Gene Symbol | Gene ID | Gene Info |
---|---|---|
Rorc
|
ENSMUSG00000028150.8 | Rorc |
Nr1d1
|
ENSMUSG00000020889.11 | Nr1d1 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Nr1d1 | chr11_98776781_98777526 | 1820 | 0.195162 | -0.50 | 4.1e-05 | Click! |
Nr1d1 | chr11_98765566_98766046 | 4620 | 0.110465 | -0.50 | 5.4e-05 | Click! |
Nr1d1 | chr11_98763470_98763621 | 6881 | 0.099833 | -0.40 | 1.6e-03 | Click! |
Nr1d1 | chr11_98766918_98767150 | 3392 | 0.125328 | -0.39 | 2.0e-03 | Click! |
Nr1d1 | chr11_98781831_98782036 | 6600 | 0.100633 | -0.38 | 2.8e-03 | Click! |
Rorc | chr3_94372701_94373986 | 549 | 0.502418 | -0.53 | 1.5e-05 | Click! |
Rorc | chr3_94380258_94380409 | 2817 | 0.093505 | -0.33 | 1.0e-02 | Click! |
Rorc | chr3_94380644_94380795 | 3203 | 0.086920 | -0.31 | 1.4e-02 | Click! |
Rorc | chr3_94377542_94377944 | 227 | 0.664105 | -0.26 | 4.5e-02 | Click! |
Rorc | chr3_94371649_94372335 | 802 | 0.347429 | -0.21 | 1.1e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr8_65617917_65619195 | 5.96 |
Marchf1 |
membrane associated ring-CH-type finger 1 |
31 |
0.99 |
chr15_76519928_76521866 | 5.87 |
Scrt1 |
scratch family zinc finger 1 |
1005 |
0.28 |
chr10_79706079_79708046 | 5.75 |
Bsg |
basigin |
2492 |
0.11 |
chr15_44705107_44706053 | 4.82 |
Sybu |
syntabulin (syntaxin-interacting) |
42208 |
0.15 |
chr2_25264308_25268001 | 4.67 |
Tprn |
taperin |
1410 |
0.14 |
chr12_29535861_29536084 | 4.57 |
Myt1l |
myelin transcription factor 1-like |
750 |
0.55 |
chr12_46813712_46814094 | 4.23 |
Gm48542 |
predicted gene, 48542 |
2395 |
0.29 |
chrX_38575712_38576177 | 4.20 |
Cul4b |
cullin 4B |
239 |
0.93 |
chr1_185456468_185456733 | 3.82 |
Gm2061 |
predicted gene 2061 |
1032 |
0.36 |
chr2_4019025_4019438 | 3.64 |
Frmd4a |
FERM domain containing 4A |
1487 |
0.38 |
chr11_74619550_74620907 | 3.63 |
Ccdc92b |
coiled-coil domain containing 92B |
623 |
0.69 |
chr4_36953759_36954250 | 3.58 |
Gm12371 |
predicted gene 12371 |
1038 |
0.55 |
chr5_26906578_26906945 | 3.41 |
Dpp6 |
dipeptidylpeptidase 6 |
2066 |
0.39 |
chr3_18057185_18057526 | 3.39 |
Bhlhe22 |
basic helix-loop-helix family, member e22 |
3181 |
0.25 |
chr3_88216520_88216671 | 3.34 |
Gm25641 |
predicted gene, 25641 |
899 |
0.24 |
chr13_34076778_34077593 | 3.27 |
Tubb2a |
tubulin, beta 2A class IIA |
822 |
0.45 |
chr11_98750268_98751902 | 3.20 |
Thra |
thyroid hormone receptor alpha |
2501 |
0.15 |
chr1_173365727_173366467 | 3.18 |
Cadm3 |
cell adhesion molecule 3 |
1536 |
0.34 |
chr9_96729464_96730774 | 3.10 |
Zbtb38 |
zinc finger and BTB domain containing 38 |
1083 |
0.47 |
chr6_95123660_95123824 | 3.08 |
Kbtbd8 |
kelch repeat and BTB (POZ) domain containing 8 |
5758 |
0.2 |
chr15_27467790_27468148 | 3.06 |
Ank |
progressive ankylosis |
1292 |
0.39 |
chr10_90578974_90579573 | 3.04 |
Anks1b |
ankyrin repeat and sterile alpha motif domain containing 1B |
2281 |
0.42 |
chr1_115684558_115685809 | 3.03 |
Cntnap5a |
contactin associated protein-like 5A |
427 |
0.58 |
chr14_118049768_118050305 | 2.97 |
Dct |
dopachrome tautomerase |
2149 |
0.31 |
chr17_22080277_22080479 | 2.93 |
Gm7818 |
predicted gene 7818 |
10490 |
0.16 |
chr17_57769126_57770140 | 2.89 |
Cntnap5c |
contactin associated protein-like 5C |
63 |
0.97 |
chr13_28416357_28416717 | 2.87 |
Gm40841 |
predicted gene, 40841 |
3326 |
0.31 |
chr5_139390751_139391547 | 2.76 |
Gpr146 |
G protein-coupled receptor 146 |
1364 |
0.29 |
chr11_54597790_54598295 | 2.74 |
Rapgef6 |
Rap guanine nucleotide exchange factor (GEF) 6 |
1868 |
0.38 |
chr3_76075315_76075943 | 2.72 |
Fstl5 |
follistatin-like 5 |
46 |
0.98 |
chr2_131158943_131159155 | 2.71 |
Gm14232 |
predicted gene 14232 |
488 |
0.55 |
chr8_122286174_122287007 | 2.67 |
Zfpm1 |
zinc finger protein, multitype 1 |
4449 |
0.18 |
chr5_27841594_27842778 | 2.66 |
Htr5a |
5-hydroxytryptamine (serotonin) receptor 5A |
37 |
0.97 |
chr2_136063053_136063406 | 2.66 |
Lamp5 |
lysosomal-associated membrane protein family, member 5 |
3798 |
0.26 |
chr11_31874060_31874636 | 2.63 |
Cpeb4 |
cytoplasmic polyadenylation element binding protein 4 |
1073 |
0.55 |
chr7_79505833_79506958 | 2.63 |
Mir9-3 |
microRNA 9-3 |
1131 |
0.28 |
chr14_117895283_117895843 | 2.61 |
Mir6239 |
microRNA 6239 |
58284 |
0.14 |
chr7_138395337_138395556 | 2.59 |
Tcerg1l |
transcription elongation regulator 1-like |
2282 |
0.37 |
chr8_33747278_33748028 | 2.59 |
Smim18 |
small integral membrane protein 18 |
117 |
0.95 |
chr15_76666348_76670076 | 2.57 |
Foxh1 |
forkhead box H1 |
1590 |
0.15 |
chr14_61139006_61139387 | 2.57 |
Sacs |
sacsin |
705 |
0.73 |
chr6_104492794_104494036 | 2.54 |
Cntn6 |
contactin 6 |
167 |
0.98 |
chr16_77422348_77423278 | 2.54 |
9430053O09Rik |
RIKEN cDNA 9430053O09 gene |
993 |
0.4 |
chr13_51564878_51565340 | 2.53 |
Shc3 |
src homology 2 domain-containing transforming protein C3 |
1975 |
0.38 |
chr11_103102696_103105788 | 2.52 |
Acbd4 |
acyl-Coenzyme A binding domain containing 4 |
463 |
0.7 |
chr1_171388990_171389691 | 2.52 |
Arhgap30 |
Rho GTPase activating protein 30 |
341 |
0.72 |
chr7_126702563_126704731 | 2.52 |
Coro1a |
coronin, actin binding protein 1A |
473 |
0.55 |
chr11_31876894_31877519 | 2.52 |
Cpeb4 |
cytoplasmic polyadenylation element binding protein 4 |
3931 |
0.25 |
chr2_181313043_181314281 | 2.50 |
Stmn3 |
stathmin-like 3 |
838 |
0.42 |
chr8_60980461_60980612 | 2.50 |
Clcn3 |
chloride channel, voltage-sensitive 3 |
2703 |
0.19 |
chr9_75681964_75682559 | 2.48 |
Scg3 |
secretogranin III |
1326 |
0.37 |
chr7_4119233_4120703 | 2.47 |
Ttyh1 |
tweety family member 1 |
214 |
0.7 |
chrX_110811626_110812334 | 2.45 |
Gm44593 |
predicted gene 44593 |
344 |
0.89 |
chr1_120264244_120264518 | 2.45 |
Steap3 |
STEAP family member 3 |
874 |
0.68 |
chr13_105444000_105445296 | 2.42 |
Htr1a |
5-hydroxytryptamine (serotonin) receptor 1A |
1009 |
0.69 |
chr11_98329171_98329487 | 2.41 |
Neurod2 |
neurogenic differentiation 2 |
319 |
0.79 |
chr13_62967411_62968273 | 2.40 |
Aopep |
aminopeptidase O |
2949 |
0.22 |
chr5_65175643_65176386 | 2.37 |
Klhl5 |
kelch-like 5 |
19944 |
0.14 |
chr16_77416103_77416788 | 2.33 |
Gm38071 |
predicted gene, 38071 |
179 |
0.91 |
chr6_91007335_91007667 | 2.33 |
Nup210 |
nucleoporin 210 |
9928 |
0.19 |
chr13_83739310_83740387 | 2.32 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
985 |
0.29 |
chr4_130794177_130795043 | 2.32 |
Sdc3 |
syndecan 3 |
1906 |
0.21 |
chr11_102394791_102396113 | 2.30 |
Rundc3a |
RUN domain containing 3A |
2049 |
0.17 |
chr6_28827182_28827949 | 2.26 |
Lrrc4 |
leucine rich repeat containing 4 |
2780 |
0.27 |
chr1_72285477_72285932 | 2.24 |
Tmem169 |
transmembrane protein 169 |
1309 |
0.28 |
chr2_91026380_91026531 | 2.23 |
Gm13777 |
predicted gene 13777 |
4667 |
0.12 |
chr18_25747291_25747951 | 2.23 |
Celf4 |
CUGBP, Elav-like family member 4 |
5071 |
0.25 |
chr7_79498955_79500626 | 2.22 |
Mir9-3hg |
Mir9-3 host gene |
236 |
0.84 |
chr15_98676159_98677448 | 2.20 |
Rnd1 |
Rho family GTPase 1 |
655 |
0.53 |
chr7_126700976_126702469 | 2.20 |
Coro1a |
coronin, actin binding protein 1A |
373 |
0.64 |
chr6_121129470_121130193 | 2.17 |
Mical3 |
microtubule associated monooxygenase, calponin and LIM domain containing 3 |
1168 |
0.43 |
chr11_34315414_34316667 | 2.15 |
Insyn2b |
inhibitory synaptic factor family member 2B |
1218 |
0.45 |
chr2_66408526_66409644 | 2.15 |
Gm13630 |
predicted gene 13630 |
409 |
0.72 |
chr15_103332641_103334410 | 2.14 |
Zfp385a |
zinc finger protein 385A |
802 |
0.46 |
chr10_103322096_103322247 | 2.13 |
Slc6a15 |
solute carrier family 6 (neurotransmitter transporter), member 15 |
45612 |
0.15 |
chr15_61690376_61690923 | 2.13 |
D030024E09Rik |
RIKEN cDNA D030024E09 gene |
54535 |
0.16 |
chr2_90885104_90886715 | 2.11 |
C1qtnf4 |
C1q and tumor necrosis factor related protein 4 |
49 |
0.95 |
chr12_31711352_31711698 | 2.08 |
Gpr22 |
G protein-coupled receptor 22 |
2401 |
0.25 |
chr1_165641112_165641461 | 2.06 |
Gm18407 |
predicted gene, 18407 |
3402 |
0.15 |
chr16_75446445_75446739 | 2.04 |
Gm49678 |
predicted gene, 49678 |
701 |
0.76 |
chr1_146310264_146310415 | 2.03 |
Gm5263 |
predicted gene 5263 |
110097 |
0.07 |
chr10_5194186_5195038 | 2.03 |
Syne1 |
spectrin repeat containing, nuclear envelope 1 |
95 |
0.98 |
chr6_7690749_7690900 | 2.01 |
Asns |
asparagine synthetase |
1398 |
0.47 |
chr4_46989792_46990047 | 2.01 |
Gabbr2 |
gamma-aminobutyric acid (GABA) B receptor, 2 |
1954 |
0.3 |
chr7_60960862_60961355 | 2.00 |
Gm44643 |
predicted gene 44643 |
277 |
0.94 |
chr2_157916786_157917265 | 1.99 |
Vstm2l |
V-set and transmembrane domain containing 2-like |
2372 |
0.3 |
chr11_69604822_69605957 | 1.96 |
Atp1b2 |
ATPase, Na+/K+ transporting, beta 2 polypeptide |
440 |
0.56 |
chr14_55061871_55064122 | 1.95 |
Gm20687 |
predicted gene 20687 |
7503 |
0.08 |
chr9_121366712_121367559 | 1.95 |
Trak1 |
trafficking protein, kinesin binding 1 |
119 |
0.96 |
chr17_12316596_12317207 | 1.94 |
Map3k4 |
mitogen-activated protein kinase kinase kinase 4 |
1490 |
0.25 |
chr16_77420100_77420782 | 1.94 |
9430053O09Rik |
RIKEN cDNA 9430053O09 gene |
1379 |
0.28 |
chr3_116864507_116864658 | 1.92 |
Frrs1 |
ferric-chelate reductase 1 |
5015 |
0.14 |
chr16_77645925_77646470 | 1.92 |
Mir125b-2 |
microRNA 125b-2 |
76 |
0.58 |
chr11_87754054_87754304 | 1.90 |
Mir142hg |
Mir142 host gene (non-protein coding) |
1398 |
0.21 |
chr4_115133068_115134495 | 1.90 |
Cyp4x1os |
cytochrome P450, family 4, subfamily x, polypeptide 1, opposite strand |
51 |
0.69 |
chr13_109446132_109446505 | 1.90 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
4135 |
0.37 |
chr17_65662234_65662385 | 1.90 |
Gm49867 |
predicted gene, 49867 |
731 |
0.65 |
chr6_80020534_80021026 | 1.90 |
Lrrtm4 |
leucine rich repeat transmembrane neuronal 4 |
1137 |
0.48 |
chr1_25824008_25825247 | 1.89 |
2900002M20Rik |
RIKEN cDNA 2900002M20 gene |
92 |
0.93 |
chr15_92162506_92162673 | 1.88 |
Cntn1 |
contactin 1 |
1232 |
0.61 |
chr13_55327025_55327689 | 1.88 |
Mxd3 |
Max dimerization protein 3 |
1995 |
0.19 |
chr9_96261065_96261240 | 1.87 |
Tfdp2 |
transcription factor Dp 2 |
1867 |
0.31 |
chr11_101667906_101669345 | 1.87 |
Arl4d |
ADP-ribosylation factor-like 4D |
3084 |
0.13 |
chr5_118413360_118413520 | 1.85 |
Gm26455 |
predicted gene, 26455 |
5378 |
0.21 |
chr3_98857590_98858050 | 1.85 |
Hsd3b1 |
hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 1 |
1974 |
0.19 |
chr14_121738741_121739039 | 1.84 |
Dock9 |
dedicator of cytokinesis 9 |
29 |
0.98 |
chr8_123980583_123981049 | 1.84 |
Abcb10 |
ATP-binding cassette, sub-family B (MDR/TAP), member 10 |
2306 |
0.17 |
chr13_6548195_6549063 | 1.82 |
Pitrm1 |
pitrilysin metallepetidase 1 |
394 |
0.86 |
chr8_54957303_54957776 | 1.82 |
Gm45263 |
predicted gene 45263 |
2280 |
0.24 |
chr3_88213113_88214199 | 1.81 |
Gm3764 |
predicted gene 3764 |
829 |
0.3 |
chr1_64115967_64116210 | 1.81 |
Klf7 |
Kruppel-like factor 7 (ubiquitous) |
5394 |
0.21 |
chr18_20666097_20666725 | 1.81 |
Ttr |
transthyretin |
1131 |
0.34 |
chr7_103861611_103861920 | 1.81 |
Hbb-y |
hemoglobin Y, beta-like embryonic chain |
8549 |
0.06 |
chr3_72908244_72908395 | 1.81 |
Sis |
sucrase isomaltase (alpha-glucosidase) |
43390 |
0.18 |
chr3_96181539_96182795 | 1.80 |
Sv2a |
synaptic vesicle glycoprotein 2 a |
1016 |
0.22 |
chr14_79331082_79331560 | 1.80 |
Naa16 |
N(alpha)-acetyltransferase 16, NatA auxiliary subunit |
11876 |
0.16 |
chr6_119328752_119331284 | 1.80 |
Lrtm2 |
leucine-rich repeats and transmembrane domains 2 |
739 |
0.43 |
chr11_16259273_16259424 | 1.80 |
Vstm2a |
V-set and transmembrane domain containing 2A |
1243 |
0.55 |
chr14_55056074_55056891 | 1.79 |
Gm20687 |
predicted gene 20687 |
989 |
0.3 |
chr16_58676691_58676928 | 1.78 |
Cpox |
coproporphyrinogen oxidase |
1030 |
0.42 |
chrX_48520506_48520726 | 1.77 |
Rab33a |
RAB33A, member RAS oncogene family |
1331 |
0.4 |
chr5_115542473_115545179 | 1.77 |
Pxn |
paxillin |
121 |
0.92 |
chrX_108832958_108834260 | 1.77 |
2810403D21Rik |
RIKEN cDNA 2810403D21 gene |
191 |
0.87 |
chr16_91372564_91373972 | 1.77 |
Ifnar2 |
interferon (alpha and beta) receptor 2 |
369 |
0.79 |
chr8_94109674_94109867 | 1.75 |
Bbs2 |
Bardet-Biedl syndrome 2 (human) |
10842 |
0.12 |
chr5_117241784_117242411 | 1.75 |
Taok3 |
TAO kinase 3 |
1637 |
0.3 |
chr7_17073976_17074453 | 1.74 |
Psg16 |
pregnancy specific glycoprotein 16 |
96 |
0.94 |
chr5_96996818_96996969 | 1.73 |
Gm9484 |
predicted gene 9484 |
471 |
0.59 |
chr2_158606690_158608449 | 1.73 |
Gm14204 |
predicted gene 14204 |
3021 |
0.15 |
chr18_79336296_79336940 | 1.73 |
Gm20593 |
predicted gene, 20593 |
11816 |
0.24 |
chr5_36621046_36621447 | 1.73 |
D5Ertd579e |
DNA segment, Chr 5, ERATO Doi 579, expressed |
9 |
0.96 |
chr18_25750468_25751272 | 1.73 |
Celf4 |
CUGBP, Elav-like family member 4 |
1822 |
0.41 |
chr17_5494452_5495422 | 1.72 |
Zdhhc14 |
zinc finger, DHHC domain containing 14 |
2380 |
0.28 |
chr14_55057899_55058210 | 1.71 |
Gm20687 |
predicted gene 20687 |
2561 |
0.12 |
chr8_41054476_41055299 | 1.71 |
Mtus1 |
mitochondrial tumor suppressor 1 |
93 |
0.95 |
chr2_6726303_6726454 | 1.71 |
Celf2 |
CUGBP, Elav-like family member 2 |
4162 |
0.34 |
chr9_110051810_110053856 | 1.71 |
Map4 |
microtubule-associated protein 4 |
781 |
0.54 |
chr13_28415333_28415484 | 1.71 |
Gm40841 |
predicted gene, 40841 |
4455 |
0.28 |
chr8_105801415_105801606 | 1.71 |
Ranbp10 |
RAN binding protein 10 |
25695 |
0.08 |
chr2_152671346_152671679 | 1.71 |
H13 |
histocompatibility 13 |
1978 |
0.18 |
chr13_41018072_41019454 | 1.70 |
Tmem14c |
transmembrane protein 14C |
2471 |
0.18 |
chr7_99271595_99272046 | 1.70 |
Map6 |
microtubule-associated protein 6 |
2688 |
0.18 |
chr8_84934277_84934726 | 1.70 |
Mast1 |
microtubule associated serine/threonine kinase 1 |
2843 |
0.09 |
chr6_45061047_45061269 | 1.68 |
Cntnap2 |
contactin associated protein-like 2 |
1097 |
0.49 |
chr6_87532408_87533256 | 1.67 |
Arhgap25 |
Rho GTPase activating protein 25 |
403 |
0.58 |
chr6_37225814_37226259 | 1.67 |
Dgki |
diacylglycerol kinase, iota |
73601 |
0.12 |
chr3_121201270_121201904 | 1.66 |
Gm5710 |
predicted gene 5710 |
20490 |
0.13 |
chr5_3929547_3929947 | 1.66 |
Akap9 |
A kinase (PRKA) anchor protein (yotiao) 9 |
1473 |
0.38 |
chr14_70625458_70627688 | 1.65 |
Dmtn |
dematin actin binding protein |
418 |
0.75 |
chrX_7638310_7639997 | 1.65 |
Syp |
synaptophysin |
152 |
0.88 |
chr7_128237036_128237253 | 1.65 |
Armc5 |
armadillo repeat containing 5 |
198 |
0.8 |
chr11_102360845_102363484 | 1.65 |
Slc4a1 |
solute carrier family 4 (anion exchanger), member 1 |
1540 |
0.24 |
chr7_78575992_78576673 | 1.64 |
Gm39038 |
predicted gene, 39038 |
1100 |
0.39 |
chr18_56870048_56870991 | 1.64 |
Gm18087 |
predicted gene, 18087 |
45569 |
0.14 |
chr8_70841499_70842327 | 1.64 |
Arrdc2 |
arrestin domain containing 2 |
2193 |
0.13 |
chr6_72100819_72101598 | 1.63 |
Gm29438 |
predicted gene 29438 |
2993 |
0.15 |
chr10_40911432_40911583 | 1.63 |
Wasf1 |
WAS protein family, member 1 |
27680 |
0.17 |
chr11_61959585_61959868 | 1.63 |
Specc1 |
sperm antigen with calponin homology and coiled-coil domains 1 |
2911 |
0.18 |
chr7_103812970_103813121 | 1.62 |
Hbb-bt |
hemoglobin, beta adult t chain |
951 |
0.27 |
chr3_73056547_73057799 | 1.62 |
Slitrk3 |
SLIT and NTRK-like family, member 3 |
230 |
0.93 |
chr19_24990251_24990719 | 1.61 |
Dock8 |
dedicator of cytokinesis 8 |
9049 |
0.18 |
chr1_120116016_120116590 | 1.61 |
Dbi |
diazepam binding inhibitor |
3835 |
0.21 |
chr6_28259638_28259987 | 1.60 |
Zfp800 |
zinc finger protein 800 |
2099 |
0.27 |
chr17_40816402_40816700 | 1.60 |
Rhag |
Rhesus blood group-associated A glycoprotein |
5367 |
0.16 |
chr2_89592453_89592604 | 1.60 |
Olfr1246 |
olfactory receptor 1246 |
598 |
0.59 |
chr3_8509825_8511666 | 1.59 |
Stmn2 |
stathmin-like 2 |
1159 |
0.54 |
chr9_101034989_101035321 | 1.59 |
Pccb |
propionyl Coenzyme A carboxylase, beta polypeptide |
257 |
0.9 |
chr2_170733371_170733888 | 1.59 |
Dok5 |
docking protein 5 |
1822 |
0.45 |
chr5_131303963_131304557 | 1.59 |
Galnt17 |
polypeptide N-acetylgalactosaminyltransferase 17 |
2655 |
0.38 |
chr4_129464555_129464706 | 1.58 |
Bsdc1 |
BSD domain containing 1 |
88 |
0.94 |
chr10_110453550_110454045 | 1.58 |
Nav3 |
neuron navigator 3 |
2407 |
0.34 |
chr5_137569837_137570642 | 1.57 |
Tfr2 |
transferrin receptor 2 |
370 |
0.67 |
chr2_165874541_165875918 | 1.57 |
Zmynd8 |
zinc finger, MYND-type containing 8 |
548 |
0.69 |
chr16_65559722_65559953 | 1.57 |
Chmp2b |
charged multivesicular body protein 2B |
2683 |
0.28 |
chr5_91961572_91961723 | 1.57 |
Thap6 |
THAP domain containing 6 |
742 |
0.4 |
chr10_26950408_26950626 | 1.57 |
Gm48084 |
predicted gene, 48084 |
777 |
0.66 |
chr8_122751484_122752386 | 1.56 |
C230057M02Rik |
RIKEN cDNA C230057M02 gene |
390 |
0.75 |
chr3_8515833_8515984 | 1.56 |
Stmn2 |
stathmin-like 2 |
6322 |
0.23 |
chr5_122950311_122951097 | 1.55 |
Kdm2b |
lysine (K)-specific demethylase 2B |
1286 |
0.34 |
chr9_75073559_75073855 | 1.54 |
Myo5a |
myosin VA |
2107 |
0.25 |
chr19_5713280_5714285 | 1.54 |
Ehbp1l1 |
EH domain binding protein 1-like 1 |
3112 |
0.08 |
chr1_180147625_180147948 | 1.53 |
Gm38331 |
predicted gene, 38331 |
365 |
0.85 |
chr9_56634052_56634463 | 1.53 |
Lingo1 |
leucine rich repeat and Ig domain containing 1 |
1371 |
0.44 |
chr7_46399823_46400899 | 1.53 |
Kcnc1 |
potassium voltage gated channel, Shaw-related subfamily, member 1 |
2713 |
0.23 |
chr11_120015496_120016298 | 1.52 |
Aatk |
apoptosis-associated tyrosine kinase |
975 |
0.25 |
chr12_4253563_4253853 | 1.52 |
Ncoa1 |
nuclear receptor coactivator 1 |
9870 |
0.11 |
chr17_29006834_29007940 | 1.52 |
Stk38 |
serine/threonine kinase 38 |
339 |
0.75 |
chr3_88211471_88212561 | 1.52 |
Gm3764 |
predicted gene 3764 |
2469 |
0.11 |
chr11_74572004_74572226 | 1.52 |
Rap1gap2 |
RAP1 GTPase activating protein 2 |
18009 |
0.18 |
chr5_129005291_129005442 | 1.51 |
Stx2 |
syntaxin 2 |
3057 |
0.26 |
chr13_47101857_47102192 | 1.51 |
Dek |
DEK oncogene (DNA binding) |
3586 |
0.15 |
chr2_22626812_22627730 | 1.51 |
Gad2 |
glutamic acid decarboxylase 2 |
3967 |
0.16 |
chr9_53973496_53973647 | 1.51 |
Elmod1 |
ELMO/CED-12 domain containing 1 |
1494 |
0.44 |
chr16_4414999_4415926 | 1.51 |
Adcy9 |
adenylate cyclase 9 |
4125 |
0.25 |
chr1_172201946_172204322 | 1.50 |
Pea15a |
phosphoprotein enriched in astrocytes 15A |
3319 |
0.13 |
chr13_34127957_34128465 | 1.50 |
Tubb2b |
tubulin, beta 2B class IIB |
2143 |
0.18 |
chr12_28804949_28805160 | 1.49 |
Gm48905 |
predicted gene, 48905 |
5084 |
0.18 |
chr11_115807155_115809217 | 1.49 |
Caskin2 |
CASK-interacting protein 2 |
84 |
0.94 |
chr9_91369028_91370469 | 1.48 |
Zic4 |
zinc finger protein of the cerebellum 4 |
250 |
0.86 |
chr14_64588312_64589438 | 1.48 |
Mir124a-1hg |
Mir124-1 host gene (non-protein coding) |
341 |
0.81 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.4 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
1.0 | 3.0 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
1.0 | 2.9 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.9 | 3.5 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.9 | 2.6 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.7 | 2.1 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.7 | 2.7 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.6 | 1.9 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.6 | 1.9 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.6 | 2.4 | GO:0097461 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.6 | 1.7 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.6 | 5.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.5 | 1.1 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.5 | 3.5 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.5 | 2.4 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.5 | 2.4 | GO:1903273 | regulation of sodium ion export(GO:1903273) regulation of sodium ion export from cell(GO:1903276) |
0.5 | 1.4 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.4 | 1.3 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.4 | 3.8 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.4 | 2.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.4 | 0.4 | GO:0045760 | positive regulation of action potential(GO:0045760) |
0.4 | 2.0 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.4 | 0.4 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
0.4 | 1.5 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.4 | 1.1 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
0.4 | 1.1 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.4 | 1.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.4 | 1.1 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.3 | 1.4 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.3 | 1.7 | GO:0036233 | glycine import(GO:0036233) |
0.3 | 1.0 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.3 | 1.0 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.3 | 1.0 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
0.3 | 1.3 | GO:0048254 | snoRNA localization(GO:0048254) |
0.3 | 1.0 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.3 | 1.0 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.3 | 1.0 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.3 | 1.3 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.3 | 1.6 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.3 | 1.6 | GO:0097113 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.3 | 0.9 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.3 | 0.9 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.3 | 0.9 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.3 | 0.6 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.3 | 1.8 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.3 | 0.9 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.3 | 0.6 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.3 | 1.2 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
0.3 | 0.6 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.3 | 6.0 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.3 | 1.4 | GO:0015816 | glycine transport(GO:0015816) |
0.3 | 1.4 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
0.3 | 0.8 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.3 | 1.9 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.3 | 0.8 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.3 | 1.0 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.3 | 2.0 | GO:0071625 | vocalization behavior(GO:0071625) |
0.2 | 1.5 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.2 | 0.5 | GO:0052203 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.2 | 0.7 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.2 | 1.0 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.2 | 1.0 | GO:0021779 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.2 | 2.4 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.2 | 3.6 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.2 | 0.7 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.2 | 0.2 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
0.2 | 0.7 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
0.2 | 1.2 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.2 | 0.7 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
0.2 | 0.7 | GO:0002442 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) |
0.2 | 0.7 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.2 | 0.7 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.2 | 4.0 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.2 | 0.5 | GO:0046959 | habituation(GO:0046959) |
0.2 | 0.5 | GO:0010915 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
0.2 | 0.5 | GO:0015677 | copper ion import(GO:0015677) |
0.2 | 0.2 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.2 | 1.6 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.2 | 1.1 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
0.2 | 1.1 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.2 | 1.1 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.2 | 1.7 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.2 | 0.9 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.2 | 1.5 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
0.2 | 0.6 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.2 | 1.1 | GO:0098828 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
0.2 | 0.4 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
0.2 | 1.3 | GO:1903961 | positive regulation of anion transmembrane transport(GO:1903961) |
0.2 | 1.3 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
0.2 | 0.9 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.2 | 1.5 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.2 | 0.6 | GO:0009080 | alanine catabolic process(GO:0006524) pyruvate family amino acid catabolic process(GO:0009080) |
0.2 | 1.3 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.2 | 0.6 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.2 | 0.4 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.2 | 0.6 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.2 | 0.6 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.2 | 0.2 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.2 | 4.7 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.2 | 2.0 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.2 | 0.8 | GO:0097286 | iron ion import(GO:0097286) |
0.2 | 0.6 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.2 | 0.6 | GO:0015808 | L-alanine transport(GO:0015808) |
0.2 | 1.0 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.2 | 0.8 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.2 | 0.2 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
0.2 | 0.6 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.2 | 0.4 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.2 | 0.8 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.2 | 0.7 | GO:0008228 | opsonization(GO:0008228) |
0.2 | 0.7 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.2 | 0.4 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.2 | 0.9 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
0.2 | 0.7 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.2 | 0.9 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.2 | 1.1 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.2 | 0.2 | GO:0071047 | nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
0.2 | 1.6 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.2 | 1.6 | GO:0050957 | equilibrioception(GO:0050957) |
0.2 | 1.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.2 | 0.4 | GO:0034091 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
0.2 | 0.7 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.2 | 1.4 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.2 | 0.2 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.2 | 0.7 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.2 | 0.5 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.2 | 1.4 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.2 | 0.7 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.2 | 1.9 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.2 | 0.5 | GO:0032264 | IMP salvage(GO:0032264) |
0.2 | 0.3 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.2 | 0.5 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.2 | 1.0 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.2 | 1.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.2 | 0.3 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.2 | 0.7 | GO:0009158 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
0.2 | 0.8 | GO:0032252 | secretory granule localization(GO:0032252) |
0.2 | 0.3 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.2 | 1.6 | GO:0032986 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.2 | 0.8 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.2 | 0.3 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.2 | 0.5 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
0.2 | 0.5 | GO:1902075 | cellular response to salt(GO:1902075) |
0.2 | 1.1 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
0.2 | 0.8 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.2 | 0.5 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
0.2 | 0.5 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.2 | 5.1 | GO:0007019 | microtubule depolymerization(GO:0007019) |
0.2 | 0.3 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.2 | 0.6 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.2 | 0.8 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.2 | 0.8 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.2 | 0.8 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
0.2 | 0.5 | GO:1903679 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.2 | 1.8 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.2 | 0.3 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.2 | 0.3 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.2 | 0.8 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.2 | 0.6 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.1 | 0.6 | GO:0001905 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
0.1 | 1.0 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.1 | 1.0 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
0.1 | 0.6 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.1 | 0.3 | GO:1901656 | glycoside transport(GO:1901656) |
0.1 | 0.3 | GO:0032415 | regulation of sodium:proton antiporter activity(GO:0032415) |
0.1 | 0.4 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.1 | 0.4 | GO:0030070 | insulin processing(GO:0030070) |
0.1 | 1.2 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.1 | 0.4 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.1 | 0.7 | GO:0018101 | protein citrullination(GO:0018101) |
0.1 | 0.7 | GO:0050812 | regulation of acyl-CoA biosynthetic process(GO:0050812) |
0.1 | 0.9 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.1 | 1.5 | GO:0097354 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
0.1 | 0.9 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.1 | 0.1 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
0.1 | 0.6 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.1 | 0.1 | GO:0046102 | inosine metabolic process(GO:0046102) inosine biosynthetic process(GO:0046103) |
0.1 | 0.6 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.1 | 1.1 | GO:0021670 | lateral ventricle development(GO:0021670) |
0.1 | 0.7 | GO:0009642 | response to light intensity(GO:0009642) |
0.1 | 1.0 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 0.3 | GO:0071922 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.1 | 1.3 | GO:0016322 | neuron remodeling(GO:0016322) |
0.1 | 0.1 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.1 | 0.3 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
0.1 | 0.6 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.1 | 0.7 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.1 | 0.3 | GO:0030035 | microspike assembly(GO:0030035) |
0.1 | 0.4 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.1 | 0.6 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
0.1 | 0.3 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.1 | 0.3 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.1 | 1.4 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.1 | 0.1 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.1 | 0.6 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.1 | 0.6 | GO:0051918 | regulation of fibrinolysis(GO:0051917) negative regulation of fibrinolysis(GO:0051918) |
0.1 | 0.4 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.1 | 1.5 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.1 | 0.7 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.1 | 0.4 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.1 | 0.5 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.1 | 0.4 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.1 | 0.3 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
0.1 | 0.9 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.3 | GO:0061687 | detoxification of copper ion(GO:0010273) detoxification of inorganic compound(GO:0061687) stress response to metal ion(GO:0097501) stress response to copper ion(GO:1990169) |
0.1 | 0.3 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.1 | 0.3 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.1 | 0.3 | GO:0042435 | indole-containing compound biosynthetic process(GO:0042435) |
0.1 | 0.3 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.1 | 0.1 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.1 | 1.7 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.1 | 0.9 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.1 | 2.3 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.1 | 0.8 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.1 | 0.6 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.1 | 0.3 | GO:0051665 | membrane raft localization(GO:0051665) |
0.1 | 0.4 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.1 | 0.4 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.1 | 0.3 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.1 | 0.3 | GO:0051462 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) |
0.1 | 1.1 | GO:0006662 | glycerol ether metabolic process(GO:0006662) |
0.1 | 1.7 | GO:0030889 | negative regulation of B cell proliferation(GO:0030889) |
0.1 | 3.2 | GO:0034605 | cellular response to heat(GO:0034605) |
0.1 | 0.5 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.1 | 0.4 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.1 | 0.4 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.1 | 0.4 | GO:0070836 | caveola assembly(GO:0070836) |
0.1 | 0.2 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.1 | 0.4 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
0.1 | 0.2 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.1 | 0.5 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.1 | 0.6 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.1 | 1.6 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.1 | 0.5 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.1 | 0.6 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.1 | 0.2 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.1 | 0.2 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.1 | 0.2 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.1 | 0.1 | GO:0061341 | non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
0.1 | 0.3 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.1 | 0.5 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.1 | 0.3 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 0.2 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.1 | 0.6 | GO:0097090 | presynaptic membrane organization(GO:0097090) |
0.1 | 0.8 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.1 | 0.2 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.1 | 0.6 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.1 | 0.5 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 0.7 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.1 | 0.8 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.1 | 0.2 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.1 | 0.7 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.1 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.4 | GO:0051126 | negative regulation of actin nucleation(GO:0051126) |
0.1 | 0.3 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.1 | 0.1 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
0.1 | 0.7 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.1 | 0.3 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
0.1 | 0.4 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.1 | 0.5 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.1 | 0.4 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.1 | 0.2 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.1 | 0.1 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
0.1 | 0.1 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
0.1 | 0.3 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.1 | 1.0 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.1 | 1.5 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.1 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.2 | GO:0046618 | drug export(GO:0046618) |
0.1 | 0.4 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
0.1 | 0.4 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.1 | 0.3 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.1 | 0.1 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.1 | 0.3 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.1 | 1.2 | GO:1902400 | signal transduction involved in mitotic G1 DNA damage checkpoint(GO:0072431) intracellular signal transduction involved in G1 DNA damage checkpoint(GO:1902400) |
0.1 | 0.3 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.1 | 0.4 | GO:0034205 | beta-amyloid formation(GO:0034205) |
0.1 | 0.6 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
0.1 | 0.1 | GO:1990123 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.1 | 0.4 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.4 | GO:0001842 | neural fold formation(GO:0001842) |
0.1 | 0.1 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.1 | 0.2 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.1 | 0.3 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.1 | 0.4 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.1 | 0.5 | GO:0050857 | positive regulation of antigen receptor-mediated signaling pathway(GO:0050857) |
0.1 | 0.1 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 0.3 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.1 | 0.7 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
0.1 | 0.2 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
0.1 | 0.9 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.1 | 0.1 | GO:0070459 | prolactin secretion(GO:0070459) |
0.1 | 0.9 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.1 | 0.5 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.1 | 5.5 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 0.2 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.1 | 2.1 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.1 | 0.2 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 0.2 | GO:0070295 | renal water absorption(GO:0070295) |
0.1 | 0.6 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.1 | 0.5 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
0.1 | 0.4 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.1 | 0.7 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.1 | 0.1 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.1 | 0.5 | GO:0031280 | negative regulation of cyclase activity(GO:0031280) |
0.1 | 0.3 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 0.3 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.1 | 0.2 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.1 | 0.2 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.1 | 0.4 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.1 | 0.1 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.1 | 0.3 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.1 | 0.3 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.1 | 0.3 | GO:0051013 | microtubule severing(GO:0051013) |
0.1 | 0.4 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.1 | 0.7 | GO:0047497 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.1 | 0.3 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
0.1 | 0.8 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.1 | 0.6 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.1 | 0.3 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.1 | 0.1 | GO:0010889 | regulation of sequestering of triglyceride(GO:0010889) |
0.1 | 0.3 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.1 | 0.4 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.1 | 0.6 | GO:0051006 | regulation of lipoprotein lipase activity(GO:0051004) positive regulation of lipoprotein lipase activity(GO:0051006) |
0.1 | 1.1 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 0.3 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.1 | 0.6 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.1 | 0.4 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.1 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.1 | 1.0 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.1 | 0.2 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.1 | 0.5 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.1 | 0.1 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) |
0.1 | 0.5 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.1 | 0.4 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.1 | 0.5 | GO:0030432 | peristalsis(GO:0030432) |
0.1 | 0.2 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.1 | 0.5 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.1 | 1.0 | GO:0055069 | zinc ion homeostasis(GO:0055069) |
0.1 | 0.5 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.1 | 0.6 | GO:1904406 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
0.1 | 0.1 | GO:0033122 | negative regulation of purine nucleotide catabolic process(GO:0033122) |
0.1 | 0.6 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.1 | 0.9 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
0.1 | 0.8 | GO:2001223 | negative regulation of neuron migration(GO:2001223) |
0.1 | 3.1 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.1 | 0.4 | GO:0040038 | polar body extrusion after meiotic divisions(GO:0040038) |
0.1 | 1.5 | GO:0060337 | type I interferon signaling pathway(GO:0060337) |
0.1 | 0.4 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.1 | 0.1 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.1 | 0.3 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.1 | 0.7 | GO:0010642 | negative regulation of platelet-derived growth factor receptor signaling pathway(GO:0010642) |
0.1 | 0.3 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.1 | 0.2 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 0.6 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
0.1 | 1.0 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.1 | 0.3 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.2 | GO:0032230 | positive regulation of synaptic transmission, GABAergic(GO:0032230) |
0.1 | 0.4 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.1 | 0.6 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.1 | 0.1 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.1 | 0.3 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.1 | 0.2 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.1 | 0.5 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.1 | 0.3 | GO:0043307 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
0.1 | 0.1 | GO:0032672 | regulation of interleukin-3 production(GO:0032672) |
0.1 | 0.1 | GO:2000286 | regulation of endosome size(GO:0051036) receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.1 | 0.8 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.1 | 0.3 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.1 | 0.3 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.1 | 0.1 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
0.1 | 0.2 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.1 | 1.7 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
0.1 | 1.1 | GO:0006465 | signal peptide processing(GO:0006465) |
0.1 | 0.2 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.1 | 0.5 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
0.1 | 0.2 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 1.7 | GO:0010107 | potassium ion import(GO:0010107) |
0.1 | 0.1 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
0.1 | 0.1 | GO:1902339 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
0.1 | 0.7 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.1 | 0.2 | GO:0035927 | RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) |
0.1 | 0.2 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.1 | 0.1 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.1 | 0.3 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
0.1 | 0.2 | GO:0042117 | monocyte activation(GO:0042117) |
0.1 | 0.6 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.1 | 0.8 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.1 | 0.3 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.1 | 0.5 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.1 | 0.1 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.1 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
0.1 | 0.2 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.1 | 0.2 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.1 | 0.3 | GO:1901836 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) |
0.1 | 0.5 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.1 | 0.3 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
0.1 | 0.9 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.1 | 0.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.3 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.1 | 0.4 | GO:0097066 | response to thyroid hormone(GO:0097066) |
0.1 | 1.2 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
0.1 | 0.6 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
0.1 | 0.3 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.1 | 0.1 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.1 | 0.2 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
0.1 | 0.8 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.1 | 0.6 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
0.1 | 0.6 | GO:0042711 | maternal behavior(GO:0042711) |
0.1 | 0.4 | GO:0032508 | DNA duplex unwinding(GO:0032508) |
0.1 | 0.2 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 0.4 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.4 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.1 | 0.4 | GO:0051189 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.1 | 0.3 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.1 | 0.2 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.1 | 0.1 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
0.1 | 0.1 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.1 | 0.4 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.1 | 0.1 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.1 | 0.1 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.1 | 0.4 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.1 | 0.1 | GO:0015911 | plasma membrane long-chain fatty acid transport(GO:0015911) fatty acid transmembrane transport(GO:1902001) |
0.1 | 0.4 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.1 | 0.2 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.1 | 1.0 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.1 | 0.3 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
0.1 | 1.3 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.1 | 0.2 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.1 | 0.4 | GO:0016266 | O-glycan processing(GO:0016266) |
0.1 | 0.5 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.1 | 0.3 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.1 | 1.4 | GO:1901381 | positive regulation of potassium ion transmembrane transport(GO:1901381) |
0.1 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.1 | 0.3 | GO:0071321 | cellular response to cGMP(GO:0071321) |
0.1 | 0.7 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
0.1 | 0.1 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
0.1 | 0.4 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.1 | 0.4 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.1 | 1.4 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.1 | 0.2 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.1 | 0.4 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
0.1 | 0.9 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.1 | 0.6 | GO:0031639 | plasminogen activation(GO:0031639) |
0.1 | 0.6 | GO:0030812 | negative regulation of nucleotide catabolic process(GO:0030812) negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
0.1 | 0.2 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.1 | 0.6 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.6 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.1 | 0.4 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.1 | 0.3 | GO:0080009 | mRNA methylation(GO:0080009) |
0.1 | 0.3 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.1 | 0.4 | GO:0045176 | apical protein localization(GO:0045176) |
0.1 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.1 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.1 | 0.9 | GO:0010765 | positive regulation of sodium ion transport(GO:0010765) |
0.1 | 0.5 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
0.1 | 0.1 | GO:2001138 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
0.1 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.1 | 0.1 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.1 | 0.7 | GO:0042026 | protein refolding(GO:0042026) |
0.1 | 0.1 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.1 | 0.6 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.1 | 0.8 | GO:0031365 | N-terminal protein amino acid modification(GO:0031365) |
0.1 | 0.1 | GO:0060746 | parental behavior(GO:0060746) |
0.1 | 0.1 | GO:1901626 | regulation of postsynaptic membrane organization(GO:1901626) |
0.1 | 0.7 | GO:0046461 | neutral lipid catabolic process(GO:0046461) acylglycerol catabolic process(GO:0046464) |
0.1 | 1.2 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
0.1 | 0.3 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.1 | 0.1 | GO:0006837 | serotonin transport(GO:0006837) |
0.1 | 1.5 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.1 | 0.1 | GO:0051095 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
0.1 | 0.2 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.1 | 0.3 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.1 | 0.5 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 0.3 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.1 | 0.4 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.1 | 0.3 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.1 | 0.1 | GO:0036215 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.1 | 0.8 | GO:0015727 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.1 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.6 | GO:0014046 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
0.1 | 0.3 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
0.1 | 0.2 | GO:0019532 | oxalate transport(GO:0019532) |
0.1 | 0.7 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.1 | 0.3 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.1 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.1 | 0.4 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.3 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.1 | 0.5 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.1 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.3 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.1 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.1 | 0.3 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.1 | 0.1 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.1 | 0.8 | GO:0006085 | acetyl-CoA biosynthetic process(GO:0006085) |
0.1 | 0.1 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.1 | 1.3 | GO:0006491 | N-glycan processing(GO:0006491) |
0.1 | 0.4 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
0.1 | 0.6 | GO:0031629 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.1 | 0.1 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.1 | 0.2 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
0.1 | 0.2 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.1 | 0.3 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.1 | 0.2 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.1 | 0.2 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.1 | 0.2 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.1 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.1 | 0.4 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.1 | 0.8 | GO:0043113 | receptor clustering(GO:0043113) |
0.1 | 0.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 0.2 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
0.1 | 0.5 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.1 | 0.5 | GO:0032239 | regulation of nucleobase-containing compound transport(GO:0032239) |
0.1 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.1 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.1 | 0.2 | GO:0010359 | regulation of anion channel activity(GO:0010359) |
0.1 | 0.1 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.1 | 0.3 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.1 | 0.7 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
0.1 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
0.1 | 0.2 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.1 | GO:0046929 | negative regulation of neurotransmitter secretion(GO:0046929) |
0.1 | 0.6 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.1 | 0.2 | GO:0046931 | pore complex assembly(GO:0046931) |
0.1 | 0.2 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.1 | 0.1 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.1 | 0.4 | GO:1901881 | positive regulation of protein depolymerization(GO:1901881) |
0.1 | 0.3 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.1 | 0.2 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.1 | 0.2 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.1 | 1.9 | GO:0019933 | cAMP-mediated signaling(GO:0019933) |
0.1 | 0.2 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.1 | 0.1 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.1 | 0.2 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.1 | 1.8 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
0.1 | 0.2 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.1 | 0.8 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.1 | 0.1 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.1 | 0.2 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.1 | 0.1 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.1 | 0.3 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.1 | 0.1 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.1 | 0.1 | GO:0048242 | epinephrine secretion(GO:0048242) |
0.1 | 0.3 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.3 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.1 | 0.3 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.1 | 0.2 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.1 | 0.2 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.1 | 0.5 | GO:0070269 | pyroptosis(GO:0070269) |
0.1 | 0.1 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.1 | 0.1 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
0.1 | 0.1 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.1 | 0.3 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.1 | 0.5 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
0.1 | 0.1 | GO:0002677 | negative regulation of chronic inflammatory response(GO:0002677) |
0.1 | 0.3 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
0.1 | 0.4 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.1 | 0.4 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
0.1 | 0.5 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.1 | 0.1 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.1 | 0.4 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
0.1 | 0.1 | GO:0045914 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.1 | 0.1 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.1 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.1 | 0.9 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.1 | 0.3 | GO:0046653 | tetrahydrofolate metabolic process(GO:0046653) |
0.1 | 0.5 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.1 | 0.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.1 | 0.2 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
0.1 | 0.1 | GO:0072366 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
0.1 | 0.3 | GO:0071265 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.1 | 0.2 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.1 | 0.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.1 | 0.1 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.1 | 0.4 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.1 | 0.3 | GO:0098581 | detection of external biotic stimulus(GO:0098581) |
0.1 | 0.2 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.1 | 0.2 | GO:0051026 | chiasma assembly(GO:0051026) |
0.1 | 0.3 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
0.1 | 0.7 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.1 | 0.4 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.1 | 0.1 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.1 | 0.2 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.1 | 1.5 | GO:0061178 | regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061178) |
0.1 | 0.2 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.1 | 0.1 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.1 | 0.3 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
0.1 | 0.2 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
0.1 | 1.7 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.1 | 0.1 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.1 | 0.3 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.1 | 1.0 | GO:0035249 | synaptic transmission, glutamatergic(GO:0035249) |
0.1 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
0.1 | 0.4 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
0.1 | 0.1 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.1 | 0.3 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.1 | 0.3 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.1 | 1.9 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.1 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
0.1 | 0.2 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
0.1 | 2.6 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
0.1 | 0.4 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.1 | 0.3 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.1 | 0.1 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.1 | 0.3 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 0.5 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.1 | 0.2 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
0.1 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.1 | 0.1 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.1 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.2 | GO:1904707 | regulation of vascular smooth muscle cell proliferation(GO:1904705) positive regulation of vascular smooth muscle cell proliferation(GO:1904707) vascular smooth muscle cell proliferation(GO:1990874) |
0.1 | 0.3 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.1 | 0.2 | GO:0072337 | modified amino acid transport(GO:0072337) |
0.1 | 0.3 | GO:0042168 | heme metabolic process(GO:0042168) |
0.1 | 0.1 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.1 | 0.3 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.1 | 0.1 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.1 | 2.1 | GO:0000086 | G2/M transition of mitotic cell cycle(GO:0000086) |
0.1 | 0.4 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.1 | 0.2 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.1 | 0.7 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.2 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.1 | 1.1 | GO:0006695 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
0.0 | 0.4 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
0.0 | 0.2 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.0 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.0 | 0.3 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.0 | 0.1 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.0 | 0.0 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.0 | 0.0 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.0 | 0.1 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.0 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.0 | 0.1 | GO:0032228 | regulation of synaptic transmission, GABAergic(GO:0032228) |
0.0 | 0.1 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 0.1 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.0 | 0.1 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.0 | 0.2 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.0 | 0.1 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.0 | 0.1 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
0.0 | 0.1 | GO:0051957 | positive regulation of amino acid transport(GO:0051957) |
0.0 | 0.2 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.0 | 0.5 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.3 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.0 | 1.0 | GO:0006284 | base-excision repair(GO:0006284) |
0.0 | 0.1 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.0 | 0.2 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.0 | 0.0 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
0.0 | 0.0 | GO:0060166 | olfactory pit development(GO:0060166) |
0.0 | 0.1 | GO:0006534 | cysteine metabolic process(GO:0006534) |
0.0 | 0.0 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.0 | 0.1 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.0 | 0.1 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.0 | 0.3 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.1 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.0 | 0.2 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.0 | 0.4 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.0 | 0.1 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.0 | 0.1 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.0 | 0.2 | GO:0060123 | regulation of growth hormone secretion(GO:0060123) |
0.0 | 0.1 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.0 | 0.6 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.6 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.1 | GO:0045023 | G0 to G1 transition(GO:0045023) regulation of G0 to G1 transition(GO:0070316) negative regulation of G0 to G1 transition(GO:0070317) |
0.0 | 0.1 | GO:0032095 | regulation of response to food(GO:0032095) |
0.0 | 0.1 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
0.0 | 0.2 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.0 | 0.1 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.0 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.0 | 0.0 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.0 | 0.0 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.0 | 0.3 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
0.0 | 0.2 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.0 | 1.1 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.1 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.0 | 0.2 | GO:0016556 | mRNA modification(GO:0016556) |
0.0 | 0.3 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.0 | 0.1 | GO:0006007 | glucose catabolic process(GO:0006007) |
0.0 | 0.0 | GO:1903899 | positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
0.0 | 1.1 | GO:0006611 | protein export from nucleus(GO:0006611) |
0.0 | 0.3 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
0.0 | 0.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.0 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.0 | 0.3 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
0.0 | 0.2 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.0 | 0.2 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.0 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.1 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.0 | 0.3 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.0 | 0.3 | GO:0006415 | translational termination(GO:0006415) |
0.0 | 0.3 | GO:0038202 | TORC1 signaling(GO:0038202) regulation of TORC1 signaling(GO:1903432) |
0.0 | 0.0 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.0 | 0.0 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.0 | 0.3 | GO:0046686 | response to cadmium ion(GO:0046686) |
0.0 | 0.3 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
0.0 | 0.1 | GO:0051029 | rRNA transport(GO:0051029) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.1 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
0.0 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.1 | GO:0043039 | tRNA aminoacylation(GO:0043039) |
0.0 | 0.1 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.0 | 0.2 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.4 | GO:0007032 | endosome organization(GO:0007032) |
0.0 | 0.1 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 0.3 | GO:0002438 | acute inflammatory response to antigenic stimulus(GO:0002438) |
0.0 | 0.1 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.0 | 0.1 | GO:1904849 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
0.0 | 0.1 | GO:0061010 | gall bladder development(GO:0061010) |
0.0 | 0.1 | GO:0060717 | chorion development(GO:0060717) extraembryonic membrane development(GO:1903867) |
0.0 | 0.2 | GO:0031297 | replication fork processing(GO:0031297) |
0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.1 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.0 | 0.1 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.0 | 0.1 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
0.0 | 0.7 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.5 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.0 | 0.2 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.0 | 0.3 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.0 | 0.7 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.5 | GO:0050858 | negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) |
0.0 | 0.2 | GO:0001787 | natural killer cell proliferation(GO:0001787) |
0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 0.1 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) |
0.0 | 0.1 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
0.0 | 0.1 | GO:0015888 | thiamine transport(GO:0015888) |
0.0 | 0.2 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 0.1 | GO:0044839 | cell cycle G2/M phase transition(GO:0044839) |
0.0 | 0.1 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.0 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 0.2 | GO:0031167 | rRNA methylation(GO:0031167) |
0.0 | 0.1 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.0 | 0.1 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.0 | 0.1 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.0 | 1.5 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.2 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.0 | 0.1 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.0 | 0.1 | GO:0044793 | negative regulation by host of viral process(GO:0044793) negative regulation by host of viral genome replication(GO:0044828) |
0.0 | 0.2 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
0.0 | 0.3 | GO:0042220 | response to cocaine(GO:0042220) |
0.0 | 0.3 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.1 | GO:0032831 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.0 | 0.0 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
0.0 | 0.3 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.1 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
0.0 | 0.2 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
0.0 | 0.2 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.3 | GO:0071354 | cellular response to interleukin-6(GO:0071354) |
0.0 | 0.2 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.0 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.0 | 0.3 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
0.0 | 0.0 | GO:0045991 | carbon catabolite activation of transcription(GO:0045991) |
0.0 | 0.4 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.0 | 0.1 | GO:0097374 | sensory neuron axon guidance(GO:0097374) dorsal root ganglion development(GO:1990791) |
0.0 | 0.2 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.0 | 0.4 | GO:0009409 | response to cold(GO:0009409) |
0.0 | 0.1 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.0 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.0 | 0.1 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.0 | 0.1 | GO:0034086 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
0.0 | 0.1 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.0 | GO:0002765 | immune response-inhibiting signal transduction(GO:0002765) |
0.0 | 0.9 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.3 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.1 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.0 | 0.1 | GO:0014889 | muscle atrophy(GO:0014889) |
0.0 | 0.0 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.0 | 0.2 | GO:0032823 | regulation of natural killer cell differentiation(GO:0032823) |
0.0 | 0.1 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.0 | 0.2 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.0 | 0.0 | GO:1902992 | negative regulation of amyloid precursor protein catabolic process(GO:1902992) |
0.0 | 0.0 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.0 | 0.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.0 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.0 | 0.2 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.0 | 0.1 | GO:0045924 | regulation of female receptivity(GO:0045924) |
0.0 | 0.2 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.1 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
0.0 | 0.1 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.2 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.0 | 0.2 | GO:0043486 | histone exchange(GO:0043486) |
0.0 | 0.5 | GO:2001222 | regulation of neuron migration(GO:2001222) |
0.0 | 0.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.2 | GO:1902803 | regulation of synaptic vesicle transport(GO:1902803) |
0.0 | 0.3 | GO:0001916 | positive regulation of T cell mediated cytotoxicity(GO:0001916) |
0.0 | 0.3 | GO:0071539 | protein localization to centrosome(GO:0071539) |
0.0 | 0.1 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.0 | 0.1 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.0 | 0.1 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
0.0 | 0.1 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
0.0 | 0.3 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.0 | 0.1 | GO:0070944 | neutrophil mediated killing of bacterium(GO:0070944) |
0.0 | 0.1 | GO:0097012 | response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
0.0 | 0.1 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.0 | 0.1 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.0 | 0.2 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.1 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.0 | 0.6 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.0 | 0.1 | GO:0019042 | viral latency(GO:0019042) |
0.0 | 0.1 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.1 | GO:1901724 | positive regulation of cell proliferation involved in kidney development(GO:1901724) |
0.0 | 0.1 | GO:0051177 | meiotic sister chromatid segregation(GO:0045144) meiotic sister chromatid cohesion(GO:0051177) |
0.0 | 0.0 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.0 | 0.3 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.1 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.0 | 0.0 | GO:0007135 | meiosis II(GO:0007135) |
0.0 | 0.1 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.0 | 0.1 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.0 | 0.0 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
0.0 | 0.1 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.0 | 0.1 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.3 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.0 | 0.1 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.0 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.0 | 0.1 | GO:0046130 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.0 | 0.1 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
0.0 | 0.3 | GO:0001893 | maternal placenta development(GO:0001893) |
0.0 | 0.0 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.0 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.0 | 0.1 | GO:0032693 | negative regulation of interleukin-10 production(GO:0032693) |
0.0 | 0.4 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.1 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
0.0 | 0.1 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
0.0 | 0.1 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.3 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.0 | 0.1 | GO:0065005 | protein-lipid complex assembly(GO:0065005) |
0.0 | 0.0 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.0 | 0.8 | GO:0006367 | transcription initiation from RNA polymerase II promoter(GO:0006367) |
0.0 | 0.1 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.0 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.0 | 0.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.0 | 0.1 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.0 | 0.2 | GO:0099565 | chemical synaptic transmission, postsynaptic(GO:0099565) |
0.0 | 0.1 | GO:0065002 | intracellular protein transmembrane transport(GO:0065002) protein transmembrane transport(GO:0071806) |
0.0 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.0 | 0.1 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.1 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.0 | 0.1 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.0 | 0.0 | GO:1901679 | nucleotide transmembrane transport(GO:1901679) |
0.0 | 0.4 | GO:0015804 | neutral amino acid transport(GO:0015804) |
0.0 | 1.0 | GO:0016125 | sterol metabolic process(GO:0016125) |
0.0 | 0.1 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.0 | 0.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.1 | GO:0090383 | phagosome acidification(GO:0090383) |
0.0 | 0.0 | GO:1903358 | regulation of Golgi organization(GO:1903358) |
0.0 | 0.0 | GO:0033029 | regulation of neutrophil apoptotic process(GO:0033029) |
0.0 | 0.0 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.0 | 0.0 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.0 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.1 | GO:0045815 | positive regulation of gene expression, epigenetic(GO:0045815) |
0.0 | 0.0 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.0 | 0.0 | GO:0002863 | positive regulation of inflammatory response to antigenic stimulus(GO:0002863) |
0.0 | 0.0 | GO:0060215 | primitive hemopoiesis(GO:0060215) |
0.0 | 0.1 | GO:0051588 | regulation of neurotransmitter transport(GO:0051588) |
0.0 | 0.9 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.0 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.0 | 0.4 | GO:0072350 | tricarboxylic acid cycle(GO:0006099) citrate metabolic process(GO:0006101) tricarboxylic acid metabolic process(GO:0072350) |
0.0 | 0.0 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.0 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.1 | GO:1900060 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
0.0 | 0.0 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.2 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.1 | GO:0060056 | mammary gland involution(GO:0060056) |
0.0 | 0.0 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 0.2 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
0.0 | 0.0 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.0 | 0.0 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.0 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.0 | 0.0 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.0 | 0.1 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.0 | GO:0060453 | regulation of gastric acid secretion(GO:0060453) |
0.0 | 0.2 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
0.0 | 0.0 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.0 | 0.1 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.0 | 0.1 | GO:0043485 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.0 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.0 | 0.2 | GO:0006541 | glutamine metabolic process(GO:0006541) |
0.0 | 0.0 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.0 | 0.0 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.5 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
0.0 | 0.2 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
0.0 | 0.0 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.0 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.0 | 0.1 | GO:0043267 | negative regulation of potassium ion transport(GO:0043267) |
0.0 | 1.1 | GO:0098792 | xenophagy(GO:0098792) |
0.0 | 0.6 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.0 | 0.0 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.0 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.0 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.0 | 0.1 | GO:0019359 | NAD biosynthetic process(GO:0009435) nicotinamide nucleotide biosynthetic process(GO:0019359) |
0.0 | 0.1 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.0 | 1.0 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.1 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.0 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
0.0 | 0.9 | GO:1903955 | positive regulation of establishment of protein localization to mitochondrion(GO:1903749) positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.0 | 0.2 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.0 | 0.2 | GO:0009303 | rRNA transcription(GO:0009303) |
0.0 | 0.0 | GO:0051176 | positive regulation of sulfur metabolic process(GO:0051176) |
0.0 | 0.0 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) positive regulation of hh target transcription factor activity(GO:0007228) |
0.0 | 0.0 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.0 | 0.3 | GO:0071427 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.0 | 0.0 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.0 | 0.1 | GO:0002084 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.0 | 0.0 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
0.0 | 0.0 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
0.0 | 0.0 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.0 | 0.0 | GO:0000087 | mitotic M phase(GO:0000087) |
0.0 | 0.0 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.0 | GO:0070741 | response to interleukin-6(GO:0070741) |
0.0 | 0.1 | GO:1901533 | negative regulation of hematopoietic progenitor cell differentiation(GO:1901533) |
0.0 | 0.0 | GO:1903232 | melanosome assembly(GO:1903232) |
0.0 | 0.1 | GO:0072662 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
0.0 | 0.1 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.0 | 0.3 | GO:1901992 | positive regulation of mitotic cell cycle phase transition(GO:1901992) |
0.0 | 0.1 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.0 | 0.1 | GO:0006829 | zinc II ion transport(GO:0006829) |
0.0 | 0.2 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.0 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.0 | 0.0 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.0 | 0.2 | GO:0051180 | vitamin transport(GO:0051180) |
0.0 | 0.0 | GO:0031296 | B cell costimulation(GO:0031296) |
0.0 | 0.0 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.0 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.1 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
0.0 | 0.5 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.0 | 0.0 | GO:0030149 | sphingolipid catabolic process(GO:0030149) |
0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.0 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.2 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.0 | 0.1 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.0 | 0.0 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.0 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
0.0 | 0.2 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) |
0.0 | 0.2 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.1 | GO:0032727 | positive regulation of interferon-alpha production(GO:0032727) |
0.0 | 0.0 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
0.0 | 0.1 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.1 | GO:0002548 | monocyte chemotaxis(GO:0002548) |
0.0 | 0.0 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.1 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.0 | 0.0 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.0 | 0.1 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.1 | GO:0030575 | nuclear body organization(GO:0030575) |
0.0 | 0.1 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.0 | 0.1 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) |
0.0 | 0.0 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.0 | 0.0 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.0 | 0.0 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.0 | 0.0 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.1 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
0.0 | 0.0 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.0 | 0.0 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.0 | 0.0 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.0 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.0 | 0.0 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.0 | 0.1 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.0 | 0.0 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.3 | GO:0031123 | RNA 3'-end processing(GO:0031123) |
0.0 | 0.0 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.0 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.0 | 0.1 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.1 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.4 | GO:0007269 | neurotransmitter secretion(GO:0007269) signal release from synapse(GO:0099643) |
0.0 | 0.1 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.0 | 0.0 | GO:0070589 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
0.0 | 0.1 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.0 | 0.0 | GO:0034143 | regulation of toll-like receptor 4 signaling pathway(GO:0034143) |
0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
0.0 | 0.0 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.0 | 0.1 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.0 | 0.2 | GO:0061512 | protein localization to cilium(GO:0061512) |
0.0 | 0.0 | GO:0006562 | proline catabolic process(GO:0006562) |
0.0 | 0.0 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.0 | 0.0 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.0 | 0.0 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.0 | 0.0 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.0 | 0.0 | GO:0016074 | snoRNA metabolic process(GO:0016074) |
0.0 | 0.0 | GO:0098661 | inorganic anion transmembrane transport(GO:0098661) |
0.0 | 0.0 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.0 | 0.0 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.1 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
0.0 | 0.0 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.0 | GO:0070488 | neutrophil aggregation(GO:0070488) |
0.0 | 0.0 | GO:0060214 | endocardium formation(GO:0060214) |
0.0 | 0.0 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.0 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.1 | GO:1990403 | embryonic brain development(GO:1990403) |
0.0 | 0.0 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
0.0 | 0.0 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.0 | 0.0 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.0 | 0.1 | GO:0007549 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.0 | 0.5 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
0.0 | 0.1 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 0.1 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.0 | GO:0009060 | aerobic respiration(GO:0009060) |
0.0 | 0.0 | GO:0072553 | terminal button organization(GO:0072553) |
0.0 | 0.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 0.0 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.0 | 0.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.0 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.0 | 0.0 | GO:0006544 | glycine metabolic process(GO:0006544) |
0.0 | 0.1 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.0 | 0.0 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
0.0 | 0.1 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.0 | GO:1904738 | vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) |
0.0 | 0.0 | GO:1903510 | mucopolysaccharide metabolic process(GO:1903510) |
0.0 | 0.5 | GO:0018149 | peptide cross-linking(GO:0018149) |
0.0 | 0.2 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.0 | 0.0 | GO:0014047 | glutamate secretion(GO:0014047) |
0.0 | 0.2 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
0.0 | 0.0 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.0 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.0 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
0.0 | 0.0 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
0.0 | 0.0 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
0.0 | 0.0 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.2 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.0 | 0.0 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.0 | 0.0 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 4.4 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.6 | 1.9 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.5 | 1.6 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.5 | 3.1 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.5 | 2.5 | GO:0097433 | dense body(GO:0097433) |
0.5 | 2.0 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.4 | 1.6 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.4 | 2.0 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.4 | 1.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.3 | 3.5 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.3 | 1.0 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.3 | 1.7 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.3 | 3.0 | GO:0005883 | neurofilament(GO:0005883) |
0.3 | 1.0 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.3 | 2.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.3 | 2.1 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.3 | 5.6 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.3 | 0.9 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.3 | 0.5 | GO:1990635 | proximal dendrite(GO:1990635) |
0.3 | 0.8 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.3 | 1.5 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.3 | 0.8 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.2 | 3.1 | GO:0001891 | phagocytic cup(GO:0001891) |
0.2 | 0.7 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.2 | 1.8 | GO:0043083 | synaptic cleft(GO:0043083) |
0.2 | 0.7 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.2 | 1.1 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.2 | 1.6 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.2 | 1.3 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.2 | 1.5 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.2 | 0.4 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
0.2 | 1.6 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.2 | 1.0 | GO:0044327 | dendritic spine head(GO:0044327) |
0.2 | 1.9 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.2 | 1.9 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.2 | 1.3 | GO:0032584 | growth cone membrane(GO:0032584) |
0.2 | 0.6 | GO:0031417 | NatC complex(GO:0031417) |
0.2 | 0.6 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.2 | 0.5 | GO:0042583 | chromaffin granule(GO:0042583) |
0.2 | 0.9 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.2 | 1.4 | GO:0043203 | axon hillock(GO:0043203) |
0.2 | 0.7 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.2 | 7.6 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.2 | 0.2 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.2 | 0.7 | GO:1990130 | Iml1 complex(GO:1990130) |
0.2 | 0.5 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.2 | 0.6 | GO:0072687 | meiotic spindle(GO:0072687) |
0.2 | 0.5 | GO:0072534 | perineuronal net(GO:0072534) |
0.2 | 0.9 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.2 | 0.6 | GO:0044308 | axonal spine(GO:0044308) |
0.2 | 0.8 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.1 | 0.6 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 1.7 | GO:0071564 | npBAF complex(GO:0071564) |
0.1 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.1 | 1.9 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.1 | 0.6 | GO:0032021 | NELF complex(GO:0032021) |
0.1 | 0.5 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.1 | 1.4 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 0.4 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.1 | 0.1 | GO:0000974 | Prp19 complex(GO:0000974) |
0.1 | 2.5 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.1 | 0.6 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 0.4 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 1.1 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.5 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.1 | 0.4 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.1 | 0.5 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.1 | 0.1 | GO:0097450 | astrocyte end-foot(GO:0097450) |
0.1 | 1.1 | GO:0031527 | filopodium membrane(GO:0031527) |
0.1 | 0.9 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 1.2 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.1 | 0.2 | GO:0042585 | germinal vesicle(GO:0042585) |
0.1 | 0.3 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 0.9 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 0.3 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.1 | 0.3 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.1 | 0.1 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.1 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.1 | 0.1 | GO:0033270 | paranode region of axon(GO:0033270) |
0.1 | 1.6 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.1 | 0.4 | GO:1990246 | uniplex complex(GO:1990246) |
0.1 | 1.7 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.1 | 0.3 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.1 | 0.5 | GO:0070695 | FHF complex(GO:0070695) |
0.1 | 0.8 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.1 | 10.6 | GO:0072562 | blood microparticle(GO:0072562) |
0.1 | 0.5 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.4 | GO:0035363 | histone locus body(GO:0035363) |
0.1 | 0.6 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.1 | 0.5 | GO:0097449 | astrocyte projection(GO:0097449) |
0.1 | 0.4 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 0.4 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 0.3 | GO:0036396 | MIS complex(GO:0036396) |
0.1 | 0.5 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 2.9 | GO:0005771 | multivesicular body(GO:0005771) |
0.1 | 1.5 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.1 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 0.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 0.6 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 0.2 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.2 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.1 | 0.5 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.1 | 1.0 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 0.8 | GO:0005869 | dynactin complex(GO:0005869) |
0.1 | 0.3 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.7 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.1 | 0.8 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.1 | 0.9 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.1 | 0.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 0.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.1 | 2.2 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.1 | 1.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.1 | 0.4 | GO:0000235 | astral microtubule(GO:0000235) |
0.1 | 0.4 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 0.1 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.1 | 0.8 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 0.7 | GO:0001650 | fibrillar center(GO:0001650) |
0.1 | 3.0 | GO:0043198 | dendritic shaft(GO:0043198) |
0.1 | 0.8 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.1 | 0.3 | GO:0097440 | apical dendrite(GO:0097440) |
0.1 | 0.3 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.1 | 1.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.1 | 1.4 | GO:0000242 | pericentriolar material(GO:0000242) |
0.1 | 0.8 | GO:0043194 | axon initial segment(GO:0043194) |
0.1 | 0.3 | GO:0038201 | TORC2 complex(GO:0031932) TOR complex(GO:0038201) |
0.1 | 0.5 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.6 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.1 | 0.3 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.1 | 0.6 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.1 | 0.5 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.7 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 0.8 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.1 | 0.6 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 1.2 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.1 | 0.5 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 1.0 | GO:0005682 | U5 snRNP(GO:0005682) |
0.1 | 0.3 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 0.4 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.1 | 0.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 4.3 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.1 | 0.2 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 1.6 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.1 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 0.6 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.1 | 0.7 | GO:0090544 | BAF-type complex(GO:0090544) |
0.1 | 0.5 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.1 | 0.2 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.1 | 0.7 | GO:0042599 | lamellar body(GO:0042599) |
0.1 | 0.3 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.8 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.1 | 0.3 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.1 | 0.5 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.1 | 2.8 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.5 | GO:0031931 | TORC1 complex(GO:0031931) |
0.1 | 0.5 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.1 | 6.7 | GO:0030426 | growth cone(GO:0030426) |
0.1 | 2.8 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.1 | 0.4 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.1 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
0.1 | 0.3 | GO:0000805 | X chromosome(GO:0000805) |
0.1 | 0.2 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 0.7 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.1 | 0.7 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.5 | GO:0035859 | Seh1-associated complex(GO:0035859) |
0.1 | 0.3 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.1 | 0.2 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
0.1 | 2.5 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.1 | 0.9 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 0.9 | GO:0097346 | INO80-type complex(GO:0097346) |
0.1 | 0.1 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.1 | 3.5 | GO:0000502 | proteasome complex(GO:0000502) |
0.1 | 0.5 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.1 | 0.6 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 2.9 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.1 | 0.2 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 1.8 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.1 | 1.1 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.1 | 0.2 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.1 | 0.4 | GO:0042382 | paraspeckles(GO:0042382) |
0.1 | 0.5 | GO:0008278 | cohesin complex(GO:0008278) |
0.1 | 0.6 | GO:1990204 | oxidoreductase complex(GO:1990204) |
0.1 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 0.4 | GO:0000801 | central element(GO:0000801) |
0.1 | 0.4 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.1 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.1 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.1 | 0.1 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.1 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.1 | 0.1 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.1 | 1.0 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.1 | 4.0 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.1 | 0.4 | GO:0070461 | SAGA-type complex(GO:0070461) |
0.1 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.0 | 0.3 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.5 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.9 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.1 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.0 | 0.7 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 0.7 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.8 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 2.0 | GO:0005643 | nuclear pore(GO:0005643) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 0.5 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 1.6 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.0 | 0.2 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.0 | 0.5 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.5 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.0 | 0.1 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.6 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.0 | 0.0 | GO:0035838 | growing cell tip(GO:0035838) |
0.0 | 0.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.0 | GO:1990423 | RZZ complex(GO:1990423) |
0.0 | 0.3 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.3 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 1.1 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 0.8 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 1.5 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.2 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.0 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.0 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.1 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.0 | 0.2 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.0 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.1 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.4 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 2.4 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.0 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.0 | 0.5 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 3.4 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.0 | 1.0 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 5.3 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
0.0 | 1.3 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.1 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.1 | GO:0036452 | ESCRT complex(GO:0036452) |
0.0 | 0.3 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.3 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 3.9 | GO:0043209 | myelin sheath(GO:0043209) |
0.0 | 0.2 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 3.7 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.0 | 0.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.0 | 0.8 | GO:0032040 | small-subunit processome(GO:0032040) |
0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 1.6 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.8 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 1.2 | GO:0005770 | late endosome(GO:0005770) |
0.0 | 0.1 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.0 | 0.7 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.4 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 1.4 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 1.0 | GO:0005776 | autophagosome(GO:0005776) |
0.0 | 0.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 1.5 | GO:0016363 | nuclear matrix(GO:0016363) |
0.0 | 1.4 | GO:0005795 | Golgi stack(GO:0005795) |
0.0 | 0.4 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.2 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.4 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.5 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 1.3 | GO:0043679 | axon terminus(GO:0043679) |
0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 0.9 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.2 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.1 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.5 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 1.3 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 0.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 6.6 | GO:0005874 | microtubule(GO:0005874) |
0.0 | 28.3 | GO:0005739 | mitochondrion(GO:0005739) |
0.0 | 0.3 | GO:1990391 | DNA repair complex(GO:1990391) |
0.0 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.4 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.2 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.0 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.1 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.1 | GO:0030894 | replisome(GO:0030894) |
0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 0.1 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
0.0 | 0.2 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.2 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.0 | 0.8 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 2.3 | GO:0005769 | early endosome(GO:0005769) |
0.0 | 0.1 | GO:0030532 | small nuclear ribonucleoprotein complex(GO:0030532) |
0.0 | 0.3 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.0 | 0.0 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.0 | 0.1 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 1.4 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.0 | 1.1 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.2 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
0.0 | 0.1 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.0 | 0.0 | GO:0070820 | tertiary granule(GO:0070820) |
0.0 | 0.2 | GO:0097546 | ciliary base(GO:0097546) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.0 | GO:0030689 | Noc complex(GO:0030689) |
0.0 | 0.4 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.1 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.1 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 2.4 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.2 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.0 | GO:0000243 | commitment complex(GO:0000243) |
0.0 | 1.5 | GO:0005681 | spliceosomal complex(GO:0005681) |
0.0 | 0.4 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.4 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.0 | 0.1 | GO:1903293 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
0.0 | 0.1 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.0 | 0.1 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.7 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 0.1 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.0 | 0.9 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.0 | 2.5 | GO:0005635 | nuclear envelope(GO:0005635) |
0.0 | 0.0 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.1 | GO:0070382 | exocytic vesicle(GO:0070382) |
0.0 | 0.4 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.1 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.1 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.3 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 0.1 | GO:0000803 | sex chromosome(GO:0000803) |
0.0 | 0.1 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.2 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.1 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.0 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.3 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.1 | GO:1902555 | endoribonuclease complex(GO:1902555) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 2.7 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.7 | 3.5 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.7 | 2.7 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.5 | 1.6 | GO:0019961 | interferon binding(GO:0019961) |
0.5 | 3.2 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.5 | 2.0 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.5 | 1.5 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.5 | 2.0 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.5 | 1.9 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.5 | 3.6 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.4 | 1.7 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.4 | 5.0 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.4 | 1.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.4 | 1.8 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.4 | 1.1 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.3 | 5.2 | GO:0005521 | lamin binding(GO:0005521) |
0.3 | 1.0 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.3 | 1.9 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.3 | 2.5 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.3 | 4.4 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.3 | 0.3 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.3 | 5.8 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.3 | 2.3 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.3 | 1.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.3 | 2.9 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.3 | 0.3 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.3 | 0.8 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.3 | 1.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.3 | 1.9 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.3 | 1.6 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.3 | 0.8 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.3 | 1.8 | GO:0016885 | ligase activity, forming carbon-carbon bonds(GO:0016885) |
0.3 | 0.8 | GO:0043176 | amine binding(GO:0043176) |
0.3 | 0.8 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.2 | 0.7 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.2 | 0.5 | GO:0031720 | haptoglobin binding(GO:0031720) |
0.2 | 1.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.2 | 1.0 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.2 | 0.9 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.2 | 0.7 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.2 | 0.5 | GO:0051425 | PTB domain binding(GO:0051425) |
0.2 | 0.7 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.2 | 0.4 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.2 | 0.7 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.2 | 3.7 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.2 | 3.5 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.2 | 0.8 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.2 | 0.6 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.2 | 2.0 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.2 | 1.0 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.2 | 1.2 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.2 | 0.2 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.2 | 0.6 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.2 | 0.6 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.2 | 1.8 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
0.2 | 0.6 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.2 | 0.8 | GO:0032356 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.2 | 1.0 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.2 | 1.0 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.2 | 0.9 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.2 | 0.7 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.2 | 1.5 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.2 | 1.7 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.2 | 1.1 | GO:0004064 | arylesterase activity(GO:0004064) |
0.2 | 1.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.2 | 2.1 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.2 | 0.2 | GO:0034618 | arginine binding(GO:0034618) |
0.2 | 1.2 | GO:0030957 | Tat protein binding(GO:0030957) |
0.2 | 0.9 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.2 | 0.7 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
0.2 | 1.0 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.2 | 0.9 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.2 | 0.5 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.2 | 0.8 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.2 | 3.5 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.2 | 4.0 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.2 | 0.3 | GO:0001031 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.2 | 0.5 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.2 | 0.5 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.2 | 1.5 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.2 | 1.0 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.2 | 0.5 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.2 | 0.8 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.2 | 0.5 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.2 | 1.0 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.2 | 0.9 | GO:0005499 | vitamin D binding(GO:0005499) |
0.2 | 0.9 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.2 | 1.1 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.2 | 0.5 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.2 | 0.5 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.2 | 0.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.2 | 1.7 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.1 | 0.7 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 0.3 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.1 | 0.6 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.1 | 0.7 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.1 | 0.7 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.1 | 0.6 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.1 | 0.9 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.1 | 0.4 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 6.1 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.1 | 0.9 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 0.4 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.1 | 2.6 | GO:0001098 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
0.1 | 3.0 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.1 | 0.4 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 0.8 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 1.4 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.1 | 1.1 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.1 | 2.1 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.1 | 0.8 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.1 | 0.5 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 0.5 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.1 | 0.8 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.1 | 0.4 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.1 | 0.7 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.1 | 2.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 0.5 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.9 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.1 | 0.4 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.1 | 0.4 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.1 | 1.0 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 0.4 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.1 | 0.4 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.1 | 1.2 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.1 | 0.5 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 2.1 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.1 | 0.9 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.1 | 0.5 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 2.1 | GO:0030506 | ankyrin binding(GO:0030506) |
0.1 | 1.0 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.1 | 1.4 | GO:0070628 | proteasome binding(GO:0070628) |
0.1 | 1.1 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.1 | 0.5 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.1 | 0.8 | GO:0018631 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 0.6 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 0.2 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
0.1 | 0.4 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.1 | 0.3 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.1 | 0.8 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 3.4 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.6 | GO:0043559 | insulin binding(GO:0043559) |
0.1 | 0.3 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.1 | 0.3 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.1 | 0.3 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.3 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.1 | 0.3 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.8 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.1 | 0.8 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 0.3 | GO:0050692 | DBD domain binding(GO:0050692) |
0.1 | 0.5 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.1 | 0.8 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 1.1 | GO:0015266 | protein channel activity(GO:0015266) |
0.1 | 0.4 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.7 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.1 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.1 | 0.3 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.1 | 1.0 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 0.4 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.3 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.1 | 0.8 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 0.6 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 1.0 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.1 | 0.3 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.1 | 0.5 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.2 | GO:1990188 | euchromatin binding(GO:1990188) |
0.1 | 0.7 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.1 | 0.4 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.1 | 0.4 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.1 | 0.3 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 0.2 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
0.1 | 0.7 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.1 | 0.3 | GO:0030911 | TPR domain binding(GO:0030911) |
0.1 | 0.5 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 2.0 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.1 | 0.4 | GO:0052796 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.1 | 0.6 | GO:0016595 | glutamate binding(GO:0016595) |
0.1 | 0.5 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.1 | 0.4 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.1 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
0.1 | 0.1 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
0.1 | 0.2 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.1 | 0.3 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.1 | 0.3 | GO:0005148 | prolactin receptor binding(GO:0005148) |
0.1 | 0.8 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.1 | 0.4 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 0.6 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.1 | 0.6 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.1 | 0.3 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 0.1 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.1 | 0.4 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.1 | 2.7 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.1 | 0.4 | GO:0048156 | tau protein binding(GO:0048156) |
0.1 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 1.0 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 1.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.1 | 0.4 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.1 | 0.3 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.1 | 0.1 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
0.1 | 0.3 | GO:0004487 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.1 | 0.3 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.1 | 0.4 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.1 | 0.3 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.1 | 0.8 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 1.9 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
0.1 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.3 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 1.9 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 0.1 | GO:0016429 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
0.1 | 0.2 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.1 | 0.8 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.1 | 0.5 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 0.3 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.1 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.1 | 0.6 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.1 | 0.8 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.1 | 0.3 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.1 | 0.2 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 0.4 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
0.1 | 0.4 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.1 | 0.2 | GO:0032564 | dATP binding(GO:0032564) |
0.1 | 0.3 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.1 | 1.5 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.1 | 0.4 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.1 | 0.4 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.1 | 0.8 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.1 | 0.4 | GO:1990405 | protein antigen binding(GO:1990405) |
0.1 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.5 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.1 | 0.6 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.1 | 0.6 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.1 | 0.2 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.1 | 0.2 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.1 | 0.7 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.1 | 0.3 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.2 | GO:0019862 | IgA binding(GO:0019862) |
0.1 | 0.4 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.3 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.1 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.1 | 0.3 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 4.0 | GO:0051087 | chaperone binding(GO:0051087) |
0.1 | 0.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.1 | 0.3 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.1 | 0.2 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.1 | 0.2 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.1 | 0.1 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.1 | 2.1 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.1 | 0.4 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 0.4 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.1 | 0.2 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.1 | 0.4 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.2 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.1 | 0.3 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 1.5 | GO:0030507 | spectrin binding(GO:0030507) |
0.1 | 0.4 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.1 | 0.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 0.5 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.6 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.1 | 0.7 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.1 | 0.8 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.1 | 0.3 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.1 | 0.3 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.1 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.1 | 0.3 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 0.3 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.1 | 0.4 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.1 | 0.7 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.3 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.1 | 0.3 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.1 | 0.2 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.1 | 0.1 | GO:0035870 | dITP diphosphatase activity(GO:0035870) XTP diphosphatase activity(GO:0036222) |
0.1 | 0.1 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.1 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.1 | 0.2 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.1 | 0.3 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.4 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.1 | 0.1 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.1 | 0.1 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.1 | 0.6 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.1 | 0.3 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 0.3 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.1 | 4.5 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
0.1 | 1.1 | GO:0001848 | complement binding(GO:0001848) |
0.1 | 0.8 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.1 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.1 | 0.9 | GO:0016917 | GABA receptor activity(GO:0016917) |
0.1 | 0.1 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.4 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.1 | 0.2 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 0.1 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.1 | 0.1 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.1 | 0.2 | GO:0030984 | kininogen binding(GO:0030984) |
0.1 | 0.1 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.1 | 0.7 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 0.1 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.1 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.1 | 0.7 | GO:0005221 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
0.1 | 1.3 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.1 | 1.1 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
0.1 | 0.2 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.1 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.1 | 0.5 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.1 | 0.9 | GO:0034876 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
0.1 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.1 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.1 | 0.2 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.1 | 0.4 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.1 | 1.9 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.1 | 0.1 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.1 | 0.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.1 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.1 | 0.5 | GO:0015172 | acidic amino acid transmembrane transporter activity(GO:0015172) |
0.1 | 0.5 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 0.2 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.1 | 0.2 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.1 | 0.5 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.1 | 0.1 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.1 | 0.4 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.1 | 0.7 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.1 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.1 | 0.1 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.1 | 0.2 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 0.3 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 7.8 | GO:0003924 | GTPase activity(GO:0003924) |
0.1 | 0.2 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.1 | 0.2 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.1 | 0.5 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.1 | 0.2 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.1 | 0.5 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 0.9 | GO:0019003 | GDP binding(GO:0019003) |
0.1 | 0.2 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.1 | 0.2 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.1 | 1.1 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.1 | 0.2 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.1 | 0.2 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.1 | 0.2 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.1 | 0.6 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.1 | 0.9 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.2 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.2 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 0.1 | GO:0019863 | IgE binding(GO:0019863) |
0.1 | 10.5 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.1 | 0.6 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.1 | 0.1 | GO:0016414 | O-octanoyltransferase activity(GO:0016414) |
0.1 | 0.4 | GO:0016594 | glycine binding(GO:0016594) |
0.1 | 0.2 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 0.2 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.1 | 1.1 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.1 | 0.2 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.1 | 0.5 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
0.1 | 0.4 | GO:0010857 | calcium-dependent protein kinase activity(GO:0010857) |
0.1 | 0.1 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
0.0 | 1.5 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.0 | 1.6 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
0.0 | 0.1 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.0 | 0.2 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.9 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.4 | GO:0016896 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.0 | 0.3 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.0 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.4 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.0 | 0.7 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.8 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.0 | 0.0 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.0 | 0.0 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
0.0 | 0.1 | GO:0035242 | histone-arginine N-methyltransferase activity(GO:0008469) protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.2 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 6.1 | GO:0003729 | mRNA binding(GO:0003729) |
0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.0 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.0 | 0.2 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.0 | 0.2 | GO:0044682 | GTP cyclohydrolase activity(GO:0003933) N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
0.0 | 0.4 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.2 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.0 | 0.3 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.0 | 1.2 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.2 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.2 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
0.0 | 0.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.2 | GO:0071949 | FAD binding(GO:0071949) |
0.0 | 0.2 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.0 | 0.3 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 1.2 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.4 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 0.2 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) |
0.0 | 1.3 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.2 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.0 | 0.5 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.0 | 0.0 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.0 | 2.4 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.3 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.0 | 0.4 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.0 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.0 | 0.2 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.9 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.8 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.0 | 0.1 | GO:0055102 | lipase inhibitor activity(GO:0055102) |
0.0 | 0.4 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 1.2 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.8 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.2 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.0 | 0.4 | GO:0016830 | carbon-carbon lyase activity(GO:0016830) |
0.0 | 0.1 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.0 | 0.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.1 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.0 | 0.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.0 | 0.4 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.0 | 0.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.2 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.2 | GO:0008066 | glutamate receptor activity(GO:0008066) |
0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.3 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.0 | 0.4 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.8 | GO:0017022 | myosin binding(GO:0017022) |
0.0 | 1.4 | GO:0044823 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.4 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.0 | 0.2 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
0.0 | 0.4 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.3 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.3 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.0 | 1.0 | GO:0030145 | manganese ion binding(GO:0030145) |
0.0 | 0.4 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.4 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.3 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.0 | 0.0 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.0 | 0.8 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.0 | 0.3 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.1 | GO:0050693 | LBD domain binding(GO:0050693) |
0.0 | 1.5 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.4 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.3 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 1.3 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.4 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.2 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.0 | 1.0 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.0 | 0.2 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.2 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.8 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.1 | GO:0015925 | galactosidase activity(GO:0015925) |
0.0 | 0.3 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.0 | 0.2 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.4 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 3.4 | GO:0004386 | helicase activity(GO:0004386) |
0.0 | 0.4 | GO:0032183 | SUMO binding(GO:0032183) |
0.0 | 0.0 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 2.0 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.4 | GO:0010181 | FMN binding(GO:0010181) |
0.0 | 0.3 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.0 | 0.1 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.0 | 2.2 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) carboxyl-O-methyltransferase activity(GO:0010340) protein carboxyl O-methyltransferase activity(GO:0051998) |
0.0 | 0.2 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.2 | GO:0035173 | histone kinase activity(GO:0035173) |
0.0 | 0.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.5 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.4 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.0 | 0.1 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.0 | 0.2 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.0 | 0.1 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.0 | 0.7 | GO:0032947 | protein complex scaffold(GO:0032947) |
0.0 | 0.6 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.1 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.0 | 0.1 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.0 | 0.7 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.0 | 0.1 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.0 | 0.0 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.0 | 0.3 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.3 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 0.3 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.0 | 4.6 | GO:0015631 | tubulin binding(GO:0015631) |
0.0 | 0.1 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 0.2 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.0 | 0.1 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.0 | 1.2 | GO:0004540 | ribonuclease activity(GO:0004540) |
0.0 | 0.4 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.1 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.0 | 2.0 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 0.1 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.1 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.0 | 0.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.0 | 0.1 | GO:0042165 | neurotransmitter binding(GO:0042165) |
0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.4 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
0.0 | 0.8 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
0.0 | 0.1 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 0.2 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.0 | 0.0 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
0.0 | 0.0 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.0 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.1 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.0 | 0.1 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.0 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.1 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.0 | 0.0 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.0 | 0.0 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.0 | 0.0 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.0 | 0.5 | GO:0015928 | fucosidase activity(GO:0015928) |
0.0 | 0.1 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
0.0 | 0.9 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 0.4 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.1 | GO:0031420 | alkali metal ion binding(GO:0031420) |
0.0 | 0.2 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.0 | 0.0 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 2.4 | GO:0005525 | GTP binding(GO:0005525) |
0.0 | 0.2 | GO:0030331 | estrogen receptor binding(GO:0030331) |
0.0 | 0.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.0 | 0.0 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.0 | 0.0 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.0 | 0.2 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.0 | 0.1 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) alpha1-adrenergic receptor activity(GO:0004937) |
0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
0.0 | 0.4 | GO:0043738 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) NADPH:sulfur oxidoreductase activity(GO:0043914) epoxyqueuosine reductase activity(GO:0052693) |
0.0 | 0.4 | GO:0016748 | succinyltransferase activity(GO:0016748) N-succinyltransferase activity(GO:0016749) |
0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.0 | 0.6 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.5 | GO:0070330 | aromatase activity(GO:0070330) |
0.0 | 0.2 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.0 | 0.0 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.0 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.5 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.0 | 0.2 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.5 | GO:0016651 | oxidoreductase activity, acting on NAD(P)H(GO:0016651) |
0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.0 | GO:0019956 | chemokine binding(GO:0019956) |
0.0 | 0.1 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.0 | 0.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.2 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.0 | 0.3 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 0.0 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.0 | 0.1 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.0 | 0.0 | GO:0030580 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
0.0 | 0.8 | GO:0016627 | oxidoreductase activity, acting on the CH-CH group of donors(GO:0016627) |
0.0 | 0.0 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.0 | 0.4 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.0 | 0.0 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.0 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.2 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.0 | 0.0 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.0 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.0 | 0.0 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.1 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.1 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.0 | GO:0000828 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 0.4 | GO:0002039 | p53 binding(GO:0002039) |
0.0 | 0.0 | GO:0016415 | octanoyltransferase activity(GO:0016415) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 1.5 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.2 | GO:0005186 | pheromone activity(GO:0005186) |
0.0 | 0.0 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.0 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.0 | 0.0 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.0 | 0.4 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.1 | GO:0005372 | water transmembrane transporter activity(GO:0005372) |
0.0 | 0.0 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.1 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.0 | 0.2 | GO:0016247 | channel regulator activity(GO:0016247) |
0.0 | 0.2 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.0 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.0 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.1 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.0 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.0 | 0.0 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.0 | 0.3 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.0 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.0 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.0 | 0.2 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.0 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.6 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.3 | 0.8 | PID RHOA PATHWAY | RhoA signaling pathway |
0.2 | 0.2 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.2 | 0.2 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.2 | 0.2 | PID IGF1 PATHWAY | IGF1 pathway |
0.1 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.1 | 1.8 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 1.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 1.7 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 4.0 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.1 | 1.2 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.1 | 2.2 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 1.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 1.7 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.1 | 3.7 | PID LKB1 PATHWAY | LKB1 signaling events |
0.1 | 3.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 1.6 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.1 | 2.7 | PID FOXO PATHWAY | FoxO family signaling |
0.1 | 1.5 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 2.5 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.1 | 0.7 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.1 | 1.1 | PID EPO PATHWAY | EPO signaling pathway |
0.1 | 2.4 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.1 | 2.2 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.1 | 1.0 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 0.6 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.1 | 0.8 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 0.6 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.1 | 0.5 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.1 | 0.3 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 0.8 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.1 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 2.8 | PID NOTCH PATHWAY | Notch signaling pathway |
0.1 | 0.3 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.1 | 0.7 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.1 | 0.5 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.1 | 0.9 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.1 | 0.2 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.1 | 0.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.1 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.1 | 0.9 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.1 | 1.0 | PID INSULIN PATHWAY | Insulin Pathway |
0.1 | 1.0 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.1 | 0.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.3 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 2.1 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.7 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 2.5 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.6 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.7 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.2 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.0 | 0.9 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.0 | 0.4 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.9 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.7 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.5 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.9 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.0 | 0.7 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 1.1 | PID PLK1 PATHWAY | PLK1 signaling events |
0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.2 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.3 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 0.5 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.0 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.6 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.6 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.6 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 2.3 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.4 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.6 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.6 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.8 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.4 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.0 | 0.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.4 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.1 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.1 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.0 | 0.1 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.0 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 2.3 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.0 | PID BARD1 PATHWAY | BARD1 signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 4.4 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.4 | 4.9 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.3 | 4.3 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.3 | 1.3 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.2 | 4.0 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.2 | 3.3 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.2 | 1.3 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.2 | 1.3 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.2 | 1.8 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.2 | 2.3 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.2 | 2.0 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.2 | 0.2 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.2 | 2.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.2 | 1.8 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.2 | 0.5 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.2 | 0.6 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.1 | 0.1 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.1 | 1.8 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.1 | 1.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.1 | 0.5 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.1 | 2.1 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.1 | 1.6 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 1.6 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 4.0 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.1 | 2.8 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.1 | 1.6 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 2.0 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.1 | 0.9 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.1 | 0.6 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.1 | 1.1 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 1.6 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 1.7 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.1 | 1.0 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 1.4 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.1 | 0.7 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 1.8 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 1.5 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.1 | 0.9 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.1 | 1.3 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.1 | 2.9 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.1 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.1 | 0.8 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 0.5 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.1 | 0.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.1 | 0.3 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.1 | 0.2 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
0.1 | 1.2 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 0.2 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
0.1 | 0.9 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.1 | 0.9 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.1 | 1.1 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 1.3 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 2.1 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 0.2 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.1 | 0.7 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.1 | 2.1 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.1 | 2.6 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
0.1 | 0.9 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 0.8 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.1 | 1.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 0.8 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.1 | 5.5 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
0.1 | 1.7 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.1 | 0.7 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.1 | 0.7 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.1 | 3.3 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.1 | 0.8 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.1 | 0.8 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 0.5 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.1 | 1.2 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.1 | 1.0 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.1 | 0.5 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 1.1 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.1 | 0.8 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.1 | 1.2 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 0.5 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.1 | 0.4 | REACTOME MITOTIC G2 G2 M PHASES | Genes involved in Mitotic G2-G2/M phases |
0.1 | 1.2 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.1 | 0.1 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.1 | 0.1 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.1 | 1.1 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.1 | 1.0 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.1 | 2.7 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
0.1 | 0.7 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 0.6 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 0.8 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.1 | 0.1 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.1 | 1.3 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.1 | 0.8 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.1 | 0.7 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.1 | 1.8 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.1 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 0.3 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 3.1 | REACTOME ORC1 REMOVAL FROM CHROMATIN | Genes involved in Orc1 removal from chromatin |
0.1 | 0.7 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.1 | 0.9 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
0.1 | 1.0 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.1 | 0.3 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.1 | 0.3 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 0.4 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 0.4 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
0.1 | 0.5 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.1 | 1.1 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.1 | 3.7 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.5 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
0.0 | 0.8 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.0 | 0.4 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.4 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.5 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.0 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.3 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.0 | 0.4 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 1.9 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.6 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 1.0 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.3 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
0.0 | 1.8 | REACTOME RNA POL II PRE TRANSCRIPTION EVENTS | Genes involved in RNA Polymerase II Pre-transcription Events |
0.0 | 1.0 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.0 | 0.7 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.3 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.0 | 1.7 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 0.1 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.0 | 0.3 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.0 | 0.6 | REACTOME AUTODEGRADATION OF CDH1 BY CDH1 APC C | Genes involved in Autodegradation of Cdh1 by Cdh1:APC/C |
0.0 | 0.6 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 0.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.1 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 0.8 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
0.0 | 1.0 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.5 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.7 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.0 | 0.6 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.0 | 0.9 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 0.4 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.2 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.7 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.5 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.0 | 1.9 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 1.7 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 0.5 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.0 | 1.3 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.2 | REACTOME PROTEIN FOLDING | Genes involved in Protein folding |
0.0 | 0.1 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.1 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.0 | 0.5 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.4 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 0.7 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
0.0 | 0.1 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 0.2 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.0 | 0.0 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 2.7 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 1.1 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.1 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.2 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.1 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.0 | 0.2 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.0 | 0.2 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.0 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 0.3 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.2 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.0 | 0.1 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.9 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
0.0 | 0.0 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
0.0 | 0.2 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
0.0 | 0.0 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.2 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 0.1 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.0 | 0.1 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.2 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.0 | REACTOME OPIOID SIGNALLING | Genes involved in Opioid Signalling |
0.0 | 0.0 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.0 | 0.1 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.0 | 0.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.1 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.7 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.0 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.2 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 1.7 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.0 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
0.0 | 0.0 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 0.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.3 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.1 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.3 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |