| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Runx3
|
ENSMUSG00000070691.4 | runt related transcription factor 3 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr4_135203168_135204139 | Runx3 | 49217 | 0.097697 | -0.45 | 2.6e-04 | Click! |
| chr4_135151521_135151692 | Runx3 | 890 | 0.559566 | -0.35 | 6.2e-03 | Click! |
| chr4_135205862_135206765 | Runx3 | 51877 | 0.092536 | 0.32 | 1.2e-02 | Click! |
| chr4_135121834_135122083 | Runx3 | 1306 | 0.340435 | -0.26 | 4.8e-02 | Click! |
| chr4_135159006_135159213 | Runx3 | 4673 | 0.194491 | -0.24 | 6.1e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr15_72546044_72547992 | 3.20 |
Kcnk9 |
potassium channel, subfamily K, member 9 |
678 |
0.75 |
| chr9_91361494_91362853 | 2.94 |
Zic4 |
zinc finger protein of the cerebellum 4 |
240 |
0.8 |
| chr15_82255980_82257145 | 2.68 |
1500009C09Rik |
RIKEN cDNA 1500009C09 gene |
539 |
0.56 |
| chr8_41052368_41053980 | 2.62 |
Gm16193 |
predicted gene 16193 |
64 |
0.96 |
| chr7_79498955_79500626 | 2.46 |
Mir9-3hg |
Mir9-3 host gene |
236 |
0.84 |
| chr19_47019038_47019748 | 2.10 |
Nt5c2 |
5'-nucleotidase, cytosolic II |
4240 |
0.14 |
| chr6_93911120_93911271 | 2.04 |
Magi1 |
membrane associated guanylate kinase, WW and PDZ domain containing 1 |
1309 |
0.53 |
| chr5_30711890_30712870 | 1.82 |
Dpysl5 |
dihydropyrimidinase-like 5 |
479 |
0.75 |
| chr15_91017138_91018295 | 1.79 |
Kif21a |
kinesin family member 21A |
32102 |
0.16 |
| chr12_102554994_102555248 | 1.77 |
Chga |
chromogranin A |
135 |
0.95 |
| chr14_122484799_122486138 | 1.72 |
Gm10837 |
predicted gene 10837 |
5118 |
0.12 |
| chr11_108606161_108607110 | 1.69 |
Cep112 |
centrosomal protein 112 |
1408 |
0.5 |
| chr12_118848802_118850409 | 1.68 |
Sp8 |
trans-acting transcription factor 8 |
2019 |
0.36 |
| chr1_42707054_42709031 | 1.63 |
Pantr2 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 2 |
10 |
0.97 |
| chr8_125897868_125898882 | 1.59 |
Pcnx2 |
pecanex homolog 2 |
58 |
0.88 |
| chr7_16921141_16922156 | 1.58 |
Calm3 |
calmodulin 3 |
2181 |
0.15 |
| chr14_48665732_48667167 | 1.57 |
Otx2 |
orthodenticle homeobox 2 |
928 |
0.34 |
| chr9_69758963_69761490 | 1.57 |
Foxb1 |
forkhead box B1 |
714 |
0.5 |
| chrX_58033180_58034063 | 1.56 |
Zic3 |
zinc finger protein of the cerebellum 3 |
2611 |
0.36 |
| chr9_91363965_91365514 | 1.55 |
Zic1 |
zinc finger protein of the cerebellum 1 |
1029 |
0.35 |
| chr15_71727651_71728452 | 1.52 |
Fam135b |
family with sequence similarity 135, member B |
213 |
0.95 |
| chr9_91380308_91380994 | 1.50 |
Gm37477 |
predicted gene, 37477 |
751 |
0.48 |
| chr2_29845262_29846623 | 1.49 |
Mir219a-2 |
microRNA 219a-2 |
215 |
0.56 |
| chr11_81634965_81635201 | 1.49 |
Gm11418 |
predicted gene 11418 |
47722 |
0.16 |
| chr4_91374442_91375761 | 1.44 |
Elavl2 |
ELAV like RNA binding protein 1 |
1206 |
0.41 |
| chr13_99446279_99447668 | 1.38 |
Map1b |
microtubule-associated protein 1B |
647 |
0.72 |
| chr16_77422348_77423278 | 1.34 |
9430053O09Rik |
RIKEN cDNA 9430053O09 gene |
993 |
0.4 |
| chr5_45493120_45493418 | 1.32 |
Lap3 |
leucine aminopeptidase 3 |
105 |
0.95 |
| chr17_72601322_72601675 | 1.28 |
Alk |
anaplastic lymphoma kinase |
2329 |
0.39 |
| chr2_28514501_28514925 | 1.27 |
Ralgds |
ral guanine nucleotide dissociation stimulator |
1387 |
0.27 |
| chr8_12947702_12949640 | 1.26 |
Mcf2l |
mcf.2 transforming sequence-like |
718 |
0.37 |
| chr13_105444000_105445296 | 1.26 |
Htr1a |
5-hydroxytryptamine (serotonin) receptor 1A |
1009 |
0.69 |
| chr7_92984620_92985508 | 1.23 |
Gm31663 |
predicted gene, 31663 |
3012 |
0.25 |
| chr18_77563866_77564228 | 1.20 |
Rnf165 |
ring finger protein 165 |
562 |
0.8 |
| chr4_142475203_142476218 | 1.19 |
Gm13052 |
predicted gene 13052 |
129235 |
0.05 |
| chr1_193034527_193035885 | 1.18 |
Syt14 |
synaptotagmin XIV |
438 |
0.79 |
| chr4_32921019_32921195 | 1.13 |
Ankrd6 |
ankyrin repeat domain 6 |
2348 |
0.26 |
| chr4_124659206_124660160 | 1.13 |
Gm2164 |
predicted gene 2164 |
2514 |
0.16 |
| chr3_88206822_88208169 | 1.12 |
Gm3764 |
predicted gene 3764 |
183 |
0.86 |
| chr14_30717679_30718013 | 1.11 |
Sfmbt1 |
Scm-like with four mbt domains 1 |
1355 |
0.4 |
| chr11_22006485_22009037 | 1.10 |
Otx1 |
orthodenticle homeobox 1 |
4864 |
0.28 |
| chr6_136167149_136168437 | 1.09 |
Grin2b |
glutamate receptor, ionotropic, NMDA2B (epsilon 2) |
4096 |
0.25 |
| chr7_44973695_44975193 | 1.09 |
Cpt1c |
carnitine palmitoyltransferase 1c |
331 |
0.61 |
| chr11_34276664_34276936 | 1.08 |
4930403D09Rik |
RIKEN cDNA 4930403D09 gene |
22907 |
0.17 |
| chr13_84058778_84060954 | 1.07 |
Gm17750 |
predicted gene, 17750 |
4906 |
0.24 |
| chr8_48646539_48646802 | 1.06 |
Gm45772 |
predicted gene 45772 |
15501 |
0.24 |
| chr14_20181864_20182094 | 1.04 |
Kcnk5 |
potassium channel, subfamily K, member 5 |
170 |
0.93 |
| chrX_20919797_20921410 | 1.03 |
Syn1 |
synapsin I |
315 |
0.81 |
| chr13_56895147_56895774 | 1.02 |
Trpc7 |
transient receptor potential cation channel, subfamily C, member 7 |
277 |
0.94 |
| chr8_12323727_12324134 | 1.01 |
Gm33175 |
predicted gene, 33175 |
4450 |
0.19 |
| chr11_103966762_103967805 | 1.00 |
Arf2 |
ADP-ribosylation factor 2 |
412 |
0.86 |
| chrX_109113551_109114201 | 0.98 |
Sh3bgrl |
SH3-binding domain glutamic acid-rich protein like |
96 |
0.97 |
| chrX_110817183_110817473 | 0.97 |
Pou3f4 |
POU domain, class 3, transcription factor 4 |
3048 |
0.3 |
| chr14_34821027_34821671 | 0.97 |
Grid1 |
glutamate receptor, ionotropic, delta 1 |
1241 |
0.48 |
| chr1_42697532_42698715 | 0.96 |
Pou3f3 |
POU domain, class 3, transcription factor 3 |
2355 |
0.2 |
| chr13_119693303_119694247 | 0.96 |
Hmgcs1 |
3-hydroxy-3-methylglutaryl-Coenzyme A synthase 1 |
3311 |
0.15 |
| chr11_60141098_60141590 | 0.96 |
Rai1 |
retinoic acid induced 1 |
1085 |
0.44 |
| chr4_127988222_127989180 | 0.96 |
Csmd2 |
CUB and Sushi multiple domains 2 |
657 |
0.77 |
| chr15_100871055_100872065 | 0.95 |
Scn8a |
sodium channel, voltage-gated, type VIII, alpha |
140 |
0.96 |
| chr14_122474810_122475253 | 0.95 |
2610035F20Rik |
RIKEN cDNA 2610035F20 gene |
168 |
0.73 |
| chr1_39312490_39312936 | 0.94 |
Gm3617 |
predicted gene 3617 |
2186 |
0.27 |
| chr4_12089420_12090502 | 0.93 |
Tmem67 |
transmembrane protein 67 |
59 |
0.88 |
| chr15_75622100_75622251 | 0.92 |
Zfp41 |
zinc finger protein 41 |
464 |
0.7 |
| chr4_24429901_24430719 | 0.92 |
Gm27243 |
predicted gene 27243 |
580 |
0.79 |
| chr8_93813521_93813847 | 0.92 |
4930488L21Rik |
RIKEN cDNA 4930488L21 gene |
38 |
0.97 |
| chr9_121718668_121718951 | 0.90 |
Nktr |
natural killer tumor recognition sequence |
360 |
0.76 |
| chr15_89453545_89454765 | 0.90 |
Mapk8ip2 |
mitogen-activated protein kinase 8 interacting protein 2 |
242 |
0.82 |
| chr4_62411517_62411959 | 0.89 |
Prpf4 |
pre-mRNA processing factor 4 |
2941 |
0.16 |
| chr12_3236855_3237648 | 0.89 |
Rab10os |
RAB10, member RAS oncogene family, opposite strand |
640 |
0.66 |
| chr11_99993492_99994171 | 0.89 |
Krtap17-1 |
keratin associated protein 17-1 |
163 |
0.85 |
| chr9_45371849_45372000 | 0.88 |
Fxyd6 |
FXYD domain-containing ion transport regulator 6 |
1482 |
0.29 |
| chr19_6504206_6504766 | 0.88 |
Nrxn2 |
neurexin II |
6651 |
0.12 |
| chr2_157914223_157915670 | 0.88 |
Vstm2l |
V-set and transmembrane domain containing 2-like |
293 |
0.91 |
| chr6_29347427_29347925 | 0.88 |
Calu |
calumenin |
393 |
0.76 |
| chr3_34640614_34641420 | 0.87 |
Gm42692 |
predicted gene 42692 |
2247 |
0.16 |
| chr1_172484027_172485046 | 0.86 |
Igsf9 |
immunoglobulin superfamily, member 9 |
2222 |
0.17 |
| chr4_12140307_12141317 | 0.86 |
Rbm12b1 |
RNA binding motif protein 12 B1 |
495 |
0.7 |
| chr18_55786289_55786440 | 0.86 |
Gm26959 |
predicted gene, 26959 |
40136 |
0.15 |
| chr11_78322615_78324056 | 0.85 |
Aldoc |
aldolase C, fructose-bisphosphate |
167 |
0.88 |
| chr8_112427534_112428308 | 0.85 |
Gm26994 |
predicted gene, 26994 |
141654 |
0.05 |
| chr8_122567353_122567849 | 0.85 |
Cdt1 |
chromatin licensing and DNA replication factor 1 |
414 |
0.69 |
| chr12_118296552_118297427 | 0.85 |
Sp4 |
trans-acting transcription factor 4 |
4379 |
0.3 |
| chr2_52557337_52558561 | 0.84 |
Cacnb4 |
calcium channel, voltage-dependent, beta 4 subunit |
611 |
0.74 |
| chr11_35797548_35798866 | 0.84 |
Fbll1 |
fibrillarin-like 1 |
677 |
0.62 |
| chr11_32001099_32002296 | 0.83 |
Nsg2 |
neuron specific gene family member 2 |
1195 |
0.52 |
| chr3_34652462_34653573 | 0.83 |
Sox2 |
SRY (sex determining region Y)-box 2 |
2612 |
0.16 |
| chr7_19332743_19333272 | 0.83 |
Gm44698 |
predicted gene 44698 |
122 |
0.89 |
| chr10_73100287_73100438 | 0.81 |
Pcdh15 |
protocadherin 15 |
909 |
0.63 |
| chr11_100758699_100760184 | 0.81 |
Kcnh4 |
potassium voltage-gated channel, subfamily H (eag-related), member 4 |
299 |
0.8 |
| chr6_72347051_72347567 | 0.81 |
0610030E20Rik |
RIKEN cDNA 0610030E20 gene |
8 |
0.93 |
| chr7_79509558_79510143 | 0.81 |
A330074H02Rik |
RIKEN cDNA A330074H02 gene |
512 |
0.59 |
| chr2_67488870_67489094 | 0.81 |
Gm13601 |
predicted gene 13601 |
27543 |
0.15 |
| chr8_94773371_94773522 | 0.81 |
Cx3cl1 |
chemokine (C-X3-C motif) ligand 1 |
1221 |
0.33 |
| chr11_93098807_93100169 | 0.80 |
Car10 |
carbonic anhydrase 10 |
198 |
0.97 |
| chr4_91400388_91400985 | 0.80 |
Elavl2 |
ELAV like RNA binding protein 1 |
99 |
0.97 |
| chr11_5761631_5762115 | 0.80 |
Ube2d-ps |
ubiquitin-conjugating enzyme E2D, pseudogene |
256 |
0.68 |
| chr1_185454578_185455807 | 0.79 |
Slc30a10 |
solute carrier family 30, member 10 |
154 |
0.74 |
| chr18_69595622_69596635 | 0.79 |
Tcf4 |
transcription factor 4 |
1946 |
0.44 |
| chr16_18623306_18623939 | 0.79 |
Gm49601 |
predicted gene, 49601 |
18 |
0.95 |
| chr10_81024569_81025640 | 0.78 |
Gm16099 |
predicted gene 16099 |
21 |
0.8 |
| chr3_87999404_88000408 | 0.78 |
Bcan |
brevican |
272 |
0.82 |
| chr11_21995570_21998947 | 0.78 |
Otx1 |
orthodenticle homeobox 1 |
4357 |
0.28 |
| chr7_142094181_142095425 | 0.77 |
Dusp8 |
dual specificity phosphatase 8 |
469 |
0.54 |
| chr14_79298239_79299672 | 0.76 |
Rgcc |
regulator of cell cycle |
2690 |
0.24 |
| chr4_132535597_132536487 | 0.76 |
Dnajc8 |
DnaJ heat shock protein family (Hsp40) member C8 |
14 |
0.95 |
| chr2_158611997_158612747 | 0.75 |
Gm14205 |
predicted gene 14205 |
552 |
0.57 |
| chr17_56992409_56992921 | 0.75 |
Clpp |
caseinolytic mitochondrial matrix peptidase proteolytic subunit |
2273 |
0.12 |
| chr7_143598603_143598754 | 0.75 |
Cars |
cysteinyl-tRNA synthetase |
1003 |
0.3 |
| chr7_79513467_79513995 | 0.74 |
2900037B21Rik |
RIKEN cDNA 2900037B21 gene |
807 |
0.36 |
| chr4_103324966_103325484 | 0.74 |
Oma1 |
OMA1 zinc metallopeptidase |
741 |
0.65 |
| chr9_106654009_106654708 | 0.74 |
Grm2 |
glutamate receptor, metabotropic 2 |
1722 |
0.25 |
| chr6_103513736_103514218 | 0.74 |
Chl1 |
cell adhesion molecule L1-like |
2647 |
0.25 |
| chr5_115438447_115439259 | 0.74 |
4930430O22Rik |
RIKEN cDNA 4930430O22 gene |
2209 |
0.13 |
| chr14_32596775_32596926 | 0.73 |
Gm49743 |
predicted gene, 49743 |
1517 |
0.34 |
| chr15_64915026_64915587 | 0.72 |
Adcy8 |
adenylate cyclase 8 |
6965 |
0.27 |
| chr15_76721855_76722516 | 0.72 |
Lrrc24 |
leucine rich repeat containing 24 |
12 |
0.92 |
| chr3_69178306_69178458 | 0.71 |
Arl14 |
ADP-ribosylation factor-like 14 |
44037 |
0.1 |
| chr5_123142167_123142508 | 0.71 |
Setd1b |
SET domain containing 1B |
144 |
0.83 |
| chr11_80481116_80481835 | 0.71 |
Cdk5r1 |
cyclin-dependent kinase 5, regulatory subunit 1 (p35) |
4419 |
0.21 |
| chr2_4017802_4019015 | 0.71 |
Frmd4a |
FERM domain containing 4A |
664 |
0.68 |
| chrX_73869730_73869881 | 0.71 |
L1cam |
L1 cell adhesion molecule |
1 |
0.96 |
| chr2_151740406_151741591 | 0.70 |
Psmf1 |
proteasome (prosome, macropain) inhibitor subunit 1 |
295 |
0.85 |
| chr8_105469813_105470589 | 0.70 |
Tppp3 |
tubulin polymerization-promoting protein family member 3 |
791 |
0.45 |
| chr10_79754764_79755450 | 0.70 |
Fgf22 |
fibroblast growth factor 22 |
30 |
0.93 |
| chr3_89159053_89160201 | 0.70 |
Hcn3 |
hyperpolarization-activated, cyclic nucleotide-gated K+ 3 |
353 |
0.68 |
| chr5_9722290_9722822 | 0.69 |
Grm3 |
glutamate receptor, metabotropic 3 |
2614 |
0.32 |
| chr17_42315796_42317065 | 0.69 |
Ptchd4 |
patched domain containing 4 |
170 |
0.98 |
| chr14_55884975_55885203 | 0.69 |
Khnyn |
KH and NYN domain containing |
72 |
0.89 |
| chr7_28907314_28907465 | 0.68 |
Actn4 |
actinin alpha 4 |
4 |
0.95 |
| chr14_69304510_69304838 | 0.68 |
Synb |
syncytin b |
10375 |
0.09 |
| chr11_105944483_105944656 | 0.67 |
Cyb561 |
cytochrome b-561 |
82 |
0.92 |
| chr4_153188389_153189047 | 0.67 |
Gm13174 |
predicted gene 13174 |
29458 |
0.21 |
| chr7_141069915_141071420 | 0.67 |
B4galnt4 |
beta-1,4-N-acetyl-galactosaminyl transferase 4 |
65 |
0.93 |
| chr5_70842167_70842810 | 0.67 |
Gabrg1 |
gamma-aminobutyric acid (GABA) A receptor, subunit gamma 1 |
129 |
0.98 |
| chr6_97938208_97938822 | 0.67 |
Mitf |
melanogenesis associated transcription factor |
2403 |
0.38 |
| chrX_52369779_52370443 | 0.66 |
Mir6384 |
microRNA 6384 |
8070 |
0.24 |
| chr5_20950714_20951763 | 0.66 |
A630072M18Rik |
RIKEN cDNA A630072M18 gene |
249 |
0.75 |
| chr6_54565526_54566892 | 0.66 |
Scrn1 |
secernin 1 |
280 |
0.9 |
| chr14_118234662_118235031 | 0.66 |
Gm4675 |
predicted gene 4675 |
1386 |
0.29 |
| chr2_105680581_105683424 | 0.66 |
Pax6 |
paired box 6 |
290 |
0.89 |
| chr4_22497544_22499061 | 0.66 |
Gm30731 |
predicted gene, 30731 |
7754 |
0.16 |
| chr4_141545169_141545853 | 0.66 |
B330016D10Rik |
RIKEN cDNA B330016D10 gene |
678 |
0.6 |
| chr13_35756745_35757212 | 0.65 |
Cdyl |
chromodomain protein, Y chromosome-like |
5834 |
0.19 |
| chr4_91399504_91400258 | 0.65 |
Elavl2 |
ELAV like RNA binding protein 1 |
95 |
0.97 |
| chr7_79502506_79503035 | 0.65 |
Mir9-3 |
microRNA 9-3 |
2494 |
0.13 |
| chrX_153498276_153500343 | 0.65 |
Ubqln2 |
ubiquilin 2 |
1082 |
0.51 |
| chr9_66916068_66916925 | 0.64 |
Rab8b |
RAB8B, member RAS oncogene family |
3191 |
0.21 |
| chr2_91269695_91269884 | 0.64 |
Arfgap2 |
ADP-ribosylation factor GTPase activating protein 2 |
303 |
0.84 |
| chr13_14521332_14521483 | 0.64 |
Gm30893 |
predicted gene, 30893 |
79 |
0.63 |
| chr13_28783043_28783194 | 0.64 |
Gm17528 |
predicted gene, 17528 |
44005 |
0.14 |
| chr14_69522759_69523087 | 0.64 |
Gm27179 |
predicted gene 27179 |
10374 |
0.1 |
| chr17_24352004_24352962 | 0.64 |
Abca3 |
ATP-binding cassette, sub-family A (ABC1), member 3 |
381 |
0.7 |
| chr6_83316808_83317533 | 0.64 |
Gm43890 |
predicted gene, 43890 |
227 |
0.64 |
| chr8_57511933_57512362 | 0.64 |
Hmgb2 |
high mobility group box 2 |
173 |
0.9 |
| chr7_31148581_31149219 | 0.63 |
G630030J09Rik |
RIKEN cDNA G630030J09 gene |
628 |
0.51 |
| chr10_63431727_63431878 | 0.63 |
Ctnna3 |
catenin (cadherin associated protein), alpha 3 |
1704 |
0.29 |
| chr7_16611263_16612711 | 0.62 |
Gm29443 |
predicted gene 29443 |
1837 |
0.17 |
| chr5_114131195_114131651 | 0.62 |
Ung |
uracil DNA glycosylase |
194 |
0.89 |
| chr15_25622246_25622550 | 0.62 |
Myo10 |
myosin X |
127 |
0.96 |
| chr2_5061458_5061698 | 0.61 |
Optn |
optineurin |
2360 |
0.26 |
| chr19_19108280_19109261 | 0.61 |
Rorb |
RAR-related orphan receptor beta |
2426 |
0.42 |
| chr16_91837314_91837722 | 0.61 |
Itsn1 |
intersectin 1 (SH3 domain protein 1A) |
2181 |
0.29 |
| chr8_121901506_121902885 | 0.61 |
Slc7a5 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 5 |
5499 |
0.11 |
| chr13_34125172_34126139 | 0.61 |
Tubb2b |
tubulin, beta 2B class IIB |
4699 |
0.12 |
| chr17_34026031_34026497 | 0.60 |
H2-Ke6 |
H2-K region expressed gene 6 |
494 |
0.34 |
| chr3_38888573_38888874 | 0.60 |
C230034O21Rik |
RIKEN cDNA C230034O21 gene |
464 |
0.8 |
| chr8_54723932_54725109 | 0.60 |
Wdr17 |
WD repeat domain 17 |
16 |
0.98 |
| chr1_132190552_132191723 | 0.60 |
Lemd1 |
LEM domain containing 1 |
294 |
0.49 |
| chr4_154960570_154962200 | 0.60 |
Gm20421 |
predicted gene 20421 |
293 |
0.57 |
| chr8_121832688_121832893 | 0.60 |
Gm42047 |
predicted gene, 42047 |
457 |
0.66 |
| chr8_121904943_121905414 | 0.59 |
Slc7a5 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 5 |
2516 |
0.15 |
| chr7_4919002_4919261 | 0.59 |
Nat14 |
N-acetyltransferase 14 |
2897 |
0.1 |
| chr12_53915674_53916197 | 0.59 |
1700060O08Rik |
RIKEN cDNA 1700060O08 gene |
163457 |
0.04 |
| chr11_75678848_75679065 | 0.59 |
Crk |
v-crk avian sarcoma virus CT10 oncogene homolog |
303 |
0.85 |
| chr11_84915695_84916573 | 0.59 |
Znhit3 |
zinc finger, HIT type 3 |
171 |
0.93 |
| chr8_12397237_12397733 | 0.58 |
Gm25239 |
predicted gene, 25239 |
1082 |
0.38 |
| chr9_113813101_113813610 | 0.58 |
Clasp2 |
CLIP associating protein 2 |
755 |
0.71 |
| chr13_34126566_34127191 | 0.58 |
Tubb2b |
tubulin, beta 2B class IIB |
3476 |
0.13 |
| chr1_71102972_71103639 | 0.58 |
Bard1 |
BRCA1 associated RING domain 1 |
159 |
0.97 |
| chr5_112228060_112229152 | 0.58 |
Miat |
myocardial infarction associated transcript (non-protein coding) |
35 |
0.96 |
| chr7_127392975_127393616 | 0.58 |
E430018J23Rik |
RIKEN cDNA E430018J23 gene |
324 |
0.7 |
| chr10_110931584_110932359 | 0.57 |
Csrp2 |
cysteine and glycine-rich protein 2 |
343 |
0.85 |
| chr9_69768961_69769699 | 0.57 |
B230323A14Rik |
RIKEN cDNA B230323A14 gene |
8184 |
0.19 |
| chr15_85676712_85677176 | 0.57 |
Lncppara |
long noncoding RNA near Ppara |
23328 |
0.12 |
| chr16_77597699_77598173 | 0.57 |
Mir99a |
microRNA 99a |
1000 |
0.31 |
| chr7_105425216_105426515 | 0.57 |
Cckbr |
cholecystokinin B receptor |
48 |
0.95 |
| chr5_108549212_108550612 | 0.57 |
Cplx1 |
complexin 1 |
88 |
0.95 |
| chr7_19749832_19750621 | 0.57 |
Nectin2 |
nectin cell adhesion molecule 2 |
257 |
0.8 |
| chrX_136270666_136271437 | 0.56 |
Bex3 |
brain expressed X-linked 3 |
276 |
0.83 |
| chr8_71570607_71571137 | 0.56 |
Slc27a1 |
solute carrier family 27 (fatty acid transporter), member 1 |
217 |
0.83 |
| chr1_173365727_173366467 | 0.56 |
Cadm3 |
cell adhesion molecule 3 |
1536 |
0.34 |
| chr3_34643259_34644170 | 0.56 |
Gm42692 |
predicted gene 42692 |
450 |
0.71 |
| chr7_19694992_19695561 | 0.56 |
Apoe |
apolipoprotein E |
2355 |
0.11 |
| chr2_25182643_25183148 | 0.56 |
Gm38287 |
predicted gene, 38287 |
444 |
0.57 |
| chr2_31247299_31247450 | 0.55 |
Ncs1 |
neuronal calcium sensor 1 |
1208 |
0.44 |
| chr18_15061824_15062413 | 0.55 |
Kctd1 |
potassium channel tetramerisation domain containing 1 |
229 |
0.95 |
| chr14_65102803_65102985 | 0.55 |
Extl3 |
exostosin-like glycosyltransferase 3 |
4788 |
0.22 |
| chrX_44367369_44368587 | 0.55 |
Dcaf12l2 |
DDB1 and CUL4 associated factor 12-like 2 |
364 |
0.91 |
| chr4_45824678_45824840 | 0.55 |
Igfbpl1 |
insulin-like growth factor binding protein-like 1 |
2164 |
0.25 |
| chr17_25014833_25015702 | 0.55 |
Cramp1l |
cramped chromatin regulator homolog 1 |
37 |
0.93 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.7 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
| 0.4 | 1.8 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.3 | 1.0 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 0.3 | 0.9 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.3 | 0.8 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.2 | 0.9 | GO:0007412 | axon target recognition(GO:0007412) |
| 0.2 | 0.9 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
| 0.2 | 3.3 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.2 | 1.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.2 | 0.6 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.2 | 1.0 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.2 | 0.7 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.2 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.2 | 0.8 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.2 | 0.5 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.2 | 0.7 | GO:0044849 | estrous cycle(GO:0044849) |
| 0.2 | 0.7 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.2 | 0.5 | GO:0044800 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.2 | 1.5 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.1 | 0.4 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
| 0.1 | 0.4 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.1 | 0.9 | GO:0046958 | nonassociative learning(GO:0046958) |
| 0.1 | 0.4 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.1 | 0.4 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.1 | 0.4 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.1 | 0.4 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.1 | 0.4 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
| 0.1 | 0.8 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.1 | 0.5 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.1 | 0.5 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.1 | 0.5 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
| 0.1 | 0.9 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 | 0.5 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.1 | 0.4 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.1 | 0.4 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.1 | 1.2 | GO:0047497 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
| 0.1 | 0.3 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.1 | 1.0 | GO:0046606 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.1 | 0.9 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 | 1.9 | GO:0006828 | manganese ion transport(GO:0006828) |
| 0.1 | 0.5 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.1 | 0.1 | GO:0021550 | medulla oblongata development(GO:0021550) |
| 0.1 | 0.4 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.1 | 0.2 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.1 | 0.2 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.1 | 0.3 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 0.1 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
| 0.1 | 0.3 | GO:0021586 | pons maturation(GO:0021586) |
| 0.1 | 0.2 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
| 0.1 | 0.6 | GO:1901660 | calcium ion export(GO:1901660) |
| 0.1 | 0.1 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.1 | 3.3 | GO:0007628 | adult walking behavior(GO:0007628) walking behavior(GO:0090659) |
| 0.1 | 0.3 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.1 | 0.4 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.1 | 0.7 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.1 | 0.7 | GO:0032075 | positive regulation of nuclease activity(GO:0032075) |
| 0.1 | 0.3 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.1 | 0.5 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.1 | 0.2 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.1 | 0.2 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.1 | 0.4 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.1 | 0.4 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.1 | 0.2 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.1 | 0.2 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.1 | 0.5 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.1 | 0.2 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.1 | 0.1 | GO:0051665 | membrane raft localization(GO:0051665) |
| 0.1 | 0.2 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.1 | 0.2 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
| 0.1 | 0.6 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.1 | 0.3 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.1 | 0.2 | GO:0050975 | sensory perception of touch(GO:0050975) |
| 0.1 | 0.1 | GO:0042713 | sperm ejaculation(GO:0042713) |
| 0.1 | 0.1 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
| 0.1 | 0.3 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 | 0.4 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.1 | 0.1 | GO:0090259 | regulation of retinal ganglion cell axon guidance(GO:0090259) |
| 0.1 | 0.3 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.1 | 0.5 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
| 0.1 | 0.3 | GO:0006551 | leucine metabolic process(GO:0006551) |
| 0.1 | 0.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.1 | 0.3 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 0.1 | 0.1 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.1 | 0.3 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 | 0.1 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.1 | 0.3 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.1 | 0.1 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
| 0.1 | 0.3 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.1 | 0.5 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.1 | 0.2 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.1 | 0.1 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
| 0.1 | 0.2 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.1 | 0.3 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.1 | 0.3 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.1 | 0.4 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.1 | 0.5 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.1 | 0.4 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 | 0.4 | GO:2000258 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
| 0.1 | 0.2 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.1 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.1 | 0.5 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
| 0.1 | 0.1 | GO:0097106 | postsynaptic density organization(GO:0097106) postsynaptic density assembly(GO:0097107) |
| 0.1 | 0.3 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
| 0.1 | 0.2 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.1 | 0.2 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
| 0.1 | 0.2 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 0.6 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.1 | 0.2 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 | 0.3 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.1 | 1.1 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.1 | 0.2 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.1 | 0.3 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
| 0.1 | 0.2 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 0.1 | 0.2 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.1 | 0.5 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.1 | 0.3 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.1 | 0.3 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 | 0.3 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.1 | 0.2 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.1 | 0.3 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 | 0.2 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.1 | 0.2 | GO:0009838 | abscission(GO:0009838) |
| 0.1 | 1.3 | GO:0010259 | multicellular organism aging(GO:0010259) |
| 0.1 | 0.3 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.1 | 0.1 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.1 | 0.2 | GO:0001812 | positive regulation of type I hypersensitivity(GO:0001812) |
| 0.1 | 0.2 | GO:1903751 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.1 | 0.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.1 | 0.6 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.0 | 0.1 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.0 | 0.1 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.0 | 0.1 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
| 0.0 | 0.2 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.0 | 0.1 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.0 | 0.1 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
| 0.0 | 0.1 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.0 | 0.5 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.0 | 0.2 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.0 | 0.3 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
| 0.0 | 0.3 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
| 0.0 | 0.1 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.0 | 0.1 | GO:1902267 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.0 | 0.4 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
| 0.0 | 0.2 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
| 0.0 | 0.2 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.1 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.0 | 0.1 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.0 | 0.2 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.0 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.0 | 0.0 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
| 0.0 | 0.2 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.1 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
| 0.0 | 0.2 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
| 0.0 | 0.2 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.3 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.0 | 0.2 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.0 | 0.2 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 0.3 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.0 | 0.2 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.3 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.0 | 0.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.0 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.0 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.0 | 0.4 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.0 | 0.2 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.0 | 0.1 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.0 | 0.8 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.2 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.0 | 0.2 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 | 0.3 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 | 0.3 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.0 | 0.2 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.0 | 0.3 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.0 | 0.1 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.0 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.0 | 0.3 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 | 0.3 | GO:0021559 | trigeminal nerve development(GO:0021559) |
| 0.0 | 0.3 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.0 | 0.5 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 0.3 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
| 0.0 | 0.0 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
| 0.0 | 0.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.0 | 0.3 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.1 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.3 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 | 0.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.4 | GO:0035493 | SNARE complex assembly(GO:0035493) |
| 0.0 | 0.8 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
| 0.0 | 0.6 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.0 | 1.1 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
| 0.0 | 0.2 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
| 0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.3 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
| 0.0 | 0.1 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.0 | 0.2 | GO:0002431 | Fc receptor mediated stimulatory signaling pathway(GO:0002431) |
| 0.0 | 0.2 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.0 | 0.1 | GO:1902430 | negative regulation of beta-amyloid formation(GO:1902430) |
| 0.0 | 0.4 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
| 0.0 | 0.1 | GO:0038202 | TORC1 signaling(GO:0038202) regulation of TORC1 signaling(GO:1903432) |
| 0.0 | 0.5 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.1 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.0 | 0.1 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.0 | 0.3 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.0 | 0.2 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.0 | 0.0 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.0 | 0.1 | GO:0010424 | DNA methylation on cytosine within a CG sequence(GO:0010424) DNA methylation on cytosine(GO:0032776) |
| 0.0 | 0.2 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.0 | 0.1 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
| 0.0 | 0.1 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.0 | 0.1 | GO:0015817 | histidine transport(GO:0015817) |
| 0.0 | 0.3 | GO:0036006 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
| 0.0 | 0.2 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.0 | 0.4 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 0.4 | GO:0080111 | DNA demethylation(GO:0080111) |
| 0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.0 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.0 | 0.1 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
| 0.0 | 0.2 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
| 0.0 | 0.1 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.0 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 0.0 | 0.3 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.0 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.0 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 | 0.1 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.0 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.0 | 0.4 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.0 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
| 0.0 | 0.1 | GO:0035524 | proline transmembrane transport(GO:0035524) |
| 0.0 | 0.1 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
| 0.0 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.0 | 0.1 | GO:0072422 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
| 0.0 | 0.1 | GO:0002254 | kinin cascade(GO:0002254) |
| 0.0 | 0.2 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.0 | 0.1 | GO:1902219 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.0 | 0.1 | GO:0035902 | response to immobilization stress(GO:0035902) |
| 0.0 | 0.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 | 0.2 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.0 | 0.8 | GO:0051703 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
| 0.0 | 0.0 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) |
| 0.0 | 0.2 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.0 | 0.1 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.0 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.0 | 0.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.4 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.0 | 0.1 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.0 | 0.6 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.0 | 0.2 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.0 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.0 | 0.1 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.0 | 0.6 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.1 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.0 | 0.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.0 | 0.8 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.0 | 0.3 | GO:0015813 | L-glutamate transport(GO:0015813) |
| 0.0 | 0.1 | GO:0006244 | pyrimidine nucleotide catabolic process(GO:0006244) |
| 0.0 | 0.1 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.0 | 0.1 | GO:0048162 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.0 | 0.1 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.0 | 0.1 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.0 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
| 0.0 | 0.1 | GO:0010446 | response to alkaline pH(GO:0010446) |
| 0.0 | 0.1 | GO:0015884 | folic acid transport(GO:0015884) |
| 0.0 | 0.1 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.0 | 0.2 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
| 0.0 | 0.1 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.0 | 0.2 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.0 | 0.1 | GO:0006569 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
| 0.0 | 0.3 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.0 | 0.2 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.0 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.0 | 0.0 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.0 | 0.1 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.0 | 0.3 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.2 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.1 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.0 | 0.1 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.0 | 0.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.0 | 0.1 | GO:0046599 | regulation of centriole replication(GO:0046599) |
| 0.0 | 0.1 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
| 0.0 | 0.1 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
| 0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
| 0.0 | 0.3 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 | 0.4 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.0 | 0.1 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.0 | 0.1 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.0 | 0.1 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.0 | 0.8 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.0 | 0.1 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.0 | 0.1 | GO:0019042 | viral latency(GO:0019042) |
| 0.0 | 0.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.0 | 0.1 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.0 | 0.1 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 0.0 | 0.2 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 | 0.0 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.0 | 0.2 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.2 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.0 | 0.1 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.0 | 0.1 | GO:0035697 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) |
| 0.0 | 0.0 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.0 | 0.1 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.0 | 0.1 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.0 | 0.0 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.1 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
| 0.0 | 0.0 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 | 0.1 | GO:0006522 | alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) |
| 0.0 | 0.0 | GO:0051788 | response to misfolded protein(GO:0051788) |
| 0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.0 | 0.1 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.0 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
| 0.0 | 0.1 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.0 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
| 0.0 | 1.0 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
| 0.0 | 0.7 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
| 0.0 | 0.0 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.0 | 0.0 | GO:0043307 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
| 0.0 | 0.1 | GO:0010998 | regulation of translational initiation by eIF2 alpha phosphorylation(GO:0010998) |
| 0.0 | 0.0 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
| 0.0 | 0.1 | GO:1901626 | regulation of postsynaptic membrane organization(GO:1901626) |
| 0.0 | 0.1 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 | 0.1 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.0 | 0.1 | GO:0010916 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
| 0.0 | 0.2 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.3 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.0 | 0.0 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
| 0.0 | 0.1 | GO:0002591 | positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
| 0.0 | 0.1 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.0 | 0.0 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.1 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
| 0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.0 | 0.0 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.0 | 0.1 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
| 0.0 | 0.1 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.0 | 0.1 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
| 0.0 | 0.0 | GO:0061549 | sympathetic ganglion development(GO:0061549) |
| 0.0 | 0.1 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.0 | 0.2 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
| 0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.0 | 0.1 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
| 0.0 | 0.1 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.0 | 0.2 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.0 | 0.0 | GO:0044027 | DNA hypermethylation(GO:0044026) hypermethylation of CpG island(GO:0044027) |
| 0.0 | 0.0 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.0 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.0 | 0.0 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
| 0.0 | 0.3 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 0.0 | 0.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.0 | 0.1 | GO:0090399 | replicative senescence(GO:0090399) |
| 0.0 | 0.1 | GO:0051775 | response to redox state(GO:0051775) |
| 0.0 | 0.1 | GO:2000343 | positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
| 0.0 | 0.2 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.1 | GO:0019740 | nitrogen utilization(GO:0019740) |
| 0.0 | 0.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.0 | 0.1 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.0 | 0.1 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.0 | 0.2 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.1 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.0 | 0.0 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.0 | 0.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 | 0.4 | GO:0021766 | hippocampus development(GO:0021766) |
| 0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.0 | 0.7 | GO:0022900 | electron transport chain(GO:0022900) |
| 0.0 | 0.1 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
| 0.0 | 0.2 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.0 | 0.1 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
| 0.0 | 0.2 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.4 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.1 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.0 | 0.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.2 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.1 | GO:1902254 | negative regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902254) |
| 0.0 | 0.1 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 0.2 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 | 0.0 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.1 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.0 | 0.4 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.6 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.0 | 0.2 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 | 0.0 | GO:0002485 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 0.0 | 0.1 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.0 | 0.1 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.0 | 0.1 | GO:0015865 | purine nucleotide transport(GO:0015865) |
| 0.0 | 0.2 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.0 | 0.4 | GO:0010107 | potassium ion import(GO:0010107) |
| 0.0 | 0.0 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.0 | 0.2 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 | 0.1 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
| 0.0 | 0.2 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.0 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 0.0 | 0.0 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.0 | 0.3 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.1 | GO:0034349 | glial cell apoptotic process(GO:0034349) |
| 0.0 | 0.0 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.0 | 0.1 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.0 | 0.0 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.0 | 0.1 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.0 | 0.0 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.0 | 0.0 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.0 | 0.3 | GO:0014044 | Schwann cell development(GO:0014044) |
| 0.0 | 0.0 | GO:0022009 | establishment of endothelial blood-brain barrier(GO:0014045) central nervous system vasculogenesis(GO:0022009) |
| 0.0 | 0.2 | GO:0070166 | enamel mineralization(GO:0070166) |
| 0.0 | 0.0 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
| 0.0 | 0.1 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.0 | 0.0 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 | 0.0 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.0 | 0.0 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.0 | 0.1 | GO:0010766 | negative regulation of sodium ion transport(GO:0010766) |
| 0.0 | 0.0 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.1 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
| 0.0 | 0.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 | 0.0 | GO:1904177 | regulation of adipose tissue development(GO:1904177) |
| 0.0 | 0.1 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
| 0.0 | 0.0 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.0 | 0.0 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.1 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.0 | 0.3 | GO:0006482 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
| 0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.0 | 0.0 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.0 | 0.0 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.0 | 0.1 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.0 | GO:2000322 | regulation of glucocorticoid receptor signaling pathway(GO:2000322) |
| 0.0 | 0.1 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
| 0.0 | 0.1 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
| 0.0 | 0.1 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.0 | 0.0 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.0 | 0.1 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 | 0.0 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
| 0.0 | 0.0 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.0 | 0.2 | GO:0036065 | fucosylation(GO:0036065) |
| 0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.0 | 0.0 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.0 | 0.1 | GO:0015816 | glycine transport(GO:0015816) |
| 0.0 | 0.0 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.0 | 0.1 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.0 | 0.0 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
| 0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.1 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
| 0.0 | 0.1 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
| 0.0 | 0.1 | GO:0014047 | glutamate secretion(GO:0014047) |
| 0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.0 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.0 | 0.1 | GO:0043485 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.0 | 0.1 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 | 0.0 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.1 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.0 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.0 | 0.0 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.0 | 0.1 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 0.0 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.0 | 0.0 | GO:0045914 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
| 0.0 | 0.1 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.0 | 0.1 | GO:0031017 | exocrine pancreas development(GO:0031017) |
| 0.0 | 0.1 | GO:0003352 | regulation of cilium movement(GO:0003352) regulation of cilium beat frequency(GO:0003356) |
| 0.0 | 0.0 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.0 | 0.4 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.0 | 0.1 | GO:0031498 | chromatin disassembly(GO:0031498) |
| 0.0 | 0.1 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 0.0 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.0 | 0.0 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.0 | 0.0 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.0 | 0.0 | GO:0031442 | positive regulation of mRNA 3'-end processing(GO:0031442) |
| 0.0 | 0.2 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.0 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.0 | 0.0 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.0 | 0.0 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.0 | 0.0 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.1 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 | 0.1 | GO:0000052 | citrulline metabolic process(GO:0000052) |
| 0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 | 0.0 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.0 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.0 | 0.1 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.0 | 0.0 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.0 | 0.0 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.0 | 0.0 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.1 | GO:0051383 | kinetochore assembly(GO:0051382) kinetochore organization(GO:0051383) |
| 0.0 | 0.0 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 | 0.1 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.0 | 0.1 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.0 | 0.0 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.0 | 0.0 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.0 | 0.1 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
| 0.0 | 0.2 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.0 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
| 0.0 | 0.0 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.0 | 0.3 | GO:0006414 | translational elongation(GO:0006414) |
| 0.0 | 0.0 | GO:0002606 | positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
| 0.0 | 0.3 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.0 | 0.1 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.1 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
| 0.0 | 0.2 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.0 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 | 0.1 | GO:0034088 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.0 | 1.0 | GO:0006457 | protein folding(GO:0006457) |
| 0.0 | 0.1 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.0 | 0.1 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.0 | 0.0 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
| 0.0 | 0.1 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.0 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.0 | 0.1 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.0 | 0.1 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 0.1 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.1 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.0 | 0.0 | GO:0003096 | renal sodium ion transport(GO:0003096) |
| 0.0 | 0.0 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.0 | 0.1 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.0 | 0.1 | GO:0031114 | regulation of microtubule depolymerization(GO:0031114) |
| 0.0 | 0.1 | GO:0060337 | type I interferon signaling pathway(GO:0060337) |
| 0.0 | 0.0 | GO:0044331 | cell-cell adhesion mediated by cadherin(GO:0044331) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.7 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.3 | 0.9 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.2 | 0.8 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.1 | 1.1 | GO:0043203 | axon hillock(GO:0043203) |
| 0.1 | 1.0 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.1 | 0.6 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.1 | 0.5 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.1 | 0.4 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.1 | 0.5 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.1 | 1.0 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.1 | 0.3 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.1 | 0.9 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 0.3 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.1 | 0.3 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.1 | 0.3 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.1 | 0.8 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 1.0 | GO:0036038 | MKS complex(GO:0036038) |
| 0.1 | 0.3 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.1 | 1.0 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 0.1 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
| 0.1 | 0.9 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.1 | 0.4 | GO:0070820 | tertiary granule(GO:0070820) |
| 0.1 | 0.1 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
| 0.1 | 0.5 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.1 | 0.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 0.2 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.1 | 0.3 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.1 | 0.2 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.1 | 0.3 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 0.7 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.1 | 0.2 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.1 | 0.2 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.1 | 0.8 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.1 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.1 | 0.4 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.1 | 0.2 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 1.6 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.1 | 0.2 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 0.4 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.1 | 0.4 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.0 | 0.4 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.0 | 0.1 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.3 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.6 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.2 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.0 | 0.9 | GO:0045120 | pronucleus(GO:0045120) |
| 0.0 | 0.2 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.0 | 0.4 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 0.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.1 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.0 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.3 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.0 | 0.3 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.1 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.0 | 0.6 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.0 | 1.4 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.0 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 1.5 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 0.6 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.2 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 0.1 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.0 | 0.4 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.1 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.2 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.9 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 1.7 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.0 | 0.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.2 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.2 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.0 | 0.7 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.4 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.0 | 1.0 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.3 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 0.3 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.4 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.0 | 0.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.0 | 0.3 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.0 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.0 | 2.8 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.0 | 0.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.3 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.9 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.3 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 0.4 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.0 | 1.0 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 0.1 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.1 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 0.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.0 | 0.2 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
| 0.0 | 0.4 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.1 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 0.3 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.2 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 0.3 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.0 | 0.2 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.2 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 0.1 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.2 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 1.3 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.1 | GO:0070695 | FHF complex(GO:0070695) |
| 0.0 | 0.3 | GO:0030894 | replisome(GO:0030894) |
| 0.0 | 0.0 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.0 | 0.1 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.0 | 0.1 | GO:0051286 | cell tip(GO:0051286) |
| 0.0 | 0.2 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.2 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 0.2 | GO:0097449 | astrocyte projection(GO:0097449) |
| 0.0 | 0.1 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.5 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
| 0.0 | 0.3 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.3 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.3 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 1.2 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.0 | 0.2 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.0 | 0.5 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 0.5 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.0 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.0 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.2 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.0 | 0.1 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.1 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.2 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 0.6 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.6 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.0 | 0.2 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.4 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.1 | GO:0030677 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
| 0.0 | 0.1 | GO:0016011 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
| 0.0 | 0.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.0 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.0 | 0.8 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 0.0 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.2 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.0 | 0.1 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.0 | 0.5 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.0 | GO:0030689 | Noc complex(GO:0030689) |
| 0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.1 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.0 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.0 | 0.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.1 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 0.3 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 0.0 | GO:0031523 | Myb complex(GO:0031523) |
| 0.0 | 0.5 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.2 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 0.7 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 0.3 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 1.8 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.1 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 0.4 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.0 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.0 | 0.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 0.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
| 0.0 | 1.4 | GO:0043209 | myelin sheath(GO:0043209) |
| 0.0 | 0.2 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.0 | 0.1 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.0 | 0.0 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 1.4 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.0 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 0.5 | GO:0043197 | dendritic spine(GO:0043197) |
| 0.0 | 0.1 | GO:0034704 | calcium channel complex(GO:0034704) |
| 0.0 | 0.2 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.0 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.0 | 0.0 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.2 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.0 | 0.0 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.5 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.0 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.6 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 0.1 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.2 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
| 0.0 | 0.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 1.0 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
| 0.0 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 2.2 | GO:0030425 | dendrite(GO:0030425) |
| 0.0 | 0.9 | GO:0005923 | bicellular tight junction(GO:0005923) |
| 0.0 | 0.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 0.5 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 0.3 | GO:0044391 | ribosomal subunit(GO:0044391) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.2 | 3.3 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.2 | 0.9 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.2 | 0.2 | GO:0032357 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
| 0.2 | 0.5 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.2 | 0.7 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.2 | 0.8 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 0.4 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.1 | 0.4 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.1 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.1 | 0.4 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.1 | 0.4 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
| 0.1 | 0.4 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.1 | 0.5 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.1 | 0.4 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.1 | 0.3 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.1 | 1.3 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.1 | 0.3 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.1 | 2.0 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.1 | 0.7 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.1 | 0.1 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.1 | 0.3 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.1 | 0.8 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.1 | 0.4 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.1 | 0.9 | GO:0051378 | serotonin binding(GO:0051378) |
| 0.1 | 0.3 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.1 | 0.7 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.1 | 0.4 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.1 | 0.9 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.1 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 0.5 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 0.2 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
| 0.1 | 1.0 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 0.6 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.1 | 0.5 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.1 | 0.7 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
| 0.1 | 0.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.3 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.1 | 0.2 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.1 | 0.8 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.1 | 0.2 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.1 | 0.3 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.1 | 0.3 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.1 | 0.2 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.1 | 1.1 | GO:0008066 | ionotropic glutamate receptor activity(GO:0004970) glutamate receptor activity(GO:0008066) |
| 0.1 | 0.2 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.1 | 0.2 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.1 | 0.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.1 | 0.4 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.1 | 0.2 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.1 | 0.3 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.1 | 0.2 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 0.7 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.1 | 0.2 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.1 | 0.3 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.1 | 0.2 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.1 | 0.8 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.1 | 0.2 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.1 | 0.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.1 | 0.8 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.1 | 0.8 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.1 | GO:0043176 | amine binding(GO:0043176) |
| 0.1 | 0.3 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
| 0.1 | 0.4 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.1 | 0.2 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.1 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.0 | 0.4 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.4 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.0 | 0.2 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.0 | 0.6 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.0 | 0.4 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.0 | 0.2 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.0 | 1.6 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.0 | 0.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.2 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.5 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
| 0.0 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.1 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
| 0.0 | 1.1 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.0 | 0.5 | GO:0005272 | sodium channel activity(GO:0005272) |
| 0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.0 | 0.3 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.0 | 0.3 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
| 0.0 | 0.3 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.1 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.0 | 0.2 | GO:0043842 | Kdo transferase activity(GO:0043842) |
| 0.0 | 0.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.0 | 0.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.2 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.0 | 0.2 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.0 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
| 0.0 | 0.1 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.0 | 0.1 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 1.0 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.0 | 0.1 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.0 | 0.2 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.2 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.1 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
| 0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.4 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
| 0.0 | 0.3 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.0 | 0.4 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.0 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
| 0.0 | 0.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.1 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.0 | 0.1 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.2 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.0 | 0.4 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.0 | 0.3 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.6 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.0 | 0.1 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.0 | 0.3 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.0 | 0.1 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.0 | 0.2 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 0.1 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.0 | 0.6 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
| 0.0 | 1.2 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.0 | 1.5 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.0 | 0.5 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.0 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
| 0.0 | 0.2 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.0 | 0.9 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.3 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
| 0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.1 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.0 | 0.1 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
| 0.0 | 1.6 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 0.2 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 0.1 | GO:0089720 | caspase binding(GO:0089720) |
| 0.0 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.0 | 0.6 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
| 0.0 | 0.1 | GO:0030619 | U1 snRNA binding(GO:0030619) |
| 0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 0.3 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.0 | 0.3 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.0 | 0.1 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.0 | 0.2 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 0.8 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 0.8 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.0 | 0.2 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
| 0.0 | 0.2 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.0 | 0.3 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.7 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.0 | 1.1 | GO:0032947 | protein complex scaffold(GO:0032947) |
| 0.0 | 0.0 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.1 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.0 | 0.7 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.1 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.2 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.3 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.8 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.0 | 0.2 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.1 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.0 | 0.2 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.1 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
| 0.0 | 1.5 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
| 0.0 | 0.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.1 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 0.2 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.0 | 0.1 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
| 0.0 | 0.1 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.0 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 0.0 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 0.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.0 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.0 | 0.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.3 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.0 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.0 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.3 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.6 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.0 | 0.4 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.0 | 0.1 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.0 | 0.2 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 0.1 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 0.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.0 | 0.3 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.2 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 0.1 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
| 0.0 | 2.8 | GO:0008017 | microtubule binding(GO:0008017) |
| 0.0 | 0.7 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
| 0.0 | 0.1 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
| 0.0 | 0.4 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.0 | 0.3 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 0.1 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.0 | 0.1 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.0 | 0.1 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.0 | 0.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.0 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.2 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.0 | 0.1 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.0 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.0 | 0.1 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.0 | 0.0 | GO:0033265 | choline binding(GO:0033265) |
| 0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 0.3 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
| 0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.0 | 0.6 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.1 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.0 | 0.1 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.4 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 0.1 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.0 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.0 | 0.1 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.0 | 0.5 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
| 0.0 | 0.2 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
| 0.0 | 0.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.1 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.0 | 0.1 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.0 | 0.3 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.1 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.0 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.0 | 0.1 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 0.2 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.0 | 0.1 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.0 | 0.4 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.0 | 0.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.0 | 0.0 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.0 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.0 | 0.1 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 1.1 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.0 | 0.1 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.0 | 0.0 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.1 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.0 | 0.0 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.0 | 0.3 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 0.1 | GO:0015605 | organophosphate ester transmembrane transporter activity(GO:0015605) |
| 0.0 | 0.3 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
| 0.0 | 0.7 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.0 | 0.0 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.1 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.1 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.0 | GO:0018566 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
| 0.0 | 0.5 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.1 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 0.0 | GO:0008252 | nucleotidase activity(GO:0008252) |
| 0.0 | 0.0 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.1 | GO:0018633 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
| 0.0 | 0.6 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.0 | 0.2 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.0 | 1.6 | GO:0052689 | carboxylic ester hydrolase activity(GO:0052689) |
| 0.0 | 0.0 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.5 | GO:0005267 | potassium channel activity(GO:0005267) |
| 0.0 | 0.0 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 0.0 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.0 | 0.2 | GO:0000217 | DNA secondary structure binding(GO:0000217) |
| 0.0 | 0.2 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.0 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.3 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.0 | 0.1 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.0 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.0 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.2 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.0 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.0 | 0.1 | GO:0008828 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
| 0.0 | 0.3 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.2 | GO:0000907 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) DNA-N1-methyladenine dioxygenase activity(GO:0043734) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
| 0.0 | 0.0 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.0 | 0.2 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.0 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.0 | 0.1 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.0 | 0.0 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.0 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 0.0 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.0 | 0.0 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.0 | 0.1 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.0 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.1 | GO:0019841 | retinol binding(GO:0019841) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 2.3 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.1 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 0.5 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 1.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 0.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 1.0 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.4 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.2 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.0 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.0 | 0.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 1.1 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.3 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.6 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.5 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.0 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.0 | 0.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.4 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 1.7 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.2 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.8 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.9 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.3 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.3 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.0 | 0.2 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.5 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.2 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.4 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.7 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.3 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.6 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.1 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.0 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.1 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 0.1 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.1 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.0 | 0.2 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.0 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.1 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 0.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.3 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.0 | 0.4 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.0 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 0.6 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.2 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.1 | ST GAQ PATHWAY | G alpha q Pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 2.4 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 2.0 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.1 | 1.2 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.1 | 1.0 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.1 | 1.4 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.1 | 0.6 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
| 0.1 | 0.2 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.1 | 1.0 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.1 | 0.9 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.1 | 0.2 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
| 0.1 | 0.6 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.1 | 1.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.1 | 0.9 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.1 | 0.7 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.1 | 0.7 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.1 | 0.7 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.1 | 0.8 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 0.1 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.1 | 0.8 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.5 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.0 | 0.9 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.7 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.5 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.5 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 0.4 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.7 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.0 | 0.4 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.0 | 0.1 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.0 | 0.5 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 0.4 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.9 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 0.3 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.0 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.0 | 0.6 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.3 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.0 | 0.3 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 0.2 | REACTOME MYD88 MAL CASCADE INITIATED ON PLASMA MEMBRANE | Genes involved in MyD88:Mal cascade initiated on plasma membrane |
| 0.0 | 0.4 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.2 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 0.7 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.2 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 0.3 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.2 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 2.5 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.7 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.5 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.4 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 0.4 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.0 | 0.5 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.5 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.6 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.0 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.2 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 0.0 | 0.4 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 0.2 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 0.2 | REACTOME ASSEMBLY OF THE PRE REPLICATIVE COMPLEX | Genes involved in Assembly of the pre-replicative complex |
| 0.0 | 1.1 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 2.0 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.0 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.0 | 0.1 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.0 | 0.2 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.0 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
| 0.0 | 0.4 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.2 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 0.2 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 0.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 0.0 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.2 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.0 | 1.4 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.2 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.0 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.2 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.0 | 0.8 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 0.1 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.0 | 0.3 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 0.4 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.0 | 0.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.1 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 0.1 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 0.0 | 0.1 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.0 | 0.0 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.0 | 0.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 0.5 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 0.1 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.0 | 0.1 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.0 | 0.0 | REACTOME ORC1 REMOVAL FROM CHROMATIN | Genes involved in Orc1 removal from chromatin |
| 0.0 | 0.2 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.6 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.2 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 0.1 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.0 | 0.0 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
| 0.0 | 0.7 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.3 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.0 | 0.0 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.1 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.2 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |