Gene Symbol | Gene ID | Gene Info |
---|---|---|
Neurog2
|
ENSMUSG00000027967.7 | Neurog2 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Neurog2 | chr3_127640593_127641597 | 7960 | 0.126258 | -0.65 | 1.6e-08 | Click! |
Neurog2 | chr3_127634278_127634696 | 1352 | 0.318896 | -0.43 | 5.5e-04 | Click! |
Neurog2 | chr3_127628252_127629180 | 4419 | 0.141297 | -0.39 | 2.0e-03 | Click! |
Neurog2 | chr3_127639508_127640557 | 6897 | 0.129277 | -0.39 | 2.4e-03 | Click! |
Neurog2 | chr3_127632452_127632935 | 442 | 0.746123 | -0.38 | 2.4e-03 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr11_102364387_102365146 | 6.81 |
Slc4a1 |
solute carrier family 4 (anion exchanger), member 1 |
481 |
0.67 |
chr4_40850011_40850208 | 5.52 |
Mir5123 |
microRNA 5123 |
29 |
0.53 |
chr10_115817324_115818606 | 5.37 |
Tspan8 |
tetraspanin 8 |
681 |
0.78 |
chr18_62176067_62177775 | 5.08 |
Adrb2 |
adrenergic receptor, beta 2 |
3038 |
0.24 |
chr7_115845489_115845805 | 5.03 |
Sox6 |
SRY (sex determining region Y)-box 6 |
458 |
0.89 |
chr1_132365874_132366736 | 4.86 |
Tmcc2 |
transmembrane and coiled-coil domains 2 |
767 |
0.54 |
chr7_99594627_99596228 | 4.68 |
Arrb1 |
arrestin, beta 1 |
804 |
0.48 |
chr4_46453910_46454934 | 4.64 |
Anp32b |
acidic (leucine-rich) nuclear phosphoprotein 32 family, member B |
3520 |
0.17 |
chr4_46854379_46855929 | 4.17 |
Gabbr2 |
gamma-aminobutyric acid (GABA) B receptor, 2 |
4748 |
0.3 |
chr2_151037018_151037169 | 3.77 |
Nanp |
N-acetylneuraminic acid phosphatase |
2269 |
0.17 |
chr9_64807169_64807758 | 3.49 |
Dennd4a |
DENN/MADD domain containing 4A |
3877 |
0.25 |
chr11_32296600_32297646 | 3.40 |
Hba-a2 |
hemoglobin alpha, adult chain 2 |
495 |
0.66 |
chr5_86903726_86904465 | 3.38 |
Ugt2b34 |
UDP glucuronosyltransferase 2 family, polypeptide B34 |
2842 |
0.15 |
chr10_87524065_87524420 | 3.36 |
Pah |
phenylalanine hydroxylase |
2215 |
0.31 |
chr5_67813721_67814007 | 3.36 |
Atp8a1 |
ATPase, aminophospholipid transporter (APLT), class I, type 8A, member 1 |
1366 |
0.35 |
chr8_84836764_84838739 | 3.34 |
Rad23a |
RAD23 homolog A, nucleotide excision repair protein |
296 |
0.75 |
chr4_63373706_63374431 | 3.33 |
Akna |
AT-hook transcription factor |
7135 |
0.11 |
chr4_63153559_63154085 | 3.32 |
Ambp |
alpha 1 microglobulin/bikunin precursor |
351 |
0.86 |
chr5_134915097_134915436 | 3.30 |
Cldn13 |
claudin 13 |
260 |
0.81 |
chr11_32283784_32284776 | 3.27 |
Hba-a1 |
hemoglobin alpha, adult chain 1 |
469 |
0.66 |
chr19_45230983_45235468 | 3.13 |
Lbx1 |
ladybird homeobox 1 |
2587 |
0.27 |
chr5_73189782_73190392 | 3.09 |
Gm42571 |
predicted gene 42571 |
330 |
0.81 |
chr16_21826156_21826862 | 3.07 |
Map3k13 |
mitogen-activated protein kinase kinase kinase 13 |
567 |
0.64 |
chrX_140954455_140954606 | 3.02 |
Psmd10 |
proteasome (prosome, macropain) 26S subunit, non-ATPase, 10 |
2159 |
0.27 |
chr7_99179478_99179971 | 2.98 |
Dgat2 |
diacylglycerol O-acyltransferase 2 |
569 |
0.67 |
chr6_7691586_7691737 | 2.94 |
Asns |
asparagine synthetase |
561 |
0.79 |
chr4_87881166_87881641 | 2.92 |
Mllt3 |
myeloid/lymphoid or mixed-lineage leukemia; translocated to, 3 |
6861 |
0.3 |
chr6_90619935_90620303 | 2.87 |
Slc41a3 |
solute carrier family 41, member 3 |
972 |
0.47 |
chr10_67002257_67005140 | 2.85 |
Gm31763 |
predicted gene, 31763 |
1322 |
0.45 |
chr4_40850257_40850410 | 2.82 |
Gm25931 |
predicted gene, 25931 |
69 |
0.44 |
chr19_38122863_38123022 | 2.81 |
Rbp4 |
retinol binding protein 4, plasma |
1783 |
0.28 |
chr15_36647605_36647897 | 2.80 |
Gm6704 |
predicted gene 6704 |
17882 |
0.12 |
chr5_120136572_120137140 | 2.70 |
Gm10390 |
predicted gene 10390 |
2405 |
0.3 |
chr13_75709278_75709841 | 2.66 |
Ell2 |
elongation factor RNA polymerase II 2 |
1848 |
0.23 |
chr1_36071298_36072369 | 2.64 |
Hs6st1 |
heparan sulfate 6-O-sulfotransferase 1 |
3433 |
0.18 |
chr1_40429769_40430295 | 2.63 |
Il1rl1 |
interleukin 1 receptor-like 1 |
462 |
0.83 |
chr9_24488178_24488449 | 2.63 |
Dpy19l1 |
dpy-19-like 1 (C. elegans) |
399 |
0.87 |
chrX_20551168_20551444 | 2.62 |
Rgn |
regucalcin |
1519 |
0.32 |
chrX_9256153_9256810 | 2.56 |
Gm14862 |
predicted gene 14862 |
418 |
0.78 |
chr9_106156833_106157412 | 2.48 |
Glyctk |
glycerate kinase |
128 |
0.86 |
chr2_163549290_163549771 | 2.46 |
Hnf4a |
hepatic nuclear factor 4, alpha |
553 |
0.68 |
chr7_90045322_90045732 | 2.44 |
Gm44861 |
predicted gene 44861 |
2830 |
0.19 |
chr2_163356404_163356958 | 2.44 |
Tox2 |
TOX high mobility group box family member 2 |
36303 |
0.11 |
chr12_111028723_111029009 | 2.42 |
Gm48631 |
predicted gene, 48631 |
10464 |
0.12 |
chr13_52829080_52829635 | 2.42 |
BB123696 |
expressed sequence BB123696 |
72152 |
0.11 |
chr6_5154616_5154962 | 2.40 |
Pon1 |
paraoxonase 1 |
38974 |
0.14 |
chr16_75906837_75907199 | 2.39 |
Samsn1 |
SAM domain, SH3 domain and nuclear localization signals, 1 |
2261 |
0.39 |
chr4_57116655_57117064 | 2.38 |
Epb41l4b |
erythrocyte membrane protein band 4.1 like 4b |
3201 |
0.29 |
chr4_46040988_46042013 | 2.38 |
Tmod1 |
tropomodulin 1 |
2291 |
0.3 |
chr11_71020656_71020807 | 2.37 |
Mis12 |
MIS12 kinetochore complex component |
840 |
0.31 |
chr3_5210054_5212105 | 2.37 |
Gm10748 |
predicted gene 10748 |
1759 |
0.36 |
chr16_76455992_76456410 | 2.37 |
Gm45030 |
predicted gene 45030 |
46708 |
0.13 |
chr19_55126480_55127385 | 2.32 |
Gpam |
glycerol-3-phosphate acyltransferase, mitochondrial |
271 |
0.92 |
chr2_35060029_35060642 | 2.30 |
Hc |
hemolytic complement |
1103 |
0.47 |
chr3_130073324_130073537 | 2.29 |
Gm9396 |
predicted gene 9396 |
5018 |
0.17 |
chr14_32167230_32167769 | 2.27 |
Ncoa4 |
nuclear receptor coactivator 4 |
1378 |
0.28 |
chr6_87808783_87808991 | 2.26 |
Rab43 |
RAB43, member RAS oncogene family |
867 |
0.33 |
chr1_185456468_185456733 | 2.26 |
Gm2061 |
predicted gene 2061 |
1032 |
0.36 |
chr8_13061441_13062199 | 2.26 |
Proz |
protein Z, vitamin K-dependent plasma glycoprotein |
855 |
0.41 |
chr16_17331632_17331929 | 2.25 |
Serpind1 |
serine (or cysteine) peptidase inhibitor, clade D, member 1 |
397 |
0.77 |
chrX_93701437_93701629 | 2.23 |
Pcyt1b |
phosphate cytidylyltransferase 1, choline, beta isoform |
26431 |
0.18 |
chr15_62158174_62158844 | 2.21 |
Pvt1 |
Pvt1 oncogene |
19666 |
0.25 |
chr10_111134360_111134511 | 2.18 |
Gm22101 |
predicted gene, 22101 |
5226 |
0.15 |
chr2_163548522_163549154 | 2.17 |
Hnf4a |
hepatic nuclear factor 4, alpha |
1245 |
0.35 |
chr12_79612527_79612715 | 2.17 |
Rad51b |
RAD51 paralog B |
285268 |
0.01 |
chr11_116615789_116616584 | 2.17 |
Rhbdf2 |
rhomboid 5 homolog 2 |
8014 |
0.1 |
chr14_54710271_54711044 | 2.17 |
Cebpe |
CCAAT/enhancer binding protein (C/EBP), epsilon |
1517 |
0.22 |
chr17_25092503_25092654 | 2.16 |
Ift140 |
intraflagellar transport 140 |
1907 |
0.2 |
chr7_18884653_18885482 | 2.16 |
Pglyrp1 |
peptidoglycan recognition protein 1 |
374 |
0.75 |
chr2_78869064_78870277 | 2.14 |
Ube2e3 |
ubiquitin-conjugating enzyme E2E 3 |
8 |
0.98 |
chr2_156494921_156495175 | 2.11 |
Epb41l1 |
erythrocyte membrane protein band 4.1 like 1 |
11346 |
0.13 |
chr6_149278397_149278720 | 2.10 |
Gm10388 |
predicted gene 10388 |
8215 |
0.16 |
chr3_127894696_127895269 | 2.09 |
Fam241a |
family with sequence similarity 241, member A |
1306 |
0.34 |
chr7_43656363_43656662 | 2.07 |
Siglece |
sialic acid binding Ig-like lectin E |
2841 |
0.12 |
chr13_101691106_101693172 | 2.06 |
Pik3r1 |
phosphoinositide-3-kinase regulatory subunit 1 |
204 |
0.95 |
chr3_83026277_83026469 | 2.05 |
Fga |
fibrinogen alpha chain |
158 |
0.94 |
chr16_45952627_45953612 | 2.05 |
Phldb2 |
pleckstrin homology like domain, family B, member 2 |
374 |
0.84 |
chr2_26485135_26488628 | 2.05 |
Notch1 |
notch 1 |
16383 |
0.09 |
chr5_108674331_108674482 | 2.04 |
Slc26a1 |
solute carrier family 26 (sulfate transporter), member 1 |
347 |
0.78 |
chr12_51827272_51827633 | 2.04 |
Hectd1 |
HECT domain E3 ubiquitin protein ligase 1 |
1866 |
0.35 |
chr17_71206427_71206897 | 2.02 |
Lpin2 |
lipin 2 |
1986 |
0.3 |
chr6_127321473_127321847 | 2.01 |
Gm43636 |
predicted gene 43636 |
3319 |
0.16 |
chr12_71876038_71876500 | 2.00 |
Daam1 |
dishevelled associated activator of morphogenesis 1 |
13461 |
0.21 |
chr11_8970315_8970617 | 2.00 |
Pkd1l1 |
polycystic kidney disease 1 like 1 |
2800 |
0.29 |
chr2_74734325_74737080 | 1.98 |
Hoxd3 |
homeobox D3 |
813 |
0.31 |
chr19_56391919_56392389 | 1.97 |
Nrap |
nebulin-related anchoring protein |
2117 |
0.28 |
chr4_119185391_119186249 | 1.96 |
Ermap |
erythroblast membrane-associated protein |
2927 |
0.12 |
chr2_131190350_131191217 | 1.96 |
Cdc25b |
cell division cycle 25B |
567 |
0.58 |
chr15_83429271_83429625 | 1.95 |
Pacsin2 |
protein kinase C and casein kinase substrate in neurons 2 |
3367 |
0.2 |
chr16_76355369_76355526 | 1.94 |
Nrip1 |
nuclear receptor interacting protein 1 |
17590 |
0.19 |
chr5_73191572_73191864 | 1.93 |
Fryl |
FRY like transcription coactivator |
161 |
0.91 |
chr2_84725217_84725962 | 1.92 |
Clp1 |
CLP1, cleavage and polyadenylation factor I subunit |
1653 |
0.17 |
chr10_127209984_127210195 | 1.92 |
Pip4k2c |
phosphatidylinositol-5-phosphate 4-kinase, type II, gamma |
1466 |
0.2 |
chr19_10015065_10016667 | 1.92 |
Rab3il1 |
RAB3A interacting protein (rabin3)-like 1 |
822 |
0.48 |
chr1_173332160_173333204 | 1.91 |
Ackr1 |
atypical chemokine receptor 1 (Duffy blood group) |
820 |
0.54 |
chr16_87705786_87706863 | 1.91 |
Bach1 |
BTB and CNC homology 1, basic leucine zipper transcription factor 1 |
7320 |
0.23 |
chr15_66811887_66812132 | 1.90 |
Sla |
src-like adaptor |
584 |
0.76 |
chr10_93070265_93070640 | 1.90 |
Cfap54 |
cilia and flagella associated protein 54 |
201 |
0.95 |
chr8_85378748_85378899 | 1.90 |
Mylk3 |
myosin light chain kinase 3 |
2155 |
0.23 |
chr12_4253563_4253853 | 1.88 |
Ncoa1 |
nuclear receptor coactivator 1 |
9870 |
0.11 |
chr4_154922289_154923481 | 1.87 |
Tnfrsf14 |
tumor necrosis factor receptor superfamily, member 14 (herpesvirus entry mediator) |
5192 |
0.13 |
chr11_22975402_22975952 | 1.85 |
Zrsr1 |
zinc finger (CCCH type), RNA binding motif and serine/arginine rich 1 |
2449 |
0.18 |
chr11_18331845_18332166 | 1.85 |
Gm12020 |
predicted gene 12020 |
4334 |
0.31 |
chr1_134110400_134110804 | 1.85 |
Chit1 |
chitinase 1 (chitotriosidase) |
640 |
0.53 |
chr10_86026040_86026657 | 1.84 |
A230060F14Rik |
RIKEN cDNA A230060F14 gene |
4019 |
0.13 |
chr15_97379421_97380753 | 1.83 |
Pced1b |
PC-esterase domain containing 1B |
18870 |
0.24 |
chr3_89386729_89388779 | 1.82 |
Zbtb7b |
zinc finger and BTB domain containing 7B |
83 |
0.91 |
chr18_65244387_65245064 | 1.82 |
Gm29966 |
predicted gene, 29966 |
426 |
0.8 |
chr6_90551160_90552107 | 1.80 |
Aldh1l1 |
aldehyde dehydrogenase 1 family, member L1 |
785 |
0.56 |
chr13_65111025_65111260 | 1.79 |
Mfsd14b |
major facilitator superfamily domain containing 14B |
1816 |
0.22 |
chr9_22134385_22134655 | 1.78 |
Acp5 |
acid phosphatase 5, tartrate resistant |
1171 |
0.24 |
chr15_62223218_62223688 | 1.78 |
Pvt1 |
Pvt1 oncogene |
850 |
0.67 |
chr13_56546608_56547115 | 1.77 |
Lect2 |
leukocyte cell-derived chemotaxin 2 |
1548 |
0.36 |
chr3_144721397_144722064 | 1.76 |
Sh3glb1 |
SH3-domain GRB2-like B1 (endophilin) |
1395 |
0.32 |
chr16_20713558_20714737 | 1.76 |
Clcn2 |
chloride channel, voltage-sensitive 2 |
479 |
0.59 |
chr1_58953501_58954127 | 1.76 |
Trak2 |
trafficking protein, kinesin binding 2 |
7477 |
0.16 |
chr17_71214561_71214955 | 1.74 |
Lpin2 |
lipin 2 |
10082 |
0.17 |
chr12_69755107_69755258 | 1.73 |
Mir681 |
microRNA 681 |
8762 |
0.13 |
chr9_31252540_31253078 | 1.73 |
Gm7244 |
predicted gene 7244 |
22012 |
0.14 |
chr19_60872126_60872508 | 1.73 |
Prdx3 |
peroxiredoxin 3 |
2239 |
0.22 |
chr13_36057526_36058113 | 1.72 |
Fars2 |
phenylalanine-tRNA synthetase 2 (mitochondrial) |
59593 |
0.08 |
chr10_83019700_83020296 | 1.72 |
Gm10773 |
predicted gene 10773 |
11697 |
0.19 |
chr6_28424707_28425215 | 1.72 |
Gcc1 |
golgi coiled coil 1 |
808 |
0.41 |
chr7_35554183_35554334 | 1.72 |
Nudt19 |
nudix (nucleoside diphosphate linked moiety X)-type motif 19 |
936 |
0.36 |
chr1_23379124_23380478 | 1.72 |
Ogfrl1 |
opioid growth factor receptor-like 1 |
1000 |
0.55 |
chr3_83028731_83029005 | 1.71 |
Fga |
fibrinogen alpha chain |
2653 |
0.2 |
chr2_31060865_31061356 | 1.71 |
Fnbp1 |
formin binding protein 1 |
5666 |
0.19 |
chr5_90462451_90462921 | 1.70 |
Alb |
albumin |
14 |
0.97 |
chrX_101379371_101379707 | 1.70 |
Gjb1 |
gap junction protein, beta 1 |
2266 |
0.23 |
chr7_118755962_118756296 | 1.69 |
Vps35l |
VPS35 endosomal protein sorting factor like |
3466 |
0.15 |
chr15_73743277_73743757 | 1.68 |
Ptp4a3 |
protein tyrosine phosphatase 4a3 |
4117 |
0.19 |
chr18_12936449_12936600 | 1.68 |
Osbpl1a |
oxysterol binding protein-like 1A |
5253 |
0.2 |
chr5_97002293_97002729 | 1.67 |
Bmp2k |
BMP2 inducible kinase |
4822 |
0.15 |
chr2_105680581_105683424 | 1.67 |
Pax6 |
paired box 6 |
290 |
0.89 |
chr12_70454010_70454539 | 1.65 |
Tmx1 |
thioredoxin-related transmembrane protein 1 |
1179 |
0.5 |
chr9_108104524_108105208 | 1.64 |
Gm47303 |
predicted gene, 47303 |
1620 |
0.16 |
chr14_41106985_41107194 | 1.64 |
Mat1a |
methionine adenosyltransferase I, alpha |
1708 |
0.25 |
chr19_7067378_7068718 | 1.62 |
Macrod1 |
mono-ADP ribosylhydrolase 1 |
11238 |
0.1 |
chr7_103909977_103910867 | 1.60 |
Olfr65 |
olfactory receptor 65 |
4080 |
0.08 |
chr10_21196551_21197034 | 1.60 |
Gm40608 |
predicted gene, 40608 |
7610 |
0.15 |
chr2_90559115_90559476 | 1.59 |
Ptprj |
protein tyrosine phosphatase, receptor type, J |
21352 |
0.19 |
chr16_30266391_30266905 | 1.58 |
Cpn2 |
carboxypeptidase N, polypeptide 2 |
851 |
0.52 |
chr5_146308878_146309040 | 1.58 |
Cdk8 |
cyclin-dependent kinase 8 |
12594 |
0.17 |
chr12_111028350_111028524 | 1.58 |
Gm48631 |
predicted gene, 48631 |
10035 |
0.12 |
chr5_107872448_107872893 | 1.58 |
Evi5 |
ecotropic viral integration site 5 |
2374 |
0.16 |
chr3_144785386_144785870 | 1.57 |
Gm17743 |
predicted gene, 17743 |
6616 |
0.12 |
chr11_115899008_115899252 | 1.57 |
Smim5 |
small integral membrane protein 5 |
836 |
0.4 |
chr3_83010068_83011013 | 1.56 |
Gm30097 |
predicted gene, 30097 |
2052 |
0.23 |
chr4_63151510_63151974 | 1.56 |
Ambp |
alpha 1 microglobulin/bikunin precursor |
2431 |
0.26 |
chr17_74267052_74267580 | 1.56 |
Memo1 |
mediator of cell motility 1 |
11331 |
0.14 |
chr11_87368033_87368351 | 1.56 |
Ppm1e |
protein phosphatase 1E (PP2C domain containing) |
9169 |
0.12 |
chr6_87776091_87777171 | 1.55 |
Gm43904 |
predicted gene, 43904 |
488 |
0.55 |
chr4_142019304_142019455 | 1.54 |
4930455G09Rik |
RIKEN cDNA 4930455G09 gene |
1481 |
0.29 |
chr8_122556522_122557920 | 1.54 |
Piezo1 |
piezo-type mechanosensitive ion channel component 1 |
5892 |
0.1 |
chr1_144775019_144775553 | 1.54 |
Rgs18 |
regulator of G-protein signaling 18 |
149 |
0.98 |
chr14_67000048_67000519 | 1.53 |
Bnip3l |
BCL2/adenovirus E1B interacting protein 3-like |
225 |
0.91 |
chr10_79881578_79883095 | 1.53 |
Prtn3 |
proteinase 3 |
553 |
0.43 |
chr11_116506247_116506688 | 1.53 |
Rpl36-ps1 |
ribosomal protein L36, pseudogene 1 |
1931 |
0.18 |
chr14_32145330_32145989 | 1.52 |
Msmb |
beta-microseminoprotein |
1928 |
0.21 |
chr9_14369210_14369409 | 1.52 |
Endod1 |
endonuclease domain containing 1 |
11674 |
0.12 |
chr17_12205164_12205523 | 1.52 |
Agpat4 |
1-acylglycerol-3-phosphate O-acyltransferase 4 (lysophosphatidic acid acyltransferase, delta) |
9782 |
0.17 |
chr16_8675743_8675894 | 1.52 |
Carhsp1 |
calcium regulated heat stable protein 1 |
3663 |
0.14 |
chr9_121452577_121452846 | 1.52 |
Trak1 |
trafficking protein, kinesin binding 1 |
1585 |
0.37 |
chr13_99754534_99754748 | 1.52 |
Gm24471 |
predicted gene, 24471 |
62112 |
0.12 |
chr5_100570574_100571670 | 1.51 |
Plac8 |
placenta-specific 8 |
1070 |
0.43 |
chr3_41179287_41179566 | 1.51 |
Gm40038 |
predicted gene, 40038 |
6763 |
0.25 |
chr1_185457337_185457617 | 1.50 |
Gm2061 |
predicted gene 2061 |
1909 |
0.22 |
chr3_36606443_36606688 | 1.50 |
Bbs7 |
Bardet-Biedl syndrome 7 (human) |
6720 |
0.15 |
chr8_121905518_121905669 | 1.50 |
Slc7a5 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 5 |
2101 |
0.17 |
chr8_3666021_3666259 | 1.50 |
Mcemp1 |
mast cell expressed membrane protein 1 |
386 |
0.64 |
chr4_41387321_41387666 | 1.49 |
Ubap1 |
ubiquitin-associated protein 1 |
15768 |
0.12 |
chr7_120875749_120876118 | 1.49 |
Eef2k |
eukaryotic elongation factor-2 kinase |
287 |
0.71 |
chr2_146098449_146098737 | 1.49 |
Cfap61 |
cilia and flagella associated protein 61 |
51342 |
0.15 |
chr8_124362117_124362708 | 1.48 |
Gm24459 |
predicted gene, 24459 |
5174 |
0.17 |
chr17_57226830_57227207 | 1.48 |
C3 |
complement component 3 |
985 |
0.39 |
chr4_141161542_141161808 | 1.48 |
Fbxo42 |
F-box protein 42 |
13753 |
0.11 |
chr16_35810345_35810496 | 1.48 |
Gm26838 |
predicted gene, 26838 |
1474 |
0.31 |
chr8_23041719_23041950 | 1.48 |
Ank1 |
ankyrin 1, erythroid |
6603 |
0.19 |
chr16_36454351_36454502 | 1.48 |
Stfa3 |
stefin A3 |
966 |
0.36 |
chr7_132776252_132776889 | 1.47 |
Fam53b |
family with sequence similarity 53, member B |
346 |
0.89 |
chr12_118296552_118297427 | 1.47 |
Sp4 |
trans-acting transcription factor 4 |
4379 |
0.3 |
chr17_36019836_36019989 | 1.47 |
H2-T24 |
histocompatibility 2, T region locus 24 |
613 |
0.42 |
chr2_170252622_170252800 | 1.46 |
Gm14270 |
predicted gene 14270 |
32324 |
0.19 |
chr7_98118384_98119588 | 1.46 |
Myo7a |
myosin VIIA |
506 |
0.78 |
chr5_107837149_107837411 | 1.46 |
Evi5 |
ecotropic viral integration site 5 |
200 |
0.89 |
chr10_115263241_115263392 | 1.46 |
Gm8942 |
predicted gene 8942 |
6662 |
0.17 |
chr1_160025834_160026011 | 1.46 |
Gm37294 |
predicted gene, 37294 |
18409 |
0.15 |
chr15_67171282_67172300 | 1.45 |
St3gal1 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 1 |
4921 |
0.29 |
chr5_7179923_7180393 | 1.44 |
Tubb4b-ps1 |
tubulin, beta 4B class IVB, pseudogene 1 |
793 |
0.61 |
chr18_77705082_77705233 | 1.43 |
8030462N17Rik |
RIKEN cDNA 8030462N17 gene |
8776 |
0.14 |
chr14_65102031_65102258 | 1.43 |
Extl3 |
exostosin-like glycosyltransferase 3 |
4038 |
0.24 |
chr17_5494452_5495422 | 1.43 |
Zdhhc14 |
zinc finger, DHHC domain containing 14 |
2380 |
0.28 |
chr4_63152318_63152930 | 1.43 |
Ambp |
alpha 1 microglobulin/bikunin precursor |
1549 |
0.36 |
chr13_112747603_112747836 | 1.42 |
Slc38a9 |
solute carrier family 38, member 9 |
12109 |
0.15 |
chr6_83247659_83247969 | 1.42 |
Slc4a5 |
solute carrier family 4, sodium bicarbonate cotransporter, member 5 |
10439 |
0.12 |
chr12_78980165_78980825 | 1.42 |
Tmem229b |
transmembrane protein 229B |
268 |
0.91 |
chr19_17354797_17355050 | 1.42 |
Gcnt1 |
glucosaminyl (N-acetyl) transferase 1, core 2 |
1744 |
0.41 |
chr6_7697635_7698104 | 1.41 |
Asns |
asparagine synthetase |
4615 |
0.24 |
chr4_98189801_98190022 | 1.40 |
Gm12691 |
predicted gene 12691 |
39650 |
0.15 |
chr10_43582536_43582946 | 1.40 |
Cd24a |
CD24a antigen |
2806 |
0.19 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 6.5 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
1.2 | 3.5 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.8 | 0.8 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
0.8 | 3.2 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.7 | 2.8 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.6 | 1.7 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.6 | 2.3 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.6 | 1.7 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.6 | 3.3 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.5 | 2.7 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.5 | 2.7 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.5 | 1.5 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.5 | 1.5 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.5 | 1.9 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.4 | 2.2 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.4 | 2.2 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.4 | 1.3 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.4 | 2.1 | GO:0019532 | oxalate transport(GO:0019532) |
0.4 | 1.3 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
0.4 | 1.7 | GO:0001907 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.4 | 1.6 | GO:0002325 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.4 | 1.1 | GO:0000087 | mitotic M phase(GO:0000087) |
0.4 | 1.4 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.4 | 0.7 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.4 | 0.7 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
0.3 | 2.4 | GO:0060613 | fat pad development(GO:0060613) |
0.3 | 1.6 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.3 | 0.9 | GO:0002432 | granuloma formation(GO:0002432) |
0.3 | 1.3 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.3 | 1.3 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.3 | 2.2 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.3 | 0.6 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.3 | 0.9 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.3 | 1.5 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.3 | 0.9 | GO:1901671 | positive regulation of superoxide dismutase activity(GO:1901671) positive regulation of removal of superoxide radicals(GO:1904833) |
0.3 | 8.1 | GO:0048821 | erythrocyte development(GO:0048821) |
0.3 | 0.9 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.3 | 0.6 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.3 | 0.8 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.3 | 2.2 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.3 | 1.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.3 | 0.8 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.3 | 1.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.3 | 1.3 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.3 | 0.8 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.2 | 0.7 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.2 | 4.5 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.2 | 2.0 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.2 | 0.7 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.2 | 1.2 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.2 | 0.7 | GO:0009197 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
0.2 | 1.7 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.2 | 1.5 | GO:0006559 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.2 | 0.7 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.2 | 0.2 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.2 | 0.9 | GO:0051697 | protein delipidation(GO:0051697) |
0.2 | 0.7 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.2 | 0.7 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.2 | 0.7 | GO:0044857 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
0.2 | 0.9 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.2 | 0.2 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.2 | 1.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.2 | 2.4 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.2 | 0.6 | GO:0046864 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.2 | 0.8 | GO:0031049 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.2 | 1.5 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.2 | 0.8 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.2 | 1.4 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
0.2 | 1.0 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
0.2 | 0.6 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.2 | 0.8 | GO:0001810 | regulation of type I hypersensitivity(GO:0001810) type I hypersensitivity(GO:0016068) |
0.2 | 0.6 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.2 | 0.6 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
0.2 | 0.6 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.2 | 1.0 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.2 | 1.4 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
0.2 | 0.4 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.2 | 0.8 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.2 | 0.6 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
0.2 | 0.4 | GO:0042938 | dipeptide transport(GO:0042938) |
0.2 | 0.6 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.2 | 0.8 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.2 | 0.9 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.2 | 0.6 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.2 | 0.4 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.2 | 0.7 | GO:0048023 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.2 | 0.5 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.2 | 0.5 | GO:0008228 | opsonization(GO:0008228) |
0.2 | 0.5 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
0.2 | 1.6 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.2 | 0.5 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.2 | 0.5 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.2 | 2.3 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
0.2 | 0.7 | GO:0036508 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
0.2 | 0.5 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.2 | 0.7 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
0.2 | 0.5 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.2 | 0.7 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.2 | 0.5 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.2 | 0.8 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.2 | 0.5 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.2 | 0.8 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.2 | 0.3 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.2 | 0.5 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.2 | 0.5 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.2 | 0.3 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.2 | 1.2 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.2 | 0.5 | GO:0070488 | neutrophil aggregation(GO:0070488) |
0.2 | 0.8 | GO:1903276 | regulation of sodium ion export(GO:1903273) regulation of sodium ion export from cell(GO:1903276) |
0.2 | 0.5 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.2 | 1.2 | GO:0097066 | response to thyroid hormone(GO:0097066) |
0.2 | 1.4 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.2 | 0.6 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.2 | 0.6 | GO:0021764 | amygdala development(GO:0021764) |
0.1 | 0.4 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.1 | 1.8 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.1 | 0.3 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.1 | 0.7 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
0.1 | 0.6 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.1 | 0.3 | GO:0009804 | coumarin metabolic process(GO:0009804) |
0.1 | 0.6 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.1 | 0.7 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.1 | 0.4 | GO:0032831 | positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.1 | 0.3 | GO:0036258 | multivesicular body assembly(GO:0036258) |
0.1 | 0.4 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.1 | 1.3 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.1 | 0.8 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.1 | 0.4 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
0.1 | 0.3 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.1 | 0.4 | GO:0006203 | dGTP catabolic process(GO:0006203) |
0.1 | 0.4 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.1 | 0.7 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.1 | 0.1 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.1 | 1.9 | GO:0006465 | signal peptide processing(GO:0006465) |
0.1 | 0.4 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.1 | 0.4 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 0.4 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 3.2 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.1 | 0.5 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.4 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.1 | 0.1 | GO:0032782 | bile acid secretion(GO:0032782) |
0.1 | 0.8 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.1 | 1.6 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.1 | 0.5 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.1 | 0.6 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.1 | 0.6 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.1 | 0.4 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.1 | 0.8 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.1 | 0.4 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.1 | 0.1 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.1 | 1.0 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
0.1 | 0.5 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.1 | 0.4 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.5 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.1 | 1.0 | GO:0006273 | lagging strand elongation(GO:0006273) |
0.1 | 0.4 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.1 | 0.5 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.1 | 0.4 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.5 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.1 | 1.0 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.1 | 0.7 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.1 | 0.2 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.1 | 0.1 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
0.1 | 0.5 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.1 | 0.4 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
0.1 | 0.2 | GO:0009642 | response to light intensity(GO:0009642) |
0.1 | 0.4 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 0.5 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.1 | 2.9 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.1 | 0.5 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.1 | 0.3 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.1 | 1.0 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.1 | 0.3 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.1 | 0.3 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.1 | 0.3 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
0.1 | 0.5 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.1 | 0.1 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.1 | 0.2 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.1 | 1.1 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.1 | 0.7 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.1 | 0.3 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.1 | 0.2 | GO:0052040 | negative regulation by symbiont of host apoptotic process(GO:0033668) modulation of programmed cell death in other organism(GO:0044531) modulation of apoptotic process in other organism(GO:0044532) modulation by symbiont of host programmed cell death(GO:0052040) negative regulation by symbiont of host programmed cell death(GO:0052041) modulation by symbiont of host apoptotic process(GO:0052150) modulation of programmed cell death in other organism involved in symbiotic interaction(GO:0052248) modulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052433) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.1 | 1.1 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.1 | 0.8 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.1 | 2.0 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.1 | 0.2 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.1 | 0.1 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
0.1 | 0.4 | GO:0002155 | thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
0.1 | 0.9 | GO:0071404 | cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
0.1 | 2.0 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.1 | 1.8 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.1 | 0.1 | GO:0090155 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
0.1 | 0.2 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
0.1 | 0.2 | GO:0071971 | extracellular exosome assembly(GO:0071971) regulation of extracellular exosome assembly(GO:1903551) |
0.1 | 0.1 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
0.1 | 0.4 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.1 | 0.4 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.1 | 3.0 | GO:1900047 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
0.1 | 0.5 | GO:0070944 | neutrophil mediated killing of bacterium(GO:0070944) |
0.1 | 0.3 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.1 | 0.3 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.5 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 0.3 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.1 | 0.2 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.1 | 0.2 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.1 | 0.8 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.1 | 0.3 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.1 | 0.4 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.1 | 0.9 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.1 | 0.4 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.1 | 0.2 | GO:0033058 | directional locomotion(GO:0033058) |
0.1 | 0.3 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.1 | 0.1 | GO:0042117 | monocyte activation(GO:0042117) |
0.1 | 0.1 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
0.1 | 0.3 | GO:0097501 | detoxification of copper ion(GO:0010273) detoxification of inorganic compound(GO:0061687) stress response to metal ion(GO:0097501) stress response to copper ion(GO:1990169) |
0.1 | 0.4 | GO:0044793 | negative regulation by host of viral process(GO:0044793) |
0.1 | 0.4 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.1 | 0.8 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.1 | 0.7 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.1 | 0.7 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.1 | 0.8 | GO:0002934 | desmosome organization(GO:0002934) |
0.1 | 0.2 | GO:0010915 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
0.1 | 1.1 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
0.1 | 0.4 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 0.5 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.1 | 0.4 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.1 | 0.1 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.1 | 0.4 | GO:0015793 | glycerol transport(GO:0015793) |
0.1 | 0.3 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.1 | 0.3 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.1 | 0.1 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.1 | 1.4 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.1 | 0.6 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.1 | 0.5 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.1 | 0.4 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.1 | 0.4 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.1 | 0.4 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.1 | 0.1 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.1 | 0.3 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.1 | 0.4 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.1 | 0.7 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.1 | 0.3 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
0.1 | 0.2 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.1 | 0.4 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.1 | 0.3 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
0.1 | 0.5 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.3 | GO:0070673 | response to interleukin-18(GO:0070673) |
0.1 | 0.4 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.1 | 0.2 | GO:0048261 | negative regulation of receptor-mediated endocytosis(GO:0048261) |
0.1 | 0.3 | GO:0032607 | interferon-alpha production(GO:0032607) |
0.1 | 0.3 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.1 | 0.5 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.1 | 0.2 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
0.1 | 0.7 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.1 | 0.4 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.1 | 0.2 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
0.1 | 0.7 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.1 | 0.7 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.1 | 0.5 | GO:0007549 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.1 | 0.1 | GO:0032802 | low-density lipoprotein particle receptor catabolic process(GO:0032802) regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
0.1 | 1.0 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.1 | 0.6 | GO:0046348 | amino sugar catabolic process(GO:0046348) |
0.1 | 0.2 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.1 | 1.5 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
0.1 | 0.6 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
0.1 | 1.5 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.1 | 0.4 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.1 | 0.5 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.1 | 0.1 | GO:0006901 | vesicle coating(GO:0006901) vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.1 | 0.1 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.1 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.1 | 0.2 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.1 | 0.6 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.1 | 0.2 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.1 | 0.3 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.1 | 0.2 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.7 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.1 | 0.6 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
0.1 | 0.1 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.1 | 0.2 | GO:2001138 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
0.1 | 0.8 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.1 | 0.2 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.1 | 0.2 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 0.5 | GO:0007603 | phototransduction, visible light(GO:0007603) |
0.1 | 0.3 | GO:0016114 | terpenoid biosynthetic process(GO:0016114) |
0.1 | 0.2 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.1 | 0.2 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.1 | 0.2 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.1 | 0.4 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.1 | 0.4 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.1 | 0.1 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.1 | 0.5 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
0.1 | 0.6 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.1 | 0.2 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.1 | 0.1 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.1 | 0.3 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.1 | 0.4 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.1 | 0.4 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.1 | 0.2 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.1 | 0.2 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.1 | 0.3 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.1 | 0.1 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
0.1 | 0.2 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
0.1 | 0.1 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.1 | 0.2 | GO:0051126 | negative regulation of actin nucleation(GO:0051126) |
0.1 | 0.5 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.1 | 0.2 | GO:0018343 | protein farnesylation(GO:0018343) |
0.1 | 0.5 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.1 | 0.1 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.1 | 0.3 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
0.1 | 0.1 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
0.1 | 0.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.2 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
0.1 | 0.1 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.1 | 0.2 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.1 | 0.3 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.1 | 0.2 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.1 | 0.2 | GO:0035106 | operant conditioning(GO:0035106) |
0.1 | 0.7 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.1 | 0.6 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.1 | 0.6 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.1 | 0.2 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.1 | 0.3 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.1 | 0.6 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.1 | 0.1 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.1 | 0.3 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.1 | 0.2 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.1 | 0.3 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.1 | 0.3 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.1 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.1 | 1.8 | GO:0006953 | acute-phase response(GO:0006953) |
0.1 | 0.5 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
0.1 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.2 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.1 | 0.9 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.1 | 0.1 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
0.1 | 0.8 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.1 | 0.3 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.1 | 0.1 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.1 | 0.3 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.1 | 0.2 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.1 | 0.3 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.1 | 0.2 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.1 | 1.4 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.1 | 0.2 | GO:0015705 | iodide transport(GO:0015705) |
0.1 | 0.3 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.1 | 0.3 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.1 | 0.1 | GO:0040031 | snRNA modification(GO:0040031) |
0.1 | 0.2 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.1 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.1 | 1.3 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
0.1 | 0.4 | GO:0070986 | left/right axis specification(GO:0070986) |
0.1 | 0.9 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.1 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.2 | GO:0032264 | IMP salvage(GO:0032264) |
0.1 | 0.1 | GO:0001969 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
0.1 | 0.2 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.1 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.1 | 0.8 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.1 | 0.2 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.1 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.1 | 0.7 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
0.1 | 0.2 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.1 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.1 | 0.1 | GO:0009078 | alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) L-alanine metabolic process(GO:0042851) |
0.1 | 0.1 | GO:0015677 | copper ion import(GO:0015677) |
0.1 | 0.2 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.1 | 0.2 | GO:0015871 | choline transport(GO:0015871) |
0.1 | 0.3 | GO:0051013 | microtubule severing(GO:0051013) |
0.1 | 0.6 | GO:0044126 | regulation of growth of symbiont in host(GO:0044126) modulation of growth of symbiont involved in interaction with host(GO:0044144) |
0.1 | 0.5 | GO:0070269 | pyroptosis(GO:0070269) |
0.1 | 0.1 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.1 | 0.2 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.1 | 0.6 | GO:0042772 | DNA damage response, signal transduction resulting in transcription(GO:0042772) |
0.1 | 0.5 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.1 | 0.2 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.1 | 0.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 0.3 | GO:0000237 | leptotene(GO:0000237) |
0.1 | 0.3 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.1 | 0.2 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 0.1 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.1 | 0.6 | GO:0006525 | arginine metabolic process(GO:0006525) |
0.1 | 0.1 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.1 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 0.2 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 0.2 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
0.1 | 0.3 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.1 | 0.4 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.1 | 0.1 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
0.1 | 0.2 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.1 | 0.1 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.1 | 0.3 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 0.5 | GO:0097286 | iron ion import(GO:0097286) |
0.1 | 0.1 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.1 | 0.2 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
0.1 | 1.1 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.1 | 0.2 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.1 | 0.8 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
0.1 | 0.2 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.1 | 0.2 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.1 | 0.3 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.1 | 0.1 | GO:0051031 | tRNA transport(GO:0051031) |
0.1 | 0.3 | GO:0009299 | mRNA transcription(GO:0009299) |
0.1 | 0.2 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.1 | 0.4 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.1 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.1 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.1 | 0.2 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.1 | 0.3 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.0 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.0 | 0.3 | GO:0016045 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
0.0 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.0 | 0.0 | GO:2000303 | regulation of ceramide biosynthetic process(GO:2000303) |
0.0 | 0.1 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.0 | 0.1 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.0 | 0.2 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.0 | 0.2 | GO:0097421 | liver regeneration(GO:0097421) |
0.0 | 1.7 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
0.0 | 0.1 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
0.0 | 0.1 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.0 | 0.3 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.0 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.2 | GO:0009115 | xanthine catabolic process(GO:0009115) |
0.0 | 0.2 | GO:1901978 | positive regulation of cell cycle checkpoint(GO:1901978) |
0.0 | 0.3 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
0.0 | 0.3 | GO:0048539 | bone marrow development(GO:0048539) |
0.0 | 0.2 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.0 | 0.1 | GO:0061511 | centriole elongation(GO:0061511) |
0.0 | 0.1 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.0 | 0.3 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.0 | 1.0 | GO:0050710 | negative regulation of cytokine secretion(GO:0050710) |
0.0 | 0.1 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.2 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.0 | 0.5 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.0 | 0.1 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.0 | 0.0 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.0 | 0.8 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.0 | 0.8 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.0 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.0 | 0.1 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.0 | 0.2 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.0 | 0.0 | GO:2001225 | regulation of chloride transport(GO:2001225) |
0.0 | 0.2 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.0 | 0.2 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
0.0 | 1.4 | GO:0006695 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
0.0 | 0.0 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.0 | 0.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.0 | 0.0 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.0 | 0.0 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
0.0 | 0.2 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 0.1 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.0 | 0.1 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.2 | GO:0018101 | protein citrullination(GO:0018101) |
0.0 | 0.0 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.0 | 0.2 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.0 | 0.2 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.2 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 0.1 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.0 | 0.1 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
0.0 | 0.4 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.0 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.0 | 0.3 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.0 | 0.1 | GO:0043091 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.0 | 0.4 | GO:0044804 | nucleophagy(GO:0044804) |
0.0 | 0.1 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
0.0 | 0.4 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.0 | 0.2 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
0.0 | 0.2 | GO:0030194 | positive regulation of blood coagulation(GO:0030194) positive regulation of hemostasis(GO:1900048) |
0.0 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.0 | 0.1 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.0 | 0.2 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 0.1 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.0 | 0.2 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.0 | 0.0 | GO:0021550 | medulla oblongata development(GO:0021550) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0009177 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
0.0 | 0.1 | GO:0002713 | negative regulation of B cell mediated immunity(GO:0002713) negative regulation of immunoglobulin mediated immune response(GO:0002890) |
0.0 | 0.1 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.0 | 0.0 | GO:0015684 | ferrous iron transport(GO:0015684) |
0.0 | 1.9 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.1 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.0 | 0.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.0 | 0.3 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.0 | 0.3 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.0 | 0.2 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.1 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.5 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.0 | 0.3 | GO:0046688 | response to copper ion(GO:0046688) |
0.0 | 0.7 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
0.0 | 0.3 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.7 | GO:0052696 | flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
0.0 | 0.0 | GO:0070459 | prolactin secretion(GO:0070459) |
0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.0 | 0.0 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.0 | 0.1 | GO:0001878 | response to yeast(GO:0001878) |
0.0 | 0.7 | GO:0002717 | positive regulation of natural killer cell mediated immunity(GO:0002717) positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
0.0 | 0.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.2 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
0.0 | 0.1 | GO:1903416 | response to glycoside(GO:1903416) |
0.0 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.3 | GO:0007063 | regulation of sister chromatid cohesion(GO:0007063) |
0.0 | 0.1 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.0 | 0.0 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
0.0 | 0.2 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.1 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.0 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.1 | GO:0015809 | arginine transport(GO:0015809) |
0.0 | 1.2 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
0.0 | 0.4 | GO:0046461 | neutral lipid catabolic process(GO:0046461) acylglycerol catabolic process(GO:0046464) |
0.0 | 0.1 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.0 | 0.2 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
0.0 | 0.3 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.0 | 0.1 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.0 | 0.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.4 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
0.0 | 0.5 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
0.0 | 0.2 | GO:2000252 | negative regulation of feeding behavior(GO:2000252) |
0.0 | 0.2 | GO:0034142 | toll-like receptor 4 signaling pathway(GO:0034142) |
0.0 | 0.0 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.0 | 0.0 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.0 | 0.3 | GO:0071625 | vocalization behavior(GO:0071625) |
0.0 | 0.2 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.0 | 0.0 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.0 | 0.3 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 0.1 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.0 | 0.0 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.0 | 0.0 | GO:0045423 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
0.0 | 0.1 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.0 | 0.2 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.0 | 0.4 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.0 | 0.2 | GO:0051026 | chiasma assembly(GO:0051026) |
0.0 | 0.2 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.0 | 0.0 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.0 | 0.6 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.1 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.0 | 0.1 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
0.0 | 0.3 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.0 | 0.3 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 1.5 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.0 | 0.2 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.0 | 0.1 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.1 | GO:1901475 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
0.0 | 0.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.0 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.0 | 0.0 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.0 | 0.1 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.0 | 0.2 | GO:0055064 | cellular chloride ion homeostasis(GO:0030644) chloride ion homeostasis(GO:0055064) |
0.0 | 0.1 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
0.0 | 0.2 | GO:0033194 | response to hydroperoxide(GO:0033194) |
0.0 | 0.3 | GO:0007097 | nuclear migration(GO:0007097) |
0.0 | 0.3 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.0 | 0.1 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.0 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.0 | 0.2 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.0 | 0.1 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.0 | 0.1 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
0.0 | 0.3 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.1 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.0 | 0.2 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.0 | GO:0097212 | late endosomal microautophagy(GO:0061738) lysosomal membrane organization(GO:0097212) |
0.0 | 0.0 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.0 | 0.2 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.1 | GO:0046541 | saliva secretion(GO:0046541) |
0.0 | 0.5 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.0 | 0.2 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.0 | 0.1 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.0 | 0.0 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.0 | 0.2 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
0.0 | 0.1 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.0 | 0.1 | GO:2000617 | positive regulation of histone H3-K9 acetylation(GO:2000617) |
0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.0 | 0.1 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
0.0 | 0.0 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
0.0 | 0.1 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.0 | 0.2 | GO:0048087 | positive regulation of developmental pigmentation(GO:0048087) positive regulation of pigment cell differentiation(GO:0050942) |
0.0 | 0.0 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.0 | 0.1 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.1 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.0 | 0.1 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.0 | 0.1 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) |
0.0 | 0.0 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
0.0 | 0.0 | GO:0071639 | positive regulation of monocyte chemotactic protein-1 production(GO:0071639) |
0.0 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.0 | 0.0 | GO:0001806 | type IV hypersensitivity(GO:0001806) |
0.0 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.0 | 0.1 | GO:0006658 | phosphatidylserine metabolic process(GO:0006658) phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.1 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.0 | 0.3 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
0.0 | 0.0 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.0 | 0.0 | GO:0061623 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.0 | 0.1 | GO:0060058 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
0.0 | 0.1 | GO:0034969 | histone arginine methylation(GO:0034969) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.0 | GO:0061724 | lipophagy(GO:0061724) |
0.0 | 0.0 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
0.0 | 0.0 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) |
0.0 | 0.0 | GO:0008050 | female courtship behavior(GO:0008050) |
0.0 | 0.1 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.0 | 0.0 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.0 | 0.3 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.0 | 0.1 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
0.0 | 0.2 | GO:0046686 | response to cadmium ion(GO:0046686) |
0.0 | 0.1 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.2 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.0 | 0.1 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.0 | 0.0 | GO:1903753 | negative regulation of p38MAPK cascade(GO:1903753) |
0.0 | 0.5 | GO:0006040 | amino sugar metabolic process(GO:0006040) |
0.0 | 0.2 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.4 | GO:0048535 | lymph node development(GO:0048535) |
0.0 | 0.0 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.0 | 0.3 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.0 | 0.0 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.0 | 0.2 | GO:0045932 | negative regulation of muscle contraction(GO:0045932) |
0.0 | 0.2 | GO:0051639 | actin filament network formation(GO:0051639) |
0.0 | 0.1 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
0.0 | 0.1 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
0.0 | 0.0 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.0 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.0 | 0.2 | GO:0006026 | aminoglycan catabolic process(GO:0006026) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.2 | GO:0009225 | nucleotide-sugar metabolic process(GO:0009225) |
0.0 | 0.2 | GO:2000757 | negative regulation of protein acetylation(GO:1901984) negative regulation of peptidyl-lysine acetylation(GO:2000757) |
0.0 | 0.1 | GO:0003160 | endocardium morphogenesis(GO:0003160) endocardium formation(GO:0060214) |
0.0 | 0.1 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.0 | 0.2 | GO:0046415 | urate metabolic process(GO:0046415) |
0.0 | 0.1 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
0.0 | 0.2 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.0 | 0.1 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
0.0 | 0.1 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.0 | 1.0 | GO:0001541 | ovarian follicle development(GO:0001541) |
0.0 | 0.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.0 | 0.3 | GO:0031062 | positive regulation of histone methylation(GO:0031062) |
0.0 | 0.0 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.0 | 0.2 | GO:0006544 | glycine metabolic process(GO:0006544) |
0.0 | 0.3 | GO:0010842 | retina layer formation(GO:0010842) |
0.0 | 0.0 | GO:1990035 | calcium ion import into cell(GO:1990035) |
0.0 | 0.0 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
0.0 | 0.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.0 | 0.2 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.0 | 0.3 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.0 | 0.1 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.0 | 0.2 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.0 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.0 | 0.1 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.0 | 0.0 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
0.0 | 0.1 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.0 | 0.1 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.1 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.0 | 0.1 | GO:0015825 | L-serine transport(GO:0015825) |
0.0 | 0.1 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.0 | 0.4 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.3 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
0.0 | 0.2 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.1 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.0 | 0.1 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.2 | GO:0010447 | response to acidic pH(GO:0010447) |
0.0 | 0.1 | GO:0090330 | regulation of platelet aggregation(GO:0090330) |
0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.0 | 0.0 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.0 | 0.1 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.1 | GO:0042420 | dopamine catabolic process(GO:0042420) |
0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.1 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.0 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.0 | 0.2 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.2 | GO:0016572 | histone phosphorylation(GO:0016572) |
0.0 | 0.0 | GO:0072393 | microtubule anchoring at microtubule organizing center(GO:0072393) |
0.0 | 0.1 | GO:0046087 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.0 | 0.1 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
0.0 | 0.1 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.0 | 0.0 | GO:0071316 | cellular response to nicotine(GO:0071316) |
0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.0 | 0.4 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
0.0 | 0.0 | GO:1990144 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
0.0 | 0.1 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.0 | 0.3 | GO:0006743 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) |
0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.1 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
0.0 | 0.0 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.3 | GO:0015816 | glycine transport(GO:0015816) |
0.0 | 0.0 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.0 | 0.1 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.0 | 0.0 | GO:0061046 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) regulation of branching involved in lung morphogenesis(GO:0061046) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.0 | 0.6 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.0 | 0.1 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.1 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
0.0 | 0.1 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.0 | 0.1 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
0.0 | 0.1 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.0 | 0.0 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.0 | 0.1 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.0 | 0.1 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.0 | 0.4 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.0 | 0.2 | GO:0060123 | regulation of growth hormone secretion(GO:0060123) positive regulation of growth hormone secretion(GO:0060124) |
0.0 | 0.1 | GO:0015817 | histidine transport(GO:0015817) |
0.0 | 0.6 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
0.0 | 0.5 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.0 | 0.3 | GO:0060997 | dendritic spine morphogenesis(GO:0060997) |
0.0 | 0.2 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.1 | GO:0002347 | response to tumor cell(GO:0002347) |
0.0 | 0.1 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.0 | 0.0 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.0 | 0.1 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.2 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.0 | 0.1 | GO:0051305 | meiotic chromosome movement towards spindle pole(GO:0016344) chromosome movement towards spindle pole(GO:0051305) |
0.0 | 0.2 | GO:0006482 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
0.0 | 0.2 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
0.0 | 0.8 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.1 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.0 | 0.2 | GO:0001675 | acrosome assembly(GO:0001675) |
0.0 | 0.1 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
0.0 | 0.0 | GO:0006563 | L-serine metabolic process(GO:0006563) |
0.0 | 0.0 | GO:0009414 | response to water deprivation(GO:0009414) |
0.0 | 0.1 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.0 | 0.0 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.0 | 0.0 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.0 | 0.9 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
0.0 | 0.1 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.1 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.0 | 0.0 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.0 | 0.0 | GO:0031506 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.0 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.1 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.0 | 0.1 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.0 | 0.1 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.0 | 0.1 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
0.0 | 0.0 | GO:0046070 | dGTP metabolic process(GO:0046070) |
0.0 | 0.0 | GO:0002438 | acute inflammatory response to antigenic stimulus(GO:0002438) |
0.0 | 0.0 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.0 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
0.0 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.0 | GO:1902896 | terminal web assembly(GO:1902896) |
0.0 | 0.1 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.0 | 0.3 | GO:0014003 | oligodendrocyte development(GO:0014003) |
0.0 | 0.2 | GO:0006568 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
0.0 | 0.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.0 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.0 | 0.1 | GO:0051458 | corticotropin secretion(GO:0051458) regulation of corticotropin secretion(GO:0051459) |
0.0 | 0.2 | GO:0032648 | regulation of interferon-beta production(GO:0032648) |
0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.1 | GO:0019359 | NAD biosynthetic process(GO:0009435) nicotinamide nucleotide biosynthetic process(GO:0019359) |
0.0 | 0.1 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.0 | 0.0 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.0 | 0.0 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.0 | GO:0002220 | innate immune response activating cell surface receptor signaling pathway(GO:0002220) |
0.0 | 0.2 | GO:0031297 | replication fork processing(GO:0031297) |
0.0 | 0.0 | GO:0044794 | positive regulation by host of viral process(GO:0044794) |
0.0 | 0.1 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.0 | 2.7 | GO:0000377 | RNA splicing, via transesterification reactions with bulged adenosine as nucleophile(GO:0000377) mRNA splicing, via spliceosome(GO:0000398) |
0.0 | 0.1 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
0.0 | 0.1 | GO:0051788 | response to misfolded protein(GO:0051788) |
0.0 | 0.1 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.1 | GO:0032048 | cardiolipin metabolic process(GO:0032048) |
0.0 | 0.0 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.0 | 0.0 | GO:0031296 | B cell costimulation(GO:0031296) |
0.0 | 0.1 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
0.0 | 0.1 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.1 | GO:0097240 | telomere tethering at nuclear periphery(GO:0034398) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.3 | GO:0002437 | inflammatory response to antigenic stimulus(GO:0002437) |
0.0 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
0.0 | 0.6 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.0 | 0.0 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.0 | GO:0046135 | pyrimidine nucleoside catabolic process(GO:0046135) |
0.0 | 0.0 | GO:0090381 | regulation of heart induction by regulation of canonical Wnt signaling pathway(GO:0090081) regulation of heart induction(GO:0090381) regulation of heart induction by canonical Wnt signaling pathway(GO:0100012) positive regulation of heart induction(GO:1901321) |
0.0 | 0.2 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.0 | 0.0 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.1 | GO:0051573 | negative regulation of histone H3-K9 methylation(GO:0051573) |
0.0 | 0.0 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.0 | 0.1 | GO:0009838 | abscission(GO:0009838) |
0.0 | 0.1 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.0 | 0.2 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.3 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.3 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.0 | GO:0048478 | replication fork protection(GO:0048478) |
0.0 | 0.0 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.0 | 0.1 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.0 | 0.1 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.0 | 0.3 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
0.0 | 0.1 | GO:0006826 | iron ion transport(GO:0006826) |
0.0 | 0.0 | GO:0030421 | defecation(GO:0030421) |
0.0 | 0.1 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 0.2 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.0 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) |
0.0 | 0.0 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.0 | 0.1 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
0.0 | 0.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.0 | 0.0 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 0.0 | GO:1900271 | regulation of long-term synaptic potentiation(GO:1900271) |
0.0 | 0.0 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.0 | 0.1 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.0 | 0.1 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.2 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
0.0 | 0.0 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.0 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.0 | 0.0 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.0 | 0.0 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.0 | 0.1 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.0 | 0.1 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.3 | GO:0071539 | protein localization to centrosome(GO:0071539) |
0.0 | 0.0 | GO:0019042 | viral latency(GO:0019042) |
0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.0 | 0.0 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
0.0 | 0.1 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.0 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.0 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.1 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.0 | 0.1 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.0 | GO:0051503 | purine nucleotide transport(GO:0015865) adenine nucleotide transport(GO:0051503) |
0.0 | 0.0 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.0 | 0.2 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 0.0 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
0.0 | 0.0 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.0 | 0.0 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.0 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.1 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.0 | 0.0 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
0.0 | 0.3 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.0 | 0.0 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.0 | 0.0 | GO:0046929 | negative regulation of neurotransmitter secretion(GO:0046929) |
0.0 | 0.1 | GO:0009648 | photoperiodism(GO:0009648) entrainment of circadian clock by photoperiod(GO:0043153) |
0.0 | 0.6 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.0 | 0.3 | GO:0035058 | nonmotile primary cilium assembly(GO:0035058) |
0.0 | 0.1 | GO:2000637 | positive regulation of gene silencing by miRNA(GO:2000637) |
0.0 | 0.0 | GO:1904738 | vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
0.0 | 0.3 | GO:0070527 | platelet aggregation(GO:0070527) |
0.0 | 0.1 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.0 | 0.0 | GO:0050819 | negative regulation of coagulation(GO:0050819) |
0.0 | 0.0 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.0 | 0.2 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 0.1 | GO:0032392 | DNA geometric change(GO:0032392) |
0.0 | 0.0 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.0 | 0.0 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
0.0 | 0.1 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.0 | 0.1 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
0.0 | 0.0 | GO:0021569 | rhombomere 3 development(GO:0021569) |
0.0 | 0.2 | GO:0048525 | negative regulation of viral process(GO:0048525) |
0.0 | 0.1 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.2 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.0 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
0.0 | 0.2 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.0 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.0 | 0.2 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
0.0 | 0.1 | GO:2000505 | regulation of energy homeostasis(GO:2000505) |
0.0 | 0.0 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.0 | 0.1 | GO:0090382 | phagosome maturation(GO:0090382) |
0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.1 | GO:0002251 | organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
0.0 | 0.0 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.0 | GO:2000851 | positive regulation of glucocorticoid secretion(GO:2000851) |
0.0 | 0.0 | GO:0048290 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.0 | 0.1 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.0 | 0.0 | GO:0046794 | transport of virus(GO:0046794) |
0.0 | 0.3 | GO:0046847 | filopodium assembly(GO:0046847) |
0.0 | 0.0 | GO:0033753 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
0.0 | 0.1 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.0 | 0.0 | GO:0009992 | cellular water homeostasis(GO:0009992) |
0.0 | 0.0 | GO:0002760 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
0.0 | 0.1 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.1 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
0.0 | 0.1 | GO:0052803 | imidazole-containing compound metabolic process(GO:0052803) |
0.0 | 0.0 | GO:0009134 | nucleoside diphosphate catabolic process(GO:0009134) |
0.0 | 0.1 | GO:0060074 | synapse maturation(GO:0060074) |
0.0 | 0.0 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.0 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.0 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.0 | 0.0 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
0.0 | 0.2 | GO:0019915 | lipid storage(GO:0019915) |
0.0 | 0.0 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.0 | 0.1 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
0.0 | 0.0 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.0 | 0.0 | GO:0033085 | negative regulation of T cell differentiation in thymus(GO:0033085) |
0.0 | 0.0 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.1 | GO:0080111 | DNA demethylation(GO:0080111) |
0.0 | 0.3 | GO:0071482 | cellular response to light stimulus(GO:0071482) |
0.0 | 0.1 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
0.0 | 0.0 | GO:0019243 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.0 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.0 | 0.0 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
0.0 | 0.0 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.0 | 0.1 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
0.0 | 0.0 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.0 | 0.3 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 0.4 | GO:0072376 | protein activation cascade(GO:0072376) |
0.0 | 0.0 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.0 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
0.0 | 0.1 | GO:0008216 | spermidine metabolic process(GO:0008216) |
0.0 | 0.0 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.0 | 0.2 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.0 | 0.1 | GO:0032332 | positive regulation of chondrocyte differentiation(GO:0032332) |
0.0 | 0.0 | GO:0042891 | antibiotic transport(GO:0042891) |
0.0 | 0.6 | GO:1903749 | positive regulation of establishment of protein localization to mitochondrion(GO:1903749) positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.0 | 0.0 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.0 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.0 | 0.1 | GO:0000338 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.0 | 0.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.0 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
0.0 | 0.0 | GO:0042738 | exogenous drug catabolic process(GO:0042738) |
0.0 | 0.0 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.1 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.0 | GO:0060850 | regulation of transcription involved in cell fate commitment(GO:0060850) |
0.0 | 0.1 | GO:0061045 | negative regulation of wound healing(GO:0061045) |
0.0 | 0.0 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
0.0 | 0.1 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.0 | 0.0 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.0 | 0.0 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.0 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.0 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
0.0 | 0.0 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.0 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.0 | 0.1 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
0.0 | 0.0 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.0 | 0.1 | GO:0015804 | neutral amino acid transport(GO:0015804) |
0.0 | 0.0 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
0.0 | 0.0 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.0 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.0 | 0.0 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.0 | 0.0 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.0 | 0.0 | GO:0006415 | translational termination(GO:0006415) |
0.0 | 0.1 | GO:0051198 | negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
0.0 | 0.1 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.0 | 0.0 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.0 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.0 | 0.0 | GO:0006265 | DNA topological change(GO:0006265) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 5.6 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.6 | 4.0 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.5 | 1.4 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.4 | 2.1 | GO:0005579 | membrane attack complex(GO:0005579) |
0.4 | 1.2 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.4 | 1.6 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.3 | 1.3 | GO:1990130 | Iml1 complex(GO:1990130) |
0.3 | 1.4 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.3 | 2.4 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.2 | 2.6 | GO:0031143 | pseudopodium(GO:0031143) |
0.2 | 0.7 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.2 | 0.4 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.2 | 0.6 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.2 | 0.6 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.2 | 0.8 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.2 | 1.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.2 | 0.9 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.2 | 17.5 | GO:0072562 | blood microparticle(GO:0072562) |
0.2 | 0.7 | GO:0005642 | annulate lamellae(GO:0005642) |
0.2 | 0.9 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.2 | 0.5 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.2 | 0.8 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.2 | 0.6 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.2 | 0.5 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.4 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.1 | 0.8 | GO:0031983 | vesicle lumen(GO:0031983) |
0.1 | 0.4 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.7 | GO:0098553 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.1 | 0.7 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 0.9 | GO:0000243 | commitment complex(GO:0000243) |
0.1 | 1.1 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.1 | 0.4 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 0.4 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.7 | GO:0042629 | mast cell granule(GO:0042629) |
0.1 | 0.2 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.1 | 1.7 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.1 | 0.3 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.1 | 0.5 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.1 | 0.6 | GO:0001739 | sex chromatin(GO:0001739) |
0.1 | 0.3 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 0.8 | GO:0035859 | Seh1-associated complex(GO:0035859) |
0.1 | 0.5 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.1 | 1.0 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.8 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 0.3 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.1 | 0.5 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.1 | 0.3 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.1 | 0.7 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.1 | 3.8 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.1 | 0.3 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.1 | 0.8 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.1 | 0.6 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.5 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.1 | 0.4 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.2 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.1 | 0.5 | GO:0005775 | vacuolar lumen(GO:0005775) |
0.1 | 0.3 | GO:0035339 | SPOTS complex(GO:0035339) |
0.1 | 0.3 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.4 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 0.3 | GO:0035061 | interchromatin granule(GO:0035061) |
0.1 | 0.4 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.1 | 0.9 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.1 | 0.3 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.1 | 3.1 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 3.0 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.1 | 1.2 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.1 | 0.6 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 0.3 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.1 | 0.2 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 0.7 | GO:0042555 | MCM complex(GO:0042555) |
0.1 | 0.4 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 0.1 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.1 | 0.7 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.1 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
0.1 | 0.4 | GO:0071986 | Ragulator complex(GO:0071986) |
0.1 | 3.3 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
0.1 | 0.2 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 0.6 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 0.3 | GO:0097422 | tubular endosome(GO:0097422) |
0.1 | 0.6 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.1 | 0.4 | GO:0031931 | TORC1 complex(GO:0031931) |
0.1 | 0.3 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.1 | 0.1 | GO:0005767 | secondary lysosome(GO:0005767) |
0.1 | 0.3 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 0.2 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.1 | 0.2 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 1.4 | GO:0030894 | replisome(GO:0030894) |
0.1 | 0.5 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.1 | 0.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 3.0 | GO:0031985 | Golgi cisterna(GO:0031985) |
0.1 | 0.6 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 0.3 | GO:0000235 | astral microtubule(GO:0000235) |
0.1 | 0.2 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 0.4 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 0.2 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.2 | GO:1990923 | PET complex(GO:1990923) |
0.1 | 0.9 | GO:0030904 | retromer complex(GO:0030904) |
0.1 | 0.5 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 0.3 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.1 | 0.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.1 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.1 | 0.3 | GO:0000796 | condensin complex(GO:0000796) |
0.1 | 0.3 | GO:0044194 | cytolytic granule(GO:0044194) |
0.1 | 0.9 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 8.0 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.1 | 0.4 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.1 | 0.7 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.1 | 4.3 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.1 | 0.8 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.1 | 0.7 | GO:0042581 | specific granule(GO:0042581) |
0.1 | 0.9 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.1 | 0.5 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.4 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
0.1 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.5 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.1 | 0.4 | GO:0005688 | U6 snRNP(GO:0005688) |
0.1 | 3.0 | GO:0000502 | proteasome complex(GO:0000502) |
0.1 | 1.0 | GO:0005771 | multivesicular body(GO:0005771) |
0.1 | 0.2 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.1 | 0.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.1 | 0.6 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.1 | 0.1 | GO:0042827 | platelet dense granule(GO:0042827) |
0.1 | 0.7 | GO:0005795 | Golgi stack(GO:0005795) |
0.0 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.5 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.2 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.0 | 0.4 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 1.4 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.0 | 0.0 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.0 | 0.3 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.4 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 1.5 | GO:0060170 | ciliary membrane(GO:0060170) |
0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.4 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.2 | GO:0001940 | male pronucleus(GO:0001940) |
0.0 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.1 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.2 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.0 | 1.1 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.0 | 0.3 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 1.6 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.0 | 0.3 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 1.4 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.2 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 0.3 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 0.4 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.6 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.0 | 0.8 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.2 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.8 | GO:0005776 | autophagosome(GO:0005776) |
0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.1 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.0 | 0.2 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.3 | GO:0008278 | cohesin complex(GO:0008278) |
0.0 | 0.3 | GO:0071010 | prespliceosome(GO:0071010) |
0.0 | 0.4 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 2.3 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.2 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 2.0 | GO:0005902 | microvillus(GO:0005902) |
0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.0 | 0.1 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.0 | 0.6 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.0 | 0.1 | GO:0031429 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
0.0 | 0.4 | GO:0043186 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
0.0 | 0.3 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.2 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.6 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.1 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.0 | 1.2 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.1 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.0 | 0.0 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.2 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.2 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 0.4 | GO:0042588 | zymogen granule(GO:0042588) |
0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 1.1 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 1.9 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.0 | GO:0098573 | intrinsic component of mitochondrial membrane(GO:0098573) |
0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
0.0 | 0.1 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.0 | 0.1 | GO:0043596 | nuclear replication fork(GO:0043596) |
0.0 | 0.3 | GO:0043073 | male germ cell nucleus(GO:0001673) germ cell nucleus(GO:0043073) |
0.0 | 0.3 | GO:0097546 | ciliary base(GO:0097546) |
0.0 | 0.2 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.1 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 0.0 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.3 | GO:1990391 | DNA repair complex(GO:1990391) |
0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.1 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.0 | 1.5 | GO:0022626 | cytosolic ribosome(GO:0022626) |
0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.0 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.6 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.2 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.0 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.1 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.0 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.9 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.2 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.2 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.1 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.1 | GO:0038201 | TOR complex(GO:0038201) |
0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.0 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
0.0 | 0.1 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 0.1 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.1 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.2 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.3 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.0 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.1 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.0 | 0.1 | GO:0051286 | cell tip(GO:0051286) |
0.0 | 0.0 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.0 | 0.0 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.0 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.2 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.2 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.4 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.0 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.2 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.0 | 0.2 | GO:0033202 | DNA helicase complex(GO:0033202) |
0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.1 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.0 | 0.1 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.0 | 0.3 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.3 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.5 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.0 | GO:1990423 | RZZ complex(GO:1990423) |
0.0 | 0.1 | GO:0045120 | pronucleus(GO:0045120) |
0.0 | 0.0 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.1 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.4 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.1 | GO:0035102 | PRC1 complex(GO:0035102) |
0.0 | 0.0 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.0 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.0 | 0.7 | GO:0000922 | spindle pole(GO:0000922) |
0.0 | 0.1 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.0 | 1.3 | GO:0000139 | Golgi membrane(GO:0000139) |
0.0 | 0.2 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.4 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.0 | 0.0 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.0 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.1 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.0 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.5 | GO:0005643 | nuclear pore(GO:0005643) |
0.0 | 0.0 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.1 | GO:0000803 | sex chromosome(GO:0000803) |
0.0 | 0.0 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.0 | 0.0 | GO:0035189 | Rb-E2F complex(GO:0035189) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.4 | 5.6 | GO:0031720 | haptoglobin binding(GO:0031720) |
1.3 | 3.8 | GO:0019862 | IgA binding(GO:0019862) |
0.9 | 2.7 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.8 | 2.3 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.7 | 2.0 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.7 | 2.0 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.5 | 1.9 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.5 | 1.4 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.4 | 6.7 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.4 | 1.3 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.4 | 1.3 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.4 | 2.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.4 | 1.6 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.4 | 1.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.3 | 2.3 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.3 | 2.9 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.3 | 1.1 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.3 | 0.8 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.3 | 0.3 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.3 | 1.8 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.3 | 2.0 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.2 | 0.7 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.2 | 2.6 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.2 | 1.3 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.2 | 3.2 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.2 | 1.5 | GO:0003680 | AT DNA binding(GO:0003680) |
0.2 | 0.8 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.2 | 0.6 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.2 | 0.8 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.2 | 0.8 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.2 | 0.6 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.2 | 1.4 | GO:0003896 | DNA primase activity(GO:0003896) |
0.2 | 0.8 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.2 | 1.4 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.2 | 0.6 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.2 | 0.2 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
0.2 | 1.3 | GO:0019864 | IgG binding(GO:0019864) |
0.2 | 1.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.2 | 0.5 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.2 | 0.5 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
0.2 | 0.7 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.2 | 1.0 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.2 | 0.5 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.2 | 0.5 | GO:0004064 | arylesterase activity(GO:0004064) |
0.2 | 0.2 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.2 | 1.6 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.2 | 1.1 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.2 | 2.5 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.2 | 0.5 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.2 | 0.5 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 2.2 | GO:0005521 | lamin binding(GO:0005521) |
0.1 | 0.9 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 0.6 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.1 | 0.4 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 0.5 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 0.4 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.1 | 0.3 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.1 | 0.7 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.1 | 0.4 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.1 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.1 | 0.8 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.1 | 0.1 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.1 | 0.4 | GO:0055100 | adiponectin binding(GO:0055100) |
0.1 | 0.4 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.1 | 1.6 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 1.0 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.4 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 1.0 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.1 | 0.6 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 1.1 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.1 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.1 | 0.4 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.1 | 0.4 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.6 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 0.6 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.1 | 0.4 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.1 | 0.5 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.1 | 1.2 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.1 | 0.6 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 0.3 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.1 | 0.7 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.1 | 1.1 | GO:0015254 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
0.1 | 0.3 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 1.1 | GO:0004568 | chitinase activity(GO:0004568) |
0.1 | 0.1 | GO:0016749 | N-succinyltransferase activity(GO:0016749) |
0.1 | 0.4 | GO:0030984 | kininogen binding(GO:0030984) |
0.1 | 0.2 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 0.7 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.4 | GO:0034618 | arginine binding(GO:0034618) |
0.1 | 0.4 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.1 | 3.3 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.1 | 0.3 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 0.2 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 0.3 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.1 | 0.6 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.1 | 0.3 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.1 | 0.8 | GO:0050544 | arachidonic acid binding(GO:0050544) |
0.1 | 0.6 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.1 | 0.5 | GO:0005534 | galactose binding(GO:0005534) |
0.1 | 1.3 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.1 | 0.4 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
0.1 | 0.9 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.6 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.1 | 0.3 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.1 | 0.4 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.1 | 0.2 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.1 | 0.3 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.1 | 0.2 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.1 | 0.4 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.1 | 2.0 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 0.4 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.6 | GO:0008494 | translation activator activity(GO:0008494) |
0.1 | 2.6 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.1 | 0.4 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.1 | 0.3 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.1 | 0.8 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.1 | 2.2 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.1 | 0.8 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.1 | 0.3 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.1 | 0.3 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.1 | 0.3 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.1 | 0.3 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.1 | 0.3 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.1 | 0.9 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
0.1 | 0.2 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.1 | 0.2 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.1 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.1 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.1 | 0.3 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.1 | 1.0 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.1 | 0.5 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.1 | 0.2 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.1 | 0.8 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.1 | 0.5 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.1 | 0.2 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.1 | 1.6 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.1 | 0.9 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.3 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 0.5 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 0.3 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.1 | 0.8 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.1 | 0.4 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 0.4 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 0.2 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.1 | 0.4 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.1 | 0.3 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.1 | 0.2 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.1 | 0.9 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.1 | 0.4 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 1.1 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.1 | 0.8 | GO:0004787 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
0.1 | 0.8 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.6 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.1 | 1.0 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.1 | 0.8 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.1 | 0.2 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
0.1 | 0.3 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.1 | 1.2 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.1 | 1.2 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.1 | 0.2 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.1 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.4 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.1 | 0.6 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.1 | 0.8 | GO:0019841 | retinol binding(GO:0019841) |
0.1 | 0.7 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.1 | 0.3 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.1 | 0.3 | GO:0042731 | PH domain binding(GO:0042731) |
0.1 | 0.3 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.1 | 0.3 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.1 | 0.3 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.1 | 0.5 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.1 | 0.2 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.1 | 0.3 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.1 | 0.3 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.1 | 0.9 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.7 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.1 | 0.3 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.1 | 0.2 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.1 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.1 | 0.6 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.1 | 0.7 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.1 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.1 | 0.2 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.1 | 0.2 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.1 | 0.2 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.1 | 0.6 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 0.2 | GO:0019961 | interferon binding(GO:0019961) |
0.1 | 0.2 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.1 | 0.4 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.1 | 1.6 | GO:0030507 | spectrin binding(GO:0030507) |
0.1 | 0.6 | GO:0010181 | FMN binding(GO:0010181) |
0.1 | 0.3 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.1 | 0.4 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 0.2 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.1 | 0.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.1 | 0.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.2 | GO:0005372 | water transmembrane transporter activity(GO:0005372) |
0.1 | 1.7 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.1 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.1 | 0.2 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.1 | 0.3 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.4 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.1 | 0.1 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.1 | 0.2 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.1 | 0.6 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.1 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.1 | 0.3 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 1.3 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
0.1 | 0.1 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 0.2 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.3 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 0.3 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 0.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 0.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.1 | 0.3 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 1.1 | GO:0005537 | mannose binding(GO:0005537) |
0.1 | 0.6 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.1 | 0.2 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.1 | 0.4 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.3 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 0.1 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.1 | 0.9 | GO:0031489 | myosin V binding(GO:0031489) |
0.1 | 0.5 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.1 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
0.1 | 0.5 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.1 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.0 | 4.8 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.2 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.1 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.0 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 3.3 | GO:0004896 | cytokine receptor activity(GO:0004896) |
0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 1.1 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.1 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.0 | 0.0 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.1 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 0.3 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.0 | 0.1 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 1.0 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.0 | GO:0030580 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
0.0 | 0.2 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
0.0 | 0.0 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.0 | 0.4 | GO:0048156 | tau protein binding(GO:0048156) |
0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.4 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
0.0 | 0.2 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.0 | 0.4 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.0 | 0.4 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.5 | GO:0005123 | death receptor binding(GO:0005123) |
0.0 | 0.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.2 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.0 | 0.2 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.0 | 0.1 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.2 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.0 | 0.0 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
0.0 | 0.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.9 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.2 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 0.5 | GO:0015248 | sterol transporter activity(GO:0015248) |
0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 1.3 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.0 | 0.1 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.0 | 0.1 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.0 | 0.2 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.0 | 0.3 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.0 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
0.0 | 0.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.0 | 0.2 | GO:0050693 | LBD domain binding(GO:0050693) |
0.0 | 0.2 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.0 | 0.2 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 2.2 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.9 | GO:0003678 | DNA helicase activity(GO:0003678) |
0.0 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.0 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.0 | 0.6 | GO:0008375 | acetylglucosaminyltransferase activity(GO:0008375) |
0.0 | 0.5 | GO:0017069 | snRNA binding(GO:0017069) |
0.0 | 0.5 | GO:0015925 | galactosidase activity(GO:0015925) |
0.0 | 0.2 | GO:0035173 | histone kinase activity(GO:0035173) |
0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.2 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.0 | 0.0 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.0 | 0.2 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.0 | 0.1 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.1 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.0 | 0.5 | GO:0008759 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
0.0 | 0.8 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.0 | 0.2 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.0 | 5.8 | GO:0004866 | endopeptidase inhibitor activity(GO:0004866) |
0.0 | 0.5 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.8 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.0 | GO:1901567 | icosanoid binding(GO:0050542) fatty acid derivative binding(GO:1901567) |
0.0 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.0 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.2 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 2.6 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
0.0 | 0.0 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.1 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.0 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.0 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) |
0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.0 | 0.2 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.0 | 0.0 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.0 | 1.0 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.0 | 0.1 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 0.5 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
0.0 | 0.5 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.0 | 0.0 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.0 | 1.0 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.0 | 0.0 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.0 | 0.0 | GO:0005416 | sodium:amino acid symporter activity(GO:0005283) cation:amino acid symporter activity(GO:0005416) |
0.0 | 0.1 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.0 | 0.8 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.1 | GO:0000828 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.0 | 0.2 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.2 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 6.0 | GO:0017171 | serine hydrolase activity(GO:0017171) |
0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.1 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.0 | 1.8 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
0.0 | 0.1 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.0 | 0.1 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.0 | 0.2 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.0 | 0.7 | GO:0030331 | estrogen receptor binding(GO:0030331) |
0.0 | 0.4 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.4 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
0.0 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
0.0 | 0.0 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.0 | 0.3 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.0 | 0.1 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.0 | 0.1 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.0 | 0.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.2 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.0 | 0.1 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.0 | 0.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.0 | 0.6 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.2 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.1 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.6 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.0 | 0.1 | GO:0019863 | IgE binding(GO:0019863) |
0.0 | 0.2 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
0.0 | 0.2 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.1 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.1 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.0 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.0 | 0.1 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.0 | 0.8 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.0 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.0 | 0.2 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
0.0 | 0.0 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.2 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.1 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.0 | 0.2 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.0 | 0.0 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.0 | 0.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.4 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.6 | GO:0008748 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
0.0 | 0.1 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.0 | 0.2 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.0 | 0.1 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.0 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.2 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.1 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 1.1 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.1 | GO:0031078 | NAD-dependent histone deacetylase activity(GO:0017136) histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) NAD-dependent protein deacetylase activity(GO:0034979) |
0.0 | 1.2 | GO:0051087 | chaperone binding(GO:0051087) |
0.0 | 0.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 0.3 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.0 | 0.1 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.3 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.0 | 0.0 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.0 | 0.8 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.4 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.0 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.0 | 0.2 | GO:0034817 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.0 | 0.0 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.9 | GO:0016651 | oxidoreductase activity, acting on NAD(P)H(GO:0016651) |
0.0 | 0.5 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.1 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.3 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.0 | 1.5 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.0 | 0.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.2 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.1 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.3 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.0 | 0.7 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
0.0 | 0.1 | GO:0052794 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.0 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.0 | 0.1 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.0 | 0.0 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.5 | GO:0032813 | tumor necrosis factor receptor binding(GO:0005164) tumor necrosis factor receptor superfamily binding(GO:0032813) |
0.0 | 0.0 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.0 | 0.5 | GO:0048365 | Rac GTPase binding(GO:0048365) |
0.0 | 0.0 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.0 | 0.0 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.0 | GO:0015928 | fucosidase activity(GO:0015928) |
0.0 | 0.2 | GO:0015266 | protein channel activity(GO:0015266) |
0.0 | 0.0 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.0 | 0.1 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.0 | 0.1 | GO:0102344 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.0 | 0.3 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
0.0 | 0.4 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.0 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.0 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.0 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.0 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.0 | 0.0 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.0 | 0.1 | GO:0035242 | histone-arginine N-methyltransferase activity(GO:0008469) protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.0 | 0.5 | GO:0019843 | rRNA binding(GO:0019843) |
0.0 | 0.1 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.1 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.1 | GO:0042300 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.3 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.1 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 2.1 | GO:0003729 | mRNA binding(GO:0003729) |
0.0 | 0.1 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 0.2 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
0.0 | 0.0 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 0.0 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
0.0 | 0.1 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.1 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.0 | 0.1 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.0 | 0.1 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.2 | GO:0030275 | LRR domain binding(GO:0030275) |
0.0 | 0.3 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.0 | 0.0 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.0 | 0.0 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.0 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 1.0 | GO:0030674 | protein binding, bridging(GO:0030674) |
0.0 | 0.2 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.0 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.0 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.0 | 0.0 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.0 | 0.1 | GO:0001848 | complement binding(GO:0001848) |
0.0 | 0.1 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.0 | 0.1 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.0 | 0.0 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.0 | 0.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.0 | 0.0 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.6 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 0.1 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
0.0 | 0.0 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 0.0 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.3 | GO:0005507 | copper ion binding(GO:0005507) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.0 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.0 | 0.0 | GO:0046977 | TAP binding(GO:0046977) |
0.0 | 0.0 | GO:0015295 | solute:proton symporter activity(GO:0015295) |
0.0 | 0.2 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.3 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.0 | GO:0034061 | DNA polymerase activity(GO:0034061) |
0.0 | 0.7 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
0.0 | 0.2 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.0 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 0.0 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.1 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.0 | 0.6 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.5 | GO:0008527 | taste receptor activity(GO:0008527) |
0.0 | 0.0 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.0 | 0.0 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.0 | 0.2 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.3 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 0.1 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.0 | GO:0031404 | chloride ion binding(GO:0031404) |
0.0 | 0.0 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.0 | 0.5 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.0 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.0 | 0.0 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.0 | 0.0 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.3 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
0.0 | 0.3 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
0.0 | 0.0 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.0 | 0.0 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.0 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.0 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 4.4 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.2 | 5.9 | PID ARF6 PATHWAY | Arf6 signaling events |
0.2 | 4.6 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.2 | 0.2 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.2 | 1.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 5.9 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 0.1 | PID IGF1 PATHWAY | IGF1 pathway |
0.1 | 2.3 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.1 | 0.9 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.1 | 1.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 2.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.1 | 1.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.1 | 0.5 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.1 | 0.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.1 | 3.7 | PID CDC42 PATHWAY | CDC42 signaling events |
0.1 | 2.6 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.1 | 3.3 | PID BCR 5PATHWAY | BCR signaling pathway |
0.1 | 0.5 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 1.6 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.1 | 1.2 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.1 | 0.3 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.1 | 1.5 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.1 | 0.5 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.1 | 1.5 | PID AURORA A PATHWAY | Aurora A signaling |
0.1 | 1.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 0.4 | PID EPO PATHWAY | EPO signaling pathway |
0.1 | 0.6 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 1.1 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.1 | 0.5 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.1 | 1.5 | PID AURORA B PATHWAY | Aurora B signaling |
0.1 | 0.7 | PID ARF 3PATHWAY | Arf1 pathway |
0.1 | 0.8 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.0 | 0.8 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 1.5 | PID PLK1 PATHWAY | PLK1 signaling events |
0.0 | 0.2 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.3 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 2.8 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 1.2 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.2 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 1.9 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 0.7 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.5 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.4 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.0 | 0.7 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.2 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.4 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 1.8 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.6 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.7 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.2 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 0.2 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 1.4 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.6 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 1.0 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.6 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.9 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.2 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.0 | 0.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.8 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.0 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 5.7 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 1.2 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.0 | 0.3 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.0 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.2 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.1 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.2 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.1 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 0.2 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.2 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 0.0 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.2 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 0.9 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.2 | PID RHOA PATHWAY | RhoA signaling pathway |
0.0 | 0.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 5.9 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.3 | 6.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.3 | 2.8 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.3 | 1.8 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.2 | 1.2 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.2 | 3.6 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.2 | 0.2 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.2 | 1.8 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.2 | 0.7 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.2 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.2 | 2.4 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.2 | 3.4 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.2 | 1.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.2 | 5.6 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.1 | 1.5 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.1 | 1.3 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.1 | 1.1 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.1 | 1.1 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.1 | 1.2 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.1 | 2.7 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.1 | 1.0 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.1 | 0.2 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.1 | 1.1 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.1 | 1.5 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 0.6 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.1 | 1.5 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.1 | 1.3 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.1 | 1.3 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.1 | 2.8 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.1 | 0.4 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 1.1 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 0.6 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.1 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 1.2 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.1 | 1.8 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.1 | 0.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.1 | 0.6 | REACTOME CD28 CO STIMULATION | Genes involved in CD28 co-stimulation |
0.1 | 1.3 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 1.1 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
0.1 | 0.9 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.1 | 0.5 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.1 | 0.2 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 0.4 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.1 | 1.1 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.1 | 0.7 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 0.9 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 0.4 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.1 | 0.4 | REACTOME E2F MEDIATED REGULATION OF DNA REPLICATION | Genes involved in E2F mediated regulation of DNA replication |
0.1 | 1.3 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 0.7 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.1 | 0.7 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.1 | 2.6 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.1 | 0.7 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 0.1 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.1 | 0.6 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.1 | 3.4 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.1 | 1.1 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.1 | 0.4 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 0.5 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.1 | 0.6 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
0.1 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 0.6 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 0.4 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.1 | 1.3 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.6 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 0.9 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.0 | 0.1 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.0 | 0.6 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.0 | 0.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 4.0 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.0 | 0.6 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.3 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.0 | 0.1 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 0.7 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.0 | 1.2 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.0 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 1.8 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 1.2 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.0 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.9 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 0.2 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 1.0 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.6 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.6 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.1 | REACTOME G1 S TRANSITION | Genes involved in G1/S Transition |
0.0 | 0.3 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 1.0 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.7 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 1.0 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 1.6 | REACTOME REGULATION OF MITOTIC CELL CYCLE | Genes involved in Regulation of mitotic cell cycle |
0.0 | 0.6 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.0 | 0.1 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.0 | 0.5 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.7 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.0 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.0 | 0.5 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 0.6 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.0 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 1.0 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 1.8 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 1.2 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.1 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.0 | 0.3 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.2 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.4 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.0 | 0.3 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 0.3 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.0 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
0.0 | 0.1 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.2 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.1 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
0.0 | 0.5 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.0 | 0.5 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.0 | 0.2 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.0 | 0.4 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.6 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.4 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.0 | 0.3 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.1 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
0.0 | 0.1 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.0 | 0.7 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.0 | 1.4 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.0 | 0.4 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 0.4 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.1 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.6 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.2 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.0 | 0.0 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.0 | 0.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.3 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.0 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.2 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 1.9 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.3 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 0.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.2 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 0.6 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.0 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.2 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
0.0 | 0.2 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.0 | 0.0 | REACTOME UNFOLDED PROTEIN RESPONSE | Genes involved in Unfolded Protein Response |
0.0 | 0.1 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
0.0 | 0.4 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.1 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.0 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.0 | 0.2 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.0 | 0.4 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.3 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.0 | 0.1 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.0 | 0.1 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.1 | REACTOME MITOTIC G1 G1 S PHASES | Genes involved in Mitotic G1-G1/S phases |
0.0 | 0.0 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.0 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.0 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.0 | 0.0 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 1.6 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.4 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.1 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.0 | 0.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.1 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.1 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.0 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
0.0 | 0.5 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.1 | REACTOME TELOMERE MAINTENANCE | Genes involved in Telomere Maintenance |