
0.4 | 0.7 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.4 | 1.1 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.4 | 0.4 | GO:0072193 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
0.4 | 1.8 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.4 | 1.1 | GO:0038091 | VEGF-activated platelet-derived growth factor receptor signaling pathway(GO:0038086) positive regulation of cell proliferation by VEGF-activated platelet derived growth factor receptor signaling pathway(GO:0038091) |
0.3 | 0.7 | GO:0071314 | cellular response to cocaine(GO:0071314) |
0.3 | 1.0 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.3 | 20.9 | GO:0048704 | embryonic skeletal system morphogenesis(GO:0048704) |
0.3 | 1.0 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
0.3 | 0.3 | GO:0015744 | succinate transport(GO:0015744) |
0.3 | 1.3 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
0.3 | 0.7 | GO:0071698 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.3 | 1.0 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.3 | 0.3 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.3 | 1.3 | GO:0061309 | cardiac neural crest cell development involved in outflow tract morphogenesis(GO:0061309) |
0.3 | 0.9 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.3 | 0.3 | GO:0072106 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
0.3 | 0.6 | GO:0021827 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.3 | 0.6 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.3 | 0.3 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.3 | 0.9 | GO:0043587 | tongue morphogenesis(GO:0043587) |
0.3 | 0.6 | GO:0021978 | telencephalon regionalization(GO:0021978) |
0.3 | 0.9 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.3 | 3.9 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.3 | 2.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.3 | 1.4 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.3 | 0.8 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.3 | 1.4 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.3 | 1.6 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.3 | 1.1 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.3 | 0.5 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.3 | 0.5 | GO:0060601 | lateral sprouting from an epithelium(GO:0060601) |
0.3 | 1.8 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.3 | 0.8 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
0.3 | 0.8 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.3 | 0.5 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.3 | 1.0 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.3 | 0.3 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.3 | 5.8 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
0.2 | 0.2 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.2 | 0.5 | GO:0090427 | activation of meiosis(GO:0090427) |
0.2 | 0.7 | GO:0060023 | soft palate development(GO:0060023) |
0.2 | 1.2 | GO:0006477 | protein sulfation(GO:0006477) |
0.2 | 0.7 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.2 | 0.7 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.2 | 0.7 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.2 | 0.7 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.2 | 0.2 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.2 | 1.0 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.2 | 0.7 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.2 | 0.7 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.2 | 0.5 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.2 | 0.7 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
0.2 | 1.8 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
0.2 | 0.4 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.2 | 0.7 | GO:0006562 | proline catabolic process(GO:0006562) |
0.2 | 0.7 | GO:0007412 | axon target recognition(GO:0007412) |
0.2 | 0.2 | GO:0021564 | vagus nerve development(GO:0021564) |
0.2 | 0.6 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.2 | 0.4 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.2 | 0.9 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.2 | 0.6 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.2 | 0.4 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
0.2 | 0.4 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.2 | 0.6 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.2 | 0.6 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.2 | 2.6 | GO:0048665 | neuron fate specification(GO:0048665) |
0.2 | 1.4 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.2 | 0.6 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.2 | 0.4 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.2 | 1.0 | GO:0003198 | epithelial to mesenchymal transition involved in endocardial cushion formation(GO:0003198) |
0.2 | 0.2 | GO:1903897 | regulation of PERK-mediated unfolded protein response(GO:1903897) |
0.2 | 0.4 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.2 | 0.2 | GO:0060437 | lung growth(GO:0060437) |
0.2 | 0.7 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.2 | 0.4 | GO:0072176 | nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
0.2 | 0.9 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.2 | 0.6 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.2 | 1.3 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.2 | 0.4 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.2 | 0.4 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.2 | 0.2 | GO:0061525 | hindgut development(GO:0061525) |
0.2 | 0.5 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.2 | 0.5 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.2 | 0.4 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.2 | 0.7 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.2 | 0.5 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
0.2 | 0.5 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.2 | 0.3 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.2 | 0.5 | GO:0060592 | mammary gland formation(GO:0060592) |
0.2 | 0.5 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.2 | 0.7 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.2 | 0.7 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.2 | 1.0 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.2 | 1.0 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.2 | 0.2 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.2 | 0.5 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.2 | 0.5 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.2 | 0.7 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.2 | 0.5 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.2 | 0.8 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.2 | 1.1 | GO:0060179 | male mating behavior(GO:0060179) |
0.2 | 0.5 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
0.2 | 0.5 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.2 | 1.3 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.2 | 1.0 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.2 | 0.3 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.2 | 0.5 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.2 | 0.5 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.2 | 0.5 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.2 | 0.6 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.2 | 0.2 | GO:0021984 | adenohypophysis development(GO:0021984) |
0.2 | 0.5 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.2 | 0.2 | GO:0060423 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
0.2 | 0.9 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.2 | 0.5 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.2 | 0.2 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.2 | 0.6 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.2 | 0.3 | GO:0009730 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.2 | 0.3 | GO:0007525 | somatic muscle development(GO:0007525) |
0.2 | 0.9 | GO:1904888 | cranial skeletal system development(GO:1904888) |
0.1 | 0.4 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.1 | 0.6 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.1 | 0.4 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.1 | 0.7 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.3 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.1 | 1.3 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.1 | 1.9 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.1 | 2.2 | GO:0003416 | endochondral bone growth(GO:0003416) |
0.1 | 0.4 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.4 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.1 | 1.3 | GO:0035136 | forelimb morphogenesis(GO:0035136) |
0.1 | 0.1 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.1 | 0.4 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.1 | 0.4 | GO:0015817 | histidine transport(GO:0015817) |
0.1 | 0.1 | GO:0060534 | trachea cartilage development(GO:0060534) |
0.1 | 0.1 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.1 | 0.4 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.1 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.1 | 0.1 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
0.1 | 0.1 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.1 | 0.3 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.1 | 1.3 | GO:0021854 | hypothalamus development(GO:0021854) |
0.1 | 0.3 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.1 | 0.7 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.1 | 1.0 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.1 | 0.1 | GO:0043309 | regulation of eosinophil degranulation(GO:0043309) |
0.1 | 0.6 | GO:0030035 | microspike assembly(GO:0030035) |
0.1 | 0.3 | GO:2000591 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.1 | 1.1 | GO:0048339 | paraxial mesoderm development(GO:0048339) |
0.1 | 0.7 | GO:0031223 | auditory behavior(GO:0031223) |
0.1 | 1.0 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.1 | 0.4 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.1 | 1.1 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.1 | 1.4 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 0.4 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.1 | 0.3 | GO:0060536 | cartilage morphogenesis(GO:0060536) |
0.1 | 0.1 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.1 | 1.1 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.1 | 0.3 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.1 | 0.3 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.3 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.1 | 0.1 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
0.1 | 0.5 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.1 | 0.4 | GO:0003164 | His-Purkinje system development(GO:0003164) |
0.1 | 0.7 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
0.1 | 1.0 | GO:0021936 | regulation of cerebellar granule cell precursor proliferation(GO:0021936) |
0.1 | 0.5 | GO:2000553 | positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
0.1 | 0.4 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.1 | 0.1 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 0.4 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.5 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.1 | 0.4 | GO:0021794 | thalamus development(GO:0021794) |
0.1 | 0.5 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.1 | GO:0051795 | positive regulation of catagen(GO:0051795) |
0.1 | 0.1 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.1 | 0.4 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.1 | 0.2 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
0.1 | 0.4 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.1 | 0.6 | GO:0048539 | bone marrow development(GO:0048539) |
0.1 | 0.6 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.1 | 0.4 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.1 | 0.1 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
0.1 | 0.4 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.8 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.1 | 0.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.1 | 0.4 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.1 | 0.5 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.1 | 0.2 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.1 | 0.6 | GO:0061162 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
0.1 | 0.2 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.1 | 1.3 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.1 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 0.7 | GO:0060325 | face morphogenesis(GO:0060325) |
0.1 | 0.3 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.1 | 0.3 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.1 | 0.3 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.1 | 0.2 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.1 | 0.5 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.1 | 0.2 | GO:0048820 | anagen(GO:0042640) hair follicle maturation(GO:0048820) |
0.1 | 0.4 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.1 | 0.4 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.1 | 0.2 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.3 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.1 | 0.7 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.1 | 0.2 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.1 | 0.1 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
0.1 | 0.8 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.1 | 0.3 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.1 | 0.1 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.1 | 0.3 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.1 | 0.1 | GO:0060066 | oviduct development(GO:0060066) |
0.1 | 0.1 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.1 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.1 | 0.5 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.1 | 1.7 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.1 | 0.1 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) |
0.1 | 0.3 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.1 | 0.1 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
0.1 | 0.7 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.1 | 0.9 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
0.1 | 0.4 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.1 | 0.3 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.1 | 0.3 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.1 | 0.2 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.1 | 0.2 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.1 | 0.4 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.1 | 0.3 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.1 | 0.6 | GO:0060013 | righting reflex(GO:0060013) |
0.1 | 0.3 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.1 | 0.3 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.1 | 0.3 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.1 | 0.5 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.2 | GO:0001757 | somite specification(GO:0001757) |
0.1 | 0.3 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.1 | 0.1 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.1 | 0.2 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.1 | 0.4 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.1 | 0.4 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.1 | 0.2 | GO:0097195 | pilomotor reflex(GO:0097195) |
0.1 | 0.5 | GO:0097264 | self proteolysis(GO:0097264) |
0.1 | 1.6 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.3 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.1 | 0.3 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.1 | 0.2 | GO:1903899 | positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
0.1 | 2.2 | GO:0007616 | long-term memory(GO:0007616) |
0.1 | 0.4 | GO:0060068 | vagina development(GO:0060068) |
0.1 | 0.4 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.1 | 0.4 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.1 | 0.2 | GO:2001028 | positive regulation of endothelial cell chemotaxis(GO:2001028) |
0.1 | 0.3 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.1 | 0.2 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.3 | GO:0035747 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.1 | 0.7 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.1 | 0.3 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.1 | 0.3 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.1 | 0.3 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.1 | 0.3 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.1 | 0.1 | GO:0031446 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
0.1 | 0.4 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.1 | 0.6 | GO:0048484 | enteric nervous system development(GO:0048484) |
0.1 | 0.4 | GO:0042637 | catagen(GO:0042637) |
0.1 | 0.1 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
0.1 | 0.3 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.1 | 0.5 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.1 | 0.3 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
0.1 | 0.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.1 | 0.8 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.1 | 0.4 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) Schwann cell proliferation(GO:0014010) |
0.1 | 0.6 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.1 | 0.2 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.1 | 0.4 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.1 | 0.1 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.1 | 0.3 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.1 | 0.1 | GO:0043584 | nose development(GO:0043584) |
0.1 | 0.1 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.3 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.1 | 0.2 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.1 | 0.3 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.1 | 0.4 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.1 | 0.5 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.1 | 0.1 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.1 | 0.1 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.1 | 0.1 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.1 | 0.2 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.1 | 0.5 | GO:0070163 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) |
0.1 | 0.2 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.1 | 0.2 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.2 | GO:0048368 | lateral mesoderm development(GO:0048368) |
0.1 | 0.2 | GO:1900086 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.1 | 0.2 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.1 | 0.2 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.1 | 0.5 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.1 | 0.1 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.1 | 0.1 | GO:0033084 | regulation of immature T cell proliferation in thymus(GO:0033084) |
0.1 | 0.5 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
0.1 | 0.2 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.1 | 0.2 | GO:0002159 | desmosome assembly(GO:0002159) |
0.1 | 0.1 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.1 | 0.7 | GO:0001975 | response to amphetamine(GO:0001975) |
0.1 | 1.2 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
0.1 | 0.2 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.1 | 0.5 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.1 | 0.3 | GO:0010042 | response to manganese ion(GO:0010042) |
0.1 | 0.5 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.4 | GO:0051256 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.1 | 0.2 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.1 | 0.5 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.1 | 0.1 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.1 | 0.2 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.1 | 0.4 | GO:0035878 | nail development(GO:0035878) |
0.1 | 0.4 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
0.1 | 0.1 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.1 | 0.4 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.1 | 0.8 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
0.1 | 0.1 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
0.1 | 0.9 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) |
0.1 | 0.6 | GO:0051546 | keratinocyte migration(GO:0051546) |
0.1 | 0.1 | GO:0097090 | presynaptic membrane organization(GO:0097090) |
0.1 | 0.3 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.2 | GO:0046958 | nonassociative learning(GO:0046958) |
0.1 | 0.1 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.1 | 0.4 | GO:0048485 | sympathetic nervous system development(GO:0048485) |
0.1 | 0.2 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 0.1 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.1 | 0.2 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.1 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.1 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.1 | 0.3 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.1 | 0.1 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
0.1 | 0.2 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.1 | 0.2 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.1 | 0.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.1 | 0.2 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.1 | 0.3 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.1 | 0.2 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.1 | 0.4 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
0.1 | 0.3 | GO:0007296 | vitellogenesis(GO:0007296) |
0.1 | 0.1 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.1 | 0.1 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.1 | 0.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.1 | 0.2 | GO:0099612 | protein localization to axon(GO:0099612) |
0.1 | 0.1 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.1 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
0.1 | 0.2 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.1 | 0.2 | GO:0071321 | cellular response to cGMP(GO:0071321) |
0.1 | 0.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.1 | 0.3 | GO:0016264 | gap junction assembly(GO:0016264) |
0.1 | 0.1 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
0.1 | 0.1 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.1 | 0.6 | GO:0061157 | mRNA destabilization(GO:0061157) |
0.1 | 0.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.1 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.1 | 0.5 | GO:0001946 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
0.1 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.1 | 0.3 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.1 | 0.1 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.1 | 0.3 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.1 | 0.2 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.4 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.1 | 0.3 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.1 | 0.5 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.1 | 0.3 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.1 | 0.1 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.1 | 0.2 | GO:0030432 | peristalsis(GO:0030432) |
0.1 | 0.1 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
0.1 | 0.1 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
0.1 | 0.1 | GO:0014901 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
0.1 | 0.4 | GO:0048799 | organ maturation(GO:0048799) |
0.1 | 0.1 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.1 | 0.9 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.1 | 0.5 | GO:0046541 | saliva secretion(GO:0046541) |
0.1 | 0.5 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.1 | 0.2 | GO:0010288 | response to lead ion(GO:0010288) |
0.1 | 0.1 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.1 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.1 | 0.1 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.1 | 0.2 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.9 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.1 | 0.2 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
0.1 | 0.1 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.1 | 0.2 | GO:1904970 | brush border assembly(GO:1904970) |
0.1 | 0.5 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.1 | 0.1 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.1 | 0.2 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.1 | 0.1 | GO:0034104 | negative regulation of tissue remodeling(GO:0034104) |
0.1 | 3.4 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.1 | 0.3 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.1 | 0.8 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.1 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.1 | 0.1 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.1 | 0.1 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.1 | 0.1 | GO:0072553 | terminal button organization(GO:0072553) |
0.1 | 0.6 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.1 | 0.1 | GO:0060914 | heart formation(GO:0060914) |
0.1 | 0.2 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.1 | 0.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 0.4 | GO:0009886 | post-embryonic morphogenesis(GO:0009886) |
0.1 | 1.4 | GO:0030326 | embryonic limb morphogenesis(GO:0030326) embryonic appendage morphogenesis(GO:0035113) |
0.1 | 0.5 | GO:0032096 | negative regulation of response to food(GO:0032096) |
0.1 | 0.1 | GO:0052200 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.1 | 0.1 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.1 | 0.1 | GO:0072015 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
0.1 | 0.2 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.1 | 0.1 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.1 | 0.1 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
0.1 | 0.1 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
0.1 | 0.5 | GO:0002093 | auditory receptor cell morphogenesis(GO:0002093) |
0.1 | 0.1 | GO:2000822 | regulation of fear response(GO:1903365) regulation of behavioral fear response(GO:2000822) |
0.1 | 0.2 | GO:0051182 | coenzyme transport(GO:0051182) |
0.1 | 0.1 | GO:0014900 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.1 | 0.2 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.1 | 0.1 | GO:0002877 | regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
0.1 | 0.3 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.2 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.0 | 0.0 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.0 | 0.0 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.0 | 0.7 | GO:0006625 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
0.0 | 0.1 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.0 | 0.1 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.0 | 0.3 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.0 | 0.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.1 | GO:0090179 | planar cell polarity pathway involved in neural tube closure(GO:0090179) |
0.0 | 0.2 | GO:0035108 | appendage morphogenesis(GO:0035107) limb morphogenesis(GO:0035108) |
0.0 | 0.1 | GO:0002158 | osteoclast proliferation(GO:0002158) |
0.0 | 0.4 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.1 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.0 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.0 | 0.8 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
0.0 | 0.1 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.0 | 0.0 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.0 | 0.3 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.0 | 0.1 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.0 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.0 | 0.0 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 1.1 | GO:0042472 | inner ear morphogenesis(GO:0042472) |
0.0 | 0.5 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.1 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
0.0 | 0.1 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
0.0 | 0.1 | GO:1903358 | regulation of Golgi organization(GO:1903358) |
0.0 | 0.0 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.0 | 0.1 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
0.0 | 0.2 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.0 | 0.1 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
0.0 | 0.1 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.0 | 0.1 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.0 | 0.4 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.0 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.0 | 0.0 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.0 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.0 | 0.1 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.0 | 0.0 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.1 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.0 | 0.0 | GO:0060426 | lung vasculature development(GO:0060426) |
0.0 | 0.3 | GO:0090043 | tubulin deacetylation(GO:0090042) regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.1 | GO:0086016 | AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) AV node cell to bundle of His cell communication(GO:0086067) |
0.0 | 0.2 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
0.0 | 0.0 | GO:0072234 | metanephric nephron tubule development(GO:0072234) |
0.0 | 0.3 | GO:0030901 | midbrain development(GO:0030901) |
0.0 | 0.2 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.0 | 0.3 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.0 | GO:0034633 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.0 | 0.2 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.8 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
0.0 | 0.0 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.0 | 0.0 | GO:0002339 | B cell selection(GO:0002339) |
0.0 | 0.1 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.0 | 0.0 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.1 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.0 | 0.2 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.2 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.0 | 1.3 | GO:0090263 | positive regulation of canonical Wnt signaling pathway(GO:0090263) |
0.0 | 0.1 | GO:0032277 | negative regulation of gonadotropin secretion(GO:0032277) negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
0.0 | 0.2 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.0 | 0.2 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.0 | 0.4 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.0 | 0.2 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.0 | 0.3 | GO:0042471 | ear morphogenesis(GO:0042471) |
0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.3 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.0 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
0.0 | 2.0 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.2 | GO:0046498 | S-adenosylhomocysteine metabolic process(GO:0046498) |
0.0 | 0.2 | GO:0015884 | folic acid transport(GO:0015884) |
0.0 | 0.3 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.0 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.0 | 0.2 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 1.5 | GO:0048705 | skeletal system morphogenesis(GO:0048705) |
0.0 | 0.1 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
0.0 | 0.3 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.1 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.0 | 0.1 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.0 | 0.2 | GO:0046851 | negative regulation of bone remodeling(GO:0046851) |
0.0 | 0.1 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.1 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.0 | 0.0 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.0 | 0.0 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.0 | 0.0 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.0 | 0.6 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.0 | 0.1 | GO:0045991 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) carbon catabolite activation of transcription(GO:0045991) |
0.0 | 0.1 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.0 | 0.1 | GO:0002076 | osteoblast development(GO:0002076) |
0.0 | 0.1 | GO:0033504 | floor plate development(GO:0033504) |
0.0 | 0.1 | GO:0060037 | pharyngeal system development(GO:0060037) |
0.0 | 0.2 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.0 | 0.3 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.0 | 0.2 | GO:0048291 | isotype switching to IgG isotypes(GO:0048291) |
0.0 | 0.2 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.0 | 0.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.0 | 0.3 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.0 | 0.1 | GO:0060317 | cardiac epithelial to mesenchymal transition(GO:0060317) |
0.0 | 0.0 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
0.0 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.0 | 0.0 | GO:0086029 | Purkinje myocyte action potential(GO:0086017) Purkinje myocyte to ventricular cardiac muscle cell signaling(GO:0086029) Purkinje myocyte to ventricular cardiac muscle cell communication(GO:0086068) |
0.0 | 0.0 | GO:0021586 | pons maturation(GO:0021586) |
0.0 | 0.2 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.0 | 0.0 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
0.0 | 0.2 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
0.0 | 0.2 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.0 | 0.1 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.0 | 0.1 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.1 | GO:0015819 | lysine transport(GO:0015819) |
0.0 | 0.1 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.0 | 0.1 | GO:0060440 | trachea formation(GO:0060440) |
0.0 | 0.3 | GO:0035082 | axoneme assembly(GO:0035082) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.1 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.0 | 0.1 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.1 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.0 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.0 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.0 | 0.4 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.0 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.0 | 0.0 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.2 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.0 | 0.0 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.0 | 0.1 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.0 | 0.0 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
0.0 | 0.1 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
0.0 | 0.1 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.0 | 0.0 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.2 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.2 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 0.0 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.0 | 0.1 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.0 | 0.1 | GO:0060850 | regulation of transcription involved in cell fate commitment(GO:0060850) |
0.0 | 0.0 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.1 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.0 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
0.0 | 0.1 | GO:0052330 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
0.0 | 0.3 | GO:0048011 | neurotrophin TRK receptor signaling pathway(GO:0048011) |
0.0 | 0.0 | GO:0031498 | chromatin disassembly(GO:0031498) |
0.0 | 0.0 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.0 | 0.1 | GO:0070197 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.1 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.0 | 0.3 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.2 | GO:0051451 | myoblast migration(GO:0051451) |
0.0 | 0.2 | GO:0006145 | purine nucleobase catabolic process(GO:0006145) |
0.0 | 0.2 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.0 | 0.0 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.0 | 0.5 | GO:0030520 | intracellular estrogen receptor signaling pathway(GO:0030520) |
0.0 | 0.1 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) |
0.0 | 0.0 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.0 | 0.6 | GO:0003382 | epithelial cell morphogenesis(GO:0003382) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.0 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.0 | 0.0 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.0 | 0.1 | GO:2000252 | negative regulation of feeding behavior(GO:2000252) |
0.0 | 0.1 | GO:0021884 | forebrain neuron development(GO:0021884) |
0.0 | 0.1 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.0 | 0.1 | GO:0097421 | liver regeneration(GO:0097421) |
0.0 | 0.1 | GO:0035329 | hippo signaling(GO:0035329) |
0.0 | 0.1 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.0 | 0.0 | GO:0042505 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.0 | 0.0 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.0 | 0.0 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.0 | 0.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.0 | 0.3 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.2 | GO:0046549 | retinal cone cell development(GO:0046549) |
0.0 | 0.0 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.1 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.0 | 0.4 | GO:0060612 | adipose tissue development(GO:0060612) |
0.0 | 0.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.0 | 0.0 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.0 | 0.0 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
0.0 | 0.0 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
0.0 | 0.0 | GO:0060022 | hard palate development(GO:0060022) |
0.0 | 0.2 | GO:0044091 | membrane biogenesis(GO:0044091) |
0.0 | 0.0 | GO:0035106 | operant conditioning(GO:0035106) |
0.0 | 0.1 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.0 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.0 | 0.1 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.0 | 0.1 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.0 | 0.2 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
0.0 | 0.2 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
0.0 | 0.1 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.0 | 0.0 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.0 | 0.1 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.0 | 0.2 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
0.0 | 1.2 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.0 | 0.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.0 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
0.0 | 0.0 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) |
0.0 | 0.2 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.0 | 0.0 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.0 | 0.2 | GO:0002385 | mucosal immune response(GO:0002385) |
0.0 | 0.0 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.0 | GO:0090399 | replicative senescence(GO:0090399) |
0.0 | 0.1 | GO:0003214 | cardiac left ventricle morphogenesis(GO:0003214) |
0.0 | 0.1 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
0.0 | 0.1 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
0.0 | 0.1 | GO:0017014 | protein nitrosylation(GO:0017014) |
0.0 | 0.2 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.1 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
0.0 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.1 | GO:0097320 | membrane tubulation(GO:0097320) |
0.0 | 0.0 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.0 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
0.0 | 0.0 | GO:0032621 | interleukin-18 production(GO:0032621) regulation of interleukin-18 production(GO:0032661) |
0.0 | 0.1 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.0 | 0.1 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.1 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.0 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.0 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.0 | 0.3 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.1 | GO:0030823 | regulation of cGMP metabolic process(GO:0030823) |
0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.1 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.0 | 0.2 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.0 | 0.0 | GO:0009750 | response to fructose(GO:0009750) |
0.0 | 0.0 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.0 | 0.1 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.0 | 0.0 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.0 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.0 | 0.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.0 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.0 | 0.6 | GO:0016079 | synaptic vesicle exocytosis(GO:0016079) |
0.0 | 0.0 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.4 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.0 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.0 | 0.0 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.0 | 0.1 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
0.0 | 0.0 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.0 | 0.0 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
0.0 | 0.0 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.0 | 0.2 | GO:0007520 | myoblast fusion(GO:0007520) |
0.0 | 0.0 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 0.0 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
0.0 | 0.0 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.0 | 0.1 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.0 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.0 | 0.0 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.0 | 0.0 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.0 | 0.0 | GO:0072170 | metanephric tubule development(GO:0072170) |
0.0 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.0 | 0.0 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.0 | 0.1 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.1 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
0.0 | 0.1 | GO:0032824 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.0 | 0.1 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.0 | 0.0 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.0 | GO:0021626 | hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
0.0 | 0.2 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.0 | 0.0 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.0 | 0.0 | GO:0035697 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) |
0.0 | 0.0 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.0 | 0.0 | GO:0090467 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.0 | 0.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.0 | 0.0 | GO:0071865 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
0.0 | 0.0 | GO:1901628 | positive regulation of postsynaptic membrane organization(GO:1901628) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
0.0 | 0.0 | GO:0048840 | otolith development(GO:0048840) |
0.0 | 0.0 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.0 | 0.0 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.0 | 0.0 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
0.0 | 0.0 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.0 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.3 | 2.6 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.3 | 1.2 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.3 | 3.6 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.3 | 1.1 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.3 | 0.5 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.3 | 1.3 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.2 | 0.9 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.2 | 1.2 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.2 | 0.7 | GO:0005914 | spot adherens junction(GO:0005914) |
0.2 | 0.6 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.2 | 1.3 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.2 | 0.6 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.2 | 0.6 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.2 | 5.5 | GO:0016235 | aggresome(GO:0016235) |
0.2 | 2.1 | GO:0043194 | axon initial segment(GO:0043194) |
0.2 | 1.1 | GO:0032584 | growth cone membrane(GO:0032584) |
0.2 | 0.2 | GO:0031523 | Myb complex(GO:0031523) |
0.1 | 0.4 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.6 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 0.9 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 0.4 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 1.1 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 0.5 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.3 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.1 | 0.5 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.1 | 0.4 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 1.4 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.1 | 0.5 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 0.8 | GO:0071437 | invadopodium(GO:0071437) |
0.1 | 0.4 | GO:0008091 | spectrin(GO:0008091) |
0.1 | 34.5 | GO:0005667 | transcription factor complex(GO:0005667) |
0.1 | 0.4 | GO:0071953 | elastic fiber(GO:0071953) |
0.1 | 0.3 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.1 | GO:0032437 | cuticular plate(GO:0032437) |
0.1 | 0.9 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 0.3 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.1 | 1.5 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.2 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 0.9 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 0.6 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.1 | 0.3 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.2 | GO:0043256 | laminin complex(GO:0043256) |
0.1 | 0.7 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.1 | 0.6 | GO:0036157 | outer dynein arm(GO:0036157) |
0.1 | 0.3 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.2 | GO:0072534 | perineuronal net(GO:0072534) |
0.1 | 0.4 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 1.2 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.1 | 0.4 | GO:0033268 | node of Ranvier(GO:0033268) |
0.1 | 7.9 | GO:0043204 | perikaryon(GO:0043204) |
0.1 | 0.2 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.1 | 1.4 | GO:0005922 | connexon complex(GO:0005922) |
0.1 | 2.4 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.1 | 0.5 | GO:0033270 | paranode region of axon(GO:0033270) |
0.1 | 0.2 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 0.5 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.4 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.1 | 0.3 | GO:0035339 | SPOTS complex(GO:0035339) |
0.1 | 0.5 | GO:0097542 | ciliary tip(GO:0097542) |
0.1 | 0.2 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 0.1 | GO:0035838 | growing cell tip(GO:0035838) |
0.1 | 0.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.1 | 0.5 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.6 | GO:0005921 | gap junction(GO:0005921) |
0.1 | 0.5 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.5 | GO:0005858 | axonemal dynein complex(GO:0005858) inner dynein arm(GO:0036156) |
0.1 | 0.2 | GO:0042827 | platelet dense granule(GO:0042827) |
0.1 | 0.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.1 | 0.3 | GO:0030056 | hemidesmosome(GO:0030056) |
0.1 | 0.3 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 0.9 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.1 | 0.3 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.1 | 0.2 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.1 | 0.2 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.1 | 0.2 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.1 | 0.2 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 0.6 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 2.1 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.1 | 0.3 | GO:0045179 | apical cortex(GO:0045179) |
0.1 | 0.4 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
0.0 | 0.5 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.6 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.4 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.2 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.2 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.0 | 0.5 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.3 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.2 | GO:0070545 | PeBoW complex(GO:0070545) |
0.0 | 0.5 | GO:0034706 | sodium channel complex(GO:0034706) |
0.0 | 1.7 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 1.2 | GO:0098878 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.0 | 0.4 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.4 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 0.8 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.2 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.0 | GO:0030891 | VCB complex(GO:0030891) |
0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.2 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 0.4 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.6 | GO:0001741 | XY body(GO:0001741) |
0.0 | 0.1 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.0 | 0.0 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 1.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 1.3 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 0.0 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 0.1 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.3 | GO:0036128 | CatSper complex(GO:0036128) |
0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
0.0 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.0 | 0.7 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 2.5 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 6.4 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 3.5 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.0 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.0 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 2.1 | GO:0030427 | site of polarized growth(GO:0030427) |
0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 0.2 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.0 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
0.0 | 0.1 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.0 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.1 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.0 | 0.1 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.2 | GO:0033202 | DNA helicase complex(GO:0033202) |
0.0 | 0.2 | GO:0044453 | nuclear membrane part(GO:0044453) |
0.0 | 0.1 | GO:0000812 | Swr1 complex(GO:0000812) |
0.0 | 0.7 | GO:0031526 | brush border membrane(GO:0031526) |
0.0 | 0.1 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.0 | 0.1 | GO:0071565 | nBAF complex(GO:0071565) |
0.0 | 0.1 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
0.0 | 0.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 0.0 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.0 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 0.0 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.0 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.0 | 0.2 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.0 | 0.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.0 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 2.4 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.4 | 1.3 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.4 | 1.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.4 | 1.2 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.4 | 5.4 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.4 | 1.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.3 | 1.0 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.3 | 1.4 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.3 | 2.7 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.3 | 0.3 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.3 | 1.3 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.3 | 1.3 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.3 | 1.2 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.3 | 1.5 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.3 | 1.5 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.3 | 2.4 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.3 | 6.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.3 | 0.8 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.3 | 2.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.3 | 1.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.3 | 0.5 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.3 | 1.0 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.3 | 1.8 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.3 | 0.8 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.2 | 0.7 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.2 | 1.5 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.2 | 1.7 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.2 | 4.8 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.2 | 0.5 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.2 | 3.4 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.2 | 2.0 | GO:0038191 | neuropilin binding(GO:0038191) |
0.2 | 0.9 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.2 | 2.6 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.2 | 0.6 | GO:0051870 | methotrexate binding(GO:0051870) |
0.2 | 0.8 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.2 | 0.6 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.2 | 0.2 | GO:0055100 | adiponectin binding(GO:0055100) |
0.2 | 0.6 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.2 | 0.2 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.2 | 0.6 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.2 | 0.7 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.2 | 0.4 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.2 | 0.7 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.2 | 0.7 | GO:0009374 | biotin binding(GO:0009374) |
0.2 | 0.9 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.2 | 2.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.2 | 0.8 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.2 | 0.5 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.2 | 1.4 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.2 | 0.2 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.2 | 0.8 | GO:1990254 | keratin filament binding(GO:1990254) |
0.2 | 1.3 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.2 | 0.8 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.2 | 0.6 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.1 | 4.9 | GO:0005109 | frizzled binding(GO:0005109) |
0.1 | 0.4 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 0.6 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.4 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.1 | 0.6 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.1 | 2.3 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.3 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.1 | 0.5 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 0.5 | GO:0042731 | PH domain binding(GO:0042731) |
0.1 | 0.4 | GO:0018571 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.1 | 0.4 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.1 | 31.1 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.1 | 0.4 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.1 | 0.8 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.1 | 0.3 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 1.6 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.5 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 0.6 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.9 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.1 | 0.6 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.1 | 2.7 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.1 | 0.4 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.1 | 0.2 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.1 | 3.1 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.1 | 0.4 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.1 | 0.4 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.1 | 0.5 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 0.2 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.1 | 0.4 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.1 | 0.5 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.1 | 1.2 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.1 | 0.9 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.1 | 0.7 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.1 | 0.3 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.1 | 0.4 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.1 | 0.8 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.1 | 0.8 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.1 | 0.2 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 1.0 | GO:0015197 | peptide transporter activity(GO:0015197) |
0.1 | 0.2 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 65.1 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
0.1 | 0.3 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.1 | 0.4 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.4 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 0.7 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
0.1 | 0.5 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 0.1 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.1 | 0.3 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.1 | 0.2 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.1 | 2.0 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.1 | 0.2 | GO:0052744 | phosphatidylinositol monophosphate phosphatase activity(GO:0052744) |
0.1 | 0.5 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.1 | 0.4 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.4 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 0.4 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.3 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 0.3 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.1 | 1.0 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.1 | 0.3 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.1 | 0.9 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 0.3 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.1 | 0.3 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 0.3 | GO:0034889 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.1 | 3.1 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.1 | 0.3 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.1 | 0.2 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.2 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.2 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 0.6 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 0.4 | GO:0038132 | neuregulin binding(GO:0038132) |
0.1 | 0.2 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.1 | 0.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.1 | 2.0 | GO:0043394 | proteoglycan binding(GO:0043394) |
0.1 | 0.2 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.1 | 0.3 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 0.2 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.1 | 1.1 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
0.1 | 0.4 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.1 | 0.2 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.1 | 0.1 | GO:0070840 | dynein complex binding(GO:0070840) |
0.1 | 0.4 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.1 | 0.2 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.1 | 0.1 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.1 | 0.2 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.1 | 0.7 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.1 | 0.3 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.1 | 0.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.2 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.1 | 0.7 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 1.1 | GO:0051183 | vitamin transporter activity(GO:0051183) |
0.1 | 0.3 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.8 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.1 | 1.2 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.1 | 1.6 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
0.1 | 0.1 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.1 | 0.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.1 | 0.1 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.1 | 0.4 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.1 | 0.2 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.1 | 0.2 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 0.4 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.1 | 0.2 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.1 | 0.3 | GO:0030275 | LRR domain binding(GO:0030275) |
0.1 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 0.2 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.1 | 1.0 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 0.6 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.1 | 0.2 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.1 | 0.2 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.1 | 0.2 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.1 | 0.2 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.1 | 0.2 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.1 | 0.2 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.1 | 0.5 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
0.1 | 0.3 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.1 | 1.4 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.1 | 0.7 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 0.2 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 0.9 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.1 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.1 | 1.0 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.1 | 0.3 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.1 | 0.3 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.1 | 1.7 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.1 | 0.2 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.1 | 0.2 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.1 | 0.2 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.1 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 0.8 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.0 | 0.1 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.1 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.0 | 0.4 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.0 | 0.0 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
0.0 | 0.2 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.9 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.4 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.0 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.0 | 0.2 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.5 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.0 | 0.2 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.0 | 0.0 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.0 | 0.4 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.0 | 0.8 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.2 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.0 | 0.2 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 0.1 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.2 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.2 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.2 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.0 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.4 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.2 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.2 | GO:0055102 | lipase inhibitor activity(GO:0055102) |
0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.5 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
0.0 | 0.3 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.0 | 0.2 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.0 | 0.2 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 0.9 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.4 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) acidic amino acid transmembrane transporter activity(GO:0015172) |
0.0 | 2.8 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.1 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.5 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 1.9 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.0 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.2 | GO:0046790 | virion binding(GO:0046790) |
0.0 | 0.3 | GO:0030546 | receptor activator activity(GO:0030546) |
0.0 | 0.2 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.2 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.0 | 0.4 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.0 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.0 | 0.4 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
0.0 | 0.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.6 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.0 | 0.2 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.0 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
0.0 | 0.1 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.0 | 0.0 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.6 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.1 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.2 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.1 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.1 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 0.1 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
0.0 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.0 | 2.4 | GO:0008201 | heparin binding(GO:0008201) |
0.0 | 0.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.0 | 0.0 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.1 | GO:0002046 | opsin binding(GO:0002046) |
0.0 | 0.4 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.0 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.1 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.1 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.0 | 0.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.0 | 0.1 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.0 | 0.0 | GO:0036033 | mediator complex binding(GO:0036033) |
0.0 | 0.5 | GO:0005272 | sodium channel activity(GO:0005272) |
0.0 | 0.1 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.0 | 0.3 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.1 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 0.0 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.0 | 0.0 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 0.2 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 0.2 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.0 | 0.1 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.3 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.0 | 0.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.7 | GO:0004027 | alcohol sulfotransferase activity(GO:0004027) |
0.0 | 0.1 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.0 | 0.1 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.0 | 0.3 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.0 | 0.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.0 | 0.1 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.1 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.1 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 0.2 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 0.0 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 0.1 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.0 | 0.0 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.2 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.5 | GO:0042826 | histone deacetylase binding(GO:0042826) |
0.0 | 0.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 0.0 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.0 | 0.1 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.0 | 0.0 | GO:0046625 | sphingolipid binding(GO:0046625) |
0.0 | 0.1 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.0 | 0.0 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.0 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
0.0 | 0.0 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.0 | 0.0 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.4 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.0 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.2 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.0 | GO:0043398 | HLH domain binding(GO:0043398) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 7.4 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.2 | 1.7 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 5.9 | NABA COLLAGENS | Genes encoding collagen proteins |
0.1 | 0.1 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 0.5 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.1 | 1.9 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 1.9 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 6.1 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.1 | 1.4 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 1.1 | PID ALK1 PATHWAY | ALK1 signaling events |
0.1 | 1.5 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.1 | 1.1 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 1.0 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.1 | 1.1 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.1 | 1.0 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 2.6 | PID FGF PATHWAY | FGF signaling pathway |
0.1 | 0.7 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 1.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 1.0 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.1 | 1.4 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.1 | 2.4 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.1 | 0.1 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 0.7 | PID RAS PATHWAY | Regulation of Ras family activation |
0.1 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 7.2 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.9 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.3 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.7 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.5 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 1.0 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 1.1 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.6 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 1.6 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 0.0 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.0 | 0.4 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.7 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.3 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 4.0 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 6.7 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.9 | NABA CORE MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
0.0 | 0.5 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 0.4 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 0.5 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.3 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.0 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 0.3 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.5 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.2 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 0.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.0 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.3 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.2 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.3 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.3 | 1.1 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
0.2 | 3.9 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
0.2 | 2.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.1 | 1.3 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.1 | 2.8 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 3.3 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 10.3 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.1 | 2.7 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 1.1 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 6.4 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.1 | 0.1 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.1 | 0.1 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
0.1 | 0.3 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
0.1 | 3.3 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.1 | 1.2 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 1.1 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.1 | 0.3 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.1 | 0.1 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 1.0 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 1.5 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 1.4 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 1.0 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.1 | 0.6 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 2.2 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.1 | 0.2 | REACTOME TRIF MEDIATED TLR3 SIGNALING | Genes involved in TRIF mediated TLR3 signaling |
0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 1.6 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 2.1 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.1 | 1.1 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.1 | 0.3 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 0.5 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.1 | 1.3 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 0.8 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.1 | 0.2 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.1 | 0.6 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.1 | 0.6 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 0.1 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.0 | 0.6 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.0 | 1.0 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.0 | 0.2 | REACTOME SIGNALLING BY NGF | Genes involved in Signalling by NGF |
0.0 | 0.5 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.0 | 0.7 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.3 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.4 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.4 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.4 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.4 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.3 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.2 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.0 | 0.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 4.9 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.2 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.3 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.7 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.5 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.0 | 1.3 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.2 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.5 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 1.1 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.3 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.2 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.4 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.0 | 0.1 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.1 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.0 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.0 | 0.0 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.0 | 0.1 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.0 | 0.0 | REACTOME ACTIVATION OF NMDA RECEPTOR UPON GLUTAMATE BINDING AND POSTSYNAPTIC EVENTS | Genes involved in Activation of NMDA receptor upon glutamate binding and postsynaptic events |
0.0 | 0.1 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.0 | 0.1 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.1 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.1 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.1 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.0 | 0.4 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 0.2 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |