Gene Symbol | Gene ID | Gene Info |
---|---|---|
Obox3
|
ENSMUSG00000066772.6 | Obox3 |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr5_119832754_119833593 | 3.58 |
Tbx5 |
T-box 5 |
505 |
0.67 |
chr17_71025887_71026476 | 3.53 |
Myom1 |
myomesin 1 |
6590 |
0.13 |
chr4_43521831_43522437 | 2.75 |
Tpm2 |
tropomyosin 2, beta |
1254 |
0.22 |
chr2_76805230_76805433 | 2.72 |
Ttn |
titin |
21211 |
0.22 |
chr8_121310902_121311668 | 2.52 |
Gm26815 |
predicted gene, 26815 |
45551 |
0.14 |
chrX_53053916_53055220 | 2.42 |
Mir322 |
microRNA 322 |
219 |
0.66 |
chr2_92140355_92141595 | 2.41 |
Phf21a |
PHD finger protein 21A |
43131 |
0.11 |
chr9_32645520_32646641 | 2.37 |
Ets1 |
E26 avian leukemia oncogene 1, 5' domain |
9832 |
0.16 |
chr2_114054589_114054921 | 2.35 |
C130080G10Rik |
RIKEN cDNA C130080G10 gene |
359 |
0.79 |
chr5_107724563_107727169 | 2.34 |
Gfi1 |
growth factor independent 1 transcription repressor |
61 |
0.88 |
chr14_101888494_101888858 | 2.30 |
Lmo7 |
LIM domain only 7 |
4557 |
0.31 |
chr3_79180505_79180656 | 2.21 |
Rapgef2 |
Rap guanine nucleotide exchange factor (GEF) 2 |
760 |
0.66 |
chr12_9573836_9576858 | 2.21 |
Osr1 |
odd-skipped related transcription factor 1 |
906 |
0.56 |
chr9_24766942_24767354 | 2.19 |
Tbx20 |
T-box 20 |
2532 |
0.28 |
chr15_41868535_41869588 | 2.18 |
Abra |
actin-binding Rho activating protein |
659 |
0.72 |
chr10_121348994_121349778 | 2.14 |
Gm48435 |
predicted gene, 48435 |
1074 |
0.36 |
chr15_93824709_93825690 | 2.10 |
Gm49445 |
predicted gene, 49445 |
161 |
0.97 |
chr13_53262209_53262987 | 2.10 |
Ror2 |
receptor tyrosine kinase-like orphan receptor 2 |
13060 |
0.26 |
chr11_82913178_82913757 | 2.06 |
Unc45b |
unc-45 myosin chaperone B |
2214 |
0.14 |
chr1_150991848_150992682 | 2.06 |
Hmcn1 |
hemicentin 1 |
786 |
0.64 |
chr8_78771411_78771855 | 2.01 |
Gm47209 |
predicted gene, 47209 |
2912 |
0.24 |
chr11_6923927_6924375 | 1.98 |
Gm11984 |
predicted gene 11984 |
61847 |
0.1 |
chr9_72779927_72780473 | 1.96 |
Gm27204 |
predicted gene 27204 |
3975 |
0.14 |
chr2_69673290_69673734 | 1.93 |
Klhl41 |
kelch-like 41 |
3392 |
0.19 |
chr8_92358774_92359033 | 1.93 |
Irx5 |
Iroquois homeobox 5 |
1154 |
0.45 |
chr2_172937060_172938226 | 1.91 |
Bmp7 |
bone morphogenetic protein 7 |
2449 |
0.28 |
chr9_75775275_75776608 | 1.87 |
Bmp5 |
bone morphogenetic protein 5 |
577 |
0.78 |
chr17_26840029_26840609 | 1.86 |
Nkx2-5 |
NK2 homeobox 5 |
1246 |
0.32 |
chr6_139586816_139587911 | 1.86 |
Pik3c2g |
phosphatidylinositol-4-phosphate 3-kinase catalytic subunit type 2 gamma |
126 |
0.96 |
chr5_31116571_31117424 | 1.84 |
Trim54 |
tripartite motif-containing 54 |
263 |
0.79 |
chr1_134801821_134802618 | 1.83 |
Gm37949 |
predicted gene, 37949 |
234 |
0.87 |
chr19_53680794_53681963 | 1.77 |
Rbm20 |
RNA binding motif protein 20 |
4072 |
0.23 |
chr14_49793886_49794107 | 1.77 |
Gm22989 |
predicted gene, 22989 |
5712 |
0.15 |
chr10_21996845_21998265 | 1.76 |
Sgk1 |
serum/glucocorticoid regulated kinase 1 |
964 |
0.51 |
chr10_53340367_53340889 | 1.75 |
Pln |
phospholamban |
2923 |
0.17 |
chr5_104095485_104095998 | 1.75 |
Gm26703 |
predicted gene, 26703 |
13476 |
0.11 |
chr5_92810933_92811565 | 1.73 |
Shroom3 |
shroom family member 3 |
1779 |
0.37 |
chr4_126508268_126508457 | 1.73 |
Ago4 |
argonaute RISC catalytic subunit 4 |
8550 |
0.11 |
chrX_153694764_153696276 | 1.69 |
Kctd12b |
potassium channel tetramerisation domain containing 12b |
760 |
0.62 |
chr8_4512079_4512363 | 1.68 |
Gm36956 |
predicted gene, 36956 |
9904 |
0.14 |
chr3_96404203_96405307 | 1.68 |
Gm26654 |
predicted gene, 26654 |
2374 |
0.09 |
chr2_153067320_153067894 | 1.65 |
Ccm2l |
cerebral cavernous malformation 2-like |
1605 |
0.3 |
chr19_43385959_43387401 | 1.64 |
Hpse2 |
heparanase 2 |
1574 |
0.38 |
chr3_138071309_138071916 | 1.63 |
1110002E22Rik |
RIKEN cDNA 1110002E22 gene |
15 |
0.97 |
chr3_54361590_54362355 | 1.62 |
Postn |
periostin, osteoblast specific factor |
829 |
0.74 |
chr15_25364028_25365185 | 1.62 |
4930445E18Rik |
RIKEN cDNA 4930445E18 gene |
31947 |
0.14 |
chr14_20656523_20656947 | 1.60 |
Myoz1 |
myozenin 1 |
195 |
0.87 |
chr15_12652178_12652473 | 1.60 |
F830212C03Rik |
RIKEN cDNA F830212C03 gene |
16979 |
0.17 |
chr8_44694283_44695120 | 1.59 |
Gm26089 |
predicted gene, 26089 |
92868 |
0.09 |
chr4_84015662_84015855 | 1.59 |
6030471H07Rik |
RIKEN cDNA 6030471H07 gene |
29121 |
0.21 |
chr14_20663885_20664570 | 1.59 |
Synpo2l |
synaptopodin 2-like |
347 |
0.74 |
chr9_64918332_64919221 | 1.58 |
Dennd4a |
DENN/MADD domain containing 4A |
6293 |
0.16 |
chr2_105125289_105128976 | 1.58 |
Wt1 |
Wilms tumor 1 homolog |
78 |
0.91 |
chr2_169204398_169205064 | 1.58 |
9430093N23Rik |
RIKEN cDNA 9430093N23 gene |
30260 |
0.21 |
chr8_13253441_13254226 | 1.57 |
Adprhl1 |
ADP-ribosylhydrolase like 1 |
238 |
0.86 |
chr2_50971013_50971859 | 1.57 |
Gm13498 |
predicted gene 13498 |
61752 |
0.14 |
chr9_77352280_77353245 | 1.57 |
Mlip |
muscular LMNA-interacting protein |
207 |
0.93 |
chr5_101537647_101538658 | 1.56 |
Gm43103 |
predicted gene 43103 |
31823 |
0.19 |
chr2_148436204_148436418 | 1.56 |
Cd93 |
CD93 antigen |
7252 |
0.16 |
chr2_180331993_180332571 | 1.55 |
Gata5os |
GATA binding protein 5, opposite strand |
575 |
0.63 |
chr10_58395820_58396456 | 1.55 |
Lims1 |
LIM and senescent cell antigen-like domains 1 |
1750 |
0.37 |
chr1_71844735_71845440 | 1.54 |
Gm37217 |
predicted gene, 37217 |
1523 |
0.42 |
chr12_85571980_85572497 | 1.51 |
Jdp2 |
Jun dimerization protein 2 |
26789 |
0.13 |
chr2_46055857_46056231 | 1.51 |
Gm13466 |
predicted gene 13466 |
246572 |
0.02 |
chr19_40302960_40303416 | 1.50 |
Sorbs1 |
sorbin and SH3 domain containing 1 |
3362 |
0.19 |
chrX_140667371_140668221 | 1.50 |
Mid2 |
midline 2 |
2724 |
0.24 |
chr2_76805862_76806506 | 1.50 |
Ttn |
titin |
20358 |
0.22 |
chr6_94592745_94593176 | 1.49 |
Lrig1 |
leucine-rich repeats and immunoglobulin-like domains 1 |
12433 |
0.18 |
chr12_73448708_73448859 | 1.48 |
Gm33929 |
predicted gene, 33929 |
465 |
0.79 |
chr11_36056449_36056704 | 1.48 |
Gm12126 |
predicted gene 12126 |
24088 |
0.21 |
chr1_62984449_62985185 | 1.48 |
Gm44468 |
predicted gene, 44468 |
40925 |
0.11 |
chr1_171189020_171190029 | 1.48 |
Pcp4l1 |
Purkinje cell protein 4-like 1 |
6744 |
0.09 |
chr12_117660805_117660956 | 1.46 |
Rapgef5 |
Rap guanine nucleotide exchange factor (GEF) 5 |
2846 |
0.32 |
chr15_6387024_6387858 | 1.46 |
Dab2 |
disabled 2, mitogen-responsive phosphoprotein |
662 |
0.75 |
chr2_93695850_93696662 | 1.46 |
Ext2 |
exostosin glycosyltransferase 2 |
8253 |
0.24 |
chr1_162207245_162208080 | 1.45 |
Dnm3os |
dynamin 3, opposite strand |
9961 |
0.17 |
chr16_57353772_57354243 | 1.45 |
Filip1l |
filamin A interacting protein 1-like |
730 |
0.63 |
chrX_11769817_11769968 | 1.44 |
Gm26314 |
predicted gene, 26314 |
80592 |
0.09 |
chr10_17796356_17797217 | 1.44 |
Txlnb |
taxilin beta |
530 |
0.7 |
chr2_17458500_17459039 | 1.43 |
Nebl |
nebulette |
1852 |
0.47 |
chrX_143058694_143058949 | 1.42 |
Rtl9 |
retrotransposon Gag like 9 |
40773 |
0.18 |
chr2_114057084_114058386 | 1.41 |
C130080G10Rik |
RIKEN cDNA C130080G10 gene |
1422 |
0.37 |
chr5_117533751_117534309 | 1.41 |
Gm42550 |
predicted gene 42550 |
13331 |
0.24 |
chr13_113662906_113663717 | 1.41 |
Hspb3 |
heat shock protein 3 |
365 |
0.85 |
chr1_163311555_163312976 | 1.41 |
Prrx1 |
paired related homeobox 1 |
1403 |
0.39 |
chr2_66783826_66785264 | 1.40 |
Scn7a |
sodium channel, voltage-gated, type VII, alpha |
369 |
0.91 |
chr9_98972964_98973852 | 1.40 |
Faim |
Fas apoptotic inhibitory molecule |
12965 |
0.12 |
chrX_106135756_106136481 | 1.39 |
Tlr13 |
toll-like receptor 13 |
7086 |
0.16 |
chr3_10367658_10368817 | 1.39 |
Chmp4c |
charged multivesicular body protein 4C |
1279 |
0.33 |
chr10_45783632_45783865 | 1.37 |
D030045P18Rik |
RIKEN cDNA D030045P18 gene |
23814 |
0.18 |
chr5_119838900_119840891 | 1.37 |
Tbx5 |
T-box 5 |
3740 |
0.21 |
chr8_22506948_22507557 | 1.36 |
Slc20a2 |
solute carrier family 20, member 2 |
1026 |
0.46 |
chr13_59948737_59948910 | 1.36 |
Gm48390 |
predicted gene, 48390 |
29385 |
0.13 |
chr10_24958395_24959363 | 1.35 |
Gm36172 |
predicted gene, 36172 |
31260 |
0.12 |
chr11_44696670_44697193 | 1.35 |
Gm12158 |
predicted gene 12158 |
34255 |
0.18 |
chr11_19102879_19103363 | 1.35 |
Gm37439 |
predicted gene, 37439 |
14313 |
0.19 |
chr11_118744160_118745307 | 1.34 |
Rbfox3 |
RNA binding protein, fox-1 homolog (C. elegans) 3 |
16308 |
0.21 |
chr9_32699930_32700500 | 1.34 |
Ets1 |
E26 avian leukemia oncogene 1, 5' domain |
3831 |
0.22 |
chr5_118327546_118328619 | 1.34 |
Gm25076 |
predicted gene, 25076 |
61633 |
0.09 |
chr7_19290671_19291896 | 1.33 |
Rtn2 |
reticulon 2 (Z-band associated protein) |
214 |
0.83 |
chr4_34976398_34976873 | 1.33 |
Gm12364 |
predicted gene 12364 |
14415 |
0.17 |
chr5_30913519_30915234 | 1.30 |
Emilin1 |
elastin microfibril interfacer 1 |
637 |
0.48 |
chr12_108370973_108372659 | 1.29 |
Eml1 |
echinoderm microtubule associated protein like 1 |
859 |
0.58 |
chr15_83528663_83529433 | 1.28 |
Bik |
BCL2-interacting killer |
2176 |
0.19 |
chr4_105108487_105108685 | 1.27 |
Prkaa2 |
protein kinase, AMP-activated, alpha 2 catalytic subunit |
1304 |
0.56 |
chr1_184728502_184729126 | 1.27 |
Hlx |
H2.0-like homeobox |
2784 |
0.2 |
chr7_70591374_70591873 | 1.27 |
Gm44809 |
predicted gene 44809 |
1267 |
0.38 |
chr10_111031392_111032094 | 1.26 |
Zdhhc17 |
zinc finger, DHHC domain containing 17 |
21603 |
0.17 |
chr7_142658126_142659753 | 1.25 |
Igf2 |
insulin-like growth factor 2 |
550 |
0.47 |
chr17_56004941_56006194 | 1.24 |
Stap2 |
signal transducing adaptor family member 2 |
6 |
0.63 |
chr7_6913275_6914303 | 1.22 |
Gm44587 |
predicted gene 44587 |
13437 |
0.12 |
chr14_76448877_76449030 | 1.21 |
Tsc22d1 |
TSC22 domain family, member 1 |
10020 |
0.25 |
chr10_128582879_128584512 | 1.19 |
Mir6917 |
microRNA 6917 |
802 |
0.34 |
chr11_100411807_100412797 | 1.19 |
P3h4 |
prolyl 3-hydroxylase family member 4 (non-enzymatic) |
428 |
0.63 |
chr16_52061640_52062011 | 1.19 |
Cblb |
Casitas B-lineage lymphoma b |
12172 |
0.24 |
chr1_135918399_135919519 | 1.18 |
Pkp1 |
plakophilin 1 |
161 |
0.94 |
chr18_61652460_61652716 | 1.18 |
Mir143 |
microRNA 143 |
3330 |
0.14 |
chr12_33966605_33968831 | 1.18 |
Twist1 |
twist basic helix-loop-helix transcription factor 1 |
10047 |
0.22 |
chr9_106340507_106340753 | 1.17 |
Gm29123 |
predicted gene 29123 |
4797 |
0.14 |
chr1_74036048_74037430 | 1.17 |
Tns1 |
tensin 1 |
394 |
0.88 |
chr16_17914132_17915323 | 1.16 |
Gsc2 |
goosecoid homebox 2 |
332 |
0.74 |
chr1_33635886_33636431 | 1.16 |
Prim2 |
DNA primase, p58 subunit |
12834 |
0.13 |
chr8_115473872_115474613 | 1.15 |
4930488N15Rik |
RIKEN cDNA 4930488N15 gene |
111150 |
0.07 |
chr3_126780406_126781098 | 1.14 |
Camk2d |
calcium/calmodulin-dependent protein kinase II, delta |
2012 |
0.31 |
chr15_25459644_25459932 | 1.14 |
Gm48957 |
predicted gene, 48957 |
1299 |
0.43 |
chr12_36216606_36217252 | 1.14 |
Lrrc72 |
leucine rich repeat containing 72 |
1273 |
0.4 |
chr17_75435976_75437284 | 1.13 |
Rasgrp3 |
RAS, guanyl releasing protein 3 |
704 |
0.77 |
chr7_135604964_135605508 | 1.13 |
Ptpre |
protein tyrosine phosphatase, receptor type, E |
592 |
0.74 |
chr13_48540456_48540998 | 1.13 |
Mirlet7a-1 |
microRNA let7a-1 |
2455 |
0.12 |
chr2_127729042_127730365 | 1.11 |
Mall |
mal, T cell differentiation protein-like |
229 |
0.9 |
chr15_3579711_3580220 | 1.11 |
Ghr |
growth hormone receptor |
1877 |
0.42 |
chr10_69617478_69618016 | 1.11 |
Gm46231 |
predicted gene, 46231 |
51386 |
0.16 |
chr18_10785293_10785854 | 1.11 |
Mir1a-2 |
microRNA 1a-2 |
21 |
0.55 |
chr3_146278183_146278548 | 1.11 |
Gm43334 |
predicted gene 43334 |
46055 |
0.11 |
chr3_87951379_87952516 | 1.11 |
Crabp2 |
cellular retinoic acid binding protein II |
197 |
0.87 |
chr9_56416072_56416694 | 1.10 |
Gm36940 |
predicted gene, 36940 |
317 |
0.81 |
chr1_74714968_74715233 | 1.09 |
Cyp27a1 |
cytochrome P450, family 27, subfamily a, polypeptide 1 |
1526 |
0.29 |
chr5_29467659_29468760 | 1.09 |
Mnx1 |
motor neuron and pancreas homeobox 1 |
10261 |
0.16 |
chr11_89056028_89056307 | 1.08 |
Dgke |
diacylglycerol kinase, epsilon |
4581 |
0.14 |
chr18_74994324_74995008 | 1.08 |
Rpl17 |
ribosomal protein L17 |
3892 |
0.1 |
chr19_34473231_34473691 | 1.07 |
Gm26902 |
predicted gene, 26902 |
1347 |
0.31 |
chr16_10313185_10314434 | 1.07 |
Emp2 |
epithelial membrane protein 2 |
62 |
0.97 |
chr18_60635871_60636120 | 1.07 |
Synpo |
synaptopodin |
6142 |
0.19 |
chr5_101933418_101933724 | 1.07 |
Wdfy3 |
WD repeat and FYVE domain containing 3 |
2718 |
0.29 |
chr5_115163340_115163643 | 1.07 |
Mlec |
malectin |
5312 |
0.11 |
chr2_137113966_137114117 | 1.07 |
Jag1 |
jagged 1 |
2603 |
0.39 |
chr2_49789131_49789282 | 1.06 |
Lypd6b |
LY6/PLAUR domain containing 6B |
1475 |
0.44 |
chr17_12766020_12767485 | 1.06 |
Igf2r |
insulin-like growth factor 2 receptor |
2912 |
0.17 |
chr3_35405050_35406065 | 1.06 |
Gm43078 |
predicted gene 43078 |
8276 |
0.26 |
chr6_30174745_30175199 | 1.06 |
Rncr4 |
retina expressed non-coding RNA 4 |
2079 |
0.22 |
chr2_163385169_163385677 | 1.06 |
Jph2 |
junctophilin 2 |
12526 |
0.14 |
chr12_24963377_24963763 | 1.06 |
Kidins220 |
kinase D-interacting substrate 220 |
11355 |
0.18 |
chr8_109075211_109075811 | 1.05 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
266 |
0.95 |
chr14_103816762_103817135 | 1.05 |
Ednrb |
endothelin receptor type B |
26747 |
0.23 |
chr8_71665120_71666309 | 1.05 |
Unc13a |
unc-13 homolog A |
2368 |
0.14 |
chr11_110167321_110168450 | 1.05 |
Abca9 |
ATP-binding cassette, sub-family A (ABC1), member 9 |
170 |
0.97 |
chr10_38970342_38970493 | 1.05 |
Lama4 |
laminin, alpha 4 |
4745 |
0.27 |
chr6_97919629_97920005 | 1.04 |
Mitf |
melanogenesis associated transcription factor |
9982 |
0.24 |
chr9_56415286_56415792 | 1.04 |
Gm36940 |
predicted gene, 36940 |
527 |
0.69 |
chr6_97457802_97459465 | 1.04 |
Frmd4b |
FERM domain containing 4B |
653 |
0.74 |
chr10_39613682_39614138 | 1.03 |
Gm16364 |
predicted gene 16364 |
228 |
0.85 |
chr7_75781306_75781612 | 1.03 |
AU020206 |
expressed sequence AU020206 |
640 |
0.66 |
chr3_149115860_149116272 | 1.03 |
Gm25127 |
predicted gene, 25127 |
87134 |
0.08 |
chr9_24772390_24773199 | 1.02 |
Tbx20 |
T-box 20 |
1490 |
0.39 |
chr13_117315332_117315483 | 1.02 |
Gm6421 |
predicted pseudogene 6421 |
43213 |
0.16 |
chr13_94595583_94596884 | 1.02 |
Gm36991 |
predicted gene, 36991 |
23047 |
0.16 |
chr8_14996081_14996572 | 1.02 |
Arhgef10 |
Rho guanine nucleotide exchange factor (GEF) 10 |
190 |
0.91 |
chr8_45627436_45629381 | 1.02 |
Sorbs2 |
sorbin and SH3 domain containing 2 |
207 |
0.94 |
chr7_133015615_133015887 | 1.02 |
Ctbp2 |
C-terminal binding protein 2 |
261 |
0.91 |
chrX_12466521_12466742 | 1.00 |
Rpl30-ps11 |
ribosomal protein L30, pseudogene 11 |
9401 |
0.26 |
chr5_99669983_99670573 | 1.00 |
Gm16226 |
predicted gene 16226 |
12132 |
0.14 |
chr1_155646511_155646749 | 1.00 |
Acbd6 |
acyl-Coenzyme A binding domain containing 6 |
40361 |
0.15 |
chr8_57326741_57329467 | 1.00 |
Hand2os1 |
Hand2, opposite strand 1 |
3871 |
0.15 |
chr13_103027528_103027878 | 1.00 |
Mast4 |
microtubule associated serine/threonine kinase family member 4 |
69125 |
0.13 |
chr6_88196136_88197817 | 0.99 |
Gata2 |
GATA binding protein 2 |
1358 |
0.32 |
chr7_112269112_112269631 | 0.99 |
Mical2 |
microtubule associated monooxygenase, calponin and LIM domain containing 2 |
1928 |
0.46 |
chr14_103834294_103835008 | 0.98 |
Ednrb |
endothelin receptor type B |
9044 |
0.28 |
chr7_4531690_4532778 | 0.98 |
Dnaaf3 |
dynein, axonemal assembly factor 3 |
219 |
0.83 |
chr18_20057395_20057959 | 0.98 |
Dsc2 |
desmocollin 2 |
1801 |
0.43 |
chr12_84875703_84876939 | 0.97 |
Ltbp2 |
latent transforming growth factor beta binding protein 2 |
158 |
0.82 |
chr5_37826544_37829286 | 0.97 |
Msx1 |
msh homeobox 1 |
3332 |
0.25 |
chr5_149713426_149714289 | 0.97 |
B3glct |
beta-3-glucosyltransferase |
25675 |
0.15 |
chr12_32955587_32956663 | 0.97 |
Sypl |
synaptophysin-like protein |
1566 |
0.26 |
chr3_146223613_146223764 | 0.97 |
Lpar3 |
lysophosphatidic acid receptor 3 |
2725 |
0.27 |
chrX_118845813_118846013 | 0.97 |
Gm7485 |
predicted gene 7485 |
147010 |
0.05 |
chr7_65350865_65351016 | 0.96 |
Tjp1 |
tight junction protein 1 |
8143 |
0.2 |
chr18_56431537_56432515 | 0.96 |
Gramd3 |
GRAM domain containing 3 |
106 |
0.97 |
chr19_44726477_44726822 | 0.96 |
Gm35610 |
predicted gene, 35610 |
13230 |
0.14 |
chr15_33082896_33084013 | 0.96 |
Cpq |
carboxypeptidase Q |
186 |
0.96 |
chr11_23047668_23047819 | 0.96 |
Gm23740 |
predicted gene, 23740 |
15489 |
0.13 |
chr3_55116043_55116382 | 0.95 |
Spg20 |
spastic paraplegia 20, spartin (Troyer syndrome) homolog (human) |
35 |
0.97 |
chr3_97823312_97824263 | 0.94 |
Pde4dip |
phosphodiesterase 4D interacting protein (myomegalin) |
834 |
0.65 |
chr5_105792301_105793482 | 0.94 |
Rps15a-ps5 |
ribosomal protein S15A, pseudogene 5 |
4822 |
0.19 |
chr15_84360728_84360879 | 0.94 |
Gm5214 |
predicted gene 5214 |
14024 |
0.17 |
chr11_98002441_98003551 | 0.94 |
Arl5c |
ADP-ribosylation factor-like 5C |
6815 |
0.09 |
chr4_152318040_152319290 | 0.93 |
Rnf207 |
ring finger protein 207 |
40 |
0.96 |
chr9_103861183_103861383 | 0.93 |
Gm5372 |
predicted gene 5372 |
26726 |
0.18 |
chr9_84051241_84051476 | 0.93 |
Bckdhb |
branched chain ketoacid dehydrogenase E1, beta polypeptide |
5471 |
0.23 |
chr6_34601698_34602422 | 0.93 |
Cald1 |
caldesmon 1 |
3440 |
0.25 |
chr1_172216795_172217394 | 0.93 |
Casq1 |
calsequestrin 1 |
2621 |
0.14 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.3 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.7 | 2.1 | GO:0010956 | negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
0.6 | 1.2 | GO:0072048 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.6 | 1.7 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.6 | 1.7 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.5 | 1.6 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.5 | 2.1 | GO:0090194 | negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
0.4 | 1.8 | GO:0032345 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.4 | 3.0 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
0.4 | 1.5 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
0.4 | 1.1 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.3 | 1.0 | GO:0007525 | somatic muscle development(GO:0007525) |
0.3 | 1.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.3 | 1.0 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.3 | 0.3 | GO:2000977 | regulation of forebrain neuron differentiation(GO:2000977) |
0.3 | 0.9 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.3 | 0.9 | GO:0072104 | glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
0.3 | 0.9 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
0.3 | 1.2 | GO:0007494 | midgut development(GO:0007494) |
0.3 | 0.6 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.3 | 0.5 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.3 | 0.8 | GO:1902219 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.3 | 0.3 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.2 | 1.7 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.2 | 0.2 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
0.2 | 0.5 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.2 | 1.1 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.2 | 0.9 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.2 | 0.8 | GO:0061218 | negative regulation of mesonephros development(GO:0061218) |
0.2 | 0.6 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.2 | 0.8 | GO:0003383 | apical constriction(GO:0003383) |
0.2 | 0.6 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
0.2 | 1.9 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
0.2 | 1.1 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.2 | 0.7 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.2 | 0.7 | GO:0060437 | lung growth(GO:0060437) |
0.2 | 0.4 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
0.2 | 0.7 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.2 | 0.5 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.2 | 1.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.2 | 0.7 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
0.2 | 0.5 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.2 | 0.8 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.2 | 0.5 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.2 | 0.7 | GO:0060486 | Clara cell differentiation(GO:0060486) |
0.2 | 0.5 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.2 | 0.5 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.9 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.1 | 0.6 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.1 | 0.4 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.1 | 1.2 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.1 | 0.6 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.1 | 1.4 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.1 | 0.3 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.1 | 0.4 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
0.1 | 1.4 | GO:0048385 | regulation of retinoic acid receptor signaling pathway(GO:0048385) |
0.1 | 0.7 | GO:0014866 | skeletal myofibril assembly(GO:0014866) |
0.1 | 1.3 | GO:0048664 | neuron fate determination(GO:0048664) |
0.1 | 0.1 | GO:0003308 | negative regulation of Wnt signaling pathway involved in heart development(GO:0003308) |
0.1 | 0.7 | GO:0030578 | PML body organization(GO:0030578) |
0.1 | 0.3 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.1 | 0.7 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.1 | 0.6 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.1 | 0.4 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.1 | 0.4 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.5 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.1 | 0.6 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.1 | 0.6 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.1 | 0.7 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.1 | 1.5 | GO:0031000 | response to caffeine(GO:0031000) |
0.1 | 0.6 | GO:0061042 | vascular wound healing(GO:0061042) |
0.1 | 0.4 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 0.5 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.1 | 0.4 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 1.4 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
0.1 | 0.7 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.2 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.1 | 0.3 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.1 | 0.5 | GO:0009838 | abscission(GO:0009838) |
0.1 | 0.2 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.1 | 0.8 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.1 | 0.6 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 0.3 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.1 | 0.3 | GO:0021861 | forebrain radial glial cell differentiation(GO:0021861) |
0.1 | 0.3 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.1 | 0.1 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.1 | 1.2 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.1 | 0.1 | GO:0032349 | positive regulation of aldosterone metabolic process(GO:0032346) regulation of aldosterone biosynthetic process(GO:0032347) positive regulation of aldosterone biosynthetic process(GO:0032349) |
0.1 | 0.2 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.1 | 0.3 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.1 | 0.6 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
0.1 | 0.6 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.1 | 0.3 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.1 | 0.3 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.1 | 0.4 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.1 | 0.5 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.1 | 0.7 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.1 | 0.7 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.1 | 0.2 | GO:2000449 | regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) |
0.1 | 0.4 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.1 | 0.4 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.1 | 0.3 | GO:0051182 | coenzyme transport(GO:0051182) |
0.1 | 0.3 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.1 | 0.9 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.1 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 0.3 | GO:0072093 | metanephric renal vesicle formation(GO:0072093) |
0.1 | 0.5 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.1 | 0.2 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
0.1 | 0.6 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.1 | 0.5 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.1 | 0.4 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.1 | 0.4 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.1 | 1.1 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.1 | 0.2 | GO:0021938 | smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
0.1 | 0.3 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.1 | 0.4 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.1 | 0.2 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.1 | 0.3 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.1 | 0.3 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.1 | 0.3 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.1 | 0.3 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.1 | 0.2 | GO:0098911 | regulation of ventricular cardiac muscle cell action potential(GO:0098911) |
0.1 | 0.2 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.1 | 0.8 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.1 | 0.2 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
0.1 | 0.1 | GO:0044557 | relaxation of smooth muscle(GO:0044557) |
0.1 | 0.2 | GO:1903911 | positive regulation of receptor clustering(GO:1903911) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
0.1 | 0.2 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.1 | 0.2 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.1 | 0.1 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.1 | 0.6 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.1 | 0.2 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.1 | 0.3 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.1 | 0.1 | GO:0002295 | T-helper cell lineage commitment(GO:0002295) CD4-positive, alpha-beta T cell lineage commitment(GO:0043373) |
0.1 | 0.2 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.1 | 0.4 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 0.1 | GO:0060594 | mammary gland specification(GO:0060594) |
0.1 | 0.2 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.1 | 1.4 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.1 | 0.1 | GO:2000407 | regulation of T cell extravasation(GO:2000407) positive regulation of T cell extravasation(GO:2000409) |
0.1 | 0.2 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
0.1 | 0.2 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.1 | 0.2 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 0.3 | GO:0010002 | cardioblast differentiation(GO:0010002) |
0.1 | 0.1 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.1 | 0.4 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
0.1 | 0.9 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.1 | 1.4 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
0.1 | 0.8 | GO:0015858 | nucleoside transport(GO:0015858) |
0.1 | 0.1 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.1 | 0.4 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.1 | 0.3 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.1 | 0.6 | GO:0043312 | neutrophil degranulation(GO:0043312) |
0.1 | 0.2 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 0.5 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.1 | 0.1 | GO:0032364 | oxygen homeostasis(GO:0032364) |
0.1 | 0.2 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.1 | 1.5 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.1 | 0.1 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.1 | 0.1 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.1 | 0.5 | GO:0032060 | bleb assembly(GO:0032060) |
0.1 | 0.3 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.1 | 0.3 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.1 | 0.2 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
0.1 | 0.5 | GO:0035137 | hindlimb morphogenesis(GO:0035137) |
0.1 | 0.2 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) |
0.1 | 0.7 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.1 | 0.5 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.6 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.1 | 0.1 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.1 | 0.7 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.1 | 0.4 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
0.1 | 0.3 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.1 | 0.1 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.1 | 0.3 | GO:0019532 | oxalate transport(GO:0019532) |
0.1 | 0.2 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
0.1 | 0.4 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.1 | 0.1 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
0.1 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.4 | GO:0061620 | glycolytic process through glucose-6-phosphate(GO:0061620) |
0.1 | 1.9 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
0.1 | 0.8 | GO:1903861 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.1 | 0.2 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
0.1 | 0.3 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.1 | 0.2 | GO:0042045 | epithelial fluid transport(GO:0042045) |
0.1 | 0.7 | GO:0072539 | T-helper 17 cell differentiation(GO:0072539) |
0.1 | 0.2 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
0.1 | 0.1 | GO:0002730 | regulation of dendritic cell cytokine production(GO:0002730) |
0.1 | 0.3 | GO:0031054 | pre-miRNA processing(GO:0031054) |
0.1 | 1.1 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.1 | 0.2 | GO:1902966 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
0.1 | 0.2 | GO:0035989 | tendon development(GO:0035989) |
0.1 | 0.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.1 | 0.2 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.1 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 0.1 | GO:1903753 | negative regulation of p38MAPK cascade(GO:1903753) |
0.1 | 0.6 | GO:0045986 | negative regulation of smooth muscle contraction(GO:0045986) |
0.1 | 0.1 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
0.1 | 0.1 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.1 | 0.2 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 0.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.1 | 0.2 | GO:0003356 | regulation of cilium movement(GO:0003352) regulation of cilium beat frequency(GO:0003356) |
0.1 | 0.4 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.1 | 0.3 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.1 | 0.7 | GO:0006817 | phosphate ion transport(GO:0006817) |
0.1 | 0.1 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
0.1 | 0.4 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
0.1 | 0.2 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.2 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.1 | 0.2 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 1.0 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
0.1 | 0.3 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.1 | 0.2 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.1 | 0.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.1 | 0.2 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.0 | 0.2 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.0 | 0.1 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.0 | 0.0 | GO:0048818 | positive regulation of hair follicle maturation(GO:0048818) |
0.0 | 0.0 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.0 | 0.1 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.0 | 0.1 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.0 | 0.0 | GO:0021747 | cochlear nucleus development(GO:0021747) |
0.0 | 0.0 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.0 | 0.3 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
0.0 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.0 | 0.1 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.0 | 0.2 | GO:0060965 | negative regulation of gene silencing by miRNA(GO:0060965) |
0.0 | 0.7 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.0 | 0.1 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.0 | 0.3 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.0 | 0.1 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
0.0 | 0.4 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.3 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.0 | GO:0033483 | gas homeostasis(GO:0033483) |
0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.0 | 0.1 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.7 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.0 | 0.3 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.0 | 0.2 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.0 | 0.3 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.0 | 0.1 | GO:0052151 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
0.0 | 0.1 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.0 | 0.1 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.0 | 0.5 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.0 | 0.3 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.0 | 0.1 | GO:1902548 | negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
0.0 | 0.3 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.8 | GO:0045214 | sarcomere organization(GO:0045214) |
0.0 | 0.2 | GO:0000237 | leptotene(GO:0000237) |
0.0 | 0.2 | GO:0060431 | primary lung bud formation(GO:0060431) |
0.0 | 0.1 | GO:1904683 | regulation of metalloendopeptidase activity(GO:1904683) |
0.0 | 0.0 | GO:1902896 | terminal web assembly(GO:1902896) |
0.0 | 0.1 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.0 | 0.2 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.0 | 0.0 | GO:0043622 | cortical microtubule organization(GO:0043622) |
0.0 | 0.2 | GO:0060539 | diaphragm development(GO:0060539) |
0.0 | 0.1 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.1 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.1 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.0 | 0.1 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.0 | 1.3 | GO:0055078 | sodium ion homeostasis(GO:0055078) |
0.0 | 0.1 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
0.0 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.3 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.0 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.0 | 0.1 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.0 | 0.2 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.0 | 0.1 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.1 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.0 | 0.1 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.0 | 0.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.0 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.0 | 0.4 | GO:0003323 | type B pancreatic cell development(GO:0003323) |
0.0 | 0.3 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.2 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.0 | 0.1 | GO:0070836 | caveola assembly(GO:0070836) |
0.0 | 0.3 | GO:0010611 | regulation of cardiac muscle hypertrophy(GO:0010611) |
0.0 | 0.1 | GO:0090269 | fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) |
0.0 | 0.0 | GO:0061010 | gall bladder development(GO:0061010) |
0.0 | 0.1 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.1 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 0.2 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.0 | 0.2 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 0.2 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.0 | 0.1 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.1 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.0 | 0.1 | GO:0000019 | regulation of mitotic recombination(GO:0000019) |
0.0 | 0.0 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.0 | 0.0 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.0 | 0.0 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.0 | 0.1 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.0 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.0 | 0.1 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.0 | 0.1 | GO:1902534 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) single-organism membrane invagination(GO:1902534) |
0.0 | 0.1 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.0 | 0.2 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.2 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.0 | 0.1 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.0 | 0.3 | GO:0030033 | microvillus assembly(GO:0030033) |
0.0 | 0.1 | GO:0097461 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.0 | 0.2 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.0 | 0.0 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
0.0 | 0.2 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.5 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.0 | 0.1 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.0 | 0.0 | GO:0002576 | platelet degranulation(GO:0002576) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.0 | GO:0048143 | astrocyte activation(GO:0048143) |
0.0 | 0.1 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
0.0 | 0.1 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
0.0 | 0.1 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.0 | 0.0 | GO:0060534 | trachea cartilage development(GO:0060534) |
0.0 | 0.1 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.0 | 0.1 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.0 | 0.1 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.1 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.0 | 0.1 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.0 | 0.0 | GO:0060045 | positive regulation of cardiac muscle cell proliferation(GO:0060045) |
0.0 | 0.4 | GO:0006855 | drug transmembrane transport(GO:0006855) |
0.0 | 0.2 | GO:0030947 | regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030947) |
0.0 | 0.1 | GO:0031033 | myosin filament organization(GO:0031033) |
0.0 | 0.1 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.0 | 0.1 | GO:0036302 | atrioventricular canal development(GO:0036302) |
0.0 | 0.0 | GO:0072198 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.0 | 0.1 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.0 | 0.1 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.0 | 0.0 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.0 | 0.2 | GO:0060056 | mammary gland involution(GO:0060056) |
0.0 | 0.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.0 | 0.0 | GO:0060911 | cardiac cell fate commitment(GO:0060911) |
0.0 | 0.1 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.0 | 0.0 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.0 | 0.1 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.0 | 0.1 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.0 | 0.2 | GO:0070269 | pyroptosis(GO:0070269) |
0.0 | 0.0 | GO:1905048 | regulation of metallopeptidase activity(GO:1905048) |
0.0 | 0.1 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.0 | 0.1 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.0 | 0.1 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.0 | 0.1 | GO:0070842 | aggresome assembly(GO:0070842) |
0.0 | 0.2 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.0 | 0.0 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
0.0 | 0.1 | GO:0051138 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.0 | 0.1 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.0 | 0.1 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.0 | 0.1 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
0.0 | 0.0 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.1 | GO:0044026 | DNA hypermethylation(GO:0044026) |
0.0 | 0.1 | GO:0009158 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
0.0 | 0.0 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.0 | 0.1 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.0 | 0.0 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.0 | 0.1 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.0 | 0.0 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.0 | 0.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.1 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.0 | 0.0 | GO:0090135 | actin filament branching(GO:0090135) |
0.0 | 0.3 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.0 | 0.0 | GO:0042322 | negative regulation of circadian sleep/wake cycle, REM sleep(GO:0042322) |
0.0 | 0.0 | GO:0030421 | defecation(GO:0030421) |
0.0 | 0.1 | GO:0070141 | response to UV-A(GO:0070141) |
0.0 | 0.1 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
0.0 | 0.3 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.1 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.0 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.4 | GO:0034142 | toll-like receptor 4 signaling pathway(GO:0034142) |
0.0 | 0.1 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
0.0 | 0.0 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.0 | GO:0071907 | determination of pancreatic left/right asymmetry(GO:0035469) determination of digestive tract left/right asymmetry(GO:0071907) |
0.0 | 0.3 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.0 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
0.0 | 0.1 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
0.0 | 0.0 | GO:0007418 | ventral midline development(GO:0007418) |
0.0 | 0.1 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
0.0 | 0.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.0 | 0.0 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.0 | 0.2 | GO:0010818 | T cell chemotaxis(GO:0010818) |
0.0 | 0.0 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) glandular epithelial cell maturation(GO:0002071) |
0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.0 | GO:0002424 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
0.0 | 0.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.0 | 0.1 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.1 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.2 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
0.0 | 0.6 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
0.0 | 0.0 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.0 | 0.3 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
0.0 | 0.2 | GO:0043032 | positive regulation of macrophage activation(GO:0043032) |
0.0 | 0.0 | GO:0086103 | G-protein coupled receptor signaling pathway involved in heart process(GO:0086103) |
0.0 | 0.1 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.0 | 0.1 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.0 | 0.1 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
0.0 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.1 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.0 | 0.0 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.0 | 0.1 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.0 | 0.2 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
0.0 | 0.0 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.0 | 0.1 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.0 | 0.0 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.1 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.0 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.1 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.0 | 0.0 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
0.0 | 0.0 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.0 | 0.0 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.0 | 0.0 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.1 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.0 | 0.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.0 | 0.1 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
0.0 | 0.2 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
0.0 | 0.1 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.0 | 0.1 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.0 | 0.1 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.0 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
0.0 | 0.0 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.1 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.0 | 0.2 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.0 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.5 | GO:0010259 | multicellular organism aging(GO:0010259) |
0.0 | 0.1 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) cardiolipin biosynthetic process(GO:0032049) |
0.0 | 0.1 | GO:0008354 | germ cell migration(GO:0008354) |
0.0 | 0.0 | GO:0071504 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.0 | 0.1 | GO:1903961 | positive regulation of anion transmembrane transport(GO:1903961) |
0.0 | 0.0 | GO:0072015 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
0.0 | 0.1 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.0 | 0.1 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.0 | 0.0 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
0.0 | 0.3 | GO:0042311 | vasodilation(GO:0042311) |
0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.0 | 0.1 | GO:0034091 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
0.0 | 0.3 | GO:0042246 | tissue regeneration(GO:0042246) |
0.0 | 0.1 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.1 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.0 | 0.2 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.0 | 0.0 | GO:0060931 | sinoatrial node cell differentiation(GO:0060921) sinoatrial node cell development(GO:0060931) |
0.0 | 0.1 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.0 | 0.1 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.0 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.1 | GO:0006477 | protein sulfation(GO:0006477) |
0.0 | 0.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.1 | GO:0003351 | epithelial cilium movement(GO:0003351) |
0.0 | 0.0 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.0 | 0.2 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.0 | 0.0 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.0 | 0.3 | GO:0045909 | positive regulation of vasodilation(GO:0045909) |
0.0 | 0.0 | GO:0006625 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
0.0 | 0.0 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.1 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.0 | 0.0 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.0 | 0.0 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
0.0 | 0.0 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.0 | 0.0 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.0 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.0 | 0.1 | GO:0036499 | PERK-mediated unfolded protein response(GO:0036499) |
0.0 | 0.1 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
0.0 | 0.0 | GO:0042117 | monocyte activation(GO:0042117) |
0.0 | 0.0 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.0 | 0.0 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.0 | 0.0 | GO:1901298 | regulation of hydrogen peroxide-mediated programmed cell death(GO:1901298) |
0.0 | 0.2 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.0 | 0.0 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.0 | 0.0 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.0 | 0.0 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.0 | 0.2 | GO:0099622 | cardiac muscle cell membrane repolarization(GO:0099622) |
0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.0 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.0 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.1 | GO:0035878 | nail development(GO:0035878) |
0.0 | 0.0 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
0.0 | 0.0 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.0 | 0.4 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
0.0 | 0.0 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.0 | 0.1 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.0 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.0 | 0.0 | GO:2000551 | regulation of T-helper 2 cell cytokine production(GO:2000551) |
0.0 | 0.0 | GO:0097152 | mesenchymal cell apoptotic process(GO:0097152) |
0.0 | 0.2 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
0.0 | 0.0 | GO:0019471 | 4-hydroxyproline metabolic process(GO:0019471) |
0.0 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.1 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
0.0 | 0.1 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.0 | 0.1 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
0.0 | 0.0 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.0 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.0 | 0.0 | GO:2000394 | regulation of lamellipodium morphogenesis(GO:2000392) positive regulation of lamellipodium morphogenesis(GO:2000394) |
0.0 | 0.0 | GO:0002254 | kinin cascade(GO:0002254) |
0.0 | 0.0 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.1 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.1 | GO:0090077 | foam cell differentiation(GO:0090077) |
0.0 | 0.0 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.0 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.0 | 0.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.0 | 0.1 | GO:0051014 | actin filament severing(GO:0051014) |
0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 0.0 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.0 | 0.0 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.0 | 0.1 | GO:0033623 | regulation of integrin activation(GO:0033623) |
0.0 | 0.1 | GO:0045974 | negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
0.0 | 0.1 | GO:0060561 | apoptotic process involved in morphogenesis(GO:0060561) |
0.0 | 0.1 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.0 | GO:0032898 | neurotrophin production(GO:0032898) |
0.0 | 0.1 | GO:1902895 | positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
0.0 | 0.0 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.0 | 0.0 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
0.0 | 0.0 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.0 | 0.1 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) |
0.0 | 0.0 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
0.0 | 0.1 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.0 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
0.0 | 0.0 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.0 | 0.0 | GO:0009212 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
0.0 | 0.0 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.0 | 0.2 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.0 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.0 | 0.0 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.0 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.0 | GO:0001787 | natural killer cell proliferation(GO:0001787) |
0.0 | 0.0 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.0 | 0.0 | GO:1905208 | negative regulation of cardiocyte differentiation(GO:1905208) negative regulation of cardiac muscle cell differentiation(GO:2000726) |
0.0 | 0.1 | GO:0002093 | auditory receptor cell morphogenesis(GO:0002093) |
0.0 | 0.2 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.0 | 0.0 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.0 | 0.1 | GO:0010863 | positive regulation of phospholipase C activity(GO:0010863) |
0.0 | 0.1 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.0 | 0.0 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.0 | 0.0 | GO:0036093 | germ cell proliferation(GO:0036093) |
0.0 | 0.0 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) regulation of activation of JAK2 kinase activity(GO:0010534) |
0.0 | 0.0 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.0 | 0.1 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.0 | 0.1 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
0.0 | 0.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.0 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.0 | 0.0 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.1 | GO:0014829 | vascular smooth muscle contraction(GO:0014829) |
0.0 | 0.0 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
0.0 | 0.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.0 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.1 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.0 | 0.0 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.0 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.0 | 0.1 | GO:0015732 | prostaglandin transport(GO:0015732) |
0.0 | 0.1 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
0.0 | 0.4 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.0 | 0.0 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.0 | 0.2 | GO:0042773 | ATP synthesis coupled electron transport(GO:0042773) |
0.0 | 0.1 | GO:0060613 | fat pad development(GO:0060613) |
0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.0 | 0.0 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.0 | 0.0 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.0 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.0 | 0.0 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.0 | 0.0 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.0 | 0.0 | GO:1990123 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.0 | 0.0 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.1 | GO:0032964 | collagen biosynthetic process(GO:0032964) |
0.0 | 0.0 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
0.0 | 0.0 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.0 | 0.1 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.0 | 0.0 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.0 | 0.0 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.0 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.0 | 0.1 | GO:0048741 | skeletal muscle fiber development(GO:0048741) |
0.0 | 0.1 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.0 | 0.2 | GO:0032400 | melanosome localization(GO:0032400) pigment granule localization(GO:0051875) |
0.0 | 0.0 | GO:1990592 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.0 | 0.1 | GO:0061365 | positive regulation of triglyceride lipase activity(GO:0061365) |
0.0 | 0.0 | GO:0051451 | myoblast migration(GO:0051451) |
0.0 | 0.0 | GO:0048643 | positive regulation of skeletal muscle tissue development(GO:0048643) |
0.0 | 0.0 | GO:0060453 | regulation of gastric acid secretion(GO:0060453) negative regulation of gastric acid secretion(GO:0060455) |
0.0 | 0.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.0 | 0.1 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.0 | 0.0 | GO:0060602 | branch elongation of an epithelium(GO:0060602) |
0.0 | 0.4 | GO:0065002 | intracellular protein transmembrane transport(GO:0065002) protein transmembrane transport(GO:0071806) |
0.0 | 0.1 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.0 | 0.0 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.0 | 0.0 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.0 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.1 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.0 | 0.3 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.0 | 0.0 | GO:2000109 | macrophage apoptotic process(GO:0071888) regulation of macrophage apoptotic process(GO:2000109) |
0.0 | 0.1 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
0.0 | 0.0 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.0 | 0.0 | GO:0003177 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
0.0 | 0.0 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.0 | 0.0 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.0 | 0.1 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.0 | 0.0 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.0 | 0.0 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.0 | 0.0 | GO:0060038 | cardiac muscle cell proliferation(GO:0060038) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 1.0 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.2 | 0.8 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.2 | 1.7 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.2 | 0.5 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.2 | 0.6 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.2 | 0.5 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.2 | 0.5 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.1 | 1.2 | GO:0005861 | troponin complex(GO:0005861) |
0.1 | 0.4 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.5 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.1 | 0.8 | GO:1990462 | omegasome(GO:1990462) |
0.1 | 0.4 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.1 | 1.1 | GO:0097470 | ribbon synapse(GO:0097470) |
0.1 | 0.7 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.1 | 0.3 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 1.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.1 | 0.4 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.1 | 0.6 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.1 | 0.4 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.4 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.1 | 0.7 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.1 | 0.5 | GO:0090543 | Flemming body(GO:0090543) |
0.1 | 0.5 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 0.5 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.1 | 1.9 | GO:0030057 | desmosome(GO:0030057) |
0.1 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
0.1 | 0.7 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 1.0 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.1 | 1.1 | GO:0031430 | M band(GO:0031430) |
0.1 | 0.2 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.1 | 0.6 | GO:0016460 | myosin II complex(GO:0016460) |
0.1 | 0.8 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.1 | 0.8 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 1.3 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.1 | 0.2 | GO:0097342 | ripoptosome(GO:0097342) |
0.1 | 0.8 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 0.7 | GO:0051286 | cell tip(GO:0051286) |
0.1 | 0.5 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.1 | 1.2 | GO:0002102 | podosome(GO:0002102) |
0.1 | 0.9 | GO:0036379 | striated muscle thin filament(GO:0005865) myofilament(GO:0036379) |
0.1 | 0.2 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.1 | 0.2 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.4 | GO:0098651 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.1 | 0.9 | GO:0097386 | glial cell projection(GO:0097386) |
0.1 | 0.3 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.1 | 0.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.1 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 0.9 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 0.3 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.1 | 0.3 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 0.5 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.4 | GO:0070938 | contractile ring(GO:0070938) |
0.0 | 0.1 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.0 | 0.3 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.0 | 0.4 | GO:0043194 | axon initial segment(GO:0043194) |
0.0 | 0.7 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 0.7 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.6 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.2 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 3.5 | GO:0030017 | sarcomere(GO:0030017) |
0.0 | 0.5 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.0 | 0.1 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.0 | 0.3 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.1 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.2 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 2.0 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 1.1 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.0 | 0.2 | GO:0071439 | clathrin complex(GO:0071439) |
0.0 | 0.1 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.0 | 0.1 | GO:0030870 | Mre11 complex(GO:0030870) |
0.0 | 0.5 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 0.3 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.3 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.3 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 0.3 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.1 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.1 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 0.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.5 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 2.5 | GO:0043296 | apical junction complex(GO:0043296) |
0.0 | 0.2 | GO:0005688 | U6 snRNP(GO:0005688) |
0.0 | 8.4 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.2 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.0 | 0.0 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.1 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.1 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.0 | GO:0032432 | actin filament bundle(GO:0032432) |
0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 1.5 | GO:0005901 | caveola(GO:0005901) |
0.0 | 2.1 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.2 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.3 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.0 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
0.0 | 1.2 | GO:0016605 | PML body(GO:0016605) |
0.0 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
0.0 | 0.1 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.0 | 0.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.1 | GO:0042825 | MHC class I peptide loading complex(GO:0042824) TAP complex(GO:0042825) |
0.0 | 0.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.1 | GO:0044449 | contractile fiber part(GO:0044449) |
0.0 | 5.4 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.1 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.0 | 0.1 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.1 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.1 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.0 | 0.0 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.0 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.0 | 0.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.1 | GO:0042641 | actomyosin(GO:0042641) |
0.0 | 0.5 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.0 | 0.0 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.0 | 0.8 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.2 | GO:0098636 | protein complex involved in cell adhesion(GO:0098636) |
0.0 | 0.1 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 2.1 | GO:0045121 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
0.0 | 0.1 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.2 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.1 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.0 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.0 | 0.2 | GO:0030016 | myofibril(GO:0030016) |
0.0 | 0.2 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
0.0 | 0.0 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 0.0 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.0 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.0 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.0 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.1 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.0 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
0.0 | 0.1 | GO:0097546 | ciliary base(GO:0097546) |
0.0 | 2.3 | GO:0005925 | focal adhesion(GO:0005925) |
0.0 | 0.0 | GO:0042827 | platelet dense granule(GO:0042827) |
0.0 | 0.0 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
0.0 | 0.1 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 0.0 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.0 | 0.0 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.1 | GO:0045252 | dihydrolipoyl dehydrogenase complex(GO:0045240) oxoglutarate dehydrogenase complex(GO:0045252) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 2.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.5 | 1.5 | GO:0051373 | FATZ binding(GO:0051373) |
0.5 | 1.4 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.5 | 1.4 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.3 | 1.0 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.3 | 0.9 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.3 | 0.8 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.3 | 1.0 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.2 | 0.7 | GO:0035877 | death effector domain binding(GO:0035877) |
0.2 | 1.7 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.2 | 0.7 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.2 | 2.5 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.2 | 1.3 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.2 | 0.6 | GO:0031433 | telethonin binding(GO:0031433) |
0.2 | 0.6 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.2 | 0.6 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.2 | 0.8 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.2 | 0.5 | GO:0055100 | adiponectin binding(GO:0055100) |
0.2 | 0.7 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.2 | 0.5 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.2 | 0.7 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.2 | 0.5 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.1 | 1.0 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.1 | 0.4 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.1 | 0.4 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 1.7 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 0.7 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 0.4 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.1 | 1.3 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.1 | 0.4 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.1 | 0.5 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.1 | 0.4 | GO:0008142 | oxysterol binding(GO:0008142) |
0.1 | 0.5 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.1 | 0.6 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.1 | 0.5 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.1 | 1.0 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.1 | 0.4 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.1 | 0.5 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.8 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 0.6 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.1 | 0.5 | GO:0031432 | titin binding(GO:0031432) |
0.1 | 0.3 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.1 | 0.4 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
0.1 | 1.0 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.1 | 0.5 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.1 | 0.3 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.1 | 0.3 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.1 | 0.9 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.1 | 0.2 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.5 | GO:0018634 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 0.4 | GO:1990254 | keratin filament binding(GO:1990254) |
0.1 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.9 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.1 | 0.2 | GO:0030172 | troponin C binding(GO:0030172) |
0.1 | 0.2 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.1 | 0.2 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.2 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.1 | 0.3 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.1 | 0.2 | GO:0031014 | troponin T binding(GO:0031014) |
0.1 | 0.5 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 0.2 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.1 | 0.2 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.1 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.3 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.1 | 0.3 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.1 | 0.2 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.3 | GO:0017040 | ceramidase activity(GO:0017040) |
0.1 | 0.2 | GO:0005148 | prolactin receptor binding(GO:0005148) |
0.1 | 0.5 | GO:0015368 | calcium:cation antiporter activity(GO:0015368) |
0.1 | 0.8 | GO:0005521 | lamin binding(GO:0005521) |
0.1 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 0.7 | GO:0008329 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.1 | 0.4 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 0.2 | GO:0036033 | mediator complex binding(GO:0036033) |
0.1 | 0.3 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.1 | 0.5 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.1 | 0.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.1 | 0.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.5 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.3 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.0 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 1.9 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.7 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.5 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.6 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.1 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.0 | 0.6 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.6 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 3.7 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.7 | GO:0030553 | cGMP binding(GO:0030553) |
0.0 | 0.2 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
0.0 | 0.1 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.0 | 0.2 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 0.2 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.0 | 0.5 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.6 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.0 | 0.3 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.8 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.0 | 0.0 | GO:0050693 | LBD domain binding(GO:0050693) |
0.0 | 0.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.0 | 0.9 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.0 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.0 | 0.3 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.2 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 3.8 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.0 | 0.0 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.0 | 0.4 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.4 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.0 | 0.2 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.4 | GO:0001846 | opsonin binding(GO:0001846) |
0.0 | 0.9 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
0.0 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.0 | 0.1 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.6 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.4 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.2 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.0 | 0.3 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.4 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
0.0 | 0.1 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.0 | 0.0 | GO:0016751 | S-succinyltransferase activity(GO:0016751) |
0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.1 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 0.1 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.0 | 0.2 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
0.0 | 0.1 | GO:0102344 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 0.1 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 1.5 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.0 | 0.1 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.0 | 0.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.0 | 0.8 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.1 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.3 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.1 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.0 | 0.1 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.0 | 0.3 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.1 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 0.4 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.2 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.0 | 0.1 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.0 | 0.4 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.1 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 0.1 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.5 | GO:0004879 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
0.0 | 0.0 | GO:0001031 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.0 | 0.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.1 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.0 | 0.4 | GO:0042805 | actinin binding(GO:0042805) |
0.0 | 0.0 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.0 | 1.6 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.0 | 0.2 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.0 | 0.4 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.6 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 0.0 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.0 | 0.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.0 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.0 | 0.1 | GO:0052630 | CTP:2,3-di-O-geranylgeranyl-sn-glycero-1-phosphate cytidyltransferase activity(GO:0043338) phospholactate guanylyltransferase activity(GO:0043814) ATP:coenzyme F420 adenylyltransferase activity(GO:0043910) UDP-N-acetylgalactosamine diphosphorylase activity(GO:0052630) |
0.0 | 0.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.2 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.3 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.1 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.1 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.0 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.2 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.1 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.2 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 1.7 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.2 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.0 | 0.0 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.0 | 0.1 | GO:0051870 | methotrexate binding(GO:0051870) |
0.0 | 0.2 | GO:0015922 | aspartate oxidase activity(GO:0015922) |
0.0 | 0.3 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.1 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.0 | 0.1 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 1.7 | GO:0005088 | Ras guanyl-nucleotide exchange factor activity(GO:0005088) |
0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.1 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.0 | 0.6 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 2.0 | GO:0008201 | heparin binding(GO:0008201) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.1 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.0 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.1 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
0.0 | 0.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.1 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.1 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.2 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
0.0 | 0.2 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.0 | 0.2 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.1 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.0 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.0 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.0 | 0.1 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.4 | GO:0052770 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.0 | 0.0 | GO:1990188 | euchromatin binding(GO:1990188) |
0.0 | 0.0 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.2 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.1 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.1 | GO:0050544 | arachidonic acid binding(GO:0050544) |
0.0 | 0.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.0 | 0.0 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 0.0 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.0 | 0.0 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.0 | 0.1 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.5 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.0 | 0.1 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) |
0.0 | 0.5 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) |
0.0 | 0.0 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.0 | 0.1 | GO:0043121 | neurotrophin binding(GO:0043121) |
0.0 | 0.6 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.0 | 0.0 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.2 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.0 | 0.1 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.0 | 0.0 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.3 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.2 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.0 | 0.0 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.0 | 0.0 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.0 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
0.0 | 0.0 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.0 | 0.1 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.0 | 0.0 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.0 | 0.0 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.0 | 0.4 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.0 | 0.2 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.0 | 0.0 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.0 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.1 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.8 | GO:0005178 | integrin binding(GO:0005178) |
0.0 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.4 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
0.0 | 0.3 | GO:0015238 | drug transmembrane transporter activity(GO:0015238) |
0.0 | 0.1 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.0 | 0.0 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.0 | 0.9 | GO:0030674 | protein binding, bridging(GO:0030674) |
0.0 | 0.2 | GO:0031420 | alkali metal ion binding(GO:0031420) |
0.0 | 0.1 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 0.0 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.0 | 0.0 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.0 | 0.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.8 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 0.1 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.0 | 0.1 | GO:0000150 | recombinase activity(GO:0000150) |
0.0 | 0.0 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 0.0 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.0 | 0.0 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.0 | 0.0 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
0.0 | 0.0 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.0 | 0.0 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.0 | 0.0 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.3 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.0 | 2.7 | GO:0003779 | actin binding(GO:0003779) |
0.0 | 0.1 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.0 | 0.6 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.3 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.2 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.0 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
0.0 | 0.0 | GO:0032557 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) pyrimidine ribonucleotide binding(GO:0032557) |
0.0 | 0.0 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.1 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 0.1 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.0 | 0.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.0 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 0.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 1.3 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.1 | 1.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 1.3 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 0.3 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.1 | 1.8 | PID RAS PATHWAY | Regulation of Ras family activation |
0.1 | 0.1 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 1.5 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.1 | 1.7 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 2.1 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.0 | 2.2 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 1.5 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 1.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 2.3 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 2.7 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 1.1 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.3 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 0.3 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.7 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 0.7 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 1.4 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 1.9 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.5 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.4 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.2 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.3 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.0 | 0.1 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.3 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.3 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.8 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 1.0 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.0 | 0.2 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 1.1 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 1.5 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.0 | 0.8 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.6 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.5 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.5 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.0 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.0 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.8 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 1.0 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.0 | 0.2 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.4 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 1.3 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.2 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.4 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.3 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.3 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.7 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.0 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 0.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.2 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.2 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.6 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.0 | 0.3 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.5 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
0.0 | 0.5 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.1 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 0.2 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 2.1 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.2 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.3 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.3 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.0 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.3 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.0 | PID EPO PATHWAY | EPO signaling pathway |
0.0 | 0.4 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 0.0 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.1 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 2.0 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.1 | PID EPHA FWDPATHWAY | EPHA forward signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.9 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.2 | 1.8 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.2 | 3.6 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 1.5 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.1 | 0.3 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
0.1 | 1.6 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.1 | 1.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 2.2 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 0.2 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 0.7 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.1 | 0.5 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.1 | 0.8 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.1 | 0.8 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.1 | 1.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.1 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 0.9 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.1 | 0.4 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.1 | 0.5 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.1 | 0.5 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.1 | 0.6 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.9 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.2 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.0 | 0.0 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.4 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.3 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.0 | 3.2 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.4 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 1.2 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.0 | 0.7 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.5 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.4 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.3 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.5 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 0.4 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.2 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.0 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.2 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.0 | 0.0 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.0 | 0.7 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.4 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.0 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.0 | 1.0 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.2 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 0.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.7 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.1 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.1 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.4 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.0 | 0.3 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.4 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.2 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.0 | 0.3 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 1.0 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.1 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 0.0 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
0.0 | 0.0 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 0.4 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.1 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.3 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
0.0 | 0.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.2 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.0 | 0.0 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.0 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 1.3 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.0 | 0.2 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.1 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.1 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 0.1 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
0.0 | 2.0 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.1 | REACTOME SLC MEDIATED TRANSMEMBRANE TRANSPORT | Genes involved in SLC-mediated transmembrane transport |
0.0 | 0.3 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.1 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 0.0 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.1 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.1 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
0.0 | 0.1 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.0 | 0.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.3 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.2 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 0.1 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.0 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.0 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 0.1 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |