Gene Symbol | Gene ID | Gene Info |
---|---|---|
Prop1
|
ENSMUSG00000044542.3 | Prop1 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Prop1 | chr11_50952280_50952539 | 45 | 0.937838 | -0.38 | 2.9e-03 | Click! |
Prop1 | chr11_50950541_50950692 | 1838 | 0.160563 | 0.02 | 8.8e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chrX_105390628_105392456 | 7.27 |
5330434G04Rik |
RIKEN cDNA 5330434G04 gene |
212 |
0.93 |
chr12_29529828_29531185 | 5.48 |
Gm20208 |
predicted gene, 20208 |
609 |
0.74 |
chr8_41054160_41054452 | 5.40 |
Mtus1 |
mitochondrial tumor suppressor 1 |
477 |
0.69 |
chr1_78193153_78194695 | 5.11 |
Pax3 |
paired box 3 |
2914 |
0.3 |
chr8_54954519_54955779 | 4.72 |
Gpm6a |
glycoprotein m6a |
306 |
0.88 |
chr4_6986587_6987701 | 4.35 |
Tox |
thymocyte selection-associated high mobility group box |
3339 |
0.35 |
chr3_5224377_5225076 | 4.14 |
Zfhx4 |
zinc finger homeodomain 4 |
3221 |
0.24 |
chr3_86543379_86544222 | 3.94 |
Lrba |
LPS-responsive beige-like anchor |
1767 |
0.38 |
chr4_22485441_22485749 | 3.83 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
2771 |
0.23 |
chr4_22485878_22486449 | 3.69 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
2203 |
0.26 |
chr15_25415436_25415919 | 3.51 |
Gm48957 |
predicted gene, 48957 |
614 |
0.58 |
chr7_137311015_137311991 | 3.50 |
Ebf3 |
early B cell factor 3 |
2413 |
0.29 |
chr18_43686213_43686392 | 3.32 |
Jakmip2 |
janus kinase and microtubule interacting protein 2 |
1323 |
0.49 |
chr4_33926104_33927188 | 3.31 |
Cnr1 |
cannabinoid receptor 1 (brain) |
444 |
0.88 |
chr1_177444257_177446079 | 3.29 |
Zbtb18 |
zinc finger and BTB domain containing 18 |
230 |
0.9 |
chr9_19622616_19622889 | 3.18 |
Zfp317 |
zinc finger protein 317 |
47 |
0.96 |
chr12_29536509_29537451 | 3.06 |
Myt1l |
myelin transcription factor 1-like |
1758 |
0.36 |
chr13_34125172_34126139 | 3.05 |
Tubb2b |
tubulin, beta 2B class IIB |
4699 |
0.12 |
chr8_33747278_33748028 | 3.04 |
Smim18 |
small integral membrane protein 18 |
117 |
0.95 |
chr13_83728524_83729044 | 2.95 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
678 |
0.43 |
chr3_86545154_86545526 | 2.91 |
Lrba |
LPS-responsive beige-like anchor |
1415 |
0.43 |
chr11_94045498_94046076 | 2.88 |
Spag9 |
sperm associated antigen 9 |
1422 |
0.4 |
chr12_46816152_46816702 | 2.84 |
Nova1 |
NOVA alternative splicing regulator 1 |
533 |
0.8 |
chr16_77645323_77645620 | 2.83 |
Mir125b-2 |
microRNA 125b-2 |
802 |
0.35 |
chr3_17789318_17789657 | 2.78 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
434 |
0.83 |
chr2_97468266_97469202 | 2.74 |
Lrrc4c |
leucine rich repeat containing 4C |
645 |
0.83 |
chr5_131535209_131535476 | 2.71 |
Auts2 |
autism susceptibility candidate 2 |
945 |
0.57 |
chr1_143644977_143645827 | 2.70 |
Cdc73 |
cell division cycle 73, Paf1/RNA polymerase II complex component |
2877 |
0.24 |
chr3_122492818_122493472 | 2.69 |
Bcar3 |
breast cancer anti-estrogen resistance 3 |
9422 |
0.14 |
chr14_122481093_122481670 | 2.66 |
Zic2 |
zinc finger protein of the cerebellum 2 |
3281 |
0.14 |
chr4_24429141_24429555 | 2.65 |
Gm27243 |
predicted gene 27243 |
1542 |
0.44 |
chr1_6731579_6732076 | 2.63 |
St18 |
suppression of tumorigenicity 18 |
1725 |
0.48 |
chr13_78193022_78193812 | 2.59 |
Nr2f1 |
nuclear receptor subfamily 2, group F, member 1 |
2956 |
0.18 |
chr9_60686843_60686994 | 2.59 |
Lrrc49 |
leucine rich repeat containing 49 |
616 |
0.74 |
chr19_6499251_6500132 | 2.57 |
Nrxn2 |
neurexin II |
1856 |
0.23 |
chr7_51629095_51630495 | 2.52 |
Slc17a6 |
solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 6 |
315 |
0.88 |
chr12_49387532_49388566 | 2.52 |
3110039M20Rik |
RIKEN cDNA 3110039M20 gene |
1603 |
0.26 |
chr17_17403475_17404024 | 2.51 |
Lix1 |
limb and CNS expressed 1 |
1077 |
0.44 |
chr16_77598670_77599917 | 2.43 |
Mir99a |
microRNA 99a |
357 |
0.44 |
chr5_65132137_65132288 | 2.39 |
Klhl5 |
kelch-like 5 |
541 |
0.73 |
chr13_109927479_109928182 | 2.39 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
986 |
0.65 |
chr3_66746318_66747483 | 2.37 |
Gm6555 |
predicted gene 6555 |
135450 |
0.05 |
chr1_66324716_66324867 | 2.35 |
Map2 |
microtubule-associated protein 2 |
2689 |
0.25 |
chr6_23382210_23383537 | 2.34 |
Cadps2 |
Ca2+-dependent activator protein for secretion 2 |
26954 |
0.22 |
chr1_155414821_155416000 | 2.32 |
Xpr1 |
xenotropic and polytropic retrovirus receptor 1 |
1919 |
0.42 |
chr8_54956010_54956394 | 2.30 |
Gpm6a |
glycoprotein m6a |
1359 |
0.38 |
chr7_51790847_51791228 | 2.27 |
Gm29296 |
predicted gene 29296 |
18311 |
0.16 |
chr8_12327956_12328107 | 2.24 |
Gm33175 |
predicted gene, 33175 |
8551 |
0.16 |
chr1_42703141_42704653 | 2.24 |
Pantr2 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 2 |
4155 |
0.16 |
chr8_34890130_34891317 | 2.24 |
Tnks |
tankyrase, TRF1-interacting ankyrin-related ADP-ribose polymerase |
572 |
0.8 |
chr10_116096404_116096629 | 2.23 |
Taf7l2 |
Taf7l2 |
17076 |
0.23 |
chr5_121008454_121009154 | 2.21 |
Rph3a |
rabphilin 3A |
262 |
0.91 |
chr12_53250015_53250166 | 2.20 |
Npas3 |
neuronal PAS domain protein 3 |
1413 |
0.56 |
chr3_34654574_34655689 | 2.16 |
Sox2ot |
SOX2 overlapping transcript (non-protein coding) |
905 |
0.42 |
chr1_84709872_84710637 | 2.14 |
Dner |
delta/notch-like EGF repeat containing |
14033 |
0.15 |
chr15_25410386_25410743 | 2.11 |
Basp1 |
brain abundant, membrane attached signal protein 1 |
3134 |
0.19 |
chr8_14381737_14382325 | 2.10 |
Dlgap2 |
DLG associated protein 2 |
35 |
0.98 |
chr7_51633247_51633711 | 2.09 |
Gm45072 |
predicted gene 45072 |
1754 |
0.35 |
chr2_13175207_13176270 | 2.07 |
Gm37780 |
predicted gene, 37780 |
12115 |
0.2 |
chr9_110053895_110054422 | 2.04 |
Map4 |
microtubule-associated protein 4 |
2106 |
0.22 |
chr12_46814495_46815083 | 2.04 |
Nova1 |
NOVA alternative splicing regulator 1 |
2171 |
0.31 |
chr4_17856015_17856350 | 2.03 |
Mmp16 |
matrix metallopeptidase 16 |
2589 |
0.43 |
chr9_41585694_41587243 | 2.03 |
Mir100hg |
Mir100 Mirlet7a-2 Mir125b-1 cluster host gene |
1301 |
0.29 |
chr8_112427534_112428308 | 1.99 |
Gm26994 |
predicted gene, 26994 |
141654 |
0.05 |
chr13_83724063_83724214 | 1.96 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
2757 |
0.18 |
chr10_69707438_69707835 | 1.95 |
Ank3 |
ankyrin 3, epithelial |
1158 |
0.65 |
chr12_55983564_55984124 | 1.94 |
Gm5183 |
predicted gene 5183 |
66689 |
0.09 |
chr5_19907724_19909563 | 1.91 |
Magi2 |
membrane associated guanylate kinase, WW and PDZ domain containing 2 |
682 |
0.82 |
chr15_91189875_91190949 | 1.91 |
Abcd2 |
ATP-binding cassette, sub-family D (ALD), member 2 |
286 |
0.92 |
chr5_131532921_131534054 | 1.90 |
Auts2 |
autism susceptibility candidate 2 |
910 |
0.58 |
chr6_138424419_138425583 | 1.90 |
Lmo3 |
LIM domain only 3 |
386 |
0.83 |
chr15_98983254_98984205 | 1.89 |
4930578M01Rik |
RIKEN cDNA 4930578M01 gene |
102 |
0.93 |
chr1_173389198_173389349 | 1.89 |
Cadm3 |
cell adhesion molecule 3 |
21578 |
0.15 |
chr3_80799469_80799764 | 1.89 |
Gria2 |
glutamate receptor, ionotropic, AMPA2 (alpha 2) |
2963 |
0.34 |
chr10_49785211_49786117 | 1.88 |
Grik2 |
glutamate receptor, ionotropic, kainate 2 (beta 2) |
2255 |
0.25 |
chr3_5222045_5223052 | 1.88 |
Zfhx4 |
zinc finger homeodomain 4 |
1043 |
0.46 |
chrX_61116034_61117613 | 1.88 |
Cdr1os |
cerebellar degeneration related antigen 1, opposite strand |
425 |
0.47 |
chr1_146494200_146495557 | 1.87 |
Gm29514 |
predicted gene 29514 |
73 |
0.56 |
chr16_43504464_43505047 | 1.85 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
1058 |
0.61 |
chr13_97746854_97747895 | 1.83 |
5330416C01Rik |
RIKEN cDNA 5330416C01 gene |
5 |
0.97 |
chr10_18470218_18471289 | 1.83 |
Nhsl1 |
NHS-like 1 |
772 |
0.72 |
chr5_134466813_134467078 | 1.82 |
Gm16020 |
predicted gene 16020 |
3705 |
0.12 |
chr6_134886811_134888239 | 1.82 |
Gpr19 |
G protein-coupled receptor 19 |
243 |
0.87 |
chr15_92160888_92162023 | 1.82 |
Cntn1 |
contactin 1 |
98 |
0.98 |
chr19_38265533_38266016 | 1.80 |
Lgi1 |
leucine-rich repeat LGI family, member 1 |
364 |
0.85 |
chr1_12577058_12577720 | 1.77 |
Gm2383 |
predicted gene 2383 |
11812 |
0.23 |
chr4_110285249_110285423 | 1.77 |
Elavl4 |
ELAV like RNA binding protein 4 |
1280 |
0.61 |
chr15_97607571_97607856 | 1.76 |
Gm49506 |
predicted gene, 49506 |
49423 |
0.13 |
chr18_37217058_37218378 | 1.76 |
Gm10544 |
predicted gene 10544 |
39196 |
0.08 |
chr10_64083865_64084461 | 1.76 |
Lrrtm3 |
leucine rich repeat transmembrane neuronal 3 |
6084 |
0.33 |
chr14_122376364_122377232 | 1.75 |
Gm25464 |
predicted gene, 25464 |
11362 |
0.18 |
chrX_166349290_166349906 | 1.74 |
Gpm6b |
glycoprotein m6b |
4756 |
0.26 |
chrX_133682515_133683917 | 1.74 |
Pcdh19 |
protocadherin 19 |
1775 |
0.49 |
chr4_72195085_72196381 | 1.73 |
Tle1 |
transducin-like enhancer of split 1 |
3359 |
0.26 |
chr5_111423567_111424249 | 1.70 |
Gm43119 |
predicted gene 43119 |
319 |
0.88 |
chr4_36949218_36949456 | 1.70 |
Lingo2 |
leucine rich repeat and Ig domain containing 2 |
1130 |
0.55 |
chr2_57613916_57615034 | 1.70 |
Gm13532 |
predicted gene 13532 |
14753 |
0.2 |
chr8_109248088_109248728 | 1.69 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
1458 |
0.54 |
chr9_96258788_96259580 | 1.69 |
Tfdp2 |
transcription factor Dp 2 |
69 |
0.97 |
chr2_22624675_22625045 | 1.68 |
Gad2 |
glutamic acid decarboxylase 2 |
1556 |
0.29 |
chr13_83727321_83728283 | 1.68 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
304 |
0.83 |
chr11_36676450_36677161 | 1.67 |
Tenm2 |
teneurin transmembrane protein 2 |
940 |
0.7 |
chr14_122477737_122477888 | 1.67 |
Zic2 |
zinc finger protein of the cerebellum 2 |
288 |
0.83 |
chr2_52860105_52860808 | 1.66 |
Fmnl2 |
formin-like 2 |
2588 |
0.39 |
chr18_31316134_31317386 | 1.64 |
Rit2 |
Ras-like without CAAX 2 |
351 |
0.9 |
chr2_157704945_157705824 | 1.64 |
Gm25407 |
predicted gene, 25407 |
8417 |
0.18 |
chr1_173389412_173390669 | 1.64 |
Cadm3 |
cell adhesion molecule 3 |
22345 |
0.14 |
chr6_16727216_16727889 | 1.62 |
Gm36669 |
predicted gene, 36669 |
49972 |
0.17 |
chr5_84413029_84413589 | 1.62 |
Epha5 |
Eph receptor A5 |
3497 |
0.31 |
chr6_13834624_13835191 | 1.61 |
Gpr85 |
G protein-coupled receptor 85 |
2334 |
0.31 |
chr16_5887080_5887640 | 1.61 |
Rbfox1 |
RNA binding protein, fox-1 homolog (C. elegans) 1 |
1773 |
0.51 |
chr2_6883618_6884699 | 1.61 |
Gm13389 |
predicted gene 13389 |
112 |
0.85 |
chr9_91366433_91367646 | 1.61 |
Zic1 |
zinc finger protein of the cerebellum 1 |
1229 |
0.26 |
chr5_37241461_37244349 | 1.60 |
Crmp1 |
collapsin response mediator protein 1 |
171 |
0.95 |
chr10_40885530_40885990 | 1.59 |
Wasf1 |
WAS protein family, member 1 |
1933 |
0.32 |
chr1_17145379_17145927 | 1.59 |
Gdap1 |
ganglioside-induced differentiation-associated-protein 1 |
185 |
0.94 |
chr12_118298161_118299409 | 1.59 |
Sp4 |
trans-acting transcription factor 4 |
2583 |
0.37 |
chr3_5236077_5236268 | 1.59 |
Zfhx4 |
zinc finger homeodomain 4 |
5500 |
0.22 |
chr4_125282262_125283039 | 1.59 |
1700041M05Rik |
RIKEN cDNA 1700041M05 gene |
54053 |
0.14 |
chr11_82863079_82863282 | 1.59 |
Rffl |
ring finger and FYVE like domain containing protein |
7564 |
0.11 |
chr1_99774315_99774575 | 1.59 |
Cntnap5b |
contactin associated protein-like 5B |
1680 |
0.43 |
chr10_110453550_110454045 | 1.58 |
Nav3 |
neuron navigator 3 |
2407 |
0.34 |
chr17_67499984_67500234 | 1.57 |
Gm36201 |
predicted gene, 36201 |
129223 |
0.05 |
chr10_42581935_42584872 | 1.57 |
Nr2e1 |
nuclear receptor subfamily 2, group E, member 1 |
229 |
0.69 |
chr6_137956817_137957406 | 1.56 |
Gm24308 |
predicted gene, 24308 |
37140 |
0.19 |
chr12_61525659_61526870 | 1.56 |
Lrfn5 |
leucine rich repeat and fibronectin type III domain containing 5 |
2316 |
0.3 |
chr2_117440042_117440467 | 1.56 |
Gm13982 |
predicted gene 13982 |
22557 |
0.24 |
chrX_133681727_133682400 | 1.56 |
Pcdh19 |
protocadherin 19 |
2928 |
0.38 |
chr3_151333109_151333260 | 1.54 |
Gm42949 |
predicted gene 42949 |
165 |
0.97 |
chr5_22342338_22343153 | 1.54 |
Reln |
reelin |
1945 |
0.26 |
chr16_77235848_77236417 | 1.53 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
185 |
0.96 |
chr15_95525831_95525991 | 1.53 |
Nell2 |
NEL-like 2 |
2267 |
0.39 |
chr1_64117867_64118702 | 1.53 |
Klf7 |
Kruppel-like factor 7 (ubiquitous) |
3198 |
0.25 |
chr7_141945515_141946556 | 1.52 |
Gm20501 |
predicted gene 20501 |
78 |
0.96 |
chr13_84905458_84906287 | 1.51 |
Gm4059 |
predicted gene 4059 |
68445 |
0.12 |
chr8_88793832_88794104 | 1.51 |
Rps6-ps2 |
ribosomal protein S6, pseudogene 2 |
12423 |
0.2 |
chr17_43157421_43159105 | 1.49 |
E130008D07Rik |
RIKEN cDNA E130008D07 gene |
3 |
0.99 |
chr7_79505833_79506958 | 1.49 |
Mir9-3 |
microRNA 9-3 |
1131 |
0.28 |
chr9_96733821_96734335 | 1.49 |
Zbtb38 |
zinc finger and BTB domain containing 38 |
1308 |
0.4 |
chr12_72233267_72233815 | 1.48 |
Rtn1 |
reticulon 1 |
2198 |
0.35 |
chr10_86489595_86489929 | 1.47 |
Syn3 |
synapsin III |
2135 |
0.22 |
chr5_137738720_137739175 | 1.47 |
Nyap1 |
neuronal tyrosine-phosphorylated phosphoinositide 3-kinase adaptor 1 |
771 |
0.43 |
chr13_44946654_44947258 | 1.46 |
Dtnbp1 |
dystrobrevin binding protein 1 |
188 |
0.96 |
chr2_20964922_20965130 | 1.46 |
Arhgap21 |
Rho GTPase activating protein 21 |
2694 |
0.26 |
chr3_86542542_86543253 | 1.46 |
Lrba |
LPS-responsive beige-like anchor |
864 |
0.63 |
chr13_110277692_110277997 | 1.45 |
Rab3c |
RAB3C, member RAS oncogene family |
2306 |
0.36 |
chr18_88040282_88040879 | 1.44 |
Gm50391 |
predicted gene, 50391 |
55970 |
0.16 |
chr2_65620767_65621991 | 1.44 |
Scn2a |
sodium channel, voltage-gated, type II, alpha |
568 |
0.82 |
chr3_34658275_34659470 | 1.43 |
Sox2ot |
SOX2 overlapping transcript (non-protein coding) |
2836 |
0.15 |
chr13_105249002_105249192 | 1.43 |
Rnf180 |
ring finger protein 180 |
21942 |
0.21 |
chr3_26329790_26330404 | 1.42 |
A830092H15Rik |
RIKEN cDNA A830092H15 gene |
1053 |
0.5 |
chr13_28881136_28881895 | 1.42 |
2610307P16Rik |
RIKEN cDNA 2610307P16 gene |
1941 |
0.32 |
chr3_107040280_107040795 | 1.42 |
AI504432 |
expressed sequence AI504432 |
1033 |
0.48 |
chr17_40812809_40813139 | 1.41 |
Rhag |
Rhesus blood group-associated A glycoprotein |
1790 |
0.29 |
chr9_37141868_37142572 | 1.39 |
Gm48717 |
predicted gene, 48717 |
2596 |
0.18 |
chr2_34368351_34369364 | 1.39 |
Pbx3 |
pre B cell leukemia homeobox 3 |
1989 |
0.33 |
chr4_82704043_82705687 | 1.39 |
Nfib |
nuclear factor I/B |
885 |
0.62 |
chr12_32058291_32058942 | 1.39 |
Prkar2b |
protein kinase, cAMP dependent regulatory, type II beta |
1973 |
0.34 |
chrX_166344665_166345995 | 1.39 |
Gpm6b |
glycoprotein m6b |
488 |
0.85 |
chr1_23379124_23380478 | 1.36 |
Ogfrl1 |
opioid growth factor receptor-like 1 |
1000 |
0.55 |
chr11_25856443_25856988 | 1.35 |
5730522E02Rik |
RIKEN cDNA 5730522E02 gene |
87574 |
0.1 |
chr16_95654046_95654641 | 1.35 |
Ets2 |
E26 avian leukemia oncogene 2, 3' domain |
47732 |
0.14 |
chr8_85697726_85697932 | 1.34 |
Neto2 |
neuropilin (NRP) and tolloid (TLL)-like 2 |
2925 |
0.2 |
chr8_47334980_47335140 | 1.33 |
Stox2 |
storkhead box 2 |
17288 |
0.23 |
chr3_88206822_88208169 | 1.32 |
Gm3764 |
predicted gene 3764 |
183 |
0.86 |
chr5_107498136_107498752 | 1.32 |
Btbd8 |
BTB (POZ) domain containing 8 |
665 |
0.57 |
chr8_42973927_42974245 | 1.32 |
Gm45590 |
predicted gene 45590 |
111501 |
0.06 |
chr2_6867243_6867952 | 1.32 |
Celf2 |
CUGBP, Elav-like family member 2 |
4375 |
0.24 |
chr1_42711455_42712692 | 1.32 |
Pantr2 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 2 |
1381 |
0.34 |
chr3_153276849_153277884 | 1.32 |
1700012D16Rik |
RIKEN cDNA 1700012D16 gene |
21283 |
0.16 |
chr16_63860769_63861945 | 1.31 |
Epha3 |
Eph receptor A3 |
2056 |
0.46 |
chr13_116514424_116515376 | 1.31 |
Gm47913 |
predicted gene, 47913 |
148636 |
0.04 |
chr4_110284889_110285145 | 1.30 |
Elavl4 |
ELAV like RNA binding protein 4 |
1599 |
0.53 |
chr11_24085127_24085687 | 1.30 |
Bcl11a |
B cell CLL/lymphoma 11A (zinc finger protein) |
4737 |
0.16 |
chr1_6729327_6730832 | 1.30 |
St18 |
suppression of tumorigenicity 18 |
9 |
0.99 |
chr4_30312853_30313130 | 1.29 |
Gm11924 |
predicted gene 11924 |
119121 |
0.06 |
chr5_67097111_67099075 | 1.29 |
Phox2b |
paired-like homeobox 2b |
964 |
0.51 |
chr8_23671495_23672460 | 1.29 |
Zmat4 |
zinc finger, matrin type 4 |
2303 |
0.35 |
chr4_97781842_97782066 | 1.29 |
E130114P18Rik |
RIKEN cDNA E130114P18 gene |
3876 |
0.23 |
chr13_78206997_78207615 | 1.28 |
A830082K12Rik |
RIKEN cDNA A830082K12 gene |
4519 |
0.16 |
chr11_36674582_36674982 | 1.28 |
Tenm2 |
teneurin transmembrane protein 2 |
2963 |
0.37 |
chr2_56959863_56960191 | 1.28 |
Gm13527 |
predicted gene 13527 |
119721 |
0.06 |
chrX_136272235_136272893 | 1.28 |
Bex3 |
brain expressed X-linked 3 |
1789 |
0.2 |
chr6_8949544_8950237 | 1.27 |
Nxph1 |
neurexophilin 1 |
214 |
0.97 |
chr19_55880817_55881064 | 1.27 |
Tcf7l2 |
transcription factor 7 like 2, T cell specific, HMG box |
12412 |
0.24 |
chr15_6498595_6498964 | 1.26 |
C9 |
complement component 9 |
8861 |
0.22 |
chr1_129275124_129275766 | 1.26 |
Thsd7b |
thrombospondin, type I, domain containing 7B |
1960 |
0.39 |
chr7_60001655_60001979 | 1.26 |
Snurf |
SNRPN upstream reading frame |
3232 |
0.09 |
chr4_8750599_8751359 | 1.26 |
Chd7 |
chromodomain helicase DNA binding protein 7 |
459 |
0.89 |
chr12_84150828_84152588 | 1.26 |
Pnma1 |
paraneoplastic antigen MA1 |
3219 |
0.13 |
chr16_7041535_7042315 | 1.25 |
Rbfox1 |
RNA binding protein, fox-1 homolog (C. elegans) 1 |
27921 |
0.28 |
chr14_74642562_74643534 | 1.25 |
Htr2a |
5-hydroxytryptamine (serotonin) receptor 2A |
2208 |
0.37 |
chr9_42262076_42262960 | 1.25 |
Sc5d |
sterol-C5-desaturase |
1682 |
0.34 |
chr8_11912753_11914044 | 1.25 |
Gm45680 |
predicted gene 45680 |
34899 |
0.12 |
chrX_66650666_66650817 | 1.24 |
Slitrk2 |
SLIT and NTRK-like family, member 2 |
1423 |
0.41 |
chrX_66650823_66651841 | 1.24 |
Slitrk2 |
SLIT and NTRK-like family, member 2 |
1675 |
0.36 |
chr3_99254836_99255604 | 1.24 |
Tbx15 |
T-box 15 |
1460 |
0.36 |
chr18_83192582_83193531 | 1.24 |
1700095A13Rik |
RIKEN cDNA 1700095A13 gene |
85166 |
0.08 |
chr2_71538271_71539979 | 1.23 |
Dlx1as |
distal-less homeobox 1, antisense |
1234 |
0.37 |
chr6_39874717_39875333 | 1.23 |
Tmem178b |
transmembrane protein 178B |
1954 |
0.27 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.4 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.9 | 3.8 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.7 | 3.4 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
0.6 | 3.1 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.6 | 2.4 | GO:0060594 | mammary gland specification(GO:0060594) |
0.6 | 1.7 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.6 | 2.2 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.6 | 1.7 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.5 | 2.7 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.5 | 1.0 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.5 | 1.5 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.5 | 3.4 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.5 | 1.4 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.5 | 2.4 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.5 | 1.4 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.4 | 1.3 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.4 | 2.5 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.4 | 0.8 | GO:0097113 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.4 | 2.9 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.4 | 0.8 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.4 | 1.6 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.4 | 1.5 | GO:0021764 | amygdala development(GO:0021764) |
0.4 | 0.4 | GO:0021827 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.4 | 1.4 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.4 | 1.1 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.4 | 0.7 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.4 | 1.8 | GO:0098596 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.3 | 1.3 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.3 | 2.5 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.3 | 1.8 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.3 | 1.2 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.3 | 0.9 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.3 | 0.9 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.3 | 0.9 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.3 | 0.3 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.3 | 0.8 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.3 | 0.8 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.3 | 0.8 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.3 | 1.9 | GO:0097264 | self proteolysis(GO:0097264) |
0.3 | 0.8 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.3 | 1.1 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.3 | 1.0 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.2 | 1.7 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.2 | 1.0 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.2 | 0.9 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) |
0.2 | 1.2 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.2 | 0.5 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.2 | 0.4 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.2 | 0.9 | GO:0032202 | telomere assembly(GO:0032202) |
0.2 | 5.3 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
0.2 | 1.3 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.2 | 0.6 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.2 | 0.6 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.2 | 0.6 | GO:0015817 | histidine transport(GO:0015817) |
0.2 | 0.8 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.2 | 2.1 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.2 | 1.0 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.2 | 2.6 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.2 | 1.0 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.2 | 0.6 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.2 | 0.6 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.2 | 0.4 | GO:0061346 | non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
0.2 | 0.6 | GO:0060174 | limb bud formation(GO:0060174) |
0.2 | 0.9 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.2 | 1.3 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.2 | 0.8 | GO:0061743 | motor learning(GO:0061743) |
0.2 | 1.1 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.2 | 0.6 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.2 | 3.2 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.2 | 0.7 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.2 | 0.5 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
0.2 | 0.7 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.2 | 0.7 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.2 | 0.9 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.2 | 0.5 | GO:0030070 | insulin processing(GO:0030070) |
0.2 | 0.7 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.2 | 0.5 | GO:0021779 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.2 | 1.6 | GO:0072501 | cellular divalent inorganic anion homeostasis(GO:0072501) |
0.2 | 0.2 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
0.2 | 0.7 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.2 | 0.8 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.2 | 0.8 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.2 | 1.4 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.2 | 0.3 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.2 | 0.6 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.2 | 0.5 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.9 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.1 | 2.8 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.1 | 0.4 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.1 | 0.4 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.1 | 0.4 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.1 | 0.6 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.1 | 2.0 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
0.1 | 0.4 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
0.1 | 6.0 | GO:0021766 | hippocampus development(GO:0021766) |
0.1 | 1.0 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.1 | 0.5 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.1 | 0.4 | GO:0048617 | foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.7 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.1 | 0.4 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.1 | 1.1 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.1 | 0.4 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.1 | 1.1 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.1 | 1.2 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.1 | 0.4 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.1 | 0.4 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.1 | 0.3 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.1 | 0.9 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.1 | 0.4 | GO:0097503 | sialylation(GO:0097503) |
0.1 | 0.1 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.1 | 0.4 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.1 | 0.5 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
0.1 | 0.5 | GO:2000617 | positive regulation of histone H3-K9 acetylation(GO:2000617) |
0.1 | 0.4 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.1 | 0.5 | GO:2000851 | positive regulation of glucocorticoid secretion(GO:2000851) |
0.1 | 0.7 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.1 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.1 | 0.2 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.5 | GO:0071698 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.1 | 0.6 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.1 | 6.4 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 1.9 | GO:0001964 | startle response(GO:0001964) |
0.1 | 0.6 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.1 | 0.9 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.1 | 0.2 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.1 | 0.3 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.1 | 0.1 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.1 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 1.0 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.1 | 0.3 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.1 | 0.3 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.1 | 0.5 | GO:0071625 | vocalization behavior(GO:0071625) |
0.1 | 0.4 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.1 | 1.1 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.1 | 0.4 | GO:0060023 | soft palate development(GO:0060023) |
0.1 | 0.1 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.1 | 0.4 | GO:0015808 | L-alanine transport(GO:0015808) |
0.1 | 0.4 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.1 | 0.1 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.1 | 0.4 | GO:0097061 | dendritic spine organization(GO:0097061) |
0.1 | 0.1 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.1 | 0.5 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 0.3 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.1 | 0.8 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
0.1 | 0.2 | GO:1903751 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.1 | 0.1 | GO:0061316 | canonical Wnt signaling pathway involved in heart development(GO:0061316) |
0.1 | 0.3 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.1 | 0.7 | GO:0060997 | dendritic spine morphogenesis(GO:0060997) |
0.1 | 0.4 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.1 | 0.3 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.1 | 0.2 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
0.1 | 0.1 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.1 | 0.7 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.1 | 0.4 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.1 | 0.3 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.1 | 0.2 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.1 | 0.3 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.1 | 0.4 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.1 | 0.5 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.1 | 0.8 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.1 | 0.6 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.1 | 0.3 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.1 | 0.8 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
0.1 | 0.1 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.1 | 0.1 | GO:0097154 | GABAergic neuron differentiation(GO:0097154) |
0.1 | 0.4 | GO:0071599 | otic vesicle development(GO:0071599) otic vesicle morphogenesis(GO:0071600) |
0.1 | 0.3 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
0.1 | 0.3 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
0.1 | 0.8 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.1 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.2 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.1 | 0.2 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.1 | 0.2 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.1 | 0.3 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.1 | 0.3 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.1 | 0.2 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 0.4 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.1 | 0.5 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.1 | 0.6 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.1 | 0.4 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.1 | 0.2 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.1 | 0.2 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.1 | 0.3 | GO:0015816 | glycine transport(GO:0015816) |
0.1 | 0.3 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.1 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
0.1 | 0.2 | GO:0032485 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
0.1 | 0.7 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.1 | 0.1 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.1 | 0.1 | GO:1904995 | negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
0.1 | 0.1 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.1 | 0.8 | GO:1902692 | regulation of neuroblast proliferation(GO:1902692) |
0.1 | 1.9 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
0.1 | 0.1 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.1 | 0.2 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.1 | 0.3 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.1 | 1.1 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.1 | 0.1 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.1 | 0.2 | GO:0018343 | protein farnesylation(GO:0018343) |
0.1 | 0.2 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.1 | 0.1 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.1 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.3 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
0.1 | 0.2 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.1 | 0.2 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.1 | 0.3 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.1 | 0.1 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
0.1 | 5.2 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.1 | 0.3 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.1 | 0.3 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.1 | 0.7 | GO:0060074 | synapse maturation(GO:0060074) |
0.1 | 1.2 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.1 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.1 | 0.3 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.1 | 0.3 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.1 | 0.4 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
0.1 | 0.3 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
0.1 | 0.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.1 | 0.3 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.1 | 0.1 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.1 | 0.1 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.1 | 0.6 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) |
0.1 | 0.1 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.1 | 0.4 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.1 | 2.0 | GO:0034605 | cellular response to heat(GO:0034605) |
0.1 | 3.1 | GO:1900006 | positive regulation of dendrite development(GO:1900006) |
0.1 | 0.9 | GO:0001502 | cartilage condensation(GO:0001502) cell aggregation(GO:0098743) |
0.1 | 0.6 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.1 | 0.4 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.1 | 0.3 | GO:0033504 | floor plate development(GO:0033504) |
0.1 | 0.1 | GO:0021578 | hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
0.1 | 0.1 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.1 | 0.4 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
0.1 | 0.1 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
0.1 | 0.2 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.1 | 0.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.1 | 1.5 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.1 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.1 | 0.2 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 0.2 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.2 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.1 | 0.5 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.1 | 0.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.1 | 0.2 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.1 | 1.1 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 0.3 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.1 | 0.2 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.1 | 0.2 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.1 | 0.1 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.1 | 0.3 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 0.6 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.1 | 0.4 | GO:0002591 | positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
0.1 | 0.1 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.3 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.1 | 1.4 | GO:0071300 | cellular response to retinoic acid(GO:0071300) |
0.1 | 0.4 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.1 | 0.6 | GO:0008210 | estrogen metabolic process(GO:0008210) |
0.1 | 0.2 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.1 | GO:0043400 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) |
0.1 | 0.5 | GO:0047497 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.1 | 0.2 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.1 | 0.1 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
0.1 | 0.3 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.1 | 0.2 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.1 | 0.2 | GO:0015747 | urate transport(GO:0015747) |
0.1 | 0.2 | GO:0046618 | drug export(GO:0046618) |
0.1 | 0.2 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.1 | 0.2 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.1 | 0.2 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.1 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.2 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
0.1 | 0.2 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.1 | 0.1 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.1 | 0.1 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.1 | 0.2 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
0.1 | 0.2 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.1 | 0.2 | GO:0052428 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.1 | 0.1 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.1 | 0.3 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.1 | GO:0046087 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.0 | 0.4 | GO:0032291 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
0.0 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.0 | 0.1 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.0 | 0.5 | GO:0021879 | forebrain neuron differentiation(GO:0021879) |
0.0 | 0.1 | GO:0021978 | telencephalon regionalization(GO:0021978) |
0.0 | 0.2 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.0 | 0.1 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.0 | 0.2 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
0.0 | 0.0 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.0 | 0.1 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.0 | 0.6 | GO:0007616 | long-term memory(GO:0007616) |
0.0 | 0.1 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.0 | 0.3 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.0 | 0.1 | GO:0046149 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.0 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.0 | 0.0 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.0 | 0.4 | GO:0070269 | pyroptosis(GO:0070269) |
0.0 | 0.1 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.0 | 0.7 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.2 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.0 | 0.0 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.0 | 0.3 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
0.0 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 0.1 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
0.0 | 0.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.0 | 1.1 | GO:0021549 | cerebellum development(GO:0021549) |
0.0 | 0.4 | GO:0006903 | vesicle targeting(GO:0006903) |
0.0 | 0.1 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.0 | 0.7 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.0 | 0.1 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.0 | 0.2 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.0 | 0.1 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.0 | 0.2 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.0 | 0.2 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.1 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.0 | 0.3 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
0.0 | 0.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.3 | GO:0060179 | male mating behavior(GO:0060179) |
0.0 | 0.2 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
0.0 | 1.9 | GO:0007270 | neuron-neuron synaptic transmission(GO:0007270) |
0.0 | 1.7 | GO:0007040 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
0.0 | 0.3 | GO:0021772 | olfactory bulb development(GO:0021772) |
0.0 | 0.9 | GO:0021954 | central nervous system neuron development(GO:0021954) |
0.0 | 0.5 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.1 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.0 | 0.1 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.0 | 0.1 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.1 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
0.0 | 0.2 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
0.0 | 0.2 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
0.0 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
0.0 | 0.1 | GO:0003139 | secondary heart field specification(GO:0003139) |
0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.0 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
0.0 | 0.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.2 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.0 | 2.8 | GO:0050684 | regulation of mRNA processing(GO:0050684) |
0.0 | 0.1 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.0 | 0.0 | GO:0021871 | forebrain regionalization(GO:0021871) |
0.0 | 0.2 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.0 | 0.0 | GO:0008038 | neuron recognition(GO:0008038) |
0.0 | 0.1 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.0 | 0.5 | GO:0045056 | transcytosis(GO:0045056) |
0.0 | 0.1 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
0.0 | 0.1 | GO:0032898 | neurotrophin production(GO:0032898) |
0.0 | 0.1 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.0 | 0.1 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.0 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.0 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.0 | 0.6 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
0.0 | 0.4 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.1 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.0 | 0.2 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.0 | 0.6 | GO:1904888 | cranial skeletal system development(GO:1904888) |
0.0 | 0.0 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.0 | 0.3 | GO:0033572 | transferrin transport(GO:0033572) |
0.0 | 0.1 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
0.0 | 0.1 | GO:0051176 | positive regulation of sulfur metabolic process(GO:0051176) |
0.0 | 0.1 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.0 | 0.1 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.1 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.0 | 0.0 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.0 | 0.0 | GO:1902415 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
0.0 | 0.0 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.0 | 0.6 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.1 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.0 | 0.0 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
0.0 | 0.2 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.0 | GO:0015824 | proline transport(GO:0015824) |
0.0 | 0.2 | GO:1902222 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.0 | 0.1 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.0 | 0.3 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
0.0 | 0.1 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.0 | 0.1 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.0 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.0 | 0.2 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.0 | 0.3 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.0 | 0.1 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.0 | 0.1 | GO:1904220 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.0 | 0.2 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.0 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.0 | 0.0 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.0 | 0.1 | GO:0050812 | regulation of acyl-CoA biosynthetic process(GO:0050812) |
0.0 | 0.0 | GO:0033084 | regulation of immature T cell proliferation in thymus(GO:0033084) |
0.0 | 0.0 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.0 | 0.1 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.0 | 0.2 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.0 | 0.1 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.0 | 0.2 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.0 | 0.3 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.0 | 0.2 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.0 | 0.1 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.0 | 0.2 | GO:1901018 | positive regulation of potassium ion transmembrane transporter activity(GO:1901018) |
0.0 | 0.4 | GO:0072401 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
0.0 | 0.6 | GO:0046847 | filopodium assembly(GO:0046847) |
0.0 | 0.1 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.0 | 0.0 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
0.0 | 0.1 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.0 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.0 | 0.1 | GO:0071674 | mononuclear cell migration(GO:0071674) |
0.0 | 0.1 | GO:0060215 | primitive hemopoiesis(GO:0060215) |
0.0 | 0.1 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.0 | 0.1 | GO:0001812 | positive regulation of type I hypersensitivity(GO:0001812) |
0.0 | 0.1 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.0 | 0.2 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
0.0 | 0.2 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.0 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.0 | 0.1 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.5 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.5 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.0 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.0 | 0.1 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.3 | GO:0007405 | neuroblast proliferation(GO:0007405) |
0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.3 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.1 | GO:0009139 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
0.0 | 0.1 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.0 | 0.1 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
0.0 | 0.1 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.0 | 0.1 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
0.0 | 0.3 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.0 | 0.2 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
0.0 | 0.1 | GO:1902219 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.0 | 0.1 | GO:0042713 | sperm ejaculation(GO:0042713) |
0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.1 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.0 | 0.0 | GO:0003129 | heart induction(GO:0003129) |
0.0 | 0.3 | GO:0006241 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.0 | 0.1 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.0 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.0 | 0.3 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.0 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.1 | GO:0051589 | negative regulation of neurotransmitter transport(GO:0051589) |
0.0 | 0.3 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.0 | GO:0046520 | sphingoid biosynthetic process(GO:0046520) |
0.0 | 0.2 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.1 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.0 | 0.9 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
0.0 | 0.1 | GO:0009173 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.0 | 0.2 | GO:0006817 | phosphate ion transport(GO:0006817) |
0.0 | 0.1 | GO:0007063 | regulation of sister chromatid cohesion(GO:0007063) |
0.0 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
0.0 | 0.0 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.0 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.0 | 0.2 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
0.0 | 0.1 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.0 | 0.1 | GO:0015870 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
0.0 | 0.1 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 0.1 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.0 | 0.2 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.0 | 0.3 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.1 | GO:0032725 | positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
0.0 | 0.1 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.0 | 0.2 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.0 | 0.1 | GO:0002713 | negative regulation of B cell mediated immunity(GO:0002713) negative regulation of immunoglobulin mediated immune response(GO:0002890) |
0.0 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.5 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) |
0.0 | 0.5 | GO:0006406 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.0 | 0.3 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.0 | 0.7 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
0.0 | 0.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.0 | 3.3 | GO:0016197 | endosomal transport(GO:0016197) |
0.0 | 0.0 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.0 | 0.1 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
0.0 | 0.2 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.0 | 0.1 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.0 | 0.1 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.0 | GO:0035747 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.0 | 0.1 | GO:0001840 | neural plate development(GO:0001840) |
0.0 | 0.0 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) positive regulation of hh target transcription factor activity(GO:0007228) |
0.0 | 0.2 | GO:0032292 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
0.0 | 0.0 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.0 | 0.0 | GO:0032907 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
0.0 | 0.0 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.0 | 0.2 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.0 | 0.0 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
0.0 | 0.0 | GO:0021846 | cell proliferation in forebrain(GO:0021846) |
0.0 | 0.0 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.1 | GO:0071404 | cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
0.0 | 0.1 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.0 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.0 | 0.1 | GO:0042737 | drug catabolic process(GO:0042737) |
0.0 | 0.0 | GO:0019064 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.0 | 0.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.0 | 0.0 | GO:0002730 | regulation of dendritic cell cytokine production(GO:0002730) |
0.0 | 0.0 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.0 | 0.2 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.0 | 0.2 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.0 | 0.3 | GO:0006625 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
0.0 | 0.0 | GO:0075136 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.0 | 0.1 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.0 | 0.0 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
0.0 | 0.2 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.0 | 0.2 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.0 | GO:0010996 | response to auditory stimulus(GO:0010996) |
0.0 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.1 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.2 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.0 | 0.1 | GO:0048854 | brain morphogenesis(GO:0048854) |
0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.1 | GO:0046688 | response to copper ion(GO:0046688) |
0.0 | 0.2 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.0 | 0.1 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
0.0 | 0.5 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
0.0 | 0.2 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
0.0 | 0.2 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
0.0 | 0.1 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.0 | 0.1 | GO:0017062 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 0.1 | GO:1901533 | negative regulation of hematopoietic progenitor cell differentiation(GO:1901533) |
0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.0 | 0.0 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.1 | GO:0001842 | neural fold formation(GO:0001842) |
0.0 | 0.0 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) establishment of T cell polarity(GO:0001768) |
0.0 | 0.1 | GO:0071168 | protein localization to chromatin(GO:0071168) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.1 | GO:0072695 | protection from non-homologous end joining at telomere(GO:0031848) negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
0.0 | 0.1 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.0 | 0.1 | GO:0019042 | viral latency(GO:0019042) |
0.0 | 0.1 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.2 | GO:1901522 | positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
0.0 | 0.1 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
0.0 | 0.0 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.0 | 0.1 | GO:0051014 | actin filament severing(GO:0051014) |
0.0 | 0.0 | GO:0070989 | oxidative demethylation(GO:0070989) |
0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 0.1 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.0 | 0.0 | GO:0032811 | negative regulation of epinephrine secretion(GO:0032811) |
0.0 | 0.0 | GO:0044532 | modulation of programmed cell death in other organism(GO:0044531) modulation of apoptotic process in other organism(GO:0044532) modulation by symbiont of host programmed cell death(GO:0052040) modulation by symbiont of host apoptotic process(GO:0052150) modulation of programmed cell death in other organism involved in symbiotic interaction(GO:0052248) modulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052433) |
0.0 | 0.0 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.0 | 0.0 | GO:0019054 | modulation by virus of host process(GO:0019054) |
0.0 | 0.1 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
0.0 | 0.1 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
0.0 | 0.1 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.0 | 0.0 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.5 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
0.0 | 0.5 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 0.0 | GO:0046490 | isopentenyl diphosphate metabolic process(GO:0046490) |
0.0 | 0.4 | GO:0007528 | neuromuscular junction development(GO:0007528) |
0.0 | 0.0 | GO:0021988 | olfactory lobe development(GO:0021988) |
0.0 | 0.0 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
0.0 | 0.0 | GO:0021895 | cerebral cortex neuron differentiation(GO:0021895) |
0.0 | 0.1 | GO:0031498 | chromatin disassembly(GO:0031498) |
0.0 | 0.2 | GO:0060707 | trophoblast giant cell differentiation(GO:0060707) |
0.0 | 0.1 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
0.0 | 0.0 | GO:0009189 | deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) |
0.0 | 0.0 | GO:0071672 | negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
0.0 | 0.1 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.0 | 0.0 | GO:0072201 | negative regulation of mesenchymal cell proliferation(GO:0072201) |
0.0 | 0.0 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.0 | 0.1 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.0 | 0.0 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.2 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.0 | 0.1 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.5 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
0.0 | 0.4 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.0 | 0.1 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.1 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.0 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.0 | 0.4 | GO:1902653 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
0.0 | 0.0 | GO:0042253 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
0.0 | 0.0 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.0 | 0.1 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
0.0 | 0.0 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.0 | 0.0 | GO:1903333 | negative regulation of protein folding(GO:1903333) |
0.0 | 0.0 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
0.0 | 0.0 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.0 | 0.0 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
0.0 | 0.0 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.0 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
0.0 | 0.1 | GO:2000105 | positive regulation of DNA-dependent DNA replication(GO:2000105) |
0.0 | 0.0 | GO:0060214 | endocardium formation(GO:0060214) |
0.0 | 0.0 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.0 | 0.0 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.0 | GO:0022038 | corpus callosum development(GO:0022038) |
0.0 | 0.0 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.0 | 0.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.0 | GO:0010988 | regulation of low-density lipoprotein particle clearance(GO:0010988) |
0.0 | 0.0 | GO:0072553 | terminal button organization(GO:0072553) |
0.0 | 0.0 | GO:0051036 | regulation of endosome size(GO:0051036) |
0.0 | 0.1 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
0.0 | 0.0 | GO:0051594 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.0 | 0.1 | GO:0018101 | protein citrullination(GO:0018101) |
0.0 | 0.0 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.0 | 0.0 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.2 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.0 | 0.1 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
0.0 | 0.0 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.0 | 0.0 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.0 | 0.0 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.0 | 0.0 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.0 | 0.0 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.0 | 0.0 | GO:0043045 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.0 | 0.0 | GO:0021648 | vestibulocochlear nerve morphogenesis(GO:0021648) |
0.0 | 0.0 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.0 | 0.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.0 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
0.0 | 0.1 | GO:0007135 | meiosis II(GO:0007135) |
0.0 | 0.9 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.0 | 0.1 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.0 | 0.0 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
0.0 | 0.0 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
0.0 | 0.1 | GO:0046836 | glycolipid transport(GO:0046836) |
0.0 | 0.0 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
0.0 | 0.0 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.0 | 0.0 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.0 | 0.0 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.0 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.0 | 0.1 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.0 | 0.0 | GO:1901160 | primary amino compound metabolic process(GO:1901160) |
0.0 | 0.1 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.0 | 0.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.0 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.0 | 0.0 | GO:0060998 | regulation of dendritic spine development(GO:0060998) |
0.0 | 0.0 | GO:0072144 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
0.0 | 0.0 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.0 | 0.0 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
0.0 | 0.0 | GO:0045924 | regulation of female receptivity(GO:0045924) positive regulation of female receptivity(GO:0045925) |
0.0 | 0.2 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
0.0 | 0.0 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.0 | 0.0 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
0.0 | 0.0 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 0.0 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
0.0 | 0.6 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.1 | GO:0006477 | protein sulfation(GO:0006477) |
0.0 | 0.0 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.0 | 0.0 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.0 | 0.2 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.0 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.0 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.0 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.0 | 0.1 | GO:0030517 | negative regulation of axon extension(GO:0030517) |
0.0 | 0.0 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.0 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
0.0 | 0.1 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.0 | 0.0 | GO:0002484 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
0.0 | 0.0 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.0 | 0.0 | GO:0071866 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
0.0 | 0.0 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.0 | 0.4 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.0 | 0.5 | GO:0007566 | embryo implantation(GO:0007566) |
0.0 | 0.0 | GO:0071864 | regulation of cell proliferation in bone marrow(GO:0071863) positive regulation of cell proliferation in bone marrow(GO:0071864) |
0.0 | 0.0 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.0 | 0.0 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
0.0 | 0.0 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
0.0 | 0.0 | GO:0002865 | negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) negative regulation of hypersensitivity(GO:0002884) |
0.0 | 0.0 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.0 | 0.1 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
0.0 | 0.0 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.0 | 0.2 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
0.0 | 0.0 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.0 | 0.0 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.0 | 0.0 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.0 | 0.0 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.0 | 0.0 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.0 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.1 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.0 | 0.0 | GO:0099500 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.0 | 0.0 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.0 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.0 | 0.0 | GO:0015911 | plasma membrane long-chain fatty acid transport(GO:0015911) fatty acid transmembrane transport(GO:1902001) |
0.0 | 0.0 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.0 | 0.0 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.0 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
0.0 | 0.0 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.0 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.0 | 0.0 | GO:0002584 | negative regulation of antigen processing and presentation(GO:0002578) negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
0.0 | 0.1 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
0.0 | 0.0 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.0 | 0.0 | GO:0045964 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.0 | 0.0 | GO:0098764 | meiotic prophase I(GO:0007128) prophase(GO:0051324) meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 0.0 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.0 | 0.0 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.0 | 0.0 | GO:0002339 | B cell selection(GO:0002339) |
0.0 | 0.1 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
0.0 | 0.1 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.0 | 0.0 | GO:1904684 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
0.0 | 0.0 | GO:0001806 | type IV hypersensitivity(GO:0001806) |
0.0 | 0.0 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
0.0 | 0.3 | GO:0007140 | male meiosis(GO:0007140) |
0.0 | 0.0 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.0 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.0 | 0.0 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.0 | 0.0 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.0 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) single-organism membrane invagination(GO:1902534) |
0.0 | 0.1 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.0 | 0.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.0 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.0 | 0.1 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.0 | 0.0 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.0 | 0.0 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.0 | 0.0 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.0 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.0 | 0.1 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
0.0 | 0.1 | GO:0052805 | histidine metabolic process(GO:0006547) histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.0 | 0.0 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.0 | 0.1 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.0 | 0.1 | GO:0051294 | establishment of spindle orientation(GO:0051294) |
0.0 | 0.1 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
0.0 | 0.1 | GO:0042533 | tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
0.0 | 0.0 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.0 | GO:1990144 | intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
0.0 | 0.0 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
0.0 | 0.0 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.0 | 0.0 | GO:0034383 | low-density lipoprotein particle clearance(GO:0034383) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 4.3 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.5 | 1.6 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.5 | 3.3 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.4 | 1.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.3 | 8.6 | GO:0044295 | axonal growth cone(GO:0044295) |
0.3 | 2.1 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.3 | 0.8 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.2 | 1.2 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.2 | 10.0 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.2 | 1.4 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.2 | 1.3 | GO:0032584 | growth cone membrane(GO:0032584) |
0.2 | 0.6 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.2 | 2.8 | GO:0031527 | filopodium membrane(GO:0031527) |
0.2 | 0.5 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.1 | 1.5 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.9 | GO:0070187 | telosome(GO:0070187) |
0.1 | 2.9 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.1 | 0.6 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.1 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 0.7 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 1.0 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 0.4 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.1 | 1.5 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.1 | 4.4 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 1.2 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 2.7 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.1 | 0.7 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 0.3 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 16.6 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.1 | 0.4 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.1 | 1.2 | GO:0036038 | MKS complex(GO:0036038) |
0.1 | 0.4 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 1.1 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.1 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.1 | 0.1 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.1 | 0.5 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.1 | 0.7 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.1 | 0.4 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 0.4 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 0.6 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.3 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.1 | 0.2 | GO:0097513 | myosin II filament(GO:0097513) |
0.1 | 1.1 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 2.1 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.1 | 0.2 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.1 | 0.4 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.1 | 0.6 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 0.6 | GO:0032590 | dendrite membrane(GO:0032590) |
0.1 | 0.6 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 0.6 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 0.2 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.1 | 0.2 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.1 | 1.3 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.1 | 0.4 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.1 | 0.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 0.2 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 0.8 | GO:0071565 | nBAF complex(GO:0071565) |
0.1 | 0.3 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 0.3 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 0.3 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.2 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.1 | 0.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.2 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.1 | 0.3 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 1.3 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 0.3 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.2 | GO:0097433 | dense body(GO:0097433) |
0.0 | 0.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 2.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 1.2 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
0.0 | 0.2 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.3 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.2 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.2 | GO:0005883 | neurofilament(GO:0005883) |
0.0 | 0.4 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.0 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.2 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.0 | 0.3 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.2 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.0 | 3.5 | GO:0030426 | growth cone(GO:0030426) |
0.0 | 0.3 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.3 | GO:0005688 | U6 snRNP(GO:0005688) |
0.0 | 0.3 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.3 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.3 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.1 | GO:0051286 | cell tip(GO:0051286) |
0.0 | 0.2 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.5 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.0 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.0 | 0.2 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.4 | GO:0000974 | Prp19 complex(GO:0000974) |
0.0 | 0.3 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.6 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.6 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.0 | 0.0 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 0.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 4.5 | GO:0005802 | trans-Golgi network(GO:0005802) |
0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.2 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.0 | 0.4 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 0.3 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.2 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.2 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.2 | GO:0070603 | SWI/SNF superfamily-type complex(GO:0070603) |
0.0 | 2.1 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
0.0 | 0.1 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.0 | 0.2 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.2 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.2 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.3 | GO:0031011 | Ino80 complex(GO:0031011) |
0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.2 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 3.2 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 3.5 | GO:0000790 | nuclear chromatin(GO:0000790) |
0.0 | 0.2 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.0 | 0.2 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.0 | GO:0005767 | secondary lysosome(GO:0005767) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.5 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.0 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.0 | 0.3 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.0 | GO:0008091 | spectrin(GO:0008091) |
0.0 | 0.1 | GO:0042825 | MHC class I peptide loading complex(GO:0042824) TAP complex(GO:0042825) |
0.0 | 1.3 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.0 | 0.2 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 0.0 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.0 | 0.1 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.3 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.9 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.2 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.3 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.0 | 1.2 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.1 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.0 | 0.2 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
0.0 | 0.1 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.2 | GO:1990391 | DNA repair complex(GO:1990391) |
0.0 | 0.1 | GO:0045293 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
0.0 | 0.0 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.0 | GO:0044327 | dendritic spine head(GO:0044327) |
0.0 | 1.6 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.0 | 0.1 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.0 | 0.1 | GO:1903349 | extrinsic component of omegasome membrane(GO:0097629) omegasome membrane(GO:1903349) |
0.0 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
0.0 | 0.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.0 | 0.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.0 | GO:0002141 | stereocilia ankle link(GO:0002141) |
0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.2 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.0 | 0.0 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.2 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.0 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.6 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.3 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.1 | GO:0042599 | lamellar body(GO:0042599) |
0.0 | 0.1 | GO:0097546 | ciliary base(GO:0097546) |
0.0 | 0.1 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.1 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.1 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.0 | 0.2 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 1.3 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.0 | 0.1 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.0 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
0.0 | 0.0 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.0 | 0.5 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.1 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.1 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.0 | 0.0 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.0 | 0.0 | GO:0000235 | astral microtubule(GO:0000235) |
0.0 | 0.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.1 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.1 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.0 | 0.0 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 0.0 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.0 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.1 | GO:0005858 | axonemal dynein complex(GO:0005858) |
0.0 | 0.0 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.1 | GO:0005682 | U5 snRNP(GO:0005682) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 3.5 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
1.1 | 3.3 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.9 | 2.6 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.7 | 3.5 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.6 | 2.2 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.4 | 1.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.4 | 1.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.4 | 1.8 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.4 | 1.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.3 | 2.2 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.3 | 0.9 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.3 | 3.6 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.3 | 1.7 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.3 | 0.8 | GO:1990188 | euchromatin binding(GO:1990188) |
0.3 | 5.9 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.3 | 1.0 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.3 | 2.0 | GO:0008430 | selenium binding(GO:0008430) |
0.3 | 0.8 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.2 | 0.7 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.2 | 0.7 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.2 | 0.4 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.2 | 1.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.2 | 1.0 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.2 | 0.6 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
0.2 | 1.2 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.2 | 0.6 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.2 | 0.8 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.2 | 0.6 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.2 | 0.4 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.2 | 0.6 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.2 | 0.5 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.2 | 0.3 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
0.2 | 0.7 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.2 | 1.4 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.2 | 0.8 | GO:0048495 | Roundabout binding(GO:0048495) |
0.2 | 0.6 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.2 | 2.0 | GO:0031005 | filamin binding(GO:0031005) |
0.2 | 0.5 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 1.0 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.1 | 0.7 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.1 | 1.1 | GO:0050544 | arachidonic acid binding(GO:0050544) |
0.1 | 3.4 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.1 | 0.3 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.1 | 2.7 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.1 | 1.3 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.1 | 2.2 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.1 | 4.5 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.1 | 0.5 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.1 | 0.5 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.1 | 2.8 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.1 | 0.3 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 0.8 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.1 | 0.3 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.1 | 0.2 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.1 | 0.4 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.4 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) glycine:sodium symporter activity(GO:0015375) |
0.1 | 0.4 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 0.4 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.1 | 1.6 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.1 | 1.3 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.1 | 0.5 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 1.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.1 | 0.4 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 0.8 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.1 | 0.4 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 0.6 | GO:0050733 | RS domain binding(GO:0050733) |
0.1 | 0.4 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.2 | GO:0070905 | serine binding(GO:0070905) |
0.1 | 0.2 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.1 | 0.4 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.6 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.1 | 0.3 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.4 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.9 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.4 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.1 | 1.0 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.4 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.1 | 1.2 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.3 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.3 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.1 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
0.1 | 0.2 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.1 | 0.4 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 0.8 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.5 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.1 | 0.3 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.1 | 0.5 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.1 | 0.4 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.1 | 0.2 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 0.4 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.1 | 0.5 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 0.1 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 0.4 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.1 | 0.9 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.1 | 0.2 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.1 | 0.9 | GO:0043176 | amine binding(GO:0043176) |
0.1 | 0.4 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.1 | 0.3 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 1.9 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.1 | 0.2 | GO:0019961 | interferon binding(GO:0019961) |
0.1 | 0.9 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 0.2 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.1 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 1.2 | GO:0031489 | myosin V binding(GO:0031489) |
0.1 | 0.4 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.1 | 0.3 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.1 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.1 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
0.1 | 0.9 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.1 | 0.6 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.1 | 0.4 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.1 | 0.3 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.1 | 0.2 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 1.1 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.1 | 0.3 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) xenobiotic transporter activity(GO:0042910) |
0.1 | 0.2 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.7 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 1.2 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.1 | 0.2 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 0.7 | GO:0001618 | virus receptor activity(GO:0001618) |
0.1 | 0.2 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.1 | 0.2 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 0.4 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.1 | 0.1 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.1 | 0.2 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.1 | 4.2 | GO:0005262 | calcium channel activity(GO:0005262) |
0.1 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.4 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 1.1 | GO:0030332 | cyclin binding(GO:0030332) |
0.1 | 0.3 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.1 | 0.7 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.0 | 0.1 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.0 | 0.7 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.0 | 0.1 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.2 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.0 | 0.2 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 0.1 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.0 | 0.4 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.0 | 0.3 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.0 | 0.1 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.0 | 0.8 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
0.0 | 0.1 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.0 | 0.3 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
0.0 | 0.4 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.3 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.3 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.5 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 2.9 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
0.0 | 0.1 | GO:0034827 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 0.2 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.3 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.3 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.5 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.0 | 0.5 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.2 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.3 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.2 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.3 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.0 | 0.4 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.3 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.0 | 0.2 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.0 | 0.0 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.0 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.0 | 0.4 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.1 | GO:0050693 | LBD domain binding(GO:0050693) |
0.0 | 0.5 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.0 | 0.6 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.0 | 0.2 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.0 | 0.4 | GO:0031402 | sodium ion binding(GO:0031402) |
0.0 | 0.5 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.0 | 0.2 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.0 | GO:0050542 | icosanoid binding(GO:0050542) fatty acid derivative binding(GO:1901567) |
0.0 | 0.5 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.2 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.1 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.2 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 0.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.0 | 0.3 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 0.2 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.0 | 0.3 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.0 | 0.1 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.0 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.0 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 0.1 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.0 | 0.2 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.0 | 4.2 | GO:0003729 | mRNA binding(GO:0003729) |
0.0 | 0.4 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.3 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
0.0 | 0.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.2 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.4 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.1 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.0 | 0.1 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.2 | GO:0015248 | sterol transporter activity(GO:0015248) |
0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 1.4 | GO:0051117 | ATPase binding(GO:0051117) |
0.0 | 0.2 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.0 | 0.2 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.5 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.0 | 0.2 | GO:0036122 | BMP binding(GO:0036122) |
0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 0.1 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) |
0.0 | 0.3 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 1.3 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.0 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) |
0.0 | 0.1 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.0 | 0.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.0 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.1 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.2 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.0 | 0.6 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.2 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.3 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.5 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.2 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.0 | 0.2 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.0 | 0.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.0 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.0 | 0.7 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
0.0 | 0.3 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.3 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.0 | 0.3 | GO:0033558 | histone deacetylase activity(GO:0004407) protein deacetylase activity(GO:0033558) |
0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.4 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.2 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.6 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.1 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.0 | 0.1 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.1 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 1.1 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.0 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.2 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.1 | GO:0016936 | galactoside binding(GO:0016936) |
0.0 | 0.0 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.6 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.2 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.1 | GO:0008932 | lytic endotransglycosylase activity(GO:0008932) |
0.0 | 0.0 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.5 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.0 | 2.3 | GO:0003714 | transcription corepressor activity(GO:0003714) |
0.0 | 0.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.0 | 0.1 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.0 | 0.0 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.0 | 0.6 | GO:0048365 | Rac GTPase binding(GO:0048365) |
0.0 | 0.1 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.2 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
0.0 | 0.1 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.0 | 0.3 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 0.0 | GO:0045340 | mercury ion binding(GO:0045340) |
0.0 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.1 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.0 | 0.2 | GO:0004601 | peroxidase activity(GO:0004601) |
0.0 | 0.0 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.0 | GO:0050543 | icosatetraenoic acid binding(GO:0050543) |
0.0 | 0.2 | GO:0019239 | deaminase activity(GO:0019239) |
0.0 | 0.1 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.0 | 0.3 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.0 | 0.3 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.1 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.0 | 0.1 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.0 | 3.4 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.0 | 0.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.0 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.6 | GO:0005548 | phospholipid transporter activity(GO:0005548) |
0.0 | 0.2 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.0 | 2.6 | GO:0015631 | tubulin binding(GO:0015631) |
0.0 | 0.1 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.0 | 0.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.0 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.0 | 0.1 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.0 | 0.1 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.1 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.0 | 0.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.1 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.0 | 0.4 | GO:0005272 | sodium channel activity(GO:0005272) |
0.0 | 0.0 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.0 | 0.0 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.0 | 0.1 | GO:0043814 | CTP:2,3-di-O-geranylgeranyl-sn-glycero-1-phosphate cytidyltransferase activity(GO:0043338) phospholactate guanylyltransferase activity(GO:0043814) ATP:coenzyme F420 adenylyltransferase activity(GO:0043910) UDP-N-acetylgalactosamine diphosphorylase activity(GO:0052630) |
0.0 | 0.4 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.1 | GO:0048156 | tau protein binding(GO:0048156) |
0.0 | 0.2 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.0 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.0 | 0.1 | GO:0032183 | SUMO binding(GO:0032183) |
0.0 | 0.0 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.5 | GO:0002039 | p53 binding(GO:0002039) |
0.0 | 0.1 | GO:0001164 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.0 | 0.0 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.0 | 0.0 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.0 | 0.1 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.0 | 0.1 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.1 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
0.0 | 0.3 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.0 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.0 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.0 | 0.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.0 | 0.0 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.1 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.1 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
0.0 | 0.1 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.0 | 0.1 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.0 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.0 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.0 | 0.0 | GO:0019863 | IgE binding(GO:0019863) |
0.0 | 0.0 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.0 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.0 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) |
0.0 | 0.6 | GO:0003724 | RNA helicase activity(GO:0003724) |
0.0 | 0.1 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.0 | 0.0 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
0.0 | 0.0 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.0 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.0 | 0.0 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.0 | 0.1 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.0 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.1 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.0 | 0.0 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.2 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 0.3 | GO:0030170 | pyridoxal phosphate binding(GO:0030170) |
0.0 | 0.1 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.0 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.0 | 0.2 | GO:0043738 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
0.0 | 0.0 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.0 | 0.1 | GO:0016209 | antioxidant activity(GO:0016209) |
0.0 | 0.1 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 6.9 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.2 | 0.2 | ST ADRENERGIC | Adrenergic Pathway |
0.1 | 0.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 2.1 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 1.0 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 1.3 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.1 | 1.3 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 1.3 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.1 | 2.1 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.1 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.0 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 2.3 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.4 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 1.2 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 2.0 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 1.7 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.6 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 2.1 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.5 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 1.9 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 1.5 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.5 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.0 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.6 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.7 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.4 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.5 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 1.4 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.5 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 0.2 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.7 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.4 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.1 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.0 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.5 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.5 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.3 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.5 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.6 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.0 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.2 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.5 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
0.2 | 1.6 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.1 | 0.4 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.1 | 2.7 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.1 | 3.5 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 0.7 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 2.8 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 0.9 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 2.0 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 1.6 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 1.6 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 1.5 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.1 | 0.4 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.1 | 1.1 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 1.4 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.1 | 1.5 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.1 | 4.4 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.1 | 2.0 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.1 | 1.6 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 0.3 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.1 | 0.1 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.1 | 1.6 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 0.9 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 0.3 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.1 | 0.6 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.1 | 0.2 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
0.1 | 0.6 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.1 | 1.2 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 0.5 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.1 | 0.5 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.1 | 0.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 0.7 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.1 | 0.4 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.1 | 0.8 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.7 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.7 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.9 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.0 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.0 | 2.1 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 1.3 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.1 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.0 | 1.1 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 0.3 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.6 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.6 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.4 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.0 | 1.1 | REACTOME ION CHANNEL TRANSPORT | Genes involved in Ion channel transport |
0.0 | 0.3 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.4 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.0 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.3 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.0 | 0.8 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 1.1 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.0 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.0 | 1.2 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 0.0 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.4 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.0 | 0.9 | REACTOME PROTEIN FOLDING | Genes involved in Protein folding |
0.0 | 0.2 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.0 | 4.2 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
0.0 | 0.3 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.0 | 0.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 0.5 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.0 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
0.0 | 0.5 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
0.0 | 0.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.3 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.1 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.3 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.2 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
0.0 | 0.0 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.0 | 0.2 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.0 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
0.0 | 0.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 0.2 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
0.0 | 0.2 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.0 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
0.0 | 0.3 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.0 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.3 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.3 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.1 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.3 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.5 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.0 | 0.3 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.2 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.0 | 0.2 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.0 | 0.2 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.1 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.0 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.0 | 0.0 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.4 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.2 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.0 | 0.0 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.0 | 0.2 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.0 | 0.1 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.1 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |