Gene Symbol | Gene ID | Gene Info |
---|---|---|
Rara
|
ENSMUSG00000037992.10 | Rara |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Rara | chr11_98964762_98965818 | 4878 | 0.116916 | 0.63 | 8.7e-08 | Click! |
Rara | chr11_98965856_98966512 | 5772 | 0.111685 | 0.58 | 1.4e-06 | Click! |
Rara | chr11_98939306_98940520 | 201 | 0.891968 | 0.56 | 2.6e-06 | Click! |
Rara | chr11_98964482_98964720 | 4189 | 0.123085 | 0.56 | 3.8e-06 | Click! |
Rara | chr11_98932376_98933648 | 4686 | 0.121214 | 0.55 | 5.9e-06 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr11_96314472_96315689 | 4.87 |
Mir10a |
microRNA 10a |
2085 |
0.12 |
chr6_52174920_52176658 | 4.68 |
Hoxaas3 |
Hoxa cluster antisense RNA 3 |
554 |
0.41 |
chr2_74711675_74712751 | 3.63 |
Hoxd3os1 |
homeobox D3, opposite strand 1 |
159 |
0.47 |
chr11_96324031_96324564 | 3.08 |
Hoxb3 |
homeobox B3 |
971 |
0.28 |
chr11_85836730_85838643 | 3.01 |
Tbx2 |
T-box 2 |
5135 |
0.14 |
chr3_79884429_79885439 | 2.91 |
Gask1b |
golgi associated kinase 1B |
3 |
0.97 |
chr15_103038687_103039944 | 2.82 |
Hoxc4 |
homeobox C4 |
4920 |
0.1 |
chr5_119668607_119669219 | 2.78 |
Tbx3 |
T-box 3 |
1756 |
0.26 |
chr7_71471596_71472579 | 2.57 |
Gm29328 |
predicted gene 29328 |
101754 |
0.07 |
chr15_103060010_103061759 | 2.56 |
5730585A16Rik |
RIKEN cDNA 5730585A16 gene |
1578 |
0.23 |
chr11_96372718_96372936 | 2.55 |
Hoxb1 |
homeobox B1 |
6569 |
0.09 |
chr6_53817061_53817543 | 2.54 |
Gm16499 |
predicted gene 16499 |
1441 |
0.39 |
chr2_33515474_33516202 | 2.43 |
Gm13530 |
predicted gene 13530 |
26056 |
0.15 |
chr12_33960516_33961726 | 2.41 |
Twist1 |
twist basic helix-loop-helix transcription factor 1 |
3450 |
0.27 |
chr6_52202371_52204739 | 2.40 |
Hoxa5 |
homeobox A5 |
1032 |
0.2 |
chr1_14303973_14305599 | 2.40 |
Eya1 |
EYA transcriptional coactivator and phosphatase 1 |
158 |
0.97 |
chr8_89036575_89038609 | 2.34 |
Sall1 |
spalt like transcription factor 1 |
6570 |
0.23 |
chr13_59096070_59096372 | 2.31 |
4930415C11Rik |
RIKEN cDNA 4930415C11 gene |
12128 |
0.16 |
chr2_74739700_74741193 | 2.30 |
Hoxd3 |
homeobox D3 |
827 |
0.31 |
chr11_101892225_101894406 | 2.28 |
Meox1 |
mesenchyme homeobox 1 |
1059 |
0.4 |
chr15_76459443_76459743 | 2.26 |
Scx |
scleraxis |
2073 |
0.14 |
chr2_74723899_74724784 | 2.19 |
Mir10b |
microRNA 10b |
1729 |
0.11 |
chr2_74730040_74731004 | 2.16 |
Hoxd3 |
homeobox D3 |
2391 |
0.09 |
chr11_19011993_19012423 | 2.14 |
Meis1 |
Meis homeobox 1 |
206 |
0.89 |
chr1_91757326_91757787 | 2.12 |
Twist2 |
twist basic helix-loop-helix transcription factor 2 |
43905 |
0.13 |
chr14_16554767_16555445 | 2.04 |
Rarb |
retinoic acid receptor, beta |
19939 |
0.21 |
chr5_134945425_134947032 | 1.96 |
Cldn4 |
claudin 4 |
706 |
0.44 |
chr13_63557270_63560459 | 1.94 |
Ptch1 |
patched 1 |
4951 |
0.16 |
chr14_28506892_28507795 | 1.83 |
Wnt5a |
wingless-type MMTV integration site family, member 5A |
1443 |
0.42 |
chr10_108443952_108444770 | 1.81 |
Gm36283 |
predicted gene, 36283 |
2241 |
0.31 |
chr1_169238407_169239099 | 1.79 |
Gm37839 |
predicted gene, 37839 |
108879 |
0.07 |
chr5_124960229_124960932 | 1.77 |
Rflna |
refilin A |
42641 |
0.13 |
chr15_37803419_37804373 | 1.75 |
Ncald |
neurocalcin delta |
11326 |
0.17 |
chr19_37695799_37696063 | 1.73 |
Cyp26a1 |
cytochrome P450, family 26, subfamily a, polypeptide 1 |
1867 |
0.32 |
chr8_105520321_105521493 | 1.71 |
Hsd11b2 |
hydroxysteroid 11-beta dehydrogenase 2 |
2152 |
0.16 |
chr10_12546537_12547601 | 1.70 |
Utrn |
utrophin |
1810 |
0.48 |
chr7_131542096_131543636 | 1.63 |
Hmx3 |
H6 homeobox 3 |
1 |
0.97 |
chr6_52190286_52190701 | 1.62 |
Hoxa4 |
homeobox A4 |
1260 |
0.16 |
chr11_96316025_96316970 | 1.62 |
Mir10a |
microRNA 10a |
668 |
0.4 |
chr13_109261723_109262640 | 1.61 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
1527 |
0.55 |
chr6_124719018_124719688 | 1.60 |
Gm15884 |
predicted gene 15884 |
522 |
0.36 |
chr11_120171201_120171417 | 1.60 |
2810410L24Rik |
RIKEN cDNA 2810410L24 gene |
17442 |
0.09 |
chr1_91770478_91771181 | 1.57 |
Twist2 |
twist basic helix-loop-helix transcription factor 2 |
30632 |
0.15 |
chrX_143825863_143827628 | 1.57 |
Capn6 |
calpain 6 |
587 |
0.46 |
chr7_46237003_46237400 | 1.57 |
Ush1c |
USH1 protein network component harmonin |
1263 |
0.37 |
chr6_52239036_52239383 | 1.56 |
Hoxa10 |
homeobox A10 |
1586 |
0.13 |
chr15_89557488_89558668 | 1.55 |
Shank3 |
SH3 and multiple ankyrin repeat domains 3 |
1376 |
0.31 |
chr10_120246974_120247580 | 1.53 |
Llph |
LLP homolog, long-term synaptic facilitation (Aplysia) |
20091 |
0.13 |
chr15_93589749_93589900 | 1.52 |
Prickle1 |
prickle planar cell polarity protein 1 |
6067 |
0.28 |
chr11_96620545_96621349 | 1.52 |
Skap1 |
src family associated phosphoprotein 1 |
87288 |
0.06 |
chr10_79989757_79990308 | 1.51 |
Cnn2 |
calponin 2 |
1409 |
0.18 |
chr7_141009744_141010714 | 1.51 |
Ifitm3 |
interferon induced transmembrane protein 3 |
541 |
0.54 |
chr18_75374458_75376171 | 1.47 |
Smad7 |
SMAD family member 7 |
400 |
0.87 |
chr13_31810556_31811961 | 1.47 |
Foxc1 |
forkhead box C1 |
4625 |
0.19 |
chr15_103026302_103028215 | 1.46 |
Hoxc4 |
homeobox C4 |
7137 |
0.09 |
chr3_146010425_146010793 | 1.46 |
Syde2 |
synapse defective 1, Rho GTPase, homolog 2 (C. elegans) |
16938 |
0.15 |
chr19_25486598_25487211 | 1.46 |
Gm5249 |
predicted gene 5249 |
6933 |
0.19 |
chr12_83087569_83088068 | 1.45 |
Gm29530 |
predicted gene 29530 |
11056 |
0.17 |
chr2_75089439_75089936 | 1.43 |
Gm13652 |
predicted gene 13652 |
48111 |
0.12 |
chr19_44746392_44747272 | 1.42 |
Gm35610 |
predicted gene, 35610 |
5479 |
0.16 |
chr14_16574044_16575901 | 1.41 |
Rarb |
retinoic acid receptor, beta |
73 |
0.92 |
chr11_35545484_35545698 | 1.38 |
Slit3 |
slit guidance ligand 3 |
906 |
0.7 |
chr2_147366625_147368623 | 1.36 |
Pax1 |
paired box 1 |
658 |
0.67 |
chr3_57293752_57294965 | 1.35 |
Tm4sf1 |
transmembrane 4 superfamily member 1 |
194 |
0.95 |
chr2_180388160_180389480 | 1.35 |
Mir1a-1 |
microRNA 1a-1 |
228 |
0.89 |
chr11_96294128_96295421 | 1.35 |
Hoxb6 |
homeobox B6 |
2298 |
0.11 |
chr12_33966605_33968831 | 1.34 |
Twist1 |
twist basic helix-loop-helix transcription factor 1 |
10047 |
0.22 |
chr6_30172641_30174725 | 1.33 |
Rncr4 |
retina expressed non-coding RNA 4 |
790 |
0.51 |
chr2_50187168_50187319 | 1.33 |
Lypd6 |
LY6/PLAUR domain containing 6 |
21842 |
0.24 |
chr4_145034033_145035168 | 1.33 |
Vps13d |
vacuolar protein sorting 13D |
16434 |
0.23 |
chr7_116197315_116198543 | 1.31 |
Plekha7 |
pleckstrin homology domain containing, family A member 7 |
632 |
0.75 |
chr12_13049686_13049847 | 1.31 |
Gm48209 |
predicted gene, 48209 |
4963 |
0.2 |
chr19_6968083_6968234 | 1.31 |
Plcb3 |
phospholipase C, beta 3 |
1550 |
0.16 |
chr4_141337980_141338742 | 1.29 |
Gm25690 |
predicted gene, 25690 |
7803 |
0.1 |
chr2_114050060_114050797 | 1.29 |
Actc1 |
actin, alpha, cardiac muscle 1 |
2459 |
0.23 |
chr3_86040419_86041443 | 1.29 |
Sh3d19 |
SH3 domain protein D19 |
208 |
0.92 |
chr6_17806620_17806968 | 1.29 |
Gm26738 |
predicted gene, 26738 |
28391 |
0.15 |
chr16_21216598_21216847 | 1.29 |
Ephb3 |
Eph receptor B3 |
95 |
0.96 |
chr11_98965856_98966512 | 1.28 |
Rara |
retinoic acid receptor, alpha |
5772 |
0.11 |
chr10_44455593_44456375 | 1.28 |
Prdm1 |
PR domain containing 1, with ZNF domain |
1226 |
0.49 |
chr12_94253154_94253305 | 1.27 |
Gm18749 |
predicted gene, 18749 |
193528 |
0.03 |
chr19_44758783_44762005 | 1.27 |
Pax2 |
paired box 2 |
479 |
0.75 |
chr1_191461780_191462583 | 1.27 |
Gm32200 |
predicted gene, 32200 |
2867 |
0.2 |
chr9_32506601_32506752 | 1.25 |
Gm27201 |
predicted gene 27201 |
1737 |
0.24 |
chr8_84917661_84917981 | 1.25 |
Dnase2a |
deoxyribonuclease II alpha |
4430 |
0.07 |
chr4_134252565_134254419 | 1.25 |
Grrp1 |
glycine/arginine rich protein 1 |
469 |
0.63 |
chr10_41292796_41293533 | 1.24 |
Fig4 |
FIG4 phosphoinositide 5-phosphatase |
10096 |
0.16 |
chr2_105235783_105235934 | 1.24 |
Them7 |
thioesterase superfamily member 7 |
11516 |
0.24 |
chr9_59133976_59134930 | 1.24 |
Gm7589 |
predicted gene 7589 |
11757 |
0.25 |
chr9_63716045_63716691 | 1.24 |
Smad3 |
SMAD family member 3 |
4399 |
0.27 |
chr9_21850341_21850776 | 1.23 |
Dock6 |
dedicator of cytokinesis 6 |
2058 |
0.19 |
chr12_108547361_108547670 | 1.22 |
Evl |
Ena-vasodilator stimulated phosphoprotein |
7205 |
0.17 |
chr2_4298620_4299406 | 1.21 |
Frmd4a |
FERM domain containing 4A |
1505 |
0.32 |
chr11_75053827_75053978 | 1.19 |
Gm12335 |
predicted gene 12335 |
12860 |
0.12 |
chr2_115542607_115542758 | 1.19 |
3110099E03Rik |
RIKEN cDNA 3110099E03 gene |
14938 |
0.2 |
chr13_94062433_94063410 | 1.19 |
Lhfpl2 |
lipoma HMGIC fusion partner-like 2 |
5089 |
0.2 |
chr15_103001984_103002537 | 1.19 |
Hoxc6 |
homeobox C6 |
1731 |
0.17 |
chr19_45207844_45208975 | 1.18 |
Lbx1 |
ladybird homeobox 1 |
27403 |
0.14 |
chr10_115306134_115306562 | 1.17 |
Rab21 |
RAB21, member RAS oncogene family |
9243 |
0.15 |
chr2_32378691_32378842 | 1.17 |
1110008P14Rik |
RIKEN cDNA 1110008P14 gene |
3096 |
0.11 |
chr3_30012132_30013421 | 1.17 |
Mecom |
MDS1 and EVI1 complex locus |
285 |
0.61 |
chr1_135255599_135256514 | 1.17 |
Elf3 |
E74-like factor 3 |
1593 |
0.25 |
chr11_75165245_75169157 | 1.16 |
Hic1 |
hypermethylated in cancer 1 |
945 |
0.35 |
chr14_61688572_61690120 | 1.15 |
Gm37820 |
predicted gene, 37820 |
5836 |
0.11 |
chr15_59652010_59653477 | 1.15 |
Trib1 |
tribbles pseudokinase 1 |
4090 |
0.24 |
chr15_87716358_87716509 | 1.15 |
Mir6393 |
microRNA 6393 |
79510 |
0.11 |
chr16_59599420_59599980 | 1.15 |
Crybg3 |
beta-gamma crystallin domain containing 3 |
1279 |
0.47 |
chr18_65143491_65144494 | 1.15 |
Nedd4l |
neural precursor cell expressed, developmentally down-regulated gene 4-like |
434 |
0.87 |
chr13_72210354_72210505 | 1.14 |
Gm4052 |
predicted gene 4052 |
139792 |
0.05 |
chr10_39614434_39615372 | 1.14 |
Gm16364 |
predicted gene 16364 |
1221 |
0.36 |
chr19_37814126_37814986 | 1.14 |
Gm9067 |
predicted gene 9067 |
30290 |
0.16 |
chr5_143000025_143001100 | 1.13 |
Rnf216 |
ring finger protein 216 |
16212 |
0.14 |
chr7_118929823_118930289 | 1.11 |
Iqck |
IQ motif containing K |
7067 |
0.19 |
chr10_61928650_61929583 | 1.11 |
Gm5750 |
predicted gene 5750 |
30508 |
0.16 |
chr6_52196485_52198020 | 1.10 |
Hoxaas3 |
Hoxa cluster antisense RNA 3 |
3872 |
0.06 |
chr11_19017316_19017603 | 1.09 |
Meis1 |
Meis homeobox 1 |
1170 |
0.39 |
chr11_83855991_83856225 | 1.09 |
Hnf1b |
HNF1 homeobox B |
3148 |
0.19 |
chr3_86544323_86545126 | 1.09 |
Lrba |
LPS-responsive beige-like anchor |
2031 |
0.33 |
chr17_28769080_28770373 | 1.08 |
Mapk13 |
mitogen-activated protein kinase 13 |
307 |
0.83 |
chr17_47946931_47947678 | 1.08 |
Gm5228 |
predicted gene 5228 |
11214 |
0.13 |
chr2_127729042_127730365 | 1.08 |
Mall |
mal, T cell differentiation protein-like |
229 |
0.9 |
chr7_25802106_25803222 | 1.08 |
Gm45226 |
predicted gene 45226 |
7511 |
0.08 |
chr12_73448708_73448859 | 1.08 |
Gm33929 |
predicted gene, 33929 |
465 |
0.79 |
chr6_126533083_126534077 | 1.08 |
Kcna5 |
potassium voltage-gated channel, shaker-related subfamily, member 5 |
1832 |
0.34 |
chr2_116070605_116071583 | 1.07 |
G630016G05Rik |
RIKEN cDNA G630016G05 gene |
3126 |
0.2 |
chr4_129135015_129135533 | 1.07 |
Gm15906 |
predicted gene 15906 |
183 |
0.89 |
chr15_35299632_35300122 | 1.06 |
Osr2 |
odd-skipped related 2 |
423 |
0.84 |
chr8_23387554_23388175 | 1.06 |
Sfrp1 |
secreted frizzled-related protein 1 |
23638 |
0.21 |
chr5_119137444_119138294 | 1.05 |
1700081H04Rik |
RIKEN cDNA 1700081H04 gene |
29635 |
0.2 |
chr10_8761475_8762950 | 1.05 |
Sash1 |
SAM and SH3 domain containing 1 |
262 |
0.93 |
chr3_138125511_138125662 | 1.05 |
Mttp |
microsomal triglyceride transfer protein |
5791 |
0.14 |
chr17_85432932_85433312 | 1.04 |
Rpl31-ps16 |
ribosomal protein L31, pseudogene 16 |
65511 |
0.12 |
chr19_24896949_24897990 | 1.04 |
Foxd4 |
forkhead box D4 |
3728 |
0.17 |
chr15_11907838_11908523 | 1.04 |
Npr3 |
natriuretic peptide receptor 3 |
893 |
0.51 |
chr11_117779316_117780928 | 1.04 |
Tmc6 |
transmembrane channel-like gene family 6 |
472 |
0.61 |
chr16_8417202_8417353 | 1.04 |
Tmem114 |
transmembrane protein 114 |
7859 |
0.18 |
chr4_139090712_139091031 | 1.04 |
Nbl1 |
NBL1, DAN family BMP antagonist |
1235 |
0.36 |
chr7_35948219_35949093 | 1.04 |
Gm28514 |
predicted gene 28514 |
110396 |
0.06 |
chr15_89085327_89085478 | 1.03 |
Trabd |
TraB domain containing |
693 |
0.47 |
chr8_119490510_119491264 | 1.03 |
Slc38a8 |
solute carrier family 38, member 8 |
4008 |
0.17 |
chr8_26626276_26626991 | 1.02 |
Gm32050 |
predicted gene, 32050 |
847 |
0.58 |
chr6_94694592_94695738 | 1.02 |
Lrig1 |
leucine-rich repeats and immunoglobulin-like domains 1 |
4972 |
0.26 |
chr7_19393073_19393250 | 1.02 |
Ercc2 |
excision repair cross-complementing rodent repair deficiency, complementation group 2 |
269 |
0.57 |
chr10_105794148_105794388 | 1.02 |
n-R5s80 |
nuclear encoded rRNA 5S 80 |
9929 |
0.18 |
chr11_97546222_97546432 | 1.02 |
Srcin1 |
SRC kinase signaling inhibitor 1 |
9382 |
0.13 |
chr8_120693953_120694425 | 1.02 |
Gm33142 |
predicted gene, 33142 |
8790 |
0.11 |
chr8_57213759_57214585 | 1.01 |
Gm17994 |
predicted gene, 17994 |
77880 |
0.08 |
chr8_121044368_121044519 | 1.01 |
Fendrr |
Foxf1 adjacent non-coding developmental regulatory RNA |
15970 |
0.14 |
chr18_76544225_76544908 | 1.01 |
Gm31933 |
predicted gene, 31933 |
88304 |
0.1 |
chr2_115869257_115869452 | 1.01 |
Meis2 |
Meis homeobox 2 |
487 |
0.89 |
chr6_52187599_52188482 | 1.01 |
Hoxa3 |
homeobox A3 |
3166 |
0.07 |
chr9_31688091_31688790 | 1.01 |
Gm47436 |
predicted gene, 47436 |
10414 |
0.21 |
chr12_8900897_8901048 | 1.00 |
9930038B18Rik |
RIKEN cDNA 9930038B18 gene |
7499 |
0.16 |
chr12_33965345_33965532 | 0.98 |
Twist1 |
twist basic helix-loop-helix transcription factor 1 |
7767 |
0.23 |
chr12_111347044_111347242 | 0.98 |
Cdc42bpb |
CDC42 binding protein kinase beta |
30476 |
0.12 |
chr16_45841533_45842060 | 0.98 |
Phldb2 |
pleckstrin homology like domain, family B, member 2 |
2438 |
0.32 |
chr2_74725879_74728683 | 0.98 |
Hoxd4 |
homeobox D4 |
207 |
0.67 |
chr4_107108362_107108716 | 0.98 |
Cdcp2 |
CUB domain containing protein 2 |
10831 |
0.13 |
chr19_58125208_58125399 | 0.98 |
Gm50287 |
predicted gene, 50287 |
29272 |
0.21 |
chr7_128003842_128005372 | 0.98 |
Trim72 |
tripartite motif-containing 72 |
229 |
0.69 |
chr6_134182046_134182799 | 0.98 |
Gm17088 |
predicted gene 17088 |
10415 |
0.19 |
chr13_3898349_3898500 | 0.97 |
Gm47813 |
predicted gene, 47813 |
1824 |
0.23 |
chr15_55306543_55308867 | 0.97 |
Col14a1 |
collagen, type XIV, alpha 1 |
45 |
0.98 |
chr5_119669544_119672401 | 0.97 |
Tbx3 |
T-box 3 |
46 |
0.85 |
chr1_89921735_89923880 | 0.97 |
Gbx2 |
gastrulation brain homeobox 2 |
6378 |
0.21 |
chr6_84021221_84022200 | 0.97 |
Dysf |
dysferlin |
2321 |
0.22 |
chr6_144042016_144042167 | 0.96 |
Sox5os1 |
SRY (sex determining region Y)-box 5, opposite strand 1 |
20183 |
0.24 |
chr7_99348638_99349529 | 0.96 |
Serpinh1 |
serine (or cysteine) peptidase inhibitor, clade H, member 1 |
3914 |
0.18 |
chr15_103169720_103170504 | 0.96 |
Smug1 |
single-strand selective monofunctional uracil DNA glycosylase |
3020 |
0.16 |
chr2_84475523_84476677 | 0.96 |
Tfpi |
tissue factor pathway inhibitor |
648 |
0.7 |
chr7_142575955_142576106 | 0.96 |
H19 |
H19, imprinted maternally expressed transcript |
508 |
0.57 |
chr17_45544425_45546027 | 0.95 |
Tmem151b |
transmembrane protein 151B |
4451 |
0.11 |
chr19_24159500_24160164 | 0.95 |
Gm50308 |
predicted gene, 50308 |
5762 |
0.18 |
chr7_68809937_68810088 | 0.95 |
Arrdc4 |
arrestin domain containing 4 |
60771 |
0.12 |
chr6_52233543_52234485 | 0.94 |
Hoxa10 |
homeobox A10 |
690 |
0.34 |
chr2_75556866_75557017 | 0.93 |
Gm13655 |
predicted gene 13655 |
76441 |
0.07 |
chr11_96308497_96309471 | 0.93 |
Hoxb5os |
homeobox B5 and homeobox B6, opposite strand |
2074 |
0.12 |
chr2_169633483_169634260 | 0.93 |
Tshz2 |
teashirt zinc finger family member 2 |
195 |
0.95 |
chr5_3844890_3845471 | 0.92 |
Lrrd1 |
leucine rich repeats and death domain containing 1 |
7 |
0.97 |
chr2_31762813_31763464 | 0.92 |
Abl1 |
c-abl oncogene 1, non-receptor tyrosine kinase |
2965 |
0.22 |
chr11_25356867_25358335 | 0.92 |
4933427E13Rik |
RIKEN cDNA 4933427E13 gene |
27644 |
0.22 |
chr2_61453755_61454593 | 0.92 |
Gm22338 |
predicted gene, 22338 |
38592 |
0.2 |
chrX_170677619_170677970 | 0.92 |
Asmt |
acetylserotonin O-methyltransferase |
5150 |
0.32 |
chr18_58204319_58204964 | 0.92 |
Fbn2 |
fibrillin 2 |
3936 |
0.3 |
chr7_110689214_110689762 | 0.92 |
Gm21123 |
predicted gene, 21123 |
10246 |
0.15 |
chr11_96578679_96579420 | 0.92 |
Skap1 |
src family associated phosphoprotein 1 |
89188 |
0.06 |
chr1_150990100_150990610 | 0.91 |
Hmcn1 |
hemicentin 1 |
2696 |
0.26 |
chr5_36373726_36373877 | 0.91 |
Sorcs2 |
sortilin-related VPS10 domain containing receptor 2 |
7883 |
0.22 |
chr11_88560963_88561346 | 0.91 |
Msi2 |
musashi RNA-binding protein 2 |
28993 |
0.2 |
chr15_103035453_103035984 | 0.91 |
Hoxc4 |
homeobox C4 |
1323 |
0.25 |
chr2_9871723_9873329 | 0.91 |
Gata3 |
GATA binding protein 3 |
1146 |
0.36 |
chr15_103013757_103015908 | 0.91 |
Mir615 |
microRNA 615 |
78 |
0.91 |
chr13_109229388_109230388 | 0.90 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
30766 |
0.25 |
chr18_84074730_84075170 | 0.89 |
Tshz1 |
teashirt zinc finger family member 1 |
10125 |
0.16 |
chr6_91795276_91796520 | 0.89 |
Grip2 |
glutamate receptor interacting protein 2 |
346 |
0.87 |
chr14_122581016_122581167 | 0.89 |
Pcca |
propionyl-Coenzyme A carboxylase, alpha polypeptide |
1593 |
0.37 |
chr14_105870289_105870865 | 0.89 |
Gm48970 |
predicted gene, 48970 |
8076 |
0.22 |
chr7_137309191_137310700 | 0.89 |
Ebf3 |
early B cell factor 3 |
3971 |
0.23 |
chr15_55189628_55189779 | 0.89 |
Deptor |
DEP domain containing MTOR-interacting protein |
56250 |
0.11 |
chr5_114199337_114199940 | 0.88 |
Acacb |
acetyl-Coenzyme A carboxylase beta |
141 |
0.95 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 4.3 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.9 | 1.8 | GO:0010159 | specification of organ position(GO:0010159) |
0.7 | 3.4 | GO:0048793 | pronephros development(GO:0048793) |
0.6 | 0.6 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
0.6 | 2.9 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.5 | 1.6 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.5 | 1.5 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.5 | 2.0 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.5 | 1.4 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.5 | 0.9 | GO:0021569 | rhombomere 3 development(GO:0021569) |
0.4 | 0.4 | GO:0021564 | vagus nerve development(GO:0021564) |
0.4 | 2.1 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.4 | 1.2 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
0.4 | 1.2 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.4 | 1.9 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.3 | 1.0 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.3 | 1.0 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.3 | 1.0 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.3 | 1.0 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
0.3 | 0.3 | GO:0072048 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.3 | 1.6 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
0.3 | 0.9 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.3 | 1.1 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.3 | 0.8 | GO:0072107 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
0.3 | 0.8 | GO:0007525 | somatic muscle development(GO:0007525) |
0.3 | 0.3 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.3 | 0.8 | GO:0032349 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) |
0.3 | 1.1 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.3 | 1.1 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.3 | 0.8 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.3 | 0.5 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
0.3 | 0.8 | GO:0001757 | somite specification(GO:0001757) |
0.2 | 1.2 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.2 | 0.2 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.2 | 1.0 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.2 | 1.2 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.2 | 0.7 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.2 | 0.7 | GO:0072103 | glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
0.2 | 0.7 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.2 | 0.5 | GO:0060596 | mammary placode formation(GO:0060596) |
0.2 | 0.2 | GO:1900200 | mesenchymal cell apoptotic process involved in metanephros development(GO:1900200) regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900211) negative regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900212) |
0.2 | 0.9 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.2 | 0.7 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.2 | 0.6 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.2 | 0.4 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.2 | 1.3 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.2 | 4.4 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.2 | 0.6 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.2 | 0.6 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.2 | 0.4 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.2 | 0.5 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.2 | 0.5 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.2 | 1.1 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.2 | 0.5 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
0.2 | 0.2 | GO:0072180 | mesonephric duct morphogenesis(GO:0072180) |
0.2 | 0.5 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.2 | 0.2 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
0.2 | 0.7 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.2 | 0.5 | GO:0060023 | soft palate development(GO:0060023) |
0.2 | 0.7 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.2 | 0.7 | GO:0033504 | floor plate development(GO:0033504) |
0.2 | 0.7 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.2 | 0.7 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.2 | 1.0 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.2 | 0.2 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.2 | 0.5 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.2 | 0.8 | GO:1904970 | brush border assembly(GO:1904970) |
0.2 | 12.3 | GO:0048704 | embryonic skeletal system morphogenesis(GO:0048704) |
0.2 | 0.3 | GO:2000019 | negative regulation of male gonad development(GO:2000019) |
0.2 | 0.3 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.2 | 0.5 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.2 | 0.9 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.2 | 0.3 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.1 | 1.0 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.1 | 0.7 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.1 | 1.0 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.1 | 0.1 | GO:0048370 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.1 | 1.1 | GO:0014820 | tonic smooth muscle contraction(GO:0014820) |
0.1 | 0.6 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.1 | 0.7 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.1 | 0.3 | GO:0051794 | regulation of catagen(GO:0051794) |
0.1 | 0.1 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.1 | 0.4 | GO:0071611 | macrophage colony-stimulating factor production(GO:0036301) granulocyte colony-stimulating factor production(GO:0071611) regulation of granulocyte colony-stimulating factor production(GO:0071655) regulation of macrophage colony-stimulating factor production(GO:1901256) |
0.1 | 0.5 | GO:0060526 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
0.1 | 0.5 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.1 | 0.2 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.1 | 0.4 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.1 | 0.5 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.1 | 0.1 | GO:0048320 | axial mesoderm formation(GO:0048320) |
0.1 | 0.4 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.1 | 0.5 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.1 | 0.5 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
0.1 | 0.3 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
0.1 | 0.2 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.1 | 0.3 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 0.9 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.1 | 0.2 | GO:0007494 | midgut development(GO:0007494) |
0.1 | 1.5 | GO:0022038 | corpus callosum development(GO:0022038) |
0.1 | 0.3 | GO:0003192 | mitral valve formation(GO:0003192) |
0.1 | 0.3 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.1 | 0.3 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.1 | 0.3 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.1 | 0.3 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.1 | 0.3 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.1 | 0.3 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 0.2 | GO:0072194 | kidney smooth muscle tissue development(GO:0072194) |
0.1 | 0.1 | GO:0051593 | response to folic acid(GO:0051593) |
0.1 | 0.4 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.1 | 0.4 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.1 | 0.1 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.1 | 0.5 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
0.1 | 0.3 | GO:0009182 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.1 | 0.3 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.1 | 2.4 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
0.1 | 0.1 | GO:0061184 | positive regulation of dermatome development(GO:0061184) |
0.1 | 0.4 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.1 | 1.9 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.1 | 0.2 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.1 | 0.3 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
0.1 | 0.6 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
0.1 | 0.6 | GO:0002158 | osteoclast proliferation(GO:0002158) |
0.1 | 0.1 | GO:0071733 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
0.1 | 0.5 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.1 | 1.3 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.1 | 0.8 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
0.1 | 0.2 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.1 | 0.5 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.1 | 0.2 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.1 | 0.3 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.1 | 0.3 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 0.4 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
0.1 | 1.0 | GO:0060065 | uterus development(GO:0060065) |
0.1 | 1.1 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
0.1 | 0.3 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
0.1 | 0.2 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
0.1 | 0.6 | GO:0001865 | NK T cell differentiation(GO:0001865) |
0.1 | 0.8 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.1 | 0.2 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.1 | 0.2 | GO:0035793 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.1 | 0.2 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.1 | 0.5 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 0.6 | GO:0055012 | ventricular cardiac muscle cell differentiation(GO:0055012) |
0.1 | 0.3 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.1 | 0.3 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.1 | 0.2 | GO:1903899 | positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
0.1 | 0.6 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.1 | 0.1 | GO:2000437 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
0.1 | 0.2 | GO:0021636 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) |
0.1 | 0.4 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
0.1 | 0.1 | GO:0048302 | regulation of isotype switching to IgG isotypes(GO:0048302) |
0.1 | 0.6 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.1 | 0.1 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
0.1 | 0.4 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.1 | 0.1 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) |
0.1 | 0.1 | GO:0003175 | tricuspid valve development(GO:0003175) |
0.1 | 0.2 | GO:0003199 | heart valve formation(GO:0003188) endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.1 | 0.1 | GO:0031946 | regulation of glucocorticoid biosynthetic process(GO:0031946) |
0.1 | 0.4 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.1 | 1.9 | GO:0060135 | maternal process involved in female pregnancy(GO:0060135) |
0.1 | 0.2 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.1 | 0.3 | GO:0002159 | desmosome assembly(GO:0002159) |
0.1 | 0.1 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
0.1 | 0.6 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.1 | 0.2 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.1 | 0.5 | GO:0060037 | pharyngeal system development(GO:0060037) |
0.1 | 0.2 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.1 | 1.0 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
0.1 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.1 | 0.1 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.1 | 0.3 | GO:0032962 | positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
0.1 | 0.7 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.1 | 0.2 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.1 | 0.1 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.1 | 0.5 | GO:0016102 | retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) |
0.1 | 0.1 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.1 | 0.2 | GO:0043587 | tongue morphogenesis(GO:0043587) |
0.1 | 0.3 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.1 | 1.3 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
0.1 | 1.2 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.1 | 0.2 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.1 | 0.3 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.1 | 0.3 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.1 | 0.1 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
0.1 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.1 | 0.2 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.1 | 0.1 | GO:0003180 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
0.1 | 0.2 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.1 | 0.2 | GO:0061042 | vascular wound healing(GO:0061042) |
0.1 | 0.2 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.1 | 0.1 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.1 | 0.4 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
0.1 | 0.3 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.1 | 0.1 | GO:0060214 | endocardium formation(GO:0060214) |
0.1 | 1.1 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.1 | 0.6 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
0.1 | 0.1 | GO:0021940 | positive regulation of cerebellar granule cell precursor proliferation(GO:0021940) |
0.1 | 0.2 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.1 | 0.1 | GO:0048818 | positive regulation of hair follicle maturation(GO:0048818) |
0.1 | 0.5 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
0.1 | 0.1 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.1 | 0.2 | GO:1900221 | regulation of beta-amyloid clearance(GO:1900221) |
0.1 | 0.1 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
0.1 | 0.2 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.1 | 0.2 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
0.1 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.1 | 0.1 | GO:0010916 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
0.1 | 0.1 | GO:0030421 | defecation(GO:0030421) |
0.1 | 0.1 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.1 | 0.1 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.1 | 0.9 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.1 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.2 | GO:0012502 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
0.1 | 0.2 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.1 | 0.2 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
0.1 | 0.3 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.1 | 0.2 | GO:0048617 | embryonic foregut morphogenesis(GO:0048617) |
0.1 | 0.3 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
0.1 | 0.1 | GO:0086068 | Purkinje myocyte to ventricular cardiac muscle cell signaling(GO:0086029) Purkinje myocyte to ventricular cardiac muscle cell communication(GO:0086068) |
0.1 | 1.1 | GO:0045109 | intermediate filament organization(GO:0045109) |
0.1 | 0.2 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.1 | 0.2 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.1 | 0.2 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.1 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.1 | 0.2 | GO:0071314 | cellular response to cocaine(GO:0071314) |
0.1 | 0.4 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.1 | 0.3 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.1 | 0.3 | GO:0048368 | lateral mesoderm development(GO:0048368) |
0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.0 | 0.4 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.0 | 0.0 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.0 | 0.0 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
0.0 | 0.0 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.0 | 0.2 | GO:0060068 | vagina development(GO:0060068) |
0.0 | 0.3 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.0 | 0.6 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.4 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.0 | 0.1 | GO:1903909 | regulation of receptor clustering(GO:1903909) |
0.0 | 0.2 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
0.0 | 0.2 | GO:0018101 | protein citrullination(GO:0018101) |
0.0 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.0 | 0.1 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
0.0 | 0.1 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.0 | 0.1 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.0 | 0.1 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.0 | 0.1 | GO:2000053 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.0 | 0.1 | GO:0035087 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.0 | 0.3 | GO:0060056 | mammary gland involution(GO:0060056) |
0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.0 | 0.2 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.0 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
0.0 | 0.3 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.0 | 0.1 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
0.0 | 0.1 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.0 | 0.2 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.3 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.0 | 0.1 | GO:0034351 | negative regulation of glial cell apoptotic process(GO:0034351) |
0.0 | 0.2 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.0 | 0.3 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.0 | 0.2 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.0 | 0.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 0.1 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.0 | 0.0 | GO:0021783 | preganglionic parasympathetic fiber development(GO:0021783) |
0.0 | 0.1 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.0 | 0.4 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.0 | 0.1 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.0 | 0.1 | GO:0035425 | autocrine signaling(GO:0035425) |
0.0 | 0.0 | GO:0070570 | regulation of neuron projection regeneration(GO:0070570) |
0.0 | 0.2 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.0 | 0.2 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
0.0 | 0.1 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.0 | 0.1 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.0 | 0.2 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.0 | 0.2 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
0.0 | 0.1 | GO:1903984 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.0 | 0.3 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
0.0 | 0.1 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.0 | 1.0 | GO:0060612 | adipose tissue development(GO:0060612) |
0.0 | 0.1 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.0 | 0.0 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.0 | 0.2 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.1 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.0 | 0.2 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.2 | GO:0002692 | negative regulation of cellular extravasation(GO:0002692) |
0.0 | 0.1 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.0 | 0.1 | GO:0010935 | regulation of macrophage cytokine production(GO:0010935) |
0.0 | 0.0 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
0.0 | 0.6 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
0.0 | 0.1 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.0 | 0.0 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.0 | 0.0 | GO:1901723 | negative regulation of cell proliferation involved in kidney development(GO:1901723) |
0.0 | 0.4 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
0.0 | 0.0 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.1 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.0 | 0.1 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.0 | 0.2 | GO:0070417 | cellular response to cold(GO:0070417) |
0.0 | 0.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.0 | 0.3 | GO:0022617 | extracellular matrix disassembly(GO:0022617) |
0.0 | 0.1 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.0 | 0.3 | GO:0002024 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.0 | 0.1 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.0 | 0.4 | GO:0010225 | response to UV-C(GO:0010225) |
0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.2 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.0 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.4 | GO:0060261 | positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
0.0 | 0.4 | GO:0045601 | regulation of endothelial cell differentiation(GO:0045601) |
0.0 | 0.2 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.1 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.0 | 0.3 | GO:0002176 | male germ cell proliferation(GO:0002176) |
0.0 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.0 | 0.1 | GO:0042637 | catagen(GO:0042637) |
0.0 | 0.2 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.1 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) neural plate regionalization(GO:0060897) |
0.0 | 0.1 | GO:1904749 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.0 | 0.1 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.0 | 0.3 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.0 | 0.5 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.0 | 0.4 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
0.0 | 0.3 | GO:0036035 | osteoclast development(GO:0036035) |
0.0 | 0.3 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.0 | 0.1 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.0 | 0.1 | GO:0031296 | B cell costimulation(GO:0031296) |
0.0 | 0.0 | GO:0097242 | beta-amyloid clearance(GO:0097242) |
0.0 | 0.1 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.0 | 0.0 | GO:0072077 | renal vesicle morphogenesis(GO:0072077) |
0.0 | 0.2 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.1 | GO:0034287 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.0 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.0 | 0.0 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.0 | 0.0 | GO:0033029 | regulation of neutrophil apoptotic process(GO:0033029) |
0.0 | 0.1 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
0.0 | 0.1 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.0 | 0.1 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.1 | GO:2000389 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
0.0 | 0.0 | GO:0032351 | negative regulation of hormone metabolic process(GO:0032351) |
0.0 | 0.3 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.1 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.0 | 0.2 | GO:0051546 | keratinocyte migration(GO:0051546) |
0.0 | 0.1 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.0 | 0.1 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.0 | 0.1 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.0 | 0.1 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
0.0 | 0.3 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
0.0 | 0.1 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.0 | 0.1 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.0 | 0.2 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.0 | 0.0 | GO:1905208 | negative regulation of cardiocyte differentiation(GO:1905208) negative regulation of cardiac muscle cell differentiation(GO:2000726) |
0.0 | 0.1 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.0 | 0.1 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.0 | 0.1 | GO:0003352 | regulation of cilium movement(GO:0003352) |
0.0 | 0.1 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.0 | 0.1 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.0 | 0.1 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
0.0 | 0.0 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.0 | 0.1 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.4 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.0 | 0.7 | GO:0030890 | positive regulation of B cell proliferation(GO:0030890) |
0.0 | 0.0 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.0 | 0.0 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.0 | 0.1 | GO:0050713 | negative regulation of interleukin-1 beta secretion(GO:0050713) |
0.0 | 0.1 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
0.0 | 0.0 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.1 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.0 | 0.3 | GO:0032096 | negative regulation of response to food(GO:0032096) |
0.0 | 0.3 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.0 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.1 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.0 | 0.2 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.2 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.0 | 0.0 | GO:0033084 | regulation of immature T cell proliferation in thymus(GO:0033084) |
0.0 | 0.3 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.1 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
0.0 | 0.1 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.0 | 0.1 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.1 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
0.0 | 0.1 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.0 | 0.1 | GO:1900084 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.0 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.0 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.1 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.0 | 0.1 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.0 | 0.3 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.1 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
0.0 | 0.4 | GO:0055013 | cardiac muscle cell development(GO:0055013) |
0.0 | 0.1 | GO:0051451 | myoblast migration(GO:0051451) |
0.0 | 0.2 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) |
0.0 | 0.0 | GO:0060231 | mesenchymal to epithelial transition(GO:0060231) |
0.0 | 0.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.0 | 0.7 | GO:0042832 | defense response to protozoan(GO:0042832) |
0.0 | 0.2 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
0.0 | 0.0 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) |
0.0 | 0.2 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.0 | 0.1 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.0 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.2 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
0.0 | 0.1 | GO:0006971 | hypotonic response(GO:0006971) |
0.0 | 0.3 | GO:0030318 | melanocyte differentiation(GO:0030318) |
0.0 | 0.2 | GO:0051894 | positive regulation of focal adhesion assembly(GO:0051894) |
0.0 | 0.1 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.0 | 0.1 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
0.0 | 0.1 | GO:0051639 | actin filament network formation(GO:0051639) |
0.0 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.3 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
0.0 | 0.0 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
0.0 | 0.1 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
0.0 | 0.2 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
0.0 | 0.0 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
0.0 | 0.0 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
0.0 | 0.1 | GO:0010454 | negative regulation of cell fate commitment(GO:0010454) |
0.0 | 0.1 | GO:0071493 | cellular response to UV-B(GO:0071493) |
0.0 | 0.2 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.0 | 0.0 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.0 | 0.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.0 | 0.0 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.1 | GO:0042523 | positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
0.0 | 0.0 | GO:0002830 | positive regulation of type 2 immune response(GO:0002830) |
0.0 | 0.1 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
0.0 | 0.0 | GO:0021854 | hypothalamus development(GO:0021854) |
0.0 | 0.1 | GO:0014870 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.0 | 0.0 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
0.0 | 0.4 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
0.0 | 0.0 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.0 | 0.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.0 | 0.0 | GO:0032095 | regulation of response to food(GO:0032095) |
0.0 | 0.0 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
0.0 | 0.3 | GO:0046184 | aldehyde biosynthetic process(GO:0046184) |
0.0 | 0.6 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.0 | 0.3 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
0.0 | 0.1 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.0 | 0.1 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.0 | 0.1 | GO:0014831 | gastro-intestinal system smooth muscle contraction(GO:0014831) |
0.0 | 0.2 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.0 | 0.2 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
0.0 | 0.1 | GO:0044331 | cell-cell adhesion mediated by cadherin(GO:0044331) |
0.0 | 0.0 | GO:0034443 | regulation of lipoprotein oxidation(GO:0034442) negative regulation of lipoprotein oxidation(GO:0034443) |
0.0 | 0.0 | GO:1903376 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
0.0 | 0.1 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
0.0 | 0.4 | GO:0044062 | regulation of excretion(GO:0044062) |
0.0 | 0.0 | GO:2000553 | positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
0.0 | 0.1 | GO:0002693 | positive regulation of cellular extravasation(GO:0002693) |
0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.1 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.0 | 0.1 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.0 | 0.1 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.0 | 0.0 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.0 | 0.0 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.0 | 0.1 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 1.5 | GO:0016441 | posttranscriptional gene silencing(GO:0016441) |
0.0 | 0.0 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.0 | 0.0 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.0 | 0.4 | GO:0060218 | hematopoietic stem cell differentiation(GO:0060218) |
0.0 | 0.1 | GO:0033483 | gas homeostasis(GO:0033483) |
0.0 | 0.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.0 | 0.1 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.0 | 0.0 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.0 | 0.0 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
0.0 | 0.1 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.0 | 0.2 | GO:1990403 | embryonic brain development(GO:1990403) |
0.0 | 0.0 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.0 | 0.0 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.1 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.0 | 0.1 | GO:0035136 | forelimb morphogenesis(GO:0035136) |
0.0 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.1 | GO:0070242 | thymocyte apoptotic process(GO:0070242) |
0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.1 | GO:0070572 | positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
0.0 | 0.0 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.0 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.0 | 0.0 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.0 | 0.0 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
0.0 | 0.0 | GO:0007512 | adult heart development(GO:0007512) |
0.0 | 0.0 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
0.0 | 0.0 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
0.0 | 0.1 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.0 | 0.1 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.0 | 0.0 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.0 | 0.0 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
0.0 | 0.1 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.0 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.0 | 0.1 | GO:0051775 | response to redox state(GO:0051775) |
0.0 | 0.3 | GO:0048535 | lymph node development(GO:0048535) |
0.0 | 0.1 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
0.0 | 0.0 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
0.0 | 0.1 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
0.0 | 0.0 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
0.0 | 0.0 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.2 | GO:0014059 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
0.0 | 0.1 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.0 | 0.0 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.0 | 0.0 | GO:0042160 | lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.1 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.0 | 0.2 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
0.0 | 0.0 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.1 | GO:0097152 | mesenchymal cell apoptotic process(GO:0097152) |
0.0 | 0.0 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.0 | 0.1 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.0 | 0.2 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.0 | 0.0 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.1 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.0 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
0.0 | 0.0 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.0 | 0.0 | GO:0071725 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.0 | 0.0 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.0 | 0.0 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) |
0.0 | 0.0 | GO:0043307 | eosinophil activation(GO:0043307) |
0.0 | 0.1 | GO:0006477 | protein sulfation(GO:0006477) |
0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.1 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
0.0 | 0.0 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.0 | 0.0 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.1 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) establishment of T cell polarity(GO:0001768) |
0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.1 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
0.0 | 0.1 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
0.0 | 0.0 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.2 | GO:0006907 | pinocytosis(GO:0006907) |
0.0 | 0.0 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
0.0 | 0.1 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.0 | 0.0 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.1 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.0 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
0.0 | 0.0 | GO:0010818 | T cell chemotaxis(GO:0010818) |
0.0 | 0.0 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.0 | 0.1 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.0 | 0.0 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.0 | 0.0 | GO:0042097 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.0 | 0.2 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.0 | 0.0 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.0 | 0.1 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.0 | 0.0 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.2 | GO:0010669 | epithelial structure maintenance(GO:0010669) |
0.0 | 0.0 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.0 | 0.1 | GO:0045777 | positive regulation of blood pressure(GO:0045777) |
0.0 | 0.0 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.0 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.0 | 0.1 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.0 | 0.3 | GO:0006911 | phagocytosis, engulfment(GO:0006911) |
0.0 | 0.0 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.2 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.0 | 0.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.1 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.0 | 0.3 | GO:0001783 | B cell apoptotic process(GO:0001783) |
0.0 | 0.0 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.0 | 0.4 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
0.0 | 0.0 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.0 | 0.0 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.0 | 0.1 | GO:0018214 | protein carboxylation(GO:0018214) |
0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.1 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.0 | 0.3 | GO:0009268 | response to pH(GO:0009268) |
0.0 | 0.5 | GO:0003073 | regulation of systemic arterial blood pressure(GO:0003073) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.2 | GO:0007588 | excretion(GO:0007588) |
0.0 | 0.0 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.0 | 0.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.0 | 0.0 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.0 | 0.2 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.0 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.0 | 0.0 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.0 | 0.0 | GO:0060285 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
0.0 | 0.1 | GO:0014850 | response to muscle activity(GO:0014850) |
0.0 | 0.0 | GO:0003179 | heart valve morphogenesis(GO:0003179) |
0.0 | 0.0 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.0 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.0 | 0.0 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.0 | 0.2 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
0.0 | 0.0 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.0 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.0 | 0.1 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
0.0 | 0.1 | GO:0032324 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.0 | 0.1 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.0 | 0.0 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.0 | 0.0 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.0 | 0.0 | GO:0019532 | oxalate transport(GO:0019532) |
0.0 | 0.0 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.0 | 0.0 | GO:0030202 | heparin metabolic process(GO:0030202) |
0.0 | 0.1 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
0.0 | 0.1 | GO:0045350 | interferon-beta biosynthetic process(GO:0045350) regulation of interferon-beta biosynthetic process(GO:0045357) |
0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
0.0 | 0.2 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
0.0 | 0.1 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.1 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.0 | 0.2 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
0.0 | 0.0 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.1 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.0 | 0.0 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.0 | 0.0 | GO:2000847 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.0 | 0.0 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.0 | 0.1 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
0.0 | 0.0 | GO:0052203 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.0 | 0.0 | GO:0048486 | parasympathetic nervous system development(GO:0048486) |
0.0 | 0.0 | GO:2000551 | regulation of T-helper 2 cell cytokine production(GO:2000551) |
0.0 | 0.0 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.0 | 0.0 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.0 | 0.1 | GO:0043312 | neutrophil degranulation(GO:0043312) |
0.0 | 0.0 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.0 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.0 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.1 | GO:0048678 | response to axon injury(GO:0048678) |
0.0 | 0.1 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.0 | 0.1 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.0 | 0.0 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.0 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
0.0 | 0.0 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.1 | GO:0071451 | cellular response to oxygen radical(GO:0071450) cellular response to superoxide(GO:0071451) |
0.0 | 0.0 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.0 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.0 | 0.1 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.0 | 0.1 | GO:0051026 | chiasma assembly(GO:0051026) |
0.0 | 0.0 | GO:0048865 | stem cell fate commitment(GO:0048865) |
0.0 | 0.1 | GO:0045606 | positive regulation of epidermal cell differentiation(GO:0045606) |
0.0 | 0.0 | GO:0090399 | replicative senescence(GO:0090399) |
0.0 | 0.0 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.0 | 0.0 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.0 | 0.0 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.0 | 0.1 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.0 | 0.0 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.0 | GO:0030903 | notochord development(GO:0030903) |
0.0 | 0.0 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
0.0 | 0.0 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.1 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.0 | 0.1 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.1 | GO:0017062 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 0.0 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.1 | GO:0032782 | bile acid secretion(GO:0032782) |
0.0 | 0.0 | GO:1904417 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.0 | 0.0 | GO:0006901 | vesicle coating(GO:0006901) |
0.0 | 0.0 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.0 | 0.0 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.0 | 0.0 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.0 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.0 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.0 | 0.0 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
0.0 | 0.0 | GO:1903672 | positive regulation of sprouting angiogenesis(GO:1903672) |
0.0 | 0.1 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
0.0 | 0.0 | GO:0031506 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.0 | GO:0046130 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.0 | 0.0 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.7 | GO:0044393 | microspike(GO:0044393) |
0.2 | 1.0 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.2 | 3.2 | GO:0005614 | interstitial matrix(GO:0005614) |
0.2 | 1.1 | GO:0005915 | zonula adherens(GO:0005915) |
0.2 | 1.0 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.2 | 0.5 | GO:0005914 | spot adherens junction(GO:0005914) |
0.2 | 0.8 | GO:0008091 | spectrin(GO:0008091) |
0.2 | 0.8 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.1 | 0.4 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 0.4 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.7 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.1 | 0.5 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 0.4 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 0.3 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.1 | 0.7 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 3.3 | GO:0016235 | aggresome(GO:0016235) |
0.1 | 0.5 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.3 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.1 | 0.7 | GO:0005861 | troponin complex(GO:0005861) |
0.1 | 0.6 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 0.9 | GO:0001527 | microfibril(GO:0001527) |
0.1 | 0.5 | GO:0030056 | hemidesmosome(GO:0030056) |
0.1 | 0.6 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.2 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 1.2 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.1 | 0.6 | GO:0097542 | ciliary tip(GO:0097542) |
0.1 | 0.3 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.1 | 1.0 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.1 | 0.3 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 0.1 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.1 | 1.1 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.5 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.1 | 0.2 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.2 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 0.2 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 0.2 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 0.5 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 0.2 | GO:0070695 | FHF complex(GO:0070695) |
0.1 | 0.2 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.1 | 0.2 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 1.4 | GO:0034451 | centriolar satellite(GO:0034451) |
0.1 | 0.2 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 0.3 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 0.1 | GO:0097433 | dense body(GO:0097433) |
0.1 | 0.9 | GO:0010369 | chromocenter(GO:0010369) |
0.1 | 0.3 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 0.2 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 0.2 | GO:0005767 | secondary lysosome(GO:0005767) |
0.0 | 0.2 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.0 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.0 | 0.4 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.0 | 0.2 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 1.2 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.8 | GO:0098644 | complex of collagen trimers(GO:0098644) |
0.0 | 0.3 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.6 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.1 | GO:0000802 | transverse filament(GO:0000802) |
0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.6 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 12.6 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.1 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.2 | GO:0045180 | basal cortex(GO:0045180) |
0.0 | 0.0 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 1.2 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.6 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 1.5 | GO:0032421 | stereocilium bundle(GO:0032421) |
0.0 | 0.2 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.5 | GO:0016460 | myosin II complex(GO:0016460) |
0.0 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.0 | 0.0 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.3 | GO:0061702 | inflammasome complex(GO:0061702) |
0.0 | 0.2 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.2 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 1.0 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.0 | 0.1 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.0 | 0.2 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 6.5 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 0.0 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.0 | 0.2 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.1 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 1.3 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.6 | GO:0000791 | euchromatin(GO:0000791) |
0.0 | 1.0 | GO:0005844 | polysome(GO:0005844) |
0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.3 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.2 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.2 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.0 | GO:0042627 | chylomicron(GO:0042627) |
0.0 | 0.0 | GO:0042827 | platelet dense granule membrane(GO:0031088) platelet dense granule(GO:0042827) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.2 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.0 | 0.3 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.1 | GO:0000235 | astral microtubule(GO:0000235) |
0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.1 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.1 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.0 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.2 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.4 | GO:0031672 | A band(GO:0031672) |
0.0 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.1 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.0 | 0.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.0 | 0.2 | GO:0005652 | nuclear lamina(GO:0005652) |
0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.1 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 0.2 | GO:0043218 | compact myelin(GO:0043218) |
0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.1 | GO:1904949 | ATPase complex(GO:1904949) |
0.0 | 1.1 | GO:0032993 | protein-DNA complex(GO:0032993) |
0.0 | 0.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.0 | 0.0 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.0 | 1.5 | GO:0001726 | ruffle(GO:0001726) |
0.0 | 0.4 | GO:0060170 | ciliary membrane(GO:0060170) |
0.0 | 0.2 | GO:0018995 | host(GO:0018995) host cell part(GO:0033643) host cell(GO:0043657) |
0.0 | 0.1 | GO:0005688 | U6 snRNP(GO:0005688) |
0.0 | 0.2 | GO:0051233 | spindle midzone(GO:0051233) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.0 | GO:0035838 | growing cell tip(GO:0035838) |
0.0 | 0.2 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 0.1 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.5 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.0 | 0.0 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.0 | GO:0005745 | m-AAA complex(GO:0005745) |
0.0 | 0.0 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.0 | 0.1 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 0.0 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.2 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.2 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 0.1 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.3 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.0 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.0 | 3.0 | GO:0030055 | cell-substrate junction(GO:0030055) |
0.0 | 0.5 | GO:0044853 | plasma membrane raft(GO:0044853) |
0.0 | 0.1 | GO:0035102 | PRC1 complex(GO:0035102) |
0.0 | 0.0 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.1 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.2 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.0 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.0 | 0.0 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.2 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 0.1 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 0.3 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.0 | GO:1990923 | PET complex(GO:1990923) |
0.0 | 0.8 | GO:0042383 | sarcolemma(GO:0042383) |
0.0 | 0.0 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.0 | 0.0 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 1.0 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.0 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.1 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.0 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.4 | 1.3 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.4 | 2.5 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.3 | 1.8 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.3 | 0.8 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.3 | 1.5 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.2 | 0.7 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.2 | 0.7 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.2 | 0.9 | GO:0009374 | biotin binding(GO:0009374) |
0.2 | 0.7 | GO:0008142 | oxysterol binding(GO:0008142) |
0.2 | 0.9 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.2 | 0.8 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.2 | 1.6 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.2 | 0.6 | GO:0035939 | microsatellite binding(GO:0035939) |
0.2 | 1.5 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.2 | 0.7 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.2 | 0.5 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.2 | 0.5 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.2 | 1.0 | GO:0048495 | Roundabout binding(GO:0048495) |
0.2 | 0.5 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.2 | 0.5 | GO:0051373 | FATZ binding(GO:0051373) |
0.2 | 0.5 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.2 | 0.7 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.2 | 1.0 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.2 | 1.3 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.2 | 0.3 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.1 | 0.4 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.6 | GO:0031433 | telethonin binding(GO:0031433) |
0.1 | 0.5 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.4 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 0.4 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 0.4 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.1 | 0.4 | GO:0030172 | troponin C binding(GO:0030172) |
0.1 | 0.3 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.6 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.1 | 0.3 | GO:0043199 | sulfate binding(GO:0043199) |
0.1 | 1.2 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 0.3 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.3 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.1 | 0.8 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.1 | 0.9 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.1 | 0.4 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.1 | 0.3 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.1 | 0.7 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.5 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.1 | 0.4 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.1 | 0.3 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.8 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.1 | 1.3 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.1 | 0.9 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.1 | 0.1 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 0.2 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.1 | 0.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.1 | 1.7 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.1 | 0.5 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.1 | 0.2 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.1 | 0.1 | GO:0031014 | troponin T binding(GO:0031014) |
0.1 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
0.1 | 0.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.1 | 0.4 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.1 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
0.1 | 0.3 | GO:0033265 | choline binding(GO:0033265) |
0.1 | 0.6 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.1 | 1.3 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.1 | 1.1 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.1 | 0.9 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.1 | 0.1 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.1 | 0.3 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 0.1 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.1 | 1.0 | GO:0008143 | poly(A) binding(GO:0008143) |
0.1 | 0.1 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.1 | 0.8 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.1 | 0.2 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.1 | 0.2 | GO:0055100 | adiponectin binding(GO:0055100) |
0.1 | 1.2 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.2 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.1 | 1.0 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 0.4 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.3 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.1 | 0.2 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.1 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.1 | 0.2 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.1 | 1.1 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.1 | 0.2 | GO:0030984 | kininogen binding(GO:0030984) |
0.1 | 0.2 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.1 | 2.0 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.1 | 0.2 | GO:0004802 | transketolase activity(GO:0004802) |
0.1 | 0.2 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.1 | 0.3 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.1 | 0.5 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.1 | 0.3 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 0.2 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.1 | 0.3 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.1 | 0.2 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.1 | 0.2 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.1 | 0.4 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 0.3 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.0 | 0.3 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.0 | 0.4 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.0 | 3.5 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.0 | 0.7 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.1 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.0 | 0.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.1 | GO:0048030 | disaccharide binding(GO:0048030) |
0.0 | 0.2 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 0.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.0 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 1.3 | GO:0098531 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
0.0 | 0.1 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.0 | 0.9 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.0 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.0 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.4 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.3 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.1 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.0 | 0.1 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.0 | 0.2 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.1 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.0 | 29.4 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.4 | GO:0008932 | lytic endotransglycosylase activity(GO:0008932) |
0.0 | 0.1 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.1 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.0 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.3 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.3 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.1 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.0 | 0.1 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.1 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.0 | 1.6 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.0 | 0.5 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.2 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.0 | 0.4 | GO:0051393 | alpha-actinin binding(GO:0051393) |
0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.0 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.0 | 0.2 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.0 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.0 | 0.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.0 | 0.3 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.7 | GO:0032867 | C-3 sterol dehydrogenase (C-4 sterol decarboxylase) activity(GO:0000252) mevaldate reductase activity(GO:0004495) gluconate dehydrogenase activity(GO:0008875) epoxide dehydrogenase activity(GO:0018451) 5-exo-hydroxycamphor dehydrogenase activity(GO:0018452) 2-hydroxytetrahydrofuran dehydrogenase activity(GO:0018453) acetoin dehydrogenase activity(GO:0019152) phenylcoumaran benzylic ether reductase activity(GO:0032442) D-xylose:NADP reductase activity(GO:0032866) L-arabinose:NADP reductase activity(GO:0032867) D-arabinitol dehydrogenase, D-ribulose forming (NADP+) activity(GO:0033709) (R)-(-)-1,2,3,4-tetrahydronaphthol dehydrogenase activity(GO:0034831) 3-hydroxymenthone dehydrogenase activity(GO:0034840) very long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0035380) (R)-2-hydroxyisocaproate dehydrogenase activity(GO:0043713) L-arabinose 1-dehydrogenase (NADP+) activity(GO:0044103) L-xylulose reductase (NAD+) activity(GO:0044105) 3-ketoglucose-reductase activity(GO:0048258) D-arabinitol dehydrogenase, D-xylulose forming (NADP+) activity(GO:0052677) |
0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) |
0.0 | 0.2 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 0.1 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.2 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.3 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.1 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.0 | 0.0 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.0 | 0.3 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.3 | GO:0016918 | retinal binding(GO:0016918) |
0.0 | 0.3 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.3 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.2 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.0 | 0.3 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.4 | GO:0001968 | fibronectin binding(GO:0001968) |
0.0 | 0.1 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.0 | 0.2 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.1 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.0 | 0.2 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.1 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.0 | 0.1 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.0 | 0.1 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.0 | 0.2 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.1 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.3 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.2 | GO:0016631 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.0 | 0.1 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
0.0 | 0.1 | GO:0102344 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.0 | 0.0 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.0 | 0.4 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
0.0 | 0.0 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.4 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.6 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.3 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.0 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.2 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
0.0 | 0.7 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.1 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.0 | 0.1 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.0 | 0.1 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.0 | 0.0 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.0 | 0.0 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.0 | 1.2 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.0 | 0.1 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.0 | 0.2 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.2 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.5 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.0 | 0.1 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.2 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.3 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.1 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.0 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.0 | 0.1 | GO:0005350 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.0 | 0.2 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.4 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.0 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.0 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.1 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.0 | 0.1 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.1 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.1 | GO:0030546 | receptor activator activity(GO:0030546) |
0.0 | 0.3 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.1 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.0 | 0.1 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.0 | 0.6 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.1 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.2 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.0 | 0.0 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.1 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.2 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 0.1 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.0 | 0.3 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.1 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.0 | 0.1 | GO:0070636 | purine-specific mismatch base pair DNA N-glycosylase activity(GO:0000701) single-strand selective uracil DNA N-glycosylase activity(GO:0017065) nicotinamide riboside hydrolase activity(GO:0070635) nicotinic acid riboside hydrolase activity(GO:0070636) deoxyribonucleoside 5'-monophosphate N-glycosidase activity(GO:0070694) |
0.0 | 0.0 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.5 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.0 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.0 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 0.0 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.0 | 0.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.1 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.0 | GO:0048019 | receptor antagonist activity(GO:0048019) |
0.0 | 0.6 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.0 | 0.0 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.1 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.2 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.0 | 0.0 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.4 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.0 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.0 | 0.1 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.2 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 1.2 | GO:0008201 | heparin binding(GO:0008201) |
0.0 | 0.0 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.0 | 0.1 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 0.2 | GO:0005542 | folic acid binding(GO:0005542) |
0.0 | 1.0 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 0.1 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.1 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.0 | 0.1 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.1 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.0 | 0.0 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.0 | 0.0 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.0 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.0 | 0.1 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.0 | 0.1 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.0 | 0.2 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.0 | 0.1 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.0 | 0.2 | GO:0052890 | oxidoreductase activity, acting on the CH-CH group of donors, with a flavin as acceptor(GO:0052890) |
0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
0.0 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.0 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.3 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.0 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.0 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.0 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.0 | 0.1 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.0 | 0.2 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.0 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 0.0 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.0 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 3.1 | GO:0003779 | actin binding(GO:0003779) |
0.0 | 0.0 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.0 | 0.2 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.0 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.0 | 0.1 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 0.0 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.1 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) |
0.0 | 0.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.0 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.1 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.0 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.1 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.0 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.0 | 0.0 | GO:0045340 | mercury ion binding(GO:0045340) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.0 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
0.0 | 0.0 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.0 | 0.0 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.3 | GO:0004027 | alcohol sulfotransferase activity(GO:0004027) |
0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.2 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.3 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
0.0 | 0.1 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.1 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.0 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.0 | 0.1 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
0.0 | 0.0 | GO:0038132 | neuregulin binding(GO:0038132) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.9 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.1 | 1.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.5 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 2.2 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.1 | 1.7 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 2.0 | PID ALK1 PATHWAY | ALK1 signaling events |
0.1 | 0.1 | ST ADRENERGIC | Adrenergic Pathway |
0.1 | 2.1 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.1 | 0.7 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 2.2 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.1 | 1.1 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.1 | 1.6 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.1 | 1.9 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.6 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 1.0 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 1.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.4 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.4 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 1.3 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.2 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.5 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.0 | 0.8 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 5.5 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.4 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.5 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 1.3 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.0 | 0.2 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.5 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 1.5 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.0 | 0.5 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.9 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 1.1 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.9 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.3 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.1 | PID EPO PATHWAY | EPO signaling pathway |
0.0 | 0.7 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.3 | PID IFNG PATHWAY | IFN-gamma pathway |
0.0 | 0.3 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.0 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.0 | 0.8 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.2 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.3 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.2 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.4 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.3 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.1 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.2 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.5 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.2 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.0 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.0 | 0.2 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 0.2 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.1 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.2 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.0 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.0 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.3 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.1 | 1.4 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 0.1 | REACTOME PI3K EVENTS IN ERBB2 SIGNALING | Genes involved in PI3K events in ERBB2 signaling |
0.1 | 2.9 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.1 | 2.3 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 0.2 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.1 | 1.8 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.1 | 0.7 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 1.2 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.1 | 3.3 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.1 | 0.6 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.5 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.1 | 0.2 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
0.1 | 0.5 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.1 | 1.4 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.4 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.6 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.0 | 1.1 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
0.0 | 0.8 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.8 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.4 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 0.4 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.7 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.0 | 0.8 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.5 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.0 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.5 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.6 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 2.2 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.2 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.0 | 0.3 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 0.3 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.0 | 0.4 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 1.6 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.3 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.0 | 0.8 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 1.3 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.2 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.0 | 0.3 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.6 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.0 | 0.2 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.3 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.0 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.0 | 0.4 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.0 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.0 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.6 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.0 | 0.2 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
0.0 | 0.2 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.5 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.3 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 0.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.2 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.0 | REACTOME SIGNALING BY INSULIN RECEPTOR | Genes involved in Signaling by Insulin receptor |
0.0 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.2 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 0.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.2 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.3 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.0 | 0.8 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 0.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.2 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.2 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.0 | 2.0 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
0.0 | 0.4 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.4 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.4 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.0 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 0.1 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
0.0 | 0.2 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.0 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 0.1 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.0 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
0.0 | 0.2 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 1.4 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.0 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.0 | 0.1 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.0 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.0 | 0.5 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.0 | 0.1 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.2 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.1 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.0 | 0.0 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 0.1 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.0 | 0.2 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 0.1 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.1 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |