| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Nkx6-2
|
ENSMUSG00000041309.11 | NK6 homeobox 2 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr7_139585914_139586065 | Nkx6-2 | 3192 | 0.244107 | -0.23 | 7.3e-02 | Click! |
| chr7_139578562_139578764 | Nkx6-2 | 4127 | 0.224426 | -0.19 | 1.6e-01 | Click! |
| chr7_139583546_139583838 | Nkx6-2 | 895 | 0.593540 | -0.13 | 3.1e-01 | Click! |
| chr7_139586228_139586379 | Nkx6-2 | 3506 | 0.234047 | 0.09 | 4.7e-01 | Click! |
| chr7_139580940_139581529 | Nkx6-2 | 1556 | 0.392982 | 0.06 | 6.3e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr12_49387532_49388566 | 1.40 |
3110039M20Rik |
RIKEN cDNA 3110039M20 gene |
1603 |
0.26 |
| chr6_56921888_56922511 | 1.21 |
Nt5c3 |
5'-nucleotidase, cytosolic III |
1525 |
0.25 |
| chr6_47591961_47592451 | 1.15 |
Ezh2 |
enhancer of zeste 2 polycomb repressive complex 2 subunit |
2824 |
0.25 |
| chr3_5222045_5223052 | 1.05 |
Zfhx4 |
zinc finger homeodomain 4 |
1043 |
0.46 |
| chr19_58978577_58979368 | 1.04 |
Eno4 |
enolase 4 |
23516 |
0.16 |
| chr2_18044333_18044941 | 1.03 |
Skida1 |
SKI/DACH domain containing 1 |
65 |
0.95 |
| chr19_37377375_37377526 | 1.03 |
Kif11 |
kinesin family member 11 |
1047 |
0.43 |
| chr11_99023043_99023245 | 1.02 |
Top2a |
topoisomerase (DNA) II alpha |
934 |
0.41 |
| chr8_70172997_70173158 | 1.01 |
Tmem161a |
transmembrane protein 161A |
658 |
0.51 |
| chr1_174173602_174173839 | 1.00 |
Spta1 |
spectrin alpha, erythrocytic 1 |
944 |
0.38 |
| chr11_78302679_78302830 | 0.99 |
Spag5 |
sperm associated antigen 5 |
1099 |
0.27 |
| chr7_120981024_120981392 | 0.97 |
Cdr2 |
cerebellar degeneration-related 2 |
582 |
0.54 |
| chr13_38153522_38153673 | 0.91 |
Gm10129 |
predicted gene 10129 |
1805 |
0.28 |
| chr15_81401274_81401425 | 0.88 |
Xpnpep3 |
X-prolyl aminopeptidase 3, mitochondrial |
1152 |
0.29 |
| chr2_119619277_119620230 | 0.88 |
Nusap1 |
nucleolar and spindle associated protein 1 |
1024 |
0.3 |
| chr13_21936138_21936292 | 0.88 |
Zfp184 |
zinc finger protein 184 (Kruppel-like) |
8879 |
0.06 |
| chr11_85643570_85644032 | 0.87 |
Bcas3 |
breast carcinoma amplified sequence 3 |
3097 |
0.31 |
| chr6_60827248_60827682 | 0.86 |
Snca |
synuclein, alpha |
91 |
0.97 |
| chr9_110134921_110135072 | 0.86 |
Smarcc1 |
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily c, member 1 |
2959 |
0.19 |
| chr4_6193017_6193186 | 0.86 |
Ubxn2b |
UBX domain protein 2B |
2003 |
0.4 |
| chr3_114033658_114034247 | 0.85 |
Col11a1 |
collagen, type XI, alpha 1 |
3318 |
0.39 |
| chr4_22833636_22833787 | 0.85 |
Gm24078 |
predicted gene, 24078 |
86580 |
0.09 |
| chr5_65334804_65334955 | 0.84 |
Rfc1 |
replication factor C (activator 1) 1 |
685 |
0.58 |
| chr6_38553053_38553359 | 0.83 |
Luc7l2 |
LUC7-like 2 (S. cerevisiae) |
1363 |
0.36 |
| chr9_44342999_44343222 | 0.83 |
Hmbs |
hydroxymethylbilane synthase |
729 |
0.33 |
| chrX_50842772_50843829 | 0.83 |
Stk26 |
serine/threonine kinase 26 |
1859 |
0.47 |
| chr11_78119793_78119944 | 0.81 |
Fam222b |
family with sequence similarity 222, member B |
4262 |
0.09 |
| chr18_35565651_35565802 | 0.81 |
Matr3 |
matrin 3 |
3037 |
0.1 |
| chr9_107872986_107873485 | 0.81 |
Rbm6 |
RNA binding motif protein 6 |
2 |
0.95 |
| chr6_25808113_25808405 | 0.81 |
Pot1a |
protection of telomeres 1A |
936 |
0.71 |
| chr6_99985572_99985809 | 0.80 |
Gm33201 |
predicted gene, 33201 |
5525 |
0.23 |
| chr16_11252920_11253071 | 0.78 |
Gspt1 |
G1 to S phase transition 1 |
1214 |
0.3 |
| chr12_91744157_91744724 | 0.77 |
Ston2 |
stonin 2 |
585 |
0.74 |
| chrX_85575371_85575676 | 0.76 |
Tab3 |
TGF-beta activated kinase 1/MAP3K7 binding protein 3 |
1373 |
0.47 |
| chr17_48271857_48272276 | 0.76 |
Treml4 |
triggering receptor expressed on myeloid cells-like 4 |
373 |
0.79 |
| chr9_68792106_68792733 | 0.75 |
Rora |
RAR-related orphan receptor alpha |
137116 |
0.05 |
| chr13_83526460_83526672 | 0.75 |
Mef2c |
myocyte enhancer factor 2C |
1646 |
0.51 |
| chr8_54491343_54491558 | 0.75 |
Gm45553 |
predicted gene 45553 |
22700 |
0.18 |
| chr1_175384090_175384241 | 0.74 |
5730408A14Rik |
RIKEN cDNA 5730408A14 gene |
3489 |
0.35 |
| chr14_30491302_30491512 | 0.74 |
Cacna1d |
calcium channel, voltage-dependent, L type, alpha 1D subunit |
46 |
0.97 |
| chr19_53389508_53389659 | 0.73 |
Smndc1 |
survival motor neuron domain containing 1 |
161 |
0.9 |
| chr11_121261783_121261957 | 0.73 |
Foxk2 |
forkhead box K2 |
1880 |
0.24 |
| chr6_23252786_23253485 | 0.72 |
C130093G08Rik |
RIKEN cDNA C130093G08 gene |
2002 |
0.3 |
| chr2_73275777_73276681 | 0.71 |
Sp9 |
trans-acting transcription factor 9 |
4263 |
0.18 |
| chr7_34167474_34167732 | 0.71 |
Uba2 |
ubiquitin-like modifier activating enzyme 2 |
972 |
0.37 |
| chr16_17721138_17721289 | 0.70 |
Med15 |
mediator complex subunit 15 |
1608 |
0.18 |
| chr6_6859882_6861627 | 0.69 |
Dlx6os1 |
distal-less homeobox 6, opposite strand 1 |
837 |
0.47 |
| chr1_165766563_165766714 | 0.68 |
Creg1 |
cellular repressor of E1A-stimulated genes 1 |
2838 |
0.13 |
| chr2_84733750_84735007 | 0.68 |
Ypel4 |
yippee like 4 |
151 |
0.89 |
| chr3_153721032_153721274 | 0.68 |
St6galnac3 |
ST6 (alpha-N-acetyl-neuraminyl-2,3-beta-galactosyl-1,3)-N-acetylgalactosaminide alpha-2,6-sialyltransferase 3 |
157 |
0.94 |
| chr13_24760759_24760932 | 0.67 |
Gmnn |
geminin |
595 |
0.68 |
| chr17_48432307_48432603 | 0.67 |
Apobec2 |
apolipoprotein B mRNA editing enzyme, catalytic polypeptide 2 |
163 |
0.92 |
| chr3_135830217_135830446 | 0.66 |
Slc39a8 |
solute carrier family 39 (metal ion transporter), member 8 |
4241 |
0.18 |
| chrX_110813716_110813994 | 0.66 |
Pou3f4 |
POU domain, class 3, transcription factor 4 |
425 |
0.82 |
| chr5_130257744_130257895 | 0.66 |
Tyw1 |
tRNA-yW synthesizing protein 1 homolog (S. cerevisiae) |
784 |
0.48 |
| chr2_125624129_125625134 | 0.66 |
Cep152 |
centrosomal protein 152 |
482 |
0.83 |
| chr2_90905456_90905607 | 0.64 |
Kbtbd4 |
kelch repeat and BTB (POZ) domain containing 4 |
456 |
0.52 |
| chr3_146394036_146394249 | 0.64 |
Gm22901 |
predicted gene, 22901 |
5075 |
0.14 |
| chr11_50128365_50128516 | 0.64 |
Gm12194 |
predicted gene 12194 |
522 |
0.66 |
| chr7_118297308_118297825 | 0.64 |
Gm23229 |
predicted gene, 23229 |
17705 |
0.13 |
| chr8_85361454_85361605 | 0.63 |
Mylk3 |
myosin light chain kinase 3 |
3795 |
0.16 |
| chr6_92093012_92093163 | 0.63 |
Nr2c2 |
nuclear receptor subfamily 2, group C, member 2 |
654 |
0.68 |
| chr8_60953813_60955404 | 0.63 |
Clcn3 |
chloride channel, voltage-sensitive 3 |
140 |
0.95 |
| chr4_3937146_3938329 | 0.63 |
Plag1 |
pleiomorphic adenoma gene 1 |
645 |
0.54 |
| chr18_80205822_80205973 | 0.63 |
Gm16286 |
predicted gene 16286 |
868 |
0.3 |
| chr10_97566192_97567945 | 0.63 |
Lum |
lumican |
1940 |
0.32 |
| chr12_99599985_99600136 | 0.63 |
1700064M15Rik |
RIKEN cDNA 1700064M15 gene |
27914 |
0.1 |
| chr6_86439799_86439950 | 0.63 |
C87436 |
expressed sequence C87436 |
1147 |
0.29 |
| chr11_104438778_104439256 | 0.63 |
Kansl1 |
KAT8 regulatory NSL complex subunit 1 |
2685 |
0.24 |
| chr9_19622616_19622889 | 0.62 |
Zfp317 |
zinc finger protein 317 |
47 |
0.96 |
| chr9_82973495_82974089 | 0.61 |
Phip |
pleckstrin homology domain interacting protein |
476 |
0.84 |
| chr3_116563532_116563761 | 0.61 |
Lrrc39 |
leucine rich repeat containing 39 |
668 |
0.48 |
| chr15_95885084_95885398 | 0.61 |
Gm25070 |
predicted gene, 25070 |
5424 |
0.21 |
| chr5_149183312_149183533 | 0.61 |
Gm43332 |
predicted gene 43332 |
239 |
0.66 |
| chr13_89542286_89542958 | 0.60 |
Hapln1 |
hyaluronan and proteoglycan link protein 1 |
2826 |
0.34 |
| chr2_75423353_75423568 | 0.60 |
Gm13658 |
predicted gene 13658 |
12597 |
0.2 |
| chr4_116624198_116624349 | 0.60 |
Nasp |
nuclear autoantigenic sperm protein (histone-binding) |
351 |
0.78 |
| chr7_58398357_58399167 | 0.60 |
Gm44852 |
predicted gene 44852 |
119400 |
0.06 |
| chr8_114418337_114418488 | 0.60 |
Clec3a |
C-type lectin domain family 3, member a |
326 |
0.9 |
| chr16_18429039_18430122 | 0.59 |
Txnrd2 |
thioredoxin reductase 2 |
655 |
0.54 |
| chr2_52435979_52436130 | 0.59 |
A430018G15Rik |
RIKEN cDNA A430018G15 gene |
11042 |
0.17 |
| chr9_120493932_120494083 | 0.59 |
D830035M03Rik |
RIKEN cDNA D830035M03 gene |
1460 |
0.26 |
| chr4_32985770_32986310 | 0.58 |
Rragd |
Ras-related GTP binding D |
2586 |
0.19 |
| chr19_6091655_6091806 | 0.58 |
Gm550 |
predicted gene 550 |
2689 |
0.07 |
| chr17_40812075_40812470 | 0.58 |
Rhag |
Rhesus blood group-associated A glycoprotein |
1088 |
0.44 |
| chrY_1243715_1243886 | 0.57 |
Uty |
ubiquitously transcribed tetratricopeptide repeat gene, Y chromosome |
1667 |
0.33 |
| chr5_72846278_72846506 | 0.57 |
Tec |
tec protein tyrosine kinase |
1943 |
0.3 |
| chr8_80500093_80500244 | 0.57 |
Gypa |
glycophorin A |
6387 |
0.24 |
| chr13_48266007_48266319 | 0.57 |
A330033J07Rik |
RIKEN cDNA A330033J07 gene |
3540 |
0.15 |
| chr9_21724792_21724952 | 0.57 |
Ldlr |
low density lipoprotein receptor |
1231 |
0.29 |
| chr8_85431460_85431739 | 0.57 |
1700051O22Rik |
RIKEN cDNA 1700051O22 Gene |
1087 |
0.33 |
| chr11_113014430_113014672 | 0.56 |
2610035D17Rik |
RIKEN cDNA 2610035D17 gene |
158526 |
0.04 |
| chr9_108559459_108559610 | 0.56 |
Impdh2 |
inosine monophosphate dehydrogenase 2 |
752 |
0.3 |
| chr17_74291708_74292234 | 0.56 |
Memo1 |
mediator of cell motility 1 |
2819 |
0.19 |
| chr19_32215460_32215611 | 0.56 |
Sgms1 |
sphingomyelin synthase 1 |
4522 |
0.25 |
| chr4_32986761_32986927 | 0.55 |
Rragd |
Ras-related GTP binding D |
3390 |
0.16 |
| chr16_32612449_32612694 | 0.55 |
Tfrc |
transferrin receptor |
2661 |
0.21 |
| chr19_44107644_44108121 | 0.55 |
Chuk |
conserved helix-loop-helix ubiquitous kinase |
402 |
0.77 |
| chr18_69630433_69630808 | 0.55 |
Tcf4 |
transcription factor 4 |
18176 |
0.26 |
| chr8_69774088_69774317 | 0.55 |
Gm20422 |
predicted gene 20422 |
684 |
0.37 |
| chr5_114941804_114941988 | 0.55 |
2210016L21Rik |
RIKEN cDNA 2210016L21 gene |
262 |
0.81 |
| chr7_3388248_3388668 | 0.55 |
Gm44257 |
predicted gene, 44257 |
1622 |
0.18 |
| chr11_109995030_109996297 | 0.55 |
Abca8b |
ATP-binding cassette, sub-family A (ABC1), member 8b |
80 |
0.98 |
| chr9_123928553_123928704 | 0.55 |
Ccr1 |
chemokine (C-C motif) receptor 1 |
40064 |
0.11 |
| chr11_117078307_117078698 | 0.55 |
Mir6516 |
microRNA 6516 |
1154 |
0.23 |
| chr11_69373204_69374091 | 0.54 |
Chd3 |
chromodomain helicase DNA binding protein 3 |
4241 |
0.09 |
| chr13_93307117_93307288 | 0.54 |
Homer1 |
homer scaffolding protein 1 |
832 |
0.53 |
| chr13_21242458_21243635 | 0.54 |
Gpx5 |
glutathione peroxidase 5 |
49685 |
0.07 |
| chrX_74082297_74082448 | 0.54 |
Mecp2 |
methyl CpG binding protein 2 |
3225 |
0.16 |
| chr1_185455922_185456264 | 0.54 |
Gm2061 |
predicted gene 2061 |
525 |
0.59 |
| chr11_4440868_4441276 | 0.54 |
Hormad2 |
HORMA domain containing 2 |
10 |
0.98 |
| chr3_103788933_103789165 | 0.53 |
Hipk1 |
homeodomain interacting protein kinase 1 |
2026 |
0.14 |
| chrX_150588358_150588734 | 0.53 |
Pfkfb1 |
6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 1 |
290 |
0.58 |
| chr12_53061586_53062872 | 0.53 |
n-R5s58 |
nuclear encoded rRNA 5S 58 |
15403 |
0.29 |
| chr3_19894434_19894682 | 0.52 |
4632415L05Rik |
RIKEN cDNA 4632415L05 gene |
328 |
0.88 |
| chr11_79995189_79995598 | 0.52 |
Suz12 |
SUZ12 polycomb repressive complex 2 subunit |
193 |
0.94 |
| chr2_177759736_177760293 | 0.52 |
Gm14322 |
predicted gene 14322 |
726 |
0.68 |
| chr7_75656111_75656262 | 0.52 |
Akap13 |
A kinase (PRKA) anchor protein 13 |
12001 |
0.18 |
| chr11_88045882_88046038 | 0.52 |
Srsf1 |
serine and arginine-rich splicing factor 1 |
1413 |
0.28 |
| chr13_23367284_23367488 | 0.52 |
Zfp322a |
zinc finger protein 322A |
825 |
0.43 |
| chr1_5084073_5084283 | 0.51 |
Atp6v1h |
ATPase, H+ transporting, lysosomal V1 subunit H |
1014 |
0.52 |
| chr4_24019194_24019998 | 0.51 |
Gm28448 |
predicted gene 28448 |
85642 |
0.11 |
| chr3_58158331_58159098 | 0.51 |
1700007F19Rik |
RIKEN cDNA 1700007F19 gene |
5093 |
0.2 |
| chr6_4749522_4750033 | 0.51 |
Peg10 |
paternally expressed 10 |
2371 |
0.22 |
| chr7_102442743_102443127 | 0.50 |
Rrm1 |
ribonucleotide reductase M1 |
892 |
0.41 |
| chr1_14308048_14308199 | 0.50 |
Eya1 |
EYA transcriptional coactivator and phosphatase 1 |
1713 |
0.47 |
| chr2_131180193_131180350 | 0.50 |
Cenpb |
centromere protein B |
204 |
0.87 |
| chr12_110698296_110698559 | 0.50 |
Hsp90aa1 |
heat shock protein 90, alpha (cytosolic), class A member 1 |
2032 |
0.22 |
| chr19_8886949_8887194 | 0.50 |
Snora57 |
small nucleolar RNA, H/ACA box 57 |
1614 |
0.09 |
| chr11_22176101_22176260 | 0.50 |
Ehbp1 |
EH domain binding protein 1 |
3174 |
0.37 |
| chr4_19568094_19568245 | 0.50 |
Cpne3 |
copine III |
1914 |
0.34 |
| chr2_166459789_166460153 | 0.50 |
5031425F14Rik |
RIKEN cDNA 5031425F14 gene |
12520 |
0.21 |
| chr7_142661668_142661819 | 0.50 |
Igf2 |
insulin-like growth factor 2 |
127 |
0.92 |
| chr1_160330499_160330785 | 0.50 |
Gm37529 |
predicted gene, 37529 |
3564 |
0.18 |
| chr6_49219024_49219184 | 0.50 |
Igf2bp3 |
insulin-like growth factor 2 mRNA binding protein 3 |
4147 |
0.18 |
| chr3_95753977_95754134 | 0.49 |
Tars2 |
threonyl-tRNA synthetase 2, mitochondrial (putative) |
300 |
0.8 |
| chr14_70241814_70242222 | 0.49 |
Gm49288 |
predicted gene, 49288 |
4449 |
0.14 |
| chr5_136960002_136960153 | 0.49 |
Fis1 |
fission, mitochondrial 1 |
2000 |
0.17 |
| chr1_71100990_71101619 | 0.49 |
Bard1 |
BRCA1 associated RING domain 1 |
1842 |
0.43 |
| chr1_58195356_58195766 | 0.49 |
Aox4 |
aldehyde oxidase 4 |
14836 |
0.17 |
| chr13_4608498_4609140 | 0.49 |
Akr1e1 |
aldo-keto reductase family 1, member E1 |
299 |
0.66 |
| chr4_127030471_127030622 | 0.49 |
Gm12940 |
predicted gene 12940 |
3185 |
0.14 |
| chr4_147809295_147810159 | 0.49 |
Zfp984 |
zinc finger protein 984 |
61 |
0.56 |
| chr2_14825138_14825659 | 0.49 |
Cacnb2 |
calcium channel, voltage-dependent, beta 2 subunit |
1306 |
0.4 |
| chr6_6007608_6007965 | 0.49 |
Dync1i1 |
dynein cytoplasmic 1 intermediate chain 1 |
1720 |
0.44 |
| chrX_77509195_77510206 | 0.49 |
Tbl1x |
transducin (beta)-like 1 X-linked |
1313 |
0.51 |
| chr7_113950384_113950535 | 0.49 |
Gm45615 |
predicted gene 45615 |
136439 |
0.04 |
| chr4_135571917_135572742 | 0.49 |
Grhl3 |
grainyhead like transcription factor 3 |
1301 |
0.37 |
| chr8_94702770_94703339 | 0.48 |
Pllp |
plasma membrane proteolipid |
6776 |
0.13 |
| chr11_115818449_115818600 | 0.48 |
Tsen54 |
tRNA splicing endonuclease subunit 54 |
2186 |
0.16 |
| chr12_73284608_73284797 | 0.48 |
Trmt5 |
TRM5 tRNA methyltransferase 5 |
2007 |
0.28 |
| chr5_134583597_134583752 | 0.48 |
Rfc2 |
replication factor C (activator 1) 2 |
917 |
0.4 |
| chr2_169094538_169094689 | 0.48 |
Gm14258 |
predicted gene 14258 |
11840 |
0.2 |
| chr3_154335608_154336123 | 0.48 |
AI606473 |
expressed sequence AI606473 |
3868 |
0.24 |
| chr3_154336278_154336429 | 0.48 |
AI606473 |
expressed sequence AI606473 |
4356 |
0.23 |
| chr10_58373225_58373745 | 0.48 |
Lims1 |
LIM and senescent cell antigen-like domains 1 |
2031 |
0.32 |
| chr2_75422821_75423293 | 0.48 |
Gm13658 |
predicted gene 13658 |
13000 |
0.2 |
| chrX_58256086_58256547 | 0.47 |
Gm14647 |
predicted gene 14647 |
31237 |
0.2 |
| chr18_73762442_73762956 | 0.47 |
Elac1 |
elaC ribonuclease Z 1 |
8220 |
0.17 |
| chr11_101801663_101801814 | 0.47 |
Etv4 |
ets variant 4 |
16367 |
0.14 |
| chr1_62795476_62796303 | 0.47 |
Gm37121 |
predicted gene, 37121 |
13413 |
0.19 |
| chr2_34803884_34804143 | 0.47 |
Rabepk |
Rab9 effector protein with kelch motifs |
4101 |
0.13 |
| chr14_48661734_48663217 | 0.47 |
Otx2 |
orthodenticle homeobox 2 |
397 |
0.71 |
| chr6_97176798_97176949 | 0.46 |
Tmf1 |
TATA element modulatory factor 1 |
2164 |
0.22 |
| chr2_163658129_163658339 | 0.46 |
Pkig |
protein kinase inhibitor, gamma |
152 |
0.94 |
| chr7_27685487_27685878 | 0.46 |
Zfp607b |
zinc finger protein 607B |
3658 |
0.12 |
| chr16_87705786_87706863 | 0.46 |
Bach1 |
BTB and CNC homology 1, basic leucine zipper transcription factor 1 |
7320 |
0.23 |
| chr6_117880035_117880414 | 0.46 |
Zfp239 |
zinc finger protein 239 |
17140 |
0.1 |
| chr11_20635116_20635267 | 0.46 |
Sertad2 |
SERTA domain containing 2 |
3212 |
0.28 |
| chr12_80789879_80790231 | 0.46 |
Gm47941 |
predicted gene, 47941 |
288 |
0.62 |
| chr1_134962613_134963210 | 0.46 |
Ube2t |
ubiquitin-conjugating enzyme E2T |
293 |
0.89 |
| chr2_160647546_160648159 | 0.46 |
Top1 |
topoisomerase (DNA) I |
1872 |
0.32 |
| chr9_61944794_61945642 | 0.45 |
Kif23 |
kinesin family member 23 |
1518 |
0.41 |
| chr5_99976322_99976726 | 0.45 |
Hnrnpd |
heterogeneous nuclear ribonucleoprotein D |
27 |
0.95 |
| chr11_48788649_48789072 | 0.45 |
Rack1 |
receptor for activated C kinase 1 |
11472 |
0.09 |
| chr16_18286012_18286942 | 0.45 |
Gm24572 |
predicted gene, 24572 |
1840 |
0.14 |
| chr1_138346039_138346510 | 0.45 |
Gm28500 |
predicted gene 28500 |
30990 |
0.17 |
| chr4_9667155_9667713 | 0.45 |
Asph |
aspartate-beta-hydroxylase |
1652 |
0.32 |
| chr9_64769326_64769517 | 0.45 |
Rab11a |
RAB11A, member RAS oncogene family |
31663 |
0.14 |
| chr12_70107861_70108470 | 0.45 |
Nin |
ninein |
3406 |
0.2 |
| chrX_75382058_75382410 | 0.45 |
F8 |
coagulation factor VIII |
57 |
0.64 |
| chr8_34075511_34075662 | 0.44 |
Dctn6 |
dynactin 6 |
17339 |
0.11 |
| chr17_14959778_14960235 | 0.44 |
Phf10 |
PHD finger protein 10 |
479 |
0.69 |
| chr2_69670826_69672050 | 0.44 |
Klhl41 |
kelch-like 41 |
1318 |
0.37 |
| chr14_66999128_66999279 | 0.44 |
Bnip3l |
BCL2/adenovirus E1B interacting protein 3-like |
454 |
0.77 |
| chr8_57334568_57334719 | 0.44 |
Gm34030 |
predicted gene, 34030 |
58 |
0.96 |
| chr12_91849413_91849645 | 0.44 |
Sel1l |
sel-1 suppressor of lin-12-like (C. elegans) |
372 |
0.83 |
| chr6_31612888_31614126 | 0.44 |
Gm43154 |
predicted gene 43154 |
8218 |
0.19 |
| chr18_42467244_42467875 | 0.44 |
Gm3631 |
predicted gene 3631 |
19529 |
0.16 |
| chr10_91169807_91170237 | 0.44 |
Tmpo |
thymopoietin |
440 |
0.81 |
| chr2_51140113_51141649 | 0.44 |
Rnd3 |
Rho family GTPase 3 |
8213 |
0.26 |
| chr16_14163308_14164229 | 0.44 |
Marf1 |
meiosis regulator and mRNA stability 1 |
417 |
0.45 |
| chr11_22075282_22075635 | 0.44 |
Otx1 |
orthodenticle homeobox 1 |
72561 |
0.11 |
| chr19_16478581_16478732 | 0.43 |
Gm8222 |
predicted gene 8222 |
12408 |
0.19 |
| chr4_24497620_24498118 | 0.43 |
Mms22l |
MMS22-like, DNA repair protein |
27 |
0.99 |
| chr2_45112061_45113148 | 0.43 |
Zeb2os |
zinc finger E-box binding homeobox 2, opposite strand |
116 |
0.73 |
| chr10_105096745_105096946 | 0.43 |
Gm25422 |
predicted gene, 25422 |
43490 |
0.14 |
| chrX_93287310_93287481 | 0.43 |
Arx |
aristaless related homeobox |
885 |
0.66 |
| chr11_20331469_20331707 | 0.43 |
Slc1a4 |
solute carrier family 1 (glutamate/neutral amino acid transporter), member 4 |
1096 |
0.49 |
| chr5_65459701_65459852 | 0.43 |
Smim14 |
small integral membrane protein 14 |
1265 |
0.27 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.0 | GO:0045963 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
| 0.3 | 0.8 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.3 | 0.5 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.2 | 0.7 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.2 | 0.7 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.2 | 0.7 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.2 | 0.5 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.1 | 0.4 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.1 | 0.4 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.1 | 0.4 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.1 | 0.5 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 0.4 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 | 0.6 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.1 | 0.4 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.1 | 0.9 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 0.4 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.1 | 0.1 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.1 | 0.3 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.1 | 0.3 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.1 | 0.6 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.1 | 0.1 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.1 | 0.3 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.1 | 0.5 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.1 | 0.3 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 0.1 | 0.3 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.1 | 0.4 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.1 | 0.4 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
| 0.1 | 0.4 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.1 | 0.5 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.1 | 0.6 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.1 | 0.4 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.1 | 0.4 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.2 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.1 | 0.5 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.1 | 0.3 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.1 | 0.3 | GO:0045006 | DNA deamination(GO:0045006) |
| 0.1 | 0.2 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.2 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.1 | 0.2 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.1 | 0.2 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
| 0.1 | 0.4 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
| 0.1 | 0.7 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.1 | 0.4 | GO:0051256 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 0.2 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.1 | 0.4 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.1 | 0.7 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
| 0.1 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.1 | 0.2 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
| 0.1 | 0.2 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.1 | 0.2 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.1 | 0.9 | GO:0016556 | mRNA modification(GO:0016556) |
| 0.1 | 0.3 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.1 | 0.3 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.1 | 0.1 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
| 0.1 | 0.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.1 | 0.2 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
| 0.1 | 0.2 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.1 | 0.2 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
| 0.1 | 1.6 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.1 | 0.3 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.1 | 0.2 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.1 | 0.3 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.1 | 0.3 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
| 0.1 | 0.3 | GO:0006551 | leucine metabolic process(GO:0006551) |
| 0.1 | 0.2 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.1 | 0.1 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.1 | 0.2 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.1 | 0.5 | GO:0045144 | meiotic sister chromatid segregation(GO:0045144) meiotic sister chromatid cohesion(GO:0051177) |
| 0.1 | 0.3 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.1 | 0.2 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.1 | 0.1 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
| 0.1 | 0.4 | GO:0061620 | glycolytic process through glucose-6-phosphate(GO:0061620) |
| 0.1 | 0.4 | GO:0035989 | tendon development(GO:0035989) |
| 0.1 | 0.4 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.1 | 0.6 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 | 0.2 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
| 0.1 | 0.2 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.1 | 0.2 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.1 | 0.5 | GO:0031272 | regulation of pseudopodium assembly(GO:0031272) |
| 0.1 | 0.7 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
| 0.1 | 0.2 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 | 0.2 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 0.1 | 0.2 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.1 | 0.2 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.1 | 0.3 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.1 | 0.2 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
| 0.1 | 0.4 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.1 | 0.4 | GO:0032328 | alanine transport(GO:0032328) |
| 0.1 | 0.4 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.1 | 0.1 | GO:0021843 | substrate-independent telencephalic tangential migration(GO:0021826) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
| 0.0 | 0.1 | GO:0009188 | ribonucleoside diphosphate biosynthetic process(GO:0009188) |
| 0.0 | 0.2 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.0 | 0.1 | GO:0072131 | kidney mesenchyme morphogenesis(GO:0072131) metanephric mesenchyme morphogenesis(GO:0072133) |
| 0.0 | 0.1 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.0 | 0.4 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 | 0.2 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.0 | 0.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.0 | 0.0 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.0 | 0.5 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.0 | 0.2 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
| 0.0 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.0 | 0.2 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.0 | 0.3 | GO:0035826 | rubidium ion transport(GO:0035826) |
| 0.0 | 0.3 | GO:0070989 | oxidative demethylation(GO:0070989) |
| 0.0 | 0.4 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.0 | 0.5 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.0 | 0.4 | GO:0031659 | positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
| 0.0 | 0.2 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.0 | 0.1 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 | 0.3 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.0 | 0.2 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
| 0.0 | 0.2 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.0 | 0.2 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.0 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.0 | 0.3 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
| 0.0 | 0.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 | 0.3 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.0 | 0.1 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.2 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.0 | 0.3 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.0 | 0.1 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.0 | 0.7 | GO:0035994 | response to muscle stretch(GO:0035994) |
| 0.0 | 0.2 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.0 | 0.1 | GO:0007208 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) |
| 0.0 | 0.0 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
| 0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 | 0.6 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.0 | 0.1 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
| 0.0 | 0.4 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.4 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.0 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.2 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
| 0.0 | 0.1 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.0 | 0.0 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.0 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.0 | 0.8 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.2 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.0 | 0.0 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
| 0.0 | 0.1 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
| 0.0 | 0.1 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.0 | 0.0 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
| 0.0 | 0.2 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.0 | 0.1 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.0 | 0.1 | GO:1900094 | nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
| 0.0 | 0.3 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.0 | 0.3 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.0 | 0.6 | GO:0090103 | cochlea morphogenesis(GO:0090103) |
| 0.0 | 0.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 | 0.3 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.0 | 0.1 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.0 | 0.2 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 | 0.1 | GO:1901475 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.0 | 0.2 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
| 0.0 | 0.1 | GO:0015822 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
| 0.0 | 0.1 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 | 0.2 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.0 | 0.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.0 | 0.1 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.0 | 0.3 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.4 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.0 | 0.6 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.0 | 0.2 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.1 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.0 | 0.2 | GO:0009115 | xanthine catabolic process(GO:0009115) xanthine metabolic process(GO:0046110) |
| 0.0 | 0.6 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 0.1 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.0 | 0.1 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.0 | 0.2 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
| 0.0 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.0 | 0.4 | GO:0003283 | atrial septum development(GO:0003283) |
| 0.0 | 0.1 | GO:0021764 | amygdala development(GO:0021764) |
| 0.0 | 0.1 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.0 | 0.2 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
| 0.0 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.0 | 0.2 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.0 | 0.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.0 | 0.6 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.0 | 0.8 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.0 | 0.3 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 | 0.1 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
| 0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 0.1 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.0 | 0.1 | GO:0009078 | alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) |
| 0.0 | 0.0 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 0.0 | 0.1 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
| 0.0 | 0.1 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.0 | 0.1 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.0 | 0.1 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.0 | 0.1 | GO:0071599 | otic vesicle development(GO:0071599) |
| 0.0 | 0.2 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.0 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.0 | 0.2 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.0 | 0.3 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.1 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
| 0.0 | 0.1 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.0 | 0.1 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.0 | 0.2 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.0 | 0.1 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.0 | 0.0 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
| 0.0 | 0.3 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
| 0.0 | 0.4 | GO:0006415 | translational termination(GO:0006415) |
| 0.0 | 0.1 | GO:0015817 | histidine transport(GO:0015817) |
| 0.0 | 0.1 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.0 | 0.0 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.0 | 0.3 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
| 0.0 | 0.1 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.1 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.0 | 0.1 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.0 | 0.1 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 0.0 | 0.1 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
| 0.0 | 0.1 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
| 0.0 | 0.1 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.2 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.0 | 0.1 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.0 | 0.0 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.0 | 0.2 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.0 | 0.1 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
| 0.0 | 0.0 | GO:1902488 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.0 | 0.4 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
| 0.0 | 0.1 | GO:0070346 | positive regulation of fat cell proliferation(GO:0070346) |
| 0.0 | 0.2 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
| 0.0 | 0.1 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.0 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.0 | 0.2 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.1 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
| 0.0 | 0.1 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.0 | 0.3 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.3 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.0 | 0.1 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.0 | 0.1 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
| 0.0 | 0.3 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
| 0.0 | 0.1 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.0 | 0.6 | GO:1903205 | regulation of hydrogen peroxide-induced cell death(GO:1903205) |
| 0.0 | 0.3 | GO:2000637 | positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.0 | 0.4 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.3 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.0 | 0.1 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 0.0 | 0.2 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.0 | 0.2 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.0 | 0.1 | GO:0009120 | deoxyribonucleoside metabolic process(GO:0009120) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.0 | 0.1 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.0 | 0.1 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
| 0.0 | 0.1 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.0 | 0.0 | GO:0046060 | dATP metabolic process(GO:0046060) |
| 0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.1 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
| 0.0 | 0.1 | GO:0090399 | replicative senescence(GO:0090399) |
| 0.0 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.0 | 0.1 | GO:0046909 | intermembrane transport(GO:0046909) |
| 0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.0 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
| 0.0 | 0.1 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
| 0.0 | 0.0 | GO:1901978 | positive regulation of cell cycle checkpoint(GO:1901978) |
| 0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 0.0 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.0 | 0.0 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
| 0.0 | 0.0 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.0 | 0.0 | GO:0019661 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.0 | 0.0 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.0 | 0.6 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.0 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.0 | 0.6 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
| 0.0 | 0.0 | GO:0002434 | immune complex clearance(GO:0002434) |
| 0.0 | 0.5 | GO:0032206 | positive regulation of telomere maintenance(GO:0032206) |
| 0.0 | 0.0 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 0.0 | 0.1 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.0 | 0.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.0 | 0.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.0 | 0.0 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
| 0.0 | 0.1 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.0 | 0.1 | GO:0006598 | polyamine catabolic process(GO:0006598) |
| 0.0 | 0.1 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 | 0.1 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 0.2 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.0 | 0.0 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
| 0.0 | 0.2 | GO:0035879 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.0 | 0.2 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.0 | 0.3 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.0 | 0.4 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.0 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 | 0.1 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.0 | 0.0 | GO:0090325 | regulation of locomotion involved in locomotory behavior(GO:0090325) |
| 0.0 | 0.3 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.0 | 0.0 | GO:0051305 | chromosome movement towards spindle pole(GO:0051305) |
| 0.0 | 0.5 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
| 0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.0 | 0.1 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.0 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.0 | 0.0 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
| 0.0 | 0.6 | GO:1902600 | hydrogen ion transmembrane transport(GO:1902600) |
| 0.0 | 0.2 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.0 | 0.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.0 | 0.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.0 | GO:0002424 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
| 0.0 | 0.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 0.0 | 0.2 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.0 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.0 | 0.1 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
| 0.0 | 0.0 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
| 0.0 | 0.3 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.1 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 0.0 | 0.2 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.0 | 0.0 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.0 | 0.2 | GO:0007143 | female meiotic division(GO:0007143) |
| 0.0 | 0.1 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.0 | 0.0 | GO:2000566 | positive regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000566) |
| 0.0 | 0.3 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.0 | 0.0 | GO:0035524 | proline transmembrane transport(GO:0035524) |
| 0.0 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.1 | GO:0006991 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.0 | 0.1 | GO:0015860 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
| 0.0 | 0.1 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.0 | 0.0 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.0 | 0.2 | GO:0003094 | glomerular filtration(GO:0003094) |
| 0.0 | 0.4 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.0 | 0.1 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.0 | 0.2 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
| 0.0 | 0.4 | GO:0048520 | positive regulation of behavior(GO:0048520) |
| 0.0 | 0.0 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.0 | 0.1 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.1 | GO:0007512 | adult heart development(GO:0007512) |
| 0.0 | 0.1 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
| 0.0 | 0.0 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.0 | 0.2 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
| 0.0 | 0.4 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.1 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.0 | 0.0 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.0 | 0.0 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 | 0.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.1 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.0 | 0.1 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.0 | 0.1 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.0 | 0.0 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.0 | 0.0 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.0 | 0.3 | GO:0045540 | regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.0 | 0.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 | 0.0 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
| 0.0 | 0.2 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.0 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.0 | 0.1 | GO:0060283 | negative regulation of oocyte development(GO:0060283) regulation of oocyte maturation(GO:1900193) negative regulation of oocyte maturation(GO:1900194) |
| 0.0 | 0.1 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.3 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 0.0 | 0.1 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.0 | 0.2 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.0 | 0.7 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 0.1 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.0 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.0 | 0.1 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.0 | 0.0 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
| 0.0 | 0.0 | GO:2001171 | positive regulation of ATP biosynthetic process(GO:2001171) |
| 0.0 | 0.0 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
| 0.0 | 0.0 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.0 | 0.0 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
| 0.0 | 0.1 | GO:2001271 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.0 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
| 0.0 | 0.1 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.0 | 0.1 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.0 | 0.1 | GO:0045630 | positive regulation of T-helper 2 cell differentiation(GO:0045630) |
| 0.0 | 0.3 | GO:0061436 | establishment of skin barrier(GO:0061436) |
| 0.0 | 0.1 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.0 | 0.0 | GO:0051299 | centrosome separation(GO:0051299) |
| 0.0 | 0.2 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.0 | 0.0 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.5 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
| 0.0 | 0.0 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.1 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.0 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.0 | 0.0 | GO:0010985 | negative regulation of lipoprotein particle clearance(GO:0010985) |
| 0.0 | 0.0 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.0 | 0.0 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.0 | 0.7 | GO:0006096 | glycolytic process(GO:0006096) |
| 0.0 | 0.0 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.0 | 0.1 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.0 | 0.1 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.0 | 0.0 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.0 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.0 | 0.1 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.0 | 0.1 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 0.1 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
| 0.0 | 0.0 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.0 | 0.0 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.0 | 0.2 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.0 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
| 0.0 | 0.1 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 | 0.0 | GO:0071224 | cellular response to peptidoglycan(GO:0071224) |
| 0.0 | 0.0 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.0 | 0.2 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
| 0.0 | 0.0 | GO:0030421 | defecation(GO:0030421) |
| 0.0 | 0.1 | GO:0060346 | bone trabecula formation(GO:0060346) |
| 0.0 | 0.0 | GO:0061687 | detoxification of copper ion(GO:0010273) detoxification of inorganic compound(GO:0061687) stress response to copper ion(GO:1990169) |
| 0.0 | 0.2 | GO:0044247 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.0 | 0.0 | GO:0097113 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
| 0.0 | 0.0 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.0 | 0.1 | GO:0016074 | snoRNA metabolic process(GO:0016074) |
| 0.0 | 0.0 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 | 0.1 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 0.0 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
| 0.0 | 0.1 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.0 | 0.0 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.0 | 0.1 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
| 0.0 | 0.0 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.0 | 0.0 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.0 | 0.1 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.0 | 0.0 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.0 | 0.0 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.0 | 0.2 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 0.1 | GO:0071354 | cellular response to interleukin-6(GO:0071354) |
| 0.0 | 0.0 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.0 | 0.1 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.0 | 0.1 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 0.0 | GO:1901524 | regulation of macromitophagy(GO:1901524) |
| 0.0 | 0.0 | GO:0051088 | monocyte activation(GO:0042117) PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.0 | 0.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.0 | 0.0 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.0 | 0.0 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.0 | 0.1 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 | 0.0 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 0.2 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.1 | GO:2000780 | negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
| 0.0 | 0.2 | GO:0060337 | type I interferon signaling pathway(GO:0060337) |
| 0.0 | 0.0 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.0 | 0.1 | GO:0000338 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
| 0.0 | 0.0 | GO:0046037 | GMP metabolic process(GO:0046037) |
| 0.0 | 0.1 | GO:1901976 | regulation of cell cycle checkpoint(GO:1901976) regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.0 | GO:0006901 | vesicle coating(GO:0006901) |
| 0.0 | 0.3 | GO:0047496 | vesicle transport along microtubule(GO:0047496) |
| 0.0 | 0.1 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.0 | 0.0 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.0 | 0.1 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.0 | 0.2 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 | 0.0 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.0 | 0.1 | GO:0044038 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
| 0.0 | 0.1 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.0 | 0.0 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.0 | 0.0 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
| 0.0 | 0.2 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 0.0 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.0 | 0.0 | GO:0014891 | skeletal muscle atrophy(GO:0014732) striated muscle atrophy(GO:0014891) |
| 0.0 | 0.1 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
| 0.0 | 0.0 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.0 | 0.1 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
| 0.0 | 0.0 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.0 | 0.0 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.0 | 0.0 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.0 | 0.0 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.0 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.0 | 0.0 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.0 | 0.2 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
| 0.0 | 0.0 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.0 | 0.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.0 | 0.0 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.0 | 0.1 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 0.2 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.4 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.0 | 0.0 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.0 | 0.6 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.0 | 0.0 | GO:0008228 | opsonization(GO:0008228) |
| 0.0 | 0.0 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.0 | 0.1 | GO:0032042 | mitochondrial DNA metabolic process(GO:0032042) |
| 0.0 | 0.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 0.0 | 0.0 | GO:0071866 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.0 | 0.0 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.0 | 0.1 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.0 | 0.0 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.0 | 0.0 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.0 | 0.0 | GO:0019374 | galactolipid metabolic process(GO:0019374) |
| 0.0 | 0.2 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.0 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
| 0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.0 | GO:0060148 | positive regulation of posttranscriptional gene silencing(GO:0060148) |
| 0.0 | 0.0 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.0 | 0.0 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.0 | 0.1 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.0 | 0.0 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.0 | 0.1 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
| 0.0 | 0.1 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.1 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
| 0.0 | 0.0 | GO:1901032 | negative regulation of response to reactive oxygen species(GO:1901032) |
| 0.0 | 0.0 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.0 | 0.0 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 0.1 | GO:2000252 | negative regulation of feeding behavior(GO:2000252) |
| 0.0 | 0.3 | GO:0031529 | ruffle organization(GO:0031529) |
| 0.0 | 0.0 | GO:0001803 | type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
| 0.0 | 0.2 | GO:0006414 | translational elongation(GO:0006414) |
| 0.0 | 0.0 | GO:0072672 | neutrophil extravasation(GO:0072672) |
| 0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.0 | 0.1 | GO:0010574 | regulation of vascular endothelial growth factor production(GO:0010574) |
| 0.0 | 0.0 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 0.0 | 0.0 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.0 | 0.0 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.1 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.4 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 0.0 | 0.1 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.0 | 0.0 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.0 | 0.0 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.0 | GO:2000410 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
| 0.0 | 0.0 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.2 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 | 0.2 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.0 | 0.0 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.0 | 0.0 | GO:1903748 | negative regulation of protein targeting to mitochondrion(GO:1903215) negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.0 | 0.0 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.0 | 0.0 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 | 0.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.8 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.2 | 1.2 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.1 | 0.9 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.1 | 0.6 | GO:0098536 | deuterosome(GO:0098536) |
| 0.1 | 0.7 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.1 | 0.4 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.1 | 0.7 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 0.4 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.1 | 0.5 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 0.5 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.1 | 0.1 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 0.5 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.1 | 0.9 | GO:0042581 | specific granule(GO:0042581) |
| 0.1 | 0.2 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.1 | 0.6 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 0.5 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.1 | 0.4 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 0.2 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.1 | 0.7 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.1 | 0.2 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 0.2 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.1 | 0.1 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.1 | 0.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.1 | 0.2 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.1 | 0.3 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 0.6 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.1 | 0.6 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 0.4 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.1 | 0.2 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.1 | 0.2 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.1 | 0.3 | GO:0005675 | holo TFIIH complex(GO:0005675) |
| 0.1 | 0.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.1 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.1 | 0.2 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.0 | 0.1 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 0.0 | 0.2 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.0 | 0.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 0.1 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 0.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.0 | 0.3 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.5 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 1.8 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.0 | GO:0044453 | nuclear membrane part(GO:0044453) |
| 0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
| 0.0 | 0.2 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 0.3 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.0 | 0.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.0 | 0.3 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.0 | 0.2 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.2 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.0 | 0.0 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.0 | 0.6 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.0 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 0.4 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.2 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.0 | 0.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.1 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.0 | 0.2 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.0 | 0.6 | GO:0045120 | pronucleus(GO:0045120) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.2 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.0 | 0.2 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.0 | 0.6 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.0 | 0.1 | GO:0070069 | cytochrome complex(GO:0070069) |
| 0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.0 | 0.5 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
| 0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 0.1 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.0 | 0.3 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.2 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.0 | 0.1 | GO:0005712 | chiasma(GO:0005712) |
| 0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.1 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.0 | 0.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.0 | 0.1 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.1 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.0 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.0 | 0.8 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.0 | 0.3 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.0 | 0.7 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.2 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.0 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.4 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
| 0.0 | 0.5 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.0 | 1.5 | GO:0000776 | kinetochore(GO:0000776) |
| 0.0 | 0.0 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.1 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.1 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 0.0 | 0.2 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.2 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.0 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 0.2 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.2 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.0 | 0.2 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.0 | 0.1 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.2 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.0 | 2.1 | GO:0022626 | cytosolic ribosome(GO:0022626) |
| 0.0 | 0.2 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 0.0 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.2 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
| 0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 0.2 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.2 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.0 | 0.4 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 0.2 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.0 | 0.1 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
| 0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
| 0.0 | 0.1 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 0.1 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.0 | 0.4 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.0 | 0.2 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.0 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.1 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 0.0 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 0.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.0 | 0.4 | GO:0015935 | small ribosomal subunit(GO:0015935) |
| 0.0 | 0.0 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.0 | 0.1 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
| 0.0 | 0.1 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.5 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.2 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.0 | 0.1 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.0 | 0.3 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.1 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.1 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 0.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.0 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.0 | 0.2 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.4 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.0 | 1.3 | GO:0016607 | nuclear speck(GO:0016607) |
| 0.0 | 1.3 | GO:0005681 | spliceosomal complex(GO:0005681) |
| 0.0 | 0.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.6 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.3 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.3 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.5 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.1 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 0.5 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 1.1 | GO:0000793 | condensed chromosome(GO:0000793) |
| 0.0 | 0.1 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.0 | 0.0 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.0 | 0.0 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.0 | 0.0 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.0 | 0.2 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.1 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.0 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.0 | 0.3 | GO:0031672 | A band(GO:0031672) |
| 0.0 | 0.1 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
| 0.0 | 0.0 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.0 | 0.3 | GO:0000791 | euchromatin(GO:0000791) |
| 0.0 | 0.3 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.0 | 0.5 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.7 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
| 0.0 | 0.1 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 0.1 | GO:0005861 | troponin complex(GO:0005861) |
| 0.0 | 0.1 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 5.2 | GO:0005730 | nucleolus(GO:0005730) |
| 0.0 | 0.1 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.0 | GO:1990745 | EARP complex(GO:1990745) |
| 0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.2 | GO:0070469 | respiratory chain(GO:0070469) |
| 0.0 | 0.0 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.0 | 0.1 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.1 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.0 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.0 | 0.0 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.0 | 0.0 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.0 | 0.0 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.0 | 0.0 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.4 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.0 | 0.1 | GO:0060091 | kinocilium(GO:0060091) |
| 0.0 | 0.0 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 0.1 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.0 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.0 | 0.0 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
| 0.0 | 1.1 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.0 | 0.0 | GO:0043511 | inhibin complex(GO:0043511) |
| 0.0 | 0.2 | GO:0097228 | sperm principal piece(GO:0097228) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.2 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.2 | 0.5 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.2 | 1.2 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 0.7 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.1 | 0.6 | GO:0032564 | dATP binding(GO:0032564) |
| 0.1 | 0.7 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 0.8 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.1 | 0.4 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.1 | 0.3 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.1 | 0.3 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.1 | 0.4 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.1 | 0.3 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.1 | 0.2 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 0.7 | GO:0050544 | arachidonic acid binding(GO:0050544) |
| 0.1 | 0.3 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.1 | 0.3 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.1 | 0.3 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.1 | 0.2 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.1 | 0.2 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.1 | 0.7 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.1 | 0.4 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.1 | 0.3 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.1 | 0.4 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.1 | 0.8 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.1 | 0.6 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.1 | 0.3 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.1 | 0.2 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.1 | 0.3 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.1 | 0.2 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.1 | 0.1 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.1 | 0.4 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 0.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 0.3 | GO:0008312 | 7S RNA binding(GO:0008312) |
| 0.1 | 0.2 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.1 | 0.5 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.1 | 0.3 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.1 | 0.8 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.1 | 0.2 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 0.2 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.1 | 0.2 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.1 | 0.2 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
| 0.0 | 0.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 0.1 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 0.3 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.3 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.0 | 0.2 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.0 | 0.2 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.0 | 0.4 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.2 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.2 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.2 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.6 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.4 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 0.5 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.0 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
| 0.0 | 0.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.0 | 0.1 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.0 | 0.3 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 0.3 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.0 | 0.1 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.0 | 0.8 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 0.3 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.0 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.0 | 0.1 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.0 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
| 0.0 | 0.2 | GO:0004854 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
| 0.0 | 0.3 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.0 | 0.2 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.0 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.0 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.2 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.0 | 0.2 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.3 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.0 | 0.2 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.5 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.1 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.0 | 0.4 | GO:0043176 | amine binding(GO:0043176) |
| 0.0 | 0.1 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.3 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.0 | 0.2 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.0 | 0.2 | GO:0044605 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.0 | 0.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.0 | 0.4 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 0.5 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 0.1 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.1 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.0 | 0.2 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.0 | 0.1 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.0 | 0.1 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.4 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
| 0.0 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.0 | 0.1 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.0 | 0.2 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.4 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.0 | 0.2 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.3 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.0 | 0.1 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.0 | 0.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.2 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.0 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.0 | 0.1 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
| 0.0 | 0.6 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
| 0.0 | 0.1 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.0 | 0.4 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 0.1 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 0.1 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.0 | 0.1 | GO:0098505 | single-stranded telomeric DNA binding(GO:0043047) G-rich strand telomeric DNA binding(GO:0098505) |
| 0.0 | 0.5 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.6 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.3 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.1 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 0.1 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
| 0.0 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.0 | 0.3 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.3 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.1 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.0 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.0 | 0.2 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.0 | 0.4 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.3 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 0.3 | GO:0010181 | FMN binding(GO:0010181) |
| 0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.0 | 0.6 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.4 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.1 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.0 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.0 | 0.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.1 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
| 0.0 | 0.3 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.0 | 0.8 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 0.1 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.0 | 0.8 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.1 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
| 0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.4 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.0 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.0 | 0.2 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.2 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.0 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 0.1 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.0 | 0.0 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 0.0 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.0 | 0.1 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.0 | 0.1 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.0 | 0.1 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.0 | 0.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.2 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.0 | 0.1 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 0.1 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.0 | 0.1 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.1 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.2 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
| 0.0 | 0.2 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.2 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.1 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.7 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.0 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.0 | 0.1 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.0 | 0.0 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.0 | 0.3 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.3 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.0 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
| 0.0 | 0.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.4 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.3 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 0.3 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 0.1 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 2.8 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.6 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.0 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.1 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.0 | 0.0 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.2 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
| 0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.0 | GO:0004487 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.0 | 0.0 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.0 | 0.0 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.0 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 0.0 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.0 | 0.4 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.0 | 0.2 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.1 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.0 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.0 | 0.2 | GO:0070717 | poly-purine tract binding(GO:0070717) |
| 0.0 | 0.2 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.0 | 0.3 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 0.2 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.0 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.0 | 0.2 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.0 | 0.5 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.0 | 0.0 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.0 | 0.3 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.0 | 0.2 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.0 | 0.1 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.0 | 0.1 | GO:0018854 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
| 0.0 | 0.0 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.0 | 0.0 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.0 | 0.0 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.0 | 0.1 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.0 | 0.2 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.1 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.0 | 0.0 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.1 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.0 | 0.3 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.0 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
| 0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.1 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.0 | 0.1 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.0 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.0 | 0.0 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.0 | 0.0 | GO:0015211 | purine nucleoside transmembrane transporter activity(GO:0015211) |
| 0.0 | 0.2 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.0 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.0 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 0.1 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.0 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.1 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.1 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.1 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.0 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.1 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.0 | 0.1 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
| 0.0 | 0.0 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 0.0 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.0 | 0.2 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.6 | GO:0017048 | Rho GTPase binding(GO:0017048) |
| 0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.0 | 0.1 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.3 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.0 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.0 | 0.7 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.7 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
| 0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 0.1 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.0 | 0.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.0 | 0.1 | GO:0031005 | filamin binding(GO:0031005) |
| 0.0 | 0.1 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.0 | 0.2 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.0 | 0.0 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.0 | 0.0 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.0 | 0.1 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.0 | 0.1 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.0 | 0.0 | GO:0050543 | icosatetraenoic acid binding(GO:0050543) |
| 0.0 | 0.1 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.4 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.0 | 0.1 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.0 | 0.0 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.0 | 0.0 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
| 0.0 | 0.0 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 1.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.5 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.5 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.4 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 0.9 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.0 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 0.8 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 1.1 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.4 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.9 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.9 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.7 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.2 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.7 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.0 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.2 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 1.1 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 1.0 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.2 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.2 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.0 | 0.9 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 0.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.7 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.1 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 0.4 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.6 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.7 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.8 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.0 | 0.0 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.1 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.0 | 0.2 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.0 | 0.2 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.3 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.0 | 0.1 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.0 | 0.2 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.2 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 0.0 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.2 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.1 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.0 | 0.0 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 0.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.2 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.0 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 0.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.3 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.1 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 0.0 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.6 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 0.6 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.1 | 0.8 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 1.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.1 | 0.4 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 0.2 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.8 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 0.7 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 0.6 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
| 0.0 | 0.2 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 0.7 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 0.6 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.0 | 0.4 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.0 | 0.6 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 0.8 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
| 0.0 | 0.8 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.0 | 0.1 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.0 | 0.9 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.0 | 0.4 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 0.6 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.7 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.2 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 0.6 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.7 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 0.4 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.0 | 0.3 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 0.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.2 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 0.0 | 0.1 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
| 0.0 | 0.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 1.3 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 0.1 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.3 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.0 | 0.6 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.2 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.2 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.0 | 0.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.3 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.0 | 0.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.9 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.1 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.0 | 0.5 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.3 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.0 | 0.1 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.0 | 0.4 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.5 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.0 | 0.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.0 | 0.6 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 0.4 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 2.2 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.0 | 0.2 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.0 | 0.2 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.4 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
| 0.0 | 0.2 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 0.1 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 0.0 | 0.5 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.0 | 0.1 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.2 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.5 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.0 | 0.3 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.0 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.2 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 0.8 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.3 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.0 | 0.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.0 | 0.1 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.3 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.1 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.4 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 0.1 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
| 0.0 | 0.0 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.0 | 0.2 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 0.0 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 0.1 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 0.0 | 0.2 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.6 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.0 | 0.8 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.0 | 0.2 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.1 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.0 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.0 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.0 | 0.2 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.2 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 0.2 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.0 | 0.0 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.0 | 0.1 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.1 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.1 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |