| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Rreb1
|
ENSMUSG00000039087.10 | ras responsive element binding protein 1 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr13_37963528_37964564 | Rreb1 | 17030 | 0.172301 | 0.46 | 2.0e-04 | Click! |
| chr13_37853981_37855228 | Rreb1 | 3330 | 0.262394 | 0.41 | 1.0e-03 | Click! |
| chr13_37830934_37831238 | Rreb1 | 3693 | 0.230018 | 0.38 | 2.4e-03 | Click! |
| chr13_37862467_37862729 | Rreb1 | 4664 | 0.238534 | 0.37 | 3.2e-03 | Click! |
| chr13_37965042_37965250 | Rreb1 | 18130 | 0.169159 | 0.37 | 3.3e-03 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr7_142662290_142664788 | 7.89 |
Igf2os |
insulin-like growth factor 2, opposite strand |
1599 |
0.21 |
| chr9_107489458_107490875 | 5.17 |
Cacna2d2 |
calcium channel, voltage-dependent, alpha 2/delta subunit 2 |
15438 |
0.08 |
| chr5_119673827_119675890 | 4.87 |
Tbx3 |
T-box 3 |
587 |
0.67 |
| chr6_99204059_99205669 | 4.78 |
Foxp1 |
forkhead box P1 |
41846 |
0.2 |
| chr14_104460227_104461225 | 4.43 |
D130079A08Rik |
RIKEN cDNA D130079A08 gene |
1390 |
0.4 |
| chr2_33933933_33934335 | 4.22 |
Gm13403 |
predicted gene 13403 |
7979 |
0.22 |
| chr8_57326741_57329467 | 3.80 |
Hand2os1 |
Hand2, opposite strand 1 |
3871 |
0.15 |
| chr8_57320946_57324000 | 3.60 |
Hand2os1 |
Hand2, opposite strand 1 |
1245 |
0.3 |
| chr10_103026340_103027824 | 3.55 |
Alx1 |
ALX homeobox 1 |
1545 |
0.39 |
| chr12_76071969_76072878 | 3.31 |
Syne2 |
spectrin repeat containing, nuclear envelope 2 |
407 |
0.88 |
| chr2_165898423_165899020 | 3.18 |
Zmynd8 |
zinc finger, MYND-type containing 8 |
295 |
0.86 |
| chr5_112848482_112849121 | 3.16 |
Myo18b |
myosin XVIIIb |
22785 |
0.18 |
| chr7_37362184_37363004 | 3.13 |
6720469O03Rik |
RIKEN cDNA 6720469O03 gene |
4036 |
0.29 |
| chr6_136793393_136794589 | 2.94 |
H4f16 |
H4 histone 16 |
10424 |
0.09 |
| chr12_117807954_117808128 | 2.94 |
Cdca7l |
cell division cycle associated 7 like |
3752 |
0.26 |
| chr7_142576116_142576267 | 2.88 |
H19 |
H19, imprinted maternally expressed transcript |
347 |
0.7 |
| chr8_89044579_89046585 | 2.76 |
Sall1 |
spalt like transcription factor 1 |
1420 |
0.48 |
| chr8_67918901_67919290 | 2.71 |
Psd3 |
pleckstrin and Sec7 domain containing 3 |
8163 |
0.25 |
| chr13_55830047_55831334 | 2.70 |
Pitx1 |
paired-like homeodomain transcription factor 1 |
735 |
0.57 |
| chr3_129216664_129219042 | 2.69 |
Pitx2 |
paired-like homeodomain transcription factor 2 |
3578 |
0.2 |
| chr13_53469792_53470715 | 2.68 |
Msx2 |
msh homeobox 2 |
2821 |
0.27 |
| chr9_69669605_69671558 | 2.56 |
Gm47203 |
predicted gene, 47203 |
70827 |
0.09 |
| chr8_57319308_57320679 | 2.56 |
Hand2os1 |
Hand2, opposite strand 1 |
63 |
0.94 |
| chr4_134017045_134017463 | 2.51 |
Gm13061 |
predicted gene 13061 |
893 |
0.36 |
| chr10_103027884_103029519 | 2.51 |
Alx1 |
ALX homeobox 1 |
74 |
0.97 |
| chr5_75148315_75152589 | 2.50 |
Pdgfra |
platelet derived growth factor receptor, alpha polypeptide |
1840 |
0.2 |
| chr8_122549886_122550037 | 2.49 |
Piezo1 |
piezo-type mechanosensitive ion channel component 1 |
1368 |
0.25 |
| chr11_115958540_115958691 | 2.47 |
Sap30bpos |
SAP30 binding protein, opposite strand |
6510 |
0.1 |
| chr8_78054594_78054969 | 2.45 |
Gm29895 |
predicted gene, 29895 |
10771 |
0.25 |
| chr15_59783478_59783809 | 2.44 |
Gm19510 |
predicted gene, 19510 |
11316 |
0.26 |
| chr2_170205245_170206276 | 2.39 |
Zfp217 |
zinc finger protein 217 |
57657 |
0.13 |
| chr8_57324709_57326732 | 2.39 |
Hand2os1 |
Hand2, opposite strand 1 |
1487 |
0.3 |
| chr5_119834833_119836185 | 2.38 |
Tbx5 |
T-box 5 |
646 |
0.68 |
| chr13_23497689_23499269 | 2.37 |
Btn2a2 |
butyrophilin, subfamily 2, member A2 |
9622 |
0.06 |
| chr4_46040988_46042013 | 2.36 |
Tmod1 |
tropomodulin 1 |
2291 |
0.3 |
| chr10_77164464_77164999 | 2.33 |
Col18a1 |
collagen, type XVIII, alpha 1 |
1817 |
0.35 |
| chr13_60479224_60481361 | 2.32 |
Gm48500 |
predicted gene, 48500 |
1006 |
0.51 |
| chr10_99267189_99269284 | 2.29 |
Gm48089 |
predicted gene, 48089 |
340 |
0.78 |
| chr9_58859032_58860034 | 2.29 |
Neo1 |
neogenin |
34401 |
0.17 |
| chr2_92140355_92141595 | 2.27 |
Phf21a |
PHD finger protein 21A |
43131 |
0.11 |
| chr12_117657998_117660727 | 2.25 |
Rapgef5 |
Rap guanine nucleotide exchange factor (GEF) 5 |
1328 |
0.51 |
| chr3_87947557_87949450 | 2.24 |
Crabp2 |
cellular retinoic acid binding protein II |
163 |
0.9 |
| chr19_55749292_55750940 | 2.21 |
Tcf7l2 |
transcription factor 7 like 2, T cell specific, HMG box |
7271 |
0.3 |
| chr13_104937937_104938327 | 2.20 |
Gm4938 |
predicted pseudogene 4938 |
19352 |
0.22 |
| chr1_173349801_173351053 | 2.13 |
Aim2 |
absent in melanoma 2 |
452 |
0.78 |
| chr8_57333046_57334560 | 2.12 |
Gm34030 |
predicted gene, 34030 |
584 |
0.59 |
| chr19_46623097_46624579 | 2.10 |
Wbp1l |
WW domain binding protein 1 like |
437 |
0.77 |
| chr3_57912102_57912755 | 2.09 |
Gm24531 |
predicted gene, 24531 |
9759 |
0.16 |
| chr4_46400544_46400900 | 2.09 |
Hemgn |
hemogen |
3514 |
0.16 |
| chr13_109632540_109633637 | 2.07 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
308 |
0.95 |
| chr2_84936571_84938205 | 2.07 |
Slc43a3 |
solute carrier family 43, member 3 |
498 |
0.71 |
| chr8_57312048_57313282 | 2.06 |
Hand2os1 |
Hand2, opposite strand 1 |
1018 |
0.44 |
| chr11_12035779_12037364 | 2.06 |
Grb10 |
growth factor receptor bound protein 10 |
830 |
0.66 |
| chr13_93673507_93674677 | 2.05 |
Bhmt2 |
betaine-homocysteine methyltransferase 2 |
210 |
0.64 |
| chr18_60646910_60648302 | 2.04 |
Synpo |
synaptopodin |
666 |
0.69 |
| chr4_148827269_148827420 | 2.04 |
Casz1 |
castor zinc finger 1 |
22879 |
0.19 |
| chr3_9334054_9335134 | 2.02 |
C030034L19Rik |
RIKEN cDNA C030034L19 gene |
68470 |
0.11 |
| chr9_118453918_118454082 | 2.01 |
Gm22479 |
predicted gene, 22479 |
13064 |
0.13 |
| chr7_73593895_73594236 | 2.00 |
Gm44734 |
predicted gene 44734 |
14883 |
0.1 |
| chr18_11049995_11051717 | 2.00 |
Gata6os |
GATA binding protein 6, opposite strand |
631 |
0.64 |
| chr10_94520068_94521446 | 2.00 |
Tmcc3 |
transmembrane and coiled coil domains 3 |
5900 |
0.23 |
| chr5_119838900_119840891 | 2.00 |
Tbx5 |
T-box 5 |
3740 |
0.21 |
| chr1_155040133_155041196 | 1.98 |
Gm29441 |
predicted gene 29441 |
8925 |
0.18 |
| chr9_22136919_22137172 | 1.95 |
Acp5 |
acid phosphatase 5, tartrate resistant |
1334 |
0.21 |
| chr3_66977838_66980287 | 1.94 |
Shox2 |
short stature homeobox 2 |
251 |
0.9 |
| chr14_48673191_48674687 | 1.94 |
Gm49154 |
predicted gene, 49154 |
40 |
0.51 |
| chrX_50842048_50842328 | 1.94 |
Stk26 |
serine/threonine kinase 26 |
747 |
0.77 |
| chr5_114560343_114561115 | 1.92 |
Fam222a |
family with sequence similarity 222, member A |
7287 |
0.17 |
| chr8_34066189_34066557 | 1.91 |
Gm9951 |
predicted gene 9951 |
11751 |
0.13 |
| chr10_45470864_45471317 | 1.90 |
Lin28b |
lin-28 homolog B (C. elegans) |
889 |
0.65 |
| chr15_97377116_97377727 | 1.87 |
Pced1b |
PC-esterase domain containing 1B |
16204 |
0.24 |
| chr11_88194059_88194740 | 1.86 |
Cuedc1 |
CUE domain containing 1 |
6578 |
0.18 |
| chr18_76542366_76542546 | 1.83 |
Gm31933 |
predicted gene, 31933 |
90414 |
0.09 |
| chr3_129220683_129222367 | 1.83 |
Gm43697 |
predicted gene 43697 |
4003 |
0.19 |
| chr12_73040538_73040689 | 1.82 |
Six1 |
sine oculis-related homeobox 1 |
2202 |
0.32 |
| chr7_36076544_36076695 | 1.82 |
Gm38991 |
predicted gene, 38991 |
20759 |
0.22 |
| chr9_37139362_37140199 | 1.80 |
Gm48717 |
predicted gene, 48717 |
156 |
0.92 |
| chr15_97991756_97991926 | 1.80 |
Col2a1 |
collagen, type II, alpha 1 |
1365 |
0.39 |
| chr14_69767927_69768467 | 1.80 |
Tnfrsf10b |
tumor necrosis factor receptor superfamily, member 10b |
712 |
0.58 |
| chr8_127126234_127126533 | 1.79 |
Pard3 |
par-3 family cell polarity regulator |
45021 |
0.15 |
| chr5_137485098_137486372 | 1.77 |
Epo |
erythropoietin |
81 |
0.93 |
| chr8_91797750_91798716 | 1.75 |
Irx3os |
iroquois homeobox 3, opposite strand |
2182 |
0.23 |
| chr2_77169306_77170885 | 1.75 |
Ccdc141 |
coiled-coil domain containing 141 |
481 |
0.83 |
| chr15_83165497_83165757 | 1.73 |
Cyb5r3 |
cytochrome b5 reductase 3 |
4550 |
0.12 |
| chr18_35868733_35868887 | 1.72 |
Gm41693 |
predicted gene, 41693 |
5504 |
0.11 |
| chr3_89271530_89271769 | 1.72 |
Slc50a1 |
solute carrier family 50 (sugar transporter), member 1 |
1079 |
0.24 |
| chr8_85379656_85380136 | 1.71 |
Mylk3 |
myosin light chain kinase 3 |
1082 |
0.42 |
| chr2_23234361_23235115 | 1.71 |
Gm13422 |
predicted gene 13422 |
498 |
0.77 |
| chr9_32542191_32543480 | 1.70 |
Fli1 |
Friend leukemia integration 1 |
26 |
0.96 |
| chr2_105611829_105612704 | 1.70 |
Paupar |
Pax6 upstream antisense RNA |
49077 |
0.11 |
| chr9_115205629_115206070 | 1.70 |
Gm27002 |
predicted gene, 27002 |
5451 |
0.18 |
| chr4_117391533_117392402 | 1.69 |
Rnf220 |
ring finger protein 220 |
16510 |
0.16 |
| chr11_95338701_95339435 | 1.69 |
Fam117a |
family with sequence similarity 117, member A |
863 |
0.43 |
| chr19_45675708_45677086 | 1.69 |
Fbxw4 |
F-box and WD-40 domain protein 4 |
16085 |
0.17 |
| chr3_101599794_101602594 | 1.69 |
Atp1a1 |
ATPase, Na+/K+ transporting, alpha 1 polypeptide |
3490 |
0.21 |
| chr7_104218726_104219812 | 1.69 |
Trim6 |
tripartite motif-containing 6 |
160 |
0.87 |
| chr8_84912623_84913887 | 1.68 |
Dnase2a |
deoxyribonuclease II alpha |
136 |
0.88 |
| chr6_38342777_38343261 | 1.68 |
Zc3hav1 |
zinc finger CCCH type, antiviral 1 |
11254 |
0.13 |
| chr3_83767702_83768200 | 1.68 |
Sfrp2 |
secreted frizzled-related protein 2 |
1098 |
0.49 |
| chr5_139598854_139600619 | 1.68 |
Uncx |
UNC homeobox |
55838 |
0.1 |
| chr2_167563437_167563946 | 1.67 |
Gm11476 |
predicted gene 11476 |
10377 |
0.12 |
| chr17_85683384_85684714 | 1.67 |
Six2 |
sine oculis-related homeobox 2 |
4205 |
0.2 |
| chr17_80009904_80010181 | 1.66 |
Gm22215 |
predicted gene, 22215 |
23472 |
0.13 |
| chr2_71540308_71541815 | 1.66 |
Dlx1as |
distal-less homeobox 1, antisense |
3170 |
0.18 |
| chr6_127252585_127252736 | 1.66 |
Gm43635 |
predicted gene 43635 |
1984 |
0.23 |
| chr2_157974620_157975884 | 1.65 |
Tti1 |
TELO2 interacting protein 1 |
31960 |
0.14 |
| chr4_138464448_138465030 | 1.64 |
Camk2n1 |
calcium/calmodulin-dependent protein kinase II inhibitor 1 |
10425 |
0.15 |
| chr13_89540278_89541317 | 1.64 |
Hapln1 |
hyaluronan and proteoglycan link protein 1 |
1001 |
0.64 |
| chr16_21908261_21909020 | 1.64 |
Gm6467 |
predicted gene 6467 |
12134 |
0.14 |
| chr11_88148528_88149368 | 1.64 |
Cuedc1 |
CUE domain containing 1 |
13313 |
0.17 |
| chr3_129215238_129216443 | 1.63 |
Pitx2 |
paired-like homeodomain transcription factor 2 |
1565 |
0.34 |
| chr18_82901868_82903196 | 1.63 |
Gm30889 |
predicted gene, 30889 |
454 |
0.78 |
| chr11_85833052_85833662 | 1.63 |
Tbx2 |
T-box 2 |
806 |
0.42 |
| chr5_16554458_16555360 | 1.62 |
Hgf |
hepatocyte growth factor |
981 |
0.56 |
| chr3_68453283_68453673 | 1.62 |
Schip1 |
schwannomin interacting protein 1 |
14705 |
0.22 |
| chr8_109352498_109353726 | 1.62 |
Gm1943 |
predicted gene 1943 |
12248 |
0.24 |
| chr5_108693538_108693789 | 1.62 |
Fgfrl1 |
fibroblast growth factor receptor-like 1 |
567 |
0.62 |
| chr7_89903398_89904159 | 1.61 |
Ccdc81 |
coiled-coil domain containing 81 |
149 |
0.95 |
| chr3_95902362_95903088 | 1.61 |
Car14 |
carbonic anhydrase 14 |
1023 |
0.3 |
| chr3_121891181_121891529 | 1.60 |
Gm42593 |
predicted gene 42593 |
28513 |
0.14 |
| chr13_47855217_47856285 | 1.60 |
G630093K05Rik |
RIKEN cDNA G630093K05 gene |
54684 |
0.16 |
| chr11_104661292_104661443 | 1.60 |
Gm11662 |
predicted gene 11662 |
19288 |
0.14 |
| chr3_102023105_102024131 | 1.58 |
Nhlh2 |
nescient helix loop helix 2 |
13463 |
0.17 |
| chr5_38509275_38509426 | 1.58 |
Gm15796 |
predicted gene 15796 |
1887 |
0.28 |
| chr11_117636399_117636798 | 1.57 |
Tnrc6c |
trinucleotide repeat containing 6C |
17691 |
0.16 |
| chrX_11826754_11827365 | 1.57 |
Gm26314 |
predicted gene, 26314 |
23425 |
0.2 |
| chr17_9905595_9906679 | 1.57 |
Gm34799 |
predicted gene, 34799 |
23630 |
0.17 |
| chr1_163307589_163308193 | 1.57 |
Gm37644 |
predicted gene, 37644 |
1176 |
0.46 |
| chr7_142658126_142659753 | 1.56 |
Igf2 |
insulin-like growth factor 2 |
550 |
0.47 |
| chr7_19575805_19575956 | 1.56 |
Zfp296 |
zinc finger protein 296 |
1407 |
0.2 |
| chr5_143357159_143357434 | 1.56 |
Grid2ip |
glutamate receptor, ionotropic, delta 2 (Grid2) interacting protein 1 |
42 |
0.94 |
| chr19_25505518_25507191 | 1.55 |
Dmrt1 |
doublesex and mab-3 related transcription factor 1 |
647 |
0.72 |
| chr2_33713186_33713886 | 1.54 |
9430024E24Rik |
RIKEN cDNA 9430024E24 gene |
5363 |
0.21 |
| chr11_99131599_99132803 | 1.54 |
Ccr7 |
chemokine (C-C motif) receptor 7 |
22876 |
0.13 |
| chr16_90400997_90401824 | 1.53 |
Hunk |
hormonally upregulated Neu-associated kinase |
866 |
0.58 |
| chr10_122911891_122912439 | 1.53 |
Ppm1h |
protein phosphatase 1H (PP2C domain containing) |
16797 |
0.2 |
| chr6_137142437_137143268 | 1.53 |
Rerg |
RAS-like, estrogen-regulated, growth-inhibitor |
2789 |
0.27 |
| chr17_23532918_23534265 | 1.53 |
6330415G19Rik |
RIKEN cDNA 6330415G19 gene |
17208 |
0.08 |
| chr10_127608155_127608306 | 1.52 |
Gm16217 |
predicted gene 16217 |
11682 |
0.09 |
| chr4_139993241_139993762 | 1.52 |
Klhdc7a |
kelch domain containing 7A |
25475 |
0.15 |
| chr2_14823792_14824714 | 1.51 |
Cacnb2 |
calcium channel, voltage-dependent, beta 2 subunit |
161 |
0.94 |
| chr16_90400287_90400987 | 1.51 |
Hunk |
hormonally upregulated Neu-associated kinase |
93 |
0.97 |
| chr8_4656570_4656923 | 1.51 |
Gm45224 |
predicted gene 45224 |
4682 |
0.13 |
| chr14_121608190_121608680 | 1.51 |
Dock9 |
dedicator of cytokinesis 9 |
3191 |
0.31 |
| chr4_117495860_117497157 | 1.51 |
Gm12827 |
predicted gene 12827 |
56 |
0.87 |
| chr10_120571176_120571626 | 1.51 |
Gm24298 |
predicted gene, 24298 |
34136 |
0.15 |
| chr12_86891509_86893562 | 1.50 |
Irf2bpl |
interferon regulatory factor 2 binding protein-like |
7737 |
0.19 |
| chr6_51173127_51174365 | 1.50 |
Mir148a |
microRNA 148a |
96164 |
0.07 |
| chr13_55827549_55829422 | 1.50 |
Gm47071 |
predicted gene, 47071 |
2235 |
0.21 |
| chr2_163278325_163278476 | 1.50 |
Tox2 |
TOX high mobility group box family member 2 |
41978 |
0.14 |
| chr7_103843867_103844018 | 1.49 |
Hbb-bh1 |
hemoglobin Z, beta-like embryonic chain |
778 |
0.32 |
| chr15_25441215_25441774 | 1.49 |
Gm48956 |
predicted gene, 48956 |
4146 |
0.19 |
| chr7_49522042_49523415 | 1.48 |
Nav2 |
neuron navigator 2 |
25464 |
0.21 |
| chr15_85615061_85615935 | 1.47 |
Gm49539 |
predicted gene, 49539 |
30585 |
0.12 |
| chr5_119830922_119832010 | 1.47 |
Gm43050 |
predicted gene 43050 |
325 |
0.82 |
| chrX_143825863_143827628 | 1.46 |
Capn6 |
calpain 6 |
587 |
0.46 |
| chr8_121474285_121475202 | 1.46 |
Gm26784 |
predicted gene, 26784 |
39763 |
0.11 |
| chr4_148921954_148922804 | 1.46 |
Gm15969 |
predicted gene 15969 |
8055 |
0.16 |
| chr6_88897108_88897259 | 1.46 |
Mcm2 |
minichromosome maintenance complex component 2 |
1494 |
0.26 |
| chr10_75882493_75882971 | 1.45 |
Gm47744 |
predicted gene, 47744 |
7301 |
0.09 |
| chr4_134011308_134012458 | 1.45 |
Lin28a |
lin-28 homolog A (C. elegans) |
503 |
0.68 |
| chr7_142576289_142578620 | 1.44 |
H19 |
H19, imprinted maternally expressed transcript |
68 |
0.78 |
| chr2_142290444_142290595 | 1.44 |
Macrod2 |
mono-ADP ribosylhydrolase 2 |
113912 |
0.07 |
| chr12_103336858_103338251 | 1.43 |
Gm15523 |
predicted gene 15523 |
648 |
0.43 |
| chrX_53052299_53053294 | 1.43 |
Gm28730 |
predicted gene 28730 |
181 |
0.73 |
| chr10_91167204_91167409 | 1.42 |
Tmpo |
thymopoietin |
3156 |
0.22 |
| chr7_25379357_25380698 | 1.42 |
4732471J01Rik |
RIKEN cDNA 4732471J01 gene |
3204 |
0.12 |
| chr1_132366786_132367836 | 1.41 |
Tmcc2 |
transmembrane and coiled-coil domains 2 |
239 |
0.89 |
| chr6_84009566_84010358 | 1.41 |
Dysf |
dysferlin |
1047 |
0.39 |
| chr1_185488803_185489318 | 1.41 |
5033404E19Rik |
RIKEN cDNA 5033404E19 gene |
1766 |
0.3 |
| chr11_77867603_77867873 | 1.41 |
Myo18a |
myosin XVIIIA |
10259 |
0.14 |
| chr4_108580942_108581278 | 1.41 |
Orc1 |
origin recognition complex, subunit 1 |
1656 |
0.2 |
| chr14_105920285_105921709 | 1.41 |
Spry2 |
sprouty RTK signaling antagonist 2 |
24178 |
0.21 |
| chr1_120269879_120270612 | 1.41 |
Steap3 |
STEAP family member 3 |
178 |
0.96 |
| chr15_80930071_80930641 | 1.41 |
Tnrc6b |
trinucleotide repeat containing 6b |
7292 |
0.14 |
| chr11_98776781_98777526 | 1.41 |
Nr1d1 |
nuclear receptor subfamily 1, group D, member 1 |
1820 |
0.2 |
| chr10_99284362_99285186 | 1.40 |
Gm48089 |
predicted gene, 48089 |
9978 |
0.12 |
| chr5_118478022_118478999 | 1.40 |
Gm15754 |
predicted gene 15754 |
8457 |
0.2 |
| chrX_124251402_124251557 | 1.40 |
Rps12-ps6 |
ribosomal protein S12, pseudogene 6 |
98644 |
0.07 |
| chr14_57115728_57116565 | 1.40 |
Gm4491 |
predicted gene 4491 |
263 |
0.89 |
| chr11_112839962_112840747 | 1.40 |
4933434M16Rik |
RIKEN cDNA 4933434M16 gene |
15175 |
0.21 |
| chr5_118465416_118466436 | 1.40 |
Gm15754 |
predicted gene 15754 |
21041 |
0.17 |
| chr9_90125982_90127078 | 1.40 |
Tmem41b-ps |
transmembrane protein 41B, pseudogene |
7593 |
0.15 |
| chr8_3568500_3569092 | 1.39 |
Rps23rg1 |
ribosomal protein S23, retrogene 1 |
798 |
0.43 |
| chr12_72944998_72946304 | 1.39 |
Gm26709 |
predicted gene, 26709 |
156 |
0.94 |
| chr6_72233456_72234176 | 1.39 |
Atoh8 |
atonal bHLH transcription factor 8 |
721 |
0.64 |
| chr1_34076942_34077712 | 1.39 |
Dst |
dystonin |
100 |
0.97 |
| chr19_23152215_23152476 | 1.39 |
Mir1192 |
microRNA 1192 |
2914 |
0.22 |
| chr18_50054342_50055177 | 1.38 |
C030005K06Rik |
RIKEN cDNA C030005K06 gene |
915 |
0.5 |
| chr11_96899744_96900045 | 1.37 |
Cdk5rap3 |
CDK5 regulatory subunit associated protein 3 |
8864 |
0.09 |
| chr6_52259871_52261414 | 1.37 |
Hoxa13 |
homeobox A13 |
160 |
0.84 |
| chr15_102270519_102271755 | 1.36 |
Gm9918 |
predicted gene 9918 |
574 |
0.55 |
| chr19_42936859_42937183 | 1.36 |
Hps1 |
HPS1, biogenesis of lysosomal organelles complex 3 subunit 1 |
157043 |
0.03 |
| chr5_143731445_143732218 | 1.36 |
Usp42 |
ubiquitin specific peptidase 42 |
449 |
0.8 |
| chr10_93294354_93295420 | 1.36 |
Elk3 |
ELK3, member of ETS oncogene family |
15924 |
0.16 |
| chr2_155793141_155793548 | 1.34 |
Mmp24 |
matrix metallopeptidase 24 |
13680 |
0.1 |
| chr19_21785153_21785677 | 1.34 |
Cemip2 |
cell migration inducing hyaluronidase 2 |
7027 |
0.22 |
| chr11_57832440_57833181 | 1.34 |
Hand1 |
heart and neural crest derivatives expressed 1 |
8 |
0.97 |
| chr4_46370834_46371670 | 1.34 |
Trmo |
tRNA methyltransferase O |
18166 |
0.11 |
| chr19_25575234_25575953 | 1.33 |
Dmrt3 |
doublesex and mab-3 related transcription factor 3 |
34708 |
0.16 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.2 | 8.8 | GO:0003166 | bundle of His development(GO:0003166) |
| 1.2 | 3.6 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
| 1.0 | 3.0 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
| 0.9 | 2.8 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.8 | 2.5 | GO:2000729 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.8 | 1.6 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
| 0.8 | 2.4 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
| 0.8 | 3.1 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.8 | 0.8 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.7 | 2.2 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.7 | 2.1 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.7 | 3.5 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.7 | 2.0 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.7 | 2.0 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.6 | 4.5 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.6 | 1.8 | GO:2000040 | regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
| 0.6 | 1.8 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
| 0.6 | 1.7 | GO:1902218 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.6 | 1.7 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.6 | 1.7 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.6 | 1.7 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.6 | 1.7 | GO:0071688 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
| 0.5 | 2.1 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.5 | 1.0 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
| 0.5 | 1.0 | GO:0070384 | Harderian gland development(GO:0070384) |
| 0.5 | 1.9 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.5 | 1.4 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.5 | 1.4 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.5 | 1.8 | GO:0060264 | regulation of respiratory burst involved in inflammatory response(GO:0060264) |
| 0.5 | 1.8 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.4 | 0.9 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.4 | 1.3 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.4 | 1.3 | GO:0072104 | glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 0.4 | 0.9 | GO:0021938 | smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 0.4 | 0.4 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.4 | 3.0 | GO:0099515 | actin filament-based transport(GO:0099515) |
| 0.4 | 1.7 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.4 | 1.3 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
| 0.4 | 1.2 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.4 | 2.5 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.4 | 1.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.4 | 1.2 | GO:0002930 | trabecular meshwork development(GO:0002930) |
| 0.4 | 1.2 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.4 | 2.0 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.4 | 1.2 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.4 | 1.5 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.4 | 0.4 | GO:0048320 | axial mesoderm formation(GO:0048320) |
| 0.4 | 0.8 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 0.4 | 1.1 | GO:0060596 | mammary placode formation(GO:0060596) |
| 0.4 | 1.5 | GO:0097461 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.4 | 1.1 | GO:0007403 | glial cell fate determination(GO:0007403) |
| 0.4 | 4.7 | GO:0048385 | regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 0.3 | 1.0 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.3 | 0.3 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.3 | 0.3 | GO:0003175 | tricuspid valve development(GO:0003175) |
| 0.3 | 0.3 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.3 | 2.0 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
| 0.3 | 1.0 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.3 | 0.3 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
| 0.3 | 0.9 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.3 | 1.5 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
| 0.3 | 0.6 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.3 | 0.3 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.3 | 1.2 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.3 | 0.9 | GO:0014891 | striated muscle atrophy(GO:0014891) |
| 0.3 | 0.9 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.3 | 1.5 | GO:0071415 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
| 0.3 | 0.9 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.3 | 0.3 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.3 | 0.9 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.3 | 0.6 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
| 0.3 | 0.6 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.3 | 1.4 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.3 | 1.1 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
| 0.3 | 0.3 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.3 | 0.5 | GO:0072566 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
| 0.3 | 1.1 | GO:2000977 | regulation of forebrain neuron differentiation(GO:2000977) |
| 0.3 | 1.6 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.3 | 0.3 | GO:0072053 | renal inner medulla development(GO:0072053) |
| 0.3 | 0.8 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.3 | 1.0 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.3 | 2.3 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.3 | 1.5 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
| 0.3 | 0.5 | GO:2001197 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.2 | 0.7 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
| 0.2 | 1.2 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.2 | 0.2 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.2 | 0.7 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.2 | 0.5 | GO:0048880 | sensory system development(GO:0048880) |
| 0.2 | 1.4 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.2 | 0.2 | GO:0060437 | lung growth(GO:0060437) |
| 0.2 | 0.7 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
| 0.2 | 0.2 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
| 0.2 | 0.9 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
| 0.2 | 0.5 | GO:0072095 | regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 0.2 | 0.2 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 0.2 | 0.5 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.2 | 0.7 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.2 | 0.5 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
| 0.2 | 1.1 | GO:0003010 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
| 0.2 | 1.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.2 | 0.5 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.2 | 0.9 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
| 0.2 | 1.3 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.2 | 2.0 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.2 | 0.2 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
| 0.2 | 0.9 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.2 | 1.1 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.2 | 0.9 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.2 | 0.9 | GO:0010424 | DNA methylation on cytosine within a CG sequence(GO:0010424) DNA methylation on cytosine(GO:0032776) |
| 0.2 | 0.4 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.2 | 0.6 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.2 | 0.8 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.2 | 0.8 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.2 | 0.6 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 0.2 | 2.1 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.2 | 1.0 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.2 | 0.6 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.2 | 0.6 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
| 0.2 | 0.6 | GO:0033504 | floor plate development(GO:0033504) |
| 0.2 | 0.6 | GO:0015744 | succinate transport(GO:0015744) |
| 0.2 | 0.6 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.2 | 0.4 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.2 | 0.6 | GO:1904688 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.2 | 0.8 | GO:0032803 | low-density lipoprotein particle receptor catabolic process(GO:0032802) regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
| 0.2 | 0.4 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
| 0.2 | 0.8 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.2 | 0.6 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.2 | 0.4 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.2 | 0.8 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
| 0.2 | 0.4 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
| 0.2 | 1.5 | GO:1901534 | positive regulation of hematopoietic progenitor cell differentiation(GO:1901534) |
| 0.2 | 0.2 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
| 0.2 | 0.6 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.2 | 0.6 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.2 | 0.9 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.2 | 0.6 | GO:0015755 | fructose transport(GO:0015755) |
| 0.2 | 0.4 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.2 | 0.6 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.2 | 0.5 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.2 | 0.2 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.2 | 0.5 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 0.2 | 0.9 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.2 | 0.7 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.2 | 1.3 | GO:0060613 | fat pad development(GO:0060613) |
| 0.2 | 0.5 | GO:0060298 | positive regulation of sarcomere organization(GO:0060298) |
| 0.2 | 0.5 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.2 | 0.7 | GO:0031947 | negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
| 0.2 | 0.5 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.2 | 0.5 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.2 | 0.2 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.2 | 0.5 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.2 | 0.9 | GO:0060536 | cartilage morphogenesis(GO:0060536) |
| 0.2 | 0.4 | GO:0048557 | embryonic digestive tract morphogenesis(GO:0048557) |
| 0.2 | 0.4 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
| 0.2 | 0.5 | GO:0052422 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.2 | 1.2 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.2 | 1.0 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.2 | 1.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.2 | 0.9 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.2 | 0.5 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.2 | 1.0 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.2 | 0.7 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
| 0.2 | 0.5 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.2 | 0.7 | GO:0009597 | detection of virus(GO:0009597) |
| 0.2 | 0.3 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.2 | 0.3 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
| 0.2 | 0.5 | GO:0071671 | regulation of smooth muscle cell chemotaxis(GO:0071671) positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 0.2 | 0.5 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.2 | 0.8 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) |
| 0.2 | 0.3 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 0.2 | 1.9 | GO:0003417 | growth plate cartilage development(GO:0003417) |
| 0.2 | 1.9 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.2 | 4.3 | GO:0060674 | placenta blood vessel development(GO:0060674) |
| 0.2 | 0.6 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.2 | 0.8 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.2 | 1.1 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.2 | 0.2 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.2 | 0.5 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.2 | 0.9 | GO:0015871 | choline transport(GO:0015871) |
| 0.2 | 0.5 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.2 | 2.0 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
| 0.2 | 1.2 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.2 | 0.2 | GO:0003180 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
| 0.2 | 1.1 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.2 | 0.2 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.2 | 1.2 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.2 | 0.3 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
| 0.2 | 2.1 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
| 0.2 | 0.2 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
| 0.2 | 0.3 | GO:1904192 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.2 | 1.2 | GO:0048368 | lateral mesoderm development(GO:0048368) |
| 0.1 | 0.3 | GO:0060751 | branch elongation involved in mammary gland duct branching(GO:0060751) |
| 0.1 | 0.4 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.1 | 2.4 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
| 0.1 | 0.7 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
| 0.1 | 1.0 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.1 | 0.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.1 | 1.6 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
| 0.1 | 0.9 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.1 | 1.3 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.1 | 0.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 | 0.3 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
| 0.1 | 0.7 | GO:0001714 | endodermal cell fate specification(GO:0001714) |
| 0.1 | 0.7 | GO:0030578 | PML body organization(GO:0030578) |
| 0.1 | 1.9 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 0.3 | GO:0052173 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 0.1 | 0.3 | GO:0006868 | glutamine transport(GO:0006868) |
| 0.1 | 1.0 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.1 | 0.3 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.1 | 0.7 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.1 | 0.3 | GO:0042693 | muscle cell fate commitment(GO:0042693) |
| 0.1 | 0.4 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.1 | 0.6 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.1 | 0.4 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 0.3 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) positive regulation of glucose mediated signaling pathway(GO:1902661) |
| 0.1 | 0.4 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.1 | 0.1 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.1 | 0.4 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
| 0.1 | 0.8 | GO:0043584 | nose development(GO:0043584) |
| 0.1 | 1.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.1 | 0.1 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 | 6.3 | GO:0060021 | palate development(GO:0060021) |
| 0.1 | 0.9 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.1 | 0.7 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.1 | 0.5 | GO:0032196 | transposition(GO:0032196) |
| 0.1 | 1.2 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 | 0.9 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.1 | 0.4 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.1 | 0.4 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.1 | 0.8 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.1 | 0.5 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 | 0.1 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.1 | 0.4 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.1 | 0.4 | GO:0046504 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
| 0.1 | 0.5 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.1 | 0.3 | GO:0048302 | regulation of isotype switching to IgG isotypes(GO:0048302) |
| 0.1 | 0.1 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.1 | 0.1 | GO:0033121 | regulation of purine nucleotide catabolic process(GO:0033121) |
| 0.1 | 0.3 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.1 | 0.9 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.1 | 0.6 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
| 0.1 | 0.4 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.1 | 0.5 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.1 | 0.1 | GO:0009996 | negative regulation of cell fate specification(GO:0009996) |
| 0.1 | 0.7 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
| 0.1 | 0.9 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.1 | 0.1 | GO:0035733 | hepatic stellate cell activation(GO:0035733) regulation of hepatic stellate cell activation(GO:2000489) positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 | 0.1 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
| 0.1 | 0.5 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 | 0.4 | GO:0003383 | apical constriction(GO:0003383) |
| 0.1 | 0.1 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
| 0.1 | 0.2 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.1 | 0.4 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.1 | 0.4 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.1 | 0.6 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 0.9 | GO:0002176 | male germ cell proliferation(GO:0002176) |
| 0.1 | 0.5 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.1 | 1.5 | GO:0008272 | sulfate transport(GO:0008272) |
| 0.1 | 1.1 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.1 | 0.1 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.1 | 0.2 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 | 0.1 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
| 0.1 | 0.7 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.1 | 0.4 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.1 | 0.2 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.1 | 0.5 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.1 | 0.1 | GO:0032364 | oxygen homeostasis(GO:0032364) |
| 0.1 | 1.1 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.1 | 0.6 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.1 | 0.3 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.1 | 0.5 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.1 | 0.4 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
| 0.1 | 1.0 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.1 | 0.5 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.1 | 0.4 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
| 0.1 | 0.3 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.1 | 0.2 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.1 | 1.5 | GO:0000737 | DNA catabolic process, endonucleolytic(GO:0000737) |
| 0.1 | 0.3 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.1 | 0.4 | GO:0018101 | protein citrullination(GO:0018101) |
| 0.1 | 0.9 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.1 | 0.1 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
| 0.1 | 0.4 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.1 | 0.1 | GO:0043307 | eosinophil activation(GO:0043307) |
| 0.1 | 0.4 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.1 | 0.3 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.1 | 0.4 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.1 | 0.5 | GO:0010534 | regulation of activation of JAK2 kinase activity(GO:0010534) |
| 0.1 | 0.4 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.1 | 0.1 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
| 0.1 | 0.1 | GO:1904238 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) pericyte cell differentiation(GO:1904238) |
| 0.1 | 0.9 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
| 0.1 | 0.4 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.1 | 0.4 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.1 | 0.1 | GO:0002606 | positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
| 0.1 | 0.3 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.1 | 0.5 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
| 0.1 | 0.6 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.1 | 0.3 | GO:0035524 | proline transmembrane transport(GO:0035524) |
| 0.1 | 0.3 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 | 0.3 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.1 | 0.3 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.1 | 0.3 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.1 | 0.3 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.1 | 0.3 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.1 | 0.6 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.1 | 0.2 | GO:0061055 | myotome development(GO:0061055) |
| 0.1 | 0.3 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.1 | 0.2 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.1 | 0.4 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 0.6 | GO:0030953 | astral microtubule organization(GO:0030953) |
| 0.1 | 0.2 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.1 | 0.5 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 0.2 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.1 | 0.2 | GO:0060897 | neural plate regionalization(GO:0060897) |
| 0.1 | 0.5 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.1 | 0.4 | GO:0035115 | embryonic forelimb morphogenesis(GO:0035115) |
| 0.1 | 0.8 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.1 | 0.4 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.1 | 0.3 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.1 | 0.1 | GO:1902415 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
| 0.1 | 0.1 | GO:0070831 | basement membrane assembly(GO:0070831) |
| 0.1 | 0.1 | GO:0061047 | positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.1 | 0.5 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.1 | 0.2 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.1 | 0.3 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
| 0.1 | 0.3 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.1 | 0.3 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 | 0.2 | GO:0048290 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
| 0.1 | 0.2 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.1 | 0.2 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.1 | 0.3 | GO:0015822 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
| 0.1 | 0.3 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.1 | 0.2 | GO:0060426 | lung vasculature development(GO:0060426) |
| 0.1 | 0.3 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
| 0.1 | 0.3 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.1 | 0.1 | GO:0060128 | corticotropin hormone secreting cell differentiation(GO:0060128) |
| 0.1 | 0.1 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
| 0.1 | 0.3 | GO:0035137 | hindlimb morphogenesis(GO:0035137) |
| 0.1 | 0.3 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.1 | 0.3 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
| 0.1 | 2.0 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.1 | 2.3 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
| 0.1 | 0.2 | GO:0061450 | trophoblast cell migration(GO:0061450) |
| 0.1 | 0.2 | GO:2000553 | positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
| 0.1 | 0.3 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.1 | 0.2 | GO:0030421 | defecation(GO:0030421) |
| 0.1 | 0.6 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
| 0.1 | 0.2 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.1 | 0.5 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 | 0.2 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.1 | 0.3 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.1 | 0.2 | GO:0014894 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.1 | 0.2 | GO:0000087 | mitotic M phase(GO:0000087) |
| 0.1 | 1.7 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.1 | 0.2 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.1 | 0.2 | GO:0071910 | determination of pancreatic left/right asymmetry(GO:0035469) determination of liver left/right asymmetry(GO:0071910) |
| 0.1 | 0.3 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 | 0.2 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.1 | 0.2 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
| 0.1 | 0.3 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.1 | 1.3 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
| 0.1 | 0.2 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.4 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 0.1 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.1 | 0.3 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.1 | 0.2 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.1 | 0.2 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.1 | 0.5 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 | 0.2 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.1 | 0.2 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.1 | 0.3 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
| 0.1 | 0.3 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 | 0.2 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.1 | 0.2 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.1 | 0.6 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
| 0.1 | 0.2 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.1 | 0.1 | GO:0061323 | cell proliferation involved in heart morphogenesis(GO:0061323) |
| 0.1 | 0.4 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.1 | 0.2 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.1 | 0.2 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.1 | 0.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.2 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.1 | 0.8 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 | 0.2 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.1 | 0.6 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.1 | 0.1 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
| 0.1 | 0.6 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 | 0.1 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.1 | 0.4 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.1 | 1.0 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.1 | 0.5 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.1 | 0.4 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.1 | 0.2 | GO:0006524 | alanine catabolic process(GO:0006524) pyruvate family amino acid catabolic process(GO:0009080) |
| 0.1 | 0.1 | GO:0051084 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 0.4 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 | 0.4 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.1 | 1.3 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
| 0.1 | 0.1 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
| 0.1 | 0.3 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.1 | 0.1 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.1 | 0.2 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
| 0.1 | 0.4 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 | 0.6 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
| 0.1 | 0.2 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.4 | GO:1901678 | iron coordination entity transport(GO:1901678) |
| 0.1 | 0.1 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.1 | 0.2 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.1 | 0.3 | GO:0045343 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.1 | 0.3 | GO:0045356 | positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
| 0.1 | 0.2 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
| 0.1 | 0.2 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
| 0.1 | 0.2 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 | 0.5 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
| 0.1 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.1 | 0.3 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.1 | 0.3 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.1 | 0.3 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 0.1 | 0.4 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.1 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.1 | 0.3 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.2 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.1 | 0.5 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
| 0.1 | 0.3 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.1 | 0.3 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.1 | 0.1 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.1 | 0.1 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.1 | 0.1 | GO:0014842 | regulation of skeletal muscle satellite cell proliferation(GO:0014842) |
| 0.1 | 1.3 | GO:0032781 | positive regulation of ATPase activity(GO:0032781) |
| 0.1 | 0.1 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.1 | 0.1 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.1 | 0.2 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.1 | 0.3 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
| 0.1 | 0.1 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.1 | 2.5 | GO:0030326 | embryonic limb morphogenesis(GO:0030326) embryonic appendage morphogenesis(GO:0035113) |
| 0.1 | 0.2 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
| 0.1 | 0.1 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
| 0.1 | 1.7 | GO:0003341 | cilium movement(GO:0003341) |
| 0.1 | 0.3 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.1 | 0.4 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.1 | 0.2 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.1 | 0.1 | GO:2000619 | negative regulation of histone H4-K16 acetylation(GO:2000619) |
| 0.1 | 0.2 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 | 0.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
| 0.1 | 0.6 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.1 | 0.4 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.1 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 | 0.3 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
| 0.1 | 0.2 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.1 | 0.4 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.1 | 0.1 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
| 0.1 | 0.2 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.1 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 0.2 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.1 | 0.2 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.1 | 0.1 | GO:0035931 | mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) regulation of aldosterone secretion(GO:2000858) |
| 0.1 | 0.1 | GO:1903333 | negative regulation of protein folding(GO:1903333) |
| 0.1 | 0.1 | GO:0070340 | detection of bacterial lipopeptide(GO:0070340) |
| 0.1 | 0.4 | GO:0010226 | response to lithium ion(GO:0010226) |
| 0.1 | 0.6 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.1 | 0.4 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
| 0.1 | 0.2 | GO:0006742 | NADP catabolic process(GO:0006742) |
| 0.1 | 0.2 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.1 | 0.1 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
| 0.1 | 0.1 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
| 0.1 | 0.1 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.1 | 0.1 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.1 | 0.7 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 0.1 | 0.2 | GO:0019081 | viral translation(GO:0019081) |
| 0.1 | 0.8 | GO:0000303 | response to superoxide(GO:0000303) |
| 0.1 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.1 | 0.1 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) |
| 0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.1 | 0.2 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.1 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.1 | 0.1 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.1 | 0.1 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
| 0.1 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 | 0.1 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
| 0.1 | 0.6 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.1 | 0.2 | GO:0048566 | embryonic digestive tract development(GO:0048566) |
| 0.1 | 0.4 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.1 | 0.2 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.1 | 0.3 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.1 | 0.1 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.1 | 0.1 | GO:0009189 | deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) |
| 0.1 | 0.2 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
| 0.1 | 0.2 | GO:0034331 | cell junction maintenance(GO:0034331) cell-cell junction maintenance(GO:0045217) |
| 0.1 | 0.3 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.1 | 0.2 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 | 0.4 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.1 | 0.2 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.1 | 0.5 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.1 | 0.2 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 | 0.6 | GO:0045581 | negative regulation of T cell differentiation(GO:0045581) |
| 0.1 | 0.1 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.1 | 1.1 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
| 0.1 | 0.3 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.1 | 0.3 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.1 | 0.2 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
| 0.1 | 0.2 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.1 | 0.2 | GO:0055119 | relaxation of cardiac muscle(GO:0055119) |
| 0.1 | 0.2 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.1 | 0.2 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
| 0.1 | 0.2 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.1 | 0.3 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.1 | 0.3 | GO:0031017 | exocrine pancreas development(GO:0031017) |
| 0.1 | 0.1 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.1 | 0.4 | GO:0046688 | response to copper ion(GO:0046688) |
| 0.1 | 0.1 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
| 0.1 | 0.9 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.1 | 0.4 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.1 | 0.5 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
| 0.1 | 0.1 | GO:0010979 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.1 | 0.1 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.1 | 0.2 | GO:0032328 | alanine transport(GO:0032328) |
| 0.1 | 0.2 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.1 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.2 | GO:0014824 | artery smooth muscle contraction(GO:0014824) |
| 0.1 | 0.3 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.1 | 0.2 | GO:0070294 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.1 | 0.3 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.1 | 0.3 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.1 | 0.5 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.1 | 0.2 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.1 | 0.1 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.0 | 0.0 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 | 0.2 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.9 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 | 0.0 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.0 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.0 | 0.2 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.0 | 0.2 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.0 | 0.2 | GO:1902165 | regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902165) |
| 0.0 | 0.2 | GO:0042508 | tyrosine phosphorylation of Stat1 protein(GO:0042508) |
| 0.0 | 0.0 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
| 0.0 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.0 | 0.0 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
| 0.0 | 0.0 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
| 0.0 | 0.1 | GO:0031033 | myosin filament organization(GO:0031033) |
| 0.0 | 0.0 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
| 0.0 | 0.0 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.0 | 0.0 | GO:0048289 | isotype switching to IgE isotypes(GO:0048289) regulation of isotype switching to IgE isotypes(GO:0048293) |
| 0.0 | 0.1 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.0 | 0.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.0 | 0.7 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.1 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) |
| 0.0 | 0.1 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 | 0.1 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.0 | 0.2 | GO:0002827 | positive regulation of T-helper 1 type immune response(GO:0002827) |
| 0.0 | 0.1 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 0.0 | 0.1 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 0.0 | 0.0 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.0 | 0.4 | GO:0045986 | negative regulation of smooth muscle contraction(GO:0045986) |
| 0.0 | 0.2 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.0 | 0.0 | GO:0002890 | negative regulation of B cell mediated immunity(GO:0002713) negative regulation of immunoglobulin mediated immune response(GO:0002890) |
| 0.0 | 0.1 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
| 0.0 | 0.5 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.0 | GO:0003198 | epithelial to mesenchymal transition involved in endocardial cushion formation(GO:0003198) |
| 0.0 | 0.0 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.0 | 0.2 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.0 | 0.1 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.0 | 0.2 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.0 | 0.0 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.0 | 0.3 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.0 | 0.0 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.0 | 0.4 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.0 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
| 0.0 | 0.6 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.0 | 0.3 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
| 0.0 | 0.0 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.0 | 0.1 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.0 | 0.1 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.0 | 0.0 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.0 | 0.1 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.0 | 1.3 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.2 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.0 | 0.1 | GO:0007351 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.0 | 0.0 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.0 | 0.2 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.0 | 0.1 | GO:0032075 | positive regulation of nuclease activity(GO:0032075) |
| 0.0 | 0.2 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
| 0.0 | 0.7 | GO:0006301 | postreplication repair(GO:0006301) |
| 0.0 | 0.2 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.0 | 0.3 | GO:0002693 | positive regulation of cellular extravasation(GO:0002693) |
| 0.0 | 0.2 | GO:0042095 | interferon-gamma biosynthetic process(GO:0042095) |
| 0.0 | 0.2 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.4 | GO:0006568 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
| 0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.5 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.0 | 0.1 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.0 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.1 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.0 | 0.0 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.0 | 0.0 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 0.0 | 0.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.4 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.0 | 0.2 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.0 | 0.3 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.0 | 0.1 | GO:0032375 | negative regulation of sterol transport(GO:0032372) negative regulation of cholesterol transport(GO:0032375) |
| 0.0 | 0.2 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.0 | 0.3 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.2 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 | 0.0 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
| 0.0 | 0.1 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.0 | 0.2 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
| 0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.0 | 0.1 | GO:2000909 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.0 | 0.1 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.0 | 0.1 | GO:0046112 | nucleobase biosynthetic process(GO:0046112) |
| 0.0 | 0.2 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 0.0 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
| 0.0 | 0.1 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.0 | 0.1 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.0 | 0.1 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.0 | 0.1 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.0 | 0.1 | GO:0006971 | hypotonic response(GO:0006971) |
| 0.0 | 0.0 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 | 0.2 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 0.0 | 0.1 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.0 | 0.0 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.0 | 0.0 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
| 0.0 | 0.4 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.0 | 0.4 | GO:0031629 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.0 | 0.4 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.0 | 0.2 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.0 | 0.1 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.0 | 0.6 | GO:0015893 | drug transport(GO:0015893) |
| 0.0 | 0.1 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.0 | 0.1 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.0 | 0.1 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.0 | 0.2 | GO:0070627 | ferrous iron import(GO:0070627) ferrous iron import into cell(GO:0097460) |
| 0.0 | 0.1 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 | 0.1 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.0 | 0.0 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
| 0.0 | 0.2 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.0 | 0.1 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
| 0.0 | 0.3 | GO:0051642 | centrosome localization(GO:0051642) |
| 0.0 | 0.3 | GO:0006266 | DNA ligation(GO:0006266) |
| 0.0 | 0.2 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.0 | 0.3 | GO:0009134 | nucleoside diphosphate catabolic process(GO:0009134) |
| 0.0 | 0.2 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.0 | 0.1 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.0 | 0.1 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.0 | 0.1 | GO:0072423 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 | 0.8 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.3 | GO:0010884 | positive regulation of lipid storage(GO:0010884) |
| 0.0 | 0.1 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.0 | 0.1 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
| 0.0 | 0.1 | GO:0042976 | activation of Janus kinase activity(GO:0042976) |
| 0.0 | 0.0 | GO:0046075 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
| 0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.1 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.0 | 0.1 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
| 0.0 | 0.2 | GO:0033260 | nuclear DNA replication(GO:0033260) |
| 0.0 | 0.1 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.0 | 0.2 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
| 0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.1 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.0 | 0.3 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.0 | 0.1 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.0 | 0.0 | GO:0001905 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
| 0.0 | 0.1 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.0 | 0.1 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.0 | 0.2 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.0 | 0.1 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
| 0.0 | 0.1 | GO:1901072 | glucosamine-containing compound catabolic process(GO:1901072) |
| 0.0 | 0.1 | GO:1903431 | positive regulation of cell maturation(GO:1903431) |
| 0.0 | 0.0 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
| 0.0 | 0.1 | GO:0002664 | regulation of T cell tolerance induction(GO:0002664) |
| 0.0 | 0.1 | GO:0042092 | type 2 immune response(GO:0042092) |
| 0.0 | 0.1 | GO:2000425 | regulation of apoptotic cell clearance(GO:2000425) positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.1 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
| 0.0 | 0.5 | GO:0048535 | lymph node development(GO:0048535) |
| 0.0 | 0.1 | GO:0060632 | regulation of microtubule-based movement(GO:0060632) |
| 0.0 | 0.1 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.0 | 0.2 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.0 | 0.1 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
| 0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.1 | GO:0050856 | regulation of T cell receptor signaling pathway(GO:0050856) |
| 0.0 | 0.3 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 0.0 | 0.2 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.0 | 0.1 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.0 | 0.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.0 | 0.0 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
| 0.0 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.0 | 0.2 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.0 | 0.1 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.0 | 0.0 | GO:0042402 | polyamine catabolic process(GO:0006598) amine catabolic process(GO:0009310) cellular biogenic amine catabolic process(GO:0042402) |
| 0.0 | 0.3 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.0 | 0.0 | GO:2000319 | regulation of T-helper 17 cell differentiation(GO:2000319) |
| 0.0 | 0.6 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.2 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.1 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.0 | 0.0 | GO:0042033 | chemokine biosynthetic process(GO:0042033) regulation of chemokine biosynthetic process(GO:0045073) negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.0 | 0.4 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.1 | GO:0043379 | memory T cell differentiation(GO:0043379) |
| 0.0 | 0.1 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.0 | 0.1 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.0 | 0.2 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
| 0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.0 | GO:0072422 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
| 0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 | 0.2 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.0 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 0.0 | 0.1 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.0 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.0 | 0.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 | 0.2 | GO:0002507 | tolerance induction(GO:0002507) |
| 0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.2 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.0 | 0.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.0 | 0.3 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.0 | GO:0048865 | stem cell fate commitment(GO:0048865) |
| 0.0 | 0.1 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.0 | 0.0 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.0 | 0.1 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.0 | 0.1 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.0 | 0.2 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 0.2 | GO:0071569 | protein ufmylation(GO:0071569) |
| 0.0 | 0.1 | GO:0072539 | T-helper 17 cell differentiation(GO:0072539) |
| 0.0 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
| 0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.0 | 0.2 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.0 | GO:0071600 | otic vesicle development(GO:0071599) otic vesicle morphogenesis(GO:0071600) |
| 0.0 | 0.1 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
| 0.0 | 0.0 | GO:0055015 | ventricular cardiac muscle cell development(GO:0055015) |
| 0.0 | 0.1 | GO:1990000 | amyloid fibril formation(GO:1990000) |
| 0.0 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.0 | 0.1 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.0 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.4 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
| 0.0 | 0.1 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
| 0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.1 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
| 0.0 | 0.1 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
| 0.0 | 0.1 | GO:0042517 | positive regulation of tyrosine phosphorylation of Stat3 protein(GO:0042517) |
| 0.0 | 0.0 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.0 | 1.0 | GO:0006749 | glutathione metabolic process(GO:0006749) |
| 0.0 | 0.1 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.2 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| 0.0 | 0.2 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 0.0 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.0 | 0.1 | GO:0002349 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.0 | 0.0 | GO:0045346 | regulation of MHC class II biosynthetic process(GO:0045346) |
| 0.0 | 0.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.0 | 0.1 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
| 0.0 | 0.0 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
| 0.0 | 0.1 | GO:0034651 | cortisol biosynthetic process(GO:0034651) |
| 0.0 | 0.0 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
| 0.0 | 0.1 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.0 | 0.1 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.2 | GO:0006071 | glycerol metabolic process(GO:0006071) |
| 0.0 | 0.0 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 | 0.1 | GO:0009110 | vitamin biosynthetic process(GO:0009110) |
| 0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.0 | 0.1 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
| 0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 0.0 | GO:0033860 | regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.0 | 0.0 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.0 | 0.0 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.0 | 0.0 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) glandular epithelial cell maturation(GO:0002071) |
| 0.0 | 0.1 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.0 | 0.2 | GO:0016556 | mRNA modification(GO:0016556) |
| 0.0 | 0.0 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
| 0.0 | 0.0 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
| 0.0 | 0.1 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
| 0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.0 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
| 0.0 | 0.0 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.0 | 0.0 | GO:0010840 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) circadian sleep/wake cycle, wakefulness(GO:0042746) |
| 0.0 | 0.1 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
| 0.0 | 0.2 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.0 | 0.1 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.0 | 0.4 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.1 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
| 0.0 | 0.1 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
| 0.0 | 0.0 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.0 | 0.1 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 0.1 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) |
| 0.0 | 0.0 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.0 | 0.1 | GO:0009642 | response to light intensity(GO:0009642) |
| 0.0 | 0.1 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.0 | 0.0 | GO:1904468 | negative regulation of tumor necrosis factor secretion(GO:1904468) |
| 0.0 | 0.2 | GO:0007007 | inner mitochondrial membrane organization(GO:0007007) |
| 0.0 | 0.0 | GO:0034727 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) single-organism membrane invagination(GO:1902534) |
| 0.0 | 0.1 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.0 | 0.0 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.0 | 0.2 | GO:0043462 | regulation of ATPase activity(GO:0043462) |
| 0.0 | 0.0 | GO:0034165 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.0 | 0.0 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.0 | 0.6 | GO:0055072 | iron ion homeostasis(GO:0055072) |
| 0.0 | 0.1 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.0 | 0.0 | GO:0033628 | regulation of cell adhesion mediated by integrin(GO:0033628) |
| 0.0 | 0.1 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
| 0.0 | 0.1 | GO:0002760 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.0 | 0.1 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.0 | 0.1 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.0 | 0.0 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.0 | 0.1 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.1 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 | 0.0 | GO:2000726 | negative regulation of cardiac muscle cell differentiation(GO:2000726) |
| 0.0 | 0.3 | GO:0045109 | intermediate filament organization(GO:0045109) |
| 0.0 | 0.2 | GO:1903429 | regulation of cell maturation(GO:1903429) |
| 0.0 | 0.0 | GO:0019400 | alditol metabolic process(GO:0019400) |
| 0.0 | 0.5 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.0 | 0.1 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.0 | 0.1 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.0 | 0.0 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
| 0.0 | 0.0 | GO:0046051 | UTP metabolic process(GO:0046051) |
| 0.0 | 0.1 | GO:0050687 | negative regulation of defense response to virus(GO:0050687) |
| 0.0 | 0.1 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.0 | 0.0 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.0 | 0.0 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
| 0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.0 | 0.1 | GO:0010883 | regulation of lipid storage(GO:0010883) |
| 0.0 | 0.1 | GO:0000050 | urea cycle(GO:0000050) |
| 0.0 | 0.3 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.0 | 0.6 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 0.0 | 0.1 | GO:0060177 | regulation of angiotensin levels in blood(GO:0002002) regulation of angiotensin metabolic process(GO:0060177) |
| 0.0 | 0.0 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 | 0.0 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.0 | 0.0 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.0 | 0.0 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.0 | 0.1 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.0 | 0.1 | GO:0046606 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.0 | 0.0 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.0 | 0.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.0 | GO:0006555 | methionine metabolic process(GO:0006555) |
| 0.0 | 0.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.0 | 0.1 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 | 0.0 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.0 | 0.1 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.0 | 0.0 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.0 | 0.5 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.0 | 0.0 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.0 | 0.0 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.0 | 0.5 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
| 0.0 | 0.0 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.0 | 0.1 | GO:0060706 | cell differentiation involved in embryonic placenta development(GO:0060706) |
| 0.0 | 0.0 | GO:0046037 | GMP metabolic process(GO:0046037) |
| 0.0 | 0.2 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 | 0.6 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.1 | GO:0032365 | intracellular lipid transport(GO:0032365) |
| 0.0 | 0.0 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.0 | 0.1 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.2 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
| 0.0 | 0.1 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.0 | 0.0 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.0 | 0.0 | GO:1902254 | negative regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902254) |
| 0.0 | 0.0 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
| 0.0 | 0.0 | GO:0042523 | positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
| 0.0 | 0.1 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.0 | 0.1 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.0 | 0.3 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
| 0.0 | 0.0 | GO:0002190 | cap-independent translational initiation(GO:0002190) |
| 0.0 | 0.1 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.0 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.0 | 0.0 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.1 | GO:0002251 | organ or tissue specific immune response(GO:0002251) |
| 0.0 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.0 | 0.0 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.0 | 0.1 | GO:0009650 | UV protection(GO:0009650) |
| 0.0 | 0.0 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.0 | 0.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 0.1 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.0 | GO:0002884 | regulation of type IV hypersensitivity(GO:0001807) negative regulation of hypersensitivity(GO:0002884) |
| 0.0 | 0.1 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.2 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.0 | 0.0 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.0 | 0.0 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.0 | 0.0 | GO:2000018 | regulation of male gonad development(GO:2000018) |
| 0.0 | 0.0 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.0 | 0.0 | GO:0000019 | regulation of mitotic recombination(GO:0000019) |
| 0.0 | 0.0 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 0.0 | GO:0015819 | lysine transport(GO:0015819) |
| 0.0 | 0.0 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.0 | 0.3 | GO:0019585 | uronic acid metabolic process(GO:0006063) glucuronate metabolic process(GO:0019585) cellular glucuronidation(GO:0052695) |
| 0.0 | 0.0 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.0 | 0.0 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
| 0.0 | 0.0 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.0 | 0.4 | GO:0006446 | regulation of translational initiation(GO:0006446) |
| 0.0 | 0.1 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.0 | 0.1 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.0 | 0.2 | GO:0060711 | labyrinthine layer development(GO:0060711) |
| 0.0 | 0.1 | GO:1905038 | regulation of sphingolipid biosynthetic process(GO:0090153) regulation of membrane lipid metabolic process(GO:1905038) regulation of ceramide biosynthetic process(GO:2000303) |
| 0.0 | 0.1 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
| 0.0 | 0.1 | GO:0016093 | polyprenol metabolic process(GO:0016093) |
| 0.0 | 0.0 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.0 | 0.0 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.0 | 0.0 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
| 0.0 | 0.8 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.0 | 0.0 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
| 0.0 | 0.0 | GO:0030049 | muscle filament sliding(GO:0030049) |
| 0.0 | 0.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.0 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.0 | 0.0 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
| 0.0 | 0.1 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.0 | 0.1 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.0 | 0.1 | GO:0044783 | G1 DNA damage checkpoint(GO:0044783) |
| 0.0 | 0.0 | GO:0046909 | intermembrane transport(GO:0046909) |
| 0.0 | 0.0 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
| 0.0 | 0.0 | GO:0002923 | regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002923) |
| 0.0 | 0.0 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.0 | 0.0 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
| 0.0 | 0.0 | GO:0010988 | regulation of low-density lipoprotein particle clearance(GO:0010988) |
| 0.0 | 0.1 | GO:0006903 | vesicle targeting(GO:0006903) |
| 0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.1 | GO:0009992 | cellular water homeostasis(GO:0009992) |
| 0.0 | 0.0 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
| 0.0 | 0.1 | GO:0032096 | negative regulation of response to food(GO:0032096) |
| 0.0 | 0.3 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.0 | GO:0090399 | replicative senescence(GO:0090399) |
| 0.0 | 0.0 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.0 | GO:1903899 | positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
| 0.0 | 0.2 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.0 | 0.0 | GO:0090032 | negative regulation of steroid hormone biosynthetic process(GO:0090032) |
| 0.0 | 0.0 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) |
| 0.0 | 0.1 | GO:0051923 | sulfation(GO:0051923) |
| 0.0 | 0.0 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 0.0 | 0.0 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
| 0.0 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.0 | 0.0 | GO:0090148 | membrane fission(GO:0090148) |
| 0.0 | 0.0 | GO:0046173 | polyol biosynthetic process(GO:0046173) |
| 0.0 | 0.0 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.0 | 0.0 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.0 | 0.0 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
| 0.0 | 0.1 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.0 | 0.1 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.0 | 0.1 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
| 0.0 | 0.0 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
| 0.0 | 0.0 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
| 0.0 | 0.3 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
| 0.0 | 0.0 | GO:0009067 | aspartate family amino acid biosynthetic process(GO:0009067) |
| 0.0 | 0.0 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
| 0.0 | 0.0 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
| 0.0 | 0.1 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 2.3 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.5 | 1.4 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.4 | 0.4 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.4 | 1.5 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.4 | 0.4 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.3 | 2.6 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.3 | 0.9 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.3 | 0.8 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.3 | 0.8 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.2 | 0.6 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.2 | 1.0 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.2 | 0.6 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.2 | 0.8 | GO:0030478 | actin cap(GO:0030478) |
| 0.2 | 1.1 | GO:1990462 | omegasome(GO:1990462) |
| 0.2 | 0.8 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.2 | 0.6 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.2 | 2.0 | GO:0042555 | MCM complex(GO:0042555) |
| 0.2 | 0.5 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.2 | 0.7 | GO:0000938 | GARP complex(GO:0000938) |
| 0.2 | 0.5 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.2 | 1.0 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.2 | 0.5 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.2 | 0.5 | GO:1990393 | 3M complex(GO:1990393) |
| 0.1 | 0.9 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.1 | 0.4 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.1 | 1.1 | GO:0005861 | troponin complex(GO:0005861) |
| 0.1 | 0.4 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 0.7 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.1 | 0.6 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.1 | 0.6 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.1 | 1.1 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.1 | 0.5 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.1 | 0.8 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.1 | 0.6 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.1 | 0.4 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.1 | 0.4 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.1 | 0.6 | GO:0016589 | NURF complex(GO:0016589) |
| 0.1 | 0.4 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 1.0 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.1 | 0.3 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.1 | 1.7 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.1 | 0.5 | GO:0035363 | histone locus body(GO:0035363) |
| 0.1 | 0.4 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.1 | 0.3 | GO:0000811 | GINS complex(GO:0000811) |
| 0.1 | 0.6 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 0.8 | GO:0043203 | axon hillock(GO:0043203) |
| 0.1 | 0.3 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 1.3 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.1 | 0.4 | GO:0042827 | platelet dense granule(GO:0042827) |
| 0.1 | 0.7 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.1 | 5.0 | GO:0005844 | polysome(GO:0005844) |
| 0.1 | 0.3 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 0.8 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.1 | 0.4 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 0.6 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.1 | 0.3 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.1 | 0.5 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.1 | 0.8 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.1 | 0.4 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.1 | 0.4 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.1 | 0.3 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.1 | 0.3 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.1 | 0.4 | GO:0008091 | spectrin(GO:0008091) |
| 0.1 | 0.5 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 32.2 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.1 | 0.6 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 0.8 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 1.0 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
| 0.1 | 0.4 | GO:0032021 | NELF complex(GO:0032021) |
| 0.1 | 1.5 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.1 | 1.1 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 1.3 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 0.3 | GO:0098536 | deuterosome(GO:0098536) |
| 0.1 | 0.5 | GO:0071546 | pi-body(GO:0071546) |
| 0.1 | 0.6 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 0.6 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 0.3 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.1 | 0.4 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.1 | 2.2 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 0.6 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 1.1 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.1 | 1.0 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.1 | 2.3 | GO:0031672 | A band(GO:0031672) |
| 0.1 | 0.7 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 0.3 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.1 | 0.7 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.1 | 0.6 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.1 | 0.7 | GO:0060091 | kinocilium(GO:0060091) |
| 0.1 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.1 | 0.6 | GO:0000243 | commitment complex(GO:0000243) |
| 0.1 | 0.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 2.1 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.1 | 0.3 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.1 | 0.8 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 0.5 | GO:0090543 | Flemming body(GO:0090543) |
| 0.1 | 1.6 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.1 | 0.2 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.1 | 0.4 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.1 | 0.2 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.1 | 0.3 | GO:0032009 | early phagosome(GO:0032009) |
| 0.1 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.1 | 0.2 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
| 0.1 | 0.2 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.1 | 0.2 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.1 | 0.2 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 2.3 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.1 | 2.0 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.1 | 0.2 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.1 | 2.4 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.1 | 0.5 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
| 0.1 | 1.2 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| 0.1 | 0.2 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 0.2 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.1 | 0.2 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.1 | 0.2 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.1 | 0.1 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.1 | 0.4 | GO:0035859 | Seh1-associated complex(GO:0035859) GATOR2 complex(GO:0061700) |
| 0.1 | 1.7 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.1 | 3.0 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.1 | 0.1 | GO:1990696 | USH2 complex(GO:1990696) |
| 0.1 | 0.3 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.1 | 0.6 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.1 | 0.7 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.1 | 0.3 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.1 | 0.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.1 | 0.4 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.1 | 0.4 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.0 | 0.6 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
| 0.0 | 0.2 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.0 | 0.2 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.4 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.2 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
| 0.0 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.0 | 0.8 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.0 | 1.2 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 3.0 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.3 | GO:0070187 | telosome(GO:0070187) |
| 0.0 | 0.2 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.4 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) |
| 0.0 | 0.5 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 0.2 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.0 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.0 | 0.4 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.7 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 0.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.0 | 0.7 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.7 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.0 | 0.2 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.0 | 1.0 | GO:0008305 | integrin complex(GO:0008305) |
| 0.0 | 0.2 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 1.2 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.8 | GO:0030057 | desmosome(GO:0030057) |
| 0.0 | 1.8 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.2 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.5 | GO:0045120 | pronucleus(GO:0045120) |
| 0.0 | 0.2 | GO:0099738 | apical cortex(GO:0045179) cell cortex region(GO:0099738) |
| 0.0 | 0.7 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.1 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.3 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.0 | 0.6 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.0 | 0.7 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 0.5 | GO:0043205 | fibril(GO:0043205) |
| 0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.7 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.0 | 0.3 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.5 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.0 | 0.1 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.0 | 0.4 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 0.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.0 | 2.0 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 0.5 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.0 | 0.5 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
| 0.0 | 0.3 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.0 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 0.3 | GO:0042627 | chylomicron(GO:0042627) |
| 0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.5 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.0 | 0.0 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.0 | 0.2 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 0.3 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.2 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
| 0.0 | 0.3 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.2 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 0.3 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 0.1 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
| 0.0 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.6 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.0 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.9 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.0 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 2.5 | GO:0005903 | brush border(GO:0005903) |
| 0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.1 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.0 | 0.1 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.0 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.0 | 0.5 | GO:1990204 | oxidoreductase complex(GO:1990204) |
| 0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.0 | 0.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 0.0 | GO:0033655 | host cell cytoplasm(GO:0030430) host intracellular part(GO:0033646) host cell cytoplasm part(GO:0033655) intracellular region of host(GO:0043656) |
| 0.0 | 0.2 | GO:0032982 | myosin filament(GO:0032982) |
| 0.0 | 0.3 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.0 | 0.3 | GO:0005605 | basal lamina(GO:0005605) |
| 0.0 | 0.0 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.0 | 0.1 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.0 | 0.1 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.0 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
| 0.0 | 0.0 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.4 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.2 | GO:0070069 | cytochrome complex(GO:0070069) |
| 0.0 | 0.2 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.0 | 0.1 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.0 | 0.0 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.0 | 0.0 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.0 | 0.5 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.1 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.0 | 0.0 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.0 | 0.0 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
| 0.0 | 0.0 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.0 | 0.0 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.0 | 0.7 | GO:0098800 | inner mitochondrial membrane protein complex(GO:0098800) |
| 0.0 | 0.6 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.0 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.0 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.0 | 0.2 | GO:0005771 | multivesicular body(GO:0005771) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 2.0 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.6 | 1.8 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.5 | 1.6 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.5 | 5.0 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.5 | 1.5 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.5 | 1.5 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.5 | 1.4 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.5 | 1.4 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
| 0.4 | 1.7 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.4 | 2.3 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.3 | 1.7 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.3 | 1.0 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.3 | 1.3 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.3 | 1.2 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.3 | 1.5 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.3 | 0.9 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.3 | 1.4 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.3 | 0.8 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.3 | 0.8 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.3 | 1.0 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.3 | 0.8 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.2 | 1.7 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.2 | 0.7 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.2 | 2.9 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.2 | 0.9 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.2 | 2.0 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.2 | 1.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.2 | 1.3 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.2 | 0.7 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.2 | 0.9 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.2 | 1.5 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.2 | 0.6 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.2 | 0.8 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.2 | 0.6 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.2 | 0.6 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.2 | 0.6 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
| 0.2 | 11.5 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.2 | 0.6 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.2 | 0.8 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.2 | 1.0 | GO:0071253 | connexin binding(GO:0071253) |
| 0.2 | 1.6 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.2 | 0.2 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.2 | 0.8 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.2 | 0.8 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.2 | 1.3 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.2 | 0.7 | GO:0009374 | biotin binding(GO:0009374) |
| 0.2 | 1.5 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
| 0.2 | 1.3 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.2 | 0.5 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.2 | 3.4 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.2 | 4.4 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.2 | 0.5 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.2 | 0.7 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.2 | 0.5 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.2 | 0.8 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.2 | 0.3 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.2 | 0.6 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.2 | 0.6 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.2 | 0.2 | GO:0043426 | MRF binding(GO:0043426) |
| 0.2 | 0.6 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.1 | 0.3 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
| 0.1 | 0.9 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.1 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.1 | 0.9 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 2.9 | GO:0030546 | receptor activator activity(GO:0030546) |
| 0.1 | 0.7 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.1 | 0.8 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.1 | 0.4 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.1 | 1.5 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.1 | 1.6 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.5 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.1 | 0.3 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.1 | 0.7 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.1 | 3.4 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.1 | 2.3 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.1 | 2.3 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.1 | 0.9 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.1 | 0.4 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.1 | 1.5 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.1 | 1.0 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.1 | 2.5 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.1 | 0.5 | GO:0034618 | arginine binding(GO:0034618) |
| 0.1 | 0.5 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.1 | 2.2 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 0.4 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.1 | 0.2 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.1 | 0.4 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.1 | 1.2 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.1 | 1.2 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.1 | 0.5 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 0.2 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.1 | 0.3 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.1 | 0.3 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.1 | 0.3 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.1 | 0.3 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.1 | 0.6 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.3 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.1 | 0.7 | GO:0005536 | glucose binding(GO:0005536) |
| 0.1 | 0.3 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 0.6 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.1 | 0.6 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 0.3 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.1 | 0.3 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.1 | 1.3 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.1 | 0.4 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.1 | 0.3 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.1 | 1.1 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.1 | 0.6 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 0.4 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.1 | 0.4 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.1 | 0.5 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.1 | 4.8 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.1 | 0.2 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.1 | 0.4 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.1 | 0.3 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.1 | 0.4 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.1 | 0.4 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.1 | 0.4 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 0.3 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.1 | 0.3 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.1 | 0.3 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.1 | 0.2 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 0.1 | 0.3 | GO:0001032 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
| 0.1 | 0.7 | GO:0070888 | E-box binding(GO:0070888) |
| 0.1 | 0.5 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.1 | 0.5 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 0.1 | 1.3 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.1 | 0.3 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.1 | 0.7 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
| 0.1 | 1.0 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.1 | 1.5 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
| 0.1 | 0.7 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.1 | 0.3 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.1 | 0.3 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.1 | 0.3 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.1 | 0.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 0.7 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.1 | 1.4 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.1 | 0.3 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.1 | 0.3 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.1 | 0.2 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) sulfate transmembrane transporter activity(GO:0015116) |
| 0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.1 | 0.2 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.1 | 0.2 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.2 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.1 | 0.9 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.1 | 0.1 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.1 | 0.4 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.1 | 0.4 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
| 0.1 | 0.1 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
| 0.1 | 0.4 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.1 | 0.4 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.1 | 0.4 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.1 | 0.3 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.1 | 0.2 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 0.2 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.1 | 1.4 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.1 | 0.1 | GO:0046977 | TAP binding(GO:0046977) |
| 0.1 | 1.8 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.1 | 0.6 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.1 | 0.9 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.1 | 0.5 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.1 | 0.9 | GO:0005542 | folic acid binding(GO:0005542) |
| 0.1 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.1 | 0.4 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.1 | 0.3 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.1 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.1 | 0.3 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.1 | 0.5 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.1 | 0.2 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.1 | 0.6 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.4 | GO:0052849 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
| 0.1 | 0.5 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.1 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.1 | 0.4 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.1 | 1.2 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.1 | 0.2 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.1 | 0.2 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.1 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.1 | 0.3 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
| 0.1 | 0.4 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.1 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.1 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.1 | 0.2 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.1 | 0.2 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.1 | 0.2 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.1 | 0.2 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.1 | 0.2 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.1 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 1.4 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.1 | 0.1 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.1 | 2.6 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.1 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.1 | 0.3 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.1 | 0.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.1 | 0.7 | GO:0038187 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
| 0.1 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.1 | 0.5 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.1 | 0.2 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.1 | 0.4 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.1 | 0.1 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.1 | 0.3 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.1 | 0.2 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.1 | 0.7 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.1 | 0.4 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.1 | 0.3 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
| 0.1 | 1.3 | GO:0004879 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
| 0.1 | 0.2 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.1 | 0.2 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.2 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.1 | 0.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.1 | 0.2 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.1 | 0.2 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.1 | 0.6 | GO:0008061 | chitin binding(GO:0008061) |
| 0.1 | 0.4 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.1 | 1.6 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
| 0.1 | 3.4 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.1 | 0.2 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.1 | 0.2 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.1 | 0.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.1 | 0.1 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
| 0.1 | 0.7 | GO:0000982 | transcription factor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0000982) |
| 0.1 | 0.4 | GO:0051119 | sugar transmembrane transporter activity(GO:0051119) |
| 0.1 | 0.2 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.1 | 0.1 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.1 | 0.1 | GO:0000295 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.1 | 0.5 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 0.5 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.1 | 0.2 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.1 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.0 | 0.2 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 0.3 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.5 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.3 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.0 | 0.1 | GO:0048256 | flap endonuclease activity(GO:0048256) |
| 0.0 | 0.3 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.0 | 0.4 | GO:0015932 | nucleobase-containing compound transmembrane transporter activity(GO:0015932) |
| 0.0 | 0.6 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 0.3 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.0 | 0.6 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.1 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.0 | 0.0 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.0 | 0.2 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
| 0.0 | 0.2 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.0 | 0.3 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.2 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.0 | 0.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.4 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.0 | 0.8 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 0.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.0 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
| 0.0 | 0.4 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.0 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
| 0.0 | 0.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.2 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.0 | 0.0 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.0 | 0.3 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.0 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.0 | 0.1 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.0 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.0 | 0.3 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.0 | 0.2 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.0 | 0.3 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.3 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
| 0.0 | 0.5 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.0 | GO:0016751 | S-succinyltransferase activity(GO:0016751) |
| 0.0 | 0.2 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.1 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.0 | 0.0 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 1.6 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
| 0.0 | 0.0 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
| 0.0 | 0.2 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) xenobiotic transporter activity(GO:0042910) |
| 0.0 | 0.1 | GO:0005350 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
| 0.0 | 0.3 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
| 0.0 | 0.4 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.0 | 0.6 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.2 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.0 | 0.7 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.0 | 0.3 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.3 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.1 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.0 | 0.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 1.5 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.3 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.1 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.0 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.0 | 0.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.0 | 0.0 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
| 0.0 | 0.1 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.0 | 0.4 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.0 | 0.4 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.0 | 0.1 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
| 0.0 | 0.8 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 7.4 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.0 | 0.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.1 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.0 | 0.1 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.7 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 1.2 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.2 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.3 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.2 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.0 | 0.4 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
| 0.0 | 0.0 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.0 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 0.1 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.0 | 0.1 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 0.0 | 0.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.0 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.4 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.0 | 0.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.0 | 5.6 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.1 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
| 0.0 | 0.2 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
| 0.0 | 0.2 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.0 | 0.3 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
| 0.0 | 0.1 | GO:0060229 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
| 0.0 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 0.1 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.0 | 0.2 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.4 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.7 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.0 | 0.8 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.0 | 0.3 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.0 | 0.2 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
| 0.0 | 0.2 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.0 | 0.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 2.7 | GO:0000987 | core promoter proximal region sequence-specific DNA binding(GO:0000987) |
| 0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.0 | 0.2 | GO:0019956 | chemokine binding(GO:0019956) |
| 0.0 | 0.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.0 | 0.4 | GO:0004601 | peroxidase activity(GO:0004601) |
| 0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 1.8 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.0 | 0.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.0 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.0 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.1 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.0 | 0.1 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
| 0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.6 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.1 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
| 0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.1 | GO:0052760 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
| 0.0 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.1 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
| 0.0 | 0.0 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.2 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
| 0.0 | 0.5 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.4 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.0 | 0.1 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.0 | 0.0 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.0 | 0.0 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.0 | 0.1 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
| 0.0 | 0.7 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
| 0.0 | 0.2 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.0 | 0.0 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.0 | 1.0 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.0 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 0.2 | GO:0032813 | tumor necrosis factor receptor superfamily binding(GO:0032813) |
| 0.0 | 0.1 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.0 | 0.2 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.0 | 0.0 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 0.1 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.1 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.0 | 0.1 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.0 | 0.0 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.0 | 0.1 | GO:0008252 | nucleotidase activity(GO:0008252) |
| 0.0 | 0.1 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.0 | 0.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.0 | 0.3 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.0 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.0 | 0.1 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.0 | 0.6 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.0 | 0.0 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 2.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.0 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
| 0.0 | 0.1 | GO:0004031 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
| 0.0 | 0.0 | GO:0018561 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
| 0.0 | 0.1 | GO:0051183 | vitamin transporter activity(GO:0051183) |
| 0.0 | 0.1 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 0.2 | GO:0048038 | quinone binding(GO:0048038) |
| 0.0 | 0.5 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.5 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) |
| 0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.2 | GO:0005372 | water transmembrane transporter activity(GO:0005372) |
| 0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.0 | 0.0 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
| 0.0 | 0.0 | GO:0016684 | oxidoreductase activity, acting on peroxide as acceptor(GO:0016684) |
| 0.0 | 0.3 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.0 | 0.4 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.2 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.0 | 0.2 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.0 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 0.4 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 0.0 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.0 | 0.2 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) oxidoreductase activity, acting on the CH-CH group of donors, with a flavin as acceptor(GO:0052890) |
| 0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.0 | 0.0 | GO:0016531 | copper chaperone activity(GO:0016531) |
| 0.0 | 0.0 | GO:0034979 | NAD-dependent protein deacetylase activity(GO:0034979) |
| 0.0 | 0.0 | GO:2001070 | starch binding(GO:2001070) |
| 0.0 | 0.0 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.0 | 0.2 | GO:0008237 | metallopeptidase activity(GO:0008237) |
| 0.0 | 0.0 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.0 | 1.6 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.0 | GO:0004946 | bombesin receptor activity(GO:0004946) |
| 0.0 | 0.1 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.5 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.0 | 0.0 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.0 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.0 | 0.0 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.0 | 0.1 | GO:0052795 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 0.1 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 0.0 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.0 | 0.0 | GO:0004487 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.0 | 0.0 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.1 | GO:0008312 | 7S RNA binding(GO:0008312) |
| 0.0 | 0.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.0 | 0.1 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) |
| 0.0 | 0.0 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.1 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.1 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.0 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.0 | 1.6 | GO:0000287 | magnesium ion binding(GO:0000287) |
| 0.0 | 0.1 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.0 | 0.2 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.0 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.0 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.0 | 0.1 | GO:0016208 | AMP binding(GO:0016208) |
| 0.0 | 0.1 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.0 | 0.4 | GO:0030414 | peptidase inhibitor activity(GO:0030414) |
| 0.0 | 0.0 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.0 | 0.0 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.0 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
| 0.0 | 0.1 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.0 | 0.1 | GO:1901567 | icosanoid binding(GO:0050542) fatty acid derivative binding(GO:1901567) |
| 0.0 | 1.0 | GO:0001012 | RNA polymerase II regulatory region DNA binding(GO:0001012) |
| 0.0 | 0.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.0 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
| 0.0 | 0.1 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
| 0.0 | 0.1 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.1 | GO:0019865 | immunoglobulin binding(GO:0019865) |
| 0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
| 0.0 | 0.1 | GO:0001848 | complement binding(GO:0001848) |
| 0.0 | 0.1 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.4 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.2 | 0.7 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.2 | 1.3 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.2 | 4.5 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 0.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 5.4 | PID BMP PATHWAY | BMP receptor signaling |
| 0.1 | 0.1 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.1 | 5.1 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.1 | 0.2 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.1 | 1.4 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 2.9 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.1 | 1.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 4.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.1 | 1.2 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.1 | 0.7 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 0.5 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.1 | 2.5 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 2.1 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.1 | 0.2 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 2.0 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.1 | 3.0 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.1 | 2.6 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.1 | 0.2 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.1 | 0.4 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 2.7 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 1.0 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.1 | 0.7 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 1.2 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.1 | 1.0 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.1 | 0.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.1 | 1.9 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.1 | 1.5 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.1 | 0.5 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.1 | 0.4 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.1 | 2.3 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.1 | 0.6 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.1 | 0.4 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.1 | 2.8 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.1 | 3.1 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.1 | 1.7 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 1.0 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 0.4 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.0 | 0.1 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 0.0 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 1.4 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.3 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.0 | 0.5 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 0.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 1.2 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.3 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.0 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.2 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.7 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.6 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 1.2 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.7 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 0.2 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 1.4 | PID CMYB PATHWAY | C-MYB transcription factor network |
| 0.0 | 0.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.7 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 0.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 0.1 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.3 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.0 | 0.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.0 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.5 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 0.9 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.1 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 0.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.2 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.0 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.0 | 0.1 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 0.0 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.0 | 0.3 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.2 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.0 | 0.6 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.2 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 2.8 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.0 | 0.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.1 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.0 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 0.1 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 0.2 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.0 | 0.3 | PID P53 REGULATION PATHWAY | p53 pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 4.5 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.2 | 4.3 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.2 | 2.7 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.2 | 1.8 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.2 | 3.7 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.1 | 1.6 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.1 | 4.0 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.1 | 1.5 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.1 | 1.8 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.1 | 1.0 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.1 | 1.5 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.1 | 1.8 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.1 | 3.3 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.1 | 1.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 1.2 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 0.2 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.1 | 0.7 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.1 | 1.1 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 1.7 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.1 | 0.7 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.1 | 0.2 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.1 | 0.7 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.1 | 0.4 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.1 | 0.7 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
| 0.1 | 0.3 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.1 | 1.0 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 1.0 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.1 | 0.4 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 0.6 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 1.5 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
| 0.1 | 4.2 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.1 | 0.7 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.1 | 0.1 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
| 0.1 | 0.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 1.8 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
| 0.1 | 1.4 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.1 | 1.0 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 1.0 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 0.8 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.1 | 0.6 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 1.0 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 0.8 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 0.6 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 1.6 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.1 | 1.2 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.1 | 0.9 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 0.6 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 0.9 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.1 | 0.2 | REACTOME SIGNALING BY FGFR IN DISEASE | Genes involved in Signaling by FGFR in disease |
| 0.1 | 0.2 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.1 | 0.6 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.1 | 1.7 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.1 | 0.6 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.1 | 5.5 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.1 | 0.8 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.1 | 0.4 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.1 | 0.9 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.1 | 0.6 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.1 | 0.2 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.1 | 1.2 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.1 | 0.6 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.1 | 1.3 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.1 | 0.6 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 0.3 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.1 | 1.0 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.1 | 0.6 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.1 | 1.2 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 1.3 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.4 | REACTOME SLC MEDIATED TRANSMEMBRANE TRANSPORT | Genes involved in SLC-mediated transmembrane transport |
| 0.0 | 0.0 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.2 | REACTOME NEGATIVE REGULATION OF FGFR SIGNALING | Genes involved in Negative regulation of FGFR signaling |
| 0.0 | 0.6 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 0.0 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.4 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 4.1 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 1.3 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.0 | 0.7 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 0.4 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.3 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.0 | 0.2 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 0.3 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.5 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.1 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.0 | 3.5 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.4 | REACTOME NUCLEOTIDE BINDING DOMAIN LEUCINE RICH REPEAT CONTAINING RECEPTOR NLR SIGNALING PATHWAYS | Genes involved in Nucleotide-binding domain, leucine rich repeat containing receptor (NLR) signaling pathways |
| 0.0 | 1.0 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 1.0 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.6 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
| 0.0 | 1.2 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.0 | 0.1 | REACTOME PLATELET ACTIVATION SIGNALING AND AGGREGATION | Genes involved in Platelet activation, signaling and aggregation |
| 0.0 | 1.4 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.0 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.0 | 0.1 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.4 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.0 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.0 | 0.1 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
| 0.0 | 2.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.0 | 0.2 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 0.1 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
| 0.0 | 0.1 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 0.6 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.1 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
| 0.0 | 0.1 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 0.6 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.1 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.0 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
| 0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 1.0 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.4 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
| 0.0 | 0.1 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
| 0.0 | 0.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.0 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.0 | 0.6 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.2 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 0.4 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
| 0.0 | 0.5 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.0 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
| 0.0 | 0.8 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.9 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.0 | 0.0 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 0.2 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.0 | 0.3 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.0 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.0 | 0.2 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.0 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 0.0 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 0.3 | REACTOME TELOMERE MAINTENANCE | Genes involved in Telomere Maintenance |
| 0.0 | 0.2 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.0 | 0.5 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
| 0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 0.0 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.0 | 0.2 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.0 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.0 | 0.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 0.2 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |