| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Pbx2
|
ENSMUSG00000034673.8 | pre B cell leukemia homeobox 2 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr17_34595558_34596136 | Pbx2 | 387 | 0.573550 | -0.56 | 3.8e-06 | Click! |
| chr17_34595264_34595455 | Pbx2 | 101 | 0.875312 | -0.52 | 2.3e-05 | Click! |
| chr17_34594560_34594711 | Pbx2 | 825 | 0.275826 | -0.50 | 5.5e-05 | Click! |
| chr17_34594736_34595253 | Pbx2 | 466 | 0.502821 | -0.49 | 7.6e-05 | Click! |
| chr17_34593403_34593932 | Pbx2 | 272 | 0.711396 | -0.43 | 5.5e-04 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr8_54957303_54957776 | 7.64 |
Gm45263 |
predicted gene 45263 |
2280 |
0.24 |
| chr11_103102696_103105788 | 3.32 |
Acbd4 |
acyl-Coenzyme A binding domain containing 4 |
463 |
0.7 |
| chr9_44340460_44342952 | 3.26 |
Hmbs |
hydroxymethylbilane synthase |
473 |
0.51 |
| chr15_25415436_25415919 | 3.25 |
Gm48957 |
predicted gene, 48957 |
614 |
0.58 |
| chr12_46816152_46816702 | 2.99 |
Nova1 |
NOVA alternative splicing regulator 1 |
533 |
0.8 |
| chr4_82497680_82498758 | 2.88 |
Nfib |
nuclear factor I/B |
1097 |
0.54 |
| chr1_79439024_79439252 | 2.88 |
Scg2 |
secretogranin II |
904 |
0.68 |
| chr18_80257995_80258304 | 2.85 |
Slc66a2 |
solute carrier family 66 member 2 |
1831 |
0.22 |
| chr14_70627710_70629563 | 2.72 |
Dmtn |
dematin actin binding protein |
363 |
0.79 |
| chr3_88206822_88208169 | 2.71 |
Gm3764 |
predicted gene 3764 |
183 |
0.86 |
| chr4_24429901_24430719 | 2.70 |
Gm27243 |
predicted gene 27243 |
580 |
0.79 |
| chr17_90450817_90451178 | 2.69 |
Nrxn1 |
neurexin I |
3825 |
0.27 |
| chr3_4796861_4798079 | 2.62 |
1110015O18Rik |
RIKEN cDNA 1110015O18 gene |
88 |
0.98 |
| chr5_138756811_138757470 | 2.59 |
Fam20c |
family with sequence similarity 20, member C |
2053 |
0.31 |
| chr6_103512786_103513033 | 2.58 |
Chl1 |
cell adhesion molecule L1-like |
1579 |
0.36 |
| chr1_81080425_81080966 | 2.57 |
Nyap2 |
neuronal tyrosine-phophorylated phosphoinositide 3-kinase adaptor 2 |
3112 |
0.38 |
| chr13_20473087_20474265 | 2.56 |
Gm32036 |
predicted gene, 32036 |
186 |
0.89 |
| chr18_25751839_25752425 | 2.56 |
Celf4 |
CUGBP, Elav-like family member 4 |
560 |
0.81 |
| chr6_55680133_55680881 | 2.54 |
Neurod6 |
neurogenic differentiation 6 |
756 |
0.69 |
| chr16_49858087_49858734 | 2.51 |
Cd47 |
CD47 antigen (Rh-related antigen, integrin-associated signal transducer) |
2623 |
0.38 |
| chr5_75577269_75578512 | 2.48 |
Kit |
KIT proto-oncogene receptor tyrosine kinase |
2935 |
0.29 |
| chr12_29529828_29531185 | 2.48 |
Gm20208 |
predicted gene, 20208 |
609 |
0.74 |
| chr13_109927479_109928182 | 2.46 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
986 |
0.65 |
| chr15_85675690_85676550 | 2.45 |
Lncppara |
long noncoding RNA near Ppara |
22504 |
0.12 |
| chr2_25264308_25268001 | 2.40 |
Tprn |
taperin |
1410 |
0.14 |
| chr16_77597699_77598173 | 2.38 |
Mir99a |
microRNA 99a |
1000 |
0.31 |
| chr9_110051810_110053856 | 2.37 |
Map4 |
microtubule-associated protein 4 |
781 |
0.54 |
| chr7_87586513_87587584 | 2.37 |
Grm5 |
glutamate receptor, metabotropic 5 |
2650 |
0.4 |
| chr1_79439702_79440415 | 2.35 |
Scg2 |
secretogranin II |
16 |
0.98 |
| chr2_35060883_35061388 | 2.27 |
Hc |
hemolytic complement |
303 |
0.88 |
| chr18_10179191_10179739 | 2.24 |
Rock1 |
Rho-associated coiled-coil containing protein kinase 1 |
2327 |
0.2 |
| chr10_80270104_80272701 | 2.23 |
Dazap1 |
DAZ associated protein 1 |
6278 |
0.07 |
| chr5_54894754_54895184 | 2.23 |
Gm24235 |
predicted gene, 24235 |
67754 |
0.12 |
| chr18_64265796_64267074 | 2.20 |
St8sia3 |
ST8 alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase 3 |
47 |
0.97 |
| chr14_65423052_65425451 | 2.20 |
Pnoc |
prepronociceptin |
909 |
0.6 |
| chr1_112456627_112457016 | 2.19 |
Gm22331 |
predicted gene, 22331 |
11090 |
0.28 |
| chr2_172346743_172346988 | 2.18 |
Fam210b |
family with sequence similarity 210, member B |
1300 |
0.34 |
| chr6_103513736_103514218 | 2.15 |
Chl1 |
cell adhesion molecule L1-like |
2647 |
0.25 |
| chr11_80481116_80481835 | 2.14 |
Cdk5r1 |
cyclin-dependent kinase 5, regulatory subunit 1 (p35) |
4419 |
0.21 |
| chr5_98182043_98182194 | 2.09 |
Prdm8 |
PR domain containing 8 |
1140 |
0.44 |
| chr4_32862939_32864770 | 2.09 |
Ankrd6 |
ankyrin repeat domain 6 |
3171 |
0.24 |
| chr7_6286498_6287315 | 2.09 |
Zfp667 |
zinc finger protein 667 |
292 |
0.82 |
| chr10_79706079_79708046 | 2.09 |
Bsg |
basigin |
2492 |
0.11 |
| chr8_106336310_106337932 | 2.07 |
Smpd3 |
sphingomyelin phosphodiesterase 3, neutral |
867 |
0.61 |
| chr8_93814307_93815014 | 2.05 |
4930488L21Rik |
RIKEN cDNA 4930488L21 gene |
938 |
0.54 |
| chr1_23765216_23765741 | 2.03 |
B3gat2 |
beta-1,3-glucuronyltransferase 2 (glucuronosyltransferase S) |
3467 |
0.34 |
| chr3_158558212_158558396 | 2.00 |
Lrrc7 |
leucine rich repeat containing 7 |
3032 |
0.37 |
| chr2_32081622_32082932 | 1.99 |
Fam78a |
family with sequence similarity 78, member A |
1506 |
0.26 |
| chr6_83185720_83187846 | 1.98 |
Dctn1 |
dynactin 1 |
837 |
0.39 |
| chr6_113890285_113891668 | 1.98 |
Atp2b2 |
ATPase, Ca++ transporting, plasma membrane 2 |
394 |
0.85 |
| chr15_44746196_44747245 | 1.98 |
Sybu |
syntabulin (syntaxin-interacting) |
1068 |
0.56 |
| chr5_108674592_108675616 | 1.97 |
Slc26a1 |
solute carrier family 26 (sulfate transporter), member 1 |
319 |
0.8 |
| chr16_76318105_76318441 | 1.97 |
Nrip1 |
nuclear receptor interacting protein 1 |
5385 |
0.27 |
| chr6_39875361_39875680 | 1.96 |
Tmem178b |
transmembrane protein 178B |
2449 |
0.23 |
| chr1_143643975_143644626 | 1.96 |
Cdc73 |
cell division cycle 73, Paf1/RNA polymerase II complex component |
1775 |
0.33 |
| chr3_4799014_4799414 | 1.93 |
1110015O18Rik |
RIKEN cDNA 1110015O18 gene |
279 |
0.93 |
| chr7_115845884_115846115 | 1.91 |
Sox6 |
SRY (sex determining region Y)-box 6 |
106 |
0.98 |
| chr6_60827699_60828046 | 1.90 |
Snca |
synuclein, alpha |
316 |
0.9 |
| chr6_95665032_95665315 | 1.90 |
Suclg2 |
succinate-Coenzyme A ligase, GDP-forming, beta subunit |
7705 |
0.32 |
| chr3_107040280_107040795 | 1.90 |
AI504432 |
expressed sequence AI504432 |
1033 |
0.48 |
| chr3_107041271_107042100 | 1.90 |
AI504432 |
expressed sequence AI504432 |
2181 |
0.26 |
| chr13_83725791_83726324 | 1.89 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
2049 |
0.22 |
| chr8_54956899_54957247 | 1.87 |
Gpm6a |
glycoprotein m6a |
2230 |
0.24 |
| chr5_125056018_125058841 | 1.87 |
Gm42838 |
predicted gene 42838 |
412 |
0.71 |
| chrX_126694343_126694494 | 1.87 |
Gm7746 |
predicted gene 7746 |
81902 |
0.1 |
| chr1_155414821_155416000 | 1.87 |
Xpr1 |
xenotropic and polytropic retrovirus receptor 1 |
1919 |
0.42 |
| chr6_29696862_29697373 | 1.86 |
Tspan33 |
tetraspanin 33 |
2883 |
0.24 |
| chrX_126772197_126772348 | 1.86 |
4932411N23Rik |
RIKEN cDNA 4932411N23 gene |
43596 |
0.18 |
| chr2_75002409_75002897 | 1.86 |
n-R5s198 |
nuclear encoded rRNA 5S 198 |
67139 |
0.09 |
| chr4_134470009_134470160 | 1.84 |
Stmn1 |
stathmin 1 |
342 |
0.76 |
| chr12_4906528_4906703 | 1.83 |
Ubxn2a |
UBX domain protein 2A |
649 |
0.63 |
| chr1_9601164_9602408 | 1.83 |
Vxn |
vexin |
587 |
0.67 |
| chr16_77646908_77647363 | 1.81 |
C130023A14Rik |
RIKEN cDNA C130023A14 gene |
795 |
0.35 |
| chr8_65619789_65620230 | 1.78 |
Marchf1 |
membrane associated ring-CH-type finger 1 |
1484 |
0.52 |
| chr3_118431913_118432064 | 1.77 |
Gm26871 |
predicted gene, 26871 |
1664 |
0.24 |
| chr15_72805381_72805998 | 1.77 |
Peg13 |
paternally expressed 13 |
4635 |
0.28 |
| chr5_67845288_67845730 | 1.75 |
Gm42466 |
predicted gene 42466 |
1089 |
0.31 |
| chr19_53359518_53360664 | 1.75 |
Mxi1 |
MAX interactor 1, dimerization protein |
9932 |
0.13 |
| chr2_94245067_94246249 | 1.74 |
Mir670hg |
MIR670 host gene (non-protein coding) |
2320 |
0.21 |
| chr2_57283800_57284113 | 1.73 |
Gm13535 |
predicted gene 13535 |
8270 |
0.19 |
| chr5_107498136_107498752 | 1.71 |
Btbd8 |
BTB (POZ) domain containing 8 |
665 |
0.57 |
| chr9_45433206_45433653 | 1.70 |
4833428L15Rik |
RIKEN cDNA 4833428L15 gene |
1699 |
0.26 |
| chr12_116283592_116283802 | 1.70 |
Esyt2 |
extended synaptotagmin-like protein 2 |
2446 |
0.19 |
| chr6_115984719_115988278 | 1.68 |
Plxnd1 |
plexin D1 |
8507 |
0.15 |
| chr14_66347306_66348516 | 1.68 |
Stmn4 |
stathmin-like 4 |
3530 |
0.22 |
| chr19_31870232_31870385 | 1.68 |
A1cf |
APOBEC1 complementation factor |
1527 |
0.47 |
| chrX_145505275_145505544 | 1.67 |
Amot |
angiomotin |
228 |
0.96 |
| chr11_54596531_54596823 | 1.67 |
Rapgef6 |
Rap guanine nucleotide exchange factor (GEF) 6 |
503 |
0.82 |
| chr3_60474737_60475110 | 1.67 |
Mbnl1 |
muscleblind like splicing factor 1 |
1844 |
0.44 |
| chr3_60529662_60530216 | 1.66 |
Mbnl1 |
muscleblind like splicing factor 1 |
308 |
0.91 |
| chr11_61957992_61958176 | 1.66 |
Specc1 |
sperm antigen with calponin homology and coiled-coil domains 1 |
1269 |
0.35 |
| chr2_22624675_22625045 | 1.66 |
Gad2 |
glutamic acid decarboxylase 2 |
1556 |
0.29 |
| chr1_81077232_81078427 | 1.65 |
Nyap2 |
neuronal tyrosine-phophorylated phosphoinositide 3-kinase adaptor 2 |
246 |
0.96 |
| chr1_136624319_136624834 | 1.64 |
Platr23 |
pluripotency associated transcript 23 |
74 |
0.79 |
| chr18_76861943_76862120 | 1.64 |
Skor2 |
SKI family transcriptional corepressor 2 |
5626 |
0.25 |
| chr9_75681964_75682559 | 1.64 |
Scg3 |
secretogranin III |
1326 |
0.37 |
| chr7_87585368_87585534 | 1.63 |
Grm5 |
glutamate receptor, metabotropic 5 |
1053 |
0.67 |
| chr14_119140059_119140210 | 1.63 |
Hs6st3 |
heparan sulfate 6-O-sulfotransferase 3 |
1793 |
0.39 |
| chrX_23283125_23283785 | 1.63 |
Klhl13 |
kelch-like 13 |
1374 |
0.57 |
| chr16_77416103_77416788 | 1.63 |
Gm38071 |
predicted gene, 38071 |
179 |
0.91 |
| chr4_82496503_82496855 | 1.63 |
Nfib |
nuclear factor I/B |
2637 |
0.29 |
| chr5_116589538_116590511 | 1.62 |
Srrm4 |
serine/arginine repetitive matrix 4 |
1793 |
0.34 |
| chr18_35212708_35213458 | 1.62 |
Ctnna1 |
catenin (cadherin associated protein), alpha 1 |
1847 |
0.28 |
| chr8_54960693_54961010 | 1.62 |
Gm45263 |
predicted gene 45263 |
1032 |
0.48 |
| chr12_32058291_32058942 | 1.61 |
Prkar2b |
protein kinase, cAMP dependent regulatory, type II beta |
1973 |
0.34 |
| chr4_101552021_101552186 | 1.61 |
Dnajc6 |
DnaJ heat shock protein family (Hsp40) member C6 |
1509 |
0.47 |
| chr10_115819043_115819440 | 1.61 |
Tspan8 |
tetraspanin 8 |
1957 |
0.43 |
| chr11_87759834_87761999 | 1.60 |
Tspoap1 |
TSPO associated protein 1 |
329 |
0.75 |
| chr4_13755753_13756054 | 1.60 |
Runx1t1 |
RUNX1 translocation partner 1 |
4606 |
0.33 |
| chr8_54956010_54956394 | 1.60 |
Gpm6a |
glycoprotein m6a |
1359 |
0.38 |
| chr13_20475352_20475668 | 1.59 |
Gm32036 |
predicted gene, 32036 |
2020 |
0.27 |
| chr8_99412200_99412785 | 1.58 |
Cdh8 |
cadherin 8 |
3827 |
0.26 |
| chr1_155413773_155414214 | 1.58 |
Xpr1 |
xenotropic and polytropic retrovirus receptor 1 |
3336 |
0.31 |
| chr15_89213546_89214345 | 1.58 |
Ppp6r2 |
protein phosphatase 6, regulatory subunit 2 |
2344 |
0.17 |
| chr3_88217018_88217342 | 1.58 |
Gm25641 |
predicted gene, 25641 |
1484 |
0.16 |
| chrX_126771123_126771307 | 1.58 |
4932411N23Rik |
RIKEN cDNA 4932411N23 gene |
44653 |
0.18 |
| chr3_8512495_8512918 | 1.57 |
Stmn2 |
stathmin-like 2 |
3120 |
0.28 |
| chr4_24647223_24647491 | 1.57 |
Klhl32 |
kelch-like 32 |
28070 |
0.22 |
| chr11_100394864_100395998 | 1.56 |
Jup |
junction plakoglobin |
2318 |
0.13 |
| chrX_126776369_126776520 | 1.56 |
4932411N23Rik |
RIKEN cDNA 4932411N23 gene |
39424 |
0.19 |
| chr7_61309776_61310205 | 1.56 |
A230006K03Rik |
RIKEN cDNA A230006K03 gene |
1723 |
0.5 |
| chr11_31875035_31875396 | 1.55 |
Cpeb4 |
cytoplasmic polyadenylation element binding protein 4 |
1940 |
0.36 |
| chr15_27469478_27469900 | 1.55 |
Ank |
progressive ankylosis |
3012 |
0.21 |
| chr5_121008454_121009154 | 1.55 |
Rph3a |
rabphilin 3A |
262 |
0.91 |
| chr2_22628752_22629014 | 1.53 |
Gad2 |
glutamic acid decarboxylase 2 |
5579 |
0.14 |
| chrX_126768349_126768522 | 1.52 |
4932411N23Rik |
RIKEN cDNA 4932411N23 gene |
47433 |
0.17 |
| chr3_17795553_17795854 | 1.52 |
Mir124a-2 |
microRNA 124a-2 |
41 |
0.5 |
| chr9_111351872_111352351 | 1.51 |
Trank1 |
tetratricopeptide repeat and ankyrin repeat containing 1 |
22709 |
0.17 |
| chr14_31779007_31779265 | 1.51 |
Ankrd28 |
ankyrin repeat domain 28 |
1257 |
0.44 |
| chr1_131638462_131638811 | 1.51 |
Ctse |
cathepsin E |
142 |
0.95 |
| chrX_113304333_113304650 | 1.50 |
Dach2 |
dachshund family transcription factor 2 |
5857 |
0.24 |
| chr4_22481988_22482455 | 1.50 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
6145 |
0.18 |
| chrX_126756841_126756994 | 1.49 |
4932411N23Rik |
RIKEN cDNA 4932411N23 gene |
58951 |
0.14 |
| chr14_64574043_64574635 | 1.49 |
Mir124a-1hg |
Mir124-1 host gene (non-protein coding) |
12992 |
0.15 |
| chrX_126753889_126754040 | 1.49 |
4932411N23Rik |
RIKEN cDNA 4932411N23 gene |
61904 |
0.14 |
| chr18_53993214_53993438 | 1.49 |
Gm5507 |
predicted gene 5507 |
9005 |
0.24 |
| chr12_41483283_41485192 | 1.48 |
Lrrn3 |
leucine rich repeat protein 3, neuronal |
2194 |
0.36 |
| chr8_31915784_31916390 | 1.48 |
Nrg1 |
neuregulin 1 |
1563 |
0.42 |
| chr15_85680534_85681451 | 1.48 |
Lncppara |
long noncoding RNA near Ppara |
22781 |
0.12 |
| chr1_25226679_25227199 | 1.47 |
Adgrb3 |
adhesion G protein-coupled receptor B3 |
1887 |
0.26 |
| chr6_55338294_55340060 | 1.47 |
Aqp1 |
aquaporin 1 |
2745 |
0.22 |
| chrX_66657509_66657976 | 1.46 |
Slitrk2 |
SLIT and NTRK-like family, member 2 |
4735 |
0.2 |
| chr8_14384517_14385115 | 1.46 |
Dlgap2 |
DLG associated protein 2 |
2820 |
0.33 |
| chr6_86472473_86473358 | 1.46 |
A430078I02Rik |
RIKEN cDNA A430078I02 gene |
7855 |
0.08 |
| chrX_126766975_126767129 | 1.46 |
4932411N23Rik |
RIKEN cDNA 4932411N23 gene |
48816 |
0.17 |
| chrX_126747376_126747529 | 1.45 |
4932411N23Rik |
RIKEN cDNA 4932411N23 gene |
68416 |
0.12 |
| chr13_52528312_52528571 | 1.45 |
Diras2 |
DIRAS family, GTP-binding RAS-like 2 |
2838 |
0.37 |
| chr17_91090702_91091377 | 1.45 |
Nrxn1 |
neurexin I |
1694 |
0.28 |
| chr7_80146767_80147040 | 1.45 |
Gm45202 |
predicted gene 45202 |
8266 |
0.11 |
| chrX_126759872_126760026 | 1.45 |
4932411N23Rik |
RIKEN cDNA 4932411N23 gene |
55919 |
0.15 |
| chrX_126769750_126769901 | 1.45 |
4932411N23Rik |
RIKEN cDNA 4932411N23 gene |
46043 |
0.17 |
| chr12_15809639_15810314 | 1.44 |
Trib2 |
tribbles pseudokinase 2 |
6809 |
0.16 |
| chr4_155893812_155895517 | 1.44 |
Acap3 |
ArfGAP with coiled-coil, ankyrin repeat and PH domains 3 |
2352 |
0.11 |
| chr2_25290133_25293095 | 1.43 |
Grin1os |
glutamate receptor, ionotropic, NMDA1 (zeta 1), opposite strand |
394 |
0.57 |
| chr3_60527660_60528578 | 1.43 |
Mbnl1 |
muscleblind like splicing factor 1 |
9 |
0.98 |
| chrX_119427268_119427419 | 1.43 |
Gm14926 |
predicted gene 14926 |
14091 |
0.29 |
| chr1_136342616_136342801 | 1.42 |
Camsap2 |
calmodulin regulated spectrin-associated protein family, member 2 |
2990 |
0.22 |
| chr5_66677688_66677893 | 1.42 |
Uchl1 |
ubiquitin carboxy-terminal hydrolase L1 |
898 |
0.41 |
| chr1_25827305_25827886 | 1.42 |
Adgrb3 |
adhesion G protein-coupled receptor B3 |
835 |
0.43 |
| chr9_48338591_48338742 | 1.42 |
Nxpe2 |
neurexophilin and PC-esterase domain family, member 2 |
2168 |
0.33 |
| chr13_84064321_84064873 | 1.42 |
Gm17750 |
predicted gene, 17750 |
175 |
0.96 |
| chr14_108909489_108909909 | 1.42 |
Slitrk1 |
SLIT and NTRK-like family, member 1 |
4459 |
0.37 |
| chrX_126758491_126758642 | 1.42 |
4932411N23Rik |
RIKEN cDNA 4932411N23 gene |
57302 |
0.15 |
| chrX_126692940_126693091 | 1.42 |
Gm7746 |
predicted gene 7746 |
80499 |
0.1 |
| chrX_126765595_126765748 | 1.41 |
4932411N23Rik |
RIKEN cDNA 4932411N23 gene |
50197 |
0.16 |
| chrX_126751120_126751271 | 1.41 |
4932411N23Rik |
RIKEN cDNA 4932411N23 gene |
64673 |
0.13 |
| chr6_32584464_32585789 | 1.40 |
Plxna4 |
plexin A4 |
3066 |
0.3 |
| chr8_34888384_34889150 | 1.40 |
Tnks |
tankyrase, TRF1-interacting ankyrin-related ADP-ribose polymerase |
1384 |
0.49 |
| chr13_8208366_8208661 | 1.40 |
Adarb2 |
adenosine deaminase, RNA-specific, B2 |
5591 |
0.19 |
| chr4_109342938_109343450 | 1.40 |
Eps15 |
epidermal growth factor receptor pathway substrate 15 |
59 |
0.97 |
| chr3_89092211_89093650 | 1.40 |
Rusc1 |
RUN and SH3 domain containing 1 |
360 |
0.7 |
| chr2_70560060_70560587 | 1.39 |
Gad1 |
glutamate decarboxylase 1 |
1719 |
0.27 |
| chr9_113970028_113970753 | 1.39 |
Gm47950 |
predicted gene, 47950 |
608 |
0.61 |
| chr10_49784845_49785206 | 1.39 |
Grik2 |
glutamate receptor, ionotropic, kainate 2 (beta 2) |
1616 |
0.33 |
| chr4_125493147_125493641 | 1.38 |
Grik3 |
glutamate receptor, ionotropic, kainate 3 |
2694 |
0.27 |
| chr5_117241784_117242411 | 1.38 |
Taok3 |
TAO kinase 3 |
1637 |
0.3 |
| chr7_144238658_144240098 | 1.38 |
Shank2 |
SH3 and multiple ankyrin repeat domains 2 |
653 |
0.8 |
| chr2_180890379_180892235 | 1.38 |
Gm14342 |
predicted gene 14342 |
1647 |
0.19 |
| chr2_65565600_65566271 | 1.37 |
Scn3a |
sodium channel, voltage-gated, type III, alpha |
1557 |
0.45 |
| chr16_72030424_72030864 | 1.37 |
Gm49667 |
predicted gene, 49667 |
151600 |
0.04 |
| chr5_131532921_131534054 | 1.37 |
Auts2 |
autism susceptibility candidate 2 |
910 |
0.58 |
| chr3_108084985_108086653 | 1.37 |
Gm12500 |
predicted gene 12500 |
157 |
0.62 |
| chr1_143641893_143642230 | 1.37 |
Cdc73 |
cell division cycle 73, Paf1/RNA polymerase II complex component |
464 |
0.75 |
| chr10_101313996_101314147 | 1.37 |
Gm19233 |
predicted gene, 19233 |
42450 |
0.21 |
| chr4_12918002_12918153 | 1.37 |
Triqk |
triple QxxK/R motif containing |
110 |
0.98 |
| chr8_33747278_33748028 | 1.36 |
Smim18 |
small integral membrane protein 18 |
117 |
0.95 |
| chr6_3398628_3399056 | 1.36 |
Samd9l |
sterile alpha motif domain containing 9-like |
730 |
0.64 |
| chr9_110053895_110054422 | 1.36 |
Map4 |
microtubule-associated protein 4 |
2106 |
0.22 |
| chr15_96282124_96282520 | 1.36 |
2610037D02Rik |
RIKEN cDNA 2610037D02 gene |
1286 |
0.45 |
| chr8_54954519_54955779 | 1.36 |
Gpm6a |
glycoprotein m6a |
306 |
0.88 |
| chr3_13948583_13948940 | 1.35 |
Ralyl |
RALY RNA binding protein-like |
2350 |
0.42 |
| chr19_7421074_7423945 | 1.35 |
Mir6991 |
microRNA 6991 |
64 |
0.94 |
| chr18_42450424_42450798 | 1.35 |
Gm16415 |
predicted pseudogene 16415 |
9592 |
0.18 |
| chr1_190464014_190464367 | 1.34 |
Gm47294 |
predicted gene, 47294 |
18826 |
0.19 |
| chr5_114569026_114570120 | 1.34 |
Fam222a |
family with sequence similarity 222, member A |
1556 |
0.35 |
| chr14_75963713_75963971 | 1.34 |
Gm25517 |
predicted gene, 25517 |
8777 |
0.18 |
| chr15_40657305_40658194 | 1.34 |
Zfpm2 |
zinc finger protein, multitype 2 |
2398 |
0.42 |
| chr18_44554485_44554717 | 1.34 |
Mcc |
mutated in colorectal cancers |
35085 |
0.2 |
| chr10_20528856_20529318 | 1.34 |
Gm17229 |
predicted gene 17229 |
9319 |
0.21 |
| chr15_36322257_36323004 | 1.33 |
Rpl7a-ps3 |
ribosomal protein L7A, pseudogene 3 |
13686 |
0.12 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.3 | 4.0 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 1.1 | 3.2 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 1.1 | 3.2 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 1.0 | 4.8 | GO:0021778 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.8 | 2.5 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
| 0.8 | 4.9 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
| 0.8 | 2.4 | GO:0045914 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
| 0.8 | 2.4 | GO:0097503 | sialylation(GO:0097503) |
| 0.8 | 4.6 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
| 0.7 | 2.0 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.7 | 2.0 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
| 0.7 | 3.3 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
| 0.6 | 1.9 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
| 0.6 | 2.4 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.6 | 1.7 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.6 | 1.7 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.5 | 1.6 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.5 | 1.5 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.5 | 3.4 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.5 | 1.9 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
| 0.5 | 4.9 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.5 | 1.9 | GO:0008228 | opsonization(GO:0008228) |
| 0.5 | 2.9 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.5 | 0.5 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
| 0.5 | 2.3 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.4 | 3.6 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.4 | 1.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.4 | 1.8 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.4 | 1.3 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.4 | 1.3 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.4 | 1.3 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.4 | 1.2 | GO:0030242 | pexophagy(GO:0030242) |
| 0.4 | 9.3 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.4 | 1.2 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.4 | 1.2 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.4 | 1.2 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.4 | 1.6 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.4 | 1.2 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.4 | 1.2 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.4 | 1.2 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
| 0.4 | 1.5 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.4 | 0.8 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.4 | 1.9 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.4 | 1.1 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 0.4 | 3.4 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
| 0.4 | 0.4 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.4 | 1.1 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 0.4 | 1.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 0.4 | 1.1 | GO:0015684 | ferrous iron transport(GO:0015684) |
| 0.4 | 1.1 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.4 | 2.5 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.4 | 0.7 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.4 | 0.4 | GO:0032672 | regulation of interleukin-3 production(GO:0032672) |
| 0.4 | 1.1 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.4 | 3.9 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.3 | 1.0 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.3 | 0.3 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.3 | 8.3 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.3 | 1.0 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.3 | 1.4 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 0.3 | 1.0 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.3 | 0.7 | GO:0021586 | pons maturation(GO:0021586) |
| 0.3 | 1.0 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.3 | 1.3 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.3 | 0.7 | GO:0043622 | cortical microtubule organization(GO:0043622) |
| 0.3 | 1.3 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.3 | 1.9 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.3 | 0.3 | GO:0010915 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
| 0.3 | 1.6 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.3 | 0.6 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.3 | 2.8 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.3 | 1.5 | GO:0034091 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
| 0.3 | 3.1 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.3 | 0.9 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.3 | 0.9 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.3 | 3.4 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.3 | 1.5 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.3 | 0.9 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.3 | 0.6 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
| 0.3 | 3.0 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
| 0.3 | 2.7 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.3 | 0.6 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.3 | 1.2 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.3 | 0.9 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 0.3 | 0.9 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.3 | 0.6 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.3 | 0.9 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
| 0.3 | 1.2 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.3 | 0.6 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.3 | 1.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.3 | 0.6 | GO:0033239 | negative regulation of cellular amine metabolic process(GO:0033239) |
| 0.3 | 0.3 | GO:0072319 | vesicle uncoating(GO:0072319) |
| 0.3 | 0.8 | GO:0001812 | positive regulation of type I hypersensitivity(GO:0001812) |
| 0.3 | 0.3 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.3 | 0.5 | GO:0007208 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) |
| 0.3 | 0.8 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.3 | 0.3 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
| 0.3 | 1.6 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
| 0.3 | 0.8 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.3 | 0.8 | GO:0072025 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
| 0.3 | 1.9 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.3 | 0.8 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.3 | 1.6 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.3 | 0.5 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.3 | 0.8 | GO:0031635 | adenylate cyclase-inhibiting opioid receptor signaling pathway(GO:0031635) |
| 0.3 | 0.8 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.3 | 1.3 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.3 | 1.0 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.3 | 1.0 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.3 | 1.0 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.3 | 2.1 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.3 | 1.8 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.3 | 1.0 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.3 | 2.5 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.3 | 0.8 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
| 0.3 | 2.8 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.2 | 4.2 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.2 | 0.5 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.2 | 0.5 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.2 | 0.7 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.2 | 1.0 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.2 | 0.5 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.2 | 0.5 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.2 | 1.2 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.2 | 0.2 | GO:2000561 | regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) |
| 0.2 | 1.2 | GO:0051095 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.2 | 1.2 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.2 | 0.7 | GO:2000850 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.2 | 0.5 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.2 | 0.7 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
| 0.2 | 1.7 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
| 0.2 | 0.7 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.2 | 0.7 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.2 | 0.9 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.2 | 0.7 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.2 | 0.7 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.2 | 0.9 | GO:0042424 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
| 0.2 | 0.7 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.2 | 0.2 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
| 0.2 | 0.7 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.2 | 0.4 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
| 0.2 | 0.4 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.2 | 1.1 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.2 | 0.4 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
| 0.2 | 1.5 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.2 | 0.7 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
| 0.2 | 2.4 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
| 0.2 | 1.3 | GO:0015816 | glycine transport(GO:0015816) |
| 0.2 | 0.6 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.2 | 0.6 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.2 | 1.9 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.2 | 0.4 | GO:0043465 | regulation of fermentation(GO:0043465) regulation of NAD metabolic process(GO:1902688) regulation of glucose catabolic process to lactate via pyruvate(GO:1904023) |
| 0.2 | 1.9 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.2 | 0.2 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.2 | 0.2 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.2 | 1.7 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.2 | 0.8 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.2 | 0.4 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
| 0.2 | 1.2 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.2 | 1.8 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.2 | 0.2 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.2 | 0.6 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.2 | 0.2 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
| 0.2 | 4.6 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
| 0.2 | 0.4 | GO:0022009 | central nervous system vasculogenesis(GO:0022009) |
| 0.2 | 0.4 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
| 0.2 | 0.6 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.2 | 1.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.2 | 0.8 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.2 | 0.6 | GO:0002877 | regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
| 0.2 | 0.2 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.2 | 0.8 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.2 | 0.6 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.2 | 0.2 | GO:0019064 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.2 | 0.2 | GO:1904861 | excitatory synapse assembly(GO:1904861) |
| 0.2 | 1.0 | GO:0006007 | glucose catabolic process(GO:0006007) |
| 0.2 | 0.6 | GO:0052041 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
| 0.2 | 0.4 | GO:1901033 | positive regulation of response to reactive oxygen species(GO:1901033) regulation of superoxide dismutase activity(GO:1901668) positive regulation of superoxide dismutase activity(GO:1901671) positive regulation of removal of superoxide radicals(GO:1904833) |
| 0.2 | 0.4 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.2 | 0.8 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.2 | 0.6 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.2 | 1.3 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) |
| 0.2 | 0.6 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.2 | 0.6 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.2 | 0.4 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
| 0.2 | 0.7 | GO:0050812 | regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.2 | 1.9 | GO:1902547 | regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902547) |
| 0.2 | 0.6 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.2 | 0.6 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 0.2 | 0.6 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
| 0.2 | 0.4 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
| 0.2 | 0.2 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
| 0.2 | 1.6 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.2 | 0.5 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 0.2 | 0.2 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.2 | 0.4 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
| 0.2 | 2.9 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.2 | 1.3 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.2 | 0.7 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.2 | 0.7 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.2 | 0.7 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.2 | 0.9 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.2 | 0.2 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.2 | 1.1 | GO:1902992 | negative regulation of amyloid precursor protein catabolic process(GO:1902992) |
| 0.2 | 0.7 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.2 | 0.5 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
| 0.2 | 0.4 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.2 | 1.6 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.2 | 1.8 | GO:0045188 | regulation of circadian sleep/wake cycle, non-REM sleep(GO:0045188) |
| 0.2 | 1.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.2 | 0.5 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.2 | 0.5 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.2 | 1.2 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.2 | 0.5 | GO:0034088 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.2 | 0.5 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.2 | 1.4 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.2 | 0.7 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.2 | 1.0 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.2 | 0.5 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.2 | 0.7 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.2 | 1.5 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.2 | 1.2 | GO:0097286 | iron ion import(GO:0097286) |
| 0.2 | 0.5 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.2 | 0.3 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.2 | 0.5 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.2 | 0.8 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.2 | 0.7 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.2 | 0.5 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.2 | 0.5 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.2 | 0.5 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.2 | 0.5 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.2 | 0.3 | GO:0015677 | copper ion import(GO:0015677) |
| 0.2 | 0.8 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 0.2 | 0.5 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.2 | 0.3 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
| 0.2 | 0.2 | GO:0042321 | negative regulation of circadian sleep/wake cycle, sleep(GO:0042321) |
| 0.2 | 0.5 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.2 | 0.3 | GO:0071733 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.2 | 0.5 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.2 | 0.5 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.2 | 0.6 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 0.2 | 0.5 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.2 | 0.6 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.2 | 0.5 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
| 0.2 | 0.5 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.2 | 0.5 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.2 | 0.6 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.2 | 1.6 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.2 | 0.9 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.2 | 0.3 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.2 | 0.2 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.2 | 0.6 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.2 | 0.5 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.2 | 1.4 | GO:0019433 | triglyceride catabolic process(GO:0019433) |
| 0.2 | 0.8 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.2 | 0.6 | GO:0015074 | DNA integration(GO:0015074) |
| 0.2 | 1.1 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.2 | 0.3 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.2 | 0.5 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.2 | 0.5 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.2 | 0.5 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
| 0.2 | 1.8 | GO:0006828 | manganese ion transport(GO:0006828) |
| 0.2 | 0.3 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.2 | 0.8 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.2 | 0.3 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
| 0.2 | 0.5 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.2 | 0.6 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.2 | 0.5 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
| 0.2 | 0.2 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.2 | 0.3 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.2 | 0.6 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.2 | 0.9 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.1 | 0.9 | GO:0019732 | antifungal humoral response(GO:0019732) |
| 0.1 | 0.3 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.1 | 0.4 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.1 | 1.2 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.7 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.1 | 0.3 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.1 | 0.9 | GO:0051489 | regulation of filopodium assembly(GO:0051489) |
| 0.1 | 0.1 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.1 | 1.0 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.1 | 0.6 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.1 | 0.7 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.1 | 0.6 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 | 0.9 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.1 | 1.3 | GO:0043090 | amino acid import(GO:0043090) |
| 0.1 | 0.3 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.1 | 0.3 | GO:0090259 | regulation of retinal ganglion cell axon guidance(GO:0090259) |
| 0.1 | 0.3 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.1 | 0.7 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.1 | 0.3 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
| 0.1 | 0.3 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.1 | 0.4 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.1 | 1.0 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.1 | 0.1 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.1 | 0.7 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 | 0.4 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.1 | 0.7 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.1 | 0.3 | GO:0032762 | mast cell cytokine production(GO:0032762) regulation of mast cell cytokine production(GO:0032763) |
| 0.1 | 0.4 | GO:2000650 | negative regulation of sodium ion transmembrane transport(GO:1902306) negative regulation of sodium ion transmembrane transporter activity(GO:2000650) |
| 0.1 | 1.0 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 0.7 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 0.4 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 1.0 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
| 0.1 | 1.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 | 0.4 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 0.5 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.1 | 0.1 | GO:0018377 | protein myristoylation(GO:0018377) |
| 0.1 | 0.7 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
| 0.1 | 0.5 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.1 | 0.3 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.1 | 0.3 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.1 | 0.4 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.1 | 0.4 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.1 | 0.9 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.1 | 0.3 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.1 | 0.4 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.1 | 0.7 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.1 | 0.8 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.1 | 0.5 | GO:0030202 | heparin metabolic process(GO:0030202) |
| 0.1 | 0.4 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.1 | 0.3 | GO:0033131 | regulation of glucokinase activity(GO:0033131) regulation of hexokinase activity(GO:1903299) |
| 0.1 | 0.9 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.1 | 0.3 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.1 | 0.5 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.1 | 1.8 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.1 | 0.4 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
| 0.1 | 0.1 | GO:0006598 | polyamine catabolic process(GO:0006598) |
| 0.1 | 0.1 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
| 0.1 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.1 | 0.4 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
| 0.1 | 0.8 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.1 | 0.4 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.1 | 1.6 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.1 | 0.5 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.1 | 0.9 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.1 | 0.7 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 0.4 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.1 | 0.6 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.1 | 2.2 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.1 | 0.6 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.1 | 0.1 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
| 0.1 | 0.1 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.1 | 1.0 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.1 | 0.7 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.1 | 0.2 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.1 | 0.5 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.1 | 0.5 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.1 | 0.1 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.1 | 0.5 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 | 0.6 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
| 0.1 | 0.2 | GO:0045964 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.1 | 0.1 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
| 0.1 | 1.2 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
| 0.1 | 0.2 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 | 0.4 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.1 | 0.4 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
| 0.1 | 0.2 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.1 | 1.1 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.1 | 0.4 | GO:0090239 | regulation of histone H4 acetylation(GO:0090239) |
| 0.1 | 0.6 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.1 | 0.6 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
| 0.1 | 0.5 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 | 0.7 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.1 | 0.4 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.1 | 1.3 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.1 | 0.9 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 | 0.5 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.1 | 0.2 | GO:0042117 | monocyte activation(GO:0042117) |
| 0.1 | 0.3 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.1 | 0.6 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
| 0.1 | 0.5 | GO:0033700 | phospholipid efflux(GO:0033700) |
| 0.1 | 0.2 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
| 0.1 | 0.2 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.1 | 1.0 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 | 0.4 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.1 | 0.3 | GO:0033091 | positive regulation of immature T cell proliferation(GO:0033091) |
| 0.1 | 0.1 | GO:0046958 | nonassociative learning(GO:0046958) habituation(GO:0046959) |
| 0.1 | 0.8 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.1 | 1.8 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.1 | 0.2 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.1 | 0.4 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.1 | 2.6 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.1 | 1.1 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.1 | 0.2 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
| 0.1 | 0.5 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.1 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.1 | 0.3 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) |
| 0.1 | 1.7 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.1 | 0.9 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.1 | 0.4 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.1 | 0.1 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
| 0.1 | 0.3 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.1 | 0.6 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.1 | 0.2 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.1 | 0.3 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.1 | 1.0 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.1 | 0.3 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.1 | 0.3 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
| 0.1 | 0.2 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.1 | 0.3 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.1 | 0.5 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.1 | 0.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.9 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.1 | 0.4 | GO:0009217 | purine deoxyribonucleoside triphosphate catabolic process(GO:0009217) |
| 0.1 | 0.3 | GO:1904219 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.1 | 0.2 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
| 0.1 | 0.9 | GO:0030889 | negative regulation of B cell proliferation(GO:0030889) |
| 0.1 | 2.2 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.1 | 0.3 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.1 | 0.2 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.1 | 1.2 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 | 0.5 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.1 | 0.6 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.1 | 1.2 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
| 0.1 | 1.7 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.1 | 0.8 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.1 | 0.2 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.1 | 1.0 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 | 0.2 | GO:0061198 | fungiform papilla formation(GO:0061198) |
| 0.1 | 0.2 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
| 0.1 | 0.8 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.1 | 0.3 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.1 | 0.5 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.1 | 0.2 | GO:0071472 | cellular response to salt stress(GO:0071472) |
| 0.1 | 0.2 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.1 | 0.6 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.1 | 0.3 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.1 | 1.2 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.1 | 0.1 | GO:0090148 | membrane fission(GO:0090148) |
| 0.1 | 0.3 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.1 | 0.3 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.1 | 0.2 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.1 | 0.2 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
| 0.1 | 0.2 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.1 | 0.2 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.1 | 0.6 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.1 | 0.5 | GO:0006983 | ER overload response(GO:0006983) |
| 0.1 | 0.5 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.1 | 0.2 | GO:0046473 | phosphatidic acid metabolic process(GO:0046473) |
| 0.1 | 0.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.1 | 0.3 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.1 | 0.7 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.1 | 0.7 | GO:0048757 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.1 | 0.4 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 | 0.5 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.1 | 0.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.1 | 1.3 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 1.1 | GO:0051205 | protein insertion into membrane(GO:0051205) |
| 0.1 | 0.5 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.1 | 0.2 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
| 0.1 | 0.3 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
| 0.1 | 0.7 | GO:0099587 | inorganic cation import into cell(GO:0098659) inorganic ion import into cell(GO:0099587) |
| 0.1 | 0.5 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
| 0.1 | 2.1 | GO:1900047 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
| 0.1 | 0.2 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.1 | 0.5 | GO:0007035 | vacuolar acidification(GO:0007035) |
| 0.1 | 1.1 | GO:0007616 | long-term memory(GO:0007616) |
| 0.1 | 0.3 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
| 0.1 | 0.5 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.1 | 0.1 | GO:0035483 | gastric emptying(GO:0035483) |
| 0.1 | 1.1 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.1 | 0.3 | GO:0033762 | response to glucagon(GO:0033762) |
| 0.1 | 0.1 | GO:1902065 | response to L-glutamate(GO:1902065) |
| 0.1 | 0.2 | GO:0043400 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) positive regulation of cortisol secretion(GO:0051464) positive regulation of glucocorticoid secretion(GO:2000851) |
| 0.1 | 0.1 | GO:1904179 | positive regulation of adipose tissue development(GO:1904179) |
| 0.1 | 0.3 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.1 | 0.5 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 | 0.2 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 | 0.1 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.1 | 0.2 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.1 | 0.3 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.1 | 0.5 | GO:0042428 | serotonin metabolic process(GO:0042428) |
| 0.1 | 0.3 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.1 | 1.8 | GO:0044705 | mating behavior(GO:0007617) multi-organism reproductive behavior(GO:0044705) |
| 0.1 | 0.9 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.6 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 0.4 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.4 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.1 | 0.1 | GO:0097360 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.1 | 0.1 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.1 | 0.6 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 0.3 | GO:0045332 | phospholipid translocation(GO:0045332) |
| 0.1 | 0.2 | GO:0006085 | acetyl-CoA biosynthetic process(GO:0006085) |
| 0.1 | 0.9 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
| 0.1 | 0.3 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 | 0.1 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
| 0.1 | 0.3 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
| 0.1 | 0.4 | GO:0048242 | epinephrine secretion(GO:0048242) |
| 0.1 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.1 | 0.7 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
| 0.1 | 0.8 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 | 0.2 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
| 0.1 | 0.4 | GO:2000765 | regulation of cytoplasmic translation(GO:2000765) |
| 0.1 | 0.3 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
| 0.1 | 0.2 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.1 | 0.2 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.1 | 0.2 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.1 | 0.2 | GO:2000301 | negative regulation of synaptic vesicle transport(GO:1902804) negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.1 | 0.2 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
| 0.1 | 0.2 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
| 0.1 | 2.1 | GO:0007019 | microtubule depolymerization(GO:0007019) |
| 0.1 | 0.3 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.1 | 0.4 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
| 0.1 | 0.4 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
| 0.1 | 0.2 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.1 | 0.3 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
| 0.1 | 0.2 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.1 | 0.3 | GO:0032366 | intracellular lipid transport(GO:0032365) intracellular sterol transport(GO:0032366) |
| 0.1 | 0.2 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 0.1 | 0.2 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.1 | 0.2 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.1 | 0.3 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.1 | 0.4 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
| 0.1 | 0.3 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.1 | 0.2 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.1 | 0.2 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.1 | 0.2 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.1 | 2.5 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.1 | 0.2 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.1 | 0.4 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.1 | 1.0 | GO:0042407 | cristae formation(GO:0042407) |
| 0.1 | 0.1 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.1 | 0.1 | GO:0030730 | sequestering of triglyceride(GO:0030730) |
| 0.1 | 0.3 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.1 | 0.2 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) glandular epithelial cell maturation(GO:0002071) |
| 0.1 | 0.2 | GO:0042268 | regulation of cytolysis(GO:0042268) |
| 0.1 | 0.4 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.1 | 0.2 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
| 0.1 | 0.2 | GO:0046618 | drug export(GO:0046618) |
| 0.1 | 0.4 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.1 | 0.3 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 | 0.2 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 0.1 | 0.2 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.1 | 0.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 | 0.2 | GO:0031077 | post-embryonic camera-type eye development(GO:0031077) |
| 0.1 | 0.5 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.1 | 0.1 | GO:0071888 | macrophage apoptotic process(GO:0071888) regulation of macrophage apoptotic process(GO:2000109) |
| 0.1 | 0.8 | GO:0031442 | positive regulation of mRNA 3'-end processing(GO:0031442) |
| 0.1 | 0.5 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.1 | 0.5 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 | 0.2 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.1 | 0.4 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.1 | 0.1 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
| 0.1 | 0.1 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
| 0.1 | 0.2 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.1 | 0.7 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 1.0 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 0.4 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.1 | 0.1 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 0.1 | 0.1 | GO:1900084 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.1 | 0.1 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.1 | 0.2 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
| 0.1 | 0.1 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
| 0.1 | 0.2 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.1 | 0.1 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.1 | 0.2 | GO:0046060 | dATP metabolic process(GO:0046060) |
| 0.1 | 0.2 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.1 | 1.4 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.1 | 0.3 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
| 0.1 | 0.1 | GO:0031446 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 0.1 | 0.6 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.1 | 0.4 | GO:1904415 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.1 | 0.3 | GO:0051156 | glucose 6-phosphate metabolic process(GO:0051156) |
| 0.1 | 0.2 | GO:0015705 | iodide transport(GO:0015705) |
| 0.1 | 0.3 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.1 | 1.3 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.1 | 0.4 | GO:2000257 | regulation of complement activation(GO:0030449) regulation of protein activation cascade(GO:2000257) |
| 0.1 | 0.1 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
| 0.1 | 0.1 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
| 0.1 | 0.4 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.1 | 0.4 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.1 | 0.8 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
| 0.1 | 0.3 | GO:1903961 | positive regulation of anion transmembrane transport(GO:1903961) |
| 0.1 | 0.7 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.1 | 0.3 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
| 0.1 | 0.1 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.1 | 0.1 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.1 | 2.8 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
| 0.1 | 0.1 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 0.1 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.1 | 0.1 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
| 0.1 | 0.1 | GO:0032493 | response to bacterial lipoprotein(GO:0032493) |
| 0.1 | 0.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.1 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.1 | 0.4 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.1 | 0.1 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
| 0.1 | 0.5 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.1 | 0.2 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.1 | 0.3 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.1 | 0.2 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 | 0.7 | GO:0032743 | positive regulation of interleukin-2 production(GO:0032743) |
| 0.1 | 0.7 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.1 | 1.2 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.1 | 0.5 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.1 | 0.3 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.1 | 0.1 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
| 0.1 | 0.2 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 | 0.8 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.1 | 0.3 | GO:0044827 | modulation by host of viral genome replication(GO:0044827) |
| 0.1 | 0.3 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
| 0.1 | 0.8 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 | 1.3 | GO:0047496 | vesicle transport along microtubule(GO:0047496) |
| 0.1 | 0.6 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.1 | 0.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.1 | 0.1 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.1 | 1.4 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.1 | 0.1 | GO:1903998 | regulation of eating behavior(GO:1903998) |
| 0.1 | 0.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.1 | 0.3 | GO:2001044 | regulation of integrin-mediated signaling pathway(GO:2001044) |
| 0.1 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 | 0.2 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
| 0.1 | 2.7 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.1 | 0.2 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.1 | 0.2 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.1 | 0.8 | GO:1901032 | negative regulation of response to reactive oxygen species(GO:1901032) |
| 0.1 | 0.1 | GO:0042253 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
| 0.1 | 0.2 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.1 | 0.1 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.1 | 0.3 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 | 0.1 | GO:0090671 | RNA localization to Cajal body(GO:0090670) telomerase RNA localization to Cajal body(GO:0090671) telomerase RNA localization(GO:0090672) |
| 0.1 | 0.8 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.1 | 0.2 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.1 | 0.3 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.3 | GO:0009651 | response to salt stress(GO:0009651) |
| 0.1 | 0.3 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.1 | 0.6 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 | 0.1 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.1 | 0.6 | GO:0006337 | nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) protein-DNA complex disassembly(GO:0032986) |
| 0.1 | 0.1 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.1 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.3 | GO:0006991 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.1 | 0.1 | GO:0072423 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) |
| 0.1 | 0.6 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.1 | 0.4 | GO:0008105 | asymmetric protein localization(GO:0008105) |
| 0.1 | 0.3 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 0.6 | GO:0006577 | amino-acid betaine metabolic process(GO:0006577) |
| 0.1 | 0.4 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.1 | 0.1 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
| 0.1 | 0.2 | GO:0071047 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.1 | 0.4 | GO:0006559 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.1 | 0.6 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 0.1 | 0.6 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
| 0.1 | 0.2 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
| 0.1 | 0.1 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.1 | 0.3 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
| 0.1 | 0.2 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.1 | 0.4 | GO:0006273 | lagging strand elongation(GO:0006273) |
| 0.1 | 0.4 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.1 | 0.7 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
| 0.1 | 0.3 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.1 | 1.1 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 | 0.2 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
| 0.1 | 0.1 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
| 0.1 | 0.1 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
| 0.1 | 0.2 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
| 0.1 | 0.2 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.1 | 0.5 | GO:0042094 | interleukin-2 biosynthetic process(GO:0042094) |
| 0.1 | 0.4 | GO:0048169 | regulation of long-term neuronal synaptic plasticity(GO:0048169) |
| 0.1 | 0.2 | GO:0072672 | neutrophil extravasation(GO:0072672) |
| 0.1 | 0.1 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.1 | 0.2 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
| 0.1 | 0.2 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.1 | 0.2 | GO:0045006 | DNA deamination(GO:0045006) |
| 0.1 | 0.8 | GO:0048260 | positive regulation of receptor-mediated endocytosis(GO:0048260) |
| 0.1 | 0.2 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.1 | 0.1 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.1 | 0.2 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.1 | 0.3 | GO:0046464 | neutral lipid catabolic process(GO:0046461) acylglycerol catabolic process(GO:0046464) |
| 0.1 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.1 | 0.2 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.1 | 0.1 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
| 0.1 | 0.6 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
| 0.1 | 0.6 | GO:0045540 | regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.1 | 0.4 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.1 | 0.5 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
| 0.1 | 0.3 | GO:0032373 | positive regulation of sterol transport(GO:0032373) positive regulation of cholesterol transport(GO:0032376) |
| 0.1 | 0.3 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.1 | 0.3 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.1 | 1.0 | GO:1902653 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
| 0.1 | 0.1 | GO:0035524 | proline transmembrane transport(GO:0035524) |
| 0.1 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.1 | 0.3 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 | 0.5 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.1 | 0.4 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
| 0.1 | 0.3 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
| 0.1 | 0.2 | GO:0090155 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.1 | 0.1 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
| 0.1 | 0.1 | GO:0034204 | lipid translocation(GO:0034204) |
| 0.1 | 0.4 | GO:0031113 | regulation of microtubule polymerization(GO:0031113) |
| 0.1 | 0.2 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.1 | 0.8 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.1 | 0.2 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
| 0.1 | 0.9 | GO:0006513 | protein monoubiquitination(GO:0006513) |
| 0.1 | 0.2 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.1 | 0.3 | GO:0042574 | retinal metabolic process(GO:0042574) |
| 0.1 | 0.2 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.1 | 0.6 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 1.2 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) |
| 0.1 | 0.2 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.1 | 0.1 | GO:2000564 | regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) positive regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000566) |
| 0.1 | 0.2 | GO:0044845 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
| 0.1 | 0.1 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.1 | 0.2 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 | 0.1 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) regulation of chloride transport(GO:2001225) |
| 0.1 | 0.2 | GO:0002349 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.1 | 1.1 | GO:0019935 | cyclic-nucleotide-mediated signaling(GO:0019935) |
| 0.1 | 0.1 | GO:0030070 | insulin processing(GO:0030070) |
| 0.1 | 0.1 | GO:1900226 | negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
| 0.1 | 0.8 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.1 | 1.2 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.1 | 0.7 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 0.1 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.1 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.1 | 0.1 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.1 | 0.1 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
| 0.1 | 0.1 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
| 0.1 | 0.3 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.1 | 0.3 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 0.2 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
| 0.1 | 0.1 | GO:0046070 | dGTP metabolic process(GO:0046070) |
| 0.1 | 0.1 | GO:0051255 | spindle midzone assembly(GO:0051255) |
| 0.1 | 0.4 | GO:0071364 | cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.1 | 0.3 | GO:0042737 | drug catabolic process(GO:0042737) |
| 0.1 | 0.2 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.1 | 0.1 | GO:0001806 | type IV hypersensitivity(GO:0001806) |
| 0.1 | 0.1 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
| 0.1 | 0.1 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
| 0.1 | 0.3 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.4 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.0 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.0 | 0.2 | GO:0022030 | cerebral cortex radial glia guided migration(GO:0021801) telencephalon glial cell migration(GO:0022030) |
| 0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.0 | 0.8 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.2 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.2 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
| 0.0 | 0.0 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.1 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
| 0.0 | 0.1 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.0 | 0.1 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.0 | 0.0 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.0 | 0.1 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.0 | 0.6 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.0 | 0.1 | GO:0043173 | nucleotide salvage(GO:0043173) |
| 0.0 | 0.2 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
| 0.0 | 0.5 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.3 | GO:0046599 | regulation of centriole replication(GO:0046599) |
| 0.0 | 0.2 | GO:0060074 | synapse maturation(GO:0060074) |
| 0.0 | 0.5 | GO:0090307 | mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.0 | 0.3 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
| 0.0 | 0.2 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.0 | 0.2 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
| 0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.1 | GO:0034138 | toll-like receptor 3 signaling pathway(GO:0034138) |
| 0.0 | 0.2 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.0 | 0.2 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 | 0.9 | GO:0009410 | response to xenobiotic stimulus(GO:0009410) |
| 0.0 | 0.1 | GO:0060717 | chorion development(GO:0060717) extraembryonic membrane development(GO:1903867) |
| 0.0 | 0.2 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
| 0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 0.0 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.0 | 0.2 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.4 | GO:0032212 | positive regulation of telomere maintenance via telomerase(GO:0032212) |
| 0.0 | 0.2 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
| 0.0 | 0.6 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
| 0.0 | 1.2 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.0 | 0.0 | GO:0002438 | acute inflammatory response to antigenic stimulus(GO:0002438) |
| 0.0 | 4.0 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.0 | 0.2 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 | 0.2 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
| 0.0 | 0.1 | GO:0045414 | interleukin-8 biosynthetic process(GO:0042228) regulation of interleukin-8 biosynthetic process(GO:0045414) positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.0 | 0.7 | GO:0045010 | actin nucleation(GO:0045010) |
| 0.0 | 0.1 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.0 | 0.7 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.0 | 0.4 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.0 | GO:0050665 | hydrogen peroxide biosynthetic process(GO:0050665) |
| 0.0 | 1.0 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.0 | 0.3 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 | 0.0 | GO:0008215 | spermine metabolic process(GO:0008215) |
| 0.0 | 0.0 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.0 | 0.2 | GO:0042168 | heme metabolic process(GO:0042168) |
| 0.0 | 0.3 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.0 | 1.2 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.0 | 0.0 | GO:0042713 | sperm ejaculation(GO:0042713) |
| 0.0 | 0.2 | GO:0060215 | primitive hemopoiesis(GO:0060215) |
| 0.0 | 0.2 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.0 | 0.0 | GO:0014055 | acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) |
| 0.0 | 0.9 | GO:0052696 | flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 0.0 | 0.2 | GO:0002717 | positive regulation of natural killer cell mediated immunity(GO:0002717) |
| 0.0 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 0.1 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
| 0.0 | 0.0 | GO:0035728 | response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 0.0 | 0.1 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.0 | 1.2 | GO:0006367 | transcription initiation from RNA polymerase II promoter(GO:0006367) |
| 0.0 | 0.1 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
| 0.0 | 0.0 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.0 | 0.2 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.0 | 0.1 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.0 | 0.3 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.0 | 0.2 | GO:0048821 | erythrocyte development(GO:0048821) |
| 0.0 | 0.6 | GO:0046653 | tetrahydrofolate metabolic process(GO:0046653) |
| 0.0 | 0.0 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.0 | 0.3 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
| 0.0 | 0.4 | GO:0046498 | S-adenosylhomocysteine metabolic process(GO:0046498) |
| 0.0 | 0.2 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.0 | 0.0 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.0 | 0.0 | GO:0006415 | translational termination(GO:0006415) |
| 0.0 | 0.0 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.0 | 0.1 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.0 | 0.2 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
| 0.0 | 0.2 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 0.0 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.0 | 0.9 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.0 | 0.1 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.0 | 0.0 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.0 | 0.3 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.0 | 0.2 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.0 | 0.1 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.0 | 0.1 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
| 0.0 | 0.0 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.2 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
| 0.0 | 0.2 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.0 | 0.5 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.0 | 0.6 | GO:1903146 | regulation of mitophagy(GO:1903146) |
| 0.0 | 0.1 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.0 | 2.1 | GO:0051297 | centrosome organization(GO:0051297) |
| 0.0 | 0.8 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
| 0.0 | 0.0 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.0 | 0.3 | GO:0061013 | regulation of mRNA catabolic process(GO:0061013) |
| 0.0 | 0.0 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.0 | 0.1 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
| 0.0 | 0.1 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 | 0.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.1 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.0 | 0.2 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.4 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
| 0.0 | 0.0 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.0 | 1.3 | GO:0007270 | neuron-neuron synaptic transmission(GO:0007270) |
| 0.0 | 0.1 | GO:0042095 | interferon-gamma biosynthetic process(GO:0042095) |
| 0.0 | 0.1 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.0 | 0.1 | GO:0034435 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.0 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.0 | 0.3 | GO:0002820 | negative regulation of adaptive immune response(GO:0002820) |
| 0.0 | 0.1 | GO:0070175 | positive regulation of enamel mineralization(GO:0070175) |
| 0.0 | 0.1 | GO:0022615 | protein to membrane docking(GO:0022615) |
| 0.0 | 0.5 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
| 0.0 | 0.0 | GO:0036124 | histone H3-K9 trimethylation(GO:0036124) |
| 0.0 | 0.0 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.0 | 0.1 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.0 | 0.3 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.1 | GO:0070857 | regulation of bile acid biosynthetic process(GO:0070857) |
| 0.0 | 0.0 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.0 | 0.4 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
| 0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.0 | 0.5 | GO:0042832 | defense response to protozoan(GO:0042832) |
| 0.0 | 0.1 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.0 | 0.5 | GO:0019835 | cytolysis(GO:0019835) |
| 0.0 | 0.6 | GO:0030193 | regulation of blood coagulation(GO:0030193) regulation of hemostasis(GO:1900046) |
| 0.0 | 0.2 | GO:0002467 | germinal center formation(GO:0002467) |
| 0.0 | 0.1 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.0 | 0.2 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 | 0.1 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.0 | 0.1 | GO:0010755 | regulation of plasminogen activation(GO:0010755) |
| 0.0 | 0.1 | GO:0006458 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.0 | 0.2 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.0 | 0.1 | GO:0002455 | humoral immune response mediated by circulating immunoglobulin(GO:0002455) |
| 0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.1 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
| 0.0 | 0.1 | GO:0046686 | response to cadmium ion(GO:0046686) |
| 0.0 | 0.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 | 0.6 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
| 0.0 | 0.1 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.0 | 0.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.0 | 0.1 | GO:0044036 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
| 0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.0 | 0.2 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.0 | 0.0 | GO:1903596 | regulation of gap junction assembly(GO:1903596) |
| 0.0 | 0.0 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.0 | 0.0 | GO:0051788 | response to misfolded protein(GO:0051788) |
| 0.0 | 0.0 | GO:1903319 | positive regulation of protein processing(GO:0010954) positive regulation of protein maturation(GO:1903319) |
| 0.0 | 0.0 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.0 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.0 | 1.5 | GO:0051028 | mRNA transport(GO:0051028) |
| 0.0 | 0.0 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
| 0.0 | 0.1 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 0.0 | 0.0 | GO:0010989 | negative regulation of lipoprotein particle clearance(GO:0010985) negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.0 | 0.3 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.0 | 0.6 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
| 0.0 | 0.1 | GO:0046909 | intermembrane transport(GO:0046909) |
| 0.0 | 0.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.0 | 0.2 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
| 0.0 | 0.0 | GO:0042505 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.0 | 0.6 | GO:0050684 | regulation of mRNA processing(GO:0050684) |
| 0.0 | 0.2 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.0 | 0.0 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
| 0.0 | 0.1 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.0 | 0.1 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
| 0.0 | 0.3 | GO:0043113 | receptor clustering(GO:0043113) |
| 0.0 | 0.3 | GO:0048679 | regulation of axon regeneration(GO:0048679) |
| 0.0 | 0.0 | GO:0002461 | tolerance induction dependent upon immune response(GO:0002461) |
| 0.0 | 0.1 | GO:0051126 | negative regulation of actin nucleation(GO:0051126) |
| 0.0 | 0.1 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.0 | 0.3 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 0.2 | GO:0002347 | response to tumor cell(GO:0002347) |
| 0.0 | 0.3 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.1 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.0 | 0.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.2 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
| 0.0 | 0.4 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.0 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.0 | 0.0 | GO:1904304 | regulation of gastro-intestinal system smooth muscle contraction(GO:1904304) |
| 0.0 | 0.1 | GO:1902268 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.0 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.0 | 0.1 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
| 0.0 | 0.0 | GO:1901679 | nucleotide transmembrane transport(GO:1901679) |
| 0.0 | 0.2 | GO:0042119 | neutrophil activation(GO:0042119) |
| 0.0 | 0.1 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.0 | 0.1 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.0 | 0.0 | GO:0003072 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
| 0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.0 | GO:0009414 | response to water deprivation(GO:0009414) |
| 0.0 | 0.1 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.0 | 0.2 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.0 | 0.1 | GO:0048259 | regulation of receptor-mediated endocytosis(GO:0048259) |
| 0.0 | 0.1 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
| 0.0 | 0.0 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.1 | GO:0006903 | vesicle targeting(GO:0006903) |
| 0.0 | 0.1 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.0 | 0.0 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.0 | 0.1 | GO:0006560 | proline metabolic process(GO:0006560) |
| 0.0 | 0.2 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.0 | GO:0070071 | proton-transporting two-sector ATPase complex assembly(GO:0070071) |
| 0.0 | 0.6 | GO:0042073 | intraciliary transport(GO:0042073) |
| 0.0 | 0.1 | GO:0014059 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
| 0.0 | 0.2 | GO:0006911 | phagocytosis, engulfment(GO:0006911) |
| 0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.0 | 0.1 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.1 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.0 | 0.1 | GO:0002481 | antigen processing and presentation of peptide antigen via MHC class Ib(GO:0002428) antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
| 0.0 | 0.2 | GO:0010388 | cullin deneddylation(GO:0010388) |
| 0.0 | 0.1 | GO:0016048 | detection of temperature stimulus(GO:0016048) |
| 0.0 | 0.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.0 | 0.0 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
| 0.0 | 0.4 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.0 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 0.0 | 0.1 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.0 | 0.1 | GO:0071242 | cellular response to ammonium ion(GO:0071242) |
| 0.0 | 0.2 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
| 0.0 | 0.1 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.0 | 0.1 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.0 | 0.6 | GO:0043487 | regulation of RNA stability(GO:0043487) |
| 0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.0 | 0.0 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.0 | 0.0 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
| 0.0 | 0.1 | GO:0046785 | microtubule polymerization(GO:0046785) |
| 0.0 | 0.0 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.0 | 0.0 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.0 | 0.3 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 | 0.0 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
| 0.0 | 0.0 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
| 0.0 | 0.1 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.0 | 0.0 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 | 0.0 | GO:0008089 | anterograde axonal transport(GO:0008089) |
| 0.0 | 0.0 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.0 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.0 | 0.0 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.0 | 0.0 | GO:1903278 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.0 | 0.0 | GO:0002579 | positive regulation of antigen processing and presentation(GO:0002579) |
| 0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.0 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.0 | 0.0 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.0 | 0.8 | GO:0002323 | natural killer cell activation involved in immune response(GO:0002323) |
| 0.0 | 0.0 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.2 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.8 | GO:0006402 | mRNA catabolic process(GO:0006402) |
| 0.0 | 0.2 | GO:0046549 | retinal cone cell development(GO:0046549) |
| 0.0 | 0.1 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.0 | 0.5 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
| 0.0 | 0.0 | GO:0009838 | abscission(GO:0009838) |
| 0.0 | 0.2 | GO:0042537 | benzene-containing compound metabolic process(GO:0042537) |
| 0.0 | 0.2 | GO:0035774 | positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 0.0 | 0.4 | GO:0048167 | regulation of synaptic plasticity(GO:0048167) |
| 0.0 | 0.1 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.0 | 0.1 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.0 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.0 | 0.1 | GO:0072384 | organelle transport along microtubule(GO:0072384) |
| 0.0 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.1 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.0 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.0 | 0.1 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.0 | GO:0021681 | cerebellar granular layer development(GO:0021681) |
| 0.0 | 0.1 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
| 0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.1 | GO:0002084 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 0.6 | GO:0099643 | neurotransmitter secretion(GO:0007269) signal release from synapse(GO:0099643) |
| 0.0 | 0.3 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.5 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.2 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.0 | 0.2 | GO:0007135 | meiosis II(GO:0007135) |
| 0.0 | 0.6 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.0 | 0.0 | GO:0007320 | insemination(GO:0007320) |
| 0.0 | 0.0 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
| 0.0 | 0.1 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.0 | 0.1 | GO:0060177 | regulation of angiotensin levels in blood(GO:0002002) regulation of angiotensin metabolic process(GO:0060177) |
| 0.0 | 0.0 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 | 0.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.0 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
| 0.0 | 0.0 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.0 | 0.1 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
| 0.0 | 0.0 | GO:0070897 | DNA-templated transcriptional preinitiation complex assembly(GO:0070897) |
| 0.0 | 0.1 | GO:0042157 | lipoprotein metabolic process(GO:0042157) |
| 0.0 | 0.0 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.0 | 0.0 | GO:0070669 | response to interleukin-2(GO:0070669) response to parathyroid hormone(GO:0071107) |
| 0.0 | 0.2 | GO:0051881 | regulation of mitochondrial membrane potential(GO:0051881) |
| 0.0 | 0.0 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
| 0.0 | 0.1 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
| 0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.0 | 0.1 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 0.0 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
| 0.0 | 0.0 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.0 | 0.2 | GO:0019884 | antigen processing and presentation of exogenous antigen(GO:0019884) |
| 0.0 | 0.0 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
| 0.0 | 0.1 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
| 0.0 | 0.0 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
| 0.0 | 0.0 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.0 | 0.1 | GO:1903859 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 0.5 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
| 0.0 | 0.0 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.0 | 0.2 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.1 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.0 | 1.4 | GO:0016072 | rRNA metabolic process(GO:0016072) |
| 0.0 | 0.0 | GO:0009084 | glutamine family amino acid biosynthetic process(GO:0009084) |
| 0.0 | 0.1 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
| 0.0 | 0.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
| 0.0 | 0.1 | GO:0010737 | protein kinase A signaling(GO:0010737) |
| 0.0 | 0.1 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.0 | 0.0 | GO:0006921 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
| 0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.0 | 0.0 | GO:0000237 | leptotene(GO:0000237) |
| 0.0 | 0.0 | GO:0039531 | regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039531) |
| 0.0 | 0.1 | GO:0019068 | virion assembly(GO:0019068) |
| 0.0 | 0.0 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.0 | 0.0 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
| 0.0 | 0.0 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
| 0.0 | 0.0 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
| 0.0 | 0.3 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
| 0.0 | 0.0 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.0 | 0.0 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
| 0.0 | 0.0 | GO:0046386 | deoxyribose phosphate catabolic process(GO:0046386) |
| 0.0 | 1.2 | GO:0006399 | tRNA metabolic process(GO:0006399) |
| 0.0 | 0.0 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 | 0.0 | GO:0043045 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.0 | 0.0 | GO:1902285 | semaphorin-plexin signaling pathway involved in neuron projection guidance(GO:1902285) |
| 0.0 | 0.2 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.0 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
| 0.0 | 0.1 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.1 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.0 | 0.0 | GO:0046459 | short-chain fatty acid metabolic process(GO:0046459) |
| 0.0 | 0.3 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.0 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.0 | 0.2 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 0.1 | GO:0048265 | response to pain(GO:0048265) |
| 0.0 | 0.2 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.2 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.0 | 0.0 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.0 | 0.0 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.0 | 0.0 | GO:0090343 | positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
| 0.0 | 0.0 | GO:1903671 | negative regulation of sprouting angiogenesis(GO:1903671) |
| 0.0 | 0.0 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
| 0.0 | 0.0 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
| 0.0 | 0.0 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.0 | 0.0 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.0 | 0.0 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.0 | 0.0 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 | 0.0 | GO:0002921 | negative regulation of humoral immune response(GO:0002921) |
| 0.0 | 0.0 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.0 | 0.0 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
| 0.0 | 0.1 | GO:2000398 | regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
| 0.0 | 0.0 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.0 | 0.0 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.0 | 0.3 | GO:0035383 | acyl-CoA metabolic process(GO:0006637) thioester metabolic process(GO:0035383) |
| 0.0 | 0.1 | GO:0000045 | autophagosome assembly(GO:0000045) |
| 0.0 | 0.0 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 3.7 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.7 | 3.4 | GO:0097433 | dense body(GO:0097433) |
| 0.6 | 1.9 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.6 | 1.7 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.5 | 3.3 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.4 | 0.4 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.4 | 4.6 | GO:0097449 | astrocyte projection(GO:0097449) |
| 0.4 | 3.3 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.4 | 1.7 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.4 | 3.3 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 0.4 | 2.9 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.4 | 6.0 | GO:0031045 | dense core granule(GO:0031045) |
| 0.4 | 1.9 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.4 | 3.1 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.4 | 1.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.4 | 1.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.4 | 1.4 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.3 | 3.4 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.3 | 1.4 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 0.3 | 2.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.3 | 2.6 | GO:0005883 | neurofilament(GO:0005883) |
| 0.3 | 0.3 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.3 | 1.0 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.3 | 0.6 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.3 | 6.0 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.3 | 0.9 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.3 | 1.1 | GO:0044308 | axonal spine(GO:0044308) |
| 0.3 | 1.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.3 | 1.4 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.3 | 0.8 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.3 | 0.3 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.3 | 9.4 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.3 | 1.3 | GO:0005638 | lamin filament(GO:0005638) |
| 0.3 | 5.0 | GO:0030673 | axolemma(GO:0030673) |
| 0.2 | 2.7 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.2 | 0.7 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.2 | 9.0 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.2 | 0.5 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.2 | 0.9 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.2 | 1.5 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.2 | 0.6 | GO:0097413 | Lewy body(GO:0097413) |
| 0.2 | 0.6 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.2 | 1.9 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.2 | 1.3 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 0.2 | 1.2 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.2 | 1.4 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.2 | 0.6 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.2 | 1.0 | GO:0051286 | cell tip(GO:0051286) |
| 0.2 | 0.2 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
| 0.2 | 0.7 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.2 | 1.6 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.2 | 0.9 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.2 | 1.1 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.2 | 0.7 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.2 | 0.5 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.2 | 0.9 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.2 | 0.3 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.2 | 1.2 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.2 | 4.7 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.2 | 2.0 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.2 | 0.8 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.2 | 1.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.2 | 2.8 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.2 | 0.5 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.2 | 1.9 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.2 | 3.8 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.2 | 2.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.2 | 5.1 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.2 | 0.6 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.2 | 4.1 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.2 | 0.5 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.2 | 0.5 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.2 | 0.5 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 0.2 | 0.3 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.1 | 0.6 | GO:0008091 | spectrin(GO:0008091) |
| 0.1 | 1.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.1 | 0.6 | GO:0097386 | glial cell projection(GO:0097386) |
| 0.1 | 0.1 | GO:0042627 | chylomicron(GO:0042627) |
| 0.1 | 0.3 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.1 | 0.7 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 0.4 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.1 | 0.4 | GO:0042581 | specific granule(GO:0042581) |
| 0.1 | 0.4 | GO:0031417 | NatC complex(GO:0031417) |
| 0.1 | 0.4 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 0.4 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.1 | 0.5 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.1 | 1.8 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.1 | 5.9 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.1 | 0.5 | GO:0070695 | FHF complex(GO:0070695) |
| 0.1 | 1.2 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.1 | 0.5 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.1 | 0.5 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.1 | 0.6 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.1 | 1.4 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.1 | 0.9 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.1 | 0.2 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.1 | 0.5 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.1 | 2.7 | GO:0044298 | cell body membrane(GO:0044298) |
| 0.1 | 0.8 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.1 | 0.5 | GO:0035363 | histone locus body(GO:0035363) |
| 0.1 | 0.5 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.1 | 0.5 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.1 | 0.8 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.1 | 1.0 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 1.9 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.1 | 0.6 | GO:0033503 | HULC complex(GO:0033503) |
| 0.1 | 10.9 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.1 | 0.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.1 | 0.7 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 0.1 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.1 | 0.5 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
| 0.1 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 1.0 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 0.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.1 | 0.3 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 1.0 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 1.3 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.1 | 0.5 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 1.4 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.1 | 1.8 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.1 | 0.6 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 1.7 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.1 | 1.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 0.6 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.1 | 0.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.1 | 0.6 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.1 | 6.3 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.1 | 7.3 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.1 | 0.3 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.1 | 0.3 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 0.4 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.1 | 0.9 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
| 0.1 | 1.0 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.1 | 0.5 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.1 | 0.4 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.1 | 1.3 | GO:0097546 | ciliary base(GO:0097546) |
| 0.1 | 1.0 | GO:0022624 | proteasome accessory complex(GO:0022624) |
| 0.1 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.1 | 0.6 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.1 | 0.8 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.1 | 0.6 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.1 | 0.7 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 1.4 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.1 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 0.7 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 0.2 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.1 | 0.4 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.1 | 0.6 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 0.3 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.1 | 1.2 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.1 | 1.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.1 | 2.3 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.1 | 0.9 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.1 | 1.0 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 0.6 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 0.5 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.1 | 1.1 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 0.4 | GO:0098576 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) lumenal side of membrane(GO:0098576) |
| 0.1 | 0.8 | GO:0030430 | host cell cytoplasm(GO:0030430) host intracellular part(GO:0033646) host cell cytoplasm part(GO:0033655) intracellular region of host(GO:0043656) |
| 0.1 | 0.6 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 2.1 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.1 | 0.2 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.1 | 3.6 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.1 | 0.1 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.1 | 0.5 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.1 | 0.1 | GO:0070820 | tertiary granule(GO:0070820) |
| 0.1 | 1.8 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.1 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.1 | 0.6 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 0.2 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.1 | 0.5 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 0.1 | GO:0031231 | intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.1 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.1 | 0.9 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.1 | 0.5 | GO:0002177 | manchette(GO:0002177) |
| 0.1 | 0.2 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.1 | 0.5 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.1 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.1 | 0.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.1 | 0.4 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.1 | 0.2 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.1 | 0.5 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 0.8 | GO:0005675 | holo TFIIH complex(GO:0005675) |
| 0.1 | 0.1 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.1 | 0.4 | GO:0089701 | U2AF(GO:0089701) |
| 0.1 | 3.4 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.1 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.1 | 0.9 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.1 | 0.9 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.1 | 0.4 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.1 | 2.7 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.1 | 0.2 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.1 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.1 | 0.8 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.1 | 0.5 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.1 | 1.0 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.1 | 0.6 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 0.2 | GO:0043219 | lateral loop(GO:0043219) |
| 0.1 | 0.5 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.1 | 0.5 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 0.4 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.1 | 0.3 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.1 | 0.2 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.1 | 0.3 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 0.7 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 0.3 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.1 | 0.1 | GO:0005767 | secondary lysosome(GO:0005767) |
| 0.1 | 1.7 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.1 | 0.3 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.1 | 1.5 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.1 | 0.3 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 0.4 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 0.6 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.1 | 0.9 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.1 | 0.8 | GO:0030904 | retromer complex(GO:0030904) |
| 0.1 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.1 | 0.1 | GO:0000235 | astral microtubule(GO:0000235) |
| 0.1 | 1.1 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 0.2 | GO:0043203 | axon hillock(GO:0043203) |
| 0.1 | 1.2 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.1 | 0.5 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.1 | 0.9 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.1 | 3.9 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
| 0.1 | 3.2 | GO:0030175 | filopodium(GO:0030175) |
| 0.1 | 2.1 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.1 | 0.7 | GO:0042599 | lamellar body(GO:0042599) |
| 0.1 | 0.3 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.1 | 0.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.1 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.1 | 0.1 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.1 | 1.4 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.1 | 0.3 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 0.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.1 | 0.3 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 0.4 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.1 | 0.5 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.1 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 0.5 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
| 0.1 | 2.5 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.1 | 1.5 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.1 | 0.4 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.1 | 0.2 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.1 | 0.3 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
| 0.1 | 2.5 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.1 | 0.2 | GO:0034464 | BBSome(GO:0034464) |
| 0.1 | 0.1 | GO:0031082 | BLOC complex(GO:0031082) |
| 0.1 | 0.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.1 | 0.6 | GO:0033202 | DNA helicase complex(GO:0033202) |
| 0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.0 | 0.1 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.4 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.0 | 2.9 | GO:0000776 | kinetochore(GO:0000776) |
| 0.0 | 0.3 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.1 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 0.0 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.0 | 0.4 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| 0.0 | 0.1 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 0.1 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.0 | 0.2 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 0.9 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.0 | 0.1 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.0 | 0.4 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.0 | 0.3 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 2.8 | GO:0034399 | nuclear periphery(GO:0034399) |
| 0.0 | 0.9 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.3 | GO:0071546 | pi-body(GO:0071546) |
| 0.0 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.0 | 0.2 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.0 | 1.4 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 0.4 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.2 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.0 | 0.4 | GO:0044815 | DNA packaging complex(GO:0044815) |
| 0.0 | 0.7 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.0 | 0.1 | GO:0000791 | euchromatin(GO:0000791) |
| 0.0 | 0.2 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 1.7 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 1.4 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 0.0 | 9.7 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 1.1 | GO:0030139 | endocytic vesicle(GO:0030139) |
| 0.0 | 1.5 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 4.2 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.0 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.4 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.0 | 1.8 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 1.2 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.9 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 0.3 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.7 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.2 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.2 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
| 0.0 | 0.0 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.0 | 0.0 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 1.4 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.2 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.0 | 0.9 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.1 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.3 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 3.4 | GO:0005769 | early endosome(GO:0005769) |
| 0.0 | 0.0 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.0 | 0.5 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.2 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.0 | 4.9 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 1.0 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
| 0.0 | 1.7 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 1.2 | GO:0098793 | presynapse(GO:0098793) |
| 0.0 | 0.3 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.8 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.0 | 0.4 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.0 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 1.6 | GO:0044309 | neuron spine(GO:0044309) |
| 0.0 | 0.4 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.0 | 0.0 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.0 | 2.3 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.7 | GO:1990204 | oxidoreductase complex(GO:1990204) |
| 0.0 | 8.1 | GO:0005768 | endosome(GO:0005768) |
| 0.0 | 0.0 | GO:0072588 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
| 0.0 | 0.3 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.0 | 0.0 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.0 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 0.1 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.0 | 0.0 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.0 | 0.1 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 0.3 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.0 | 0.3 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 0.3 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 5.3 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 1.8 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 1.5 | GO:0000793 | condensed chromosome(GO:0000793) |
| 0.0 | 0.0 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
| 0.0 | 0.0 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
| 0.0 | 4.3 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
| 0.0 | 1.2 | GO:0030426 | growth cone(GO:0030426) |
| 0.0 | 0.0 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
| 0.0 | 0.2 | GO:1902555 | endoribonuclease complex(GO:1902555) |
| 0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.0 | 0.0 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
| 0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.0 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.3 | GO:0043679 | axon terminus(GO:0043679) |
| 0.0 | 0.3 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.0 | 0.0 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.0 | 0.3 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.0 | 0.4 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.1 | GO:0033176 | proton-transporting V-type ATPase complex(GO:0033176) |
| 0.0 | 0.0 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.0 | 0.0 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
| 0.0 | 0.0 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.0 | 0.4 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 1.1 | GO:0043209 | myelin sheath(GO:0043209) |
| 0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
| 0.0 | 1.8 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.1 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.0 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.0 | 0.1 | GO:0030894 | replisome(GO:0030894) |
| 0.0 | 0.3 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
| 0.0 | 0.0 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.1 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.1 | GO:0035267 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.0 | GO:1990923 | PET complex(GO:1990923) |
| 0.0 | 0.8 | GO:0005840 | ribosome(GO:0005840) |
| 0.0 | 0.3 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
| 0.0 | 8.6 | GO:0005739 | mitochondrion(GO:0005739) |
| 0.0 | 0.0 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.0 | 0.1 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.5 | GO:0098562 | cytoplasmic side of membrane(GO:0098562) |
| 0.0 | 0.0 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.0 | 0.3 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.4 | 4.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 1.1 | 3.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.9 | 2.7 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.9 | 2.6 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.8 | 1.6 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.8 | 3.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.7 | 2.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.7 | 3.4 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.6 | 4.7 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.6 | 2.8 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.5 | 1.1 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.5 | 1.5 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.5 | 1.5 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.5 | 2.0 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.5 | 1.4 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.5 | 3.2 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.4 | 1.3 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.4 | 3.9 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.4 | 1.7 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.4 | 3.3 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.4 | 1.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.4 | 2.1 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.4 | 3.2 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.4 | 1.2 | GO:0019961 | interferon binding(GO:0019961) |
| 0.4 | 1.2 | GO:0019862 | IgA binding(GO:0019862) |
| 0.4 | 1.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.4 | 1.1 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.4 | 1.8 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.4 | 2.5 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.3 | 2.4 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.3 | 1.0 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.3 | 1.0 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.3 | 1.6 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.3 | 1.3 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.3 | 1.3 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
| 0.3 | 0.6 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.3 | 3.6 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
| 0.3 | 1.5 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.3 | 0.9 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.3 | 3.3 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.3 | 0.9 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.3 | 3.0 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.3 | 1.5 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.3 | 1.1 | GO:0034549 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
| 0.3 | 1.4 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.3 | 3.4 | GO:0043176 | amine binding(GO:0043176) |
| 0.3 | 1.4 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.3 | 2.2 | GO:0050544 | arachidonic acid binding(GO:0050544) |
| 0.3 | 1.6 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.3 | 1.1 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) glycine:sodium symporter activity(GO:0015375) |
| 0.3 | 0.8 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.3 | 1.6 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.3 | 0.8 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.3 | 1.8 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.3 | 0.8 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.3 | 0.8 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
| 0.3 | 0.8 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.2 | 2.2 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.2 | 1.0 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.2 | 4.2 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.2 | 0.7 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.2 | 0.2 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.2 | 1.5 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.2 | 0.7 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.2 | 1.9 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.2 | 1.4 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.2 | 1.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.2 | 0.7 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.2 | 0.7 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.2 | 0.7 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.2 | 2.2 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
| 0.2 | 0.8 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.2 | 1.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.2 | 0.6 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.2 | 0.8 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.2 | 0.2 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.2 | 0.2 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.2 | 1.0 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.2 | 0.8 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.2 | 1.0 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.2 | 0.6 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
| 0.2 | 0.8 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.2 | 1.0 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.2 | 2.0 | GO:0016594 | glycine binding(GO:0016594) |
| 0.2 | 1.6 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.2 | 0.6 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.2 | 0.8 | GO:0004083 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) |
| 0.2 | 0.4 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.2 | 0.7 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.2 | 1.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.2 | 1.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.2 | 2.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.2 | 1.1 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.2 | 0.5 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.2 | 0.9 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.2 | 0.9 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.2 | 0.7 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.2 | 1.4 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.2 | 0.5 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.2 | 0.9 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.2 | 3.9 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.2 | 0.5 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.2 | 0.7 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.2 | 0.5 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.2 | 0.8 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.2 | 0.5 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.2 | 0.8 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.2 | 0.5 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.2 | 0.5 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.2 | 0.5 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.2 | 3.5 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.2 | 0.7 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.2 | 4.0 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.2 | 1.0 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.2 | 1.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.2 | 0.6 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.2 | 0.6 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 0.2 | 0.8 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.2 | 0.8 | GO:0070728 | leucine binding(GO:0070728) |
| 0.2 | 0.5 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.2 | 0.9 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.2 | 0.8 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.2 | 0.5 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.2 | 0.3 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.2 | 0.5 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.2 | 2.3 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
| 0.2 | 0.6 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.1 | 0.4 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.1 | 1.0 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 0.3 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.1 | 0.6 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 0.6 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.1 | 0.6 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.1 | 2.0 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 1.0 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.1 | 1.0 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.1 | 0.8 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 1.8 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.1 | 1.0 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.1 | 0.4 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.1 | 1.3 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.1 | 1.5 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.1 | 2.8 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.1 | 1.5 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 0.4 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.1 | 1.0 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.9 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.1 | 0.4 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.1 | 0.4 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.1 | 0.4 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 0.8 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.1 | 0.8 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.1 | 0.5 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.1 | 0.8 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.1 | 0.3 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 0.7 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 0.1 | 0.7 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.1 | 0.6 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 0.3 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.1 | 0.5 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 0.1 | 0.4 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.1 | 0.6 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.1 | 0.4 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.1 | 2.3 | GO:0001848 | complement binding(GO:0001848) |
| 0.1 | 0.4 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.1 | 0.4 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.1 | 0.4 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.1 | 0.9 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.1 | 1.0 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.1 | 0.4 | GO:2001070 | starch binding(GO:2001070) |
| 0.1 | 0.4 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.1 | 0.9 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 2.2 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 0.4 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 1.1 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.1 | 0.4 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.1 | 1.4 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.1 | 0.4 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.1 | 0.4 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
| 0.1 | 0.5 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.1 | 1.2 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.1 | 0.4 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.1 | 1.4 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.1 | 0.6 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.1 | 0.5 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.1 | 0.3 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.1 | 0.6 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 0.8 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.1 | 0.2 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.1 | 0.3 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.1 | 0.2 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.1 | 0.3 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.1 | 0.5 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.1 | 0.4 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.1 | 0.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.1 | 0.6 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 0.5 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.1 | 0.3 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.1 | 0.9 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.1 | 0.1 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.1 | 1.6 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.4 | GO:0043559 | insulin binding(GO:0043559) |
| 0.1 | 1.1 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.4 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.1 | 0.8 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.1 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 0.6 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
| 0.1 | 0.4 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 0.3 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.1 | 0.1 | GO:0050542 | icosanoid binding(GO:0050542) fatty acid derivative binding(GO:1901567) |
| 0.1 | 0.3 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 0.7 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 1.1 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.1 | 0.2 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.1 | 1.7 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.1 | 1.3 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.1 | 0.9 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.1 | 0.6 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 0.4 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.1 | 1.4 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.1 | 0.2 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.1 | 1.6 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.1 | 0.3 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.1 | 0.2 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.1 | 0.1 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
| 0.1 | 0.7 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.1 | 2.1 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
| 0.1 | 0.5 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.1 | 0.6 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 1.0 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
| 0.1 | 0.4 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.1 | 0.8 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.1 | 0.4 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.1 | 0.3 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.1 | 1.2 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.1 | 0.9 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.1 | 0.4 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 0.3 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.1 | 0.4 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.1 | 0.4 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.1 | 2.7 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.5 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.1 | 2.1 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
| 0.1 | 1.2 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.1 | 0.1 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.1 | 0.1 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.1 | 1.8 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.1 | 0.3 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.1 | 0.2 | GO:0031720 | haptoglobin binding(GO:0031720) |
| 0.1 | 0.2 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 0.2 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.1 | 0.4 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 2.2 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.1 | 0.4 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.1 | 0.3 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 0.3 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.1 | 0.3 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.1 | 0.4 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.1 | 0.4 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.1 | 0.9 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.1 | 0.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.1 | 0.3 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.1 | 0.6 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.1 | 0.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 1.8 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.1 | 0.3 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.1 | 0.8 | GO:0042301 | phosphate ion binding(GO:0042301) |
| 0.1 | 1.0 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 0.7 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.1 | 7.9 | GO:0017124 | SH3 domain binding(GO:0017124) |
| 0.1 | 2.8 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.1 | 1.2 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.1 | 0.2 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
| 0.1 | 3.8 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.1 | 0.2 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.1 | 0.2 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.1 | 0.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.1 | 0.5 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.1 | 0.2 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.1 | 0.4 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.1 | 0.4 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.1 | 0.3 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 0.3 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.1 | 0.3 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.1 | 0.5 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.1 | 0.2 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.1 | 0.7 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
| 0.1 | 0.9 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 0.2 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.1 | 0.1 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
| 0.1 | 0.8 | GO:0022821 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) potassium ion antiporter activity(GO:0022821) |
| 0.1 | 1.0 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.1 | 0.4 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.1 | 1.4 | GO:0045309 | protein phosphorylated amino acid binding(GO:0045309) |
| 0.1 | 0.6 | GO:0034841 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
| 0.1 | 0.6 | GO:0034071 | phosphorylase kinase regulator activity(GO:0008607) cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.1 | 1.5 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.1 | 1.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 0.2 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.1 | 0.2 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.1 | 1.1 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.1 | 0.3 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.1 | 0.8 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.1 | 0.3 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.1 | 1.6 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.1 | 0.8 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.1 | 0.2 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.1 | 0.4 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.1 | 1.0 | GO:0005521 | lamin binding(GO:0005521) |
| 0.1 | 0.6 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.1 | 1.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.1 | 0.6 | GO:0016303 | 1-phosphatidylinositol-3-kinase activity(GO:0016303) |
| 0.1 | 1.1 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.1 | 0.8 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.1 | 0.6 | GO:0010181 | FMN binding(GO:0010181) |
| 0.1 | 1.9 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.1 | 0.4 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.1 | 1.3 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
| 0.1 | 0.7 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
| 0.1 | 0.9 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.1 | 0.1 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.1 | 0.4 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.1 | 0.2 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.1 | 0.3 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.1 | 0.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 1.1 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.1 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.1 | 0.7 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 0.1 | 0.7 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.1 | 1.7 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.1 | 0.2 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.1 | 0.3 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.1 | 0.4 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) xenobiotic transporter activity(GO:0042910) |
| 0.1 | 0.3 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.1 | 0.5 | GO:0090079 | translation activator activity(GO:0008494) translation regulator activity, nucleic acid binding(GO:0090079) |
| 0.1 | 0.5 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.1 | 0.2 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.1 | 0.2 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.1 | 8.5 | GO:0003729 | mRNA binding(GO:0003729) |
| 0.1 | 0.5 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.1 | 0.2 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.1 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.1 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.1 | 0.1 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
| 0.1 | 0.6 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.1 | 0.5 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
| 0.1 | 0.2 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
| 0.1 | 0.5 | GO:0018449 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
| 0.1 | 0.8 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.1 | 1.3 | GO:0044390 | ubiquitin conjugating enzyme binding(GO:0031624) ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
| 0.1 | 1.5 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.1 | 0.3 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.1 | 0.3 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.1 | 0.2 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
| 0.1 | 2.7 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.1 | 0.3 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 0.1 | 0.3 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 0.4 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.1 | 1.3 | GO:0016651 | oxidoreductase activity, acting on NAD(P)H(GO:0016651) |
| 0.1 | 1.9 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.1 | 5.4 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.1 | 0.2 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 0.6 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.1 | 0.3 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
| 0.1 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.1 | 1.2 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
| 0.1 | 0.3 | GO:0030955 | potassium ion binding(GO:0030955) |
| 0.1 | 0.4 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.1 | 0.8 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.1 | 0.5 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.1 | 0.3 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.1 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.5 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.1 | 1.0 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.1 | 0.2 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.1 | 0.2 | GO:0019976 | interleukin-2 binding(GO:0019976) |
| 0.1 | 0.2 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.1 | 0.4 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 0.3 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.1 | 0.2 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.1 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 3.7 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.1 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.1 | 0.1 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.1 | 0.2 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.1 | 1.1 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.1 | 1.2 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.1 | 0.4 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.1 | 0.2 | GO:0015922 | aspartate oxidase activity(GO:0015922) |
| 0.1 | 4.4 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.1 | 0.9 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.1 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.1 | 0.3 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.1 | 0.8 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 0.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.1 | 0.5 | GO:0071814 | lipoprotein particle binding(GO:0071813) protein-lipid complex binding(GO:0071814) |
| 0.1 | 0.9 | GO:0043826 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
| 0.1 | 0.2 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.1 | 0.7 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 0.7 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.1 | 1.0 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.1 | 0.5 | GO:0045502 | dynein binding(GO:0045502) |
| 0.1 | 0.8 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.1 | 0.3 | GO:0016273 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
| 0.1 | 0.1 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.1 | 0.2 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.1 | 0.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.1 | 1.3 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.1 | 1.2 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.7 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.0 | GO:0016436 | rRNA methyltransferase activity(GO:0008649) rRNA (uridine) methyltransferase activity(GO:0016436) |
| 0.0 | 0.2 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.0 | 0.2 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.0 | 0.0 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.0 | 0.7 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 0.0 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.0 | 0.1 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.0 | 0.3 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.0 | 0.2 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.0 | 0.7 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.0 | 0.2 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 0.5 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.5 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.0 | 0.8 | GO:0043531 | ADP binding(GO:0043531) |
| 0.0 | 0.5 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.0 | 0.3 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.4 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.0 | 0.2 | GO:0003905 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
| 0.0 | 0.4 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 2.0 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.0 | 0.0 | GO:0016531 | copper chaperone activity(GO:0016531) |
| 0.0 | 0.2 | GO:0015925 | galactosidase activity(GO:0015925) |
| 0.0 | 0.7 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.4 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.2 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.3 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.0 | 0.1 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.0 | 0.5 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.2 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.4 | GO:0008373 | sialyltransferase activity(GO:0008373) |
| 0.0 | 0.2 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.0 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 0.8 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
| 0.0 | 0.2 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
| 0.0 | 1.8 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.8 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.2 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.0 | GO:0001614 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
| 0.0 | 0.3 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.2 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
| 0.0 | 1.1 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
| 0.0 | 0.4 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.0 | 0.1 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.0 | 0.2 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.0 | 1.4 | GO:0043621 | protein self-association(GO:0043621) |
| 0.0 | 0.1 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
| 0.0 | 0.6 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.0 | 0.0 | GO:0016429 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.0 | 0.0 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.3 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.0 | 0.4 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.3 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.0 | 0.1 | GO:0052795 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 0.1 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
| 0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.1 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.0 | 10.7 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
| 0.0 | 0.3 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.0 | 0.5 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.0 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
| 0.0 | 0.1 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.0 | 0.2 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 0.3 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.2 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
| 0.0 | 0.3 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.3 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
| 0.0 | 0.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.1 | GO:0004946 | bombesin receptor activity(GO:0004946) |
| 0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.3 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
| 0.0 | 0.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.0 | 0.3 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.5 | GO:0050661 | NADP binding(GO:0050661) |
| 0.0 | 0.2 | GO:0003678 | DNA helicase activity(GO:0003678) |
| 0.0 | 0.3 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
| 0.0 | 0.5 | GO:0005186 | pheromone activity(GO:0005186) |
| 0.0 | 0.7 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.3 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.2 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.0 | 0.9 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.1 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 0.1 | GO:0019767 | IgE receptor activity(GO:0019767) |
| 0.0 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 0.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.8 | GO:0051219 | phosphoprotein binding(GO:0051219) |
| 0.0 | 0.0 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.0 | 0.2 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
| 0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.0 | 4.5 | GO:0015631 | tubulin binding(GO:0015631) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.7 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.0 | 0.1 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.0 | 0.1 | GO:0102345 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
| 0.0 | 1.6 | GO:0005262 | calcium channel activity(GO:0005262) |
| 0.0 | 0.1 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.0 | 0.9 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.4 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.1 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.0 | 0.8 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 2.0 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.0 | GO:0016595 | glutamate binding(GO:0016595) |
| 0.0 | 0.1 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
| 0.0 | 0.0 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.0 | 0.3 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 0.3 | GO:0016247 | channel regulator activity(GO:0016247) |
| 0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.0 | 0.1 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.0 | 0.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.0 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.0 | 2.7 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.1 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.0 | 0.1 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 0.0 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.0 | 0.1 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
| 0.0 | 0.0 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 0.4 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.0 | GO:0019863 | IgE binding(GO:0019863) |
| 0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.3 | GO:0052634 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
| 0.0 | 0.4 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
| 0.0 | 0.0 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.0 | 0.1 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.0 | 0.1 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.0 | 0.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.0 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.0 | 0.1 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.0 | 0.1 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.1 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.0 | 0.4 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
| 0.0 | 0.1 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
| 0.0 | 0.9 | GO:0016820 | hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances(GO:0016820) |
| 0.0 | 0.2 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.1 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 0.2 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.0 | 0.2 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.0 | 0.0 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.0 | 0.5 | GO:0051117 | ATPase binding(GO:0051117) |
| 0.0 | 0.6 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
| 0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.0 | 0.0 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.0 | 0.3 | GO:0005272 | sodium channel activity(GO:0005272) |
| 0.0 | 0.2 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 0.6 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
| 0.0 | 0.1 | GO:0005372 | water transmembrane transporter activity(GO:0005372) |
| 0.0 | 0.6 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.0 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.0 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.2 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.0 | 0.1 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.1 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.0 | 0.1 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.0 | 0.2 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
| 0.0 | 0.0 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.0 | 0.0 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.0 | 0.3 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.0 | 1.2 | GO:0052689 | carboxylic ester hydrolase activity(GO:0052689) |
| 0.0 | 0.0 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.0 | 0.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.4 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
| 0.0 | 0.0 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.2 | GO:0016893 | endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 5'-phosphomonoesters(GO:0016893) |
| 0.0 | 0.0 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.0 | 0.0 | GO:0046915 | transition metal ion transmembrane transporter activity(GO:0046915) |
| 0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.0 | 0.2 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.0 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.0 | 0.0 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 0.0 | 0.1 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.1 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.0 | 0.2 | GO:0016627 | oxidoreductase activity, acting on the CH-CH group of donors(GO:0016627) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 4.1 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.2 | 4.8 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.2 | 0.5 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.2 | 0.2 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.2 | 0.5 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.1 | 1.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.1 | 0.3 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.1 | 4.4 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.1 | 3.8 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.1 | 0.1 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.1 | 3.5 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.1 | 4.8 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.1 | 3.4 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 0.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.1 | 1.3 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.1 | 0.2 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.1 | 2.4 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.1 | 4.3 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.1 | 3.1 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.1 | 1.4 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.1 | 1.8 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.1 | 3.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.1 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.1 | 1.5 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 3.6 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.1 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.1 | 2.5 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.1 | 2.5 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.1 | 0.8 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.1 | 0.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.1 | 0.5 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.1 | 1.0 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.1 | 0.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.1 | 0.7 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.1 | 1.4 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.1 | 1.7 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.1 | 0.9 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.1 | 2.4 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.1 | 0.3 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.1 | 1.1 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.1 | 0.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.1 | 1.7 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.1 | 1.2 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.1 | 0.2 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 0.4 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 0.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.1 | 0.5 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 0.5 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.1 | 0.3 | PID FOXO PATHWAY | FoxO family signaling |
| 0.1 | 2.3 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.1 | 0.1 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.1 | 2.9 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.1 | 2.1 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 0.7 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.1 | 2.3 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.1 | 0.7 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.1 | 0.9 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.1 | 0.7 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 0.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 0.7 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.1 | 0.7 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.1 | 0.3 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.5 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.4 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 1.2 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 1.6 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.3 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.0 | 0.0 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.2 | PID EPO PATHWAY | EPO signaling pathway |
| 0.0 | 0.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 0.0 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.0 | 0.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 1.1 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 0.3 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.7 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.4 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 0.2 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.5 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.2 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.2 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 0.2 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.1 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 0.6 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.2 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.0 | 0.6 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.7 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.0 | 0.3 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.2 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.3 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.2 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.2 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 0.2 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.0 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.0 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 0.6 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.0 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.0 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.2 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.1 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.7 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.4 | 5.4 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.4 | 1.1 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
| 0.3 | 3.5 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.3 | 4.3 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.3 | 2.3 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.3 | 5.6 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.3 | 4.6 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.3 | 2.8 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.3 | 2.0 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.2 | 2.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.2 | 2.9 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.2 | 2.6 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.2 | 0.7 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
| 0.2 | 0.4 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.2 | 2.3 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.2 | 2.4 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.2 | 0.2 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.2 | 1.5 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.2 | 2.4 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.2 | 2.4 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.2 | 1.6 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.2 | 6.3 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.2 | 2.5 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.2 | 2.7 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.2 | 2.6 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.2 | 1.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.2 | 1.8 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.2 | 0.9 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.2 | 2.9 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.2 | 4.9 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.1 | 1.0 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 1.0 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 1.9 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.1 | 0.8 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.1 | 1.9 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.1 | 2.2 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.1 | 1.9 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 0.1 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.1 | 2.5 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.1 | 0.8 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 1.5 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.1 | 0.9 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 1.0 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.1 | 1.8 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.1 | 2.7 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.1 | 0.4 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.1 | 1.1 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.1 | 2.6 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 0.9 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.1 | 1.3 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.1 | 1.3 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.1 | 1.4 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.1 | 0.7 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.1 | 1.7 | REACTOME INTEGRIN ALPHAIIB BETA3 SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
| 0.1 | 1.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 0.4 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.1 | 4.6 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 0.9 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 0.2 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.1 | 6.0 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.1 | 0.1 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.1 | 2.7 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 1.4 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.1 | 0.2 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.1 | 2.0 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.1 | 1.3 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 0.8 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.1 | 1.3 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.1 | 0.9 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.1 | 0.6 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.1 | 1.4 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
| 0.1 | 0.3 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.1 | 0.5 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 0.8 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.1 | 0.9 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.1 | 1.3 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.1 | 1.0 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.1 | 1.8 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.1 | 3.4 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.1 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.1 | 1.3 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
| 0.1 | 0.7 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 0.4 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.1 | 0.5 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.1 | 1.3 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.1 | 0.9 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.1 | 2.2 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.1 | 0.6 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 0.1 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.1 | 0.9 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.1 | 0.6 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.1 | 1.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.1 | 0.9 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.1 | 0.8 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.1 | 1.8 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 0.4 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.1 | 1.5 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 0.1 | 0.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 0.3 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.1 | 0.4 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 0.6 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.1 | 1.0 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.1 | 0.5 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.1 | 0.9 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.1 | 0.2 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.1 | 0.8 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.1 | 0.6 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.1 | 0.9 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.1 | 0.9 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
| 0.1 | 0.8 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.1 | 1.3 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.1 | 0.6 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.1 | 0.5 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.1 | 0.3 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.1 | 0.6 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.1 | 0.3 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.1 | 0.7 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 0.8 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.1 | 0.6 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.3 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.0 | REACTOME CDK MEDIATED PHOSPHORYLATION AND REMOVAL OF CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
| 0.0 | 0.3 | REACTOME TCR SIGNALING | Genes involved in TCR signaling |
| 0.0 | 1.9 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
| 0.0 | 0.3 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.3 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.3 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.9 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.1 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 0.8 | REACTOME MYD88 MAL CASCADE INITIATED ON PLASMA MEMBRANE | Genes involved in MyD88:Mal cascade initiated on plasma membrane |
| 0.0 | 1.3 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.6 | REACTOME AUTODEGRADATION OF CDH1 BY CDH1 APC C | Genes involved in Autodegradation of Cdh1 by Cdh1:APC/C |
| 0.0 | 0.2 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.0 | 1.2 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 0.2 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.0 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.9 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.0 | REACTOME GASTRIN CREB SIGNALLING PATHWAY VIA PKC AND MAPK | Genes involved in Gastrin-CREB signalling pathway via PKC and MAPK |
| 0.0 | 0.0 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.0 | 0.3 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.0 | 1.4 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 0.3 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
| 0.0 | 0.4 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 0.4 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 1.6 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 0.7 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.4 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 0.8 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 2.0 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.4 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.0 | 0.7 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 0.2 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 0.2 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 1.3 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 1.0 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.3 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.3 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 0.2 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.0 | 0.4 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.4 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 0.4 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
| 0.0 | 0.1 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 0.2 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.0 | 0.1 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.5 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
| 0.0 | 0.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 1.2 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 0.0 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.0 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
| 0.0 | 0.2 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 0.6 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
| 0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.0 | 0.0 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 0.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.3 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.0 | 0.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.7 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
| 0.0 | 0.9 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.2 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.3 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.0 | 0.3 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.0 | 0.5 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.3 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.2 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.0 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.0 | 0.3 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.0 | 1.6 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
| 0.0 | 0.1 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.0 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
| 0.0 | 0.1 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.0 | 0.0 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.0 | 0.3 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 0.1 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
| 0.0 | 0.9 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 1.3 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.0 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.0 | 0.1 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 0.1 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.0 | 0.0 | REACTOME EARLY PHASE OF HIV LIFE CYCLE | Genes involved in Early Phase of HIV Life Cycle |