Gene Symbol | Gene ID | Gene Info |
---|---|---|
Onecut2
|
ENSMUSG00000045991.12 | one cut domain, family member 2 |
Onecut3
|
ENSMUSG00000045518.8 | one cut domain, family member 3 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
chr18_64340633_64341751 | Onecut2 | 1172 | 0.447814 | 0.60 | 3.2e-07 | Click! |
chr18_64344305_64344524 | Onecut2 | 4394 | 0.193459 | 0.54 | 7.2e-06 | Click! |
chr18_64344559_64346244 | Onecut2 | 5381 | 0.183610 | 0.53 | 1.1e-05 | Click! |
chr18_64342312_64344053 | Onecut2 | 3162 | 0.219476 | 0.53 | 1.1e-05 | Click! |
chr18_64341775_64341956 | Onecut2 | 1845 | 0.308607 | 0.52 | 1.8e-05 | Click! |
chr10_80489754_80491751 | Onecut3 | 4083 | 0.109368 | -0.34 | 8.5e-03 | Click! |
chr10_80487858_80488400 | Onecut3 | 6706 | 0.095361 | -0.32 | 1.3e-02 | Click! |
chr10_80496379_80497661 | Onecut3 | 2185 | 0.157256 | 0.29 | 2.3e-02 | Click! |
chr10_80500937_80501182 | Onecut3 | 6224 | 0.095192 | -0.28 | 2.7e-02 | Click! |
chr10_80491930_80492771 | Onecut3 | 2485 | 0.143251 | -0.26 | 4.5e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr3_88208985_88210116 | 6.12 |
Gm3764 |
predicted gene 3764 |
78 |
0.92 |
chr8_109250884_109251908 | 5.37 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
1530 |
0.52 |
chr14_64588312_64589438 | 5.24 |
Mir124a-1hg |
Mir124-1 host gene (non-protein coding) |
341 |
0.81 |
chr1_66323360_66324079 | 5.14 |
Map2 |
microtubule-associated protein 2 |
1617 |
0.37 |
chr6_55680133_55680881 | 4.92 |
Neurod6 |
neurogenic differentiation 6 |
756 |
0.69 |
chr11_94046147_94046506 | 4.90 |
Spag9 |
sperm associated antigen 9 |
1961 |
0.31 |
chr3_4796861_4798079 | 4.85 |
1110015O18Rik |
RIKEN cDNA 1110015O18 gene |
88 |
0.98 |
chr4_109342938_109343450 | 4.22 |
Eps15 |
epidermal growth factor receptor pathway substrate 15 |
59 |
0.97 |
chr3_102010214_102010759 | 4.16 |
Nhlh2 |
nescient helix loop helix 2 |
331 |
0.89 |
chr7_87584791_87585125 | 4.07 |
Grm5 |
glutamate receptor, metabotropic 5 |
560 |
0.85 |
chr13_105248515_105248922 | 4.06 |
Rnf180 |
ring finger protein 180 |
22321 |
0.21 |
chr1_25827305_25827886 | 3.95 |
Adgrb3 |
adhesion G protein-coupled receptor B3 |
835 |
0.43 |
chr2_181766837_181767244 | 3.90 |
Myt1 |
myelin transcription factor 1 |
2 |
0.97 |
chr17_52601836_52601987 | 3.79 |
Gm27217 |
predicted gene 27217 |
749 |
0.46 |
chr1_109984209_109985108 | 3.71 |
Cdh7 |
cadherin 7, type 2 |
921 |
0.74 |
chr16_77646908_77647363 | 3.68 |
C130023A14Rik |
RIKEN cDNA C130023A14 gene |
795 |
0.35 |
chr16_77597699_77598173 | 3.56 |
Mir99a |
microRNA 99a |
1000 |
0.31 |
chr16_94996056_94996272 | 3.56 |
Kcnj6 |
potassium inwardly-rectifying channel, subfamily J, member 6 |
1088 |
0.63 |
chr1_66322822_66322976 | 3.45 |
Map2 |
microtubule-associated protein 2 |
797 |
0.63 |
chr1_115686481_115687365 | 3.44 |
Cntnap5a |
contactin associated protein-like 5A |
2167 |
0.34 |
chr3_8513445_8513907 | 3.35 |
Stmn2 |
stathmin-like 2 |
4090 |
0.25 |
chr8_108537198_108537924 | 3.33 |
Gm39244 |
predicted gene, 39244 |
340 |
0.92 |
chr3_84219260_84219630 | 3.32 |
Trim2 |
tripartite motif-containing 2 |
1400 |
0.49 |
chr13_56895147_56895774 | 3.26 |
Trpc7 |
transient receptor potential cation channel, subfamily C, member 7 |
277 |
0.94 |
chr2_6881042_6881689 | 3.25 |
Gm13389 |
predicted gene 13389 |
2905 |
0.24 |
chr7_51623529_51624502 | 3.24 |
Slc17a6 |
solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 6 |
1133 |
0.51 |
chr11_80481116_80481835 | 3.20 |
Cdk5r1 |
cyclin-dependent kinase 5, regulatory subunit 1 (p35) |
4419 |
0.21 |
chr15_25415052_25415352 | 3.14 |
Gm48957 |
predicted gene, 48957 |
139 |
0.9 |
chrX_105389448_105389994 | 3.13 |
5330434G04Rik |
RIKEN cDNA 5330434G04 gene |
1807 |
0.32 |
chr18_64265796_64267074 | 2.97 |
St8sia3 |
ST8 alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase 3 |
47 |
0.97 |
chr11_94044930_94045437 | 2.95 |
Spag9 |
sperm associated antigen 9 |
818 |
0.6 |
chr12_88725437_88725947 | 2.83 |
Nrxn3 |
neurexin III |
11 |
0.98 |
chr7_61309034_61309202 | 2.82 |
A230006K03Rik |
RIKEN cDNA A230006K03 gene |
2595 |
0.4 |
chr2_96319240_96319943 | 2.77 |
Lrrc4c |
leucine rich repeat containing 4C |
1375 |
0.61 |
chr4_22485878_22486449 | 2.76 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
2203 |
0.26 |
chr12_29526477_29526710 | 2.74 |
Myt1l |
myelin transcription factor 1-like |
1791 |
0.41 |
chr8_109244278_109244568 | 2.73 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
5443 |
0.3 |
chr16_81201314_81201888 | 2.68 |
Ncam2 |
neural cell adhesion molecule 2 |
844 |
0.72 |
chr1_81079064_81079824 | 2.67 |
Nyap2 |
neuronal tyrosine-phophorylated phosphoinositide 3-kinase adaptor 2 |
1861 |
0.49 |
chr1_32174771_32175297 | 2.65 |
Khdrbs2 |
KH domain containing, RNA binding, signal transduction associated 2 |
2147 |
0.41 |
chr4_22485441_22485749 | 2.61 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
2771 |
0.23 |
chr10_49784845_49785206 | 2.58 |
Grik2 |
glutamate receptor, ionotropic, kainate 2 (beta 2) |
1616 |
0.33 |
chr13_109445560_109445945 | 2.57 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
3569 |
0.38 |
chr18_23036665_23037864 | 2.57 |
Nol4 |
nucleolar protein 4 |
1392 |
0.59 |
chr12_69149864_69150387 | 2.57 |
Gm24499 |
predicted gene, 24499 |
2252 |
0.11 |
chr17_91090702_91091377 | 2.53 |
Nrxn1 |
neurexin I |
1694 |
0.28 |
chr8_109247005_109247806 | 2.50 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
2461 |
0.39 |
chr11_41999400_42000640 | 2.48 |
Gabrg2 |
gamma-aminobutyric acid (GABA) A receptor, subunit gamma 2 |
336 |
0.92 |
chr8_54957303_54957776 | 2.46 |
Gm45263 |
predicted gene 45263 |
2280 |
0.24 |
chr6_32583482_32584367 | 2.44 |
Plxna4 |
plexin A4 |
4268 |
0.26 |
chr6_136166865_136167115 | 2.42 |
Grin2b |
glutamate receptor, ionotropic, NMDA2B (epsilon 2) |
4899 |
0.24 |
chr4_23601397_23602347 | 2.41 |
Gm25978 |
predicted gene, 25978 |
24873 |
0.22 |
chr1_146494200_146495557 | 2.40 |
Gm29514 |
predicted gene 29514 |
73 |
0.56 |
chr4_22481988_22482455 | 2.36 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
6145 |
0.18 |
chr9_45433206_45433653 | 2.36 |
4833428L15Rik |
RIKEN cDNA 4833428L15 gene |
1699 |
0.26 |
chr7_141945515_141946556 | 2.32 |
Gm20501 |
predicted gene 20501 |
78 |
0.96 |
chr6_112943851_112944495 | 2.31 |
Srgap3 |
SLIT-ROBO Rho GTPase activating protein 3 |
2581 |
0.19 |
chr14_39469812_39470401 | 2.27 |
Nrg3 |
neuregulin 3 |
2560 |
0.44 |
chr16_77594640_77595970 | 2.23 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
403 |
0.71 |
chr15_85675690_85676550 | 2.23 |
Lncppara |
long noncoding RNA near Ppara |
22504 |
0.12 |
chr8_31915119_31915654 | 2.22 |
Nrg1 |
neuregulin 1 |
2264 |
0.34 |
chr4_148284201_148285628 | 2.20 |
Disp3 |
dispatched RND transporter family member 3 |
3051 |
0.22 |
chr3_17799177_17799545 | 2.19 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
3617 |
0.21 |
chr11_114794635_114794844 | 2.17 |
Btbd17 |
BTB (POZ) domain containing 17 |
1134 |
0.38 |
chr1_78193153_78194695 | 2.13 |
Pax3 |
paired box 3 |
2914 |
0.3 |
chr13_109928298_109928867 | 2.12 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
1738 |
0.46 |
chr7_62365207_62365438 | 2.12 |
Magel2 |
melanoma antigen, family L, 2 |
11688 |
0.17 |
chr3_45383303_45383667 | 2.11 |
Pcdh10 |
protocadherin 10 |
852 |
0.56 |
chr12_3368833_3369546 | 2.10 |
Gm48511 |
predicted gene, 48511 |
760 |
0.54 |
chr8_117260847_117261416 | 2.08 |
Cmip |
c-Maf inducing protein |
4014 |
0.3 |
chr7_128689234_128689975 | 2.08 |
Gm43580 |
predicted gene 43580 |
1069 |
0.26 |
chr12_88723574_88724074 | 2.06 |
Nrxn3 |
neurexin III |
715 |
0.73 |
chr1_50928853_50929386 | 2.03 |
Tmeff2 |
transmembrane protein with EGF-like and two follistatin-like domains 2 |
1600 |
0.44 |
chr13_34341882_34342941 | 1.99 |
Slc22a23 |
solute carrier family 22, member 23 |
1792 |
0.34 |
chr8_109248088_109248728 | 1.96 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
1458 |
0.54 |
chr4_45824039_45824548 | 1.93 |
Igfbpl1 |
insulin-like growth factor binding protein-like 1 |
2630 |
0.22 |
chr15_25754845_25755428 | 1.93 |
Myo10 |
myosin X |
2157 |
0.37 |
chr14_45653945_45654549 | 1.92 |
Ddhd1 |
DDHD domain containing 1 |
3113 |
0.15 |
chr1_15288505_15288656 | 1.92 |
Kcnb2 |
potassium voltage gated channel, Shab-related subfamily, member 2 |
1326 |
0.51 |
chrX_23295858_23296139 | 1.90 |
Klhl13 |
kelch-like 13 |
160 |
0.97 |
chr15_91017138_91018295 | 1.90 |
Kif21a |
kinesin family member 21A |
32102 |
0.16 |
chr3_89759596_89761036 | 1.86 |
Chrnb2 |
cholinergic receptor, nicotinic, beta polypeptide 2 (neuronal) |
3085 |
0.15 |
chr7_91544757_91544936 | 1.84 |
Dlg2 |
discs large MAGUK scaffold protein 2 |
1757 |
0.31 |
chr13_18743768_18744314 | 1.84 |
Vps41 |
VPS41 HOPS complex subunit |
26751 |
0.23 |
chr14_64589664_64590503 | 1.84 |
Mir124a-1hg |
Mir124-1 host gene (non-protein coding) |
388 |
0.55 |
chr12_29531656_29532106 | 1.83 |
Gm20208 |
predicted gene, 20208 |
766 |
0.61 |
chr2_37516828_37517574 | 1.83 |
Gpr21 |
G protein-coupled receptor 21 |
575 |
0.47 |
chr19_38263947_38265363 | 1.81 |
Lgi1 |
leucine-rich repeat LGI family, member 1 |
5 |
0.97 |
chr13_73117045_73117937 | 1.80 |
Rpl31-ps2 |
ribosomal protein L31, pseudogene 2 |
115904 |
0.06 |
chr5_142608124_142609162 | 1.80 |
Mmd2 |
monocyte to macrophage differentiation-associated 2 |
157 |
0.94 |
chr11_24075034_24075265 | 1.79 |
A830031A19Rik |
RIKEN cDNA A830031A19 gene |
95 |
0.94 |
chr1_69498955_69499253 | 1.79 |
Gm29113 |
predicted gene 29113 |
5316 |
0.22 |
chr1_54554713_54554864 | 1.79 |
Pgap1 |
post-GPI attachment to proteins 1 |
2839 |
0.24 |
chr13_96668320_96668471 | 1.75 |
Hmgcr |
3-hydroxy-3-methylglutaryl-Coenzyme A reductase |
1259 |
0.39 |
chr12_27336880_27337279 | 1.75 |
Sox11 |
SRY (sex determining region Y)-box 11 |
5495 |
0.31 |
chr9_74865733_74868961 | 1.75 |
Onecut1 |
one cut domain, family member 1 |
863 |
0.54 |
chr3_8509825_8511666 | 1.75 |
Stmn2 |
stathmin-like 2 |
1159 |
0.54 |
chr13_83732205_83734272 | 1.75 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
672 |
0.58 |
chr13_69737356_69737994 | 1.70 |
Ube2ql1 |
ubiquitin-conjugating enzyme E2Q family-like 1 |
2214 |
0.21 |
chrX_165325643_165325925 | 1.67 |
Glra2 |
glycine receptor, alpha 2 subunit |
1609 |
0.56 |
chr12_72234504_72235243 | 1.67 |
Rtn1 |
reticulon 1 |
866 |
0.66 |
chr9_111351872_111352351 | 1.67 |
Trank1 |
tetratricopeptide repeat and ankyrin repeat containing 1 |
22709 |
0.17 |
chr12_98562134_98562933 | 1.67 |
Kcnk10 |
potassium channel, subfamily K, member 10 |
12179 |
0.14 |
chr9_117870768_117871285 | 1.66 |
Rbms3 |
RNA binding motif, single stranded interacting protein |
1558 |
0.39 |
chr1_61472065_61473256 | 1.66 |
Gm25839 |
predicted gene, 25839 |
2219 |
0.24 |
chr19_19106641_19106954 | 1.65 |
Rorb |
RAR-related orphan receptor beta |
4399 |
0.34 |
chr4_13747506_13748460 | 1.64 |
Runx1t1 |
RUNX1 translocation partner 1 |
3314 |
0.37 |
chr3_8512495_8512918 | 1.63 |
Stmn2 |
stathmin-like 2 |
3120 |
0.28 |
chr10_57787071_57787893 | 1.63 |
Fabp7 |
fatty acid binding protein 7, brain |
2559 |
0.25 |
chr8_31917541_31918367 | 1.62 |
Nrg1 |
neuregulin 1 |
288 |
0.81 |
chr8_71728107_71728816 | 1.62 |
Fcho1 |
FCH domain only 1 |
2745 |
0.14 |
chr14_13453867_13454386 | 1.62 |
Synpr |
synaptoporin |
97 |
0.98 |
chr13_8205494_8206737 | 1.62 |
Adarb2 |
adenosine deaminase, RNA-specific, B2 |
3193 |
0.23 |
chr15_72808819_72809008 | 1.61 |
Peg13 |
paternally expressed 13 |
1411 |
0.52 |
chr8_109378550_109379871 | 1.61 |
Gm1943 |
predicted gene 1943 |
38346 |
0.16 |
chr18_54984578_54984982 | 1.58 |
Zfp608 |
zinc finger protein 608 |
5386 |
0.22 |
chr3_34104464_34105670 | 1.57 |
Sox2ot |
SOX2 overlapping transcript (non-protein coding) |
609 |
0.68 |
chr15_77151796_77152203 | 1.56 |
Rbfox2 |
RNA binding protein, fox-1 homolog (C. elegans) 2 |
1557 |
0.32 |
chr2_115510173_115510507 | 1.56 |
3110099E03Rik |
RIKEN cDNA 3110099E03 gene |
1861 |
0.43 |
chr19_15922352_15922560 | 1.55 |
Psat1 |
phosphoserine aminotransferase 1 |
1047 |
0.54 |
chr12_84150828_84152588 | 1.55 |
Pnma1 |
paraneoplastic antigen MA1 |
3219 |
0.13 |
chr17_8343386_8343779 | 1.55 |
Prr18 |
proline rich 18 |
2843 |
0.16 |
chr13_83736071_83736534 | 1.54 |
Gm33366 |
predicted gene, 33366 |
2233 |
0.18 |
chr17_85393481_85393696 | 1.54 |
Rpl31-ps16 |
ribosomal protein L31, pseudogene 16 |
105045 |
0.07 |
chr13_28419484_28419778 | 1.54 |
Gm40841 |
predicted gene, 40841 |
232 |
0.95 |
chr12_29529268_29529419 | 1.54 |
Myt1l |
myelin transcription factor 1-like |
942 |
0.56 |
chr11_31872311_31873528 | 1.54 |
Cpeb4 |
cytoplasmic polyadenylation element binding protein 4 |
356 |
0.89 |
chr12_29528030_29528268 | 1.53 |
Myt1l |
myelin transcription factor 1-like |
235 |
0.94 |
chr2_65848318_65848473 | 1.52 |
Csrnp3 |
cysteine-serine-rich nuclear protein 3 |
2540 |
0.31 |
chr7_139833633_139836105 | 1.52 |
Adgra1 |
adhesion G protein-coupled receptor A1 |
93 |
0.96 |
chr5_48598987_48600332 | 1.51 |
Kcnip4 |
Kv channel interacting protein 4 |
23 |
0.97 |
chr17_90452868_90453681 | 1.50 |
Nrxn1 |
neurexin I |
1548 |
0.36 |
chr16_77645925_77646470 | 1.49 |
Mir125b-2 |
microRNA 125b-2 |
76 |
0.58 |
chr10_92164315_92164805 | 1.49 |
Rmst |
rhabdomyosarcoma 2 associated transcript (non-coding RNA) |
106 |
0.97 |
chr15_16729545_16729850 | 1.49 |
Cdh9 |
cadherin 9 |
941 |
0.71 |
chr3_69320878_69321096 | 1.48 |
Gm17214 |
predicted gene 17214 |
402 |
0.83 |
chr18_42895118_42895392 | 1.48 |
Ppp2r2b |
protein phosphatase 2, regulatory subunit B, beta |
3560 |
0.3 |
chr14_55114527_55116659 | 1.48 |
Jph4 |
junctophilin 4 |
41 |
0.94 |
chr14_108914298_108914499 | 1.47 |
Slitrk1 |
SLIT and NTRK-like family, member 1 |
240 |
0.96 |
chr10_12187176_12187338 | 1.47 |
Gm48723 |
predicted gene, 48723 |
137404 |
0.04 |
chr14_68126289_68127413 | 1.47 |
Nefm |
neurofilament, medium polypeptide |
2005 |
0.3 |
chrX_88113433_88114223 | 1.46 |
Il1rapl1 |
interleukin 1 receptor accessory protein-like 1 |
1817 |
0.46 |
chr19_40512299_40512450 | 1.46 |
Sorbs1 |
sorbin and SH3 domain containing 1 |
1299 |
0.43 |
chr3_19957528_19957877 | 1.45 |
Cp |
ceruloplasmin |
418 |
0.83 |
chr5_70842167_70842810 | 1.45 |
Gabrg1 |
gamma-aminobutyric acid (GABA) A receptor, subunit gamma 1 |
129 |
0.98 |
chr1_23380807_23381185 | 1.44 |
Ogfrl1 |
opioid growth factor receptor-like 1 |
195 |
0.95 |
chr11_31874060_31874636 | 1.44 |
Cpeb4 |
cytoplasmic polyadenylation element binding protein 4 |
1073 |
0.55 |
chr10_76576102_76576338 | 1.44 |
Ftcd |
formiminotransferase cyclodeaminase |
568 |
0.63 |
chr4_25797148_25797299 | 1.43 |
Fut9 |
fucosyltransferase 9 |
2632 |
0.27 |
chr6_60827699_60828046 | 1.43 |
Snca |
synuclein, alpha |
316 |
0.9 |
chr16_85169623_85170249 | 1.43 |
Gm27295 |
predicted gene, 27295 |
1087 |
0.49 |
chr1_23382218_23382510 | 1.43 |
Ogfrl1 |
opioid growth factor receptor-like 1 |
811 |
0.64 |
chr12_29537800_29538885 | 1.42 |
Myt1l |
myelin transcription factor 1-like |
3120 |
0.28 |
chr2_169445439_169445840 | 1.42 |
Gm14249 |
predicted gene 14249 |
34978 |
0.16 |
chr13_109116105_109117683 | 1.42 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
253 |
0.96 |
chr6_119481820_119482341 | 1.42 |
Fbxl14 |
F-box and leucine-rich repeat protein 14 |
2412 |
0.3 |
chr4_13749333_13749927 | 1.41 |
Runx1t1 |
RUNX1 translocation partner 1 |
1667 |
0.52 |
chr7_56051388_56051653 | 1.40 |
Herc2 |
HECT and RLD domain containing E3 ubiquitin protein ligase 2 |
643 |
0.55 |
chr5_70841090_70841579 | 1.40 |
Gabrg1 |
gamma-aminobutyric acid (GABA) A receptor, subunit gamma 1 |
870 |
0.75 |
chrX_38601902_38602122 | 1.40 |
Mcts1 |
malignant T cell amplified sequence 1 |
713 |
0.66 |
chr16_23889696_23891150 | 1.39 |
Sst |
somatostatin |
535 |
0.77 |
chr6_13833304_13833848 | 1.38 |
Gpr85 |
G protein-coupled receptor 85 |
3665 |
0.25 |
chr7_91262074_91263006 | 1.38 |
Gm24552 |
predicted gene, 24552 |
19545 |
0.18 |
chr3_97763340_97765161 | 1.38 |
Pde4dip |
phosphodiesterase 4D interacting protein (myomegalin) |
3681 |
0.23 |
chr4_148391829_148392098 | 1.38 |
Gm13200 |
predicted gene 13200 |
32503 |
0.12 |
chr13_28420292_28420642 | 1.38 |
Gm40841 |
predicted gene, 40841 |
401 |
0.89 |
chr16_43504464_43505047 | 1.37 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
1058 |
0.61 |
chr2_45108054_45108205 | 1.37 |
Zeb2 |
zinc finger E-box binding homeobox 2 |
1947 |
0.32 |
chr10_127121208_127121635 | 1.36 |
Os9 |
amplified in osteosarcoma |
290 |
0.78 |
chr2_32428080_32429746 | 1.35 |
Slc25a25 |
solute carrier family 25 (mitochondrial carrier, phosphate carrier), member 25 |
1839 |
0.19 |
chr9_72534819_72535047 | 1.35 |
Rfx7 |
regulatory factor X, 7 |
2198 |
0.16 |
chr9_91350199_91351559 | 1.34 |
A730094K22Rik |
RIKEN cDNA A730094K22 gene |
74 |
0.95 |
chr1_176272954_176273350 | 1.33 |
Pld5 |
phospholipase D family, member 5 |
2122 |
0.3 |
chr15_92160888_92162023 | 1.33 |
Cntn1 |
contactin 1 |
98 |
0.98 |
chr12_61525470_61525621 | 1.33 |
Lrfn5 |
leucine rich repeat and fibronectin type III domain containing 5 |
1597 |
0.38 |
chrX_113304333_113304650 | 1.32 |
Dach2 |
dachshund family transcription factor 2 |
5857 |
0.24 |
chr4_9270926_9271667 | 1.32 |
Clvs1 |
clavesin 1 |
159 |
0.96 |
chr13_100863175_100863392 | 1.31 |
Gm37830 |
predicted gene, 37830 |
9497 |
0.14 |
chr3_17325836_17326169 | 1.31 |
Gm30340 |
predicted gene, 30340 |
8423 |
0.23 |
chr9_91372507_91373295 | 1.30 |
Zic4 |
zinc finger protein of the cerebellum 4 |
1551 |
0.25 |
chr2_48538709_48539576 | 1.30 |
Gm13481 |
predicted gene 13481 |
81897 |
0.1 |
chr4_119815673_119815824 | 1.30 |
Hivep3 |
human immunodeficiency virus type I enhancer binding protein 3 |
1253 |
0.57 |
chrX_169829854_169830387 | 1.30 |
Mid1 |
midline 1 |
1961 |
0.41 |
chr3_17782537_17782894 | 1.30 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
7206 |
0.19 |
chr10_92404661_92405130 | 1.30 |
4930401A07Rik |
RIKEN cDNA 4930401A07 gene |
3881 |
0.24 |
chr14_122376364_122377232 | 1.30 |
Gm25464 |
predicted gene, 25464 |
11362 |
0.18 |
chr7_6435207_6435948 | 1.30 |
Olfr1344 |
olfactory receptor 1344 |
3111 |
0.1 |
chr12_74285521_74285936 | 1.29 |
1700086L19Rik |
RIKEN cDNA 1700086L19 gene |
1439 |
0.35 |
chr10_111247804_111248910 | 1.29 |
Osbpl8 |
oxysterol binding protein-like 8 |
289 |
0.91 |
chrX_6171274_6171425 | 1.28 |
Nudt10 |
nudix (nucleoside diphosphate linked moiety X)-type motif 10 |
1666 |
0.4 |
chr1_177448882_177449429 | 1.26 |
Zbtb18 |
zinc finger and BTB domain containing 18 |
3334 |
0.19 |
chrX_75577044_75577513 | 1.26 |
Rab39b |
RAB39B, member RAS oncogene family |
953 |
0.4 |
chr13_58811787_58812184 | 1.25 |
C630044B11Rik |
RIKEN cDNA C630044B11 gene |
168 |
0.92 |
chr11_85135092_85135243 | 1.25 |
Usp32 |
ubiquitin specific peptidase 32 |
4762 |
0.15 |
chr3_107041271_107042100 | 1.24 |
AI504432 |
expressed sequence AI504432 |
2181 |
0.26 |
chr4_33926104_33927188 | 1.24 |
Cnr1 |
cannabinoid receptor 1 (brain) |
444 |
0.88 |
chrX_151170941_151171092 | 1.24 |
Gm15138 |
predicted gene 15138 |
1316 |
0.33 |
chr2_92431215_92432318 | 1.24 |
Cry2 |
cryptochrome 2 (photolyase-like) |
626 |
0.59 |
chr14_65423052_65425451 | 1.24 |
Pnoc |
prepronociceptin |
909 |
0.6 |
chr1_105665986_105666204 | 1.23 |
Relch |
RAB11 binding and LisH domain, coiled-coil and HEAT repeat containing |
1654 |
0.29 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.8 | 3.6 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
1.5 | 4.5 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.9 | 2.8 | GO:0097503 | sialylation(GO:0097503) |
0.8 | 3.4 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.8 | 2.5 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.6 | 2.4 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.6 | 2.9 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.6 | 1.7 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
0.6 | 2.2 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.5 | 3.7 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.5 | 2.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.5 | 3.2 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.4 | 0.9 | GO:0072025 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.4 | 4.0 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
0.4 | 0.4 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
0.4 | 2.2 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.4 | 1.3 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.4 | 3.7 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.4 | 1.1 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.3 | 1.0 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.3 | 1.3 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.3 | 1.0 | GO:0070268 | cornification(GO:0070268) |
0.3 | 0.9 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.3 | 1.6 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.3 | 1.2 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.3 | 1.2 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) |
0.3 | 0.9 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.3 | 1.7 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.3 | 0.8 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.3 | 2.2 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.3 | 4.1 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.3 | 1.3 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.2 | 1.0 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.2 | 1.2 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.2 | 0.7 | GO:0021586 | pons maturation(GO:0021586) |
0.2 | 2.1 | GO:0060539 | diaphragm development(GO:0060539) |
0.2 | 0.9 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.2 | 3.4 | GO:0006828 | manganese ion transport(GO:0006828) |
0.2 | 0.7 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.2 | 0.7 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.2 | 2.0 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.2 | 0.2 | GO:1904177 | regulation of adipose tissue development(GO:1904177) |
0.2 | 0.6 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.2 | 2.1 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.2 | 0.6 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.2 | 0.6 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.2 | 0.8 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.2 | 0.6 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.2 | 1.0 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
0.2 | 0.6 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.2 | 0.6 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.2 | 0.4 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.2 | 0.9 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.2 | 0.9 | GO:0060023 | soft palate development(GO:0060023) |
0.2 | 0.9 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.2 | 0.5 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.2 | 1.0 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.2 | 0.5 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.2 | 0.8 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.2 | 2.7 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.2 | 0.5 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
0.2 | 0.8 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.2 | 1.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.2 | 0.2 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.1 | 0.7 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.1 | 0.4 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.1 | 1.0 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.1 | 1.0 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.1 | 1.2 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.1 | 0.4 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.1 | 0.4 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.1 | 0.3 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.1 | 0.4 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.1 | 0.4 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.1 | 0.7 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 1.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 3.8 | GO:0007617 | mating behavior(GO:0007617) multi-organism reproductive behavior(GO:0044705) |
0.1 | 0.7 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.1 | 0.4 | GO:0060618 | nipple development(GO:0060618) |
0.1 | 0.3 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.1 | 0.6 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.1 | 0.3 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.1 | 1.6 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.1 | 0.4 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.1 | 0.4 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.1 | 0.4 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 0.4 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.1 | 0.7 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.1 | 0.2 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.1 | 0.5 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.1 | 0.6 | GO:0014029 | neural crest formation(GO:0014029) |
0.1 | 0.2 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.1 | 2.7 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
0.1 | 0.2 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.1 | 0.3 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.1 | 0.8 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 0.5 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.1 | 1.0 | GO:0050957 | equilibrioception(GO:0050957) |
0.1 | 0.5 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.1 | 0.5 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.1 | 1.9 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
0.1 | 0.3 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.1 | 0.6 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.1 | 0.4 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.1 | 0.3 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.1 | 0.4 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.1 | 0.4 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.1 | 0.3 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.1 | 0.3 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.1 | 0.4 | GO:0015886 | heme transport(GO:0015886) |
0.1 | 0.4 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.1 | 0.3 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.1 | 0.3 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
0.1 | 0.4 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.1 | 0.5 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.1 | 0.3 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.1 | 0.7 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.1 | 0.1 | GO:1904192 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.1 | 0.4 | GO:0030035 | microspike assembly(GO:0030035) |
0.1 | 0.2 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 0.3 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.1 | 0.8 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.1 | 0.1 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.1 | 0.2 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.1 | 0.5 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.1 | 0.6 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.1 | 6.0 | GO:0001578 | microtubule bundle formation(GO:0001578) |
0.1 | 0.3 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.1 | 0.3 | GO:0015755 | fructose transport(GO:0015755) |
0.1 | 0.6 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.1 | 0.2 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.1 | 0.3 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 0.3 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.1 | 0.4 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.1 | 0.5 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.1 | 0.7 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.1 | 0.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.1 | 0.6 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.1 | 0.2 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
0.1 | 0.2 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.2 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.1 | 0.3 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.1 | 0.2 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.1 | 0.4 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.1 | 0.3 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.1 | 0.1 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.1 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.1 | 0.8 | GO:0007614 | short-term memory(GO:0007614) |
0.1 | 0.4 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.1 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.1 | 0.6 | GO:0015791 | polyol transport(GO:0015791) |
0.1 | 2.1 | GO:1904893 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
0.1 | 0.3 | GO:0032225 | regulation of synaptic transmission, dopaminergic(GO:0032225) |
0.1 | 0.1 | GO:0046865 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.1 | 0.2 | GO:1902075 | cellular response to salt(GO:1902075) |
0.1 | 0.3 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 0.4 | GO:1902221 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.1 | 0.3 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.1 | 0.9 | GO:0006825 | copper ion transport(GO:0006825) |
0.1 | 1.0 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.1 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.1 | 0.7 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.1 | 0.1 | GO:0061591 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
0.1 | 0.5 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.1 | 0.2 | GO:2000617 | positive regulation of histone H3-K9 acetylation(GO:2000617) |
0.1 | 0.7 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.1 | 0.1 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.1 | 0.4 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.1 | 0.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.1 | 0.8 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 0.6 | GO:0030575 | nuclear body organization(GO:0030575) |
0.1 | 0.1 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.1 | 1.2 | GO:0035418 | protein localization to synapse(GO:0035418) |
0.1 | 0.2 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.1 | 0.5 | GO:0033572 | transferrin transport(GO:0033572) |
0.1 | 0.2 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 5.1 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.4 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
0.1 | 0.3 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.1 | 0.2 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.1 | 0.5 | GO:1903817 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
0.1 | 0.2 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.1 | 0.9 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.1 | 0.2 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.1 | 0.2 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 0.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.1 | 0.7 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.1 | 0.2 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.1 | 0.2 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.4 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.1 | 0.1 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.1 | 0.2 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.1 | 1.6 | GO:0019835 | cytolysis(GO:0019835) |
0.1 | 0.3 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.2 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.1 | 2.3 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 0.1 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.1 | 0.3 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.1 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 1.4 | GO:0051489 | regulation of filopodium assembly(GO:0051489) |
0.1 | 1.3 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.1 | 0.4 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.1 | 0.2 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.1 | 0.1 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.1 | 0.2 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.1 | 1.9 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
0.1 | 0.1 | GO:0042713 | sperm ejaculation(GO:0042713) |
0.1 | 0.6 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
0.1 | 0.1 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
0.1 | 0.5 | GO:0031629 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.1 | 0.2 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
0.1 | 0.3 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.1 | 0.8 | GO:0031442 | positive regulation of mRNA 3'-end processing(GO:0031442) |
0.0 | 0.1 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.0 | 0.3 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.0 | 0.4 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.0 | 0.4 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 0.1 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.0 | 0.1 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
0.0 | 0.5 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 0.4 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
0.0 | 0.0 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.0 | 0.2 | GO:1901679 | nucleotide transmembrane transport(GO:1901679) |
0.0 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.0 | 0.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.0 | 0.0 | GO:0045073 | chemokine biosynthetic process(GO:0042033) regulation of chemokine biosynthetic process(GO:0045073) positive regulation of chemokine biosynthetic process(GO:0045080) |
0.0 | 0.8 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.0 | 0.2 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
0.0 | 0.1 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.0 | 0.1 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.0 | 0.5 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
0.0 | 0.1 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.0 | 0.1 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.0 | 0.1 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.0 | 0.2 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.2 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.0 | 0.0 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.0 | 1.7 | GO:0080171 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
0.0 | 0.3 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.0 | 0.2 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.0 | 0.2 | GO:0070474 | positive regulation of uterine smooth muscle contraction(GO:0070474) |
0.0 | 0.1 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.0 | 0.1 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 0.2 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.8 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.0 | 0.1 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.0 | 0.2 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.4 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.0 | 0.0 | GO:1902996 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.0 | 0.1 | GO:0010288 | response to lead ion(GO:0010288) |
0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.0 | 0.3 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.6 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
0.0 | 0.3 | GO:0060074 | synapse maturation(GO:0060074) |
0.0 | 0.4 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.0 | 0.2 | GO:0015816 | glycine transport(GO:0015816) |
0.0 | 0.1 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.0 | 0.3 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.2 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.1 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.1 | GO:0019614 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
0.0 | 0.1 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.0 | 0.5 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
0.0 | 0.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.0 | 0.2 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.2 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.0 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.0 | 0.2 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.1 | GO:0031296 | B cell costimulation(GO:0031296) |
0.0 | 0.2 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.0 | 0.3 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.0 | 0.1 | GO:0061511 | centriole elongation(GO:0061511) |
0.0 | 0.1 | GO:1901642 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.0 | 0.1 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.3 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.0 | 0.1 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.0 | 0.1 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.0 | 0.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.0 | 0.1 | GO:0014050 | negative regulation of glutamate secretion(GO:0014050) |
0.0 | 0.3 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
0.0 | 0.2 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.0 | 0.0 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.0 | 0.1 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.0 | 1.2 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
0.0 | 0.1 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.0 | 0.1 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.0 | 1.3 | GO:0061178 | regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061178) |
0.0 | 0.1 | GO:0061687 | detoxification of copper ion(GO:0010273) detoxification of inorganic compound(GO:0061687) stress response to copper ion(GO:1990169) |
0.0 | 0.1 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
0.0 | 0.1 | GO:1900620 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.0 | 0.4 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
0.0 | 0.2 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.0 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.0 | 0.0 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.6 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
0.0 | 0.2 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.0 | 0.1 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.1 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
0.0 | 0.2 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.0 | 0.4 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.0 | 0.2 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.8 | GO:0006778 | porphyrin-containing compound metabolic process(GO:0006778) |
0.0 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.3 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.1 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.0 | 0.2 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.0 | 0.3 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.7 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.1 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
0.0 | 0.3 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.1 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.0 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.0 | 0.2 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 0.2 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
0.0 | 0.2 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.0 | 0.2 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.0 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.0 | 0.0 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.0 | 0.1 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.0 | 0.0 | GO:0071351 | cellular response to interleukin-18(GO:0071351) |
0.0 | 0.3 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.1 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.1 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.0 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.1 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.0 | 0.4 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.0 | 0.2 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.0 | 0.0 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.0 | 0.2 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
0.0 | 0.1 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.0 | 0.1 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.0 | 0.1 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.0 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.0 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.0 | 0.2 | GO:0046146 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
0.0 | 0.4 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.0 | 0.3 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.0 | 0.0 | GO:0003051 | angiotensin-mediated drinking behavior(GO:0003051) |
0.0 | 0.1 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.0 | 0.1 | GO:1903071 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.0 | 0.2 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.1 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.0 | 0.1 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.0 | 0.1 | GO:1903416 | response to glycoside(GO:1903416) |
0.0 | 0.2 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.0 | 0.0 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.0 | 0.2 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.0 | 0.1 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.0 | 0.1 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.0 | 0.1 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.1 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.0 | 0.2 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.0 | 0.2 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.1 | GO:0021590 | cerebellum maturation(GO:0021590) |
0.0 | 0.1 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.1 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.0 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
0.0 | 0.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.1 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.0 | 0.5 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.0 | 0.0 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.0 | 0.1 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.0 | 0.4 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.1 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.0 | 0.1 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.0 | 0.1 | GO:0010755 | regulation of plasminogen activation(GO:0010755) |
0.0 | 0.1 | GO:0030432 | peristalsis(GO:0030432) |
0.0 | 0.0 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) positive regulation of glucose mediated signaling pathway(GO:1902661) |
0.0 | 0.3 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.0 | 0.1 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.1 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.0 | 0.0 | GO:0072512 | ferric iron transport(GO:0015682) trivalent inorganic cation transport(GO:0072512) |
0.0 | 0.2 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.1 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.0 | 0.0 | GO:0042938 | dipeptide transport(GO:0042938) |
0.0 | 0.1 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.0 | 0.0 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.0 | 0.3 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.0 | 0.1 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
0.0 | 0.0 | GO:0009732 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.0 | 0.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.0 | 0.0 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.0 | 0.0 | GO:0045963 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.0 | 0.2 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.0 | 0.0 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.0 | 0.0 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.0 | GO:0045608 | negative regulation of auditory receptor cell differentiation(GO:0045608) |
0.0 | 0.1 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.0 | 0.0 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.0 | 0.3 | GO:0003016 | respiratory system process(GO:0003016) |
0.0 | 0.2 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.7 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
0.0 | 0.0 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.0 | 0.0 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.0 | 0.8 | GO:0021549 | cerebellum development(GO:0021549) |
0.0 | 0.2 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 0.0 | GO:0022028 | tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.0 | GO:0090148 | membrane fission(GO:0090148) |
0.0 | 0.0 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.0 | 0.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.1 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
0.0 | 0.1 | GO:0042748 | circadian sleep/wake cycle, non-REM sleep(GO:0042748) |
0.0 | 0.0 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.0 | 0.0 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.0 | 0.1 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.0 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
0.0 | 0.1 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.0 | 0.2 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
0.0 | 0.0 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.0 | GO:0002434 | immune complex clearance(GO:0002434) |
0.0 | 0.5 | GO:0006509 | membrane protein ectodomain proteolysis(GO:0006509) |
0.0 | 0.8 | GO:1901379 | regulation of potassium ion transmembrane transport(GO:1901379) |
0.0 | 0.1 | GO:0042711 | maternal behavior(GO:0042711) |
0.0 | 0.1 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.0 | 0.1 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.0 | 0.1 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.0 | 0.0 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.0 | 0.2 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.0 | 0.0 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.0 | 0.3 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
0.0 | 0.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.0 | 0.0 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.0 | GO:1902262 | apoptotic process involved in patterning of blood vessels(GO:1902262) |
0.0 | 0.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.0 | 0.0 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.1 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.0 | 0.4 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.0 | 0.5 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.0 | 0.1 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.0 | GO:2000412 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
0.0 | 0.1 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.0 | 0.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.0 | 0.0 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
0.0 | 0.0 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
0.0 | 0.4 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.0 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.1 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.0 | 0.2 | GO:0070269 | pyroptosis(GO:0070269) |
0.0 | 0.1 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
0.0 | 0.0 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.1 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.0 | 0.0 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.0 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.0 | 0.0 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.1 | GO:0031280 | negative regulation of adenylate cyclase activity(GO:0007194) negative regulation of cyclase activity(GO:0031280) |
0.0 | 1.1 | GO:0030516 | regulation of axon extension(GO:0030516) |
0.0 | 0.0 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
0.0 | 0.0 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
0.0 | 0.1 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.0 | 0.1 | GO:0071863 | regulation of cell proliferation in bone marrow(GO:0071863) |
0.0 | 0.0 | GO:0002371 | dendritic cell cytokine production(GO:0002371) |
0.0 | 0.3 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.0 | 0.1 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.0 | 0.1 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.0 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.0 | 0.0 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 0.1 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.1 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.0 | 0.1 | GO:2001223 | negative regulation of neuron migration(GO:2001223) |
0.0 | 0.1 | GO:0072584 | caveolin-mediated endocytosis(GO:0072584) |
0.0 | 0.2 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
0.0 | 0.0 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.1 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
0.0 | 0.3 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.0 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.0 | 0.1 | GO:0046618 | drug export(GO:0046618) |
0.0 | 0.0 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.0 | 0.7 | GO:0050806 | positive regulation of synaptic transmission(GO:0050806) |
0.0 | 0.0 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.0 | 0.1 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
0.0 | 0.1 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
0.0 | 0.1 | GO:0001905 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
0.0 | 0.2 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.0 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.0 | 0.0 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.0 | 0.0 | GO:0071435 | potassium ion export(GO:0071435) |
0.0 | 0.1 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.0 | 0.1 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.0 | 0.2 | GO:0007215 | glutamate receptor signaling pathway(GO:0007215) |
0.0 | 0.0 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.0 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.0 | 0.1 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
0.0 | 0.0 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
0.0 | 0.1 | GO:0042345 | regulation of NF-kappaB import into nucleus(GO:0042345) NF-kappaB import into nucleus(GO:0042348) |
0.0 | 0.0 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.0 | 0.3 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.0 | 0.0 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.0 | GO:0046689 | response to mercury ion(GO:0046689) |
0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.1 | GO:0032372 | negative regulation of sterol transport(GO:0032372) negative regulation of cholesterol transport(GO:0032375) |
0.0 | 0.0 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.0 | 0.1 | GO:2001222 | regulation of neuron migration(GO:2001222) |
0.0 | 0.1 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.0 | 0.0 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.0 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.0 | 0.0 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
0.0 | 0.0 | GO:0046909 | intermembrane transport(GO:0046909) |
0.0 | 0.4 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.0 | 0.0 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.0 | 0.1 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.0 | 0.1 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
0.0 | 0.0 | GO:0031622 | positive regulation of fever generation(GO:0031622) |
0.0 | 0.1 | GO:0031055 | chromatin remodeling at centromere(GO:0031055) |
0.0 | 0.0 | GO:2000662 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) positive regulation of interleukin-5 secretion(GO:2000664) regulation of interleukin-13 secretion(GO:2000665) positive regulation of interleukin-13 secretion(GO:2000667) |
0.0 | 0.0 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.0 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.0 | 0.1 | GO:0007625 | grooming behavior(GO:0007625) |
0.0 | 0.0 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.0 | 0.4 | GO:0071427 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.0 | 0.0 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
0.0 | 0.1 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.0 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
0.0 | 0.0 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.0 | 0.0 | GO:0032239 | regulation of nucleobase-containing compound transport(GO:0032239) |
0.0 | 0.0 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.0 | 0.0 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.0 | 0.1 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.2 | GO:0016079 | synaptic vesicle exocytosis(GO:0016079) |
0.0 | 0.2 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.1 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
0.0 | 0.0 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.0 | 0.0 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.0 | 0.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.0 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.0 | 0.0 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 0.1 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
0.0 | 0.0 | GO:0010979 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
0.0 | 0.0 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
0.0 | 0.1 | GO:0032648 | regulation of interferon-beta production(GO:0032648) |
0.0 | 0.0 | GO:0070857 | regulation of bile acid biosynthetic process(GO:0070857) |
0.0 | 0.0 | GO:0002159 | desmosome assembly(GO:0002159) |
0.0 | 0.1 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.0 | 0.2 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.0 | 0.0 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.0 | 0.0 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.0 | 0.0 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.0 | 0.1 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
0.0 | 0.0 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.2 | GO:0060122 | inner ear receptor stereocilium organization(GO:0060122) |
0.0 | 0.0 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.0 | 0.0 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.0 | 0.0 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.0 | 0.1 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
0.0 | 0.0 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
0.0 | 0.1 | GO:0090504 | epiboly(GO:0090504) |
0.0 | 0.0 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.0 | 0.1 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.0 | 0.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.0 | 0.1 | GO:0051220 | cytoplasmic sequestering of protein(GO:0051220) |
0.0 | 0.0 | GO:0009838 | abscission(GO:0009838) |
0.0 | 0.0 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.0 | 0.0 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.0 | 1.2 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
0.0 | 0.3 | GO:0016239 | positive regulation of macroautophagy(GO:0016239) |
0.0 | 0.0 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
0.0 | 0.4 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.0 | 0.0 | GO:0046051 | UTP metabolic process(GO:0046051) |
0.0 | 0.0 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.0 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.0 | 0.2 | GO:0046834 | lipid phosphorylation(GO:0046834) |
0.0 | 0.0 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.0 | 0.0 | GO:0034182 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
0.0 | 0.0 | GO:0009414 | response to water deprivation(GO:0009414) |
0.0 | 0.1 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.3 | GO:0043124 | negative regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043124) |
0.0 | 0.0 | GO:0002093 | auditory receptor cell morphogenesis(GO:0002093) |
0.0 | 0.0 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
0.0 | 0.5 | GO:0090630 | activation of GTPase activity(GO:0090630) |
0.0 | 0.0 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.0 | 0.0 | GO:0070431 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.0 | 0.0 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.1 | GO:0042772 | DNA damage response, signal transduction resulting in transcription(GO:0042772) |
0.0 | 0.0 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.0 | 0.0 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.0 | 0.0 | GO:0030826 | regulation of cGMP biosynthetic process(GO:0030826) |
0.0 | 0.1 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 0.3 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.0 | 0.1 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.0 | 0.0 | GO:0022038 | corpus callosum development(GO:0022038) |
0.0 | 0.0 | GO:0001555 | oocyte growth(GO:0001555) |
0.0 | 0.0 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.0 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.0 | 0.4 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.0 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.2 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
0.0 | 0.0 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
0.0 | 0.0 | GO:0035608 | protein deglutamylation(GO:0035608) |
0.0 | 0.0 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.0 | 0.0 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.0 | 0.0 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 4.4 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.4 | 1.3 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.4 | 1.3 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.4 | 4.3 | GO:0097449 | astrocyte projection(GO:0097449) |
0.4 | 1.1 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.3 | 1.0 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.3 | 3.0 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.3 | 1.2 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.3 | 1.5 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.3 | 2.3 | GO:0043083 | synaptic cleft(GO:0043083) |
0.3 | 8.6 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.3 | 0.8 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.3 | 1.3 | GO:0005638 | lamin filament(GO:0005638) |
0.3 | 2.3 | GO:0030673 | axolemma(GO:0030673) |
0.3 | 1.3 | GO:0097433 | dense body(GO:0097433) |
0.3 | 1.6 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.3 | 4.7 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.2 | 1.5 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.2 | 0.7 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.2 | 0.6 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.2 | 8.2 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.2 | 0.5 | GO:1990635 | proximal dendrite(GO:1990635) |
0.1 | 0.3 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.1 | 1.9 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.9 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 2.9 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.1 | 1.8 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.2 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 0.2 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 1.0 | GO:0031527 | filopodium membrane(GO:0031527) |
0.1 | 0.8 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.2 | GO:0008091 | spectrin(GO:0008091) |
0.1 | 0.4 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.1 | 1.3 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 3.4 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 0.7 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 0.6 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.8 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.1 | 2.3 | GO:0034707 | chloride channel complex(GO:0034707) |
0.1 | 0.8 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 0.3 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.1 | 0.2 | GO:0097427 | microtubule bundle(GO:0097427) |
0.1 | 0.5 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 1.9 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.1 | 0.2 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.1 | 0.3 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.1 | 0.3 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 0.5 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 0.3 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 0.5 | GO:0071437 | invadopodium(GO:0071437) |
0.1 | 0.5 | GO:0043194 | axon initial segment(GO:0043194) |
0.1 | 0.5 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.1 | 2.1 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 1.3 | GO:0022624 | proteasome accessory complex(GO:0022624) |
0.1 | 0.5 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.1 | 0.5 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.1 | 0.6 | GO:0042555 | MCM complex(GO:0042555) |
0.1 | 8.6 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.1 | 0.4 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 0.3 | GO:0016589 | NURF complex(GO:0016589) |
0.1 | 0.2 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 0.4 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.5 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 1.5 | GO:0030175 | filopodium(GO:0030175) |
0.0 | 0.3 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.0 | 0.4 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 0.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.6 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 1.8 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.1 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.0 | 0.3 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.2 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.3 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.3 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.0 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.0 | 0.2 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 3.9 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.3 | GO:0033263 | CORVET complex(GO:0033263) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.2 | GO:0016012 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
0.0 | 2.3 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.2 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.0 | 0.4 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.7 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.4 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.5 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.1 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.0 | 0.4 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.0 | 0.2 | GO:0043203 | axon hillock(GO:0043203) |
0.0 | 0.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.0 | 0.1 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.3 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 0.3 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.0 | 0.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.1 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.0 | 0.2 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 1.4 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.0 | 1.9 | GO:0016363 | nuclear matrix(GO:0016363) |
0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 1.3 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 0.6 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.2 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 0.1 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.3 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.1 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.0 | 0.4 | GO:0044215 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
0.0 | 2.6 | GO:0030427 | site of polarized growth(GO:0030427) |
0.0 | 0.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.0 | 0.0 | GO:0044308 | axonal spine(GO:0044308) |
0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.2 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.2 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.1 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.0 | 0.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
0.0 | 0.2 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 0.3 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.1 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.0 | 0.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.4 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 2.0 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.0 | 0.1 | GO:0008278 | cohesin complex(GO:0008278) |
0.0 | 1.2 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.0 | 0.1 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 0.2 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.0 | 0.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.7 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.0 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.1 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.2 | GO:0000800 | lateral element(GO:0000800) |
0.0 | 0.3 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.6 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.1 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.1 | GO:0001939 | female pronucleus(GO:0001939) |
0.0 | 0.5 | GO:0043195 | terminal bouton(GO:0043195) |
0.0 | 0.0 | GO:0097441 | basilar dendrite(GO:0097441) |
0.0 | 0.3 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.5 | GO:0005844 | polysome(GO:0005844) |
0.0 | 0.0 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.0 | 0.4 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.2 | GO:0044453 | nuclear membrane part(GO:0044453) |
0.0 | 0.2 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.0 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.0 | GO:0005767 | secondary lysosome(GO:0005767) |
0.0 | 0.0 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 0.2 | GO:0030894 | replisome(GO:0030894) |
0.0 | 0.0 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.0 | 0.0 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.0 | 0.0 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.1 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.1 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.7 | GO:0031301 | integral component of organelle membrane(GO:0031301) |
0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.0 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.1 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.0 | 0.5 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.0 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.0 | 0.1 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 1.1 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.2 | 6.5 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
1.0 | 2.9 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.9 | 4.4 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.6 | 1.9 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.6 | 3.2 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.6 | 3.5 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.6 | 2.4 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.5 | 3.2 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.5 | 2.9 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.5 | 1.4 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.4 | 3.3 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.4 | 1.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.3 | 0.9 | GO:0034927 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.3 | 1.6 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.3 | 0.9 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.3 | 0.8 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.3 | 0.8 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.3 | 0.5 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.3 | 1.3 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.2 | 4.7 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.2 | 3.1 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.2 | 2.0 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.2 | 0.8 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.2 | 1.0 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.2 | 0.9 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.2 | 0.5 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.2 | 1.2 | GO:0043495 | protein anchor(GO:0043495) |
0.2 | 0.7 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.2 | 1.0 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.2 | 1.3 | GO:0050542 | icosanoid binding(GO:0050542) arachidonic acid binding(GO:0050544) fatty acid derivative binding(GO:1901567) |
0.2 | 0.8 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.2 | 1.0 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.2 | 1.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.2 | 4.0 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.2 | 0.5 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.2 | 0.6 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.2 | 1.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.1 | 0.6 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 0.5 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 0.8 | GO:0005499 | vitamin D binding(GO:0005499) |
0.1 | 0.6 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 0.5 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 1.4 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.4 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.1 | 0.4 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.1 | 0.5 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.1 | 0.1 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.1 | 0.8 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.1 | 0.4 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.4 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 0.5 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 0.3 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.1 | 1.4 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.1 | 0.8 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.1 | 0.3 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.6 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.1 | 4.3 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.1 | 0.9 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.1 | 0.6 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 2.3 | GO:0052714 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.1 | 0.4 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 0.2 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.4 | GO:0015232 | heme transporter activity(GO:0015232) |
0.1 | 0.3 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.1 | 0.4 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 0.9 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 0.4 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.1 | 0.5 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.1 | 3.2 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.1 | 0.4 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 2.1 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 0.5 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.1 | 1.9 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.1 | 0.3 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.1 | 0.2 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.1 | 0.3 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.4 | GO:0043559 | insulin binding(GO:0043559) |
0.1 | 0.2 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.8 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.1 | 1.5 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.1 | 1.8 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.1 | 1.7 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.1 | 0.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.4 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.1 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
0.1 | 0.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.1 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 0.4 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.2 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.1 | 0.7 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 0.3 | GO:0031720 | haptoglobin binding(GO:0031720) |
0.1 | 0.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.9 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 0.9 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.1 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.1 | 0.4 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 0.3 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.1 | 0.5 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.1 | 2.3 | GO:0019894 | kinesin binding(GO:0019894) |
0.1 | 1.1 | GO:0031489 | myosin V binding(GO:0031489) |
0.1 | 0.3 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.1 | 1.6 | GO:0030507 | spectrin binding(GO:0030507) |
0.1 | 1.8 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.1 | 0.7 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.1 | 0.2 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.3 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.1 | 0.9 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 0.5 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.1 | 0.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.1 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.1 | 0.2 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.1 | 0.2 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.1 | 0.2 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.1 | 0.5 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 0.4 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.1 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 0.3 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.1 | 0.4 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.1 | 0.7 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.5 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.0 | 0.1 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.0 | 0.1 | GO:0048045 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.0 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 1.0 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.0 | 0.2 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.0 | 1.5 | GO:0017022 | myosin binding(GO:0017022) |
0.0 | 0.3 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.0 | 0.2 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.2 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.0 | 3.2 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
0.0 | 0.3 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.0 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.0 | 0.6 | GO:0032183 | SUMO binding(GO:0032183) |
0.0 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 3.2 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
0.0 | 0.5 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 0.2 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.0 | 0.6 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.2 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.0 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.0 | 1.1 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.2 | GO:0052723 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.0 | 0.6 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 1.0 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.3 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.0 | 0.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 0.1 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.0 | 1.1 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
0.0 | 0.2 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.0 | 0.5 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.0 | 0.1 | GO:0035939 | microsatellite binding(GO:0035939) |
0.0 | 0.1 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.0 | 0.6 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.9 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.0 | 0.1 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.0 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.8 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.0 | 0.3 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.1 | GO:0001030 | RNA polymerase III regulatory region DNA binding(GO:0001016) RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.0 | 0.5 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
0.0 | 0.2 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.3 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 0.2 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.4 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.0 | 0.1 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.4 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.2 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.4 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.0 | 0.9 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.0 | GO:0016769 | transferase activity, transferring nitrogenous groups(GO:0016769) |
0.0 | 0.3 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.5 | GO:0008373 | sialyltransferase activity(GO:0008373) |
0.0 | 0.0 | GO:0030580 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
0.0 | 0.2 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.3 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.7 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.0 | 0.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.0 | 0.1 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.0 | 0.4 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 0.7 | GO:0043738 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
0.0 | 5.1 | GO:0015631 | tubulin binding(GO:0015631) |
0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.1 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.4 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.0 | 0.0 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
0.0 | 0.2 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.0 | 0.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.0 | 1.1 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 1.0 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
0.0 | 0.1 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.0 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.1 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.0 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.0 | 0.1 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
0.0 | 0.4 | GO:0051393 | alpha-actinin binding(GO:0051393) |
0.0 | 0.0 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.0 | 0.7 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.0 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.1 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.5 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.0 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
0.0 | 0.1 | GO:0015185 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.0 | 0.0 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.3 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.3 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.0 | 0.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.0 | 2.2 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.2 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.1 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.0 | 0.0 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.0 | 0.1 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.1 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.0 | 1.2 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
0.0 | 0.1 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.0 | 0.1 | GO:0015265 | urea channel activity(GO:0015265) |
0.0 | 0.1 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.0 | 0.0 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.1 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.4 | GO:0005504 | fatty acid binding(GO:0005504) |
0.0 | 0.1 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.0 | 0.0 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 0.1 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.0 | 0.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.5 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.0 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 0.0 | GO:0051870 | methotrexate binding(GO:0051870) |
0.0 | 0.1 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
0.0 | 0.1 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 0.1 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.0 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.0 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
0.0 | 0.1 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.0 | 0.1 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.0 | 0.3 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.3 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.3 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.0 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.0 | 0.3 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
0.0 | 0.3 | GO:0045309 | protein phosphorylated amino acid binding(GO:0045309) |
0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.0 | 0.0 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.0 | 0.0 | GO:0046915 | transition metal ion transmembrane transporter activity(GO:0046915) |
0.0 | 0.2 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.5 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.0 | 0.0 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.0 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.0 | 0.1 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.0 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.0 | 0.0 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.0 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.0 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 0.0 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.2 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.0 | 0.0 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.0 | 0.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.1 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.0 | 0.2 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.0 | 0.0 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.0 | 0.0 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.0 | 0.1 | GO:0017099 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.0 | 0.0 | GO:0030345 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
0.0 | 0.0 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.0 | 1.9 | GO:0003729 | mRNA binding(GO:0003729) |
0.0 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 1.1 | GO:0002020 | protease binding(GO:0002020) |
0.0 | 0.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.0 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.0 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.1 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.0 | 0.2 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.0 | 0.4 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.3 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.2 | GO:0031402 | sodium ion binding(GO:0031402) |
0.0 | 0.0 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.0 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.0 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.1 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.1 | GO:0016595 | glutamate binding(GO:0016595) |
0.0 | 0.3 | GO:0004521 | endoribonuclease activity(GO:0004521) |
0.0 | 0.0 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 0.0 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.0 | 0.1 | GO:0051378 | serotonin binding(GO:0051378) |
0.0 | 0.0 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.0 | 0.3 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.0 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.8 | GO:0016273 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
0.0 | 0.2 | GO:0052635 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.0 | 0.0 | GO:0004952 | dopamine neurotransmitter receptor activity(GO:0004952) |
0.0 | 0.1 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.0 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.0 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.4 | GO:0008907 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.0 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.1 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.1 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.1 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.0 | 0.0 | GO:0003680 | AT DNA binding(GO:0003680) |
0.0 | 0.0 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 3.6 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 6.1 | PID LKB1 PATHWAY | LKB1 signaling events |
0.1 | 5.1 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.1 | 0.8 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.1 | 2.6 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 0.9 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 2.9 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.1 | 1.5 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.1 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 0.6 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 0.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.7 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 0.9 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.6 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.5 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.6 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.1 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.0 | 1.7 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 1.5 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.6 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.3 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.6 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.8 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.9 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.8 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.1 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.0 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.5 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.1 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.3 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.5 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.2 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.2 | PID INSULIN PATHWAY | Insulin Pathway |
0.0 | 0.0 | PID IGF1 PATHWAY | IGF1 pathway |
0.0 | 0.0 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.0 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.4 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.1 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 2.8 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.3 | 3.5 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.3 | 5.1 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.2 | 2.7 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.2 | 4.3 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.2 | 4.1 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.2 | 4.0 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 1.1 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 0.5 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.1 | 1.7 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 1.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 2.1 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 2.3 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.1 | 0.8 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 0.1 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
0.1 | 1.2 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.1 | 3.5 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 1.2 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.1 | 0.1 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.1 | 0.8 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.1 | 0.9 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 1.6 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.1 | 0.1 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.1 | 1.0 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 1.2 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.1 | 1.3 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 1.6 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.1 | 0.9 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 0.1 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.1 | 0.8 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 0.9 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 0.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.1 | 0.1 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.1 | 0.7 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 0.2 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.1 | 0.1 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.1 | 0.8 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 0.6 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 1.0 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 1.2 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.6 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.1 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.7 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
0.0 | 0.6 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.4 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.0 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.0 | 0.9 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
0.0 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 0.3 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.0 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 1.4 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.0 | 0.4 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.5 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.0 | 1.4 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.0 | 0.8 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 0.6 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.0 | 0.4 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.5 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 0.6 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 0.7 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.3 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.6 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.3 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.1 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.1 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
0.0 | 0.0 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.3 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.8 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 0.4 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 0.4 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.3 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.0 | 0.4 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.0 | 0.0 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
0.0 | 0.2 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 0.6 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.5 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.5 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.0 | 0.1 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.0 | 0.3 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.4 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.4 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.0 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.3 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.0 | 0.2 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.2 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.3 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
0.0 | 0.1 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.1 | REACTOME PI3K EVENTS IN ERBB4 SIGNALING | Genes involved in PI3K events in ERBB4 signaling |
0.0 | 0.0 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.1 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.6 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.0 | 0.2 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.0 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 0.1 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.0 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 1.7 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
0.0 | 0.0 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 0.4 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.1 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.0 | 0.0 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 0.1 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
0.0 | 0.0 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.3 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |