Gene Symbol | Gene ID | Gene Info |
---|---|---|
Nkx2-9
|
ENSMUSG00000058669.7 | Nkx2-9 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Nkx2-9 | chr12_56612812_56613598 | 79 | 0.950279 | 0.59 | 8.0e-07 | Click! |
Nkx2-9 | chr12_56611649_56612610 | 1155 | 0.317592 | 0.35 | 5.6e-03 | Click! |
Nkx2-9 | chr12_56614156_56614445 | 1016 | 0.399010 | 0.29 | 2.3e-02 | Click! |
Nkx2-9 | chr12_56615446_56615597 | 2237 | 0.195780 | -0.22 | 8.5e-02 | Click! |
Nkx2-9 | chr12_56614526_56614818 | 1388 | 0.295894 | 0.15 | 2.7e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr8_57320946_57324000 | 5.13 |
Hand2os1 |
Hand2, opposite strand 1 |
1245 |
0.3 |
chr12_103336507_103336792 | 3.49 |
Asb2 |
ankyrin repeat and SOCS box-containing 2 |
85 |
0.72 |
chr10_3368375_3368998 | 3.44 |
Ppp1r14c |
protein phosphatase 1, regulatory inhibitor subunit 14C |
2142 |
0.36 |
chr2_69672410_69673170 | 3.40 |
Klhl41 |
kelch-like 41 |
2670 |
0.21 |
chr6_119195676_119196202 | 3.27 |
Cacna1c |
calcium channel, voltage-dependent, L type, alpha 1C subunit |
292 |
0.91 |
chr1_43196103_43196958 | 3.26 |
Fhl2 |
four and a half LIM domains 2 |
231 |
0.93 |
chr1_51288641_51290950 | 3.25 |
Cavin2 |
caveolae associated 2 |
669 |
0.72 |
chr11_104577433_104578193 | 3.15 |
Myl4 |
myosin, light polypeptide 4 |
532 |
0.64 |
chr10_58394296_58394848 | 2.94 |
Lims1 |
LIM and senescent cell antigen-like domains 1 |
184 |
0.95 |
chr2_91120400_91120551 | 2.84 |
Mybpc3 |
myosin binding protein C, cardiac |
2331 |
0.18 |
chr3_142429664_142430381 | 2.80 |
Pdlim5 |
PDZ and LIM domain 5 |
34326 |
0.16 |
chr1_91351519_91351937 | 2.65 |
Klhl30 |
kelch-like 30 |
712 |
0.52 |
chr9_44069466_44069831 | 2.64 |
Usp2 |
ubiquitin specific peptidase 2 |
205 |
0.83 |
chr1_135799428_135800706 | 2.59 |
Tnni1 |
troponin I, skeletal, slow 1 |
234 |
0.9 |
chr7_19411651_19412289 | 2.48 |
Ckm |
creatine kinase, muscle |
907 |
0.3 |
chr5_147992927_147993358 | 2.45 |
Mtus2 |
microtubule associated tumor suppressor candidate 2 |
35800 |
0.15 |
chr2_91118182_91118787 | 2.36 |
Mybpc3 |
myosin binding protein C, cardiac |
340 |
0.81 |
chr3_30010716_30011762 | 2.32 |
Mecom |
MDS1 and EVI1 complex locus |
200 |
0.91 |
chr7_48847211_48847926 | 2.30 |
Csrp3 |
cysteine and glycine-rich protein 3 |
465 |
0.76 |
chr19_53679305_53679727 | 2.26 |
Rbm20 |
RNA binding motif protein 20 |
2210 |
0.3 |
chr9_95256675_95257394 | 2.26 |
Slc9a9 |
solute carrier family 9 (sodium/hydrogen exchanger), member 9 |
135348 |
0.04 |
chr18_11057575_11058184 | 2.24 |
Gata6 |
GATA binding protein 6 |
1168 |
0.53 |
chr1_135838304_135838637 | 2.23 |
Tnnt2 |
troponin T2, cardiac |
2057 |
0.23 |
chr8_45660711_45661611 | 2.20 |
Sorbs2 |
sorbin and SH3 domain containing 2 |
832 |
0.66 |
chr6_119194389_119194967 | 2.13 |
Cacna1c |
calcium channel, voltage-dependent, L type, alpha 1C subunit |
1553 |
0.37 |
chr11_5802324_5803834 | 2.11 |
Pgam2 |
phosphoglycerate mutase 2 |
654 |
0.56 |
chr17_81737002_81738450 | 2.07 |
Slc8a1 |
solute carrier family 8 (sodium/calcium exchanger), member 1 |
651 |
0.81 |
chr5_74161401_74162605 | 2.06 |
A330058E17Rik |
RIKEN cDNA A330058E17 gene |
14047 |
0.14 |
chr14_63244119_63245953 | 2.06 |
Gata4 |
GATA binding protein 4 |
212 |
0.93 |
chr9_24773249_24774873 | 2.02 |
Tbx20 |
T-box 20 |
223 |
0.92 |
chr14_54987002_54987576 | 2.01 |
Myh7 |
myosin, heavy polypeptide 7, cardiac muscle, beta |
129 |
0.88 |
chr14_20663037_20663711 | 1.97 |
Synpo2l |
synaptopodin 2-like |
1200 |
0.26 |
chr19_24046514_24046795 | 1.97 |
Fam189a2 |
family with sequence similarity 189, member A2 |
15635 |
0.16 |
chr6_112459682_112460792 | 1.95 |
Cav3 |
caveolin 3 |
732 |
0.65 |
chr2_178411563_178412733 | 1.90 |
Ppp1r3d |
protein phosphatase 1, regulatory subunit 3D |
2324 |
0.22 |
chr7_126248023_126249285 | 1.89 |
Sbk1 |
SH3-binding kinase 1 |
208 |
0.69 |
chr14_54962885_54964094 | 1.83 |
Myh6 |
myosin, heavy polypeptide 6, cardiac muscle, alpha |
3085 |
0.08 |
chr2_180331993_180332571 | 1.83 |
Gata5os |
GATA binding protein 5, opposite strand |
575 |
0.63 |
chr18_65393472_65393826 | 1.82 |
Alpk2 |
alpha-kinase 2 |
245 |
0.87 |
chr7_19768817_19769198 | 1.81 |
Bcam |
basal cell adhesion molecule |
1488 |
0.17 |
chr6_97929540_97930859 | 1.81 |
Mitf |
melanogenesis associated transcription factor |
400 |
0.89 |
chr12_52856330_52856518 | 1.79 |
Akap6 |
A kinase (PRKA) anchor protein 6 |
60588 |
0.14 |
chr6_99203165_99203959 | 1.78 |
Foxp1 |
forkhead box P1 |
40544 |
0.2 |
chr2_92140355_92141595 | 1.77 |
Phf21a |
PHD finger protein 21A |
43131 |
0.11 |
chr5_122103035_122103526 | 1.74 |
Myl2 |
myosin, light polypeptide 2, regulatory, cardiac, slow |
99 |
0.96 |
chr10_84439190_84439711 | 1.72 |
Nuak1 |
NUAK family, SNF1-like kinase, 1 |
1147 |
0.35 |
chr17_12766020_12767485 | 1.72 |
Igf2r |
insulin-like growth factor 2 receptor |
2912 |
0.17 |
chr8_35378537_35379185 | 1.70 |
Ppp1r3b |
protein phosphatase 1, regulatory subunit 3B |
2201 |
0.24 |
chr9_75775275_75776608 | 1.69 |
Bmp5 |
bone morphogenetic protein 5 |
577 |
0.78 |
chr5_88711618_88712231 | 1.69 |
Mob1b |
MOB kinase activator 1B |
8931 |
0.16 |
chr1_135839024_135839175 | 1.68 |
Tnnt2 |
troponin T2, cardiac |
1600 |
0.28 |
chr6_119194163_119194363 | 1.67 |
Dcp1b |
decapping mRNA 1B |
1907 |
0.3 |
chr17_69167346_69168046 | 1.66 |
Epb41l3 |
erythrocyte membrane protein band 4.1 like 3 |
10838 |
0.27 |
chr9_56864653_56866648 | 1.66 |
Cspg4 |
chondroitin sulfate proteoglycan 4 |
617 |
0.51 |
chr14_63245964_63246115 | 1.65 |
Gata4 |
GATA binding protein 4 |
768 |
0.63 |
chr19_25412451_25412980 | 1.64 |
Kank1 |
KN motif and ankyrin repeat domains 1 |
6016 |
0.23 |
chr2_180388160_180389480 | 1.64 |
Mir1a-1 |
microRNA 1a-1 |
228 |
0.89 |
chr3_109772056_109772600 | 1.63 |
Ntng1 |
netrin G1 |
60931 |
0.13 |
chr3_19647711_19647862 | 1.63 |
Trim55 |
tripartite motif-containing 55 |
3278 |
0.2 |
chr15_25941347_25942080 | 1.62 |
Retreg1 |
reticulophagy regulator 1 |
826 |
0.63 |
chr8_57213759_57214585 | 1.62 |
Gm17994 |
predicted gene, 17994 |
77880 |
0.08 |
chr10_93307247_93307878 | 1.62 |
Elk3 |
ELK3, member of ETS oncogene family |
3249 |
0.21 |
chr14_31211131_31211749 | 1.61 |
Tnnc1 |
troponin C, cardiac/slow skeletal |
3108 |
0.13 |
chr11_5897192_5898699 | 1.60 |
Myl7 |
myosin, light polypeptide 7, regulatory |
837 |
0.46 |
chr6_145935645_145936179 | 1.58 |
Sspn |
sarcospan |
1790 |
0.31 |
chr7_31053809_31054516 | 1.58 |
Fxyd1 |
FXYD domain-containing ion transport regulator 1 |
117 |
0.91 |
chr3_36481601_36482189 | 1.57 |
1810062G17Rik |
RIKEN cDNA 1810062G17 gene |
5958 |
0.12 |
chr18_61651079_61652393 | 1.57 |
Mir143 |
microRNA 143 |
2478 |
0.16 |
chr3_123033789_123034940 | 1.57 |
Myoz2 |
myozenin 2 |
480 |
0.73 |
chr1_73959560_73959947 | 1.56 |
Tns1 |
tensin 1 |
3290 |
0.3 |
chr6_71261498_71261790 | 1.54 |
Smyd1 |
SET and MYND domain containing 1 |
588 |
0.59 |
chr8_45659789_45659954 | 1.53 |
Sorbs2 |
sorbin and SH3 domain containing 2 |
1067 |
0.56 |
chr15_6873552_6875064 | 1.53 |
Osmr |
oncostatin M receptor |
12 |
0.99 |
chr4_62699646_62700723 | 1.52 |
Rgs3 |
regulator of G-protein signaling 3 |
504 |
0.76 |
chr10_63457257_63458786 | 1.51 |
Ctnna3 |
catenin (cadherin associated protein), alpha 3 |
511 |
0.78 |
chr5_122101429_122101581 | 1.50 |
Myl2 |
myosin, light polypeptide 2, regulatory, cardiac, slow |
75 |
0.96 |
chr9_110763098_110763394 | 1.48 |
Myl3 |
myosin, light polypeptide 3 |
400 |
0.76 |
chr17_46026212_46026936 | 1.48 |
Vegfa |
vascular endothelial growth factor A |
1693 |
0.33 |
chr14_54991806_54993467 | 1.48 |
Myh7 |
myosin, heavy polypeptide 7, cardiac muscle, beta |
1055 |
0.25 |
chr9_107596249_107596487 | 1.48 |
Lsmem2 |
leucine-rich single-pass membrane protein 2 |
707 |
0.32 |
chr4_124178294_124179256 | 1.47 |
Gm37667 |
predicted gene, 37667 |
100402 |
0.06 |
chr6_135362982_135365483 | 1.47 |
Emp1 |
epithelial membrane protein 1 |
1164 |
0.42 |
chr14_30490880_30491293 | 1.47 |
Cacna1d |
calcium channel, voltage-dependent, L type, alpha 1D subunit |
367 |
0.84 |
chr19_6384347_6385874 | 1.46 |
Pygm |
muscle glycogen phosphorylase |
695 |
0.45 |
chr1_43160684_43161180 | 1.45 |
Fhl2 |
four and a half LIM domains 2 |
3029 |
0.23 |
chr8_104101710_104103631 | 1.44 |
Cdh5 |
cadherin 5 |
1045 |
0.43 |
chr15_66559688_66560010 | 1.42 |
Tmem71 |
transmembrane protein 71 |
1254 |
0.49 |
chr18_58206427_58207135 | 1.42 |
Fbn2 |
fibrillin 2 |
3145 |
0.33 |
chr13_9128006_9128583 | 1.42 |
Larp4b |
La ribonucleoprotein domain family, member 4B |
7921 |
0.16 |
chr16_97359346_97359968 | 1.41 |
Bace2 |
beta-site APP-cleaving enzyme 2 |
2915 |
0.29 |
chr10_33084786_33085000 | 1.41 |
Trdn |
triadin |
1332 |
0.54 |
chr2_105163268_105163700 | 1.41 |
Wt1 |
Wilms tumor 1 homolog |
676 |
0.72 |
chr7_142662290_142664788 | 1.40 |
Igf2os |
insulin-like growth factor 2, opposite strand |
1599 |
0.21 |
chr7_67043727_67044251 | 1.40 |
Adamts17 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 17 |
3482 |
0.25 |
chr4_147986271_147987020 | 1.39 |
Nppb |
natriuretic peptide type B |
857 |
0.42 |
chr13_63241575_63242090 | 1.38 |
Aopep |
aminopeptidase O |
1724 |
0.2 |
chr18_38188855_38189945 | 1.38 |
Pcdh1 |
protocadherin 1 |
13763 |
0.13 |
chr7_122045829_122046314 | 1.37 |
Ears2 |
glutamyl-tRNA synthetase 2, mitochondrial |
20940 |
0.1 |
chr2_17459201_17459498 | 1.36 |
Nebl |
nebulette |
1272 |
0.59 |
chr5_102768473_102769767 | 1.35 |
Arhgap24 |
Rho GTPase activating protein 24 |
349 |
0.93 |
chr4_102254418_102255744 | 1.34 |
Pde4b |
phosphodiesterase 4B, cAMP specific |
78 |
0.99 |
chr10_120900011_120900716 | 1.33 |
Gm4473 |
predicted gene 4473 |
1206 |
0.3 |
chr3_128192124_128192781 | 1.33 |
D030025E07Rik |
RIKEN cDNA D030025E07 gene |
39101 |
0.18 |
chr3_79180890_79182068 | 1.33 |
Rapgef2 |
Rap guanine nucleotide exchange factor (GEF) 2 |
139 |
0.96 |
chr13_74362852_74363978 | 1.33 |
Lrrc14b |
leucine rich repeat containing 14B |
590 |
0.54 |
chr10_33085123_33085496 | 1.33 |
Trdn |
triadin |
1748 |
0.46 |
chr2_156776920_156777878 | 1.33 |
Myl9 |
myosin, light polypeptide 9, regulatory |
1118 |
0.36 |
chr19_56388317_56388468 | 1.32 |
Nrap |
nebulin-related anchoring protein |
1485 |
0.37 |
chr14_79645123_79645681 | 1.31 |
Cnmd |
chondromodulin |
108 |
0.96 |
chr2_122576443_122576913 | 1.31 |
Gatm |
glycine amidinotransferase (L-arginine:glycine amidinotransferase) |
21856 |
0.15 |
chr15_98606691_98607532 | 1.31 |
Adcy6 |
adenylate cyclase 6 |
522 |
0.61 |
chr12_117657998_117660727 | 1.30 |
Rapgef5 |
Rap guanine nucleotide exchange factor (GEF) 5 |
1328 |
0.51 |
chr6_136620290_136620893 | 1.29 |
Gm44401 |
predicted gene, 44401 |
41 |
0.97 |
chr11_82910336_82910848 | 1.29 |
Unc45b |
unc-45 myosin chaperone B |
42 |
0.94 |
chr7_44474127_44475010 | 1.29 |
5430431A17Rik |
RIKEN cDNA 5430431A17 gene |
1030 |
0.25 |
chr5_104095485_104095998 | 1.28 |
Gm26703 |
predicted gene, 26703 |
13476 |
0.11 |
chr7_4522809_4523120 | 1.27 |
Tnni3 |
troponin I, cardiac 3 |
170 |
0.87 |
chr12_117743663_117743926 | 1.27 |
Rapgef5 |
Rap guanine nucleotide exchange factor (GEF) 5 |
3199 |
0.27 |
chr16_16526595_16527684 | 1.27 |
Fgd4 |
FYVE, RhoGEF and PH domain containing 4 |
272 |
0.92 |
chr18_60646141_60646566 | 1.26 |
Synpo |
synaptopodin |
1919 |
0.32 |
chrX_11437076_11437384 | 1.26 |
H2al1j |
H2A histone family member L1J |
109408 |
0.05 |
chr16_87611121_87611369 | 1.26 |
Gm22808 |
predicted gene, 22808 |
9875 |
0.19 |
chr11_82911356_82912079 | 1.25 |
Unc45b |
unc-45 myosin chaperone B |
464 |
0.63 |
chr18_10786308_10786708 | 1.25 |
Mir133a-1hg |
Mir133a-1, Mir1b and Mir1a-2 host gene |
625 |
0.41 |
chr6_119193258_119193409 | 1.25 |
Dcp1b |
decapping mRNA 1B |
977 |
0.55 |
chr16_22108024_22108260 | 1.25 |
Igf2bp2 |
insulin-like growth factor 2 mRNA binding protein 2 |
13094 |
0.18 |
chr18_11055800_11055951 | 1.24 |
Gata6 |
GATA binding protein 6 |
837 |
0.64 |
chr1_135324343_135325907 | 1.24 |
Lmod1 |
leiomodin 1 (smooth muscle) |
318 |
0.83 |
chr3_144759885_144761021 | 1.23 |
Clca3a1 |
chloride channel accessory 3A1 |
388 |
0.78 |
chrX_49786754_49787740 | 1.23 |
Igsf1 |
immunoglobulin superfamily, member 1 |
996 |
0.6 |
chr14_63242393_63242968 | 1.23 |
Gata4 |
GATA binding protein 4 |
2568 |
0.26 |
chr19_40376409_40376771 | 1.22 |
Sorbs1 |
sorbin and SH3 domain containing 1 |
284 |
0.93 |
chr16_38364563_38365451 | 1.22 |
Popdc2 |
popeye domain containing 2 |
2762 |
0.17 |
chr7_15963733_15964484 | 1.22 |
Ehd2 |
EH-domain containing 2 |
3367 |
0.13 |
chr17_5769888_5770950 | 1.22 |
3300005D01Rik |
RIKEN cDNA 3300005D01 gene |
28238 |
0.15 |
chr9_32701032_32702235 | 1.22 |
Ets1 |
E26 avian leukemia oncogene 1, 5' domain |
5249 |
0.2 |
chr16_92427997_92428711 | 1.21 |
Rcan1 |
regulator of calcineurin 1 |
28277 |
0.11 |
chr9_71588753_71589279 | 1.21 |
Myzap |
myocardial zonula adherens protein |
3249 |
0.25 |
chr4_98789544_98790709 | 1.21 |
Kank4os |
KN motif and ankyrin repeat domains 4, opposite strand |
3642 |
0.19 |
chr8_45888861_45889164 | 1.20 |
Pdlim3 |
PDZ and LIM domain 3 |
3492 |
0.17 |
chr9_21337624_21338958 | 1.20 |
Slc44a2 |
solute carrier family 44, member 2 |
463 |
0.67 |
chr1_77080723_77080989 | 1.19 |
Gm816 |
predicted gene 816 |
53064 |
0.14 |
chr5_57721137_57722906 | 1.19 |
Pcdh7 |
protocadherin 7 |
108 |
0.94 |
chr2_137115145_137115830 | 1.18 |
Jag1 |
jagged 1 |
1157 |
0.62 |
chr13_51155587_51156096 | 1.18 |
Nxnl2 |
nucleoredoxin-like 2 |
15181 |
0.16 |
chr6_146726570_146727178 | 1.18 |
Stk38l |
serine/threonine kinase 38 like |
1562 |
0.33 |
chr3_79887847_79889192 | 1.18 |
Gm36569 |
predicted gene, 36569 |
1713 |
0.31 |
chr3_30009457_30010152 | 1.17 |
Mecom |
MDS1 and EVI1 complex locus |
1635 |
0.36 |
chr19_24861287_24862270 | 1.17 |
Pgm5 |
phosphoglucomutase 5 |
77 |
0.96 |
chr10_53635516_53636000 | 1.16 |
Fam184a |
family with sequence similarity 184, member A |
2511 |
0.19 |
chr15_58323092_58323511 | 1.16 |
Klhl38 |
kelch-like 38 |
868 |
0.62 |
chr19_36117589_36118325 | 1.16 |
Ankrd1 |
ankyrin repeat domain 1 (cardiac muscle) |
1953 |
0.34 |
chr11_59003437_59003818 | 1.16 |
Gm10435 |
predicted gene 10435 |
717 |
0.4 |
chrX_73775197_73775531 | 1.15 |
Srpk3 |
serine/arginine-rich protein specific kinase 3 |
959 |
0.34 |
chr16_25683728_25684269 | 1.15 |
Trp63 |
transformation related protein 63 |
233 |
0.94 |
chr5_119829778_119830485 | 1.15 |
Gm43050 |
predicted gene 43050 |
1660 |
0.31 |
chr10_69617478_69618016 | 1.15 |
Gm46231 |
predicted gene, 46231 |
51386 |
0.16 |
chr13_46420548_46420948 | 1.14 |
Rbm24 |
RNA binding motif protein 24 |
197 |
0.96 |
chr8_35377349_35377500 | 1.14 |
Ppp1r3b |
protein phosphatase 1, regulatory subunit 3B |
764 |
0.47 |
chr19_56388806_56389568 | 1.14 |
Nrap |
nebulin-related anchoring protein |
690 |
0.66 |
chr9_58309544_58310675 | 1.14 |
Loxl1 |
lysyl oxidase-like 1 |
3077 |
0.21 |
chrX_101449122_101450190 | 1.13 |
Itgb1bp2 |
integrin beta 1 binding protein 2 |
568 |
0.66 |
chr17_8433318_8434839 | 1.13 |
T |
brachyury, T-box transcription factor T |
345 |
0.87 |
chr7_136007847_136008710 | 1.13 |
Gm9341 |
predicted gene 9341 |
55480 |
0.13 |
chr12_73910432_73911326 | 1.13 |
Hif1a |
hypoxia inducible factor 1, alpha subunit |
2975 |
0.22 |
chr2_66783826_66785264 | 1.12 |
Scn7a |
sodium channel, voltage-gated, type VII, alpha |
369 |
0.91 |
chr9_24762716_24763169 | 1.12 |
Tbx20 |
T-box 20 |
6738 |
0.2 |
chr18_65085107_65085852 | 1.12 |
Nedd4l |
neural precursor cell expressed, developmentally down-regulated gene 4-like |
2425 |
0.36 |
chr13_41510901_41511052 | 1.12 |
Nedd9 |
neural precursor cell expressed, developmentally down-regulated gene 9 |
23614 |
0.13 |
chr14_63251160_63252593 | 1.12 |
Gata4 |
GATA binding protein 4 |
6605 |
0.19 |
chr15_85297584_85298676 | 1.12 |
Fbln1 |
fibulin 1 |
34676 |
0.14 |
chr8_23387554_23388175 | 1.12 |
Sfrp1 |
secreted frizzled-related protein 1 |
23638 |
0.21 |
chr8_46209751_46210307 | 1.12 |
Slc25a4 |
solute carrier family 25 (mitochondrial carrier, adenine nucleotide translocator), member 4 |
1001 |
0.38 |
chr1_83407298_83408547 | 1.11 |
Sphkap |
SPHK1 interactor, AKAP domain containing |
217 |
0.94 |
chr13_12334755_12335919 | 1.11 |
Actn2 |
actinin alpha 2 |
5387 |
0.19 |
chr7_15966801_15967249 | 1.11 |
Ehd2 |
EH-domain containing 2 |
450 |
0.69 |
chr6_119713129_119713393 | 1.11 |
Erc1 |
ELKS/RAB6-interacting/CAST family member 1 |
30183 |
0.21 |
chrX_114477896_114478376 | 1.11 |
Klhl4 |
kelch-like 4 |
3532 |
0.28 |
chr10_69536011_69536410 | 1.09 |
Ank3 |
ankyrin 3, epithelial |
1988 |
0.39 |
chr5_122101598_122101934 | 1.09 |
Myl2 |
myosin, light polypeptide 2, regulatory, cardiac, slow |
31 |
0.97 |
chr2_137191943_137192517 | 1.09 |
Gm28214 |
predicted gene 28214 |
6753 |
0.29 |
chr15_92520747_92521652 | 1.09 |
Pdzrn4 |
PDZ domain containing RING finger 4 |
34538 |
0.23 |
chr9_24768202_24768375 | 1.09 |
Tbx20 |
T-box 20 |
1392 |
0.42 |
chr17_72921491_72924008 | 1.08 |
Lbh |
limb-bud and heart |
1561 |
0.47 |
chr14_69611536_69611961 | 1.08 |
Loxl2 |
lysyl oxidase-like 2 |
2270 |
0.18 |
chr15_41819857_41820760 | 1.08 |
Oxr1 |
oxidation resistance 1 |
10624 |
0.21 |
chr1_168890384_168890659 | 1.08 |
Mir6354 |
microRNA 6354 |
128568 |
0.06 |
chr17_43390382_43390611 | 1.08 |
Adgrf5 |
adhesion G protein-coupled receptor F5 |
1008 |
0.62 |
chr14_101510884_101511350 | 1.08 |
Tbc1d4 |
TBC1 domain family, member 4 |
3791 |
0.3 |
chr10_93672331_93673286 | 1.07 |
Gm8580 |
predicted gene 8580 |
6962 |
0.14 |
chr16_36989294_36990265 | 1.07 |
Fbxo40 |
F-box protein 40 |
688 |
0.6 |
chr9_32697004_32697902 | 1.07 |
Ets1 |
E26 avian leukemia oncogene 1, 5' domain |
1069 |
0.51 |
chr7_110619204_110619774 | 1.06 |
Sbf2 |
SET binding factor 2 |
4567 |
0.18 |
chr6_142700636_142701025 | 1.06 |
Abcc9 |
ATP-binding cassette, sub-family C (CFTR/MRP), member 9 |
1388 |
0.47 |
chr14_103841831_103842556 | 1.06 |
Ednrb |
endothelin receptor type B |
1502 |
0.53 |
chr1_135836765_135837624 | 1.05 |
Tnnt2 |
troponin T2, cardiac |
781 |
0.54 |
chr14_54961452_54961727 | 1.05 |
Myh6 |
myosin, heavy polypeptide 6, cardiac muscle, alpha |
3682 |
0.07 |
chr8_41014606_41014939 | 1.05 |
Mtus1 |
mitochondrial tumor suppressor 1 |
1548 |
0.32 |
chr17_81736193_81736564 | 1.04 |
Slc8a1 |
solute carrier family 8 (sodium/calcium exchanger), member 1 |
1999 |
0.44 |
chr10_3718250_3718784 | 1.04 |
Plekhg1 |
pleckstrin homology domain containing, family G (with RhoGef domain) member 1 |
21847 |
0.25 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.2 | 6.7 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
1.7 | 8.7 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
1.6 | 1.6 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
1.5 | 6.0 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
1.4 | 4.2 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
1.4 | 5.6 | GO:0035995 | detection of muscle stretch(GO:0035995) |
1.2 | 2.5 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
1.2 | 4.7 | GO:0003175 | tricuspid valve development(GO:0003175) |
1.0 | 5.1 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
1.0 | 2.0 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.9 | 2.8 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.8 | 8.2 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.8 | 2.4 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.8 | 2.3 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.7 | 2.2 | GO:0061325 | cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
0.7 | 0.7 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.7 | 2.2 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.7 | 3.5 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.7 | 2.0 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.6 | 3.9 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.6 | 1.9 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.6 | 1.7 | GO:0090259 | regulation of retinal ganglion cell axon guidance(GO:0090259) |
0.6 | 3.3 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.6 | 1.7 | GO:0060618 | nipple development(GO:0060618) |
0.5 | 1.6 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.5 | 1.6 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.5 | 1.6 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.5 | 3.2 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.5 | 1.1 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.5 | 2.1 | GO:0003257 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) |
0.5 | 1.6 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.5 | 1.5 | GO:0086069 | bundle of His cell to Purkinje myocyte communication(GO:0086069) |
0.5 | 1.0 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.5 | 2.0 | GO:0032345 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.5 | 2.4 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.5 | 1.9 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
0.5 | 1.9 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.5 | 1.9 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.5 | 0.5 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.5 | 1.4 | GO:0007525 | somatic muscle development(GO:0007525) |
0.5 | 0.9 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
0.5 | 1.4 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.4 | 1.8 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.4 | 2.6 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
0.4 | 0.4 | GO:0003256 | regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003256) |
0.4 | 1.3 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.4 | 1.3 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.4 | 1.7 | GO:0007494 | midgut development(GO:0007494) |
0.4 | 1.7 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.4 | 0.8 | GO:1904192 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.4 | 2.4 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.4 | 0.8 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
0.4 | 2.4 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.4 | 0.4 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.4 | 1.1 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.4 | 3.7 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.4 | 0.7 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.4 | 1.8 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.4 | 1.4 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.4 | 0.7 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.3 | 0.7 | GO:0003164 | His-Purkinje system development(GO:0003164) bundle of His development(GO:0003166) |
0.3 | 0.7 | GO:0048369 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.3 | 1.3 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.3 | 1.0 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.3 | 6.0 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.3 | 1.3 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.3 | 2.0 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
0.3 | 0.6 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.3 | 1.9 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
0.3 | 0.9 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.3 | 2.8 | GO:0060421 | positive regulation of heart growth(GO:0060421) |
0.3 | 0.9 | GO:0060435 | bronchiole development(GO:0060435) |
0.3 | 0.3 | GO:0042520 | positive regulation of tyrosine phosphorylation of Stat4 protein(GO:0042520) |
0.3 | 1.5 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.3 | 0.9 | GO:0060486 | Clara cell differentiation(GO:0060486) |
0.3 | 0.9 | GO:0032346 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) |
0.3 | 0.9 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.3 | 1.5 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.3 | 1.2 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.3 | 0.3 | GO:0070384 | Harderian gland development(GO:0070384) |
0.3 | 0.9 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.3 | 1.2 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.3 | 0.6 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
0.3 | 0.9 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.3 | 0.6 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.3 | 3.9 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
0.3 | 0.3 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
0.3 | 0.8 | GO:0060437 | lung growth(GO:0060437) |
0.3 | 0.3 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.3 | 1.1 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.3 | 1.1 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.3 | 0.5 | GO:2000041 | regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
0.3 | 0.8 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.3 | 1.0 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.3 | 1.5 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.3 | 0.3 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
0.3 | 0.3 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.3 | 0.8 | GO:0014866 | skeletal myofibril assembly(GO:0014866) |
0.3 | 1.0 | GO:2001212 | regulation of vasculogenesis(GO:2001212) |
0.3 | 1.0 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.3 | 1.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.2 | 0.7 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.2 | 0.7 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.2 | 0.2 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
0.2 | 0.5 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
0.2 | 0.5 | GO:0051795 | positive regulation of catagen(GO:0051795) |
0.2 | 0.7 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.2 | 0.2 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.2 | 0.5 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) |
0.2 | 0.2 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.2 | 1.2 | GO:0032962 | positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
0.2 | 0.7 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.2 | 0.9 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
0.2 | 1.6 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) |
0.2 | 2.3 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
0.2 | 2.3 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
0.2 | 0.9 | GO:0003163 | sinoatrial node development(GO:0003163) |
0.2 | 0.7 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.2 | 0.9 | GO:0014028 | notochord formation(GO:0014028) |
0.2 | 0.7 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.2 | 0.9 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.2 | 1.1 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.2 | 0.6 | GO:0045297 | mating plug formation(GO:0042628) single-organism reproductive behavior(GO:0044704) post-mating behavior(GO:0045297) |
0.2 | 0.9 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.2 | 0.2 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
0.2 | 0.9 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.2 | 0.2 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.2 | 0.2 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.2 | 0.4 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.2 | 1.0 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
0.2 | 0.8 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.2 | 0.8 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.2 | 0.2 | GO:0051794 | regulation of catagen(GO:0051794) |
0.2 | 0.4 | GO:1902946 | protein localization to early endosome(GO:1902946) regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
0.2 | 0.6 | GO:0030421 | defecation(GO:0030421) |
0.2 | 1.7 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.2 | 0.2 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.2 | 0.6 | GO:0060513 | prostatic bud formation(GO:0060513) |
0.2 | 0.8 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.2 | 0.4 | GO:0072107 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
0.2 | 0.2 | GO:0086070 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) SA node cell to atrial cardiac muscle cell communication(GO:0086070) |
0.2 | 0.6 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.2 | 0.4 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
0.2 | 0.4 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.2 | 0.6 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.2 | 1.8 | GO:0086091 | regulation of heart rate by cardiac conduction(GO:0086091) |
0.2 | 2.6 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.2 | 0.4 | GO:0032353 | negative regulation of hormone biosynthetic process(GO:0032353) |
0.2 | 0.4 | GO:0003161 | cardiac conduction system development(GO:0003161) |
0.2 | 1.0 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.2 | 0.6 | GO:0015888 | thiamine transport(GO:0015888) |
0.2 | 1.4 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.2 | 0.8 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.2 | 0.8 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.2 | 1.0 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.2 | 0.8 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.2 | 0.4 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.2 | 0.2 | GO:0060423 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
0.2 | 1.7 | GO:0032060 | bleb assembly(GO:0032060) |
0.2 | 0.7 | GO:0055012 | ventricular cardiac muscle cell differentiation(GO:0055012) |
0.2 | 0.7 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.2 | 0.7 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.2 | 0.4 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
0.2 | 0.5 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.2 | 1.5 | GO:0060420 | regulation of heart growth(GO:0060420) |
0.2 | 0.9 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.2 | 0.4 | GO:0001757 | somite specification(GO:0001757) |
0.2 | 0.9 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.2 | 0.5 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.2 | 0.2 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
0.2 | 0.5 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.2 | 2.9 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
0.2 | 0.9 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.2 | 1.3 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.2 | 0.2 | GO:0060128 | corticotropin hormone secreting cell differentiation(GO:0060128) |
0.2 | 0.7 | GO:0051639 | actin filament network formation(GO:0051639) |
0.2 | 0.4 | GO:0097048 | dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
0.2 | 1.2 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.2 | 0.9 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.2 | 0.5 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
0.2 | 1.9 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.2 | 0.5 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
0.2 | 0.9 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.2 | 0.7 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.2 | 0.3 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.2 | 0.5 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.2 | 0.7 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
0.2 | 0.8 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.2 | 1.0 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
0.2 | 3.3 | GO:0045214 | sarcomere organization(GO:0045214) |
0.2 | 0.3 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.2 | 0.2 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.2 | 0.3 | GO:0014745 | negative regulation of muscle adaptation(GO:0014745) |
0.2 | 0.3 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.2 | 0.3 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.2 | 1.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.2 | 0.6 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.2 | 1.3 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
0.2 | 0.2 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
0.2 | 0.9 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.2 | 2.3 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.2 | 0.6 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.2 | 1.2 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
0.2 | 0.6 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.2 | 0.9 | GO:0072102 | glomerulus morphogenesis(GO:0072102) |
0.2 | 0.9 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.2 | 0.8 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.2 | 0.5 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.2 | 1.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.2 | 0.3 | GO:0031033 | myosin filament organization(GO:0031033) |
0.1 | 0.4 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.1 | 0.4 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.1 | 0.6 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
0.1 | 0.7 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.1 | GO:0003177 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
0.1 | 0.3 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
0.1 | 0.9 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.1 | 1.0 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.1 | 0.3 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.1 | 0.6 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
0.1 | 0.1 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.1 | 0.6 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.1 | 0.6 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.1 | 0.4 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 0.3 | GO:0035793 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.1 | 0.6 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 2.2 | GO:0032232 | negative regulation of actin filament bundle assembly(GO:0032232) |
0.1 | 0.4 | GO:0044849 | estrous cycle(GO:0044849) |
0.1 | 1.0 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.1 | 1.5 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 0.4 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.1 | 0.9 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.1 | 0.9 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.1 | 0.3 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
0.1 | 0.5 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.1 | 0.5 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.1 | 0.3 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.1 | 2.2 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.1 | 0.4 | GO:0071321 | cellular response to cGMP(GO:0071321) |
0.1 | 1.9 | GO:0008210 | estrogen metabolic process(GO:0008210) |
0.1 | 0.9 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.1 | 0.4 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
0.1 | 0.1 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
0.1 | 0.4 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.1 | 0.4 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.1 | 0.9 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.1 | 0.6 | GO:0035989 | tendon development(GO:0035989) |
0.1 | 0.6 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.1 | 1.2 | GO:0055006 | cardiac cell development(GO:0055006) |
0.1 | 0.2 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.1 | 0.4 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.1 | 0.4 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
0.1 | 0.4 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.1 | 0.8 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.1 | 0.2 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.1 | 0.5 | GO:0015705 | iodide transport(GO:0015705) |
0.1 | 0.4 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.1 | 0.6 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
0.1 | 0.1 | GO:0071639 | positive regulation of monocyte chemotactic protein-1 production(GO:0071639) |
0.1 | 0.3 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.2 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 0.4 | GO:1990000 | amyloid fibril formation(GO:1990000) |
0.1 | 0.4 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
0.1 | 0.3 | GO:2000739 | regulation of mesenchymal stem cell differentiation(GO:2000739) positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.1 | 0.3 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.1 | 1.2 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.1 | 0.3 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.1 | 0.2 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.1 | 0.3 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.1 | 0.3 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.1 | 0.4 | GO:0002604 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
0.1 | 1.0 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.1 | 0.3 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
0.1 | 0.4 | GO:0032621 | interleukin-18 production(GO:0032621) |
0.1 | 0.3 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.1 | 0.6 | GO:0014820 | tonic smooth muscle contraction(GO:0014820) |
0.1 | 0.1 | GO:1903726 | negative regulation of phospholipid metabolic process(GO:1903726) |
0.1 | 0.8 | GO:0009251 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
0.1 | 0.9 | GO:0002176 | male germ cell proliferation(GO:0002176) |
0.1 | 0.4 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.1 | 0.1 | GO:0071316 | cellular response to nicotine(GO:0071316) |
0.1 | 0.3 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.1 | 0.2 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.1 | 0.5 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.1 | 0.2 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.1 | 0.2 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.1 | 0.1 | GO:0042693 | muscle cell fate commitment(GO:0042693) |
0.1 | 0.3 | GO:1901201 | regulation of extracellular matrix assembly(GO:1901201) |
0.1 | 0.6 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.1 | 0.3 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.1 | 0.7 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.1 | 0.3 | GO:0051775 | response to redox state(GO:0051775) |
0.1 | 0.1 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.1 | 0.2 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.1 | 0.4 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.1 | 0.1 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.1 | 0.1 | GO:0097195 | pilomotor reflex(GO:0097195) |
0.1 | 0.3 | GO:0090335 | regulation of brown fat cell differentiation(GO:0090335) |
0.1 | 0.2 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
0.1 | 0.6 | GO:0018119 | peptidyl-cysteine S-nitrosylation(GO:0018119) |
0.1 | 0.3 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 0.7 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
0.1 | 0.2 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
0.1 | 0.1 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.1 | 0.3 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 0.2 | GO:0033058 | directional locomotion(GO:0033058) |
0.1 | 0.7 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.1 | 0.4 | GO:0071476 | cellular hypotonic response(GO:0071476) |
0.1 | 0.5 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
0.1 | 0.9 | GO:0030325 | adrenal gland development(GO:0030325) |
0.1 | 0.5 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.7 | GO:0035994 | response to muscle stretch(GO:0035994) |
0.1 | 0.3 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.1 | 0.2 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.1 | 0.1 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.1 | 0.2 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.1 | 0.4 | GO:0034351 | negative regulation of glial cell apoptotic process(GO:0034351) |
0.1 | 0.5 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.1 | 0.2 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
0.1 | 0.1 | GO:0072223 | metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
0.1 | 0.1 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
0.1 | 0.4 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.1 | 0.2 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.1 | 0.2 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.1 | 0.1 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.1 | 0.4 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.1 | 1.5 | GO:0010107 | potassium ion import(GO:0010107) |
0.1 | 0.9 | GO:0014850 | response to muscle activity(GO:0014850) |
0.1 | 0.2 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.1 | 0.3 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.1 | 0.1 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.1 | 0.2 | GO:2000542 | negative regulation of gastrulation(GO:2000542) |
0.1 | 0.5 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.1 | 0.2 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.1 | 0.2 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
0.1 | 0.9 | GO:0001946 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
0.1 | 0.2 | GO:0016264 | gap junction assembly(GO:0016264) |
0.1 | 0.5 | GO:0032495 | response to muramyl dipeptide(GO:0032495) |
0.1 | 0.2 | GO:0060005 | vestibular reflex(GO:0060005) |
0.1 | 0.1 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.1 | 0.4 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.1 | 0.5 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 0.2 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.1 | 0.5 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
0.1 | 0.2 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.1 | 0.1 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.1 | 0.4 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.1 | 0.2 | GO:0042713 | sperm ejaculation(GO:0042713) |
0.1 | 0.1 | GO:0021550 | medulla oblongata development(GO:0021550) |
0.1 | 0.3 | GO:0042637 | catagen(GO:0042637) |
0.1 | 0.2 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.1 | 0.2 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.1 | 1.3 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.1 | 0.2 | GO:0061042 | vascular wound healing(GO:0061042) |
0.1 | 0.2 | GO:2000341 | regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000341) |
0.1 | 0.2 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.1 | 0.5 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
0.1 | 0.5 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
0.1 | 0.1 | GO:0003352 | regulation of cilium movement(GO:0003352) |
0.1 | 0.2 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.1 | 0.2 | GO:0045402 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.1 | 0.1 | GO:1903242 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
0.1 | 0.5 | GO:0033688 | regulation of osteoblast proliferation(GO:0033688) |
0.1 | 0.2 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.1 | 0.3 | GO:0021794 | thalamus development(GO:0021794) |
0.1 | 0.4 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.1 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.1 | 0.5 | GO:0001976 | neurological system process involved in regulation of systemic arterial blood pressure(GO:0001976) |
0.1 | 1.0 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.1 | 0.3 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.1 | 0.3 | GO:0072012 | renal system vasculature development(GO:0061437) kidney vasculature development(GO:0061440) glomerulus vasculature development(GO:0072012) |
0.1 | 0.1 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.1 | 0.1 | GO:0060029 | convergent extension involved in organogenesis(GO:0060029) |
0.1 | 0.3 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
0.1 | 0.3 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.1 | 0.1 | GO:1903367 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
0.1 | 0.1 | GO:0033278 | cell proliferation in midbrain(GO:0033278) |
0.1 | 1.7 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
0.1 | 0.1 | GO:0001826 | inner cell mass cell differentiation(GO:0001826) |
0.1 | 0.3 | GO:0045601 | regulation of endothelial cell differentiation(GO:0045601) |
0.1 | 0.3 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
0.1 | 0.1 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.1 | 1.0 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.1 | 0.3 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.1 | 1.0 | GO:0009250 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
0.1 | 0.3 | GO:0048539 | bone marrow development(GO:0048539) |
0.1 | 0.3 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.1 | 0.6 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.1 | 0.1 | GO:0021557 | oculomotor nerve development(GO:0021557) trochlear nerve development(GO:0021558) |
0.1 | 0.1 | GO:0010002 | cardioblast differentiation(GO:0010002) |
0.1 | 0.3 | GO:2000318 | positive regulation of T-helper 17 type immune response(GO:2000318) |
0.1 | 0.5 | GO:0097205 | renal filtration(GO:0097205) |
0.1 | 0.1 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.1 | 0.1 | GO:0060022 | hard palate development(GO:0060022) |
0.1 | 0.2 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.1 | 0.1 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.2 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.1 | 0.1 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.1 | 0.1 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.1 | 0.8 | GO:0045109 | intermediate filament organization(GO:0045109) |
0.1 | 0.1 | GO:0071351 | cellular response to interleukin-18(GO:0071351) |
0.1 | 0.2 | GO:0032905 | transforming growth factor beta1 production(GO:0032905) regulation of transforming growth factor beta1 production(GO:0032908) |
0.1 | 0.1 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
0.1 | 0.1 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) |
0.1 | 0.2 | GO:0006573 | valine metabolic process(GO:0006573) |
0.1 | 0.1 | GO:2000054 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.1 | 0.1 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
0.1 | 0.1 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.1 | 0.3 | GO:0045410 | positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
0.1 | 2.0 | GO:0003073 | regulation of systemic arterial blood pressure(GO:0003073) |
0.1 | 0.4 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.1 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.1 | 0.1 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.1 | 0.2 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.2 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.1 | 0.1 | GO:0035483 | gastric motility(GO:0035482) gastric emptying(GO:0035483) |
0.1 | 0.1 | GO:0035697 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) |
0.1 | 0.2 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.1 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.1 | 0.2 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.1 | 0.2 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.1 | 0.1 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.1 | 0.1 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.1 | 0.4 | GO:0045056 | transcytosis(GO:0045056) |
0.1 | 1.0 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.1 | 0.1 | GO:0048880 | sensory system development(GO:0048880) |
0.1 | 0.1 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) |
0.1 | 0.1 | GO:0050711 | negative regulation of interleukin-1 secretion(GO:0050711) |
0.1 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
0.1 | 0.1 | GO:0032278 | positive regulation of gonadotropin secretion(GO:0032278) |
0.1 | 0.2 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.1 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.2 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.1 | 0.3 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.1 | 0.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.1 | 0.2 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.1 | 0.1 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.1 | 0.4 | GO:0006108 | malate metabolic process(GO:0006108) |
0.1 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.4 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.1 | 0.2 | GO:0034476 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
0.1 | 1.1 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.1 | 0.2 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.1 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
0.1 | 0.3 | GO:0060353 | regulation of cell adhesion molecule production(GO:0060353) |
0.1 | 0.3 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.1 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.1 | 0.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 0.1 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.1 | 0.1 | GO:0032196 | transposition(GO:0032196) |
0.1 | 0.2 | GO:0046049 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 1.1 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
0.1 | 0.1 | GO:2000409 | regulation of T cell extravasation(GO:2000407) positive regulation of T cell extravasation(GO:2000409) |
0.1 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.1 | 0.2 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.1 | 0.3 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.1 | GO:0044026 | DNA hypermethylation(GO:0044026) |
0.1 | 0.2 | GO:0002568 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
0.1 | 0.5 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.1 | 0.2 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.1 | 0.1 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
0.1 | 0.2 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.1 | 0.2 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.1 | 0.4 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.1 | 0.6 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.0 | 0.0 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
0.0 | 0.1 | GO:1900620 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.0 | 0.2 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.0 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.3 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.0 | 0.3 | GO:0098828 | modulation of inhibitory postsynaptic potential(GO:0098828) |
0.0 | 0.4 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:1904738 | vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) |
0.0 | 0.3 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.1 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.1 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.0 | 0.2 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.0 | 0.1 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 1.4 | GO:0001938 | positive regulation of endothelial cell proliferation(GO:0001938) |
0.0 | 0.5 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
0.0 | 0.2 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.0 | 0.3 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.1 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.0 | 0.3 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.0 | 0.0 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
0.0 | 0.1 | GO:0021756 | striatum development(GO:0021756) |
0.0 | 0.5 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.0 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.0 | 0.4 | GO:0003323 | type B pancreatic cell development(GO:0003323) |
0.0 | 0.0 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.0 | 0.4 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.1 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.0 | 0.2 | GO:0090383 | phagosome acidification(GO:0090383) |
0.0 | 0.1 | GO:0033240 | positive regulation of cellular amine metabolic process(GO:0033240) |
0.0 | 0.4 | GO:0002066 | columnar/cuboidal epithelial cell development(GO:0002066) |
0.0 | 0.3 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.1 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
0.0 | 0.6 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.0 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.0 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.0 | 0.0 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.0 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
0.0 | 0.0 | GO:0034650 | cortisol metabolic process(GO:0034650) |
0.0 | 0.1 | GO:0061140 | Type II pneumocyte differentiation(GO:0060510) lung secretory cell differentiation(GO:0061140) |
0.0 | 0.2 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
0.0 | 0.1 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.0 | 0.1 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.0 | 0.3 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
0.0 | 0.2 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.1 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
0.0 | 0.2 | GO:0030432 | peristalsis(GO:0030432) |
0.0 | 0.0 | GO:0036491 | regulation of translation in response to endoplasmic reticulum stress(GO:0036490) regulation of translation initiation in response to endoplasmic reticulum stress(GO:0036491) eiF2alpha phosphorylation in response to endoplasmic reticulum stress(GO:0036492) |
0.0 | 0.1 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
0.0 | 0.1 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.0 | 0.2 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
0.0 | 0.2 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
0.0 | 0.1 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.0 | 0.2 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.0 | 0.1 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.0 | 0.1 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.0 | 0.1 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.0 | 0.2 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.2 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
0.0 | 0.0 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.0 | 0.2 | GO:0046110 | xanthine metabolic process(GO:0046110) |
0.0 | 0.1 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.0 | 0.1 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.0 | 0.0 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) |
0.0 | 0.1 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) asymmetric neuroblast division(GO:0055059) |
0.0 | 0.3 | GO:0035329 | hippo signaling(GO:0035329) |
0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 0.3 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.0 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.0 | 0.0 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
0.0 | 0.4 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.0 | 1.8 | GO:0035914 | skeletal muscle cell differentiation(GO:0035914) |
0.0 | 0.1 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.0 | 0.0 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.0 | 0.3 | GO:0019321 | pentose metabolic process(GO:0019321) |
0.0 | 0.2 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.0 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.0 | 0.1 | GO:0046016 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
0.0 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.0 | 0.1 | GO:0042321 | negative regulation of circadian sleep/wake cycle, sleep(GO:0042321) negative regulation of circadian sleep/wake cycle, REM sleep(GO:0042322) |
0.0 | 0.0 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
0.0 | 0.5 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.1 | GO:0048340 | paraxial mesoderm morphogenesis(GO:0048340) |
0.0 | 0.1 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.0 | 0.0 | GO:0061588 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
0.0 | 0.2 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.0 | 0.2 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.0 | 0.2 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.2 | GO:0042023 | DNA endoreduplication(GO:0042023) |
0.0 | 0.1 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.0 | 0.3 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.0 | GO:0006808 | regulation of nitrogen utilization(GO:0006808) |
0.0 | 0.1 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
0.0 | 0.2 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
0.0 | 0.4 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
0.0 | 0.1 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.0 | 0.1 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.0 | 0.2 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.1 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
0.0 | 0.1 | GO:0007412 | axon target recognition(GO:0007412) |
0.0 | 0.2 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.0 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.0 | 0.1 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.0 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.0 | 0.0 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.0 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.0 | 0.2 | GO:0071364 | cellular response to epidermal growth factor stimulus(GO:0071364) |
0.0 | 0.1 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.0 | 0.3 | GO:0001967 | suckling behavior(GO:0001967) |
0.0 | 0.0 | GO:0030239 | myofibril assembly(GO:0030239) |
0.0 | 0.3 | GO:0071800 | podosome assembly(GO:0071800) |
0.0 | 0.1 | GO:0046689 | response to mercury ion(GO:0046689) |
0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.3 | GO:0090218 | positive regulation of lipid kinase activity(GO:0090218) |
0.0 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.0 | 0.2 | GO:0002053 | positive regulation of mesenchymal cell proliferation(GO:0002053) |
0.0 | 0.3 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.0 | 0.0 | GO:0019661 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.0 | 0.3 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
0.0 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
0.0 | 0.1 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.0 | 0.1 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.0 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.1 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.0 | 0.2 | GO:0070170 | regulation of tooth mineralization(GO:0070170) |
0.0 | 0.1 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.0 | 0.1 | GO:0002765 | immune response-inhibiting signal transduction(GO:0002765) |
0.0 | 0.0 | GO:0043134 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
0.0 | 0.1 | GO:0060056 | mammary gland involution(GO:0060056) |
0.0 | 0.1 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
0.0 | 0.2 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.0 | GO:0032831 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.0 | 0.1 | GO:0030812 | negative regulation of nucleotide catabolic process(GO:0030812) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
0.0 | 0.2 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.0 | 0.1 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.0 | 0.1 | GO:0051124 | synaptic growth at neuromuscular junction(GO:0051124) |
0.0 | 0.1 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.0 | 0.8 | GO:0008542 | visual learning(GO:0008542) |
0.0 | 0.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.0 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.0 | 0.1 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.0 | 0.1 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
0.0 | 0.6 | GO:0031032 | actomyosin structure organization(GO:0031032) |
0.0 | 0.0 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
0.0 | 0.0 | GO:0002248 | connective tissue replacement involved in inflammatory response wound healing(GO:0002248) connective tissue replacement(GO:0097709) |
0.0 | 0.1 | GO:0003179 | heart valve morphogenesis(GO:0003179) |
0.0 | 0.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.0 | 0.0 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.0 | 0.2 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.0 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.0 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.0 | 0.2 | GO:2000505 | regulation of energy homeostasis(GO:2000505) |
0.0 | 0.2 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.0 | 0.5 | GO:0043616 | keratinocyte proliferation(GO:0043616) |
0.0 | 0.0 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.2 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.1 | GO:1901017 | negative regulation of potassium ion transmembrane transporter activity(GO:1901017) |
0.0 | 0.1 | GO:1901525 | regulation of macromitophagy(GO:1901524) negative regulation of macromitophagy(GO:1901525) |
0.0 | 0.0 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
0.0 | 0.1 | GO:0001696 | gastric acid secretion(GO:0001696) |
0.0 | 0.0 | GO:1904688 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.0 | 0.1 | GO:0002666 | positive regulation of T cell tolerance induction(GO:0002666) |
0.0 | 0.4 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
0.0 | 0.2 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.0 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.0 | 0.0 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.0 | 0.1 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.0 | GO:1902074 | response to salt(GO:1902074) cellular response to salt(GO:1902075) |
0.0 | 0.1 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.0 | 0.1 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) |
0.0 | 0.8 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.0 | GO:0046884 | follicle-stimulating hormone secretion(GO:0046884) |
0.0 | 0.1 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.0 | 0.0 | GO:0034239 | macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) |
0.0 | 0.0 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.0 | 0.0 | GO:1902308 | regulation of peptidyl-serine dephosphorylation(GO:1902308) |
0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.0 | 0.2 | GO:0032620 | interleukin-17 production(GO:0032620) |
0.0 | 0.0 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.0 | 0.0 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.0 | GO:0097201 | negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
0.0 | 0.0 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.0 | GO:0003264 | cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) regulation of secondary heart field cardioblast proliferation(GO:0003266) |
0.0 | 0.0 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
0.0 | 0.0 | GO:0071731 | response to nitric oxide(GO:0071731) |
0.0 | 0.2 | GO:0010595 | positive regulation of endothelial cell migration(GO:0010595) |
0.0 | 0.0 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.0 | 0.0 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.0 | 0.0 | GO:0090579 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
0.0 | 0.0 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
0.0 | 0.1 | GO:0045986 | negative regulation of smooth muscle contraction(GO:0045986) |
0.0 | 0.0 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.0 | 0.1 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.0 | 0.1 | GO:0060179 | male mating behavior(GO:0060179) |
0.0 | 0.1 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.0 | 0.4 | GO:0007528 | neuromuscular junction development(GO:0007528) |
0.0 | 0.2 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
0.0 | 0.1 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.0 | 0.0 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.0 | 0.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 0.1 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.0 | GO:0030913 | paranodal junction assembly(GO:0030913) |
0.0 | 0.0 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.0 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.0 | 0.0 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
0.0 | 0.2 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.0 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.1 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
0.0 | 0.0 | GO:0032275 | luteinizing hormone secretion(GO:0032275) |
0.0 | 0.0 | GO:0070488 | neutrophil aggregation(GO:0070488) |
0.0 | 0.0 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.0 | 0.0 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.2 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.0 | GO:0061072 | iris morphogenesis(GO:0061072) |
0.0 | 0.1 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.0 | 0.1 | GO:0042510 | regulation of tyrosine phosphorylation of Stat1 protein(GO:0042510) |
0.0 | 0.3 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
0.0 | 0.0 | GO:0002676 | regulation of chronic inflammatory response(GO:0002676) |
0.0 | 0.0 | GO:0032891 | negative regulation of organic acid transport(GO:0032891) |
0.0 | 0.0 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
0.0 | 0.0 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.0 | 0.1 | GO:0034776 | response to histamine(GO:0034776) |
0.0 | 0.0 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.0 | 0.0 | GO:0010870 | positive regulation of receptor biosynthetic process(GO:0010870) |
0.0 | 0.0 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.0 | 0.2 | GO:0009086 | methionine biosynthetic process(GO:0009086) |
0.0 | 0.1 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.0 | 0.0 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.0 | 0.0 | GO:0031017 | exocrine pancreas development(GO:0031017) |
0.0 | 0.0 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.2 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.0 | 0.1 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.0 | 0.0 | GO:0046471 | phosphatidylglycerol metabolic process(GO:0046471) |
0.0 | 0.1 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
0.0 | 0.1 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
0.0 | 0.0 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
0.0 | 0.3 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.0 | GO:0001787 | natural killer cell proliferation(GO:0001787) |
0.0 | 0.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.0 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.1 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.0 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
0.0 | 0.0 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 0.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.0 | 0.0 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.0 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.0 | 0.0 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.0 | 0.0 | GO:0035358 | regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035358) |
0.0 | 0.1 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.0 | GO:0060120 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
0.0 | 0.1 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.0 | 0.0 | GO:0045606 | positive regulation of epidermal cell differentiation(GO:0045606) |
0.0 | 0.1 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.0 | 0.0 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.0 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.0 | 0.2 | GO:0048286 | lung alveolus development(GO:0048286) |
0.0 | 0.0 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.0 | 0.0 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.0 | 0.2 | GO:0046580 | negative regulation of Ras protein signal transduction(GO:0046580) negative regulation of small GTPase mediated signal transduction(GO:0051058) |
0.0 | 0.0 | GO:0031296 | B cell costimulation(GO:0031296) |
0.0 | 0.0 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
0.0 | 0.0 | GO:0090148 | membrane fission(GO:0090148) |
0.0 | 0.1 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.0 | 0.0 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) |
0.0 | 0.2 | GO:0035315 | hair cell differentiation(GO:0035315) |
0.0 | 0.1 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.0 | 0.1 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.0 | 0.0 | GO:1902713 | regulation of interferon-gamma secretion(GO:1902713) |
0.0 | 0.0 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
0.0 | 0.0 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.0 | 0.1 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.0 | 0.0 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
0.0 | 0.0 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.0 | 0.0 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.0 | 0.0 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.0 | GO:0003209 | cardiac atrium morphogenesis(GO:0003209) |
0.0 | 0.0 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.0 | 0.0 | GO:0042747 | regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) circadian sleep/wake cycle, REM sleep(GO:0042747) |
0.0 | 0.2 | GO:0030199 | collagen fibril organization(GO:0030199) |
0.0 | 0.0 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) |
0.0 | 0.0 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.0 | 0.1 | GO:0060612 | adipose tissue development(GO:0060612) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 4.5 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
1.2 | 7.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
1.1 | 6.4 | GO:0005859 | muscle myosin complex(GO:0005859) |
1.0 | 8.3 | GO:0005861 | troponin complex(GO:0005861) |
0.8 | 2.5 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.8 | 2.5 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.8 | 3.2 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.6 | 1.7 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.5 | 6.9 | GO:0005916 | fascia adherens(GO:0005916) |
0.5 | 1.5 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.4 | 1.3 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.4 | 36.2 | GO:0030018 | Z disc(GO:0030018) |
0.4 | 0.8 | GO:0030056 | hemidesmosome(GO:0030056) |
0.4 | 1.5 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.3 | 2.4 | GO:0031430 | M band(GO:0031430) |
0.3 | 4.1 | GO:0031672 | A band(GO:0031672) |
0.3 | 1.9 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.3 | 1.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.3 | 1.3 | GO:0016460 | myosin II complex(GO:0016460) |
0.3 | 0.8 | GO:0031523 | Myb complex(GO:0031523) |
0.3 | 1.0 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.2 | 0.7 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.2 | 0.7 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.2 | 1.4 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.2 | 12.3 | GO:0030016 | myofibril(GO:0030016) |
0.2 | 0.7 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.2 | 1.3 | GO:0005915 | zonula adherens(GO:0005915) |
0.2 | 4.1 | GO:0098644 | complex of collagen trimers(GO:0098644) |
0.2 | 0.9 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.2 | 0.6 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.2 | 0.6 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.2 | 0.6 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.2 | 1.0 | GO:0045180 | basal cortex(GO:0045180) |
0.2 | 1.6 | GO:0042587 | glycogen granule(GO:0042587) |
0.2 | 0.6 | GO:0048179 | activin receptor complex(GO:0048179) |
0.2 | 0.8 | GO:1990696 | USH2 complex(GO:1990696) |
0.2 | 0.7 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.2 | 0.5 | GO:1990393 | 3M complex(GO:1990393) |
0.2 | 3.5 | GO:0014704 | intercalated disc(GO:0014704) |
0.2 | 0.6 | GO:0071953 | elastic fiber(GO:0071953) |
0.1 | 0.6 | GO:0030478 | actin cap(GO:0030478) |
0.1 | 1.3 | GO:0034706 | sodium channel complex(GO:0034706) |
0.1 | 11.5 | GO:0005604 | basement membrane(GO:0005604) |
0.1 | 1.4 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.1 | 1.1 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 0.5 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 1.7 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.1 | 0.6 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 0.5 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.4 | GO:1990357 | terminal web(GO:1990357) |
0.1 | 2.1 | GO:0030315 | T-tubule(GO:0030315) |
0.1 | 1.2 | GO:0033270 | paranode region of axon(GO:0033270) |
0.1 | 0.2 | GO:0033010 | paranodal junction(GO:0033010) |
0.1 | 0.3 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.1 | 0.3 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.8 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
0.1 | 1.4 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.1 | 3.2 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.1 | 2.1 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.1 | 0.3 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 4.7 | GO:0042383 | sarcolemma(GO:0042383) |
0.1 | 0.3 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.9 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 0.3 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.1 | 0.4 | GO:0042629 | mast cell granule(GO:0042629) |
0.1 | 0.5 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 0.4 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 1.3 | GO:0030057 | desmosome(GO:0030057) |
0.1 | 0.8 | GO:0001527 | microfibril(GO:0001527) |
0.1 | 0.3 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.1 | 0.5 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.3 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.1 | 0.2 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.2 | GO:0043218 | compact myelin(GO:0043218) |
0.1 | 0.5 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
0.1 | 0.4 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.1 | 0.6 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.1 | 1.0 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.1 | 0.2 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 0.6 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.1 | 0.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.1 | 0.5 | GO:0036157 | outer dynein arm(GO:0036157) |
0.1 | 1.7 | GO:0016235 | aggresome(GO:0016235) |
0.1 | 0.9 | GO:0097225 | sperm midpiece(GO:0097225) |
0.1 | 2.2 | GO:0045095 | keratin filament(GO:0045095) |
0.1 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 1.6 | GO:0032421 | stereocilium bundle(GO:0032421) |
0.1 | 1.9 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.3 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 0.7 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.2 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 0.2 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.0 | 1.7 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.0 | 0.4 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.0 | GO:1904949 | ATPase complex(GO:1904949) |
0.0 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.7 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.5 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
0.0 | 0.7 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 3.6 | GO:0043296 | apical junction complex(GO:0043296) |
0.0 | 0.3 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.9 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 0.2 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.1 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.0 | 3.5 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 0.7 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.0 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 9.6 | GO:0005912 | adherens junction(GO:0005912) |
0.0 | 8.7 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.0 | GO:0030430 | host cell cytoplasm(GO:0030430) host cell cytoplasm part(GO:0033655) |
0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.3 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.0 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 6.3 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 0.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.0 | 0.6 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.3 | GO:0002102 | podosome(GO:0002102) |
0.0 | 1.2 | GO:0005901 | caveola(GO:0005901) |
0.0 | 0.1 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 0.1 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.1 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.0 | 0.3 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.2 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 1.2 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 0.2 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.0 | 0.2 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.7 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.6 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.0 | GO:0070820 | tertiary granule(GO:0070820) |
0.0 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.0 | 0.0 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.3 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.0 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 0.0 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.2 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.0 | 0.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 1.8 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.0 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.0 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.2 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.3 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.0 | 0.4 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.0 | 0.1 | GO:0033263 | CORVET complex(GO:0033263) |
0.0 | 0.0 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.1 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 0.0 | GO:0033186 | CAF-1 complex(GO:0033186) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.8 | 5.4 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
1.6 | 1.6 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
1.5 | 6.1 | GO:0031433 | telethonin binding(GO:0031433) |
1.3 | 4.0 | GO:0030172 | troponin C binding(GO:0030172) |
1.2 | 5.8 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.9 | 2.7 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.7 | 3.5 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.7 | 2.1 | GO:0031013 | troponin I binding(GO:0031013) |
0.6 | 1.9 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.6 | 2.9 | GO:0071253 | connexin binding(GO:0071253) |
0.6 | 1.7 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.5 | 2.7 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.5 | 1.6 | GO:0070538 | oleic acid binding(GO:0070538) |
0.5 | 1.5 | GO:0051373 | FATZ binding(GO:0051373) |
0.5 | 10.0 | GO:0003785 | actin monomer binding(GO:0003785) |
0.5 | 2.9 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.5 | 4.3 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.5 | 3.2 | GO:0031432 | titin binding(GO:0031432) |
0.4 | 2.6 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.4 | 0.8 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.4 | 1.7 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.4 | 1.2 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.4 | 1.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.4 | 1.6 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.4 | 2.2 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.4 | 4.0 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.4 | 0.4 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.4 | 1.8 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.4 | 1.1 | GO:0035939 | microsatellite binding(GO:0035939) |
0.3 | 0.7 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.3 | 2.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.3 | 1.4 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.3 | 2.4 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.3 | 1.6 | GO:0048495 | Roundabout binding(GO:0048495) |
0.3 | 1.0 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.3 | 0.6 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.3 | 1.0 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.3 | 0.9 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.3 | 1.9 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.3 | 0.9 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.3 | 1.3 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.3 | 1.5 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.3 | 0.9 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.3 | 0.9 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.3 | 2.9 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.3 | 0.9 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.3 | 0.8 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.3 | 1.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.3 | 0.5 | GO:0031014 | troponin T binding(GO:0031014) |
0.3 | 1.0 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.3 | 0.8 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.3 | 0.8 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.2 | 0.7 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.2 | 1.0 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.2 | 0.7 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.2 | 2.6 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.2 | 1.2 | GO:1990254 | keratin filament binding(GO:1990254) |
0.2 | 2.8 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.2 | 0.9 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.2 | 3.9 | GO:0005112 | Notch binding(GO:0005112) |
0.2 | 1.7 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.2 | 0.6 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.2 | 0.8 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.2 | 0.6 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.2 | 0.8 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.2 | 0.8 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.2 | 0.6 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.2 | 0.8 | GO:0043515 | kinetochore binding(GO:0043515) |
0.2 | 0.6 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.2 | 0.6 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.2 | 0.6 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.2 | 1.0 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.2 | 0.8 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.2 | 0.8 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
0.2 | 1.1 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.2 | 2.0 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.2 | 0.4 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.2 | 0.5 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.2 | 4.0 | GO:0004119 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.2 | 0.5 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.2 | 0.9 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.2 | 1.9 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.2 | 0.7 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.2 | 0.9 | GO:0034711 | inhibin binding(GO:0034711) |
0.2 | 1.7 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.2 | 2.1 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.2 | 1.2 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.2 | 0.2 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.2 | 0.5 | GO:0048185 | activin binding(GO:0048185) |
0.2 | 0.7 | GO:0042731 | PH domain binding(GO:0042731) |
0.2 | 1.3 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.2 | 0.3 | GO:0043199 | sulfate binding(GO:0043199) |
0.2 | 0.5 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.2 | 0.8 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.2 | 0.8 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.4 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.1 | 0.7 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.6 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
0.1 | 0.1 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.1 | 1.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.1 | 0.7 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.1 | 1.1 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 1.6 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 1.9 | GO:0015026 | coreceptor activity(GO:0015026) |
0.1 | 0.4 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.5 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 0.9 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 2.0 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.1 | 3.3 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.1 | 0.5 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 1.6 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.1 | 0.5 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.1 | 0.4 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.6 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 0.5 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.1 | 0.4 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.1 | 3.1 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.1 | 0.7 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.1 | 0.3 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.1 | 0.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.1 | 0.3 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.1 | 0.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.5 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.1 | 0.8 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.1 | 0.7 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.1 | 0.8 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.1 | 1.3 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 2.0 | GO:0042805 | actinin binding(GO:0042805) |
0.1 | 0.4 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.1 | 0.3 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 0.2 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.1 | 0.3 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.1 | 0.3 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.1 | 0.7 | GO:0018637 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 0.8 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 0.2 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 0.6 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.1 | 0.9 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.1 | 0.3 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.1 | 0.3 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.1 | 0.5 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.1 | 0.2 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.1 | 0.5 | GO:0038132 | neuregulin binding(GO:0038132) |
0.1 | 2.6 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.1 | 0.6 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 0.4 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.1 | 0.5 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.1 | 0.5 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.1 | 0.5 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 0.3 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.1 | 1.3 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 0.4 | GO:0034584 | piRNA binding(GO:0034584) |
0.1 | 0.7 | GO:0015922 | aspartate oxidase activity(GO:0015922) |
0.1 | 0.4 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 1.0 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.1 | 0.5 | GO:0034912 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.1 | 1.9 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.1 | 0.2 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.1 | 0.1 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.1 | 0.3 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.1 | 0.5 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.1 | 0.3 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.1 | 1.9 | GO:0045296 | cadherin binding(GO:0045296) |
0.1 | 0.3 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 1.2 | GO:0008143 | poly(A) binding(GO:0008143) |
0.1 | 2.6 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.1 | 0.2 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 0.2 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.9 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.1 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.5 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.1 | 0.3 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.1 | 0.2 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.1 | 0.3 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.1 | 0.4 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.1 | 0.4 | GO:0043495 | protein anchor(GO:0043495) |
0.1 | 0.4 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.1 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.1 | 0.4 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.2 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.1 | 2.1 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.1 | 0.4 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.1 | 0.5 | GO:0044548 | S100 protein binding(GO:0044548) |
0.1 | 0.2 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.1 | 0.2 | GO:0048030 | disaccharide binding(GO:0048030) |
0.1 | 0.2 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.1 | 0.8 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.1 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.1 | 0.9 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.1 | 0.6 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 1.2 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.1 | 17.5 | GO:0003779 | actin binding(GO:0003779) |
0.1 | 3.0 | GO:0017022 | myosin binding(GO:0017022) |
0.1 | 0.1 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.1 | 5.1 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.1 | 0.8 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.1 | 0.4 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.1 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.2 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.1 | 0.2 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.1 | 0.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.1 | 0.3 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.1 | 0.2 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.1 | 0.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.2 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.1 | 0.3 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 0.7 | GO:0042562 | hormone binding(GO:0042562) |
0.1 | 0.2 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.1 | 0.2 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.1 | 0.2 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.1 | 0.2 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.1 | 1.5 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.1 | 0.5 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.1 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.1 | 0.4 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.1 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.1 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 0.3 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.1 | 0.6 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.1 | 0.5 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.4 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.1 | 0.4 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.7 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.1 | 0.3 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 0.1 | GO:0018573 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.1 | 0.2 | GO:0018585 | fluorene oxygenase activity(GO:0018585) |
0.1 | 0.1 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.0 | 0.1 | GO:0004675 | transmembrane receptor protein serine/threonine kinase activity(GO:0004675) |
0.0 | 0.2 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.0 | 1.8 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 1.0 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.0 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.2 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.0 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.1 | GO:0016775 | phosphotransferase activity, nitrogenous group as acceptor(GO:0016775) |
0.0 | 0.2 | GO:0036033 | mediator complex binding(GO:0036033) |
0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.0 | 0.3 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.2 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.0 | 1.1 | GO:0016504 | peptidase activator activity(GO:0016504) |
0.0 | 0.4 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.0 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.0 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.1 | GO:0035276 | ethanol binding(GO:0035276) |
0.0 | 1.0 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.0 | 0.2 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.1 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.0 | 0.5 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.0 | 0.5 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.0 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 0.2 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.3 | GO:0031402 | sodium ion binding(GO:0031402) |
0.0 | 0.2 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.0 | 0.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.2 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.2 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.2 | GO:0016623 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 1.1 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.1 | GO:0005148 | prolactin receptor binding(GO:0005148) |
0.0 | 0.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.0 | 0.3 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.0 | 0.1 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 0.2 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.0 | 0.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.8 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.7 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.1 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.0 | 3.1 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.0 | 0.3 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 2.0 | GO:0005178 | integrin binding(GO:0005178) |
0.0 | 2.1 | GO:0044325 | ion channel binding(GO:0044325) |
0.0 | 0.0 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
0.0 | 0.3 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.1 | GO:0032357 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.0 | 0.2 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.0 | 0.2 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.0 | 0.1 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.1 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.0 | 0.4 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.0 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.0 | 0.2 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.0 | 0.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.0 | 0.4 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 1.1 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
0.0 | 0.1 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.0 | 0.1 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 0.3 | GO:0034823 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.3 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.0 | 0.2 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 2.5 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.1 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.0 | 0.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.0 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.1 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.3 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.0 | 0.1 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.0 | 0.3 | GO:0055103 | ligase regulator activity(GO:0055103) ubiquitin-protein transferase regulator activity(GO:0055106) |
0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.2 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.0 | 0.1 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.2 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.3 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.0 | 0.0 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.0 | 0.0 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.0 | 0.0 | GO:0052872 | tocotrienol omega-hydroxylase activity(GO:0052872) |
0.0 | 0.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.0 | 0.3 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.2 | GO:0004954 | prostanoid receptor activity(GO:0004954) |
0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.0 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.2 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 0.4 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.1 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.7 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.4 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.3 | GO:0004629 | phospholipase C activity(GO:0004629) |
0.0 | 0.0 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.1 | GO:0004802 | transketolase activity(GO:0004802) |
0.0 | 0.1 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.0 | 0.1 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.0 | 0.3 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.0 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.0 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 3.4 | GO:0030695 | GTPase regulator activity(GO:0030695) |
0.0 | 0.1 | GO:0008932 | lytic endotransglycosylase activity(GO:0008932) |
0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 0.4 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.3 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.1 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.0 | 0.0 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.0 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.2 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.3 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.0 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
0.0 | 0.0 | GO:0031420 | alkali metal ion binding(GO:0031420) |
0.0 | 0.0 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.1 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.0 | 0.6 | GO:0019208 | phosphatase regulator activity(GO:0019208) |
0.0 | 0.4 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.0 | 0.0 | GO:0016936 | galactoside binding(GO:0016936) |
0.0 | 0.0 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.0 | 0.3 | GO:0018722 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) heparan sulfate 2-O-sulfotransferase activity(GO:0004394) HNK-1 sulfotransferase activity(GO:0016232) heparan sulfate 6-O-sulfotransferase activity(GO:0017095) trans-9R,10R-dihydrodiolphenanthrene sulfotransferase activity(GO:0018721) 1-phenanthrol sulfotransferase activity(GO:0018722) 3-phenanthrol sulfotransferase activity(GO:0018723) 4-phenanthrol sulfotransferase activity(GO:0018724) trans-3,4-dihydrodiolphenanthrene sulfotransferase activity(GO:0018725) 9-phenanthrol sulfotransferase activity(GO:0018726) 2-phenanthrol sulfotransferase activity(GO:0018727) phenanthrol sulfotransferase activity(GO:0019111) 1-hydroxypyrene sulfotransferase activity(GO:0034930) proteoglycan sulfotransferase activity(GO:0050698) cholesterol sulfotransferase activity(GO:0051922) hydroxyjasmonate sulfotransferase activity(GO:0080131) |
0.0 | 0.0 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.0 | 0.0 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
0.0 | 0.1 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.0 | 0.0 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 2.8 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.3 | 4.5 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.2 | 9.6 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.2 | 9.9 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.2 | 8.9 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.2 | 0.4 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.2 | 1.0 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.2 | 4.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.2 | 1.5 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 3.5 | PID ALK1 PATHWAY | ALK1 signaling events |
0.1 | 0.4 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.1 | 1.7 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 0.7 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.1 | 0.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.1 | 3.1 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.1 | 3.3 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.1 | 3.2 | NABA COLLAGENS | Genes encoding collagen proteins |
0.1 | 0.2 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 2.4 | PID INSULIN PATHWAY | Insulin Pathway |
0.1 | 0.8 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 4.0 | PID NOTCH PATHWAY | Notch signaling pathway |
0.1 | 4.8 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.1 | 2.6 | PID RAS PATHWAY | Regulation of Ras family activation |
0.1 | 1.7 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.1 | 1.7 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 0.5 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.1 | 2.2 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 0.3 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.1 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.1 | 1.9 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.1 | 1.1 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.1 | 3.4 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.1 | 11.2 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.1 | 2.3 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.1 | 2.4 | PID BMP PATHWAY | BMP receptor signaling |
0.1 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 1.9 | PID ENDOTHELIN PATHWAY | Endothelins |
0.1 | 0.6 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.1 | 1.6 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.1 | 0.5 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.1 | 1.9 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.1 | 1.0 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 0.7 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.1 | 0.4 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.1 | 3.2 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.1 | 0.2 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.1 | 1.0 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 0.3 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.1 | 0.3 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.1 | 1.1 | PID SHP2 PATHWAY | SHP2 signaling |
0.1 | 0.5 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 0.4 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.3 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 1.6 | NABA CORE MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
0.0 | 0.5 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.2 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.3 | PID RHOA PATHWAY | RhoA signaling pathway |
0.0 | 0.6 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.1 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.0 | ST ADRENERGIC | Adrenergic Pathway |
0.0 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.1 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 3.3 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.5 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 0.2 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.5 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.4 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.2 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.4 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.4 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.0 | 0.5 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.2 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.2 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.0 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.2 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.1 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.5 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 2.6 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.0 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.1 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.1 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.0 | 0.4 | PID P73PATHWAY | p73 transcription factor network |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 24.8 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.4 | 5.2 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.3 | 6.2 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.3 | 3.2 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.3 | 2.5 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.3 | 3.5 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.2 | 2.2 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.2 | 1.4 | REACTOME OPSINS | Genes involved in Opsins |
0.2 | 1.8 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.2 | 2.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.2 | 0.5 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.2 | 2.9 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.2 | 2.8 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.2 | 1.7 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 1.5 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.1 | 0.3 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 0.3 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.1 | 1.4 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 0.3 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 2.1 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 0.7 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.1 | 2.9 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 0.5 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
0.1 | 1.8 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.1 | 2.7 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.1 | 1.0 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.1 | 5.5 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.1 | 1.5 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 0.2 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.1 | 0.9 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.1 | 0.7 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 2.0 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 0.4 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
0.1 | 1.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 2.0 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 0.6 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.1 | 1.7 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.1 | 0.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 1.0 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.1 | 0.6 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.1 | 0.2 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.1 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
0.1 | 0.6 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.1 | 1.8 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.1 | 0.9 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.1 | 2.1 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.1 | 2.7 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.1 | 0.5 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.1 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 1.3 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 0.5 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.1 | 5.9 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.1 | 0.2 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.1 | 0.5 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.1 | 0.2 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.1 | 0.8 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.1 | 0.8 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.1 | 0.5 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.5 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.3 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 1.4 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.0 | 1.0 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 2.7 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.4 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.3 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.0 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
0.0 | 1.0 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.5 | REACTOME SIGNALING BY FGFR MUTANTS | Genes involved in Signaling by FGFR mutants |
0.0 | 1.0 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 0.4 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.0 | 0.4 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.2 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.7 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 0.1 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
0.0 | 1.2 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 2.3 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.2 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.4 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 0.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.1 | REACTOME GABA RECEPTOR ACTIVATION | Genes involved in GABA receptor activation |
0.0 | 0.3 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
0.0 | 0.2 | REACTOME CD28 CO STIMULATION | Genes involved in CD28 co-stimulation |
0.0 | 0.1 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.0 | 0.3 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.4 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.4 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.2 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.0 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.0 | 0.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 2.6 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
0.0 | 0.2 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.3 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.2 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.3 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.8 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 0.3 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.3 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.1 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.0 | 0.7 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.0 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.0 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.0 | 0.3 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.1 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.0 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.2 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.9 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.0 | 0.2 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 0.1 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 0.0 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
0.0 | 0.1 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 0.0 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.0 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.0 | 0.0 | REACTOME DEFENSINS | Genes involved in Defensins |
0.0 | 0.0 | REACTOME PHOSPHOLIPASE C MEDIATED CASCADE | Genes involved in Phospholipase C-mediated cascade |
0.0 | 0.3 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.1 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.0 | 0.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |