| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Pax5
|
ENSMUSG00000014030.9 | paired box 5 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr4_44634266_44634436 | Pax5 | 11372 | 0.154385 | 0.38 | 3.0e-03 | Click! |
| chr4_44709615_44709766 | Pax5 | 718 | 0.601904 | 0.34 | 8.8e-03 | Click! |
| chr4_44706079_44706299 | Pax5 | 2183 | 0.229661 | 0.33 | 9.6e-03 | Click! |
| chr4_44706395_44706546 | Pax5 | 2464 | 0.212356 | 0.32 | 1.3e-02 | Click! |
| chr4_44633883_44634171 | Pax5 | 11696 | 0.153961 | 0.30 | 2.1e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr11_102360845_102363484 | 5.01 |
Slc4a1 |
solute carrier family 4 (anion exchanger), member 1 |
1540 |
0.24 |
| chr15_99137781_99138230 | 3.71 |
Gm25183 |
predicted gene, 25183 |
4833 |
0.12 |
| chr11_78071874_78072441 | 3.08 |
Mir144 |
microRNA 144 |
848 |
0.26 |
| chr5_114969022_114970855 | 2.84 |
Hnf1aos1 |
HNF1 homeobox A, opposite strand 1 |
18 |
0.91 |
| chr10_80487858_80488400 | 2.80 |
Onecut3 |
one cut domain, family member 3 |
6706 |
0.1 |
| chr9_106356476_106357185 | 2.62 |
Dusp7 |
dual specificity phosphatase 7 |
11802 |
0.12 |
| chr11_102145120_102148094 | 2.43 |
Nags |
N-acetylglutamate synthase |
241 |
0.58 |
| chr6_143832506_143833713 | 2.30 |
Sox5 |
SRY (sex determining region Y)-box 5 |
113979 |
0.06 |
| chr11_4573644_4574075 | 2.25 |
Gm11960 |
predicted gene 11960 |
10227 |
0.16 |
| chr17_84180639_84182724 | 2.24 |
Gm36279 |
predicted gene, 36279 |
4075 |
0.18 |
| chr19_10015065_10016667 | 2.17 |
Rab3il1 |
RAB3A interacting protein (rabin3)-like 1 |
822 |
0.48 |
| chr14_75178051_75179727 | 2.15 |
Lcp1 |
lymphocyte cytosolic protein 1 |
2681 |
0.23 |
| chr4_154635108_154637998 | 2.13 |
Prdm16 |
PR domain containing 16 |
244 |
0.83 |
| chr7_19022230_19023942 | 2.11 |
Foxa3 |
forkhead box A3 |
452 |
0.57 |
| chr11_4573041_4573459 | 2.10 |
Gm11960 |
predicted gene 11960 |
9618 |
0.16 |
| chr4_63152318_63152930 | 2.05 |
Ambp |
alpha 1 microglobulin/bikunin precursor |
1549 |
0.36 |
| chr5_147304305_147307985 | 1.98 |
Cdx2 |
caudal type homeobox 2 |
1125 |
0.33 |
| chr7_45523041_45524800 | 1.96 |
Ppp1r15a |
protein phosphatase 1, regulatory subunit 15A |
151 |
0.85 |
| chr12_78904719_78905643 | 1.95 |
Plek2 |
pleckstrin 2 |
1783 |
0.34 |
| chr2_127369985_127371247 | 1.94 |
Adra2b |
adrenergic receptor, alpha 2b |
7330 |
0.15 |
| chr2_9882196_9886301 | 1.92 |
9230102O04Rik |
RIKEN cDNA 9230102O04 gene |
255 |
0.84 |
| chr12_103863075_103863579 | 1.90 |
Serpina1a |
serine (or cysteine) peptidase inhibitor, clade A, member 1A |
224 |
0.87 |
| chr11_75450553_75451558 | 1.88 |
Wdr81 |
WD repeat domain 81 |
28 |
0.94 |
| chr4_154926952_154928851 | 1.87 |
Tnfrsf14 |
tumor necrosis factor receptor superfamily, member 14 (herpesvirus entry mediator) |
176 |
0.92 |
| chr4_128789802_128790420 | 1.83 |
Zfp362 |
zinc finger protein 362 |
19 |
0.98 |
| chr17_35045614_35047458 | 1.82 |
Msh5 |
mutS homolog 5 |
6 |
0.9 |
| chr9_64084354_64085640 | 1.79 |
Scarletltr |
Scarletltr, erythroid developmental long intergenic non-protein coding transcript |
4236 |
0.14 |
| chr2_173024069_173026002 | 1.72 |
Rbm38 |
RNA binding motif protein 38 |
1985 |
0.21 |
| chr8_80867565_80868184 | 1.71 |
Gm31105 |
predicted gene, 31105 |
12066 |
0.18 |
| chr9_107975554_107976970 | 1.69 |
Uba7 |
ubiquitin-like modifier activating enzyme 7 |
46 |
0.91 |
| chr5_137570868_137571950 | 1.67 |
Tfr2 |
transferrin receptor 2 |
42 |
0.93 |
| chr17_57233273_57233586 | 1.67 |
C3 |
complement component 3 |
5293 |
0.12 |
| chr8_71702224_71703093 | 1.63 |
B3gnt3 |
UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 3 |
869 |
0.35 |
| chr12_83486061_83487699 | 1.62 |
Dpf3 |
D4, zinc and double PHD fingers, family 3 |
828 |
0.6 |
| chr10_86023427_86024178 | 1.61 |
A230060F14Rik |
RIKEN cDNA A230060F14 gene |
1473 |
0.24 |
| chr6_135167030_135167215 | 1.58 |
Hebp1 |
heme binding protein 1 |
1013 |
0.38 |
| chrX_101377313_101377922 | 1.57 |
Gjb1 |
gap junction protein, beta 1 |
344 |
0.84 |
| chr3_95172192_95174377 | 1.55 |
Sema6c |
sema domain, transmembrane domain (TM), and cytoplasmic domain, (semaphorin) 6C |
2479 |
0.12 |
| chr3_89139460_89139679 | 1.53 |
Pklr |
pyruvate kinase liver and red blood cell |
2946 |
0.1 |
| chr6_90988951_90989175 | 1.52 |
Iqsec1 |
IQ motif and Sec7 domain 1 |
378 |
0.87 |
| chr1_74949307_74952042 | 1.50 |
Ihh |
Indian hedgehog |
768 |
0.5 |
| chr13_107019530_107020448 | 1.50 |
Kif2a |
kinesin family member 2A |
2038 |
0.22 |
| chr9_64806162_64806616 | 1.49 |
Dennd4a |
DENN/MADD domain containing 4A |
4951 |
0.23 |
| chr2_146098737_146098949 | 1.46 |
Cfap61 |
cilia and flagella associated protein 61 |
51592 |
0.15 |
| chr4_62515031_62515361 | 1.45 |
Alad |
aminolevulinate, delta-, dehydratase |
4685 |
0.12 |
| chr2_30547312_30548173 | 1.44 |
Gm14487 |
predicted gene 14487 |
13013 |
0.16 |
| chr4_62515406_62516411 | 1.41 |
Alad |
aminolevulinate, delta-, dehydratase |
3973 |
0.13 |
| chr1_91544021_91544496 | 1.41 |
Asb1 |
ankyrin repeat and SOCS box-containing 1 |
3178 |
0.2 |
| chr16_18429039_18430122 | 1.40 |
Txnrd2 |
thioredoxin reductase 2 |
655 |
0.54 |
| chr1_90775497_90776005 | 1.40 |
Col6a3 |
collagen, type VI, alpha 3 |
2536 |
0.32 |
| chr3_84269309_84270900 | 1.39 |
Trim2 |
tripartite motif-containing 2 |
687 |
0.77 |
| chr19_55126480_55127385 | 1.38 |
Gpam |
glycerol-3-phosphate acyltransferase, mitochondrial |
271 |
0.92 |
| chr6_31612888_31614126 | 1.37 |
Gm43154 |
predicted gene 43154 |
8218 |
0.19 |
| chr12_33317702_33317935 | 1.35 |
Atxn7l1 |
ataxin 7-like 1 |
2413 |
0.31 |
| chr5_119669544_119672401 | 1.35 |
Tbx3 |
T-box 3 |
46 |
0.85 |
| chr4_46401911_46402304 | 1.34 |
Hemgn |
hemogen |
2129 |
0.22 |
| chr19_53258792_53259696 | 1.32 |
1700001K23Rik |
RIKEN cDNA 1700001K23 gene |
4024 |
0.18 |
| chr1_131275635_131276472 | 1.31 |
Ikbke |
inhibitor of kappaB kinase epsilon |
660 |
0.58 |
| chr16_38294375_38294815 | 1.31 |
Nr1i2 |
nuclear receptor subfamily 1, group I, member 2 |
229 |
0.9 |
| chr11_69915606_69917001 | 1.28 |
Gps2 |
G protein pathway suppressor 2 |
262 |
0.72 |
| chr17_56611646_56612754 | 1.28 |
Rpl36 |
ribosomal protein L36 |
1216 |
0.28 |
| chr7_100492685_100494805 | 1.27 |
Ucp2 |
uncoupling protein 2 (mitochondrial, proton carrier) |
50 |
0.95 |
| chr8_84971307_84971830 | 1.26 |
Prdx2 |
peroxiredoxin 2 |
112 |
0.87 |
| chr5_137290070_137291279 | 1.24 |
Ache |
acetylcholinesterase |
1427 |
0.17 |
| chr17_36869615_36870619 | 1.24 |
Trim10 |
tripartite motif-containing 10 |
543 |
0.55 |
| chr10_80367271_80367422 | 1.23 |
Gm15123 |
predicted gene 15123 |
4552 |
0.07 |
| chr17_48300015_48301474 | 1.23 |
Treml2 |
triggering receptor expressed on myeloid cells-like 2 |
358 |
0.8 |
| chr16_45952627_45953612 | 1.22 |
Phldb2 |
pleckstrin homology like domain, family B, member 2 |
374 |
0.84 |
| chr7_100860786_100861064 | 1.22 |
Relt |
RELT tumor necrosis factor receptor |
2233 |
0.23 |
| chr15_103250315_103251530 | 1.21 |
Nfe2 |
nuclear factor, erythroid derived 2 |
543 |
0.62 |
| chr2_26138540_26139205 | 1.21 |
Tmem250-ps |
transmembrane protein 250, pseudogene |
70 |
0.8 |
| chr10_79897288_79897960 | 1.20 |
Med16 |
mediator complex subunit 16 |
2061 |
0.1 |
| chr12_32060123_32061616 | 1.20 |
Prkar2b |
protein kinase, cAMP dependent regulatory, type II beta |
280 |
0.91 |
| chr1_132387629_132389330 | 1.19 |
Tmcc2 |
transmembrane and coiled-coil domains 2 |
1839 |
0.25 |
| chr12_4872157_4872308 | 1.19 |
Mfsd2b |
major facilitator superfamily domain containing 2B |
2113 |
0.21 |
| chr2_163549842_163550031 | 1.19 |
Hnf4a |
hepatic nuclear factor 4, alpha |
147 |
0.94 |
| chr8_105823481_105824055 | 1.18 |
Ranbp10 |
RAN binding protein 10 |
3437 |
0.11 |
| chrX_12005788_12007643 | 1.18 |
Gm14512 |
predicted gene 14512 |
22247 |
0.22 |
| chr6_29695942_29696399 | 1.18 |
Tspan33 |
tetraspanin 33 |
1936 |
0.31 |
| chr17_85485071_85487191 | 1.18 |
Rpl31-ps16 |
ribosomal protein L31, pseudogene 16 |
12502 |
0.23 |
| chr6_83068298_83071797 | 1.17 |
Tlx2 |
T cell leukemia, homeobox 2 |
178 |
0.81 |
| chr17_87208796_87208947 | 1.17 |
C330024C12Rik |
RIKEN cDNA C330024C12 gene |
13929 |
0.15 |
| chr12_110976380_110976989 | 1.16 |
Ankrd9 |
ankyrin repeat domain 9 |
1571 |
0.26 |
| chr8_119439982_119440335 | 1.16 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
2969 |
0.2 |
| chr15_103013757_103015908 | 1.16 |
Mir615 |
microRNA 615 |
78 |
0.91 |
| chr17_57233601_57234302 | 1.15 |
C3 |
complement component 3 |
5815 |
0.11 |
| chr11_116549205_116550438 | 1.15 |
Gm11742 |
predicted gene 11742 |
597 |
0.47 |
| chr1_130740681_130741391 | 1.14 |
Gm28857 |
predicted gene 28857 |
291 |
0.71 |
| chrX_12001809_12002609 | 1.14 |
Gm14512 |
predicted gene 14512 |
17741 |
0.23 |
| chr5_115947488_115948141 | 1.14 |
Cit |
citron |
2517 |
0.25 |
| chr5_137485098_137486372 | 1.14 |
Epo |
erythropoietin |
81 |
0.93 |
| chr12_103737616_103738118 | 1.14 |
Serpina1b |
serine (or cysteine) preptidase inhibitor, clade A, member 1B |
291 |
0.83 |
| chr4_119124500_119124990 | 1.13 |
Mir1957a |
microRNA 1957a |
5034 |
0.11 |
| chr8_123980583_123981049 | 1.13 |
Abcb10 |
ATP-binding cassette, sub-family B (MDR/TAP), member 10 |
2306 |
0.17 |
| chr2_33629896_33632414 | 1.12 |
Lmx1b |
LIM homeobox transcription factor 1 beta |
1128 |
0.43 |
| chr4_135727528_135728972 | 1.12 |
Il22ra1 |
interleukin 22 receptor, alpha 1 |
78 |
0.96 |
| chr10_77210976_77211783 | 1.12 |
Col18a1 |
collagen, type XVIII, alpha 1 |
44831 |
0.11 |
| chr13_60479224_60481361 | 1.11 |
Gm48500 |
predicted gene, 48500 |
1006 |
0.51 |
| chr6_34874317_34875662 | 1.11 |
Cyren |
cell cycle regulator of NHEJ |
1991 |
0.2 |
| chr8_120291813_120292018 | 1.11 |
Gse1 |
genetic suppressor element 1, coiled-coil protein |
63459 |
0.09 |
| chr2_155990244_155990644 | 1.11 |
Cep250 |
centrosomal protein 250 |
4529 |
0.12 |
| chr11_75438634_75439472 | 1.11 |
Serpinf2 |
serine (or cysteine) peptidase inhibitor, clade F, member 2 |
153 |
0.89 |
| chr11_96946068_96946479 | 1.11 |
D030028A08Rik |
RIKEN cDNA D030028A08 gene |
1961 |
0.15 |
| chr8_23039541_23040180 | 1.10 |
Ank1 |
ankyrin 1, erythroid |
4629 |
0.21 |
| chr18_21152486_21153141 | 1.10 |
Gm6378 |
predicted pseudogene 6378 |
75704 |
0.09 |
| chr11_96948253_96948423 | 1.09 |
D030028A08Rik |
RIKEN cDNA D030028A08 gene |
4026 |
0.1 |
| chr11_85803390_85804226 | 1.09 |
2610027K06Rik |
RIKEN cDNA 2610027K06 gene |
347 |
0.79 |
| chr6_52174920_52176658 | 1.09 |
Hoxaas3 |
Hoxa cluster antisense RNA 3 |
554 |
0.41 |
| chr7_132771931_132772484 | 1.09 |
Fam53b |
family with sequence similarity 53, member B |
4709 |
0.23 |
| chr12_84150828_84152588 | 1.08 |
Pnma1 |
paraneoplastic antigen MA1 |
3219 |
0.13 |
| chr11_102895188_102895912 | 1.07 |
Gfap |
glial fibrillary acidic protein |
1581 |
0.23 |
| chr12_111028723_111029009 | 1.07 |
Gm48631 |
predicted gene, 48631 |
10464 |
0.12 |
| chr1_171279909_171280107 | 1.07 |
Ppox |
protoporphyrinogen oxidase |
181 |
0.84 |
| chr6_38352677_38353101 | 1.07 |
Zc3hav1 |
zinc finger CCCH type, antiviral 1 |
1384 |
0.32 |
| chr11_102364387_102365146 | 1.07 |
Slc4a1 |
solute carrier family 4 (anion exchanger), member 1 |
481 |
0.67 |
| chr2_174283563_174287177 | 1.07 |
Gnas |
GNAS (guanine nucleotide binding protein, alpha stimulating) complex locus |
12 |
0.53 |
| chrX_103479028_103479792 | 1.06 |
Xist |
inactive X specific transcripts |
3844 |
0.1 |
| chr8_70630745_70631808 | 1.06 |
Gdf15 |
growth differentiation factor 15 |
819 |
0.39 |
| chr6_90989200_90989476 | 1.06 |
Iqsec1 |
IQ motif and Sec7 domain 1 |
653 |
0.72 |
| chr12_103827485_103827986 | 1.06 |
Serpina1b |
serine (or cysteine) preptidase inhibitor, clade A, member 1B |
2638 |
0.15 |
| chr2_163548522_163549154 | 1.05 |
Hnf4a |
hepatic nuclear factor 4, alpha |
1245 |
0.35 |
| chr19_6299419_6300583 | 1.05 |
Ehd1 |
EH-domain containing 1 |
2087 |
0.13 |
| chr7_115844628_115845173 | 1.05 |
Sox6 |
SRY (sex determining region Y)-box 6 |
1205 |
0.62 |
| chr19_7294483_7295524 | 1.05 |
Mark2 |
MAP/microtubule affinity regulating kinase 2 |
444 |
0.7 |
| chr2_105675959_105678109 | 1.05 |
Pax6 |
paired box 6 |
905 |
0.54 |
| chr16_4552537_4553851 | 1.05 |
Tfap4 |
transcription factor AP4 |
232 |
0.9 |
| chr11_116076531_116078496 | 1.05 |
Unc13d |
unc-13 homolog D |
77 |
0.94 |
| chr5_86906001_86906546 | 1.04 |
Ugt2b34 |
UDP glucuronosyltransferase 2 family, polypeptide B34 |
664 |
0.55 |
| chr4_57914999_57916744 | 1.04 |
D630039A03Rik |
RIKEN cDNA D630039A03 gene |
426 |
0.84 |
| chr4_46403560_46404035 | 1.04 |
Hemgn |
hemogen |
439 |
0.76 |
| chr4_142047694_142048400 | 1.04 |
Gm13053 |
predicted gene 13053 |
531 |
0.7 |
| chr8_94985246_94986199 | 1.04 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
154 |
0.93 |
| chr10_42537420_42537724 | 1.04 |
Nr2e1 |
nuclear receptor subfamily 2, group E, member 1 |
31256 |
0.14 |
| chr19_16875307_16877159 | 1.03 |
Foxb2 |
forkhead box B2 |
2428 |
0.3 |
| chr2_18940582_18941283 | 1.03 |
Pip4k2a |
phosphatidylinositol-5-phosphate 4-kinase, type II, alpha |
34658 |
0.18 |
| chr12_103773135_103773583 | 1.03 |
Serpina1d |
serine (or cysteine) peptidase inhibitor, clade A, member 1D |
233 |
0.87 |
| chr1_190463600_190464002 | 1.03 |
Gm30725 |
predicted gene, 30725 |
18946 |
0.19 |
| chr9_108104524_108105208 | 1.03 |
Gm47303 |
predicted gene, 47303 |
1620 |
0.16 |
| chr9_108105212_108105676 | 1.02 |
Gm47303 |
predicted gene, 47303 |
2198 |
0.12 |
| chr15_80623544_80623972 | 1.02 |
Grap2 |
GRB2-related adaptor protein 2 |
236 |
0.9 |
| chr15_99029361_99031026 | 1.02 |
Tuba1c |
tubulin, alpha 1C |
128 |
0.92 |
| chr7_102103075_102103226 | 1.02 |
Art5 |
ADP-ribosyltransferase 5 |
305 |
0.77 |
| chr4_137751261_137751442 | 1.02 |
Alpl |
alkaline phosphatase, liver/bone/kidney |
4204 |
0.21 |
| chr7_27450272_27450472 | 1.02 |
Blvrb |
biliverdin reductase B (flavin reductase (NADPH)) |
2046 |
0.16 |
| chrX_9274237_9274969 | 1.01 |
Xk |
X-linked Kx blood group |
1847 |
0.24 |
| chr13_75709278_75709841 | 1.01 |
Ell2 |
elongation factor RNA polymerase II 2 |
1848 |
0.23 |
| chr7_80203517_80204120 | 1.01 |
Sema4b |
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4B |
5282 |
0.11 |
| chr2_30064389_30064949 | 1.00 |
Set |
SET nuclear oncogene |
1787 |
0.21 |
| chr4_154024246_154024397 | 1.00 |
Smim1 |
small integral membrane protein 1 |
2 |
0.95 |
| chr10_70598201_70600143 | 0.99 |
Phyhipl |
phytanoyl-CoA hydroxylase interacting protein-like |
90 |
0.98 |
| chr4_53143397_53144061 | 0.99 |
Abca1 |
ATP-binding cassette, sub-family A (ABC1), member 1 |
16166 |
0.21 |
| chr7_44350602_44354420 | 0.99 |
Shank1 |
SH3 and multiple ankyrin repeat domains 1 |
1749 |
0.15 |
| chr6_72388069_72388633 | 0.99 |
Vamp8 |
vesicle-associated membrane protein 8 |
1560 |
0.22 |
| chr4_152128919_152130064 | 0.99 |
Espn |
espin |
566 |
0.63 |
| chr6_135165211_135165571 | 0.99 |
Hebp1 |
heme binding protein 1 |
2744 |
0.16 |
| chr11_32283214_32283432 | 0.98 |
Hba-a1 |
hemoglobin alpha, adult chain 1 |
188 |
0.89 |
| chr2_148043571_148045987 | 0.98 |
Foxa2 |
forkhead box A2 |
685 |
0.65 |
| chr5_122018591_122019443 | 0.97 |
Gm3970 |
predicted gene 3970 |
6313 |
0.16 |
| chr1_165765873_165766425 | 0.97 |
Creg1 |
cellular repressor of E1A-stimulated genes 1 |
2403 |
0.15 |
| chr7_79841260_79842229 | 0.97 |
Anpep |
alanyl (membrane) aminopeptidase |
608 |
0.6 |
| chr7_5029343_5032174 | 0.97 |
Zfp865 |
zinc finger protein 865 |
1434 |
0.15 |
| chr4_135061186_135061431 | 0.97 |
Gm16225 |
predicted gene 16225 |
59139 |
0.1 |
| chr8_83428906_83429066 | 0.96 |
Scoc |
short coiled-coil protein |
8841 |
0.14 |
| chr5_143509158_143510231 | 0.96 |
Rac1 |
Rac family small GTPase 1 |
7914 |
0.12 |
| chr13_107065516_107065770 | 0.96 |
Gm31452 |
predicted gene, 31452 |
1948 |
0.3 |
| chr15_100666130_100666758 | 0.96 |
Bin2 |
bridging integrator 2 |
3061 |
0.13 |
| chr5_113279864_113280669 | 0.96 |
Sgsm1 |
small G protein signaling modulator 1 |
321 |
0.85 |
| chr14_69499762_69500195 | 0.96 |
Gm37094 |
predicted gene, 37094 |
412 |
0.69 |
| chr4_108217222_108218259 | 0.96 |
Zyg11a |
zyg-11 family member A, cell cycle regulator |
182 |
0.94 |
| chr2_155992156_155992465 | 0.96 |
Cep250 |
centrosomal protein 250 |
6395 |
0.11 |
| chr14_69281512_69281946 | 0.95 |
Gm20236 |
predicted gene, 20236 |
411 |
0.68 |
| chr10_59875062_59875405 | 0.95 |
Gm7413 |
predicted gene 7413 |
3551 |
0.18 |
| chr6_136854322_136855143 | 0.95 |
Art4 |
ADP-ribosyltransferase 4 |
3001 |
0.12 |
| chr18_62174392_62175675 | 0.95 |
Adrb2 |
adrenergic receptor, beta 2 |
4926 |
0.21 |
| chr8_120537063_120538443 | 0.95 |
1700016A09Rik |
RIKEN cDNA 1700016A09 gene |
27 |
0.8 |
| chr18_37821959_37823152 | 0.95 |
Gm38182 |
predicted gene, 38182 |
1324 |
0.18 |
| chr12_103956429_103956881 | 0.94 |
Serpina1e |
serine (or cysteine) peptidase inhibitor, clade A, member 1E |
243 |
0.87 |
| chr3_88364024_88365387 | 0.94 |
Paqr6 |
progestin and adipoQ receptor family member VI |
112 |
0.89 |
| chr10_58371395_58372247 | 0.93 |
Lims1 |
LIM and senescent cell antigen-like domains 1 |
367 |
0.87 |
| chrX_134582306_134583089 | 0.93 |
Btk |
Bruton agammaglobulinemia tyrosine kinase |
224 |
0.87 |
| chr15_102188471_102188879 | 0.93 |
Csad |
cysteine sulfinic acid decarboxylase |
1 |
0.96 |
| chr17_87209373_87209524 | 0.93 |
C330024C12Rik |
RIKEN cDNA C330024C12 gene |
14506 |
0.15 |
| chr8_120294780_120295786 | 0.93 |
Gse1 |
genetic suppressor element 1, coiled-coil protein |
66827 |
0.09 |
| chr13_97778409_97778790 | 0.93 |
Gm47577 |
predicted gene, 47577 |
11965 |
0.15 |
| chr8_80495549_80496014 | 0.93 |
Gypa |
glycophorin A |
2000 |
0.38 |
| chr7_114415300_114416538 | 0.92 |
Pde3b |
phosphodiesterase 3B, cGMP-inhibited |
638 |
0.51 |
| chr12_103904702_103904898 | 0.92 |
Serpina1c |
serine (or cysteine) peptidase inhibitor, clade A, member 1C |
87 |
0.94 |
| chr1_64078361_64079271 | 0.92 |
Gm13748 |
predicted gene 13748 |
162 |
0.96 |
| chr11_98581326_98581888 | 0.92 |
Ormdl3 |
ORM1-like 3 (S. cerevisiae) |
5761 |
0.11 |
| chr3_127893429_127894301 | 0.92 |
Fam241a |
family with sequence similarity 241, member A |
2423 |
0.2 |
| chr14_69278101_69278489 | 0.91 |
Gm20236 |
predicted gene, 20236 |
3845 |
0.11 |
| chr9_69669605_69671558 | 0.91 |
Gm47203 |
predicted gene, 47203 |
70827 |
0.09 |
| chr11_75281390_75283049 | 0.91 |
Gm47300 |
predicted gene, 47300 |
36389 |
0.1 |
| chr9_108081228_108081695 | 0.91 |
Mir7088 |
microRNA 7088 |
37 |
0.9 |
| chr15_78571734_78572724 | 0.91 |
Rac2 |
Rac family small GTPase 2 |
552 |
0.62 |
| chr7_5060529_5061652 | 0.91 |
Gm45133 |
predicted gene 45133 |
959 |
0.21 |
| chr15_99717549_99718677 | 0.91 |
Gpd1 |
glycerol-3-phosphate dehydrogenase 1 (soluble) |
534 |
0.53 |
| chr7_142662290_142664788 | 0.91 |
Igf2os |
insulin-like growth factor 2, opposite strand |
1599 |
0.21 |
| chr10_76576462_76576906 | 0.91 |
Ftcd |
formiminotransferase cyclodeaminase |
1032 |
0.38 |
| chr4_123663941_123665300 | 0.91 |
Macf1 |
microtubule-actin crosslinking factor 1 |
132 |
0.92 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.8 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
| 0.6 | 1.7 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
| 0.5 | 2.2 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.5 | 1.5 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.5 | 1.5 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.5 | 2.0 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
| 0.5 | 0.5 | GO:0070627 | ferrous iron import(GO:0070627) |
| 0.4 | 1.3 | GO:0009732 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.4 | 1.3 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.4 | 2.1 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.4 | 1.2 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.4 | 2.0 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.4 | 2.7 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
| 0.4 | 1.1 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.4 | 1.5 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.4 | 1.8 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.4 | 0.7 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.4 | 1.4 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.4 | 1.1 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.4 | 1.8 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
| 0.4 | 0.7 | GO:0002894 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.4 | 1.1 | GO:1902219 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.4 | 1.8 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.4 | 0.4 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
| 0.3 | 3.3 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
| 0.3 | 1.0 | GO:0002930 | trabecular meshwork development(GO:0002930) |
| 0.3 | 1.0 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.3 | 1.0 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
| 0.3 | 1.0 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
| 0.3 | 1.0 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.3 | 0.6 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.3 | 1.9 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.3 | 0.6 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
| 0.3 | 0.9 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.3 | 1.3 | GO:0001812 | positive regulation of type I hypersensitivity(GO:0001812) |
| 0.3 | 1.6 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.3 | 1.6 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.3 | 1.2 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.3 | 1.2 | GO:0061205 | paramesonephric duct development(GO:0061205) |
| 0.3 | 1.1 | GO:2000562 | regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.3 | 0.5 | GO:0032632 | interleukin-3 production(GO:0032632) |
| 0.3 | 1.3 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.3 | 1.1 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.3 | 3.7 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
| 0.3 | 0.3 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
| 0.3 | 1.6 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.3 | 0.5 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.3 | 1.0 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.3 | 0.8 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.3 | 1.0 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
| 0.3 | 0.8 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
| 0.3 | 0.8 | GO:0006742 | NADP catabolic process(GO:0006742) |
| 0.3 | 1.0 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.3 | 0.8 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.2 | 0.5 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 0.2 | 0.7 | GO:0018992 | germ-line sex determination(GO:0018992) |
| 0.2 | 0.7 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.2 | 1.7 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
| 0.2 | 0.5 | GO:0046864 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
| 0.2 | 1.0 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.2 | 0.9 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.2 | 1.1 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.2 | 0.9 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.2 | 0.7 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.2 | 1.4 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.2 | 1.6 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.2 | 0.7 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.2 | 0.9 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.2 | 0.7 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.2 | 2.0 | GO:0045332 | phospholipid translocation(GO:0045332) |
| 0.2 | 0.7 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.2 | 1.3 | GO:0061620 | glycolytic process through glucose-6-phosphate(GO:0061620) |
| 0.2 | 4.3 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.2 | 0.4 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.2 | 0.2 | GO:0010159 | specification of organ position(GO:0010159) |
| 0.2 | 0.6 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.2 | 0.2 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) |
| 0.2 | 0.6 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.2 | 0.6 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
| 0.2 | 0.4 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.2 | 0.8 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.2 | 0.4 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
| 0.2 | 1.0 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.2 | 0.6 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
| 0.2 | 0.6 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.2 | 0.6 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.2 | 0.6 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
| 0.2 | 0.8 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.2 | 1.8 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.2 | 0.8 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.2 | 0.8 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.2 | 0.2 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.2 | 1.0 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.2 | 0.6 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.2 | 0.6 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.2 | 0.6 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.2 | 0.6 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) |
| 0.2 | 0.6 | GO:0042117 | monocyte activation(GO:0042117) |
| 0.2 | 0.6 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 0.2 | 0.9 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.2 | 0.2 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
| 0.2 | 0.5 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.2 | 0.4 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.2 | 0.7 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.2 | 0.3 | GO:0010873 | positive regulation of cholesterol esterification(GO:0010873) |
| 0.2 | 0.9 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.2 | 0.9 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 0.2 | 0.2 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
| 0.2 | 0.3 | GO:0048880 | sensory system development(GO:0048880) |
| 0.2 | 0.5 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.2 | 0.5 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.2 | 0.5 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.2 | 0.3 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.2 | 0.8 | GO:0036233 | glycine import(GO:0036233) |
| 0.2 | 0.7 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
| 0.2 | 0.7 | GO:0032776 | DNA methylation on cytosine within a CG sequence(GO:0010424) DNA methylation on cytosine(GO:0032776) |
| 0.2 | 0.2 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.2 | 0.3 | GO:0072530 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
| 0.2 | 0.3 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
| 0.2 | 1.8 | GO:0097066 | response to thyroid hormone(GO:0097066) |
| 0.2 | 1.3 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
| 0.2 | 0.6 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.2 | 0.3 | GO:0072526 | pyridine-containing compound catabolic process(GO:0072526) |
| 0.2 | 1.1 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.2 | 0.3 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 0.2 | 0.5 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.2 | 0.2 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
| 0.2 | 0.3 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
| 0.2 | 0.5 | GO:0072095 | regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 0.2 | 0.6 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.2 | 0.2 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.2 | 0.8 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.2 | 0.3 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.2 | 0.5 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.2 | 0.9 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
| 0.2 | 0.8 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.1 | 0.4 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.1 | 0.7 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.1 | 0.3 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.1 | 0.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.1 | 0.4 | GO:0000087 | mitotic M phase(GO:0000087) |
| 0.1 | 0.9 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.3 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.1 | 0.4 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.1 | 0.7 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.1 | 0.1 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
| 0.1 | 0.6 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.1 | 0.9 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.1 | 0.1 | GO:0097459 | iron ion import into cell(GO:0097459) |
| 0.1 | 0.7 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 0.1 | 0.6 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.1 | 0.6 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 | 0.3 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.1 | 0.8 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 | 0.4 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.1 | 0.6 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.1 | 0.7 | GO:0018101 | protein citrullination(GO:0018101) |
| 0.1 | 0.6 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.1 | 0.4 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.1 | 0.1 | GO:1904468 | negative regulation of tumor necrosis factor secretion(GO:1904468) |
| 0.1 | 0.3 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.1 | 1.0 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.1 | 0.4 | GO:0071224 | cellular response to peptidoglycan(GO:0071224) |
| 0.1 | 0.4 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.1 | 0.4 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 0.1 | 0.4 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 0.4 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
| 0.1 | 0.4 | GO:0097286 | iron ion import(GO:0097286) |
| 0.1 | 0.4 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 | 0.1 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.1 | 0.4 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.1 | 0.1 | GO:0015684 | ferrous iron transport(GO:0015684) |
| 0.1 | 0.3 | GO:2000739 | regulation of mesenchymal stem cell differentiation(GO:2000739) |
| 0.1 | 0.6 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 0.9 | GO:0021903 | rostrocaudal neural tube patterning(GO:0021903) |
| 0.1 | 0.3 | GO:0015793 | glycerol transport(GO:0015793) |
| 0.1 | 2.3 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 0.6 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
| 0.1 | 0.3 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.1 | 1.1 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.1 | 0.2 | GO:1901859 | negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.1 | 0.4 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.1 | 0.6 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.1 | 0.7 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.1 | 0.4 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.1 | 0.4 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
| 0.1 | 0.2 | GO:0010985 | negative regulation of lipoprotein particle clearance(GO:0010985) |
| 0.1 | 1.2 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
| 0.1 | 1.0 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 | 0.4 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.1 | 0.1 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.1 | 0.2 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.1 | 0.4 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.1 | 0.2 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.1 | 0.1 | GO:1905065 | positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.1 | 0.2 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.1 | 0.7 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.1 | 0.2 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
| 0.1 | 0.4 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.1 | 0.8 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.1 | 0.1 | GO:1904193 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.1 | 0.5 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 0.4 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
| 0.1 | 0.5 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
| 0.1 | 0.2 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.1 | 0.3 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.1 | 0.1 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.1 | 1.0 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.1 | 0.5 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 | 0.1 | GO:0070487 | monocyte aggregation(GO:0070487) |
| 0.1 | 0.2 | GO:0042435 | indole-containing compound biosynthetic process(GO:0042435) |
| 0.1 | 0.7 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 0.1 | GO:0007494 | midgut development(GO:0007494) |
| 0.1 | 0.3 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.1 | 0.1 | GO:0051195 | negative regulation of nucleotide catabolic process(GO:0030812) negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.1 | 0.8 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.1 | 2.0 | GO:0000305 | response to oxygen radical(GO:0000305) |
| 0.1 | 0.3 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
| 0.1 | 0.3 | GO:0021570 | rhombomere 4 development(GO:0021570) |
| 0.1 | 0.5 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.1 | 0.3 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.1 | 0.4 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.1 | 1.8 | GO:0032801 | receptor catabolic process(GO:0032801) |
| 0.1 | 1.2 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 | 0.2 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.1 | 0.2 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.1 | 0.3 | GO:0003096 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.1 | 0.4 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.1 | 0.1 | GO:0034136 | negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
| 0.1 | 0.1 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.1 | 0.1 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.1 | 1.0 | GO:0034383 | low-density lipoprotein particle clearance(GO:0034383) |
| 0.1 | 0.6 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.1 | 2.5 | GO:0055069 | zinc ion homeostasis(GO:0055069) |
| 0.1 | 0.5 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.1 | 0.4 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.1 | 0.9 | GO:0046606 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.1 | 1.5 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.1 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.1 | 1.8 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
| 0.1 | 0.4 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
| 0.1 | 0.6 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.1 | 0.4 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.1 | 0.6 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.1 | 0.2 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
| 0.1 | 0.3 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.1 | 0.7 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.1 | 0.4 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 | 0.4 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
| 0.1 | 0.5 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
| 0.1 | 0.2 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.1 | 0.3 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.1 | 0.2 | GO:0030910 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.1 | 0.8 | GO:0051382 | kinetochore assembly(GO:0051382) |
| 0.1 | 0.3 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 | 0.3 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.1 | 0.6 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 | 0.4 | GO:0019081 | viral translation(GO:0019081) |
| 0.1 | 0.3 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.1 | 0.6 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.1 | 0.6 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.1 | 0.2 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.1 | 0.3 | GO:0046087 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.1 | 0.4 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
| 0.1 | 0.3 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.1 | 0.8 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.1 | 0.2 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.1 | 0.4 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.1 | 0.3 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.1 | 0.2 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.1 | 0.2 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.1 | 0.3 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
| 0.1 | 0.2 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
| 0.1 | 0.6 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.1 | 0.4 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
| 0.1 | 0.3 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.1 | 0.3 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.1 | 0.6 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.1 | 0.6 | GO:1904666 | regulation of ubiquitin protein ligase activity(GO:1904666) |
| 0.1 | 0.1 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
| 0.1 | 1.0 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.1 | 0.3 | GO:0009629 | response to gravity(GO:0009629) |
| 0.1 | 0.1 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.1 | 0.5 | GO:0002441 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.1 | 0.2 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.1 | 0.2 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.1 | 0.4 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
| 0.1 | 0.6 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.1 | 0.6 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
| 0.1 | 0.3 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.1 | 1.2 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.1 | 0.4 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.1 | 0.3 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.1 | 0.4 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.1 | 0.1 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
| 0.1 | 0.3 | GO:0009189 | deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) |
| 0.1 | 0.3 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.1 | 0.6 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.1 | 0.2 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
| 0.1 | 0.9 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.1 | 0.6 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.1 | 0.5 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
| 0.1 | 0.3 | GO:0002730 | dendritic cell cytokine production(GO:0002371) regulation of dendritic cell cytokine production(GO:0002730) |
| 0.1 | 0.2 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.1 | 0.6 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.1 | 0.4 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 | 0.1 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.1 | 0.4 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.1 | 0.2 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.1 | 0.3 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
| 0.1 | 0.3 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.1 | 0.7 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.1 | 0.3 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 0.1 | 0.3 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.1 | 0.2 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.1 | 0.4 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.1 | 0.3 | GO:0048069 | eye pigmentation(GO:0048069) |
| 0.1 | 0.2 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
| 0.1 | 0.2 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.1 | 0.2 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.1 | 0.7 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.1 | 0.2 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 0.1 | 0.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.1 | 0.7 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.1 | 0.2 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.1 | 0.7 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
| 0.1 | 0.7 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.1 | 0.1 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.1 | 0.2 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.1 | 0.1 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
| 0.1 | 0.2 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.1 | 0.2 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
| 0.1 | 1.2 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
| 0.1 | 0.3 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.4 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
| 0.1 | 0.4 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.1 | 0.2 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.1 | 0.1 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.1 | 0.2 | GO:0070669 | response to interleukin-2(GO:0070669) |
| 0.1 | 0.2 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 0.1 | 0.2 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
| 0.1 | 0.5 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.1 | 0.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.1 | 0.2 | GO:0045345 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.1 | 0.1 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
| 0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 1.4 | GO:0034340 | response to type I interferon(GO:0034340) |
| 0.1 | 0.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 0.9 | GO:0048821 | erythrocyte development(GO:0048821) |
| 0.1 | 0.5 | GO:0060379 | cardiac muscle cell myoblast differentiation(GO:0060379) |
| 0.1 | 0.3 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.1 | 0.3 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.1 | 0.2 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
| 0.1 | 0.5 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.1 | 0.1 | GO:0039529 | RIG-I signaling pathway(GO:0039529) |
| 0.1 | 0.2 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.1 | 0.3 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.1 | 0.1 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.1 | 0.3 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.1 | 0.8 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.1 | 0.2 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.1 | 0.3 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.1 | 2.5 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.1 | 0.5 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 | 0.2 | GO:0061743 | motor learning(GO:0061743) |
| 0.1 | 0.2 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.1 | 0.2 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.1 | 0.6 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 | 0.2 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.1 | 0.5 | GO:0015825 | L-serine transport(GO:0015825) |
| 0.1 | 0.3 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) negative regulation of peptidyl-lysine acetylation(GO:2000757) |
| 0.1 | 0.1 | GO:0022615 | protein to membrane docking(GO:0022615) |
| 0.1 | 0.1 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.1 | 0.3 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
| 0.1 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.1 | 1.0 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.1 | 0.4 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.1 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.1 | 1.0 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
| 0.1 | 0.2 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 | 0.4 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.1 | 0.5 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.1 | 0.1 | GO:0035087 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.1 | 0.1 | GO:0043379 | memory T cell differentiation(GO:0043379) regulation of memory T cell differentiation(GO:0043380) positive regulation of memory T cell differentiation(GO:0043382) |
| 0.1 | 0.4 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.1 | 0.1 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 | 0.2 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.1 | 0.3 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
| 0.1 | 0.2 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
| 0.1 | 0.1 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
| 0.1 | 0.1 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.1 | 0.2 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 0.2 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.1 | 0.2 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.1 | 0.6 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.1 | 0.5 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.1 | 0.3 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.1 | 0.4 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.1 | 0.2 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.1 | 0.2 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.1 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
| 0.1 | 0.3 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.1 | 0.4 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.1 | 0.1 | GO:0043173 | nucleotide salvage(GO:0043173) |
| 0.1 | 0.4 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
| 0.1 | 0.2 | GO:0035483 | gastric emptying(GO:0035483) |
| 0.1 | 0.2 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 | 0.1 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.1 | 0.4 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.1 | 0.6 | GO:0045408 | regulation of interleukin-6 biosynthetic process(GO:0045408) |
| 0.1 | 0.4 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.1 | 0.2 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.1 | 0.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 1.6 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.1 | 0.6 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.1 | 0.1 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
| 0.1 | 0.1 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
| 0.1 | 0.3 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.1 | 0.3 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 | 0.3 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.1 | 0.3 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.1 | 0.3 | GO:0014842 | regulation of skeletal muscle satellite cell proliferation(GO:0014842) |
| 0.1 | 0.2 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 | 0.3 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.1 | 0.3 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.1 | 0.8 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.1 | 0.1 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
| 0.1 | 0.4 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.1 | 0.5 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.1 | 0.3 | GO:1901678 | iron coordination entity transport(GO:1901678) |
| 0.1 | 0.1 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.1 | 0.3 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.4 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.1 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 | 0.1 | GO:0048320 | axial mesoderm formation(GO:0048320) |
| 0.1 | 0.4 | GO:0043486 | histone exchange(GO:0043486) |
| 0.1 | 0.3 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.1 | 0.1 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.1 | 0.7 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.1 | 0.3 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
| 0.1 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.2 | GO:0060368 | regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060368) |
| 0.1 | 0.2 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.1 | 0.6 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.1 | 0.4 | GO:2000258 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
| 0.1 | 0.3 | GO:0061615 | glycolytic process through fructose-6-phosphate(GO:0061615) |
| 0.1 | 0.1 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
| 0.1 | 0.5 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 | 0.1 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
| 0.1 | 0.3 | GO:0016114 | terpenoid biosynthetic process(GO:0016114) |
| 0.1 | 0.2 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.1 | 0.3 | GO:0031100 | organ regeneration(GO:0031100) |
| 0.1 | 0.5 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.1 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 | 0.5 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.1 | 0.2 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
| 0.1 | 0.7 | GO:0042119 | neutrophil activation(GO:0042119) |
| 0.1 | 0.3 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.1 | 0.2 | GO:0060215 | primitive hemopoiesis(GO:0060215) |
| 0.1 | 0.3 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.1 | 0.3 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.1 | 0.1 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
| 0.1 | 0.8 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.1 | 0.7 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.1 | 0.1 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
| 0.1 | 0.7 | GO:0010458 | exit from mitosis(GO:0010458) |
| 0.1 | 0.1 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.1 | 0.3 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
| 0.1 | 0.4 | GO:0071569 | protein ufmylation(GO:0071569) |
| 0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.1 | 0.4 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.1 | 0.6 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
| 0.1 | 0.6 | GO:0060135 | maternal process involved in female pregnancy(GO:0060135) |
| 0.1 | 0.1 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.1 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.1 | 0.3 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.1 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.1 | 0.2 | GO:1901033 | positive regulation of response to reactive oxygen species(GO:1901033) positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.1 | 0.7 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.1 | 0.4 | GO:0046218 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
| 0.1 | 0.1 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
| 0.1 | 0.2 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
| 0.1 | 0.3 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
| 0.1 | 1.0 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.1 | 0.6 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.1 | 2.1 | GO:0007091 | metaphase/anaphase transition of mitotic cell cycle(GO:0007091) metaphase/anaphase transition of cell cycle(GO:0044784) |
| 0.1 | 0.5 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.1 | 0.1 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.1 | 0.1 | GO:0070198 | protein localization to chromosome, telomeric region(GO:0070198) |
| 0.1 | 0.2 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.1 | 0.2 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.1 | 0.4 | GO:0060396 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.1 | 0.2 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.1 | 0.2 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 0.2 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.1 | 0.2 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.1 | 0.3 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 0.1 | 0.1 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.1 | 0.2 | GO:0048162 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.1 | 0.1 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.1 | 0.2 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
| 0.1 | 0.2 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.1 | 0.4 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.1 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.1 | 0.2 | GO:0090343 | positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
| 0.1 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.1 | 0.1 | GO:0008078 | mesodermal cell migration(GO:0008078) |
| 0.1 | 0.2 | GO:0060023 | soft palate development(GO:0060023) |
| 0.1 | 0.3 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.1 | 0.2 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.1 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.1 | 0.1 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.1 | 0.5 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.1 | 0.1 | GO:0009310 | amine catabolic process(GO:0009310) |
| 0.1 | 0.2 | GO:0072423 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 | 0.6 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.1 | 0.3 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 0.2 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.1 | 0.2 | GO:0000237 | leptotene(GO:0000237) |
| 0.1 | 0.1 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.1 | 0.3 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.1 | 0.2 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 | 0.2 | GO:0021898 | commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
| 0.1 | 0.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.1 | 0.2 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.1 | 0.1 | GO:0075136 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 0.1 | 0.3 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 | 0.2 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.4 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.1 | 0.3 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 | 0.7 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.1 | 0.2 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
| 0.1 | 0.1 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.1 | 0.2 | GO:0071816 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.1 | 0.1 | GO:0008228 | opsonization(GO:0008228) |
| 0.1 | 1.9 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.1 | 0.1 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.1 | 0.2 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 | 0.1 | GO:0036302 | atrioventricular canal development(GO:0036302) |
| 0.1 | 0.1 | GO:0065001 | specification of axis polarity(GO:0065001) |
| 0.1 | 0.1 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
| 0.1 | 0.3 | GO:0032324 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.1 | 0.1 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.1 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 0.1 | GO:0032667 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) positive regulation of interleukin-23 production(GO:0032747) |
| 0.1 | 0.1 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
| 0.1 | 0.2 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.1 | 0.1 | GO:0002586 | regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
| 0.1 | 0.4 | GO:0006778 | porphyrin-containing compound metabolic process(GO:0006778) |
| 0.1 | 0.4 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.1 | 0.3 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.1 | 0.7 | GO:0045620 | negative regulation of lymphocyte differentiation(GO:0045620) |
| 0.1 | 0.2 | GO:0030299 | intestinal cholesterol absorption(GO:0030299) |
| 0.1 | 0.1 | GO:0032058 | positive regulation of translation in response to stress(GO:0032056) positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.1 | 1.8 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.1 | 0.1 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
| 0.1 | 0.2 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 | 0.8 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 | 0.4 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.1 | 0.5 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
| 0.1 | 0.4 | GO:0042730 | fibrinolysis(GO:0042730) |
| 0.1 | 0.1 | GO:0018377 | protein myristoylation(GO:0018377) |
| 0.1 | 0.4 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.1 | 0.2 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 | 1.1 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
| 0.1 | 0.5 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 | 0.1 | GO:0060318 | definitive erythrocyte differentiation(GO:0060318) |
| 0.1 | 0.1 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
| 0.1 | 0.2 | GO:0018904 | ether metabolic process(GO:0018904) |
| 0.1 | 0.2 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.1 | 1.0 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
| 0.0 | 0.4 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| 0.0 | 0.1 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.0 | 0.1 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.0 | 0.0 | GO:0021978 | telencephalon regionalization(GO:0021978) |
| 0.0 | 0.0 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.0 | 0.2 | GO:0002591 | positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
| 0.0 | 0.2 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
| 0.0 | 0.0 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.0 | 0.3 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.0 | 0.3 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
| 0.0 | 0.3 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.0 | 0.5 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.0 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 | 0.6 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.4 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.0 | 0.0 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.0 | 0.5 | GO:0001845 | phagolysosome assembly(GO:0001845) |
| 0.0 | 0.2 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.0 | 0.1 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.0 | 0.3 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.0 | 0.0 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
| 0.0 | 0.2 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.0 | 0.1 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.1 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.0 | 0.2 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.0 | 0.0 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.0 | 0.1 | GO:0051985 | negative regulation of chromosome segregation(GO:0051985) |
| 0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.0 | 0.2 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.0 | 0.2 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.0 | 0.6 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.0 | 0.3 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 3.0 | GO:0051028 | mRNA transport(GO:0051028) |
| 0.0 | 0.3 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.0 | 0.1 | GO:0051029 | rRNA transport(GO:0051029) |
| 0.0 | 0.1 | GO:0032621 | interleukin-18 production(GO:0032621) |
| 0.0 | 0.1 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.0 | 0.0 | GO:0002351 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
| 0.0 | 0.3 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.0 | 0.1 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.0 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.0 | 0.2 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.0 | 0.0 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
| 0.0 | 0.1 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.0 | 0.1 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.0 | 0.3 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.3 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
| 0.0 | 0.1 | GO:0071684 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.0 | 0.2 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.0 | 0.1 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.0 | 0.1 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
| 0.0 | 0.0 | GO:0061624 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.0 | 0.3 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.2 | GO:2000542 | negative regulation of gastrulation(GO:2000542) |
| 0.0 | 0.2 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
| 0.0 | 0.0 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.0 | 0.1 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
| 0.0 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
| 0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 | 0.1 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
| 0.0 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.5 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
| 0.0 | 0.3 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.0 | 0.1 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.0 | 0.3 | GO:0006801 | superoxide metabolic process(GO:0006801) |
| 0.0 | 0.4 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
| 0.0 | 0.2 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.0 | 0.4 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 0.0 | 0.2 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.0 | 0.3 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
| 0.0 | 0.0 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.0 | 0.2 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.0 | 0.8 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.0 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.0 | 0.0 | GO:0009445 | putrescine metabolic process(GO:0009445) |
| 0.0 | 0.0 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.0 | 0.3 | GO:0050779 | RNA destabilization(GO:0050779) |
| 0.0 | 0.0 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 | 0.1 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.0 | 0.1 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
| 0.0 | 0.3 | GO:0048596 | embryonic camera-type eye morphogenesis(GO:0048596) |
| 0.0 | 0.5 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
| 0.0 | 0.0 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
| 0.0 | 0.1 | GO:0071280 | cellular response to copper ion(GO:0071280) |
| 0.0 | 0.1 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.0 | 0.5 | GO:0071800 | podosome assembly(GO:0071800) |
| 0.0 | 0.1 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
| 0.0 | 0.0 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
| 0.0 | 0.0 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.0 | 1.4 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
| 0.0 | 0.2 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.0 | 0.1 | GO:0021984 | adenohypophysis development(GO:0021984) |
| 0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 | 0.0 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
| 0.0 | 0.0 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.0 | 0.3 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.0 | 0.2 | GO:0007549 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 | 0.1 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.0 | 0.1 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.8 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.1 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.0 | 0.0 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
| 0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.3 | GO:0048368 | lateral mesoderm development(GO:0048368) |
| 0.0 | 0.2 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 | 0.1 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.0 | 0.2 | GO:0007035 | vacuolar acidification(GO:0007035) |
| 0.0 | 0.0 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
| 0.0 | 0.8 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) |
| 0.0 | 0.3 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 0.0 | 0.0 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
| 0.0 | 0.1 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.0 | 0.2 | GO:0008595 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.0 | 0.7 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.4 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.4 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 | 0.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.5 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.0 | 0.0 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
| 0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.0 | 0.0 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.0 | 0.2 | GO:0015809 | arginine transport(GO:0015809) |
| 0.0 | 0.5 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.2 | GO:0006560 | proline metabolic process(GO:0006560) |
| 0.0 | 0.1 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.0 | 0.2 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.0 | 0.2 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.1 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.0 | 0.3 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
| 0.0 | 0.1 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
| 0.0 | 0.0 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.0 | 0.3 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 | 0.1 | GO:0044598 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 | 0.1 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
| 0.0 | 0.2 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 0.0 | 0.1 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
| 0.0 | 0.2 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
| 0.0 | 0.2 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.0 | 0.1 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
| 0.0 | 0.3 | GO:0021670 | lateral ventricle development(GO:0021670) |
| 0.0 | 0.0 | GO:0010255 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
| 0.0 | 0.5 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
| 0.0 | 0.1 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.0 | 0.0 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
| 0.0 | 0.0 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.0 | 1.2 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.0 | 0.3 | GO:0045672 | positive regulation of osteoclast differentiation(GO:0045672) |
| 0.0 | 0.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.1 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) positive regulation of osteoclast proliferation(GO:0090290) |
| 0.0 | 0.2 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.0 | 0.1 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.2 | GO:0048484 | enteric nervous system development(GO:0048484) |
| 0.0 | 0.3 | GO:0030225 | macrophage differentiation(GO:0030225) |
| 0.0 | 0.2 | GO:0060037 | pharyngeal system development(GO:0060037) |
| 0.0 | 0.1 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.0 | 0.1 | GO:0072576 | liver morphogenesis(GO:0072576) |
| 0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.1 | GO:0002374 | cytokine secretion involved in immune response(GO:0002374) |
| 0.0 | 0.3 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.2 | GO:0030220 | platelet formation(GO:0030220) |
| 0.0 | 0.5 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.4 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
| 0.0 | 0.2 | GO:0060009 | Sertoli cell development(GO:0060009) |
| 0.0 | 0.1 | GO:0045730 | respiratory burst(GO:0045730) |
| 0.0 | 0.1 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 0.0 | 0.0 | GO:0014900 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 0.0 | 0.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.2 | GO:0006971 | hypotonic response(GO:0006971) |
| 0.0 | 0.1 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.0 | 0.2 | GO:0006356 | regulation of transcription from RNA polymerase I promoter(GO:0006356) |
| 0.0 | 0.1 | GO:0060613 | fat pad development(GO:0060613) |
| 0.0 | 0.3 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.0 | 0.0 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.3 | GO:0046051 | UTP metabolic process(GO:0046051) |
| 0.0 | 0.1 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
| 0.0 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.2 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.0 | 0.1 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
| 0.0 | 0.1 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.0 | 0.1 | GO:0045144 | meiotic sister chromatid segregation(GO:0045144) meiotic sister chromatid cohesion(GO:0051177) |
| 0.0 | 0.4 | GO:0001516 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.0 | 0.1 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 | 0.2 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
| 0.0 | 0.0 | GO:0090656 | t-circle formation(GO:0090656) |
| 0.0 | 0.0 | GO:0001692 | histamine metabolic process(GO:0001692) |
| 0.0 | 0.0 | GO:0009173 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.0 | 0.1 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
| 0.0 | 0.0 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
| 0.0 | 0.3 | GO:0071548 | response to dexamethasone(GO:0071548) cellular response to dexamethasone stimulus(GO:0071549) |
| 0.0 | 0.0 | GO:0043587 | tongue morphogenesis(GO:0043587) |
| 0.0 | 0.1 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 0.0 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.0 | 0.1 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.0 | 0.1 | GO:0048333 | mesodermal cell differentiation(GO:0048333) |
| 0.0 | 0.2 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
| 0.0 | 0.1 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 0.1 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.0 | 0.1 | GO:0033363 | secretory granule organization(GO:0033363) |
| 0.0 | 0.1 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.0 | 0.8 | GO:0007040 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
| 0.0 | 0.0 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.2 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.0 | 0.7 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.0 | 0.3 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.0 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.0 | 0.0 | GO:0006266 | DNA ligation(GO:0006266) |
| 0.0 | 0.0 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.0 | 0.1 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.0 | 0.1 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.2 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 | 0.0 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.0 | 0.0 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) |
| 0.0 | 0.0 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.0 | 0.1 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 | 0.1 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.0 | 0.1 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 | 0.1 | GO:0034695 | response to prostaglandin E(GO:0034695) |
| 0.0 | 0.0 | GO:0035791 | platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 0.0 | 0.5 | GO:0006378 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
| 0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.0 | GO:0002677 | negative regulation of chronic inflammatory response(GO:0002677) |
| 0.0 | 0.0 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.0 | 0.1 | GO:0046015 | regulation of transcription by glucose(GO:0046015) positive regulation of transcription by glucose(GO:0046016) |
| 0.0 | 0.3 | GO:0042026 | protein refolding(GO:0042026) |
| 0.0 | 0.1 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.0 | 0.2 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.0 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.0 | 0.0 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
| 0.0 | 0.1 | GO:0051299 | centrosome separation(GO:0051299) |
| 0.0 | 0.3 | GO:0033866 | coenzyme A biosynthetic process(GO:0015937) nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 0.0 | 0.1 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.0 | 0.1 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 0.2 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.0 | 0.1 | GO:0060442 | branching involved in prostate gland morphogenesis(GO:0060442) |
| 0.0 | 0.1 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.0 | 0.1 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
| 0.0 | 0.1 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.0 | 0.1 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.2 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.0 | 0.3 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.0 | GO:0002583 | regulation of antigen processing and presentation of peptide antigen(GO:0002583) |
| 0.0 | 0.1 | GO:0061450 | trophoblast cell migration(GO:0061450) |
| 0.0 | 0.1 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 | 0.1 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 0.7 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.0 | 0.1 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 | 0.2 | GO:0031639 | plasminogen activation(GO:0031639) |
| 0.0 | 0.3 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.0 | 0.1 | GO:0032960 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.0 | 0.1 | GO:0035987 | endodermal cell differentiation(GO:0035987) |
| 0.0 | 0.1 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.0 | 0.1 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.0 | 0.0 | GO:0019042 | viral latency(GO:0019042) |
| 0.0 | 0.0 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.0 | 0.0 | GO:1903299 | regulation of hexokinase activity(GO:1903299) |
| 0.0 | 0.1 | GO:0071305 | vitamin D receptor signaling pathway(GO:0070561) cellular response to vitamin D(GO:0071305) |
| 0.0 | 0.1 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.0 | 0.2 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.0 | 0.3 | GO:0015893 | drug transport(GO:0015893) |
| 0.0 | 0.0 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
| 0.0 | 0.1 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 0.1 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.0 | 0.0 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
| 0.0 | 0.1 | GO:0009299 | mRNA transcription(GO:0009299) |
| 0.0 | 0.0 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
| 0.0 | 0.0 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.0 | 0.1 | GO:0035635 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.0 | 0.1 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
| 0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 | 0.2 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 0.1 | GO:0016137 | glycoside metabolic process(GO:0016137) |
| 0.0 | 0.0 | GO:0051709 | regulation of killing of cells of other organism(GO:0051709) positive regulation of killing of cells of other organism(GO:0051712) |
| 0.0 | 0.4 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.0 | 0.0 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.0 | 0.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.0 | 0.0 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
| 0.0 | 0.2 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.0 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.0 | 0.0 | GO:0033034 | positive regulation of neutrophil apoptotic process(GO:0033031) positive regulation of myeloid cell apoptotic process(GO:0033034) |
| 0.0 | 0.0 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.1 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
| 0.0 | 0.1 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.1 | GO:0030728 | ovulation(GO:0030728) |
| 0.0 | 0.0 | GO:0002485 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 0.0 | 0.1 | GO:0031998 | regulation of fatty acid beta-oxidation(GO:0031998) |
| 0.0 | 0.1 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.0 | 0.0 | GO:1902669 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
| 0.0 | 0.5 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.0 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.0 | 0.0 | GO:0052041 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
| 0.0 | 0.1 | GO:2000178 | negative regulation of neural precursor cell proliferation(GO:2000178) |
| 0.0 | 0.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.1 | GO:0019363 | pyridine nucleotide biosynthetic process(GO:0019363) |
| 0.0 | 0.1 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
| 0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.0 | 0.1 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
| 0.0 | 0.0 | GO:0009217 | purine deoxyribonucleoside triphosphate catabolic process(GO:0009217) |
| 0.0 | 0.1 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
| 0.0 | 0.1 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
| 0.0 | 0.1 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
| 0.0 | 0.0 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.0 | 0.1 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
| 0.0 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.0 | 0.1 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.0 | 0.0 | GO:0006693 | prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.0 | 0.1 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
| 0.0 | 0.0 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
| 0.0 | 0.2 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
| 0.0 | 0.0 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.0 | 0.0 | GO:0006188 | IMP biosynthetic process(GO:0006188) |
| 0.0 | 0.0 | GO:2000319 | regulation of T-helper 17 cell differentiation(GO:2000319) |
| 0.0 | 0.7 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
| 0.0 | 0.1 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
| 0.0 | 0.2 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.0 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.0 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.0 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.0 | 0.3 | GO:0071470 | cellular response to osmotic stress(GO:0071470) |
| 0.0 | 0.4 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 | 0.1 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.1 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.0 | 0.1 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.0 | 0.0 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.0 | 0.0 | GO:0046112 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) nucleobase biosynthetic process(GO:0046112) |
| 0.0 | 0.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.0 | 0.3 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.0 | 0.1 | GO:0061085 | regulation of histone H3-K27 methylation(GO:0061085) |
| 0.0 | 0.0 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.0 | 0.1 | GO:0097341 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.0 | 0.1 | GO:0045840 | positive regulation of mitotic nuclear division(GO:0045840) |
| 0.0 | 0.3 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
| 0.0 | 0.0 | GO:0009202 | deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
| 0.0 | 0.0 | GO:0034204 | lipid translocation(GO:0034204) |
| 0.0 | 0.2 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.1 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
| 0.0 | 0.2 | GO:0017145 | stem cell division(GO:0017145) |
| 0.0 | 0.0 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.0 | 0.1 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.0 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
| 0.0 | 0.2 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.0 | 0.1 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.0 | 0.1 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
| 0.0 | 0.2 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.0 | 0.0 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.0 | 0.0 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.0 | 0.1 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.0 | 0.0 | GO:1904587 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
| 0.0 | 0.0 | GO:0002431 | Fc receptor mediated stimulatory signaling pathway(GO:0002431) |
| 0.0 | 0.2 | GO:0042993 | positive regulation of transcription factor import into nucleus(GO:0042993) |
| 0.0 | 0.0 | GO:1903297 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
| 0.0 | 0.1 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 0.0 | GO:1902804 | negative regulation of synaptic vesicle transport(GO:1902804) |
| 0.0 | 0.8 | GO:0007051 | spindle organization(GO:0007051) |
| 0.0 | 0.1 | GO:0007207 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.0 | 0.0 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.0 | 0.0 | GO:0002467 | germinal center formation(GO:0002467) |
| 0.0 | 0.0 | GO:2000779 | regulation of double-strand break repair(GO:2000779) |
| 0.0 | 0.0 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.0 | 0.0 | GO:0034086 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.0 | 0.0 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
| 0.0 | 0.0 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 | 0.1 | GO:0042255 | ribosome assembly(GO:0042255) |
| 0.0 | 0.0 | GO:0010635 | regulation of mitochondrial fusion(GO:0010635) |
| 0.0 | 0.1 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.0 | 0.0 | GO:0046596 | regulation of viral entry into host cell(GO:0046596) |
| 0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.0 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
| 0.0 | 0.0 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
| 0.0 | 0.0 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.0 | 0.0 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.0 | 0.1 | GO:0030901 | midbrain development(GO:0030901) |
| 0.0 | 0.0 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.0 | 0.3 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
| 0.0 | 0.0 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.0 | 0.0 | GO:0046113 | nucleobase catabolic process(GO:0046113) |
| 0.0 | 0.0 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
| 0.0 | 0.0 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.0 | 0.0 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
| 0.0 | 0.0 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.0 | 0.2 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
| 0.0 | 0.0 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.0 | 0.2 | GO:0097352 | autophagosome maturation(GO:0097352) |
| 0.0 | 0.1 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
| 0.0 | 0.1 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.0 | 0.0 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.0 | 0.5 | GO:0035036 | sperm-egg recognition(GO:0035036) |
| 0.0 | 0.0 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.0 | 0.6 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.0 | 0.0 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.0 | 0.0 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.0 | 0.0 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.0 | 0.0 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.0 | 0.0 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.0 | 0.1 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.0 | 0.1 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.0 | 0.0 | GO:0015865 | purine nucleotide transport(GO:0015865) adenine nucleotide transport(GO:0051503) |
| 0.0 | 0.0 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.0 | 0.2 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.1 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
| 0.0 | 0.0 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 0.0 | 0.0 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.0 | 0.4 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 0.2 | GO:0035137 | hindlimb morphogenesis(GO:0035137) |
| 0.0 | 1.7 | GO:0010466 | negative regulation of peptidase activity(GO:0010466) |
| 0.0 | 0.0 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 | 0.1 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.0 | 0.4 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.0 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.0 | 0.0 | GO:0090399 | replicative senescence(GO:0090399) |
| 0.0 | 0.0 | GO:0002254 | kinin cascade(GO:0002254) |
| 0.0 | 0.1 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 0.0 | 0.1 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.0 | 0.1 | GO:0000070 | mitotic sister chromatid segregation(GO:0000070) |
| 0.0 | 0.1 | GO:0006826 | iron ion transport(GO:0006826) |
| 0.0 | 0.0 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.0 | 0.1 | GO:0046348 | amino sugar catabolic process(GO:0046348) |
| 0.0 | 0.1 | GO:0072662 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.0 | 0.1 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.0 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
| 0.0 | 0.0 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.0 | 0.2 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.0 | 0.0 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.0 | 0.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.0 | GO:0015744 | succinate transport(GO:0015744) |
| 0.0 | 0.0 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.0 | 0.0 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.0 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.0 | 0.0 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.0 | 0.0 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.0 | 0.0 | GO:0042574 | retinal metabolic process(GO:0042574) |
| 0.0 | 0.0 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
| 0.0 | 0.1 | GO:0006829 | zinc II ion transport(GO:0006829) |
| 0.0 | 0.0 | GO:0042517 | positive regulation of tyrosine phosphorylation of Stat3 protein(GO:0042517) |
| 0.0 | 0.0 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.0 | 0.0 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.6 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.5 | 0.5 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.4 | 2.2 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.3 | 1.2 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.3 | 1.4 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.2 | 1.0 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.2 | 1.7 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.2 | 1.0 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.2 | 1.4 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.2 | 1.0 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.2 | 0.8 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.2 | 0.5 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.2 | 0.7 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 0.2 | 0.3 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.2 | 1.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.2 | 0.7 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.2 | 1.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.2 | 1.0 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.2 | 0.8 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.2 | 1.3 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.2 | 0.5 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.2 | 0.5 | GO:0008091 | spectrin(GO:0008091) |
| 0.2 | 0.9 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.2 | 0.5 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.2 | 0.6 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.2 | 0.8 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.2 | 0.5 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.1 | 0.7 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.1 | 0.4 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.1 | 0.4 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.1 | 0.9 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 1.3 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 0.4 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 0.4 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.1 | 0.7 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 0.4 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.1 | 1.7 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 0.1 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.1 | 1.8 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 0.5 | GO:0098536 | deuterosome(GO:0098536) |
| 0.1 | 0.5 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.1 | 0.4 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.1 | 8.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.1 | 0.4 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.1 | 0.5 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.1 | 0.6 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.1 | 0.6 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.1 | 0.3 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.1 | 0.3 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.1 | 0.3 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 0.9 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.4 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.1 | 2.5 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.1 | 0.2 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.1 | 0.9 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.1 | 1.0 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.1 | 0.5 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 1.2 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 0.2 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.1 | 0.4 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.1 | 0.4 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 0.4 | GO:0030689 | Noc complex(GO:0030689) |
| 0.1 | 0.7 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 1.0 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 0.4 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.1 | 0.4 | GO:0000805 | X chromosome(GO:0000805) |
| 0.1 | 0.7 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.1 | 0.7 | GO:0042627 | chylomicron(GO:0042627) |
| 0.1 | 0.1 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
| 0.1 | 0.3 | GO:0000811 | GINS complex(GO:0000811) |
| 0.1 | 0.3 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.1 | 0.7 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.1 | 0.2 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.1 | 0.4 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 0.3 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.1 | 0.4 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 1.0 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.1 | 0.7 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 1.1 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.1 | 0.2 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.1 | 0.4 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.1 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.1 | 0.8 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 0.6 | GO:0042581 | specific granule(GO:0042581) |
| 0.1 | 0.6 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.1 | 0.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.1 | 0.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.1 | 0.4 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.1 | 0.1 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.1 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.1 | 0.8 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.1 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 0.4 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.1 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.1 | 1.0 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 0.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 0.2 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 0.3 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.1 | 0.7 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.1 | 0.6 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.1 | 0.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.1 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.1 | 0.8 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.1 | 0.6 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.1 | 0.4 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.1 | 0.6 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.1 | 0.2 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.1 | 0.2 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.1 | 0.6 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 0.5 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 0.2 | GO:0000938 | GARP complex(GO:0000938) |
| 0.1 | 0.2 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.1 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.1 | 0.3 | GO:0016589 | NURF complex(GO:0016589) |
| 0.1 | 5.0 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.1 | 0.6 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.1 | 2.5 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.1 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.1 | 0.2 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.1 | 1.2 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
| 0.1 | 0.8 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.1 | 0.1 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.1 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.1 | 0.2 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.1 | 0.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.1 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.1 | 3.6 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.1 | 0.3 | GO:0032009 | early phagosome(GO:0032009) |
| 0.1 | 0.2 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.1 | 0.2 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.1 | 0.2 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.1 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 0.4 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.1 | 0.8 | GO:0000145 | exocyst(GO:0000145) |
| 0.1 | 1.4 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 0.2 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.1 | 0.9 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.1 | 0.7 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.1 | 0.3 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.1 | 0.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 1.7 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.1 | 0.3 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.1 | 0.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 0.2 | GO:0035859 | Seh1-associated complex(GO:0035859) |
| 0.1 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.7 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 0.2 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 0.6 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.0 | 0.9 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 0.2 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.0 | 0.3 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.0 | 0.6 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 0.1 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.0 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.5 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 1.7 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.0 | 0.3 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 0.2 | GO:0002139 | stereocilia coupling link(GO:0002139) stereocilia ankle link(GO:0002141) |
| 0.0 | 0.5 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.2 | GO:0000235 | astral microtubule(GO:0000235) |
| 0.0 | 0.1 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.0 | 0.4 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.2 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.0 | 2.0 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.1 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.0 | 0.6 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.0 | 3.6 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.0 | 0.2 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.3 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.0 | 0.1 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.0 | 1.4 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 1.4 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 0.0 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.3 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.2 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.0 | 0.3 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
| 0.0 | 0.4 | GO:0045120 | pronucleus(GO:0045120) |
| 0.0 | 0.1 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
| 0.0 | 1.0 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.4 | GO:0099738 | cell cortex region(GO:0099738) |
| 0.0 | 0.4 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 3.3 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.0 | 0.2 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.0 | 1.0 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
| 0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.0 | 1.9 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.0 | 0.0 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.0 | 0.4 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 0.2 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.5 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.7 | GO:0008305 | integrin complex(GO:0008305) |
| 0.0 | 0.4 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.1 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 0.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.1 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.6 | GO:0030904 | retromer complex(GO:0030904) |
| 0.0 | 0.0 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.0 | 0.3 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.5 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.0 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.0 | 0.1 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.0 | 0.2 | GO:0032797 | SMN complex(GO:0032797) |
| 0.0 | 0.1 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 9.8 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.6 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.0 | 0.6 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.2 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.3 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.3 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 0.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.0 | 0.6 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
| 0.0 | 0.2 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.0 | 0.3 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.0 | GO:0005818 | aster(GO:0005818) |
| 0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 2.5 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 3.5 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.0 | 0.2 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.0 | 4.6 | GO:0000785 | chromatin(GO:0000785) |
| 0.0 | 0.7 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 0.0 | 0.0 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 0.0 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.0 | 0.0 | GO:0042827 | platelet dense granule(GO:0042827) |
| 0.0 | 1.4 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.0 | 0.2 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.0 | 0.1 | GO:0005858 | axonemal dynein complex(GO:0005858) |
| 0.0 | 0.0 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.0 | 0.1 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 0.7 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.6 | GO:0015934 | large ribosomal subunit(GO:0015934) |
| 0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.4 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.2 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.0 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.0 | 0.3 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 4.5 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 0.2 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.1 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 0.1 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 0.2 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.1 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.0 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.5 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.0 | 0.1 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 0.0 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.0 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.6 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.0 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.0 | 0.0 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.4 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.0 | 0.6 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.0 | GO:0061702 | inflammasome complex(GO:0061702) |
| 0.0 | 0.9 | GO:0005681 | spliceosomal complex(GO:0005681) |
| 0.0 | 0.5 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
| 0.0 | 0.3 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.1 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.0 | 0.1 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.0 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.0 | 0.0 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 0.0 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.3 | GO:0031301 | integral component of organelle membrane(GO:0031301) |
| 0.0 | 0.0 | GO:0030891 | VCB complex(GO:0030891) |
| 0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 0.7 | GO:0016604 | nuclear body(GO:0016604) |
| 0.0 | 0.0 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.0 | 0.0 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.0 | 0.1 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 0.1 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.0 | 0.2 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.1 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.0 | 0.0 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 1.2 | GO:0000139 | Golgi membrane(GO:0000139) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.8 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.5 | 1.6 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.4 | 1.7 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.4 | 1.2 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.4 | 1.2 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.4 | 3.2 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.3 | 1.4 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.3 | 1.4 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.3 | 2.2 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.3 | 1.2 | GO:0031720 | haptoglobin binding(GO:0031720) |
| 0.3 | 0.9 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.3 | 0.8 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.3 | 0.8 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
| 0.3 | 0.8 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.3 | 0.5 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.3 | 0.8 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.3 | 0.8 | GO:0019862 | IgA binding(GO:0019862) |
| 0.3 | 0.8 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.2 | 0.7 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.2 | 1.0 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.2 | 1.0 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.2 | 0.9 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.2 | 1.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.2 | 2.0 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.2 | 1.5 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.2 | 0.9 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
| 0.2 | 0.9 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.2 | 0.6 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.2 | 0.8 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.2 | 2.3 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.2 | 0.6 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.2 | 0.6 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.2 | 0.6 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.2 | 1.0 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.2 | 0.6 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.2 | 0.4 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.2 | 0.8 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.2 | 1.0 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.2 | 0.8 | GO:0034618 | arginine binding(GO:0034618) |
| 0.2 | 0.6 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.2 | 0.6 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.2 | 0.6 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.2 | 0.9 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.2 | 0.4 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
| 0.2 | 0.5 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.2 | 1.4 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.2 | 0.9 | GO:0000828 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.2 | 0.5 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.2 | 0.5 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.2 | 0.5 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.2 | 0.8 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.2 | 0.6 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.2 | 0.5 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.2 | 0.5 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.2 | 1.1 | GO:0005113 | patched binding(GO:0005113) |
| 0.2 | 0.9 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) xenobiotic transporter activity(GO:0042910) |
| 0.2 | 0.3 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
| 0.2 | 0.5 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.2 | 0.5 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.2 | 0.6 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.2 | 0.5 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.1 | 0.7 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.1 | 0.4 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.1 | 0.7 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.1 | 0.6 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.1 | 1.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.1 | 1.0 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.7 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.1 | 0.4 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 0.5 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.1 | 0.7 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.1 | 0.1 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
| 0.1 | 0.3 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.1 | 0.5 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.1 | 0.5 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 0.4 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.1 | 0.5 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.1 | 0.5 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.1 | 0.5 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 0.4 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.1 | 0.4 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 0.4 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.1 | 1.1 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.1 | 0.3 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 0.5 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
| 0.1 | 0.3 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.1 | 0.2 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.1 | 0.1 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.1 | 0.4 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
| 0.1 | 1.7 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.1 | 2.2 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.1 | 0.3 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.1 | 0.4 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
| 0.1 | 0.9 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.1 | 0.3 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.1 | 0.5 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 0.4 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.1 | 1.0 | GO:0034871 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
| 0.1 | 1.6 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.1 | 0.2 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.1 | 0.4 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.1 | 0.4 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.1 | 0.7 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.1 | 0.7 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.1 | 0.2 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.3 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.1 | 0.3 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.1 | 0.3 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.1 | 1.3 | GO:0005521 | lamin binding(GO:0005521) |
| 0.1 | 0.3 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.1 | 3.0 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.1 | 2.8 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.2 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.1 | 0.3 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.1 | 0.6 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.1 | 0.8 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.1 | 0.5 | GO:0043559 | insulin binding(GO:0043559) |
| 0.1 | 0.5 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.1 | 0.5 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 1.0 | GO:0016208 | AMP binding(GO:0016208) |
| 0.1 | 1.3 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.1 | 0.5 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.1 | 0.5 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.1 | 0.5 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 0.4 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 0.3 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.1 | 0.4 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 0.3 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.1 | 0.7 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.1 | 0.6 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.1 | 0.4 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.1 | 0.4 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
| 0.1 | 0.4 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.1 | 0.4 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 0.4 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.1 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
| 0.1 | 0.5 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.1 | 0.5 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.1 | 0.4 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.1 | 0.8 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
| 0.1 | 0.7 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.1 | 0.3 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.1 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 0.6 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 1.5 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
| 0.1 | 0.9 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.1 | 0.8 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.1 | 2.3 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 0.5 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.1 | 0.6 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.1 | 9.7 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.1 | 0.2 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
| 0.1 | 0.7 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
| 0.1 | 1.0 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.1 | 0.7 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 0.6 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.1 | 0.7 | GO:0051734 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) ATP-dependent polynucleotide kinase activity(GO:0051734) phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
| 0.1 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 0.2 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.1 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.1 | 0.2 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.1 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.1 | 0.2 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.1 | 0.4 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.5 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 0.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.1 | 0.4 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.1 | 0.5 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.1 | 0.7 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.1 | 0.9 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.1 | 0.3 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.1 | 0.4 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 0.8 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 1.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.1 | 0.2 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.1 | 0.2 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.1 | 0.4 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.1 | 0.2 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.1 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.1 | 0.7 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.1 | 0.1 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.1 | 0.7 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.1 | 1.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.1 | 0.3 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
| 0.1 | 0.2 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 0.6 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 0.7 | GO:0044466 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
| 0.1 | 0.3 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.1 | 0.4 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.1 | 1.8 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
| 0.1 | 0.5 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.1 | 0.2 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.1 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 0.7 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.1 | 0.2 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 0.1 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.1 | 0.6 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.1 | 0.6 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.1 | 0.3 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 0.3 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.1 | 0.5 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 0.6 | GO:0070513 | death domain binding(GO:0070513) |
| 0.1 | 0.8 | GO:0010181 | FMN binding(GO:0010181) |
| 0.1 | 0.2 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.1 | 0.1 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.1 | 0.7 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.1 | 0.4 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.1 | 0.2 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
| 0.1 | 0.2 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.1 | 0.2 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.1 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.2 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.1 | 0.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 0.2 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 0.2 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.1 | 0.5 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.1 | 0.4 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.1 | 0.4 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.1 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.1 | 0.2 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.1 | 0.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.7 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.1 | 0.1 | GO:0001030 | RNA polymerase III regulatory region DNA binding(GO:0001016) RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
| 0.1 | 0.2 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
| 0.1 | 0.2 | GO:0034979 | NAD-dependent protein deacetylase activity(GO:0034979) |
| 0.1 | 0.4 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.1 | 0.2 | GO:0015116 | sulfate transmembrane transporter activity(GO:0015116) |
| 0.1 | 0.2 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.1 | 1.1 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.1 | 0.5 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 0.9 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 0.3 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.1 | 0.2 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.1 | 0.4 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.1 | 0.4 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.1 | 2.5 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.1 | 0.2 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.2 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 0.1 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 0.1 | 0.6 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
| 0.1 | 0.2 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.1 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.1 | 0.8 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.1 | 0.4 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 0.5 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.1 | 0.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 0.3 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.1 | 0.2 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.1 | 0.5 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.1 | 1.0 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.1 | 0.6 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
| 0.1 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.3 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.6 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.2 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
| 0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 4.2 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.2 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.0 | 0.2 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.0 | 0.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.1 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
| 0.0 | 0.4 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.3 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.0 | 0.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.7 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.0 | 0.3 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.0 | 0.3 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.0 | 0.1 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 0.4 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.5 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.1 | GO:0070061 | fructose binding(GO:0070061) |
| 0.0 | 0.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.0 | 0.3 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.1 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.2 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 0.2 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.5 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.0 | 0.2 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.0 | 0.2 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.0 | 0.2 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.0 | 0.2 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.0 | 0.9 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.5 | GO:0019841 | retinol binding(GO:0019841) |
| 0.0 | 1.7 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 2.2 | GO:0016836 | hydro-lyase activity(GO:0016836) |
| 0.0 | 0.8 | GO:0043531 | ADP binding(GO:0043531) |
| 0.0 | 0.5 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.0 | 0.2 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.4 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.2 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.1 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.0 | 0.3 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.8 | GO:0043028 | cysteine-type endopeptidase regulator activity involved in apoptotic process(GO:0043028) |
| 0.0 | 0.3 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.1 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.3 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.5 | GO:0015238 | drug transmembrane transporter activity(GO:0015238) |
| 0.0 | 0.5 | GO:0048038 | quinone binding(GO:0048038) |
| 0.0 | 0.3 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.0 | 0.2 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.6 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.0 | 0.2 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 1.9 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 0.2 | GO:0038100 | nodal binding(GO:0038100) |
| 0.0 | 0.8 | GO:0045502 | dynein binding(GO:0045502) |
| 0.0 | 0.2 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
| 0.0 | 0.4 | GO:0016684 | oxidoreductase activity, acting on peroxide as acceptor(GO:0016684) |
| 0.0 | 0.2 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.0 | 0.9 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.3 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 0.2 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.0 | 0.5 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 0.0 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 0.1 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.0 | 0.1 | GO:0003917 | DNA topoisomerase activity(GO:0003916) DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.2 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.0 | 0.3 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.1 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
| 0.0 | 1.0 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.0 | 0.5 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.0 | 0.2 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 1.1 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.1 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.0 | 0.2 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.0 | 0.6 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.7 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.2 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.0 | 0.3 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.1 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.0 | 0.1 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
| 0.0 | 0.1 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.0 | 0.7 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.0 | 0.1 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.0 | 6.3 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.1 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.0 | 0.7 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.1 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.0 | 1.6 | GO:0030414 | peptidase inhibitor activity(GO:0030414) |
| 0.0 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 1.1 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.0 | 0.1 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.0 | 0.2 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.0 | 0.4 | GO:0005542 | folic acid binding(GO:0005542) |
| 0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.4 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.0 | 0.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.0 | 0.2 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.0 | 0.2 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 0.2 | GO:0016209 | antioxidant activity(GO:0016209) |
| 0.0 | 0.1 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.0 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.1 | GO:0052794 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 0.4 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.0 | 0.3 | GO:0005372 | water transmembrane transporter activity(GO:0005372) |
| 0.0 | 0.3 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.0 | 0.9 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.0 | 1.0 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
| 0.0 | 0.1 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.0 | GO:0030249 | guanylate cyclase regulator activity(GO:0030249) |
| 0.0 | 0.4 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.0 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.0 | 1.0 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.3 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
| 0.0 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.0 | 0.1 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.0 | 0.3 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
| 0.0 | 0.4 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 0.6 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.0 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.0 | 0.3 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
| 0.0 | 2.6 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.0 | 0.1 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 0.2 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 1.0 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.0 | 0.4 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
| 0.0 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
| 0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.1 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.0 | 0.1 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.2 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.0 | 0.0 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.0 | 0.0 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.5 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.3 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.2 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
| 0.0 | 1.3 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 0.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.0 | 0.1 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.0 | 0.9 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.0 | 0.1 | GO:0019767 | IgE receptor activity(GO:0019767) |
| 0.0 | 0.1 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.0 | 0.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.0 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) cyclohydrolase activity(GO:0019238) |
| 0.0 | 0.1 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.0 | 0.0 | GO:0019863 | IgE binding(GO:0019863) |
| 0.0 | 0.1 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.2 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.0 | 0.2 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.0 | 0.2 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.0 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.0 | 0.4 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.0 | 0.1 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 0.0 | 0.6 | GO:0004879 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
| 0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.0 | 0.2 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.0 | 0.2 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.0 | 0.1 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 9.8 | GO:0044212 | transcription regulatory region DNA binding(GO:0044212) |
| 0.0 | 0.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.0 | GO:0000217 | DNA secondary structure binding(GO:0000217) |
| 0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 1.3 | GO:0020037 | heme binding(GO:0020037) |
| 0.0 | 0.1 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.0 | 0.1 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 0.3 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.0 | 0.1 | GO:0008251 | tRNA-specific adenosine deaminase activity(GO:0008251) |
| 0.0 | 0.3 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.7 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
| 0.0 | 0.0 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.0 | 0.3 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 3.5 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
| 0.0 | 0.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.6 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.1 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.0 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.0 | 0.1 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.0 | 0.0 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.0 | 0.0 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.1 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.0 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.0 | 0.2 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 0.1 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.0 | 0.1 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.0 | 0.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.1 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.0 | 2.7 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 0.0 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.0 | 0.0 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
| 0.0 | 0.0 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.0 | 0.0 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.0 | 0.0 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.0 | 2.5 | GO:0043773 | UDP-N-acetylmuramoylalanyl-D-glutamyl-2,6-diaminopimelate-D-alanyl-D-alanine ligase activity(GO:0008766) ribosomal S6-glutamic acid ligase activity(GO:0018169) coenzyme F420-0 gamma-glutamyl ligase activity(GO:0043773) coenzyme F420-2 alpha-glutamyl ligase activity(GO:0043774) protein-glycine ligase activity(GO:0070735) protein-glycine ligase activity, initiating(GO:0070736) protein-glycine ligase activity, elongating(GO:0070737) tubulin-glycine ligase activity(GO:0070738) |
| 0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.5 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.0 | 0.0 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.0 | 0.1 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
| 0.0 | 0.6 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.0 | 0.0 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.1 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.0 | 0.0 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
| 0.0 | 1.3 | GO:0003729 | mRNA binding(GO:0003729) |
| 0.0 | 0.4 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.0 | 0.1 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 0.2 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.0 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.0 | 0.0 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.0 | 0.7 | GO:0003724 | RNA helicase activity(GO:0003724) |
| 0.0 | 0.1 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.0 | 0.0 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.0 | 0.0 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.0 | 0.0 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.0 | 0.0 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.0 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.0 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.0 | 1.7 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
| 0.0 | 0.1 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.0 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 6.2 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 1.2 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 0.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.1 | 3.9 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.1 | 1.1 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.1 | 4.2 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 1.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 1.6 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 6.8 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.1 | 0.3 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.1 | 1.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 1.6 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.1 | 0.7 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.1 | 2.1 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.1 | 1.2 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.1 | 0.2 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.1 | 0.5 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 4.2 | PID CMYB PATHWAY | C-MYB transcription factor network |
| 0.1 | 0.7 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 1.4 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 4.4 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.1 | 0.2 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.1 | 0.6 | PID MYC PATHWAY | C-MYC pathway |
| 0.1 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.1 | 0.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.1 | 1.6 | PID EPO PATHWAY | EPO signaling pathway |
| 0.1 | 0.3 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 0.7 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 0.2 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.1 | 0.6 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 0.9 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.1 | 0.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.1 | 0.3 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.1 | 0.8 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.1 | 0.2 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.0 | 1.8 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.9 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 1.8 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 1.1 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 0.0 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.0 | 1.2 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 0.0 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.4 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.3 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 0.8 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.8 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 1.0 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.0 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.5 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.9 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.4 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.4 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.9 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.0 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 0.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.6 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 0.7 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 1.1 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.6 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.8 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 1.9 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 0.5 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 0.4 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.3 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 0.3 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 0.4 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.0 | 0.4 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.4 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.2 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.2 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.0 | 0.3 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.3 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.1 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.5 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.2 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.1 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.3 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 0.1 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 0.2 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.1 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.2 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.1 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.0 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 5.5 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.3 | 3.5 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.2 | 1.9 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.2 | 1.0 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.2 | 0.8 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.2 | 1.0 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.2 | 1.9 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.2 | 0.8 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.1 | 1.0 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.1 | 0.6 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.1 | 0.1 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
| 0.1 | 4.0 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.1 | 2.4 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.1 | 1.4 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.1 | 1.6 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.1 | 0.8 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 1.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 2.3 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.1 | 1.8 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 1.2 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.1 | 0.8 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 4.0 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.1 | 1.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.1 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.1 | 1.6 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 1.3 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 0.1 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
| 0.1 | 1.3 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.1 | 1.5 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.1 | 1.0 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 1.4 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
| 0.1 | 1.4 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.1 | 0.1 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.1 | 1.2 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 2.2 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.1 | 0.3 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 0.9 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 2.1 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.1 | 0.8 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 0.5 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 1.3 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
| 0.1 | 0.2 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.1 | 0.4 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 1.3 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.1 | 0.1 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
| 0.1 | 1.5 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.1 | 1.5 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.1 | 2.8 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.1 | 0.2 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.1 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.1 | 1.1 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.1 | 1.1 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 1.4 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
| 0.1 | 5.7 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.1 | 0.4 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 0.5 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.1 | 6.3 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.1 | 0.5 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.1 | 2.1 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.1 | 1.1 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.1 | 0.2 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.1 | 1.0 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 0.2 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.1 | 1.5 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.1 | 0.8 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.1 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.1 | 1.2 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.1 | 0.4 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.1 | 1.1 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.1 | 0.3 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.1 | 0.9 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.1 | 0.9 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.1 | 0.5 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.1 | 0.9 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 0.7 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.1 | 0.6 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.1 | 4.0 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.1 | 0.2 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 1.0 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 0.2 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.1 | 2.5 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.1 | 0.1 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.1 | 0.7 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.1 | 0.4 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.1 | 1.2 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.1 | 1.5 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 1.0 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.3 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 0.3 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.6 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.2 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.5 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 0.8 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.0 | 0.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.7 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.3 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.0 | 0.5 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.9 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 0.8 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.4 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 3.4 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
| 0.0 | 0.3 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.0 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 0.3 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 0.5 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 0.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.0 | 0.2 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.6 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.2 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 2.1 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.0 | 0.6 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.0 | 1.8 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.5 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.1 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 0.1 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
| 0.0 | 0.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.2 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.0 | 0.2 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
| 0.0 | 0.5 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 4.4 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.3 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.0 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 0.3 | REACTOME NUCLEOTIDE BINDING DOMAIN LEUCINE RICH REPEAT CONTAINING RECEPTOR NLR SIGNALING PATHWAYS | Genes involved in Nucleotide-binding domain, leucine rich repeat containing receptor (NLR) signaling pathways |
| 0.0 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.3 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.4 | REACTOME MEIOSIS | Genes involved in Meiosis |
| 0.0 | 0.2 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
| 0.0 | 0.1 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.2 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.2 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.2 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.3 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 0.6 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.0 | 0.1 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.0 | 0.0 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.0 | 0.0 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
| 0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.5 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
| 0.0 | 0.0 | REACTOME CELL CYCLE CHECKPOINTS | Genes involved in Cell Cycle Checkpoints |
| 0.0 | 0.1 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.0 | 0.0 | REACTOME SYNTHESIS OF DNA | Genes involved in Synthesis of DNA |
| 0.0 | 0.1 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.0 | 0.4 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
| 0.0 | 0.4 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
| 0.0 | 0.2 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.0 | 0.2 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
| 0.0 | 0.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.1 | REACTOME HIV LIFE CYCLE | Genes involved in HIV Life Cycle |
| 0.0 | 0.0 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.4 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.1 | REACTOME METABOLISM OF MRNA | Genes involved in Metabolism of mRNA |
| 0.0 | 0.0 | REACTOME G1 S TRANSITION | Genes involved in G1/S Transition |
| 0.0 | 0.0 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |