| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Nfatc2
|
ENSMUSG00000027544.10 | nuclear factor of activated T cells, cytoplasmic, calcineurin dependent 2 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr2_168600746_168602223 | Nfatc2 | 148 | 0.965326 | 0.57 | 2.4e-06 | Click! |
| chr2_168531678_168531829 | Nfatc2 | 20523 | 0.218822 | -0.39 | 2.2e-03 | Click! |
| chr2_168532294_168532489 | Nfatc2 | 19885 | 0.220452 | -0.27 | 3.5e-02 | Click! |
| chr2_168527622_168527773 | Nfatc2 | 24579 | 0.208044 | -0.26 | 4.2e-02 | Click! |
| chr2_168613798_168613949 | Nfatc2 | 12216 | 0.198721 | -0.20 | 1.2e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr1_92849002_92850443 | 8.70 |
Mir149 |
microRNA 149 |
656 |
0.43 |
| chr18_69595622_69596635 | 8.58 |
Tcf4 |
transcription factor 4 |
1946 |
0.44 |
| chr12_61523440_61524787 | 8.05 |
Lrfn5 |
leucine rich repeat and fibronectin type III domain containing 5 |
165 |
0.95 |
| chr5_88583963_88584847 | 7.81 |
Rufy3 |
RUN and FYVE domain containing 3 |
611 |
0.7 |
| chr12_95691954_95693678 | 7.45 |
Flrt2 |
fibronectin leucine rich transmembrane protein 2 |
590 |
0.73 |
| chr3_13472022_13472431 | 6.60 |
Gm2464 |
predicted gene 2464 |
397 |
0.59 |
| chr1_164454554_164455430 | 6.59 |
Atp1b1 |
ATPase, Na+/K+ transporting, beta 1 polypeptide |
1215 |
0.39 |
| chr18_40257309_40257704 | 6.36 |
Kctd16 |
potassium channel tetramerisation domain containing 16 |
483 |
0.67 |
| chr16_49615530_49616665 | 6.24 |
Ift57 |
intraflagellar transport 57 |
83136 |
0.1 |
| chr13_110397628_110399698 | 6.21 |
Plk2 |
polo like kinase 2 |
866 |
0.68 |
| chr5_117242536_117243323 | 5.97 |
Taok3 |
TAO kinase 3 |
2469 |
0.22 |
| chr5_114090407_114091746 | 5.87 |
Svop |
SV2 related protein |
291 |
0.84 |
| chr14_28508967_28511864 | 5.70 |
Wnt5a |
wingless-type MMTV integration site family, member 5A |
203 |
0.89 |
| chr5_19907724_19909563 | 5.64 |
Magi2 |
membrane associated guanylate kinase, WW and PDZ domain containing 2 |
682 |
0.82 |
| chr4_64045841_64047503 | 5.64 |
Tnc |
tenascin C |
343 |
0.9 |
| chr3_53043747_53045351 | 5.60 |
Gm42901 |
predicted gene 42901 |
2794 |
0.16 |
| chr16_75092043_75093126 | 5.57 |
Gm49676 |
predicted gene, 49676 |
54649 |
0.14 |
| chr5_52475943_52477197 | 5.56 |
Ccdc149 |
coiled-coil domain containing 149 |
5049 |
0.19 |
| chr1_25826538_25826915 | 5.55 |
Adgrb3 |
adhesion G protein-coupled receptor B3 |
34 |
0.95 |
| chrX_165326738_165328112 | 5.46 |
Glra2 |
glycine receptor, alpha 2 subunit |
32 |
0.99 |
| chr3_8509825_8511666 | 5.39 |
Stmn2 |
stathmin-like 2 |
1159 |
0.54 |
| chr1_55225274_55225752 | 5.37 |
Gm10561 |
predicted gene 10561 |
738 |
0.49 |
| chr3_94477599_94477954 | 5.11 |
Celf3 |
CUGBP, Elav-like family member 3 |
519 |
0.57 |
| chr2_74713120_74713846 | 5.11 |
Hoxd3os1 |
homeobox D3, opposite strand 1 |
957 |
0.21 |
| chr6_39874717_39875333 | 5.09 |
Tmem178b |
transmembrane protein 178B |
1954 |
0.27 |
| chr14_28506892_28507795 | 5.04 |
Wnt5a |
wingless-type MMTV integration site family, member 5A |
1443 |
0.42 |
| chr12_31711839_31712627 | 5.04 |
Gpr22 |
G protein-coupled receptor 22 |
1693 |
0.32 |
| chr8_31089411_31091663 | 5.02 |
Dusp26 |
dual specificity phosphatase 26 (putative) |
733 |
0.65 |
| chr8_12947702_12949640 | 4.96 |
Mcf2l |
mcf.2 transforming sequence-like |
718 |
0.37 |
| chr3_55782570_55784448 | 4.95 |
Nbea |
neurobeachin |
19 |
0.96 |
| chr3_26332588_26333347 | 4.93 |
Nlgn1 |
neuroligin 1 |
507 |
0.68 |
| chr8_99415302_99416849 | 4.91 |
Cdh8 |
cadherin 8 |
244 |
0.77 |
| chr14_30352297_30353029 | 4.86 |
Cacna1d |
calcium channel, voltage-dependent, L type, alpha 1D subunit |
301 |
0.89 |
| chr1_172296846_172298307 | 4.85 |
Atp1a2 |
ATPase, Na+/K+ transporting, alpha 2 polypeptide |
488 |
0.67 |
| chr18_57785762_57786717 | 4.85 |
Gm19519 |
predicted gene, 19519 |
6094 |
0.27 |
| chr6_148046801_148048056 | 4.84 |
Far2 |
fatty acyl CoA reductase 2 |
12 |
0.57 |
| chr1_42686011_42687379 | 4.83 |
Pantr1 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 1 |
6398 |
0.14 |
| chr12_119235620_119236481 | 4.81 |
Itgb8 |
integrin beta 8 |
2720 |
0.31 |
| chr2_140666876_140668088 | 4.77 |
Flrt3 |
fibronectin leucine rich transmembrane protein 3 |
3918 |
0.37 |
| chr4_82501450_82502014 | 4.77 |
Nfib |
nuclear factor I/B |
2416 |
0.3 |
| chr12_101817155_101817772 | 4.69 |
Fbln5 |
fibulin 5 |
1005 |
0.56 |
| chr4_97582473_97584218 | 4.65 |
E130114P18Rik |
RIKEN cDNA E130114P18 gene |
1251 |
0.53 |
| chr14_75962509_75963193 | 4.65 |
Kctd4 |
potassium channel tetramerisation domain containing 4 |
7842 |
0.18 |
| chr1_169746128_169746823 | 4.65 |
Rgs4 |
regulator of G-protein signaling 4 |
1148 |
0.55 |
| chr7_82335360_82336568 | 4.64 |
Adamtsl3 |
ADAMTS-like 3 |
232 |
0.93 |
| chr13_49504584_49505268 | 4.61 |
Ecm2 |
extracellular matrix protein 2, female organ and adipocyte specific |
57 |
0.97 |
| chr13_40606184_40607253 | 4.56 |
Gm47039 |
predicted gene, 47039 |
239 |
0.93 |
| chr6_85371815_85372854 | 4.53 |
Rab11fip5 |
RAB11 family interacting protein 5 (class I) |
2230 |
0.24 |
| chr3_38892303_38893788 | 4.51 |
Fat4 |
FAT atypical cadherin 4 |
2103 |
0.36 |
| chr6_107530820_107531278 | 4.49 |
Lrrn1 |
leucine rich repeat protein 1, neuronal |
1281 |
0.51 |
| chr1_76866192_76866893 | 4.48 |
Gm816 |
predicted gene 816 |
161250 |
0.04 |
| chr3_154663659_154664932 | 4.46 |
Erich3 |
glutamate rich 3 |
436 |
0.82 |
| chr2_74706316_74706960 | 4.46 |
Hoxd8 |
homeobox D8 |
1486 |
0.13 |
| chr2_178141581_178143125 | 4.44 |
Phactr3 |
phosphatase and actin regulator 3 |
420 |
0.88 |
| chr1_164455819_164456603 | 4.44 |
Atp1b1 |
ATPase, Na+/K+ transporting, beta 1 polypeptide |
1811 |
0.27 |
| chr13_72629730_72632045 | 4.43 |
Irx2 |
Iroquois homeobox 2 |
1062 |
0.51 |
| chr2_110360491_110361293 | 4.42 |
Fibin |
fin bud initiation factor homolog (zebrafish) |
2291 |
0.34 |
| chr3_126363591_126364889 | 4.41 |
Arsj |
arylsulfatase J |
556 |
0.8 |
| chr5_124184090_124186568 | 4.38 |
Pitpnm2 |
phosphatidylinositol transfer protein, membrane-associated 2 |
211 |
0.9 |
| chr18_37496992_37497992 | 4.34 |
Pcdhb19 |
protocadherin beta 19 |
501 |
0.54 |
| chr17_93201490_93204144 | 4.33 |
Adcyap1 |
adenylate cyclase activating polypeptide 1 |
741 |
0.65 |
| chr2_14873634_14875007 | 4.26 |
Cacnb2 |
calcium channel, voltage-dependent, beta 2 subunit |
101 |
0.97 |
| chr2_84648361_84648948 | 4.24 |
Ctnnd1 |
catenin (cadherin associated protein), delta 1 |
117 |
0.92 |
| chr3_84952327_84953098 | 4.23 |
Fbxw7 |
F-box and WD-40 domain protein 7 |
566 |
0.84 |
| chr5_150260534_150260992 | 4.23 |
Fry |
FRY microtubule binding protein |
996 |
0.55 |
| chr3_114030507_114031514 | 4.22 |
Col11a1 |
collagen, type XI, alpha 1 |
376 |
0.93 |
| chr3_131084785_131085629 | 4.21 |
Lef1 |
lymphoid enhancer binding factor 1 |
25264 |
0.14 |
| chr14_76419153_76419898 | 4.20 |
Tsc22d1 |
TSC22 domain family, member 1 |
697 |
0.78 |
| chr4_86055007_86055578 | 4.19 |
Adamtsl1 |
ADAMTS-like 1 |
1272 |
0.55 |
| chr4_9270926_9271667 | 4.12 |
Clvs1 |
clavesin 1 |
159 |
0.96 |
| chr7_87586513_87587584 | 4.11 |
Grm5 |
glutamate receptor, metabotropic 5 |
2650 |
0.4 |
| chr11_4948719_4949803 | 4.08 |
Nefh |
neurofilament, heavy polypeptide |
1197 |
0.38 |
| chr8_8656555_8657725 | 4.07 |
Efnb2 |
ephrin B2 |
4099 |
0.11 |
| chr8_99414293_99414856 | 4.05 |
Cdh8 |
cadherin 8 |
1745 |
0.36 |
| chr2_96319240_96319943 | 4.05 |
Lrrc4c |
leucine rich repeat containing 4C |
1375 |
0.61 |
| chr18_49543238_49543945 | 4.04 |
1700044K03Rik |
RIKEN cDNA 1700044K03 gene |
20302 |
0.23 |
| chr4_102760289_102761654 | 4.02 |
Sgip1 |
SH3-domain GRB2-like (endophilin) interacting protein 1 |
446 |
0.87 |
| chr5_150261018_150262108 | 3.95 |
Fry |
FRY microtubule binding protein |
1796 |
0.34 |
| chr9_102721179_102722320 | 3.95 |
Amotl2 |
angiomotin-like 2 |
567 |
0.65 |
| chr4_22835212_22836357 | 3.94 |
Gm24078 |
predicted gene, 24078 |
88653 |
0.09 |
| chr11_34315006_34315399 | 3.93 |
Insyn2b |
inhibitory synaptic factor family member 2B |
380 |
0.85 |
| chr4_14621039_14622190 | 3.93 |
Slc26a7 |
solute carrier family 26, member 7 |
55 |
0.99 |
| chr8_94269367_94270471 | 3.93 |
Nup93 |
nucleoporin 93 |
1313 |
0.31 |
| chr10_85389057_85389718 | 3.91 |
Btbd11 |
BTB (POZ) domain containing 11 |
2560 |
0.31 |
| chr6_93911862_93913573 | 3.91 |
Magi1 |
membrane associated guanylate kinase, WW and PDZ domain containing 1 |
213 |
0.95 |
| chr16_78930672_78931913 | 3.88 |
Chodl |
chondrolectin |
15 |
0.98 |
| chr17_75177945_75179637 | 3.87 |
Ltbp1 |
latent transforming growth factor beta binding protein 1 |
19 |
0.98 |
| chr4_100779099_100780016 | 3.86 |
Cachd1 |
cache domain containing 1 |
2882 |
0.38 |
| chr18_35214570_35215443 | 3.86 |
Lrrtm2 |
leucine rich repeat transmembrane neuronal 2 |
2 |
0.52 |
| chr8_32292517_32293013 | 3.85 |
Nrg1 |
neuregulin 1 |
148 |
0.98 |
| chr6_136873814_136874977 | 3.84 |
Mgp |
matrix Gla protein |
1386 |
0.26 |
| chr7_105425216_105426515 | 3.83 |
Cckbr |
cholecystokinin B receptor |
48 |
0.95 |
| chr11_96306504_96308444 | 3.82 |
Hoxb5os |
homeobox B5 and homeobox B6, opposite strand |
564 |
0.48 |
| chr12_46815602_46816139 | 3.82 |
Nova1 |
NOVA alternative splicing regulator 1 |
1090 |
0.54 |
| chr16_77417791_77418279 | 3.81 |
Gm38071 |
predicted gene, 38071 |
1411 |
0.28 |
| chr1_42710531_42711233 | 3.80 |
Pantr2 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 2 |
2572 |
0.21 |
| chr6_145933944_145934978 | 3.80 |
Sspn |
sarcospan |
339 |
0.86 |
| chr12_31711352_31711698 | 3.79 |
Gpr22 |
G protein-coupled receptor 22 |
2401 |
0.25 |
| chr6_92478725_92480195 | 3.79 |
Prickle2 |
prickle planar cell polarity protein 2 |
1932 |
0.44 |
| chr5_65130636_65132102 | 3.78 |
Klhl5 |
kelch-like 5 |
34 |
0.97 |
| chr1_192850833_192852651 | 3.76 |
Sertad4 |
SERTA domain containing 4 |
5 |
0.96 |
| chr14_93889405_93889684 | 3.75 |
Pcdh9 |
protocadherin 9 |
615 |
0.83 |
| chr3_136007264_136008202 | 3.75 |
Gm5281 |
predicted gene 5281 |
43955 |
0.12 |
| chr1_17727029_17728148 | 3.75 |
Gm16070 |
predicted gene 16070 |
58 |
0.89 |
| chr8_65617917_65619195 | 3.75 |
Marchf1 |
membrane associated ring-CH-type finger 1 |
31 |
0.99 |
| chr17_90087597_90088717 | 3.74 |
Nrxn1 |
neurexin I |
17 |
0.99 |
| chr12_26412078_26413343 | 3.72 |
Rnf144a |
ring finger protein 144A |
1294 |
0.35 |
| chr7_100926314_100930096 | 3.71 |
Arhgef17 |
Rho guanine nucleotide exchange factor (GEF) 17 |
3902 |
0.17 |
| chr8_94266327_94267391 | 3.71 |
Nup93 |
nucleoporin 93 |
12 |
0.96 |
| chr14_36918744_36919600 | 3.70 |
Ccser2 |
coiled-coil serine rich 2 |
161 |
0.97 |
| chr11_36675585_36676180 | 3.70 |
Tenm2 |
teneurin transmembrane protein 2 |
1863 |
0.47 |
| chr8_11309999_11311023 | 3.70 |
Col4a1 |
collagen, type IV, alpha 1 |
2178 |
0.24 |
| chr16_21209865_21210937 | 3.70 |
Ephb3 |
Eph receptor B3 |
123 |
0.96 |
| chr17_90453806_90453957 | 3.67 |
Nrxn1 |
neurexin I |
941 |
0.44 |
| chr11_57011668_57012922 | 3.64 |
Gria1 |
glutamate receptor, ionotropic, AMPA1 (alpha 1) |
339 |
0.94 |
| chr10_116470404_116471142 | 3.63 |
Kcnmb4os2 |
potassium large conductance calcium-activated channel, subfamily M, beta member 4, opposite strand 2 |
2390 |
0.2 |
| chr12_117691391_117691877 | 3.62 |
Rapgef5 |
Rap guanine nucleotide exchange factor (GEF) 5 |
2678 |
0.32 |
| chr15_85675690_85676550 | 3.60 |
Lncppara |
long noncoding RNA near Ppara |
22504 |
0.12 |
| chr18_37177671_37178142 | 3.60 |
Gm10544 |
predicted gene 10544 |
600 |
0.62 |
| chr16_77418973_77419718 | 3.59 |
9430053O09Rik |
RIKEN cDNA 9430053O09 gene |
2475 |
0.17 |
| chr2_138258513_138258664 | 3.59 |
Btbd3 |
BTB (POZ) domain containing 3 |
1918 |
0.52 |
| chr14_29718651_29719941 | 3.59 |
Cacna2d3 |
calcium channel, voltage-dependent, alpha2/delta subunit 3 |
2499 |
0.26 |
| chr8_121118797_121121438 | 3.59 |
Foxc2 |
forkhead box C2 |
3946 |
0.14 |
| chr17_48932346_48933546 | 3.58 |
Lrfn2 |
leucine rich repeat and fibronectin type III domain containing 2 |
567 |
0.85 |
| chr5_102846515_102846666 | 3.58 |
Arhgap24 |
Rho GTPase activating protein 24 |
1583 |
0.52 |
| chr13_88822801_88824341 | 3.56 |
Edil3 |
EGF-like repeats and discoidin I-like domains 3 |
1929 |
0.5 |
| chr6_13835523_13837039 | 3.56 |
Gpr85 |
G protein-coupled receptor 85 |
960 |
0.59 |
| chr12_119945587_119946924 | 3.54 |
Tmem196 |
transmembrane protein 196 |
155 |
0.95 |
| chr4_116405618_116406369 | 3.53 |
Mast2 |
microtubule associated serine/threonine kinase 2 |
7 |
0.98 |
| chr7_94042433_94043470 | 3.53 |
Gm32647 |
predicted gene, 32647 |
199 |
0.97 |
| chr13_63242151_63243167 | 3.53 |
Gm47586 |
predicted gene, 47586 |
1562 |
0.22 |
| chr10_115664370_115664984 | 3.53 |
Gm8960 |
predicted gene 8960 |
64349 |
0.11 |
| chr4_121052300_121053220 | 3.52 |
Col9a2 |
collagen, type IX, alpha 2 |
239 |
0.88 |
| chr7_75308076_75309218 | 3.51 |
1500012K07Rik |
RIKEN cDNA 1500012K07 gene |
49 |
0.78 |
| chr14_124675118_124677112 | 3.51 |
Fgf14 |
fibroblast growth factor 14 |
1012 |
0.63 |
| chr3_149518877_149520003 | 3.51 |
Gm30382 |
predicted gene, 30382 |
74139 |
0.12 |
| chr1_173389412_173390669 | 3.51 |
Cadm3 |
cell adhesion molecule 3 |
22345 |
0.14 |
| chr11_84520959_84524590 | 3.49 |
Lhx1 |
LIM homeobox protein 1 |
63 |
0.97 |
| chr8_102786084_102786854 | 3.49 |
Cdh11 |
cadherin 11 |
827 |
0.62 |
| chr14_96517868_96518996 | 3.47 |
Klhl1 |
kelch-like 1 |
670 |
0.78 |
| chr10_64088546_64089368 | 3.47 |
Lrrtm3 |
leucine rich repeat transmembrane neuronal 3 |
1290 |
0.62 |
| chr9_51766782_51767242 | 3.46 |
Arhgap20 |
Rho GTPase activating protein 20 |
1352 |
0.52 |
| chr4_82502671_82503506 | 3.46 |
Nfib |
nuclear factor I/B |
2220 |
0.31 |
| chr4_156184450_156185176 | 3.45 |
Agrn |
agrin |
1088 |
0.33 |
| chr16_72027587_72029370 | 3.45 |
Gm49667 |
predicted gene, 49667 |
149434 |
0.04 |
| chr14_108912235_108913525 | 3.45 |
Slitrk1 |
SLIT and NTRK-like family, member 1 |
1278 |
0.64 |
| chr10_39165752_39166209 | 3.45 |
Ccn6 |
cellular communication network factor 6 |
2186 |
0.23 |
| chrX_135209330_135210111 | 3.44 |
Tceal6 |
transcription elongation factor A (SII)-like 6 |
967 |
0.45 |
| chr6_55676662_55677830 | 3.43 |
Neurod6 |
neurogenic differentiation 6 |
4017 |
0.26 |
| chr3_79144294_79146166 | 3.42 |
Rapgef2 |
Rap guanine nucleotide exchange factor (GEF) 2 |
253 |
0.94 |
| chr18_37680140_37681188 | 3.40 |
Pcdhgb1 |
protocadherin gamma subfamily B, 1 |
407 |
0.52 |
| chr18_54988564_54988904 | 3.40 |
Zfp608 |
zinc finger protein 608 |
1432 |
0.35 |
| chr13_34125172_34126139 | 3.39 |
Tubb2b |
tubulin, beta 2B class IIB |
4699 |
0.12 |
| chr13_109927479_109928182 | 3.37 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
986 |
0.65 |
| chr13_44946654_44947258 | 3.35 |
Dtnbp1 |
dystrobrevin binding protein 1 |
188 |
0.96 |
| chr12_36313868_36315206 | 3.35 |
Sostdc1 |
sclerostin domain containing 1 |
398 |
0.82 |
| chr14_39471112_39471496 | 3.34 |
Nrg3 |
neuregulin 3 |
1362 |
0.61 |
| chr1_55224050_55224958 | 3.34 |
Gm10561 |
predicted gene 10561 |
1747 |
0.25 |
| chr6_22205697_22206658 | 3.33 |
Gm42573 |
predicted gene 42573 |
39757 |
0.17 |
| chr9_27791337_27792219 | 3.33 |
Opcml |
opioid binding protein/cell adhesion molecule-like |
476 |
0.89 |
| chrX_16911592_16911917 | 3.33 |
Ndp |
Norrie disease (pseudoglioma) (human) |
20 |
0.99 |
| chr8_23314997_23315222 | 3.33 |
Gm24335 |
predicted gene, 24335 |
24945 |
0.15 |
| chr2_110949491_110950578 | 3.33 |
Ano3 |
anoctamin 3 |
338 |
0.92 |
| chr13_78193022_78193812 | 3.33 |
Nr2f1 |
nuclear receptor subfamily 2, group F, member 1 |
2956 |
0.18 |
| chr1_23764777_23765091 | 3.32 |
B3gat2 |
beta-1,3-glucuronyltransferase 2 (glucuronosyltransferase S) |
2923 |
0.36 |
| chr7_89632223_89633470 | 3.31 |
Me3 |
malic enzyme 3, NADP(+)-dependent, mitochondrial |
40 |
0.79 |
| chr13_83739310_83740387 | 3.31 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
985 |
0.29 |
| chr17_49308960_49309232 | 3.31 |
Gm17830 |
predicted gene, 17830 |
3145 |
0.24 |
| chr9_110051810_110053856 | 3.31 |
Map4 |
microtubule-associated protein 4 |
781 |
0.54 |
| chr7_121393854_121394773 | 3.30 |
Gm36736 |
predicted gene, 36736 |
1212 |
0.44 |
| chr6_42644439_42645626 | 3.29 |
Tcaf2 |
TRPM8 channel-associated factor 2 |
222 |
0.91 |
| chr2_21918033_21918756 | 3.29 |
Gm24886 |
predicted gene, 24886 |
123339 |
0.06 |
| chr4_135699309_135699555 | 3.29 |
Ifnlr1 |
interferon lambda receptor 1 |
13145 |
0.13 |
| chr5_3432895_3433605 | 3.29 |
Cdk6 |
cyclin-dependent kinase 6 |
37699 |
0.12 |
| chr16_77422348_77423278 | 3.27 |
9430053O09Rik |
RIKEN cDNA 9430053O09 gene |
993 |
0.4 |
| chr2_153440322_153442352 | 3.27 |
Nol4l |
nucleolar protein 4-like |
3142 |
0.22 |
| chr3_38015645_38016389 | 3.27 |
Gm22899 |
predicted gene, 22899 |
20782 |
0.16 |
| chr15_4375207_4376518 | 3.26 |
Plcxd3 |
phosphatidylinositol-specific phospholipase C, X domain containing 3 |
358 |
0.93 |
| chr4_129226645_129228191 | 3.26 |
C77080 |
expressed sequence C77080 |
62 |
0.96 |
| chr8_11187747_11188818 | 3.25 |
Gm15418 |
predicted gene 15418 |
527 |
0.75 |
| chr1_194622071_194623282 | 3.24 |
Plxna2 |
plexin A2 |
2851 |
0.26 |
| chr2_62089120_62089485 | 3.23 |
Slc4a10 |
solute carrier family 4, sodium bicarbonate cotransporter-like, member 10 |
42657 |
0.19 |
| chr13_53308848_53310270 | 3.22 |
Ror2 |
receptor tyrosine kinase-like orphan receptor 2 |
23435 |
0.2 |
| chrX_159628838_159629399 | 3.22 |
Sh3kbp1 |
SH3-domain kinase binding protein 1 |
1577 |
0.41 |
| chr6_135362982_135365483 | 3.21 |
Emp1 |
epithelial membrane protein 1 |
1164 |
0.42 |
| chr18_40259056_40260097 | 3.21 |
Kctd16 |
potassium channel tetramerisation domain containing 16 |
773 |
0.5 |
| chr7_109010827_109011701 | 3.21 |
Tub |
tubby bipartite transcription factor |
439 |
0.81 |
| chr13_63246241_63247210 | 3.21 |
Gm47586 |
predicted gene, 47586 |
2504 |
0.15 |
| chr6_53290295_53290911 | 3.19 |
Creb5 |
cAMP responsive element binding protein 5 |
180 |
0.97 |
| chr5_81023833_81024680 | 3.19 |
Adgrl3 |
adhesion G protein-coupled receptor L3 |
2446 |
0.43 |
| chr8_64690831_64691226 | 3.18 |
Cpe |
carboxypeptidase E |
2026 |
0.3 |
| chr5_126768981_126769769 | 3.18 |
Gm33347 |
predicted gene, 33347 |
42091 |
0.14 |
| chr7_44973695_44975193 | 3.17 |
Cpt1c |
carnitine palmitoyltransferase 1c |
331 |
0.61 |
| chrX_61116034_61117613 | 3.16 |
Cdr1os |
cerebellar degeneration related antigen 1, opposite strand |
425 |
0.47 |
| chr3_114065499_114066238 | 3.15 |
Col11a1 |
collagen, type XI, alpha 1 |
5426 |
0.34 |
| chr12_27338037_27338443 | 3.13 |
Sox11 |
SRY (sex determining region Y)-box 11 |
4334 |
0.33 |
| chr2_45024242_45025237 | 3.13 |
Zeb2 |
zinc finger E-box binding homeobox 2 |
1069 |
0.47 |
| chrX_151170019_151170801 | 3.13 |
Gm15138 |
predicted gene 15138 |
710 |
0.57 |
| chr5_128596612_128597857 | 3.13 |
Gm42498 |
predicted gene 42498 |
722 |
0.6 |
| chr4_110285468_110287125 | 3.13 |
Elavl4 |
ELAV like RNA binding protein 4 |
320 |
0.94 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 6.0 | 17.9 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 4.6 | 13.9 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 4.1 | 12.4 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
| 3.9 | 3.9 | GO:0033058 | directional locomotion(GO:0033058) |
| 3.7 | 26.2 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 3.4 | 10.3 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
| 3.4 | 10.1 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 3.3 | 9.8 | GO:0021825 | cerebral cortex tangential migration using cell-axon interactions(GO:0021824) substrate-dependent cerebral cortex tangential migration(GO:0021825) gonadotrophin-releasing hormone neuronal migration to the hypothalamus(GO:0021828) hypothalamic tangential migration using cell-axon interactions(GO:0021856) facioacoustic ganglion development(GO:1903375) |
| 3.3 | 9.8 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 3.2 | 3.2 | GO:0072108 | positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) |
| 3.2 | 15.9 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
| 3.1 | 9.4 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 3.1 | 18.5 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
| 2.9 | 8.8 | GO:0072235 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
| 2.7 | 8.2 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 2.7 | 10.9 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
| 2.7 | 2.7 | GO:2000987 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 2.6 | 5.3 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
| 2.6 | 7.9 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 2.6 | 20.9 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
| 2.6 | 13.0 | GO:0031223 | auditory behavior(GO:0031223) |
| 2.5 | 7.6 | GO:0061205 | paramesonephric duct development(GO:0061205) |
| 2.5 | 5.0 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
| 2.4 | 7.2 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 2.4 | 9.6 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 2.3 | 9.3 | GO:0060174 | limb bud formation(GO:0060174) |
| 2.2 | 4.5 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
| 2.2 | 6.7 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 2.2 | 8.8 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 2.2 | 2.2 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 2.2 | 19.7 | GO:0071625 | vocalization behavior(GO:0071625) |
| 2.2 | 6.5 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 2.1 | 6.2 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 2.0 | 6.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 2.0 | 6.0 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
| 2.0 | 8.0 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
| 2.0 | 6.0 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 2.0 | 5.9 | GO:0060437 | lung growth(GO:0060437) |
| 2.0 | 5.9 | GO:0072017 | distal tubule development(GO:0072017) |
| 2.0 | 2.0 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 1.9 | 5.8 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 1.9 | 3.9 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
| 1.9 | 11.7 | GO:0021559 | trigeminal nerve development(GO:0021559) |
| 1.9 | 1.9 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 1.9 | 5.8 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 1.9 | 1.9 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
| 1.9 | 5.6 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 1.8 | 5.5 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 1.8 | 3.6 | GO:0061642 | chemoattraction of axon(GO:0061642) |
| 1.8 | 5.4 | GO:0072092 | ureteric bud invasion(GO:0072092) |
| 1.8 | 5.4 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
| 1.8 | 19.8 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 1.8 | 3.6 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 1.8 | 14.3 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 1.8 | 3.5 | GO:0001757 | somite specification(GO:0001757) |
| 1.8 | 7.1 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 1.8 | 3.5 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
| 1.7 | 5.2 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 1.7 | 5.2 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 1.7 | 5.1 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 1.7 | 8.5 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 1.7 | 8.5 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 1.7 | 3.3 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 1.6 | 1.6 | GO:0070384 | Harderian gland development(GO:0070384) |
| 1.6 | 6.5 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 1.6 | 3.2 | GO:0060166 | olfactory pit development(GO:0060166) |
| 1.6 | 6.4 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 1.6 | 4.8 | GO:0021586 | pons maturation(GO:0021586) |
| 1.6 | 98.6 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
| 1.6 | 6.3 | GO:0030035 | microspike assembly(GO:0030035) |
| 1.5 | 4.6 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
| 1.5 | 3.1 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
| 1.5 | 1.5 | GO:2000040 | regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
| 1.5 | 1.5 | GO:0051464 | positive regulation of cortisol secretion(GO:0051464) |
| 1.5 | 1.5 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 1.5 | 5.9 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 1.4 | 2.9 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 1.4 | 4.3 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 1.4 | 2.9 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 1.4 | 2.9 | GO:0060513 | prostatic bud formation(GO:0060513) |
| 1.4 | 7.2 | GO:1900086 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 1.4 | 5.7 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 1.4 | 4.2 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 1.4 | 4.2 | GO:0030070 | insulin processing(GO:0030070) |
| 1.4 | 12.6 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 1.4 | 7.0 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 1.4 | 9.8 | GO:0097264 | self proteolysis(GO:0097264) |
| 1.4 | 1.4 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
| 1.4 | 2.8 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 1.4 | 5.5 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 1.4 | 1.4 | GO:0007403 | glial cell fate determination(GO:0007403) |
| 1.4 | 4.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 1.4 | 5.4 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 1.4 | 6.8 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
| 1.4 | 27.0 | GO:0001964 | startle response(GO:0001964) |
| 1.3 | 5.4 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 1.3 | 5.4 | GO:0032811 | negative regulation of epinephrine secretion(GO:0032811) |
| 1.3 | 1.3 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
| 1.3 | 3.9 | GO:0035793 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 1.3 | 1.3 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 1.3 | 12.8 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 1.2 | 5.0 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
| 1.2 | 4.9 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 1.2 | 7.4 | GO:0035989 | tendon development(GO:0035989) |
| 1.2 | 2.4 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
| 1.2 | 3.6 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 1.2 | 1.2 | GO:0036166 | phenotypic switching(GO:0036166) |
| 1.2 | 4.9 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 1.2 | 12.1 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 1.2 | 1.2 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
| 1.2 | 3.6 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 1.2 | 6.0 | GO:0061591 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 1.2 | 2.4 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
| 1.2 | 8.3 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 1.2 | 2.4 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 1.2 | 14.0 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
| 1.2 | 1.2 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 1.1 | 9.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 1.1 | 3.4 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
| 1.1 | 4.5 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 1.1 | 2.3 | GO:0051795 | positive regulation of catagen(GO:0051795) |
| 1.1 | 5.7 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 1.1 | 3.4 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
| 1.1 | 2.3 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 1.1 | 1.1 | GO:0014060 | regulation of epinephrine secretion(GO:0014060) |
| 1.1 | 2.2 | GO:0072300 | positive regulation of metanephric glomerulus development(GO:0072300) |
| 1.1 | 4.4 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 1.1 | 1.1 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
| 1.1 | 4.4 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
| 1.1 | 5.5 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) |
| 1.1 | 2.2 | GO:0021604 | cranial nerve structural organization(GO:0021604) |
| 1.1 | 3.3 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 1.1 | 9.7 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
| 1.1 | 2.1 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
| 1.1 | 1.1 | GO:1903596 | angiotensin-mediated drinking behavior(GO:0003051) regulation of gap junction assembly(GO:1903596) |
| 1.1 | 2.1 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
| 1.0 | 2.1 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 1.0 | 23.8 | GO:0007616 | long-term memory(GO:0007616) |
| 1.0 | 3.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 1.0 | 3.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 1.0 | 4.1 | GO:0060278 | regulation of ovulation(GO:0060278) |
| 1.0 | 2.0 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
| 1.0 | 1.0 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 1.0 | 6.9 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 1.0 | 3.9 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 1.0 | 3.9 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 1.0 | 2.9 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 1.0 | 2.9 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
| 1.0 | 2.9 | GO:1990035 | calcium ion import into cell(GO:1990035) |
| 1.0 | 4.9 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
| 1.0 | 1.9 | GO:0061743 | motor learning(GO:0061743) |
| 1.0 | 4.8 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 1.0 | 7.6 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 1.0 | 9.5 | GO:0008038 | neuron recognition(GO:0008038) |
| 1.0 | 4.8 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.9 | 2.8 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.9 | 2.8 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.9 | 0.9 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.9 | 2.8 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.9 | 2.8 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.9 | 1.9 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.9 | 6.5 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.9 | 0.9 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
| 0.9 | 1.9 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.9 | 0.9 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
| 0.9 | 3.7 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.9 | 0.9 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) |
| 0.9 | 2.8 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
| 0.9 | 4.6 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
| 0.9 | 3.6 | GO:0030091 | protein repair(GO:0030091) |
| 0.9 | 1.8 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.9 | 3.6 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
| 0.9 | 3.5 | GO:0021571 | rhombomere 5 development(GO:0021571) |
| 0.9 | 1.8 | GO:0048505 | regulation of timing of cell differentiation(GO:0048505) |
| 0.9 | 1.8 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.9 | 3.5 | GO:0021542 | dentate gyrus development(GO:0021542) |
| 0.9 | 0.9 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.9 | 0.9 | GO:0061005 | cell differentiation involved in kidney development(GO:0061005) |
| 0.9 | 1.7 | GO:0032353 | negative regulation of hormone biosynthetic process(GO:0032353) |
| 0.8 | 64.6 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
| 0.8 | 2.5 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.8 | 3.4 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.8 | 1.7 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.8 | 4.2 | GO:0032344 | regulation of aldosterone metabolic process(GO:0032344) |
| 0.8 | 0.8 | GO:0071314 | cellular response to cocaine(GO:0071314) |
| 0.8 | 1.7 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.8 | 3.3 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
| 0.8 | 5.8 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.8 | 0.8 | GO:0072048 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
| 0.8 | 1.6 | GO:0030910 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.8 | 2.4 | GO:0038031 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.8 | 2.4 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
| 0.8 | 0.8 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.8 | 4.9 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
| 0.8 | 4.8 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.8 | 7.2 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
| 0.8 | 0.8 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.8 | 0.8 | GO:0060231 | mesenchymal to epithelial transition(GO:0060231) |
| 0.8 | 0.8 | GO:1900274 | regulation of phospholipase C activity(GO:1900274) |
| 0.8 | 12.5 | GO:1901381 | positive regulation of potassium ion transmembrane transport(GO:1901381) |
| 0.8 | 1.6 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
| 0.8 | 2.3 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.8 | 2.3 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.8 | 1.6 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.8 | 2.3 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.8 | 2.3 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
| 0.8 | 2.3 | GO:0021681 | cerebellar granular layer development(GO:0021681) |
| 0.8 | 0.8 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
| 0.8 | 6.9 | GO:0032330 | regulation of chondrocyte differentiation(GO:0032330) |
| 0.8 | 3.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
| 0.8 | 0.8 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
| 0.8 | 1.5 | GO:0072199 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.8 | 2.3 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.8 | 3.8 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.8 | 0.8 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.8 | 2.3 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.8 | 0.8 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.7 | 1.5 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.7 | 0.7 | GO:0033088 | negative regulation of immature T cell proliferation(GO:0033087) negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.7 | 2.9 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.7 | 2.9 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.7 | 15.3 | GO:0010107 | potassium ion import(GO:0010107) |
| 0.7 | 0.7 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.7 | 0.7 | GO:0061110 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
| 0.7 | 12.2 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.7 | 0.7 | GO:0090191 | negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
| 0.7 | 1.4 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.7 | 0.7 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.7 | 1.4 | GO:0003253 | cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
| 0.7 | 0.7 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.7 | 2.1 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.7 | 1.4 | GO:0060594 | mammary gland specification(GO:0060594) |
| 0.7 | 2.1 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.7 | 2.8 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.7 | 1.4 | GO:2000849 | glucocorticoid secretion(GO:0035933) regulation of glucocorticoid secretion(GO:2000849) |
| 0.7 | 1.4 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
| 0.7 | 11.7 | GO:0060997 | dendritic spine morphogenesis(GO:0060997) |
| 0.7 | 2.8 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.7 | 6.9 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.7 | 0.7 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.7 | 1.4 | GO:0002093 | auditory receptor cell morphogenesis(GO:0002093) |
| 0.7 | 8.2 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.7 | 0.7 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
| 0.7 | 0.7 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.7 | 4.1 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.7 | 1.4 | GO:0070948 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
| 0.7 | 1.4 | GO:0010996 | response to auditory stimulus(GO:0010996) |
| 0.7 | 2.0 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.7 | 4.0 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.7 | 2.7 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.7 | 4.0 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.7 | 0.7 | GO:0021855 | hypothalamus cell migration(GO:0021855) |
| 0.7 | 2.0 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
| 0.7 | 0.7 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.7 | 2.0 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.7 | 2.6 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.7 | 3.3 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.7 | 1.3 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
| 0.7 | 0.7 | GO:0098901 | regulation of cardiac muscle cell action potential(GO:0098901) |
| 0.7 | 2.0 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.7 | 2.0 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
| 0.7 | 5.9 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.7 | 1.3 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.7 | 3.9 | GO:0097154 | GABAergic neuron differentiation(GO:0097154) |
| 0.7 | 7.2 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.7 | 3.3 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.7 | 2.6 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.6 | 5.2 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.6 | 5.2 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.6 | 0.6 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
| 0.6 | 0.6 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.6 | 3.9 | GO:0035418 | protein localization to synapse(GO:0035418) |
| 0.6 | 2.6 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
| 0.6 | 7.7 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.6 | 2.6 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.6 | 1.3 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.6 | 2.6 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.6 | 2.5 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.6 | 1.9 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.6 | 2.5 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.6 | 5.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.6 | 1.3 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
| 0.6 | 1.3 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.6 | 4.4 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.6 | 3.2 | GO:0030432 | peristalsis(GO:0030432) |
| 0.6 | 6.3 | GO:0090103 | cochlea morphogenesis(GO:0090103) |
| 0.6 | 1.3 | GO:0007412 | axon target recognition(GO:0007412) |
| 0.6 | 11.3 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) regulation of microtubule depolymerization(GO:0031114) |
| 0.6 | 1.3 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
| 0.6 | 8.7 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.6 | 1.2 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
| 0.6 | 0.6 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.6 | 1.2 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
| 0.6 | 1.9 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
| 0.6 | 2.5 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.6 | 0.6 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.6 | 3.1 | GO:0060384 | innervation(GO:0060384) |
| 0.6 | 0.6 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
| 0.6 | 1.2 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.6 | 2.4 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.6 | 1.2 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.6 | 3.0 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.6 | 1.2 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
| 0.6 | 3.0 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.6 | 1.2 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.6 | 1.8 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.6 | 5.3 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
| 0.6 | 1.2 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.6 | 2.9 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.6 | 0.6 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
| 0.6 | 1.2 | GO:0060452 | positive regulation of cardiac muscle contraction(GO:0060452) |
| 0.6 | 8.6 | GO:0048843 | negative regulation of axon extension involved in axon guidance(GO:0048843) negative regulation of axon guidance(GO:1902668) |
| 0.6 | 1.1 | GO:0043416 | regulation of skeletal muscle tissue regeneration(GO:0043416) |
| 0.6 | 1.7 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.6 | 2.3 | GO:0048841 | regulation of axon extension involved in axon guidance(GO:0048841) regulation of axon guidance(GO:1902667) |
| 0.6 | 1.1 | GO:0071873 | response to norepinephrine(GO:0071873) |
| 0.6 | 1.1 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
| 0.6 | 4.0 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.6 | 2.3 | GO:0070831 | basement membrane assembly(GO:0070831) |
| 0.6 | 1.1 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
| 0.6 | 0.6 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
| 0.6 | 1.1 | GO:0009629 | response to gravity(GO:0009629) |
| 0.6 | 1.7 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.6 | 0.6 | GO:0042488 | positive regulation of odontogenesis of dentin-containing tooth(GO:0042488) |
| 0.6 | 5.0 | GO:0060065 | uterus development(GO:0060065) |
| 0.6 | 1.1 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
| 0.6 | 1.7 | GO:0086069 | bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 0.6 | 1.1 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
| 0.6 | 2.8 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.6 | 7.2 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.6 | 0.6 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 0.6 | 3.3 | GO:0007625 | grooming behavior(GO:0007625) |
| 0.6 | 3.3 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
| 0.5 | 1.6 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.5 | 0.5 | GO:0050975 | sensory perception of touch(GO:0050975) cellular response to temperature stimulus(GO:0071502) |
| 0.5 | 1.6 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.5 | 1.6 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.5 | 0.5 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.5 | 1.1 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
| 0.5 | 1.1 | GO:1900135 | positive regulation of renin secretion into blood stream(GO:1900135) |
| 0.5 | 2.7 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.5 | 1.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.5 | 1.6 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.5 | 1.6 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.5 | 0.5 | GO:0086015 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) SA node cell to atrial cardiac muscle cell communication(GO:0086070) |
| 0.5 | 0.5 | GO:0003257 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) |
| 0.5 | 0.5 | GO:0043134 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
| 0.5 | 2.6 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.5 | 1.0 | GO:0070305 | response to cGMP(GO:0070305) |
| 0.5 | 2.6 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.5 | 2.6 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.5 | 3.6 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.5 | 2.5 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 0.5 | 1.5 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.5 | 3.6 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.5 | 1.5 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.5 | 1.5 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.5 | 1.0 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
| 0.5 | 2.0 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.5 | 2.9 | GO:0002666 | positive regulation of T cell tolerance induction(GO:0002666) |
| 0.5 | 0.5 | GO:0033080 | immature T cell proliferation in thymus(GO:0033080) |
| 0.5 | 2.4 | GO:2001223 | negative regulation of neuron migration(GO:2001223) |
| 0.5 | 1.0 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
| 0.5 | 1.9 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.5 | 1.9 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.5 | 1.9 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.5 | 1.9 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
| 0.5 | 2.4 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.5 | 2.4 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.5 | 3.3 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.5 | 2.8 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.5 | 1.4 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.5 | 0.9 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
| 0.5 | 3.8 | GO:0035136 | forelimb morphogenesis(GO:0035136) |
| 0.5 | 3.3 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
| 0.5 | 35.3 | GO:0097485 | neuron projection guidance(GO:0097485) |
| 0.5 | 0.9 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.5 | 1.4 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.5 | 1.9 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.5 | 3.3 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.5 | 28.4 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
| 0.5 | 0.5 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.5 | 0.9 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.5 | 0.9 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.5 | 0.5 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
| 0.5 | 0.5 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.5 | 0.5 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.5 | 6.4 | GO:1901016 | regulation of potassium ion transmembrane transporter activity(GO:1901016) |
| 0.5 | 1.4 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
| 0.4 | 1.3 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
| 0.4 | 1.3 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.4 | 0.9 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.4 | 1.3 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.4 | 0.9 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) |
| 0.4 | 2.2 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.4 | 0.9 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.4 | 0.4 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.4 | 1.3 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.4 | 0.9 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.4 | 0.9 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.4 | 0.4 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.4 | 0.9 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.4 | 1.3 | GO:1904995 | negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.4 | 0.9 | GO:0002930 | trabecular meshwork development(GO:0002930) |
| 0.4 | 1.7 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.4 | 0.9 | GO:0010446 | response to alkaline pH(GO:0010446) |
| 0.4 | 0.9 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.4 | 3.4 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.4 | 1.3 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.4 | 1.3 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
| 0.4 | 0.8 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.4 | 1.3 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.4 | 1.3 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.4 | 1.3 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.4 | 0.8 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
| 0.4 | 0.4 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
| 0.4 | 1.3 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.4 | 1.7 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
| 0.4 | 0.8 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.4 | 1.2 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
| 0.4 | 2.9 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
| 0.4 | 1.2 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
| 0.4 | 0.8 | GO:0070163 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) |
| 0.4 | 1.2 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.4 | 2.1 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.4 | 4.9 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.4 | 1.6 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
| 0.4 | 0.8 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.4 | 0.4 | GO:0014056 | acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) acetylcholine secretion(GO:0061526) |
| 0.4 | 1.6 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.4 | 1.2 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.4 | 1.2 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
| 0.4 | 0.4 | GO:0021783 | preganglionic parasympathetic fiber development(GO:0021783) |
| 0.4 | 0.4 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.4 | 2.4 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.4 | 1.2 | GO:0060023 | soft palate development(GO:0060023) |
| 0.4 | 1.2 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.4 | 1.2 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
| 0.4 | 1.2 | GO:1902307 | positive regulation of sodium ion transmembrane transport(GO:1902307) |
| 0.4 | 1.2 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
| 0.4 | 0.4 | GO:0046864 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
| 0.4 | 0.4 | GO:0071415 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
| 0.4 | 6.5 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.4 | 0.4 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
| 0.4 | 1.1 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.4 | 1.1 | GO:0045906 | negative regulation of vasoconstriction(GO:0045906) |
| 0.4 | 1.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.4 | 3.0 | GO:2001258 | negative regulation of cation channel activity(GO:2001258) |
| 0.4 | 1.5 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.4 | 3.7 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.4 | 0.4 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
| 0.4 | 0.7 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.4 | 1.5 | GO:0014820 | tonic smooth muscle contraction(GO:0014820) artery smooth muscle contraction(GO:0014824) |
| 0.4 | 21.2 | GO:0071805 | potassium ion transmembrane transport(GO:0071805) |
| 0.4 | 0.7 | GO:0043084 | penile erection(GO:0043084) |
| 0.4 | 1.5 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.4 | 0.7 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.4 | 2.5 | GO:0021936 | regulation of cerebellar granule cell precursor proliferation(GO:0021936) |
| 0.4 | 8.0 | GO:0008542 | visual learning(GO:0008542) |
| 0.4 | 2.5 | GO:0021854 | hypothalamus development(GO:0021854) |
| 0.4 | 1.4 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
| 0.4 | 4.0 | GO:0051966 | regulation of synaptic transmission, glutamatergic(GO:0051966) |
| 0.4 | 0.4 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
| 0.4 | 0.4 | GO:0072143 | mesangial cell differentiation(GO:0072007) glomerular mesangial cell differentiation(GO:0072008) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) |
| 0.4 | 0.4 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
| 0.4 | 1.8 | GO:0035878 | nail development(GO:0035878) |
| 0.4 | 0.4 | GO:0086005 | ventricular cardiac muscle cell action potential(GO:0086005) |
| 0.4 | 2.1 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.4 | 2.1 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.4 | 0.7 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.3 | 2.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.3 | 0.3 | GO:0010979 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.3 | 0.3 | GO:0071436 | sodium ion export(GO:0071436) |
| 0.3 | 0.3 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.3 | 0.3 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.3 | 2.1 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.3 | 2.1 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.3 | 1.0 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.3 | 2.8 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
| 0.3 | 3.4 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
| 0.3 | 15.7 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.3 | 2.7 | GO:0021766 | hippocampus development(GO:0021766) |
| 0.3 | 0.7 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
| 0.3 | 0.7 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.3 | 4.4 | GO:0032094 | response to food(GO:0032094) |
| 0.3 | 1.7 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
| 0.3 | 1.0 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.3 | 1.0 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.3 | 1.3 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 0.3 | 1.3 | GO:0043267 | negative regulation of potassium ion transport(GO:0043267) |
| 0.3 | 3.6 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
| 0.3 | 0.7 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
| 0.3 | 0.7 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
| 0.3 | 0.3 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.3 | 1.6 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.3 | 3.3 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
| 0.3 | 0.3 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
| 0.3 | 0.3 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
| 0.3 | 9.4 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.3 | 0.3 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.3 | 0.6 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.3 | 1.0 | GO:0003383 | apical constriction(GO:0003383) |
| 0.3 | 1.9 | GO:0030815 | negative regulation of cAMP metabolic process(GO:0030815) |
| 0.3 | 1.3 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.3 | 0.6 | GO:0042220 | response to cocaine(GO:0042220) |
| 0.3 | 1.3 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.3 | 2.5 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.3 | 0.6 | GO:0060618 | nipple development(GO:0060618) |
| 0.3 | 0.9 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.3 | 0.6 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
| 0.3 | 5.3 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.3 | 1.9 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.3 | 0.9 | GO:0035728 | response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 0.3 | 0.9 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.3 | 0.3 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
| 0.3 | 2.5 | GO:0021772 | olfactory bulb development(GO:0021772) |
| 0.3 | 2.1 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.3 | 1.2 | GO:0033605 | positive regulation of catecholamine secretion(GO:0033605) |
| 0.3 | 1.5 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
| 0.3 | 3.0 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.3 | 0.9 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.3 | 3.9 | GO:0021954 | central nervous system neuron development(GO:0021954) |
| 0.3 | 3.0 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.3 | 0.9 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.3 | 0.9 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.3 | 0.6 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.3 | 1.7 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.3 | 0.6 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.3 | 0.3 | GO:0060022 | hard palate development(GO:0060022) |
| 0.3 | 0.3 | GO:1903421 | regulation of synaptic vesicle recycling(GO:1903421) |
| 0.3 | 0.6 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.3 | 0.9 | GO:0021871 | forebrain regionalization(GO:0021871) |
| 0.3 | 1.4 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
| 0.3 | 0.9 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.3 | 1.7 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.3 | 0.9 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.3 | 0.6 | GO:2000343 | positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
| 0.3 | 1.7 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.3 | 1.1 | GO:0042637 | catagen(GO:0042637) |
| 0.3 | 0.8 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.3 | 1.9 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.3 | 0.6 | GO:0045606 | positive regulation of epidermal cell differentiation(GO:0045606) |
| 0.3 | 0.5 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
| 0.3 | 0.5 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
| 0.3 | 0.3 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
| 0.3 | 0.5 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.3 | 0.8 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.3 | 0.5 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.3 | 1.3 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.3 | 0.5 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.3 | 0.8 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.3 | 2.1 | GO:0036303 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
| 0.3 | 0.5 | GO:0051586 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.3 | 2.0 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.3 | 0.5 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.3 | 0.3 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.2 | 0.2 | GO:0042428 | serotonin metabolic process(GO:0042428) primary amino compound metabolic process(GO:1901160) |
| 0.2 | 1.2 | GO:0045687 | positive regulation of glial cell differentiation(GO:0045687) |
| 0.2 | 2.2 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.2 | 0.5 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.2 | 0.2 | GO:0072053 | renal inner medulla development(GO:0072053) |
| 0.2 | 0.5 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.2 | 1.5 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.2 | 2.4 | GO:0042670 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.2 | 3.8 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.2 | 0.7 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.2 | 0.2 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.2 | 0.2 | GO:2000794 | regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
| 0.2 | 0.2 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 0.2 | 0.5 | GO:0070141 | response to UV-A(GO:0070141) |
| 0.2 | 0.2 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.2 | 0.5 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.2 | 0.7 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.2 | 0.7 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
| 0.2 | 2.3 | GO:0045056 | transcytosis(GO:0045056) |
| 0.2 | 1.9 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
| 0.2 | 0.5 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
| 0.2 | 2.1 | GO:0007416 | synapse assembly(GO:0007416) |
| 0.2 | 0.5 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.2 | 0.5 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.2 | 1.4 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.2 | 0.7 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.2 | 5.7 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.2 | 0.5 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.2 | 0.9 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.2 | 0.2 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.2 | 0.9 | GO:0060346 | bone trabecula formation(GO:0060346) |
| 0.2 | 0.4 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.2 | 0.7 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.2 | 4.8 | GO:0060612 | adipose tissue development(GO:0060612) |
| 0.2 | 0.9 | GO:0042447 | hormone catabolic process(GO:0042447) |
| 0.2 | 0.9 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
| 0.2 | 1.8 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
| 0.2 | 0.4 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.2 | 1.3 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
| 0.2 | 0.6 | GO:0032439 | endosome localization(GO:0032439) |
| 0.2 | 0.6 | GO:0021801 | cerebral cortex radial glia guided migration(GO:0021801) telencephalon glial cell migration(GO:0022030) |
| 0.2 | 0.4 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.2 | 1.7 | GO:0042983 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.2 | 1.1 | GO:0043206 | extracellular fibril organization(GO:0043206) |
| 0.2 | 2.5 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.2 | 1.3 | GO:1905145 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.2 | 0.2 | GO:0014075 | response to amine(GO:0014075) |
| 0.2 | 0.2 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.2 | 0.4 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.2 | 2.3 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.2 | 1.5 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.2 | 0.4 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 0.2 | 1.4 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.2 | 0.6 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.2 | 1.6 | GO:0006582 | melanin metabolic process(GO:0006582) |
| 0.2 | 0.4 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.2 | 0.2 | GO:0042693 | muscle cell fate commitment(GO:0042693) |
| 0.2 | 0.6 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.2 | 0.2 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
| 0.2 | 0.2 | GO:0060120 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.2 | 1.2 | GO:0015074 | DNA integration(GO:0015074) |
| 0.2 | 0.6 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.2 | 0.2 | GO:1903899 | positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
| 0.2 | 0.6 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.2 | 2.8 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.2 | 0.4 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.2 | 2.2 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.2 | 1.0 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.2 | 0.2 | GO:0060638 | mesenchymal-epithelial cell signaling(GO:0060638) |
| 0.2 | 0.6 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.2 | 0.6 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.2 | 0.4 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.2 | 0.2 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
| 0.2 | 1.4 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
| 0.2 | 0.2 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.2 | 0.6 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.2 | 0.2 | GO:2000410 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
| 0.2 | 1.9 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.2 | 1.0 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.2 | 0.2 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
| 0.2 | 0.4 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.2 | 0.2 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.2 | 0.2 | GO:0086016 | AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) AV node cell to bundle of His cell communication(GO:0086067) |
| 0.2 | 0.4 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.2 | 1.1 | GO:1901522 | positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
| 0.2 | 0.4 | GO:0046880 | regulation of follicle-stimulating hormone secretion(GO:0046880) |
| 0.2 | 8.8 | GO:0048813 | dendrite morphogenesis(GO:0048813) |
| 0.2 | 0.4 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 0.2 | 0.6 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.2 | 0.4 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
| 0.2 | 0.4 | GO:0071351 | cellular response to interleukin-18(GO:0071351) |
| 0.2 | 0.5 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.2 | 0.5 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.2 | 0.4 | GO:2000696 | regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
| 0.2 | 0.9 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.2 | 0.5 | GO:0008306 | associative learning(GO:0008306) |
| 0.2 | 0.2 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.2 | 1.1 | GO:0023019 | signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.2 | 1.9 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.2 | 0.4 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
| 0.2 | 0.3 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.2 | 0.5 | GO:0060180 | female mating behavior(GO:0060180) |
| 0.2 | 0.5 | GO:0042891 | antibiotic transport(GO:0042891) |
| 0.2 | 0.2 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.2 | 0.2 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
| 0.2 | 0.2 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
| 0.2 | 0.3 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.2 | 0.7 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.2 | 0.5 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.2 | 0.2 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.2 | 0.2 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.2 | 0.7 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
| 0.2 | 0.5 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.2 | 0.2 | GO:0060459 | left lung development(GO:0060459) |
| 0.2 | 0.3 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.2 | 0.5 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.2 | 1.3 | GO:0035176 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
| 0.2 | 0.5 | GO:0051775 | response to redox state(GO:0051775) |
| 0.2 | 0.9 | GO:0099515 | actin filament-based transport(GO:0099515) |
| 0.2 | 0.3 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.2 | 0.5 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.2 | 0.3 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.2 | 0.5 | GO:0050705 | regulation of interleukin-1 alpha secretion(GO:0050705) |
| 0.2 | 0.6 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.2 | 0.3 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.2 | 0.9 | GO:0030318 | melanocyte differentiation(GO:0030318) |
| 0.1 | 1.2 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 | 0.4 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.3 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
| 0.1 | 1.8 | GO:0050974 | detection of mechanical stimulus involved in sensory perception(GO:0050974) |
| 0.1 | 0.1 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.1 | 0.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.1 | 0.1 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
| 0.1 | 3.9 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.1 | 0.1 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
| 0.1 | 0.3 | GO:0014028 | notochord formation(GO:0014028) |
| 0.1 | 0.9 | GO:0032401 | establishment of melanosome localization(GO:0032401) |
| 0.1 | 0.3 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 | 0.1 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 0.1 | 0.8 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
| 0.1 | 0.8 | GO:0050927 | positive regulation of positive chemotaxis(GO:0050927) |
| 0.1 | 0.4 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 0.3 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.1 | 0.9 | GO:0007603 | phototransduction, visible light(GO:0007603) |
| 0.1 | 0.3 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.1 | 0.3 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
| 0.1 | 0.3 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
| 0.1 | 0.4 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.1 | 1.3 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.1 | 0.1 | GO:0097499 | protein localization to nonmotile primary cilium(GO:0097499) |
| 0.1 | 0.9 | GO:0097186 | amelogenesis(GO:0097186) |
| 0.1 | 2.2 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.1 | 0.3 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.1 | 0.4 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.1 | 0.9 | GO:0007528 | neuromuscular junction development(GO:0007528) |
| 0.1 | 1.2 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
| 0.1 | 0.2 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
| 0.1 | 4.4 | GO:0001578 | microtubule bundle formation(GO:0001578) |
| 0.1 | 0.8 | GO:0007628 | adult walking behavior(GO:0007628) walking behavior(GO:0090659) |
| 0.1 | 0.6 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.1 | 0.6 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
| 0.1 | 0.2 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
| 0.1 | 0.1 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
| 0.1 | 0.5 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.1 | 0.2 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.1 | 0.4 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 | 0.8 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.1 | 0.4 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.1 | 0.5 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.1 | 0.2 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.1 | 0.2 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.1 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.1 | 0.6 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
| 0.1 | 0.3 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
| 0.1 | 0.2 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.1 | 0.3 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.1 | 0.3 | GO:0032725 | positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
| 0.1 | 0.2 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.1 | 0.4 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 0.2 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.1 | 0.1 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.1 | 0.3 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.1 | 0.2 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.1 | 0.2 | GO:0038001 | paracrine signaling(GO:0038001) |
| 0.1 | 0.4 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.1 | 0.1 | GO:0060931 | sinoatrial node development(GO:0003163) sinoatrial node cell differentiation(GO:0060921) sinoatrial node cell development(GO:0060931) |
| 0.1 | 0.5 | GO:0031111 | negative regulation of microtubule polymerization or depolymerization(GO:0031111) negative regulation of microtubule polymerization(GO:0031115) |
| 0.1 | 0.4 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.1 | 0.4 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.3 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
| 0.1 | 0.2 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.1 | 0.4 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.1 | 0.2 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.1 | 0.1 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.1 | 0.1 | GO:0032048 | cardiolipin metabolic process(GO:0032048) |
| 0.1 | 1.4 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
| 0.1 | 1.2 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.1 | 0.5 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 | 0.1 | GO:0021670 | lateral ventricle development(GO:0021670) |
| 0.1 | 0.2 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.1 | 0.2 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 | 0.1 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.1 | 0.2 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
| 0.1 | 0.6 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.1 | 0.3 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.1 | 0.9 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
| 0.1 | 0.3 | GO:0030242 | pexophagy(GO:0030242) |
| 0.1 | 0.5 | GO:2001222 | regulation of neuron migration(GO:2001222) |
| 0.1 | 0.5 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.1 | 0.1 | GO:0048241 | epinephrine transport(GO:0048241) |
| 0.1 | 0.1 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
| 0.1 | 0.1 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) |
| 0.1 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 0.3 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.1 | 0.4 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.1 | 0.3 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.1 | 0.3 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.1 | 0.1 | GO:0060290 | transdifferentiation(GO:0060290) |
| 0.1 | 0.2 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.1 | 0.1 | GO:0019374 | galactolipid metabolic process(GO:0019374) |
| 0.1 | 0.2 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 0.1 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.1 | 0.2 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.1 | 0.2 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
| 0.1 | 0.2 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.1 | 0.4 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.1 | 0.1 | GO:0014721 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.1 | 0.1 | GO:0072126 | positive regulation of glomerular mesangial cell proliferation(GO:0072126) |
| 0.1 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.1 | 1.4 | GO:0030514 | negative regulation of BMP signaling pathway(GO:0030514) |
| 0.1 | 0.2 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.1 | 0.1 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.1 | 0.2 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.1 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.1 | 0.5 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
| 0.1 | 0.6 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
| 0.1 | 0.1 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.1 | 0.1 | GO:0002730 | regulation of dendritic cell cytokine production(GO:0002730) |
| 0.1 | 1.0 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.1 | 0.2 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
| 0.1 | 0.1 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.1 | 0.4 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
| 0.1 | 0.1 | GO:0015867 | ATP transport(GO:0015867) |
| 0.1 | 0.3 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.1 | 0.3 | GO:0032835 | glomerulus development(GO:0032835) |
| 0.1 | 0.1 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.1 | 0.1 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
| 0.1 | 0.1 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.1 | 0.1 | GO:0032328 | alanine transport(GO:0032328) |
| 0.1 | 0.2 | GO:1902172 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
| 0.1 | 0.3 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.1 | 0.2 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.1 | 0.2 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.1 | 0.2 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.1 | 0.1 | GO:0006531 | aspartate metabolic process(GO:0006531) |
| 0.1 | 0.1 | GO:0032650 | regulation of interleukin-1 alpha production(GO:0032650) |
| 0.1 | 1.0 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.1 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.1 | 0.1 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.1 | 0.1 | GO:0032493 | response to bacterial lipoprotein(GO:0032493) |
| 0.1 | 0.2 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.1 | 0.3 | GO:0003091 | renal water homeostasis(GO:0003091) |
| 0.1 | 0.4 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.1 | 0.2 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.1 | 0.2 | GO:0031000 | response to caffeine(GO:0031000) |
| 0.1 | 0.2 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.1 | 0.1 | GO:0035768 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
| 0.1 | 0.4 | GO:0042634 | regulation of hair cycle(GO:0042634) |
| 0.1 | 0.1 | GO:0032026 | response to magnesium ion(GO:0032026) |
| 0.1 | 0.2 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.1 | 0.6 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.1 | 0.2 | GO:0031033 | myosin filament organization(GO:0031033) |
| 0.1 | 0.1 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.1 | 0.2 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.1 | 0.1 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
| 0.1 | 0.3 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 | 0.3 | GO:0015824 | proline transport(GO:0015824) |
| 0.1 | 0.1 | GO:0015817 | histidine transport(GO:0015817) |
| 0.1 | 0.2 | GO:0033085 | negative regulation of T cell differentiation in thymus(GO:0033085) |
| 0.1 | 0.2 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.0 | 0.2 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
| 0.0 | 0.0 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.0 | 0.0 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
| 0.0 | 0.1 | GO:0035902 | response to immobilization stress(GO:0035902) |
| 0.0 | 0.3 | GO:2000505 | regulation of energy homeostasis(GO:2000505) |
| 0.0 | 1.7 | GO:0006836 | neurotransmitter transport(GO:0006836) |
| 0.0 | 0.2 | GO:2000018 | regulation of male gonad development(GO:2000018) |
| 0.0 | 0.3 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.0 | 1.4 | GO:0080171 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
| 0.0 | 0.0 | GO:0070254 | mucus secretion(GO:0070254) |
| 0.0 | 0.2 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.0 | 0.0 | GO:0097709 | connective tissue replacement involved in inflammatory response wound healing(GO:0002248) connective tissue replacement(GO:0097709) |
| 0.0 | 0.0 | GO:0007632 | visual behavior(GO:0007632) |
| 0.0 | 0.1 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.0 | 0.0 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.0 | 0.9 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.0 | 0.1 | GO:0045354 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.0 | 0.1 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
| 0.0 | 0.3 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 | 1.0 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
| 0.0 | 0.1 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
| 0.0 | 0.7 | GO:0071300 | cellular response to retinoic acid(GO:0071300) |
| 0.0 | 0.3 | GO:0044247 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.0 | 0.0 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
| 0.0 | 0.6 | GO:0097352 | autophagosome maturation(GO:0097352) |
| 0.0 | 0.3 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.0 | 0.4 | GO:0010669 | epithelial structure maintenance(GO:0010669) |
| 0.0 | 0.3 | GO:0051497 | negative regulation of actin filament bundle assembly(GO:0032232) negative regulation of stress fiber assembly(GO:0051497) |
| 0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.0 | 0.1 | GO:0043576 | regulation of respiratory gaseous exchange(GO:0043576) |
| 0.0 | 0.1 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.0 | 0.1 | GO:0034650 | cortisol metabolic process(GO:0034650) |
| 0.0 | 0.1 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.0 | 0.2 | GO:0015800 | acidic amino acid transport(GO:0015800) |
| 0.0 | 0.1 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.0 | 0.3 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.0 | 0.0 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.0 | 0.1 | GO:0034405 | response to fluid shear stress(GO:0034405) cellular response to fluid shear stress(GO:0071498) |
| 0.0 | 0.2 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.2 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.0 | 0.1 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
| 0.0 | 0.0 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.0 | 0.0 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
| 0.0 | 0.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.0 | 0.1 | GO:0021983 | pituitary gland development(GO:0021983) |
| 0.0 | 0.0 | GO:0072319 | vesicle uncoating(GO:0072319) |
| 0.0 | 0.2 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.0 | 0.1 | GO:1901185 | negative regulation of ERBB signaling pathway(GO:1901185) |
| 0.0 | 0.8 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
| 0.0 | 0.0 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.1 | GO:0021794 | thalamus development(GO:0021794) |
| 0.0 | 1.0 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
| 0.0 | 0.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 | 0.0 | GO:0043589 | skin morphogenesis(GO:0043589) |
| 0.0 | 0.0 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
| 0.0 | 0.1 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 0.1 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.0 | 0.0 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 | 0.0 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
| 0.0 | 0.1 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
| 0.0 | 0.0 | GO:0007567 | parturition(GO:0007567) |
| 0.0 | 0.0 | GO:0002645 | positive regulation of tolerance induction(GO:0002645) |
| 0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.0 | 0.1 | GO:0008105 | asymmetric protein localization(GO:0008105) |
| 0.0 | 0.0 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.0 | 0.0 | GO:0071608 | macrophage inflammatory protein-1 alpha production(GO:0071608) |
| 0.0 | 0.1 | GO:0019321 | pentose metabolic process(GO:0019321) |
| 0.0 | 0.0 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.0 | 0.0 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.0 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.0 | 0.0 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
| 0.0 | 0.0 | GO:0097205 | renal filtration(GO:0097205) |
| 0.0 | 0.0 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.0 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.0 | 24.1 | GO:0043083 | synaptic cleft(GO:0043083) |
| 2.6 | 15.6 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 2.1 | 6.4 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 1.9 | 5.8 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 1.9 | 16.9 | GO:0030673 | axolemma(GO:0030673) |
| 1.8 | 15.9 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 1.8 | 12.4 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 1.6 | 4.9 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 1.6 | 9.6 | GO:0005915 | zonula adherens(GO:0005915) |
| 1.6 | 1.6 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 1.5 | 7.3 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 1.4 | 12.9 | GO:0005883 | neurofilament(GO:0005883) |
| 1.4 | 4.2 | GO:0043198 | dendritic shaft(GO:0043198) |
| 1.4 | 9.6 | GO:0032584 | growth cone membrane(GO:0032584) |
| 1.4 | 10.9 | GO:0071437 | invadopodium(GO:0071437) |
| 1.3 | 5.4 | GO:0044308 | axonal spine(GO:0044308) |
| 1.3 | 5.3 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 1.3 | 3.9 | GO:0072534 | perineuronal net(GO:0072534) |
| 1.3 | 32.7 | GO:0044295 | axonal growth cone(GO:0044295) |
| 1.3 | 6.3 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 1.2 | 19.8 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 1.2 | 4.7 | GO:0071953 | elastic fiber(GO:0071953) |
| 1.2 | 3.5 | GO:0097441 | basilar dendrite(GO:0097441) |
| 1.2 | 13.9 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 1.2 | 3.5 | GO:0005606 | laminin-1 complex(GO:0005606) |
| 1.2 | 3.5 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 1.1 | 11.3 | GO:0008328 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
| 1.1 | 20.0 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 1.1 | 1.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 1.1 | 1.1 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 1.1 | 8.5 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 1.1 | 26.7 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 1.1 | 5.3 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 1.1 | 15.8 | GO:0005614 | interstitial matrix(GO:0005614) |
| 1.1 | 12.6 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 1.0 | 47.4 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 1.0 | 8.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 1.0 | 1.0 | GO:0097513 | myosin II filament(GO:0097513) |
| 1.0 | 9.8 | GO:0001527 | microfibril(GO:0001527) |
| 0.9 | 7.5 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.9 | 2.8 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.9 | 5.4 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.9 | 6.2 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.9 | 22.0 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.9 | 3.5 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.9 | 1.7 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.9 | 1.7 | GO:0016342 | catenin complex(GO:0016342) |
| 0.9 | 122.5 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.8 | 1.7 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.8 | 5.0 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.8 | 3.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.8 | 3.1 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.8 | 2.3 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.7 | 8.9 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.7 | 40.4 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.7 | 3.6 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.7 | 5.0 | GO:0098644 | complex of collagen trimers(GO:0098644) |
| 0.7 | 2.1 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.7 | 1.4 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.7 | 2.7 | GO:0097433 | dense body(GO:0097433) |
| 0.7 | 2.7 | GO:1990696 | USH2 complex(GO:1990696) |
| 0.7 | 2.0 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.7 | 5.3 | GO:0005861 | troponin complex(GO:0005861) |
| 0.7 | 3.3 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.6 | 2.5 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.6 | 1.9 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.6 | 0.6 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.6 | 10.5 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.6 | 16.1 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.6 | 14.4 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.6 | 2.9 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.6 | 2.2 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.6 | 6.1 | GO:0031045 | dense core granule(GO:0031045) |
| 0.5 | 4.4 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.5 | 4.9 | GO:0005605 | basal lamina(GO:0005605) |
| 0.5 | 1.6 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.5 | 0.5 | GO:0034705 | potassium channel complex(GO:0034705) |
| 0.5 | 2.2 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.5 | 0.5 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.5 | 1.6 | GO:0043511 | inhibin complex(GO:0043511) |
| 0.5 | 1.0 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.5 | 16.4 | GO:0044291 | cell-cell contact zone(GO:0044291) |
| 0.5 | 6.0 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| 0.5 | 4.5 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.5 | 0.5 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.5 | 4.9 | GO:0032590 | dendrite membrane(GO:0032590) |
| 0.5 | 3.4 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.5 | 1.0 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.5 | 1.4 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.5 | 47.1 | GO:0060076 | excitatory synapse(GO:0060076) |
| 0.5 | 1.9 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.4 | 1.3 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.4 | 1.3 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.4 | 3.0 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.4 | 1.7 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.4 | 2.4 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.4 | 0.4 | GO:0035838 | growing cell tip(GO:0035838) |
| 0.4 | 4.1 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
| 0.4 | 0.7 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.4 | 90.0 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
| 0.4 | 1.1 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.4 | 0.4 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.4 | 23.2 | GO:0043204 | perikaryon(GO:0043204) |
| 0.3 | 4.4 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.3 | 23.2 | GO:0030427 | site of polarized growth(GO:0030427) |
| 0.3 | 2.3 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.3 | 7.8 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.3 | 0.6 | GO:1990357 | terminal web(GO:1990357) |
| 0.3 | 1.9 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.3 | 2.5 | GO:0031430 | M band(GO:0031430) |
| 0.3 | 0.3 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.3 | 1.2 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.3 | 8.7 | GO:0032420 | stereocilium(GO:0032420) |
| 0.3 | 1.6 | GO:0071546 | pi-body(GO:0071546) |
| 0.3 | 1.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.3 | 2.9 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.3 | 2.8 | GO:0034704 | calcium channel complex(GO:0034704) |
| 0.2 | 1.2 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.2 | 2.0 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.2 | 3.5 | GO:0030057 | desmosome(GO:0030057) |
| 0.2 | 3.0 | GO:0070382 | exocytic vesicle(GO:0070382) |
| 0.2 | 0.7 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.2 | 0.7 | GO:1990393 | 3M complex(GO:1990393) |
| 0.2 | 0.9 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.2 | 26.7 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.2 | 1.5 | GO:0043034 | costamere(GO:0043034) |
| 0.2 | 9.7 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.2 | 5.1 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.2 | 0.4 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
| 0.2 | 6.7 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.2 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.2 | 0.4 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.2 | 1.4 | GO:0034464 | BBSome(GO:0034464) |
| 0.2 | 11.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.2 | 0.6 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.2 | 0.6 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.2 | 5.3 | GO:0005921 | gap junction(GO:0005921) |
| 0.2 | 1.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.2 | 0.6 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.2 | 0.5 | GO:0043293 | apoptosome(GO:0043293) |
| 0.2 | 0.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.2 | 1.7 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.2 | 1.4 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.2 | 0.5 | GO:0071547 | piP-body(GO:0071547) |
| 0.2 | 4.8 | GO:0016459 | myosin complex(GO:0016459) |
| 0.2 | 0.3 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.2 | 0.2 | GO:0043196 | varicosity(GO:0043196) |
| 0.2 | 0.5 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.2 | 1.3 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.2 | 0.5 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.2 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.2 | 6.3 | GO:0043195 | terminal bouton(GO:0043195) |
| 0.2 | 1.8 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.2 | 0.3 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.2 | 0.6 | GO:0060091 | kinocilium(GO:0060091) |
| 0.1 | 1.9 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.1 | 0.9 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.1 | 2.1 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 25.3 | GO:0045202 | synapse(GO:0045202) |
| 0.1 | 1.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.1 | 1.2 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.1 | 1.8 | GO:0036038 | MKS complex(GO:0036038) |
| 0.1 | 1.1 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.1 | 0.8 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
| 0.1 | 0.1 | GO:0044393 | microspike(GO:0044393) |
| 0.1 | 0.4 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.1 | 1.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.1 | 0.6 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.1 | 0.6 | GO:0070695 | FHF complex(GO:0070695) |
| 0.1 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.1 | 2.4 | GO:0043679 | axon terminus(GO:0043679) |
| 0.1 | 0.3 | GO:0000802 | transverse filament(GO:0000802) |
| 0.1 | 0.8 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.1 | 3.2 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.1 | 2.2 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 0.4 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.1 | 0.9 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.1 | 0.3 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.1 | 1.0 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.1 | 0.7 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.1 | 2.2 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.1 | 0.6 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
| 0.1 | 0.4 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.1 | 0.2 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.1 | 1.1 | GO:0036379 | myofilament(GO:0036379) |
| 0.1 | 3.9 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.1 | 0.2 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 1.0 | GO:0042611 | MHC protein complex(GO:0042611) |
| 0.1 | 0.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 1.1 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.1 | 0.3 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.1 | 0.5 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.1 | 4.1 | GO:0030027 | lamellipodium(GO:0030027) |
| 0.1 | 0.2 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.1 | 0.9 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.1 | 1.1 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.1 | 0.4 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.1 | 0.2 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.0 | 0.4 | GO:0005858 | axonemal dynein complex(GO:0005858) |
| 0.0 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
| 0.0 | 16.0 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.0 | 0.2 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.0 | 0.2 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.0 | 0.1 | GO:0044447 | axoneme part(GO:0044447) |
| 0.0 | 0.6 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.2 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
| 0.0 | 0.1 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.0 | 0.2 | GO:0044306 | neuron projection terminus(GO:0044306) |
| 0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 1.1 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.0 | 0.0 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
| 0.0 | 2.3 | GO:0098857 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
| 0.0 | 0.0 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 0.0 | GO:0043203 | axon hillock(GO:0043203) |
| 0.0 | 0.4 | GO:0005581 | collagen trimer(GO:0005581) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 5.3 | 10.6 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 3.8 | 11.4 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 3.3 | 9.8 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 3.0 | 12.2 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 2.7 | 8.0 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 2.6 | 7.7 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 2.5 | 7.6 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 2.4 | 21.9 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 2.4 | 2.4 | GO:0008066 | glutamate receptor activity(GO:0008066) |
| 2.4 | 12.0 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 2.4 | 9.4 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 2.3 | 7.0 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 2.3 | 9.3 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 2.0 | 9.9 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 1.9 | 9.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 1.8 | 14.8 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 1.7 | 6.8 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 1.7 | 8.3 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 1.6 | 14.8 | GO:0038191 | neuropilin binding(GO:0038191) |
| 1.6 | 4.9 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 1.6 | 9.8 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 1.6 | 6.4 | GO:0070052 | collagen V binding(GO:0070052) |
| 1.6 | 6.4 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 1.6 | 4.8 | GO:0035939 | microsatellite binding(GO:0035939) |
| 1.6 | 4.7 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 1.5 | 4.6 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 1.5 | 4.6 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 1.5 | 6.0 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 1.5 | 4.5 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 1.5 | 4.4 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 1.5 | 5.8 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 1.5 | 11.7 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 1.4 | 11.2 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
| 1.4 | 19.5 | GO:0031402 | sodium ion binding(GO:0031402) |
| 1.4 | 5.5 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 1.4 | 14.9 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 1.4 | 9.5 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 1.3 | 4.0 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 1.3 | 1.3 | GO:0055100 | adiponectin binding(GO:0055100) |
| 1.3 | 2.6 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 1.3 | 15.4 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
| 1.3 | 6.4 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
| 1.3 | 2.5 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 1.3 | 7.6 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 1.2 | 9.7 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 1.2 | 3.6 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 1.2 | 6.0 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 1.2 | 3.6 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 1.2 | 6.0 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 1.1 | 5.7 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 1.1 | 1.1 | GO:0051425 | PTB domain binding(GO:0051425) |
| 1.1 | 3.3 | GO:0071253 | connexin binding(GO:0071253) |
| 1.1 | 5.4 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 1.1 | 17.2 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 1.1 | 4.3 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 1.1 | 4.3 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 1.1 | 10.6 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
| 1.1 | 20.1 | GO:0016917 | GABA-A receptor activity(GO:0004890) GABA receptor activity(GO:0016917) |
| 1.0 | 5.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 1.0 | 3.1 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 1.0 | 7.3 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 1.0 | 10.3 | GO:0051378 | serotonin binding(GO:0051378) |
| 1.0 | 2.0 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 1.0 | 3.0 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 1.0 | 2.9 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 1.0 | 6.7 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.9 | 0.9 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.9 | 22.7 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.9 | 8.5 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.9 | 6.5 | GO:0004952 | dopamine neurotransmitter receptor activity(GO:0004952) |
| 0.9 | 4.6 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.9 | 4.6 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.9 | 4.6 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.9 | 2.7 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.9 | 1.8 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.9 | 4.5 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.9 | 3.5 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
| 0.9 | 10.5 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.9 | 4.4 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.9 | 2.6 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
| 0.9 | 6.0 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.8 | 2.5 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.8 | 10.1 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.8 | 25.1 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.8 | 8.2 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.8 | 1.6 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.8 | 2.4 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.8 | 18.5 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.8 | 1.6 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.8 | 3.2 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.8 | 2.3 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.8 | 17.0 | GO:0052715 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.8 | 27.7 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.8 | 3.0 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.8 | 3.8 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.7 | 3.7 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.7 | 20.6 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.7 | 3.7 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.7 | 2.9 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.7 | 0.7 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
| 0.7 | 2.9 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.7 | 21.1 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.7 | 2.8 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.7 | 3.5 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.7 | 12.6 | GO:0005112 | Notch binding(GO:0005112) |
| 0.7 | 2.8 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.7 | 2.1 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.7 | 0.7 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.7 | 3.4 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.7 | 0.7 | GO:0000982 | transcription factor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0000982) |
| 0.7 | 10.9 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
| 0.7 | 1.3 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.7 | 3.3 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.7 | 9.3 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.7 | 5.3 | GO:0051393 | alpha-actinin binding(GO:0051393) |
| 0.7 | 2.0 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.7 | 3.9 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.6 | 9.7 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.6 | 2.6 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
| 0.6 | 0.6 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.6 | 0.6 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.6 | 1.9 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.6 | 3.1 | GO:0043426 | MRF binding(GO:0043426) |
| 0.6 | 6.9 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.6 | 1.9 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.6 | 3.7 | GO:0031432 | titin binding(GO:0031432) |
| 0.6 | 6.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.6 | 15.9 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.6 | 3.0 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
| 0.6 | 2.4 | GO:0034902 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
| 0.6 | 2.4 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.6 | 2.4 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.6 | 3.0 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.6 | 3.6 | GO:0048185 | activin binding(GO:0048185) |
| 0.6 | 1.8 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.6 | 2.4 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.6 | 17.1 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.6 | 0.6 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.6 | 6.9 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.6 | 2.3 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.6 | 0.6 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
| 0.6 | 4.5 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.6 | 8.9 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.5 | 2.2 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.5 | 2.7 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.5 | 1.6 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.5 | 0.5 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.5 | 4.8 | GO:0035254 | glutamate receptor binding(GO:0035254) |
| 0.5 | 9.1 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.5 | 1.6 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.5 | 4.8 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.5 | 3.2 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.5 | 3.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.5 | 2.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.5 | 1.6 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.5 | 5.3 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.5 | 2.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.5 | 4.7 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
| 0.5 | 1.6 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
| 0.5 | 12.2 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.5 | 12.7 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.5 | 4.6 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.5 | 0.5 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.5 | 4.5 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.5 | 1.0 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.5 | 2.5 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.5 | 1.0 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.5 | 2.0 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.5 | 1.5 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.5 | 1.0 | GO:0019114 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
| 0.5 | 1.5 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.5 | 1.0 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.5 | 11.1 | GO:0005249 | voltage-gated potassium channel activity(GO:0005249) |
| 0.5 | 2.4 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.5 | 1.4 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.5 | 1.4 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.5 | 1.4 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.5 | 1.4 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.4 | 0.9 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.4 | 2.7 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.4 | 2.2 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.4 | 4.4 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.4 | 1.3 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
| 0.4 | 2.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.4 | 28.1 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.4 | 1.7 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.4 | 4.7 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.4 | 8.1 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.4 | 3.4 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.4 | 2.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.4 | 2.5 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.4 | 1.3 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.4 | 2.9 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.4 | 2.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.4 | 4.1 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.4 | 1.2 | GO:0004946 | bombesin receptor activity(GO:0004946) |
| 0.4 | 6.9 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.4 | 1.2 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
| 0.4 | 1.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.4 | 14.1 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.4 | 1.9 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.4 | 7.0 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.4 | 1.1 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.4 | 1.5 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.4 | 1.9 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
| 0.4 | 4.9 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.4 | 0.4 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.4 | 6.4 | GO:0004629 | phospholipase C activity(GO:0004629) |
| 0.4 | 9.0 | GO:0051018 | protein kinase A binding(GO:0051018) |
| 0.4 | 0.7 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.4 | 1.5 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.4 | 1.5 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.4 | 0.7 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.4 | 1.8 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.3 | 1.0 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.3 | 1.4 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.3 | 1.7 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.3 | 0.7 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.3 | 6.5 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.3 | 3.7 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.3 | 1.7 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.3 | 2.7 | GO:0042923 | neuropeptide binding(GO:0042923) |
| 0.3 | 4.7 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.3 | 1.7 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.3 | 0.3 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.3 | 2.0 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
| 0.3 | 1.3 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.3 | 4.4 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.3 | 3.4 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.3 | 2.5 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.3 | 1.9 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.3 | 0.9 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.3 | 1.5 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.3 | 4.6 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.3 | 1.2 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.3 | 3.0 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.3 | 0.6 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.3 | 1.2 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.3 | 1.2 | GO:0050543 | icosatetraenoic acid binding(GO:0050543) |
| 0.3 | 1.2 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.3 | 0.9 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.3 | 0.3 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.3 | 0.6 | GO:0051380 | norepinephrine binding(GO:0051380) |
| 0.3 | 0.6 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.3 | 1.7 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.3 | 0.8 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.3 | 0.3 | GO:0005221 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
| 0.3 | 4.2 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.3 | 1.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.3 | 1.1 | GO:0036122 | BMP binding(GO:0036122) |
| 0.3 | 1.9 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.3 | 2.2 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.3 | 1.6 | GO:0099528 | G-protein coupled neurotransmitter receptor activity(GO:0099528) |
| 0.3 | 0.8 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.3 | 6.2 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.3 | 1.1 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
| 0.3 | 18.6 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
| 0.3 | 1.0 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.3 | 0.8 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
| 0.3 | 2.6 | GO:0022842 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
| 0.3 | 6.3 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.3 | 0.8 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.3 | 4.5 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.2 | 10.0 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
| 0.2 | 1.2 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
| 0.2 | 0.5 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.2 | 2.5 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.2 | 0.7 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.2 | 0.5 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.2 | 1.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.2 | 0.7 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.2 | 1.0 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.2 | 6.0 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.2 | 0.7 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
| 0.2 | 0.7 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.2 | 1.4 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.2 | 1.6 | GO:0005522 | profilin binding(GO:0005522) |
| 0.2 | 5.0 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.2 | 0.5 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.2 | 0.2 | GO:0001962 | alpha-1,3-galactosyltransferase activity(GO:0001962) |
| 0.2 | 2.0 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.2 | 2.0 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
| 0.2 | 1.6 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.2 | 1.1 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.2 | 1.3 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.2 | 0.4 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.2 | 1.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.2 | 1.3 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
| 0.2 | 4.8 | GO:0005262 | calcium channel activity(GO:0005262) |
| 0.2 | 0.7 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.2 | 0.6 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.2 | 0.6 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.2 | 0.2 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.2 | 0.6 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.2 | 0.8 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.2 | 0.6 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.2 | 0.6 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.2 | 3.3 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.2 | 2.1 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.2 | 0.6 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.2 | 0.4 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.2 | 0.4 | GO:0070888 | E-box binding(GO:0070888) |
| 0.2 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.2 | 7.6 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.2 | 0.6 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.2 | 1.0 | GO:0046625 | sphingolipid binding(GO:0046625) |
| 0.2 | 2.0 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.2 | 0.6 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.2 | 0.4 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.2 | 2.8 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
| 0.2 | 0.7 | GO:1905030 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.2 | 0.4 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.2 | 39.9 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.2 | 0.4 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.2 | 0.4 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.2 | 0.9 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.2 | 15.2 | GO:0017124 | SH3 domain binding(GO:0017124) |
| 0.2 | 1.6 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.2 | 0.5 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.2 | 3.2 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.2 | 0.4 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.2 | 0.5 | GO:0004096 | catalase activity(GO:0004096) |
| 0.2 | 0.2 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.2 | 5.6 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
| 0.2 | 0.2 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.2 | 0.9 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.2 | 0.7 | GO:0004083 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) |
| 0.2 | 1.5 | GO:0015922 | aspartate oxidase activity(GO:0015922) |
| 0.2 | 3.6 | GO:0005261 | cation channel activity(GO:0005261) |
| 0.2 | 0.2 | GO:0004954 | prostanoid receptor activity(GO:0004954) |
| 0.2 | 0.3 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.2 | 0.5 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.2 | 0.3 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.2 | 0.5 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.2 | 0.2 | GO:0038100 | nodal binding(GO:0038100) |
| 0.2 | 1.7 | GO:0044213 | intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.2 | 0.3 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.2 | 0.2 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 0.2 | 1.4 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.2 | 2.0 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.2 | 14.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.2 | 0.9 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.2 | 1.5 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.1 | 0.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.1 | 0.6 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.1 | 0.3 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.1 | 0.3 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.1 | 0.7 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
| 0.1 | 0.4 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.1 | 0.6 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.1 | 0.4 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
| 0.1 | 6.8 | GO:0044325 | ion channel binding(GO:0044325) |
| 0.1 | 0.7 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.1 | 1.1 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
| 0.1 | 3.2 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.1 | 0.8 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
| 0.1 | 0.6 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 0.1 | 0.7 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.1 | 0.7 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.1 | 0.4 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.1 | 0.4 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 2.8 | GO:0017022 | myosin binding(GO:0017022) |
| 0.1 | 0.4 | GO:0005148 | prolactin receptor binding(GO:0005148) |
| 0.1 | 0.5 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.1 | 0.6 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.3 | GO:0004027 | alcohol sulfotransferase activity(GO:0004027) |
| 0.1 | 0.4 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.1 | 1.7 | GO:0004879 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
| 0.1 | 1.8 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
| 0.1 | 0.4 | GO:0050694 | galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.1 | 1.0 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.1 | 0.4 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
| 0.1 | 0.4 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.1 | 3.2 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.1 | 2.9 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.1 | 3.3 | GO:0043914 | NADPH:sulfur oxidoreductase activity(GO:0043914) |
| 0.1 | 0.1 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 0.1 | 1.5 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.1 | 0.2 | GO:0035671 | enone reductase activity(GO:0035671) |
| 0.1 | 1.6 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.1 | 0.8 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.1 | 0.5 | GO:0016623 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
| 0.1 | 40.7 | GO:0005509 | calcium ion binding(GO:0005509) |
| 0.1 | 0.4 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
| 0.1 | 1.4 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
| 0.1 | 0.4 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 0.1 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.1 | 0.3 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
| 0.1 | 4.2 | GO:0008237 | metallopeptidase activity(GO:0008237) |
| 0.1 | 1.5 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.1 | 0.9 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.3 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
| 0.1 | 0.3 | GO:0032356 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
| 0.1 | 0.8 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.1 | 0.3 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.1 | 0.8 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.1 | 1.0 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
| 0.1 | 3.7 | GO:0008013 | beta-catenin binding(GO:0008013) |
| 0.1 | 0.7 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.1 | 0.2 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.1 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 0.2 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.1 | 1.4 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.1 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
| 0.1 | 3.7 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
| 0.1 | 0.3 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.1 | 0.2 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.1 | 0.5 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.1 | 0.3 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 0.1 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.1 | 0.2 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.1 | 0.5 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.1 | 0.6 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.1 | 0.7 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.1 | 0.2 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.1 | 0.3 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.1 | 0.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.1 | 0.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.1 | 0.6 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
| 0.1 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.1 | 0.3 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.1 | 31.8 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
| 0.1 | 0.3 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.1 | 0.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 0.2 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.0 | 0.0 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 1.2 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.0 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.0 | GO:0070697 | activin receptor binding(GO:0070697) |
| 0.0 | 0.0 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.0 | 0.7 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.0 | 0.2 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.0 | 0.0 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.0 | 0.3 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.0 | 0.2 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.0 | 0.1 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
| 0.0 | 0.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.1 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.0 | 0.4 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.0 | 0.0 | GO:0098631 | protein binding involved in cell adhesion(GO:0098631) |
| 0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 1.6 | GO:0005179 | hormone activity(GO:0005179) |
| 0.0 | 0.2 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.0 | 0.1 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
| 0.0 | 5.6 | GO:0001071 | nucleic acid binding transcription factor activity(GO:0001071) transcription factor activity, sequence-specific DNA binding(GO:0003700) |
| 0.0 | 0.1 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
| 0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.0 | 0.5 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
| 0.0 | 0.1 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.0 | GO:0023023 | MHC protein complex binding(GO:0023023) |
| 0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 0.1 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.5 | 22.3 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 1.0 | 14.4 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.9 | 3.6 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.9 | 7.8 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.9 | 23.9 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.8 | 35.3 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.7 | 17.9 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.7 | 2.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.7 | 8.0 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.7 | 16.0 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.7 | 11.8 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.6 | 7.6 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.6 | 3.8 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.6 | 10.5 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.6 | 5.3 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.6 | 18.9 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.6 | 18.9 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.6 | 14.9 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.5 | 15.5 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.5 | 8.5 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.5 | 9.9 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.5 | 9.7 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.5 | 71.4 | NABA CORE MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
| 0.5 | 19.5 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.5 | 30.5 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.4 | 2.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.4 | 6.6 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.4 | 2.3 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.4 | 14.1 | PID BMP PATHWAY | BMP receptor signaling |
| 0.4 | 4.8 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.4 | 3.7 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.4 | 1.5 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.4 | 2.8 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.3 | 0.7 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.3 | 13.4 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.3 | 0.6 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.3 | 2.9 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.3 | 0.9 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.3 | 0.6 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.3 | 4.5 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.3 | 1.9 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.3 | 37.7 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.3 | 5.0 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.3 | 5.9 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.3 | 0.8 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.2 | 0.9 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.2 | 0.6 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.2 | 4.2 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.2 | 2.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.2 | 42.9 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.2 | 3.3 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.2 | 3.1 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.2 | 0.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.2 | 4.1 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.1 | 0.1 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.1 | 0.8 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.1 | 1.3 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.1 | 1.7 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.1 | 1.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.1 | 1.6 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.1 | 1.6 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 0.2 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 1.3 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.1 | 1.6 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.1 | 1.8 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.1 | 2.3 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.1 | 0.6 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.1 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.1 | 1.1 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.1 | 10.7 | NABA MATRISOME | Ensemble of genes encoding extracellular matrix and extracellular matrix-associated proteins |
| 0.1 | 0.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.1 | 0.4 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.0 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.0 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.4 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.0 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.1 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.2 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.0 | 2.0 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 1.6 | 34.6 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 1.6 | 36.9 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 1.5 | 13.2 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 1.4 | 21.3 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 1.4 | 16.8 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 1.3 | 18.4 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 1.3 | 10.5 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 1.2 | 13.7 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 1.2 | 29.2 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 1.1 | 2.1 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
| 1.0 | 38.4 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 1.0 | 13.3 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.9 | 9.0 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.9 | 10.7 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.9 | 9.6 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.9 | 9.5 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.9 | 9.4 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.8 | 3.3 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.8 | 19.0 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.8 | 7.9 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.8 | 3.0 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
| 0.7 | 5.9 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.7 | 13.4 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.7 | 30.0 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.7 | 46.7 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.7 | 1.3 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.7 | 2.0 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.6 | 0.6 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.6 | 1.9 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.6 | 8.1 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.6 | 4.9 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.6 | 7.7 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.6 | 15.3 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.6 | 12.6 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.6 | 3.4 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
| 0.6 | 3.3 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.5 | 2.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.5 | 18.6 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.5 | 19.9 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.5 | 10.0 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.5 | 5.3 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.5 | 4.2 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.5 | 4.1 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.4 | 4.0 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.4 | 6.1 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.4 | 3.4 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
| 0.4 | 1.7 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.4 | 8.3 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.4 | 3.2 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.4 | 7.8 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.4 | 4.2 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
| 0.4 | 4.5 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.4 | 6.3 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.4 | 5.2 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.4 | 6.8 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.3 | 2.4 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.3 | 3.5 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.3 | 2.5 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.3 | 2.2 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.3 | 6.2 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.3 | 13.8 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
| 0.3 | 4.5 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.3 | 0.3 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.3 | 3.4 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.3 | 40.7 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.3 | 4.1 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.3 | 3.5 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.2 | 2.5 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.2 | 8.1 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.2 | 2.0 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.2 | 0.9 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.2 | 1.7 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.2 | 1.0 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.2 | 1.6 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.2 | 2.6 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.2 | 0.4 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.2 | 4.4 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
| 0.2 | 0.4 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.2 | 2.4 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.2 | 7.5 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.2 | 0.4 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.2 | 0.7 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.2 | 11.6 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.2 | 1.0 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.2 | 1.7 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.2 | 3.0 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.2 | 0.2 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
| 0.2 | 9.1 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.1 | 2.3 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.1 | 0.9 | REACTOME DEFENSINS | Genes involved in Defensins |
| 0.1 | 0.3 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.1 | 1.2 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.1 | 0.2 | REACTOME NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Neurotransmitter Release Cycle |
| 0.1 | 0.1 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.1 | 0.8 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.1 | 0.5 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.1 | 0.7 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.1 | 0.4 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.1 | 0.9 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
| 0.1 | 0.6 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.1 | 0.8 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.1 | 0.1 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.1 | 0.5 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.1 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 0.3 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.1 | 0.2 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.1 | 0.2 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.1 | 0.3 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.1 | 0.6 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.0 | 0.5 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 0.1 | REACTOME ACETYLCHOLINE BINDING AND DOWNSTREAM EVENTS | Genes involved in Acetylcholine Binding And Downstream Events |
| 0.0 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.2 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 0.1 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.0 | 0.1 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.3 | REACTOME ION CHANNEL TRANSPORT | Genes involved in Ion channel transport |