Gene Symbol | Gene ID | Gene Info |
---|---|---|
Pou6f2
|
ENSMUSG00000009734.11 | Pou6f2 |
Pou4f2
|
ENSMUSG00000031688.3 | Pou4f2 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Pou4f2 | chr8_78426572_78427821 | 9449 | 0.204621 | 0.69 | 9.6e-10 | Click! |
Pou4f2 | chr8_78436227_78437698 | 317 | 0.902621 | 0.67 | 4.9e-09 | Click! |
Pou4f2 | chr8_78435714_78436188 | 694 | 0.710644 | 0.65 | 1.7e-08 | Click! |
Pou4f2 | chr8_78434733_78435587 | 1485 | 0.428421 | 0.63 | 8.9e-08 | Click! |
Pou4f2 | chr8_78434459_78434699 | 2066 | 0.337487 | 0.52 | 2.3e-05 | Click! |
Pou6f2 | chr13_18497673_18498474 | 100387 | 0.075873 | 0.61 | 3.0e-07 | Click! |
Pou6f2 | chr13_18218561_18219179 | 32384 | 0.192406 | 0.54 | 8.2e-06 | Click! |
Pou6f2 | chr13_18497007_18497174 | 99404 | 0.077023 | 0.32 | 1.1e-02 | Click! |
Pou6f2 | chr13_18281372_18281523 | 94961 | 0.076643 | 0.30 | 2.1e-02 | Click! |
Pou6f2 | chr13_18495535_18495875 | 98019 | 0.078681 | 0.29 | 2.2e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr17_57769126_57770140 | 6.68 |
Cntnap5c |
contactin associated protein-like 5C |
63 |
0.97 |
chr13_83736071_83736534 | 6.46 |
Gm33366 |
predicted gene, 33366 |
2233 |
0.18 |
chr14_64591760_64591911 | 5.87 |
Mir3078 |
microRNA 3078 |
650 |
0.54 |
chr12_29529828_29531185 | 5.68 |
Gm20208 |
predicted gene, 20208 |
609 |
0.74 |
chr10_29143400_29144848 | 5.27 |
Soga3 |
SOGA family member 3 |
65 |
0.5 |
chr3_55786102_55786728 | 5.11 |
Nbea |
neurobeachin |
487 |
0.8 |
chr1_42703141_42704653 | 4.95 |
Pantr2 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 2 |
4155 |
0.16 |
chr8_125897573_125897839 | 4.78 |
A730098A19Rik |
RIKEN cDNA A730098A19 gene |
208 |
0.8 |
chr18_31316134_31317386 | 4.58 |
Rit2 |
Ras-like without CAAX 2 |
351 |
0.9 |
chr3_45384939_45386122 | 4.54 |
Pcdh10 |
protocadherin 10 |
2897 |
0.22 |
chr7_51626624_51628140 | 4.45 |
Slc17a6 |
solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 6 |
2098 |
0.31 |
chr8_123412815_123413352 | 4.42 |
Tubb3 |
tubulin, beta 3 class III |
1493 |
0.18 |
chr8_67817715_67818694 | 4.33 |
Psd3 |
pleckstrin and Sec7 domain containing 3 |
29 |
0.99 |
chr4_82496866_82497618 | 4.31 |
Nfib |
nuclear factor I/B |
2074 |
0.34 |
chr16_41534559_41535426 | 4.30 |
Lsamp |
limbic system-associated membrane protein |
1573 |
0.55 |
chr18_59062200_59063436 | 4.25 |
Minar2 |
membrane integral NOTCH2 associated receptor 2 |
307 |
0.94 |
chr13_84064321_84064873 | 4.12 |
Gm17750 |
predicted gene, 17750 |
175 |
0.96 |
chr11_94046147_94046506 | 4.03 |
Spag9 |
sperm associated antigen 9 |
1961 |
0.31 |
chr2_105675959_105678109 | 3.88 |
Pax6 |
paired box 6 |
905 |
0.54 |
chr4_78606166_78606938 | 3.81 |
Gm11261 |
predicted gene 11261 |
53830 |
0.17 |
chr17_17402413_17403374 | 3.67 |
Lix1 |
limb and CNS expressed 1 |
221 |
0.91 |
chr4_110290101_110291006 | 3.51 |
Elavl4 |
ELAV like RNA binding protein 4 |
281 |
0.95 |
chr9_74977325_74977617 | 3.50 |
Fam214a |
family with sequence similarity 214, member A |
1360 |
0.45 |
chr8_23669376_23670424 | 3.45 |
Zmat4 |
zinc finger, matrin type 4 |
226 |
0.95 |
chr4_110287512_110287903 | 3.36 |
Elavl4 |
ELAV like RNA binding protein 4 |
180 |
0.97 |
chrX_110811626_110812334 | 3.33 |
Gm44593 |
predicted gene 44593 |
344 |
0.89 |
chr2_65620767_65621991 | 3.28 |
Scn2a |
sodium channel, voltage-gated, type II, alpha |
568 |
0.82 |
chr4_134470669_134471383 | 3.26 |
Stmn1 |
stathmin 1 |
1284 |
0.28 |
chr9_60648638_60649971 | 3.22 |
Lrrc49 |
leucine rich repeat containing 49 |
406 |
0.86 |
chr4_110281444_110282224 | 3.09 |
Elavl4 |
ELAV like RNA binding protein 4 |
4782 |
0.33 |
chr16_63862649_63862946 | 3.08 |
Epha3 |
Eph receptor A3 |
616 |
0.83 |
chrX_69363262_69363944 | 3.04 |
Gm14705 |
predicted gene 14705 |
2334 |
0.33 |
chr16_77420100_77420782 | 3.01 |
9430053O09Rik |
RIKEN cDNA 9430053O09 gene |
1379 |
0.28 |
chr6_16991857_16992473 | 2.97 |
Gm5721 |
predicted gene 5721 |
66934 |
0.1 |
chr8_55939901_55941088 | 2.96 |
Glra3 |
glycine receptor, alpha 3 subunit |
15 |
0.98 |
chr18_80982763_80983698 | 2.96 |
Sall3 |
spalt like transcription factor 3 |
3306 |
0.17 |
chr3_38889511_38889886 | 2.91 |
Fat4 |
FAT atypical cadherin 4 |
1244 |
0.41 |
chr5_4821463_4821961 | 2.86 |
Gm43112 |
predicted gene 43112 |
915 |
0.45 |
chr11_16259557_16259824 | 2.82 |
Vstm2a |
V-set and transmembrane domain containing 2A |
901 |
0.67 |
chr7_34753113_34753812 | 2.81 |
Chst8 |
carbohydrate sulfotransferase 8 |
350 |
0.89 |
chr1_172056022_172057415 | 2.72 |
Nhlh1 |
nescient helix loop helix 1 |
855 |
0.45 |
chr5_111423567_111424249 | 2.70 |
Gm43119 |
predicted gene 43119 |
319 |
0.88 |
chrX_153501207_153502250 | 2.70 |
Ubqln2 |
ubiquilin 2 |
3501 |
0.22 |
chr17_15371644_15373099 | 2.67 |
Dll1 |
delta like canonical Notch ligand 1 |
540 |
0.73 |
chrX_135209330_135210111 | 2.64 |
Tceal6 |
transcription elongation factor A (SII)-like 6 |
967 |
0.45 |
chr7_70347472_70349327 | 2.57 |
Gm44948 |
predicted gene 44948 |
703 |
0.54 |
chr9_41376046_41377501 | 2.56 |
Mir100hg |
Mir100 Mirlet7a-2 Mir125b-1 cluster host gene |
212 |
0.93 |
chr18_69498798_69498975 | 2.53 |
Tcf4 |
transcription factor 4 |
503 |
0.86 |
chr16_43503039_43503193 | 2.53 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
498 |
0.85 |
chr1_115684558_115685809 | 2.53 |
Cntnap5a |
contactin associated protein-like 5A |
427 |
0.58 |
chr5_122047844_122047995 | 2.51 |
Cux2 |
cut-like homeobox 2 |
28 |
0.88 |
chr12_88723574_88724074 | 2.49 |
Nrxn3 |
neurexin III |
715 |
0.73 |
chr13_56895826_56896120 | 2.49 |
Trpc7 |
transient receptor potential cation channel, subfamily C, member 7 |
20 |
0.98 |
chr1_6760592_6761327 | 2.47 |
St18 |
suppression of tumorigenicity 18 |
23384 |
0.23 |
chr5_65133569_65133946 | 2.46 |
Klhl5 |
kelch-like 5 |
2086 |
0.25 |
chr3_35481945_35482453 | 2.45 |
Gm7733 |
predicted gene 7733 |
55601 |
0.12 |
chr18_54125378_54126373 | 2.43 |
Gm8594 |
predicted gene 8594 |
94567 |
0.09 |
chr4_54952410_54952904 | 2.43 |
Zfp462 |
zinc finger protein 462 |
4681 |
0.31 |
chr15_30458403_30458947 | 2.42 |
Ctnnd2 |
catenin (cadherin associated protein), delta 2 |
887 |
0.67 |
chr13_56296335_56296721 | 2.38 |
Cxcl14 |
chemokine (C-X-C motif) ligand 14 |
23 |
0.97 |
chr17_90087597_90088717 | 2.38 |
Nrxn1 |
neurexin I |
17 |
0.99 |
chr12_118850924_118851621 | 2.36 |
Sp8 |
trans-acting transcription factor 8 |
3686 |
0.27 |
chr2_129698961_129700174 | 2.34 |
Pdyn |
prodynorphin |
266 |
0.93 |
chr9_58203042_58203248 | 2.31 |
Islr2 |
immunoglobulin superfamily containing leucine-rich repeat 2 |
194 |
0.54 |
chr2_140668225_140669392 | 2.30 |
Flrt3 |
fibronectin leucine rich transmembrane protein 3 |
2592 |
0.43 |
chr9_35422384_35422637 | 2.28 |
Cdon |
cell adhesion molecule-related/down-regulated by oncogenes |
952 |
0.52 |
chr10_96621972_96622429 | 2.21 |
Btg1 |
BTG anti-proliferation factor 1 |
4646 |
0.23 |
chr11_69834618_69835201 | 2.21 |
Nlgn2 |
neuroligin 2 |
60 |
0.9 |
chr8_88793832_88794104 | 2.20 |
Rps6-ps2 |
ribosomal protein S6, pseudogene 2 |
12423 |
0.2 |
chr6_8948312_8949000 | 2.18 |
Nxph1 |
neurexophilin 1 |
42 |
0.99 |
chrX_105390628_105392456 | 2.17 |
5330434G04Rik |
RIKEN cDNA 5330434G04 gene |
212 |
0.93 |
chr3_153276849_153277884 | 2.17 |
1700012D16Rik |
RIKEN cDNA 1700012D16 gene |
21283 |
0.16 |
chr7_139833633_139836105 | 2.16 |
Adgra1 |
adhesion G protein-coupled receptor A1 |
93 |
0.96 |
chr13_115346333_115347310 | 2.15 |
Gm47891 |
predicted gene, 47891 |
64620 |
0.13 |
chr14_12189749_12189942 | 2.13 |
Ptprg |
protein tyrosine phosphatase, receptor type, G |
98 |
0.97 |
chr18_65583033_65584701 | 2.13 |
Zfp532 |
zinc finger protein 532 |
70 |
0.95 |
chr3_134236641_134237783 | 2.12 |
Cxxc4 |
CXXC finger 4 |
392 |
0.78 |
chr10_100865501_100865985 | 2.10 |
Gm35722 |
predicted gene, 35722 |
124108 |
0.05 |
chr7_79512487_79513145 | 2.08 |
2900037B21Rik |
RIKEN cDNA 2900037B21 gene |
108 |
0.91 |
chr12_71048832_71049275 | 2.08 |
Arid4a |
AT rich interactive domain 4A (RBP1-like) |
712 |
0.65 |
chr9_41585694_41587243 | 2.06 |
Mir100hg |
Mir100 Mirlet7a-2 Mir125b-1 cluster host gene |
1301 |
0.29 |
chr13_63627159_63628101 | 2.06 |
Gm30709 |
predicted gene, 30709 |
251 |
0.9 |
chr2_77709184_77709412 | 2.05 |
Zfp385b |
zinc finger protein 385B |
5919 |
0.31 |
chr8_71376663_71376971 | 2.03 |
Nr2f6 |
nuclear receptor subfamily 2, group F, member 6 |
1027 |
0.33 |
chr11_119544322_119545100 | 2.03 |
Nptx1 |
neuronal pentraxin 1 |
3042 |
0.19 |
chr10_111250333_111250593 | 2.03 |
Osbpl8 |
oxysterol binding protein-like 8 |
2395 |
0.29 |
chr17_87444292_87445035 | 2.03 |
Calm2 |
calmodulin 2 |
2185 |
0.19 |
chr15_95639290_95640155 | 2.02 |
Dbx2 |
developing brain homeobox 2 |
6894 |
0.21 |
chr11_19475047_19475739 | 1.97 |
Gm12026 |
predicted gene 12026 |
91708 |
0.08 |
chr13_81570195_81570888 | 1.97 |
Adgrv1 |
adhesion G protein-coupled receptor V1 |
99 |
0.98 |
chr13_70840476_70842094 | 1.96 |
Adamts16 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 16 |
490 |
0.63 |
chr4_91399504_91400258 | 1.96 |
Elavl2 |
ELAV like RNA binding protein 1 |
95 |
0.97 |
chr5_35454181_35454829 | 1.95 |
Gm43377 |
predicted gene 43377 |
58407 |
0.08 |
chr8_40633582_40633735 | 1.95 |
Mtmr7 |
myotubularin related protein 7 |
1101 |
0.48 |
chr16_77236514_77236677 | 1.94 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
276 |
0.93 |
chr10_40969317_40970070 | 1.92 |
Gm48057 |
predicted gene, 48057 |
65502 |
0.09 |
chr13_78189592_78191761 | 1.91 |
Nr2f1 |
nuclear receptor subfamily 2, group F, member 1 |
233 |
0.9 |
chr13_29014902_29016014 | 1.90 |
A330102I10Rik |
RIKEN cDNA A330102I10 gene |
835 |
0.7 |
chr16_97169746_97171103 | 1.90 |
Dscam |
DS cell adhesion molecule |
328 |
0.94 |
chr12_29534253_29535510 | 1.89 |
Gm20208 |
predicted gene, 20208 |
10 |
0.8 |
chr12_86216416_86217464 | 1.87 |
Gpatch2l |
G patch domain containing 2 like |
24918 |
0.17 |
chr9_48662848_48663204 | 1.86 |
Nnmt |
nicotinamide N-methyltransferase |
57873 |
0.13 |
chr17_66761376_66761829 | 1.86 |
Gm49939 |
predicted gene, 49939 |
17279 |
0.14 |
chr14_118422287_118423239 | 1.86 |
Gm5672 |
predicted gene 5672 |
46569 |
0.11 |
chr11_80478619_80479391 | 1.82 |
Cdk5r1 |
cyclin-dependent kinase 5, regulatory subunit 1 (p35) |
1949 |
0.32 |
chr13_109928298_109928867 | 1.82 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
1738 |
0.46 |
chr4_130836245_130836902 | 1.79 |
Gm26716 |
predicted gene, 26716 |
10260 |
0.12 |
chr1_25824008_25825247 | 1.79 |
2900002M20Rik |
RIKEN cDNA 2900002M20 gene |
92 |
0.93 |
chr2_170638744_170639040 | 1.79 |
Gm14264 |
predicted gene 14264 |
23573 |
0.17 |
chr5_125533783_125534484 | 1.79 |
Tmem132b |
transmembrane protein 132B |
1746 |
0.33 |
chr1_179106840_179106991 | 1.79 |
Smyd3 |
SET and MYND domain containing 3 |
117570 |
0.06 |
chr3_34562856_34563429 | 1.79 |
Sox2ot |
SOX2 overlapping transcript (non-protein coding) |
2750 |
0.22 |
chr11_118907285_118907593 | 1.78 |
Rbfox3 |
RNA binding protein, fox-1 homolog (C. elegans) 3 |
566 |
0.76 |
chr7_4119233_4120703 | 1.77 |
Ttyh1 |
tweety family member 1 |
214 |
0.7 |
chrX_58020054_58020828 | 1.76 |
Zic3 |
zinc finger protein of the cerebellum 3 |
2259 |
0.37 |
chr12_29537463_29537646 | 1.75 |
Myt1l |
myelin transcription factor 1-like |
2332 |
0.32 |
chrX_7919510_7921219 | 1.75 |
Pcsk1n |
proprotein convertase subtilisin/kexin type 1 inhibitor |
542 |
0.52 |
chr18_31442020_31442171 | 1.75 |
Gm26658 |
predicted gene, 26658 |
1777 |
0.3 |
chr5_147155422_147156154 | 1.74 |
Gsx1 |
GS homeobox 1 |
32908 |
0.12 |
chr17_15826761_15827329 | 1.73 |
Rgmb |
repulsive guidance molecule family member B |
459 |
0.77 |
chr2_34368049_34368262 | 1.73 |
Pbx3 |
pre B cell leukemia homeobox 3 |
2691 |
0.28 |
chr14_60381648_60381975 | 1.72 |
Amer2 |
APC membrane recruitment 2 |
3525 |
0.27 |
chr13_81944263_81944829 | 1.71 |
F830210D05Rik |
RIKEN cDNA F830210D05 gene |
14859 |
0.26 |
chr18_54988564_54988904 | 1.71 |
Zfp608 |
zinc finger protein 608 |
1432 |
0.35 |
chr2_106512529_106513407 | 1.69 |
Gm14015 |
predicted gene 14015 |
10135 |
0.26 |
chr1_106072019_106072330 | 1.69 |
Gm37372 |
predicted gene, 37372 |
3720 |
0.22 |
chr7_116035635_116036386 | 1.69 |
Sox6 |
SRY (sex determining region Y)-box 6 |
1497 |
0.31 |
chr13_83722679_83723219 | 1.69 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
1568 |
0.29 |
chr12_83337469_83337659 | 1.69 |
Dpf3 |
D4, zinc and double PHD fingers, family 3 |
13331 |
0.26 |
chr2_121868683_121868979 | 1.68 |
Casc4 |
cancer susceptibility candidate 4 |
1126 |
0.4 |
chr3_86544323_86545126 | 1.67 |
Lrba |
LPS-responsive beige-like anchor |
2031 |
0.33 |
chr2_57613916_57615034 | 1.66 |
Gm13532 |
predicted gene 13532 |
14753 |
0.2 |
chr5_98183897_98184048 | 1.66 |
A730035I17Rik |
RIKEN cDNA A730035I17 gene |
1238 |
0.41 |
chrX_166346941_166347276 | 1.66 |
Gpm6b |
glycoprotein m6b |
2266 |
0.36 |
chr17_46656580_46656731 | 1.65 |
Cul7 |
cullin 7 |
3762 |
0.1 |
chr16_77596529_77597235 | 1.64 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
1980 |
0.16 |
chr6_36797061_36797436 | 1.63 |
Ptn |
pleiotrophin |
12931 |
0.26 |
chr14_55052408_55052978 | 1.63 |
Zfhx2os |
zinc finger homeobox 2, opposite strand |
1176 |
0.24 |
chrX_6169933_6171264 | 1.63 |
Nudt10 |
nudix (nucleoside diphosphate linked moiety X)-type motif 10 |
2417 |
0.31 |
chr7_76889140_76890193 | 1.62 |
Gm45210 |
predicted gene 45210 |
189949 |
0.03 |
chr6_32584464_32585789 | 1.61 |
Plxna4 |
plexin A4 |
3066 |
0.3 |
chr12_88724589_88725423 | 1.61 |
Nrxn3 |
neurexin III |
3 |
0.98 |
chr12_26533196_26533974 | 1.60 |
Gm46344 |
predicted gene, 46344 |
46794 |
0.11 |
chr14_64595595_64595857 | 1.60 |
Mir3078 |
microRNA 3078 |
4541 |
0.17 |
chr5_37244380_37244680 | 1.59 |
Crmp1 |
collapsin response mediator protein 1 |
1234 |
0.48 |
chr6_51472238_51472471 | 1.59 |
Cbx3 |
chromobox 3 |
1608 |
0.31 |
chrX_146962362_146963776 | 1.58 |
Htr2c |
5-hydroxytryptamine (serotonin) receptor 2C |
46 |
0.97 |
chr14_80846334_80846497 | 1.58 |
Gm19120 |
predicted gene, 19120 |
12083 |
0.28 |
chr2_136386859_136388332 | 1.57 |
Pak7 |
p21 (RAC1) activated kinase 7 |
343 |
0.88 |
chr3_127258380_127258813 | 1.57 |
Gm42972 |
predicted gene 42972 |
13693 |
0.12 |
chr3_66976156_66976605 | 1.57 |
Shox2 |
short stature homeobox 2 |
2067 |
0.29 |
chr8_48414548_48414978 | 1.55 |
Tenm3 |
teneurin transmembrane protein 3 |
114664 |
0.06 |
chr17_84067213_84067396 | 1.54 |
4933433H22Rik |
RIKEN cDNA 4933433H22 gene |
11356 |
0.14 |
chr8_83167665_83167943 | 1.54 |
Gm10645 |
predicted gene 10645 |
1634 |
0.32 |
chr7_16611263_16612711 | 1.54 |
Gm29443 |
predicted gene 29443 |
1837 |
0.17 |
chr9_91357788_91358422 | 1.53 |
Zic4 |
zinc finger protein of the cerebellum 4 |
4308 |
0.12 |
chr1_77512287_77513134 | 1.52 |
Epha4 |
Eph receptor A4 |
2369 |
0.26 |
chr3_34638141_34639272 | 1.52 |
Sox2ot |
SOX2 overlapping transcript (non-protein coding) |
202 |
0.53 |
chr10_86490806_86491632 | 1.51 |
Syn3 |
synapsin III |
678 |
0.59 |
chr12_107990188_107992301 | 1.50 |
Bcl11b |
B cell leukemia/lymphoma 11B |
12170 |
0.28 |
chr12_49394720_49395481 | 1.50 |
3110039M20Rik |
RIKEN cDNA 3110039M20 gene |
4441 |
0.15 |
chr14_105668981_105669366 | 1.49 |
Gm10076 |
predicted gene 10076 |
12655 |
0.18 |
chr3_73055286_73056050 | 1.49 |
Slitrk3 |
SLIT and NTRK-like family, member 3 |
1275 |
0.44 |
chr2_65848718_65849208 | 1.48 |
Csrnp3 |
cysteine-serine-rich nuclear protein 3 |
3108 |
0.27 |
chr9_78503900_78504103 | 1.48 |
Eef1a1 |
eukaryotic translation elongation factor 1 alpha 1 |
14850 |
0.11 |
chr3_96181539_96182795 | 1.48 |
Sv2a |
synaptic vesicle glycoprotein 2 a |
1016 |
0.22 |
chr10_92162169_92163486 | 1.47 |
Rmst |
rhabdomyosarcoma 2 associated transcript (non-coding RNA) |
66 |
0.98 |
chr15_25415436_25415919 | 1.46 |
Gm48957 |
predicted gene, 48957 |
614 |
0.58 |
chr3_18057619_18058479 | 1.46 |
Bhlhe22 |
basic helix-loop-helix family, member e22 |
3875 |
0.23 |
chrX_133684344_133684778 | 1.46 |
Pcdh19 |
protocadherin 19 |
430 |
0.9 |
chr15_8706491_8707357 | 1.46 |
Slc1a3 |
solute carrier family 1 (glial high affinity glutamate transporter), member 3 |
2664 |
0.34 |
chr3_19406311_19407021 | 1.46 |
Pde7a |
phosphodiesterase 7A |
95344 |
0.07 |
chr15_85975792_85976179 | 1.45 |
Celsr1 |
cadherin, EGF LAG seven-pass G-type receptor 1 |
2745 |
0.29 |
chr12_89815214_89815490 | 1.44 |
Nrxn3 |
neurexin III |
2869 |
0.41 |
chr7_143198091_143198718 | 1.44 |
Gm28821 |
predicted gene 28821 |
57796 |
0.08 |
chr13_83728524_83729044 | 1.44 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
678 |
0.43 |
chr19_16955617_16956908 | 1.44 |
Prune2 |
prune homolog 2 |
144 |
0.97 |
chr8_90345047_90345661 | 1.44 |
Tox3 |
TOX high mobility group box family member 3 |
2772 |
0.42 |
chr19_44494300_44494608 | 1.43 |
Wnt8b |
wingless-type MMTV integration site family, member 8B |
982 |
0.47 |
chr17_8368706_8369049 | 1.43 |
T2 |
brachyury 2 |
3519 |
0.15 |
chr10_13114669_13114820 | 1.42 |
Plagl1 |
pleiomorphic adenoma gene-like 1 |
1279 |
0.49 |
chr18_54720208_54720640 | 1.42 |
Gm5821 |
predicted gene 5821 |
45708 |
0.16 |
chr2_158613157_158614206 | 1.42 |
Gm14205 |
predicted gene 14205 |
1861 |
0.2 |
chr15_88977708_88978900 | 1.42 |
Mlc1 |
megalencephalic leukoencephalopathy with subcortical cysts 1 homolog (human) |
703 |
0.51 |
chr5_5007975_5008126 | 1.42 |
Gm22897 |
predicted gene, 22897 |
22812 |
0.18 |
chr3_104616448_104616599 | 1.41 |
Gm26091 |
predicted gene, 26091 |
15284 |
0.1 |
chr5_66327956_66328708 | 1.41 |
Gm43790 |
predicted gene 43790 |
5315 |
0.14 |
chrX_136666183_136667703 | 1.40 |
Tceal3 |
transcription elongation factor A (SII)-like 3 |
332 |
0.84 |
chr18_23036665_23037864 | 1.40 |
Nol4 |
nucleolar protein 4 |
1392 |
0.59 |
chr6_101198088_101199306 | 1.39 |
Gm26911 |
predicted gene, 26911 |
39 |
0.89 |
chr10_43162323_43162700 | 1.39 |
Gm29245 |
predicted gene 29245 |
8295 |
0.14 |
chr7_34869820_34870063 | 1.37 |
Pepd |
peptidase D |
42438 |
0.13 |
chr7_140057458_140058738 | 1.37 |
Msx3 |
msh homeobox 3 |
9009 |
0.09 |
chr11_94044930_94045437 | 1.37 |
Spag9 |
sperm associated antigen 9 |
818 |
0.6 |
chr8_108535196_108536010 | 1.36 |
Gm39244 |
predicted gene, 39244 |
1344 |
0.54 |
chr7_119076692_119076843 | 1.36 |
Gprc5b |
G protein-coupled receptor, family C, group 5, member B |
81556 |
0.08 |
chr9_100266506_100267433 | 1.36 |
Gm28167 |
predicted gene 28167 |
56555 |
0.13 |
chr3_79144294_79146166 | 1.35 |
Rapgef2 |
Rap guanine nucleotide exchange factor (GEF) 2 |
253 |
0.94 |
chr10_87490860_87491182 | 1.35 |
Ascl1 |
achaete-scute family bHLH transcription factor 1 |
2639 |
0.28 |
chr17_32162253_32163139 | 1.34 |
Notch3 |
notch 3 |
4156 |
0.15 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 3.9 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
1.3 | 3.8 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
1.0 | 2.9 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.9 | 2.7 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.9 | 3.6 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.8 | 2.3 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
0.7 | 2.0 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.6 | 2.3 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.6 | 2.8 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.5 | 2.0 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.5 | 1.5 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
0.5 | 2.4 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.5 | 1.9 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.5 | 3.2 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.4 | 1.3 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.4 | 1.3 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.4 | 1.7 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.4 | 2.1 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.4 | 4.0 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
0.4 | 1.2 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.4 | 1.5 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.4 | 1.8 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
0.4 | 0.7 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.4 | 1.1 | GO:0015755 | fructose transport(GO:0015755) |
0.4 | 5.3 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.3 | 1.0 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.3 | 1.0 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.3 | 0.9 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.3 | 1.5 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.3 | 1.2 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.3 | 1.2 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.3 | 1.2 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.3 | 0.6 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.3 | 0.8 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.3 | 0.5 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.3 | 1.3 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.3 | 2.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.2 | 3.0 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.2 | 3.0 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.2 | 0.7 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.2 | 0.9 | GO:0021636 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) |
0.2 | 0.5 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.2 | 3.3 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.2 | 0.4 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.2 | 0.7 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.2 | 2.2 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.2 | 0.9 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) |
0.2 | 0.6 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.2 | 0.6 | GO:0021586 | pons maturation(GO:0021586) |
0.2 | 1.0 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.2 | 0.6 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.2 | 0.8 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.2 | 0.6 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.2 | 2.3 | GO:0007614 | short-term memory(GO:0007614) |
0.2 | 0.6 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.2 | 0.7 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.2 | 1.1 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.2 | 0.7 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.2 | 0.9 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.2 | 0.7 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.2 | 0.5 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.2 | 0.5 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
0.2 | 0.3 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.2 | 1.0 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
0.2 | 0.3 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.2 | 0.3 | GO:0043134 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
0.2 | 1.0 | GO:0060179 | male mating behavior(GO:0060179) |
0.2 | 1.4 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.2 | 0.3 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
0.2 | 0.6 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.2 | 3.1 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.1 | 0.4 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 1.0 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.1 | 0.3 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.1 | 0.3 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.1 | 0.3 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.1 | 0.6 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.4 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.7 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.1 | 0.4 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.1 | 0.5 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 0.3 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.1 | 1.4 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
0.1 | 0.7 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
0.1 | 0.4 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
0.1 | 0.7 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.1 | 0.5 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.1 | 0.7 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.1 | 0.1 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.1 | 0.6 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.1 | 0.5 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.1 | 0.6 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.1 | 0.5 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.1 | 1.6 | GO:0035640 | exploration behavior(GO:0035640) |
0.1 | 1.6 | GO:0022038 | corpus callosum development(GO:0022038) |
0.1 | 0.2 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.1 | 0.4 | GO:0002877 | regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
0.1 | 1.0 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.1 | 0.2 | GO:0021978 | telencephalon regionalization(GO:0021978) |
0.1 | 0.7 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.1 | 0.4 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.1 | 0.4 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.1 | 0.6 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.1 | 6.7 | GO:1900006 | positive regulation of dendrite development(GO:1900006) |
0.1 | 0.2 | GO:0060594 | mammary gland specification(GO:0060594) |
0.1 | 0.3 | GO:0052422 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.1 | 0.3 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.1 | 0.7 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.1 | 0.4 | GO:0071699 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.1 | 0.5 | GO:0021794 | thalamus development(GO:0021794) |
0.1 | 0.2 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.1 | 0.3 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.1 | 0.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.1 | 0.4 | GO:0060029 | convergent extension involved in organogenesis(GO:0060029) |
0.1 | 0.3 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.1 | 1.7 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.1 | 0.3 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.1 | 2.1 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.1 | 0.2 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.1 | 1.3 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
0.1 | 0.3 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.1 | 0.4 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.1 | 1.3 | GO:0060997 | dendritic spine morphogenesis(GO:0060997) |
0.1 | 0.4 | GO:0018343 | protein farnesylation(GO:0018343) |
0.1 | 0.3 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.1 | 0.4 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.1 | 0.3 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.1 | 0.2 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.1 | 0.7 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.1 | 0.4 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.1 | 0.4 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.1 | 0.4 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.1 | 0.3 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.1 | 0.3 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 0.3 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.1 | 0.3 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.1 | 0.3 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.1 | 0.7 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.1 | 0.7 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.1 | 0.3 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.1 | 0.5 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.1 | 0.3 | GO:0003257 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) |
0.1 | 0.2 | GO:0022028 | tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
0.1 | 0.2 | GO:0097061 | dendritic spine organization(GO:0097061) |
0.1 | 0.2 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.1 | 0.1 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.1 | 0.1 | GO:0072553 | terminal button organization(GO:0072553) |
0.1 | 0.3 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
0.1 | 0.7 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.2 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.1 | 0.2 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.1 | 0.4 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.1 | 0.3 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 0.3 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.1 | 0.3 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.1 | 0.1 | GO:0072193 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
0.1 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.1 | 0.1 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.1 | 5.7 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.1 | 1.0 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
0.1 | 0.2 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.1 | 0.2 | GO:0060174 | limb bud formation(GO:0060174) |
0.1 | 0.1 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.1 | 0.3 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 0.2 | GO:0014028 | notochord formation(GO:0014028) |
0.1 | 0.4 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.1 | 0.5 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.1 | 0.1 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
0.1 | 0.2 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.1 | 0.2 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.3 | GO:0060023 | soft palate development(GO:0060023) |
0.1 | 0.5 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
0.1 | 0.1 | GO:2000053 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.1 | 0.1 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.1 | 0.2 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.1 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.1 | 0.2 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.1 | 0.3 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.1 | 0.1 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
0.1 | 0.4 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.1 | 0.1 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
0.1 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.1 | 0.3 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.1 | 0.1 | GO:0021578 | hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
0.1 | 0.1 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.1 | 0.4 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.1 | 0.1 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.1 | 0.3 | GO:0019532 | oxalate transport(GO:0019532) |
0.1 | 0.4 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.1 | 0.2 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.1 | 0.4 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.1 | 0.3 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.1 | 0.2 | GO:0035989 | tendon development(GO:0035989) |
0.1 | 0.4 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.1 | 0.2 | GO:0007525 | somatic muscle development(GO:0007525) |
0.1 | 0.4 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.1 | 0.4 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
0.1 | 0.3 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.1 | 0.4 | GO:0030903 | notochord development(GO:0030903) |
0.1 | 0.3 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.1 | 0.2 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.1 | 0.2 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.1 | 0.2 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.1 | 0.2 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.1 | 0.2 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.1 | 0.1 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.1 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
0.1 | 0.3 | GO:0090383 | phagosome acidification(GO:0090383) |
0.1 | 1.2 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
0.1 | 0.2 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.1 | 0.2 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.1 | 0.1 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.1 | 0.3 | GO:0042637 | catagen(GO:0042637) |
0.1 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.1 | 0.1 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.1 | 0.2 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.1 | 0.2 | GO:0046075 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
0.1 | 0.4 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.1 | 0.2 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.1 | 0.3 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.0 | 0.0 | GO:2000412 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
0.0 | 0.2 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.0 | 1.1 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
0.0 | 0.3 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.0 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.0 | 0.0 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.2 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.0 | 0.1 | GO:0071608 | macrophage inflammatory protein-1 alpha production(GO:0071608) |
0.0 | 0.1 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.0 | 0.2 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.0 | 0.5 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.4 | GO:0021756 | striatum development(GO:0021756) |
0.0 | 0.2 | GO:0032252 | secretory granule localization(GO:0032252) |
0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.0 | 0.2 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.0 | 0.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.0 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.0 | 0.0 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
0.0 | 0.2 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.4 | GO:0010388 | cullin deneddylation(GO:0010388) |
0.0 | 0.3 | GO:0002591 | positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
0.0 | 0.2 | GO:0098596 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.0 | 0.3 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
0.0 | 0.1 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.0 | 0.1 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.0 | 0.3 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.1 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.0 | 0.2 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.0 | 0.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.0 | 0.1 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.0 | 0.2 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.0 | 0.1 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.0 | 0.3 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.0 | 0.0 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.0 | 0.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.0 | 0.2 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.0 | 0.1 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.0 | 0.4 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.0 | 0.2 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.0 | 0.3 | GO:0014075 | response to amine(GO:0014075) |
0.0 | 0.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.0 | 0.1 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.0 | GO:0051938 | L-glutamate import(GO:0051938) |
0.0 | 0.3 | GO:0090190 | positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
0.0 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.2 | GO:0045760 | positive regulation of action potential(GO:0045760) |
0.0 | 0.1 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.0 | 0.0 | GO:0072199 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.0 | 0.1 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.6 | GO:0021766 | hippocampus development(GO:0021766) |
0.0 | 2.6 | GO:0072332 | intrinsic apoptotic signaling pathway by p53 class mediator(GO:0072332) |
0.0 | 0.0 | GO:0048818 | positive regulation of hair follicle maturation(GO:0048818) |
0.0 | 1.1 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.2 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.0 | 0.1 | GO:0086070 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) SA node cell to atrial cardiac muscle cell communication(GO:0086070) |
0.0 | 0.1 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 2.1 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.1 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.0 | 0.2 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
0.0 | 0.1 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.0 | 0.9 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.2 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.1 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.0 | 0.3 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
0.0 | 0.1 | GO:0002884 | regulation of type IV hypersensitivity(GO:0001807) negative regulation of hypersensitivity(GO:0002884) |
0.0 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.3 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 0.1 | GO:0021936 | regulation of cerebellar granule cell precursor proliferation(GO:0021936) |
0.0 | 0.2 | GO:0060074 | synapse maturation(GO:0060074) |
0.0 | 0.1 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.0 | 0.1 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.0 | 0.1 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.2 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
0.0 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.0 | 0.1 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.0 | 0.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.0 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 2.8 | GO:0010977 | negative regulation of neuron projection development(GO:0010977) |
0.0 | 0.3 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.6 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.1 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.0 | 0.3 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.0 | 1.2 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.0 | 0.1 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
0.0 | 0.5 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.5 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
0.0 | 0.2 | GO:0072044 | collecting duct development(GO:0072044) |
0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.3 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 1.7 | GO:0007613 | memory(GO:0007613) |
0.0 | 1.9 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.0 | 0.7 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.1 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.0 | 0.1 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.1 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) negative regulation of Schwann cell proliferation(GO:0010626) |
0.0 | 0.1 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.0 | 0.1 | GO:1902019 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.2 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
0.0 | 0.1 | GO:1904181 | positive regulation of membrane depolarization(GO:1904181) |
0.0 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.1 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
0.0 | 0.1 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.0 | 0.1 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.0 | 0.1 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.0 | 0.1 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
0.0 | 0.3 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.0 | 0.3 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
0.0 | 0.2 | GO:0007097 | nuclear migration(GO:0007097) |
0.0 | 0.2 | GO:0060068 | vagina development(GO:0060068) |
0.0 | 0.0 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
0.0 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.0 | 0.1 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
0.0 | 0.6 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
0.0 | 0.1 | GO:0001802 | type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
0.0 | 0.1 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.0 | 0.1 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
0.0 | 0.1 | GO:0006848 | pyruvate transport(GO:0006848) |
0.0 | 0.0 | GO:0071481 | cellular response to X-ray(GO:0071481) |
0.0 | 0.1 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.0 | 0.1 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.0 | 0.1 | GO:0060026 | convergent extension(GO:0060026) |
0.0 | 0.1 | GO:0060005 | vestibular reflex(GO:0060005) |
0.0 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.0 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
0.0 | 0.1 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.0 | 0.2 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
0.0 | 0.1 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
0.0 | 0.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.2 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.0 | 0.0 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
0.0 | 0.2 | GO:1903624 | regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
0.0 | 0.2 | GO:1990403 | embryonic brain development(GO:1990403) |
0.0 | 0.0 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.5 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.0 | 0.5 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.0 | 0.1 | GO:0030516 | regulation of axon extension(GO:0030516) |
0.0 | 0.2 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.0 | 0.1 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.0 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.0 | 0.2 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.0 | 0.1 | GO:0090237 | regulation of arachidonic acid secretion(GO:0090237) |
0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.2 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
0.0 | 0.1 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.0 | 1.3 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.0 | 0.1 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.0 | 0.0 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.0 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.0 | 0.0 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.0 | GO:0048162 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
0.0 | 0.0 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
0.0 | 0.2 | GO:1901381 | positive regulation of potassium ion transmembrane transport(GO:1901381) |
0.0 | 0.2 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.1 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
0.0 | 1.0 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 0.3 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.0 | 0.2 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.1 | GO:0043482 | cellular pigment accumulation(GO:0043482) |
0.0 | 0.3 | GO:0035774 | positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.0 | 0.2 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.0 | 0.0 | GO:0002339 | B cell selection(GO:0002339) |
0.0 | 0.0 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.1 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.0 | 0.0 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
0.0 | 0.1 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.0 | 0.0 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.0 | 0.0 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
0.0 | 0.0 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.0 | 0.1 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.0 | 0.3 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
0.0 | 0.4 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.2 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.0 | 0.0 | GO:1903423 | positive regulation of synaptic vesicle transport(GO:1902805) positive regulation of synaptic vesicle recycling(GO:1903423) |
0.0 | 0.3 | GO:0090102 | cochlea development(GO:0090102) |
0.0 | 0.1 | GO:1900619 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.0 | 0.1 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.1 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
0.0 | 0.0 | GO:0001555 | oocyte growth(GO:0001555) |
0.0 | 0.2 | GO:0003323 | type B pancreatic cell development(GO:0003323) |
0.0 | 0.1 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.0 | 0.1 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.0 | 0.1 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.2 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.3 | GO:0060359 | response to ammonium ion(GO:0060359) |
0.0 | 0.3 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.0 | 0.1 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.0 | 0.0 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.0 | 0.1 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
0.0 | 0.1 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.0 | 0.0 | GO:0007228 | signal transduction downstream of smoothened(GO:0007227) positive regulation of hh target transcription factor activity(GO:0007228) |
0.0 | 0.1 | GO:1903275 | regulation of sodium ion export(GO:1903273) positive regulation of sodium ion export(GO:1903275) regulation of sodium ion export from cell(GO:1903276) positive regulation of sodium ion export from cell(GO:1903278) |
0.0 | 0.1 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.0 | 0.1 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.0 | 0.0 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.0 | 0.0 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.0 | 0.1 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.0 | 0.0 | GO:0021884 | forebrain neuron development(GO:0021884) |
0.0 | 0.2 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.0 | 0.0 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
0.0 | 0.0 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.0 | 0.1 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
0.0 | 0.0 | GO:0014029 | neural crest formation(GO:0014029) |
0.0 | 0.0 | GO:0048143 | astrocyte activation(GO:0048143) |
0.0 | 0.0 | GO:1902837 | amino acid import into cell(GO:1902837) |
0.0 | 0.0 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.0 | 0.0 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.0 | 0.5 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.0 | 0.3 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
0.0 | 0.0 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.0 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.1 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
0.0 | 0.0 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.0 | 0.0 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.0 | 0.1 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.0 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.0 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) |
0.0 | 0.0 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
0.0 | 0.1 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.0 | 0.1 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.0 | 0.1 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.0 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.0 | 0.0 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.0 | 0.4 | GO:0046847 | filopodium assembly(GO:0046847) |
0.0 | 0.0 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.0 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.0 | 0.0 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.0 | 0.0 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.0 | 0.0 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.1 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.0 | 0.1 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
0.0 | 0.0 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
0.0 | 0.1 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.1 | GO:0006563 | L-serine metabolic process(GO:0006563) |
0.0 | 0.0 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.0 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.0 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.0 | 0.1 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
0.0 | 0.0 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.0 | 1.0 | GO:0007411 | axon guidance(GO:0007411) |
0.0 | 0.0 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.0 | 0.0 | GO:1900164 | determination of left/right asymmetry in lateral mesoderm(GO:0003140) nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
0.0 | 0.0 | GO:0036315 | cellular response to sterol(GO:0036315) |
0.0 | 0.1 | GO:0090205 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.0 | 0.1 | GO:0046697 | decidualization(GO:0046697) |
0.0 | 0.1 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.0 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
0.0 | 0.1 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.0 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.0 | 0.1 | GO:0033275 | actin-myosin filament sliding(GO:0033275) |
0.0 | 0.1 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.0 | 0.1 | GO:0006531 | aspartate metabolic process(GO:0006531) |
0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.1 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
0.0 | 0.1 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
0.0 | 0.2 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.1 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
0.0 | 0.0 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.0 | 0.0 | GO:0015819 | lysine transport(GO:0015819) |
0.0 | 0.0 | GO:0097012 | response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
0.0 | 0.1 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
0.0 | 0.0 | GO:0070340 | detection of bacterial lipopeptide(GO:0070340) |
0.0 | 0.0 | GO:0097154 | GABAergic neuron differentiation(GO:0097154) |
0.0 | 0.1 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.0 | 0.3 | GO:1904893 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
0.0 | 0.0 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.0 | 0.0 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.0 | 0.0 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.0 | 0.1 | GO:0014002 | astrocyte development(GO:0014002) |
0.0 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.0 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.0 | 0.0 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
0.0 | 0.5 | GO:0007566 | embryo implantation(GO:0007566) |
0.0 | 0.0 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
0.0 | 0.6 | GO:0014065 | phosphatidylinositol 3-kinase signaling(GO:0014065) |
0.0 | 0.0 | GO:0003011 | diaphragm contraction(GO:0002086) involuntary skeletal muscle contraction(GO:0003011) |
0.0 | 0.0 | GO:0021877 | forebrain neuron fate commitment(GO:0021877) |
0.0 | 0.0 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.0 | 0.0 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.0 | 0.1 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
0.0 | 0.1 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
0.0 | 0.0 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.0 | 0.2 | GO:0007040 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
0.0 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.1 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.0 | 0.0 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.0 | 0.1 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.0 | 0.0 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.0 | 0.0 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.0 | GO:1900738 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.0 | 0.0 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.0 | 0.0 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.0 | 0.0 | GO:0031622 | positive regulation of fever generation(GO:0031622) |
0.0 | 0.1 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.0 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.0 | 0.0 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
0.0 | 0.2 | GO:0006220 | pyrimidine nucleotide metabolic process(GO:0006220) |
0.0 | 0.4 | GO:0043484 | regulation of RNA splicing(GO:0043484) |
0.0 | 0.1 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.0 | 0.0 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 7.7 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.6 | 2.3 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.4 | 2.7 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.4 | 1.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.3 | 0.9 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.3 | 1.2 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.3 | 0.8 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.2 | 1.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.2 | 2.0 | GO:0097470 | ribbon synapse(GO:0097470) |
0.2 | 0.6 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.2 | 2.4 | GO:0071565 | nBAF complex(GO:0071565) |
0.2 | 9.4 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.2 | 0.3 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.2 | 0.5 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.1 | 0.4 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.1 | 0.5 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.5 | GO:0008091 | spectrin(GO:0008091) |
0.1 | 4.6 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.1 | 2.5 | GO:0044295 | axonal growth cone(GO:0044295) |
0.1 | 0.5 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 4.4 | GO:0034707 | chloride channel complex(GO:0034707) |
0.1 | 1.2 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.1 | 0.3 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 0.9 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 0.5 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.1 | 0.2 | GO:0097427 | microtubule bundle(GO:0097427) |
0.1 | 0.2 | GO:0033010 | paranodal junction(GO:0033010) |
0.1 | 0.3 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.1 | 2.3 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 10.6 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.1 | 0.3 | GO:0070695 | FHF complex(GO:0070695) |
0.1 | 0.2 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 0.6 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.1 | 6.7 | GO:0030426 | growth cone(GO:0030426) |
0.1 | 1.0 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 0.4 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 0.2 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 0.6 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.3 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 0.4 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.4 | GO:0042382 | paraspeckles(GO:0042382) |
0.1 | 0.3 | GO:0061617 | MICOS complex(GO:0061617) |
0.1 | 0.4 | GO:0043194 | axon initial segment(GO:0043194) |
0.0 | 0.1 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.2 | GO:0097433 | dense body(GO:0097433) |
0.0 | 4.3 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.0 | 0.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.0 | 0.1 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.0 | 0.0 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.2 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.0 | 0.3 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.2 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.6 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.2 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 0.6 | GO:0043205 | fibril(GO:0043205) |
0.0 | 0.6 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.0 | 0.2 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.0 | 0.2 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.3 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.2 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.1 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 1.4 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
0.0 | 0.2 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.3 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 0.1 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.7 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 0.2 | GO:0032797 | SMN complex(GO:0032797) |
0.0 | 0.7 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.4 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.0 | 0.6 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 0.6 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 0.1 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
0.0 | 0.7 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 2.7 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.5 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.2 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.0 | 0.2 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 1.1 | GO:0043197 | dendritic spine(GO:0043197) |
0.0 | 0.1 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.0 | 0.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 0.3 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.1 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.0 | 0.2 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 0.4 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.0 | 0.2 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.3 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.0 | 1.0 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.0 | 0.2 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.1 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 1.4 | GO:0043679 | axon terminus(GO:0043679) |
0.0 | 0.2 | GO:0043198 | dendritic shaft(GO:0043198) |
0.0 | 0.2 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.3 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.0 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.0 | 0.1 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.0 | 0.1 | GO:0071439 | clathrin complex(GO:0071439) |
0.0 | 0.7 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 0.1 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.2 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.0 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.0 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.0 | 0.2 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.1 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.0 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.1 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.0 | 0.0 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.4 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.1 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.0 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.0 | 0.0 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.0 | 0.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.1 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.0 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 3.8 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
1.0 | 4.9 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.7 | 1.4 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.5 | 3.7 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.5 | 3.2 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.4 | 2.2 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.4 | 2.6 | GO:0003680 | AT DNA binding(GO:0003680) |
0.4 | 3.4 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.4 | 8.5 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.3 | 2.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.3 | 3.8 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.3 | 2.2 | GO:0030957 | Tat protein binding(GO:0030957) |
0.3 | 3.0 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.3 | 0.8 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.3 | 0.8 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.2 | 0.7 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.2 | 0.7 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.2 | 1.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.2 | 4.9 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.2 | 0.9 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.2 | 1.6 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.2 | 0.7 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.2 | 1.3 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.2 | 2.5 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.2 | 0.7 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.2 | 0.9 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.2 | 4.5 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.2 | 0.5 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.2 | 2.3 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.2 | 0.2 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.2 | 0.6 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.2 | 0.3 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 0.3 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.1 | 0.7 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.1 | 0.6 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.1 | 0.8 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 1.5 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.1 | 5.5 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.1 | 0.5 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.1 | 0.4 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.1 | 0.4 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.1 | 0.4 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.1 | 0.6 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 0.6 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.1 | 0.4 | GO:0008412 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.1 | 0.6 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.1 | 1.5 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 0.6 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.3 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.1 | 0.5 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.1 | 0.3 | GO:0005119 | smoothened binding(GO:0005119) |
0.1 | 0.4 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.4 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.1 | 0.4 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
0.1 | 0.3 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.1 | 1.3 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.7 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.1 | 0.4 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.1 | 0.2 | GO:0009374 | biotin binding(GO:0009374) |
0.1 | 0.3 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.1 | 2.2 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.1 | 1.4 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.1 | 1.4 | GO:0015026 | coreceptor activity(GO:0015026) |
0.1 | 0.2 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 1.7 | GO:0030552 | cAMP binding(GO:0030552) |
0.1 | 0.3 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.1 | 2.0 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.1 | 0.2 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.1 | 0.2 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.1 | 1.9 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.1 | 0.2 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.1 | 1.5 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.1 | 0.1 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
0.1 | 0.4 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.1 | 2.7 | GO:0018727 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) heparan sulfate 2-O-sulfotransferase activity(GO:0004394) HNK-1 sulfotransferase activity(GO:0016232) heparan sulfate 6-O-sulfotransferase activity(GO:0017095) trans-9R,10R-dihydrodiolphenanthrene sulfotransferase activity(GO:0018721) 1-phenanthrol sulfotransferase activity(GO:0018722) 3-phenanthrol sulfotransferase activity(GO:0018723) 4-phenanthrol sulfotransferase activity(GO:0018724) trans-3,4-dihydrodiolphenanthrene sulfotransferase activity(GO:0018725) 9-phenanthrol sulfotransferase activity(GO:0018726) 2-phenanthrol sulfotransferase activity(GO:0018727) phenanthrol sulfotransferase activity(GO:0019111) 1-hydroxypyrene sulfotransferase activity(GO:0034930) proteoglycan sulfotransferase activity(GO:0050698) cholesterol sulfotransferase activity(GO:0051922) hydroxyjasmonate sulfotransferase activity(GO:0080131) |
0.1 | 1.7 | GO:0050699 | WW domain binding(GO:0050699) |
0.1 | 0.5 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.1 | 0.2 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.1 | 0.1 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.1 | 0.3 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.1 | 0.5 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 0.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 1.2 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.1 | 0.3 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.1 | 0.2 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.3 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.1 | 0.8 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 3.6 | GO:0002039 | p53 binding(GO:0002039) |
0.1 | 2.1 | GO:0019894 | kinesin binding(GO:0019894) |
0.1 | 0.2 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.1 | 1.3 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.1 | 0.3 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 1.0 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 0.5 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.1 | 0.3 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.1 | 0.3 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.1 | 0.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.1 | 0.2 | GO:1990254 | keratin filament binding(GO:1990254) |
0.1 | 0.6 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.1 | 0.3 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.1 | 0.6 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.0 | 0.2 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.0 | 0.2 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.0 | 0.5 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 1.2 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.0 | 0.3 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.4 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.4 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.4 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.4 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.3 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.0 | 1.2 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.0 | 0.4 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.2 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.0 | 0.2 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.0 | 0.2 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.1 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.0 | 0.2 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.0 | 0.2 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.0 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
0.0 | 0.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.0 | 2.0 | GO:0017022 | myosin binding(GO:0017022) |
0.0 | 0.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.0 | 0.1 | GO:0097001 | ceramide binding(GO:0097001) |
0.0 | 0.2 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.0 | 0.2 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.2 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.0 | 0.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.0 | 0.3 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.9 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.1 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
0.0 | 0.1 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.0 | 0.5 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 0.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.0 | 0.0 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 1.3 | GO:0008009 | chemokine activity(GO:0008009) |
0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.4 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
0.0 | 0.6 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.6 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 0.1 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 0.3 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 0.2 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.3 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.4 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.0 | 0.4 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.1 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.0 | 0.0 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.4 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.1 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.0 | 0.3 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.1 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.0 | 0.7 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.0 | 0.7 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.0 | 0.1 | GO:0019864 | IgG binding(GO:0019864) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.1 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.0 | 0.1 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.0 | 0.0 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
0.0 | 0.1 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.0 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.0 | 0.1 | GO:0005221 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.1 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.0 | 0.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.2 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 0.5 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.1 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.5 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.0 | 1.6 | GO:0030165 | PDZ domain binding(GO:0030165) |
0.0 | 0.0 | GO:1990459 | transferrin receptor binding(GO:1990459) |
0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.1 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.1 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.0 | 0.4 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.3 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.3 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.1 | GO:0031402 | sodium ion binding(GO:0031402) |
0.0 | 0.2 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.3 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
0.0 | 0.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.2 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.1 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.0 | 0.1 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.1 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.0 | 0.8 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
0.0 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.1 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.2 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.0 | 0.1 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.5 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.0 | 0.1 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.0 | 0.2 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.1 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 0.1 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.0 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.0 | 0.2 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.2 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 0.6 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.0 | 0.5 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.0 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.0 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.1 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.0 | 0.0 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.0 | 0.0 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.0 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.0 | 0.2 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.0 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.0 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.0 | 0.0 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
0.0 | 0.1 | GO:0022821 | potassium ion antiporter activity(GO:0022821) |
0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.1 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.0 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.0 | 0.0 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 0.2 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.1 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.0 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.1 | GO:0102344 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.0 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.0 | 0.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.2 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.3 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.0 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.0 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 0.0 | GO:0005148 | prolactin receptor binding(GO:0005148) |
0.0 | 0.0 | GO:0004027 | alcohol sulfotransferase activity(GO:0004027) |
0.0 | 0.0 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.1 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.0 | 0.0 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.0 | 0.0 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.0 | 0.0 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.0 | 0.0 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.0 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
0.0 | 0.0 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.0 | 0.1 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.0 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 0.1 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.0 | 0.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.1 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.0 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.8 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
0.0 | 0.0 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.0 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.0 | 0.3 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.0 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.0 | 0.2 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.0 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.2 | GO:0052635 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) DNA-N1-methyladenine dioxygenase activity(GO:0043734) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.0 | 0.0 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 4.7 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.1 | 4.2 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.1 | 3.9 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.1 | 1.0 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 2.2 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 0.7 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 1.3 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 2.7 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.1 | 3.1 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 4.0 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.1 | 1.6 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.1 | 0.3 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 0.6 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.5 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.7 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.7 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.9 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 1.0 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.2 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.4 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 1.4 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.5 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 1.3 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.5 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.4 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.2 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.5 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.7 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.3 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.5 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.5 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.3 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.3 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.1 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.0 | 0.2 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.0 | 0.1 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.0 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.1 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 0.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.2 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.0 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 2.6 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.4 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 2.6 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.3 | 3.9 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.2 | 0.2 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.2 | 2.8 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.2 | 1.9 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.2 | 4.7 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.2 | 2.8 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.2 | 3.9 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.2 | 2.3 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
0.2 | 2.1 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.2 | 3.2 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 1.5 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.1 | 1.1 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.1 | 1.4 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.1 | 1.9 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 0.2 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.1 | 1.0 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 2.4 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 0.1 | REACTOME NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Neurotransmitter Release Cycle |
0.1 | 1.7 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 1.0 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 1.4 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 3.1 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 1.2 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 0.1 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
0.1 | 0.8 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.1 | 1.0 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.1 | 0.8 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 2.8 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.1 | 0.8 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.1 | 0.6 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 0.1 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
0.1 | 0.5 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
0.1 | 0.5 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.2 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 0.1 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
0.0 | 0.7 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.5 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.0 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.1 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
0.0 | 0.7 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.0 | 0.4 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.0 | 0.3 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.7 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.2 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 1.0 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.1 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.0 | 0.6 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.2 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.3 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.2 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.3 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.0 | 0.1 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.0 | 0.0 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.0 | 0.0 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.2 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 0.1 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.0 | 0.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.0 | 0.1 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.1 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.0 | 0.0 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 0.4 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 0.0 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.0 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.1 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.1 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.7 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.1 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.1 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |