Gene Symbol | Gene ID | Gene Info |
---|---|---|
Sin3a
|
ENSMUSG00000042557.8 | Sin3a |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Sin3a | chr9_57072078_57073428 | 713 | 0.402930 | -0.50 | 5.3e-05 | Click! |
Sin3a | chr9_57075283_57076016 | 311 | 0.839677 | -0.29 | 2.2e-02 | Click! |
Sin3a | chr9_57074979_57075276 | 211 | 0.900719 | -0.27 | 3.8e-02 | Click! |
Sin3a | chr9_57076511_57076734 | 6 | 0.964972 | -0.26 | 4.6e-02 | Click! |
Sin3a | chr9_57076753_57077643 | 570 | 0.658226 | -0.24 | 6.1e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr19_45230983_45235468 | 2.23 |
Lbx1 |
ladybird homeobox 1 |
2587 |
0.27 |
chr4_154635108_154637998 | 2.10 |
Prdm16 |
PR domain containing 16 |
244 |
0.83 |
chr12_3806578_3808221 | 2.07 |
Dnmt3a |
DNA methyltransferase 3A |
239 |
0.92 |
chr15_87624263_87625701 | 2.03 |
Tafa5 |
TAFA chemokine like family member 5 |
248 |
0.96 |
chr5_24525963_24527321 | 1.98 |
Gbx1 |
gastrulation brain homeobox 1 |
560 |
0.59 |
chr1_42697532_42698715 | 1.90 |
Pou3f3 |
POU domain, class 3, transcription factor 3 |
2355 |
0.2 |
chr6_114041186_114042349 | 1.86 |
Atp2b2 |
ATPase, Ca++ transporting, plasma membrane 2 |
248 |
0.91 |
chr3_92080511_92081802 | 1.75 |
Lor |
loricrin |
1986 |
0.2 |
chr13_73260273_73261531 | 1.72 |
Irx4 |
Iroquois homeobox 4 |
405 |
0.82 |
chrX_60892404_60893251 | 1.60 |
Sox3 |
SRY (sex determining region Y)-box 3 |
603 |
0.52 |
chr7_44477821_44478055 | 1.60 |
5430431A17Rik |
RIKEN cDNA 5430431A17 gene |
4400 |
0.07 |
chr11_102818096_102819493 | 1.55 |
Gjc1 |
gap junction protein, gamma 1 |
385 |
0.75 |
chr8_57320946_57324000 | 1.52 |
Hand2os1 |
Hand2, opposite strand 1 |
1245 |
0.3 |
chr8_108703804_108704681 | 1.52 |
Zfhx3 |
zinc finger homeobox 3 |
1142 |
0.58 |
chr8_9770297_9772011 | 1.50 |
Fam155a |
family with sequence similarity 155, member A |
7 |
0.79 |
chr9_63144078_63146888 | 1.40 |
Skor1 |
SKI family transcriptional corepressor 1 |
1497 |
0.38 |
chr3_107458501_107460302 | 1.35 |
Kcnc4 |
potassium voltage gated channel, Shaw-related subfamily, member 4 |
151 |
0.95 |
chr5_28165280_28166978 | 1.31 |
En2 |
engrailed 2 |
435 |
0.81 |
chr3_34648572_34651394 | 1.29 |
Sox2 |
SRY (sex determining region Y)-box 2 |
422 |
0.73 |
chr11_21995570_21998947 | 1.26 |
Otx1 |
orthodenticle homeobox 1 |
4357 |
0.28 |
chr7_43489310_43490670 | 1.20 |
Iglon5 |
IgLON family member 5 |
85 |
0.92 |
chr14_122475443_122476757 | 1.18 |
Zic2 |
zinc finger protein of the cerebellum 2 |
665 |
0.44 |
chr2_180892979_180894605 | 1.16 |
Mir124a-3 |
microRNA 124a-3 |
248 |
0.53 |
chr8_11727451_11729215 | 1.14 |
Arhgef7 |
Rho guanine nucleotide exchange factor (GEF7) |
156 |
0.91 |
chr5_116590520_116593206 | 1.13 |
Srrm4 |
serine/arginine repetitive matrix 4 |
46 |
0.98 |
chr17_85686512_85689764 | 1.13 |
Six2 |
sine oculis-related homeobox 2 |
116 |
0.96 |
chr8_12396308_12397229 | 1.12 |
Gm25239 |
predicted gene, 25239 |
365 |
0.77 |
chr14_104465474_104466650 | 1.11 |
Pou4f1 |
POU domain, class 4, transcription factor 1 |
697 |
0.67 |
chr8_121729721_121730922 | 1.11 |
Jph3 |
junctophilin 3 |
242 |
0.9 |
chr11_66525570_66526846 | 1.10 |
Shisa6 |
shisa family member 6 |
244 |
0.95 |
chr4_125490136_125491914 | 1.10 |
Grik3 |
glutamate receptor, ionotropic, kainate 3 |
325 |
0.89 |
chr8_120228360_120231502 | 1.10 |
Gse1 |
genetic suppressor element 1, coiled-coil protein |
1475 |
0.32 |
chr6_54485008_54486029 | 1.09 |
Wipf3 |
WAS/WASL interacting protein family, member 3 |
2388 |
0.25 |
chrX_98149736_98151206 | 1.09 |
Ar |
androgen receptor |
1702 |
0.52 |
chr1_191717775_191718786 | 1.06 |
Lpgat1 |
lysophosphatidylglycerol acyltransferase 1 |
109 |
0.96 |
chr17_85683384_85684714 | 1.06 |
Six2 |
sine oculis-related homeobox 2 |
4205 |
0.2 |
chr11_4746017_4747134 | 1.05 |
Cabp7 |
calcium binding protein 7 |
203 |
0.93 |
chr7_131542096_131543636 | 1.03 |
Hmx3 |
H6 homeobox 3 |
1 |
0.97 |
chr9_98954965_98956948 | 1.03 |
Foxl2os |
forkhead box L2, opposite strand |
657 |
0.38 |
chr14_31211131_31211749 | 1.02 |
Tnnc1 |
troponin C, cardiac/slow skeletal |
3108 |
0.13 |
chr6_52315311_52317365 | 1.00 |
Evx1os |
even skipped homeotic gene 1, opposite strand |
1506 |
0.21 |
chr4_140245362_140247262 | 1.00 |
Igsf21 |
immunoglobulin superfamily, member 21 |
472 |
0.85 |
chr12_67221394_67222796 | 0.99 |
Mdga2 |
MAM domain containing glycosylphosphatidylinositol anchor 2 |
286 |
0.94 |
chr4_46343785_46345364 | 0.99 |
Gm12446 |
predicted gene 12446 |
941 |
0.34 |
chr3_94478073_94479450 | 0.99 |
Celf3 |
CUGBP, Elav-like family member 3 |
70 |
0.92 |
chr17_47484348_47484534 | 0.98 |
Taf8 |
TATA-box binding protein associated factor 8 |
17831 |
0.12 |
chr1_36259015_36259166 | 0.98 |
Neurl3 |
neuralized E3 ubiquitin protein ligase 3 |
14345 |
0.14 |
chr8_57342348_57342499 | 0.98 |
5033428I22Rik |
RIKEN cDNA 5033428I22 gene |
1623 |
0.29 |
chr3_131110318_131112630 | 0.97 |
Lef1os1 |
LEF1 opposite strand RNA 1 |
616 |
0.56 |
chr4_139724528_139725287 | 0.97 |
Tas1r2 |
taste receptor, type 1, member 2 |
71358 |
0.08 |
chr15_96524152_96524382 | 0.96 |
Gm41392 |
predicted gene, 41392 |
26365 |
0.18 |
chr9_22050521_22051976 | 0.96 |
Elavl3 |
ELAV like RNA binding protein 3 |
762 |
0.41 |
chr8_92356309_92358734 | 0.95 |
Irx5 |
Iroquois homeobox 5 |
104 |
0.95 |
chr6_126163282_126164936 | 0.93 |
Ntf3 |
neurotrophin 3 |
851 |
0.73 |
chr8_92359084_92360805 | 0.93 |
Irx5 |
Iroquois homeobox 5 |
2195 |
0.28 |
chr7_40898734_40899964 | 0.92 |
Vstm2b |
V-set and transmembrane domain containing 2B |
17 |
0.93 |
chr10_80494659_80496349 | 0.90 |
Onecut3 |
one cut domain, family member 3 |
669 |
0.5 |
chr7_136689650_136690800 | 0.90 |
Gm6249 |
predicted gene 6249 |
20379 |
0.22 |
chrX_137118132_137120673 | 0.90 |
Esx1 |
extraembryonic, spermatogenesis, homeobox 1 |
769 |
0.36 |
chr2_70561988_70564432 | 0.88 |
Gad1os |
glutamate decarboxylase 1, opposite strand |
147 |
0.61 |
chr7_44441951_44442938 | 0.88 |
Lrrc4b |
leucine rich repeat containing 4B |
41 |
0.93 |
chr15_66285652_66286618 | 0.87 |
Kcnq3 |
potassium voltage-gated channel, subfamily Q, member 3 |
84 |
0.93 |
chr4_58236469_58236620 | 0.87 |
Svep1 |
sushi, von Willebrand factor type A, EGF and pentraxin domain containing 1 |
29685 |
0.2 |
chr18_45559502_45560715 | 0.85 |
Gm31907 |
predicted gene, 31907 |
22 |
0.51 |
chr19_36117589_36118325 | 0.84 |
Ankrd1 |
ankyrin repeat domain 1 (cardiac muscle) |
1953 |
0.34 |
chr15_72546044_72547992 | 0.84 |
Kcnk9 |
potassium channel, subfamily K, member 9 |
678 |
0.75 |
chr4_146932068_146933352 | 0.84 |
Gm20760 |
predicted gene, 20760 |
32 |
0.97 |
chr2_157914223_157915670 | 0.83 |
Vstm2l |
V-set and transmembrane domain containing 2-like |
293 |
0.91 |
chr3_137343305_137343475 | 0.83 |
Emcn |
endomucin |
2216 |
0.39 |
chr18_23309850_23311104 | 0.83 |
Gm7788 |
predicted gene 7788 |
93808 |
0.08 |
chrX_58030987_58032527 | 0.83 |
Zic3 |
zinc finger protein of the cerebellum 3 |
747 |
0.74 |
chr7_44478079_44478838 | 0.83 |
5430431A17Rik |
RIKEN cDNA 5430431A17 gene |
4920 |
0.07 |
chr8_91800429_91802211 | 0.83 |
Irx3 |
Iroquois related homeobox 3 |
595 |
0.52 |
chr1_120340233_120341796 | 0.82 |
C1ql2 |
complement component 1, q subcomponent-like 2 |
432 |
0.88 |
chr13_53454655_53455466 | 0.82 |
Msx2 |
msh homeobox 2 |
18014 |
0.17 |
chr16_22162478_22163682 | 0.82 |
Igf2bp2 |
insulin-like growth factor 2 mRNA binding protein 2 |
61 |
0.97 |
chr1_154725630_154727200 | 0.81 |
Cacna1e |
calcium channel, voltage-dependent, R type, alpha 1E subunit |
59 |
0.99 |
chr7_44428104_44428935 | 0.81 |
Lrrc4b |
leucine rich repeat containing 4B |
499 |
0.58 |
chr7_4993272_4994998 | 0.81 |
Zfp579 |
zinc finger protein 579 |
1205 |
0.21 |
chr7_44474127_44475010 | 0.81 |
5430431A17Rik |
RIKEN cDNA 5430431A17 gene |
1030 |
0.25 |
chr4_145463454_145464525 | 0.80 |
Smarca5-ps |
SWI/SNF related, matrix associated, actin depenent ragulator of chromatin, subfamily a, member 5, pseudogene |
215 |
0.89 |
chr9_87729583_87731038 | 0.80 |
Tbx18 |
T-box18 |
187 |
0.9 |
chr10_90828879_90830154 | 0.80 |
Anks1b |
ankyrin repeat and sterile alpha motif domain containing 1B |
50 |
0.97 |
chr1_42697110_42697488 | 0.80 |
Pou3f3 |
POU domain, class 3, transcription factor 3 |
1531 |
0.26 |
chr2_180385943_180386992 | 0.79 |
B230312C02Rik |
RIKEN cDNA B230312C02 gene |
582 |
0.63 |
chr6_55676662_55677830 | 0.79 |
Neurod6 |
neurogenic differentiation 6 |
4017 |
0.26 |
chr17_25556052_25557244 | 0.78 |
Gm50026 |
predicted gene, 50026 |
4565 |
0.09 |
chr1_135836765_135837624 | 0.78 |
Tnnt2 |
troponin T2, cardiac |
781 |
0.54 |
chr2_21367263_21369086 | 0.78 |
Gpr158 |
G protein-coupled receptor 158 |
607 |
0.59 |
chr6_128802336_128802487 | 0.78 |
Klrb1c |
killer cell lectin-like receptor subfamily B member 1C |
13196 |
0.09 |
chr17_90454435_90455834 | 0.78 |
Gm10493 |
predicted gene 10493 |
245 |
0.58 |
chr2_146221972_146223699 | 0.77 |
Insm1 |
insulinoma-associated 1 |
914 |
0.56 |
chr10_69536011_69536410 | 0.77 |
Ank3 |
ankyrin 3, epithelial |
1988 |
0.39 |
chr4_145640372_145641403 | 0.77 |
Gm13231 |
predicted gene 13231 |
470 |
0.67 |
chr4_91399504_91400258 | 0.77 |
Elavl2 |
ELAV like RNA binding protein 1 |
95 |
0.97 |
chr11_118908287_118909561 | 0.76 |
Rbfox3 |
RNA binding protein, fox-1 homolog (C. elegans) 3 |
626 |
0.73 |
chr11_89301437_89303142 | 0.76 |
Nog |
noggin |
43 |
0.88 |
chr14_12822570_12823126 | 0.76 |
Cadps |
Ca2+-dependent secretion activator |
197 |
0.96 |
chr11_98327227_98329144 | 0.76 |
Neurod2 |
neurogenic differentiation 2 |
1463 |
0.23 |
chr11_99385465_99386775 | 0.76 |
Krt10 |
keratin 10 |
23 |
0.94 |
chr6_110645148_110646464 | 0.76 |
Gm20387 |
predicted gene 20387 |
110 |
0.67 |
chr8_45660711_45661611 | 0.76 |
Sorbs2 |
sorbin and SH3 domain containing 2 |
832 |
0.66 |
chr10_70598201_70600143 | 0.75 |
Phyhipl |
phytanoyl-CoA hydroxylase interacting protein-like |
90 |
0.98 |
chr17_9763907_9764755 | 0.74 |
4930452A19Rik |
RIKEN cDNA 4930452A19 gene |
11535 |
0.21 |
chr2_147083670_147085642 | 0.74 |
Nkx2-4 |
NK2 homeobox 4 |
789 |
0.65 |
chr6_99692136_99693442 | 0.74 |
Gpr27 |
G protein-coupled receptor 27 |
110 |
0.95 |
chr1_120602812_120604098 | 0.74 |
En1 |
engrailed 1 |
1037 |
0.58 |
chr2_82052683_82053913 | 0.74 |
Zfp804a |
zinc finger protein 804A |
76 |
0.99 |
chr8_64880540_64881129 | 0.74 |
Klhl2 |
kelch-like 2, Mayven |
30817 |
0.11 |
chr9_122552316_122552468 | 0.74 |
Gm47133 |
predicted gene, 47133 |
17372 |
0.12 |
chr4_147738310_147739205 | 0.73 |
Gm13136 |
predicted gene 13136 |
331 |
0.8 |
chr19_43440284_43441554 | 0.73 |
Gm47936 |
predicted gene, 47936 |
459 |
0.46 |
chr3_31309226_31310664 | 0.73 |
Slc7a14 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 14 |
433 |
0.72 |
chr2_28907958_28910057 | 0.72 |
Barhl1 |
BarH like homeobox 1 |
3488 |
0.21 |
chr7_44350602_44354420 | 0.72 |
Shank1 |
SH3 and multiple ankyrin repeat domains 1 |
1749 |
0.15 |
chr8_66687402_66688613 | 0.72 |
Npy5r |
neuropeptide Y receptor Y5 |
40 |
0.98 |
chr1_75549315_75550106 | 0.71 |
Slc4a3 |
solute carrier family 4 (anion exchanger), member 3 |
58 |
0.95 |
chr14_122450074_122451370 | 0.71 |
Gm5089 |
predicted gene 5089 |
393 |
0.78 |
chr16_91226312_91227667 | 0.71 |
Olig2 |
oligodendrocyte transcription factor 2 |
1532 |
0.27 |
chr4_98778068_98779014 | 0.71 |
Kank4 |
KN motif and ankyrin repeat domains 4 |
7066 |
0.15 |
chr4_139993241_139993762 | 0.71 |
Klhdc7a |
kelch domain containing 7A |
25475 |
0.15 |
chr13_109116105_109117683 | 0.71 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
253 |
0.96 |
chr19_59459141_59460287 | 0.71 |
Emx2 |
empty spiracles homeobox 2 |
195 |
0.89 |
chr11_61022134_61023265 | 0.71 |
Kcnj12 |
potassium inwardly-rectifying channel, subfamily J, member 12 |
135 |
0.96 |
chr8_104630432_104631968 | 0.70 |
Rrad |
Ras-related associated with diabetes |
40 |
0.73 |
chr5_124353199_124354886 | 0.70 |
Cdk2ap1 |
CDK2 (cyclin-dependent kinase 2)-associated protein 1 |
629 |
0.59 |
chr19_7421074_7423945 | 0.70 |
Mir6991 |
microRNA 6991 |
64 |
0.94 |
chr6_6880959_6882181 | 0.69 |
Dlx5 |
distal-less homeobox 5 |
498 |
0.71 |
chr2_31638722_31641540 | 0.68 |
Prdm12 |
PR domain containing 12 |
94 |
0.84 |
chr18_76860656_76861219 | 0.68 |
Skor2 |
SKI family transcriptional corepressor 2 |
4532 |
0.27 |
chr4_141421681_141422558 | 0.68 |
Hspb7 |
heat shock protein family, member 7 (cardiovascular) |
1340 |
0.25 |
chr12_109032942_109034323 | 0.68 |
Begain |
brain-enriched guanylate kinase-associated |
3455 |
0.19 |
chr12_8297863_8299187 | 0.67 |
Gdf7 |
growth differentiation factor 7 |
3429 |
0.18 |
chr5_111418246_111419747 | 0.67 |
Mn1 |
meningioma 1 |
1554 |
0.34 |
chr13_31625167_31627270 | 0.67 |
Gm27516 |
predicted gene, 27516 |
325 |
0.4 |
chr6_142506733_142508000 | 0.67 |
Ldhb |
lactate dehydrogenase B |
439 |
0.83 |
chr11_118568846_118570341 | 0.66 |
Rbfox3 |
RNA binding protein, fox-1 homolog (C. elegans) 3 |
317 |
0.91 |
chr14_118322252_118323294 | 0.66 |
Gm32093 |
predicted gene, 32093 |
204 |
0.92 |
chr1_93175979_93177278 | 0.66 |
Crocc2 |
ciliary rootlet coiled-coil, rootletin family member 2 |
7903 |
0.13 |
chr2_73272878_73274762 | 0.65 |
Sp9 |
trans-acting transcription factor 9 |
1854 |
0.29 |
chr9_24769617_24771807 | 0.65 |
Tbx20 |
T-box 20 |
962 |
0.56 |
chr1_42698766_42699058 | 0.65 |
Pou3f3 |
POU domain, class 3, transcription factor 3 |
3144 |
0.17 |
chr12_72917053_72918126 | 0.65 |
4930447C04Rik |
RIKEN cDNA 4930447C04 gene |
171 |
0.94 |
chr2_33639069_33641423 | 0.65 |
Lmx1b |
LIM homeobox transcription factor 1 beta |
234 |
0.85 |
chr2_28914529_28916444 | 0.65 |
Barhl1 |
BarH like homeobox 1 |
19 |
0.98 |
chr12_73044500_73046647 | 0.65 |
Six1 |
sine oculis-related homeobox 1 |
282 |
0.92 |
chr4_146067009_146067996 | 0.65 |
Gm13034 |
predicted gene 13034 |
250 |
0.89 |
chr9_86879335_86880899 | 0.64 |
Snap91 |
synaptosomal-associated protein 91 |
280 |
0.93 |
chr16_35000118_35001569 | 0.64 |
Gm21691 |
predicted gene, 21691 |
3858 |
0.19 |
chr7_3389818_3390428 | 0.64 |
Gm44257 |
predicted gene, 44257 |
43 |
0.88 |
chr3_45379351_45381850 | 0.64 |
Pcdh10 |
protocadherin 10 |
2033 |
0.25 |
chr1_135584243_135585787 | 0.64 |
Gm4793 |
predicted gene 4793 |
242 |
0.6 |
chr9_56712582_56712844 | 0.64 |
Lingo1 |
leucine rich repeat and Ig domain containing 1 |
27460 |
0.18 |
chr5_37241461_37244349 | 0.63 |
Crmp1 |
collapsin response mediator protein 1 |
171 |
0.95 |
chr11_16260501_16261352 | 0.63 |
Vstm2a |
V-set and transmembrane domain containing 2A |
335 |
0.92 |
chr13_48664673_48666478 | 0.63 |
Barx1 |
BarH-like homeobox 1 |
2577 |
0.26 |
chr3_18054443_18055798 | 0.63 |
Bhlhe22 |
basic helix-loop-helix family, member e22 |
946 |
0.58 |
chr14_12343518_12345314 | 0.62 |
Fezf2 |
Fez family zinc finger 2 |
1428 |
0.3 |
chr1_75263860_75264397 | 0.62 |
Ptprn |
protein tyrosine phosphatase, receptor type, N |
78 |
0.92 |
chr10_19356598_19357962 | 0.62 |
Olig3 |
oligodendrocyte transcription factor 3 |
747 |
0.72 |
chr10_67539792_67541315 | 0.62 |
Egr2 |
early growth response 2 |
1870 |
0.25 |
chr4_149586203_149587699 | 0.61 |
Clstn1 |
calsyntenin 1 |
297 |
0.85 |
chr3_105046370_105047357 | 0.61 |
Cttnbp2nl |
CTTNBP2 N-terminal like |
6062 |
0.19 |
chr11_117636399_117636798 | 0.61 |
Tnrc6c |
trinucleotide repeat containing 6C |
17691 |
0.16 |
chr1_78188923_78189310 | 0.60 |
Pax3 |
paired box 3 |
7722 |
0.24 |
chr14_49524944_49526079 | 0.60 |
Slc35f4 |
solute carrier family 35, member F4 |
342 |
0.88 |
chr17_26840808_26841709 | 0.60 |
Nkx2-5 |
NK2 homeobox 5 |
307 |
0.83 |
chr10_42581935_42584872 | 0.60 |
Nr2e1 |
nuclear receptor subfamily 2, group E, member 1 |
229 |
0.69 |
chr2_149830330_149831719 | 0.60 |
Syndig1 |
synapse differentiation inducing 1 |
102 |
0.63 |
chr2_114057084_114058386 | 0.60 |
C130080G10Rik |
RIKEN cDNA C130080G10 gene |
1422 |
0.37 |
chr2_136711813_136712965 | 0.60 |
Snap25 |
synaptosomal-associated protein 25 |
1064 |
0.55 |
chr7_44481287_44481705 | 0.60 |
5430431A17Rik |
RIKEN cDNA 5430431A17 gene |
3021 |
0.09 |
chr4_124861345_124862773 | 0.59 |
Maneal |
mannosidase, endo-alpha-like |
112 |
0.93 |
chr2_135711404_135712221 | 0.59 |
Gm14211 |
predicted gene 14211 |
18658 |
0.18 |
chr12_33928070_33929277 | 0.59 |
Gm40383 |
predicted gene, 40383 |
217 |
0.53 |
chr14_3809696_3810741 | 0.59 |
Gm3002 |
predicted gene 3002 |
144 |
0.94 |
chr2_71543869_71545172 | 0.59 |
Dlx2 |
distal-less homeobox 2 |
1430 |
0.33 |
chr2_116061308_116062718 | 0.59 |
Meis2 |
Meis homeobox 2 |
347 |
0.86 |
chr14_115040989_115042168 | 0.59 |
Mir17hg |
Mir17 host gene (non-protein coding) |
1301 |
0.2 |
chr5_122497119_122497392 | 0.58 |
Gm43361 |
predicted gene 43361 |
1096 |
0.3 |
chr10_115584850_115585018 | 0.58 |
Lgr5 |
leucine rich repeat containing G protein coupled receptor 5 |
2559 |
0.27 |
chr14_48665732_48667167 | 0.58 |
Otx2 |
orthodenticle homeobox 2 |
928 |
0.34 |
chr13_38153771_38154277 | 0.58 |
Gm10129 |
predicted gene 10129 |
2232 |
0.25 |
chrX_93988674_93988919 | 0.58 |
Gm15165 |
predicted gene 15165 |
23 |
0.97 |
chr14_67234584_67235906 | 0.58 |
Ebf2 |
early B cell factor 2 |
601 |
0.67 |
chr6_28133524_28134506 | 0.57 |
Grm8 |
glutamate receptor, metabotropic 8 |
370 |
0.89 |
chr2_160472979_160473873 | 0.57 |
Mafb |
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein B (avian) |
106361 |
0.06 |
chr18_25546078_25546229 | 0.57 |
Celf4 |
CUGBP, Elav-like family member 4 |
44914 |
0.16 |
chr10_31076625_31077143 | 0.57 |
Gm30676 |
predicted gene, 30676 |
10640 |
0.24 |
chr3_146044950_146045559 | 0.57 |
Wdr63 |
WD repeat domain 63 |
1931 |
0.29 |
chr9_65140865_65142286 | 0.57 |
Igdcc3 |
immunoglobulin superfamily, DCC subclass, member 3 |
363 |
0.83 |
chr2_174074417_174075662 | 0.57 |
Stx16 |
syntaxin 16 |
1269 |
0.43 |
chr10_76001102_76001253 | 0.57 |
Gm16220 |
predicted gene 16220 |
7185 |
0.1 |
chr15_78119178_78120215 | 0.57 |
A730060N03Rik |
RIKEN cDNA A730060N03 gene |
10 |
0.83 |
chr14_24003644_24004258 | 0.57 |
Kcnma1 |
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
21 |
0.59 |
chr4_21678491_21679769 | 0.56 |
Prdm13 |
PR domain containing 13 |
6651 |
0.18 |
chr6_51209022_51209173 | 0.56 |
Mir148a |
microRNA 148a |
60813 |
0.12 |
chr17_85614150_85615720 | 0.56 |
Six3os1 |
SIX homeobox 3, opposite strand 1 |
413 |
0.73 |
chr6_70956025_70957311 | 0.56 |
Foxi3 |
forkhead box I3 |
62 |
0.97 |
chr3_101109423_101110640 | 0.56 |
Ptgfrn |
prostaglandin F2 receptor negative regulator |
247 |
0.93 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.9 | GO:0072069 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.5 | 1.1 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.5 | 1.6 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.5 | 2.1 | GO:0060685 | regulation of prostatic bud formation(GO:0060685) |
0.5 | 2.6 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.5 | 1.5 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.5 | 2.0 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.5 | 1.0 | GO:0072050 | S-shaped body morphogenesis(GO:0072050) |
0.5 | 1.4 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.5 | 1.9 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
0.4 | 1.8 | GO:0019230 | proprioception(GO:0019230) |
0.4 | 1.3 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.4 | 0.8 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.4 | 1.6 | GO:0021557 | oculomotor nerve development(GO:0021557) |
0.4 | 0.4 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
0.4 | 0.4 | GO:0021550 | medulla oblongata development(GO:0021550) |
0.4 | 1.2 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.4 | 0.8 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.4 | 1.2 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.4 | 0.8 | GO:0060166 | olfactory pit development(GO:0060166) |
0.4 | 1.1 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.4 | 1.1 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.4 | 0.7 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.4 | 1.1 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
0.4 | 1.1 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.4 | 1.1 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.3 | 1.0 | GO:0003253 | cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
0.3 | 1.0 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.3 | 0.6 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.3 | 2.2 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
0.3 | 0.9 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.3 | 1.9 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.3 | 0.9 | GO:0033058 | directional locomotion(GO:0033058) |
0.3 | 0.9 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
0.3 | 0.9 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.3 | 1.2 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.3 | 1.1 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.3 | 1.7 | GO:0048840 | otolith development(GO:0048840) |
0.3 | 0.6 | GO:0086017 | Purkinje myocyte action potential(GO:0086017) |
0.3 | 2.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.3 | 1.9 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.3 | 0.8 | GO:0046959 | habituation(GO:0046959) |
0.3 | 0.5 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
0.3 | 1.1 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.3 | 0.3 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
0.3 | 2.4 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
0.3 | 0.5 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
0.3 | 0.8 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.3 | 1.8 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.3 | 1.0 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.2 | 3.0 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.2 | 0.7 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.2 | 0.7 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.2 | 0.7 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
0.2 | 1.0 | GO:0061743 | motor learning(GO:0061743) |
0.2 | 0.9 | GO:0072044 | collecting duct development(GO:0072044) |
0.2 | 0.7 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.2 | 0.7 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.2 | 3.0 | GO:0021854 | hypothalamus development(GO:0021854) |
0.2 | 0.9 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.2 | 0.5 | GO:0021978 | telencephalon regionalization(GO:0021978) |
0.2 | 0.2 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.2 | 0.9 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.2 | 1.8 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.2 | 0.5 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.2 | 0.9 | GO:0003010 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
0.2 | 0.7 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.2 | 0.4 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
0.2 | 0.2 | GO:0045608 | negative regulation of auditory receptor cell differentiation(GO:0045608) |
0.2 | 0.9 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.2 | 0.6 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.2 | 1.0 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.2 | 1.0 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.2 | 0.6 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.2 | 0.4 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.2 | 0.4 | GO:0086043 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.2 | 0.4 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.2 | 0.8 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
0.2 | 0.2 | GO:0021648 | vestibulocochlear nerve morphogenesis(GO:0021648) |
0.2 | 1.0 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.2 | 0.2 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
0.2 | 0.8 | GO:0090427 | activation of meiosis(GO:0090427) |
0.2 | 0.6 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.2 | 0.4 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.2 | 0.6 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.2 | 0.6 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.2 | 0.6 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.2 | 0.7 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.2 | 0.2 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
0.2 | 0.4 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) |
0.2 | 0.9 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.2 | 1.0 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.2 | 0.5 | GO:1900620 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.2 | 0.7 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.2 | 1.9 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.2 | 0.5 | GO:0030421 | defecation(GO:0030421) |
0.2 | 0.2 | GO:0021637 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) |
0.2 | 0.5 | GO:0003257 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) |
0.2 | 0.5 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
0.2 | 0.2 | GO:0046958 | nonassociative learning(GO:0046958) |
0.2 | 0.5 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.2 | 2.2 | GO:0001502 | cartilage condensation(GO:0001502) cell aggregation(GO:0098743) |
0.2 | 0.3 | GO:0061047 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.2 | 0.5 | GO:0048369 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.2 | 0.3 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.2 | 0.9 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.2 | 0.3 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.2 | 0.5 | GO:0021586 | pons maturation(GO:0021586) |
0.1 | 0.4 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.1 | 0.1 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.1 | 0.3 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.3 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 0.1 | GO:0060071 | Wnt signaling pathway, planar cell polarity pathway(GO:0060071) |
0.1 | 0.6 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.1 | 0.3 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.1 | 0.6 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.1 | 1.0 | GO:0098828 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
0.1 | 0.1 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.1 | 0.4 | GO:0097090 | presynaptic membrane organization(GO:0097090) |
0.1 | 0.4 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.1 | 0.3 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.1 | 0.3 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.1 | 0.4 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.1 | 0.5 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.1 | 0.5 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.1 | 0.3 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.1 | 0.1 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.1 | 1.0 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.1 | 0.3 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.1 | 0.5 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.1 | 0.3 | GO:0021564 | vagus nerve development(GO:0021564) |
0.1 | 0.3 | GO:0032346 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) |
0.1 | 0.3 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.1 | 0.6 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 0.2 | GO:0099612 | protein localization to axon(GO:0099612) |
0.1 | 0.7 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.1 | 0.7 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.1 | 0.1 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
0.1 | 0.4 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.1 | 0.2 | GO:0097113 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.1 | 0.5 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.2 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.1 | 0.7 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.1 | 0.1 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
0.1 | 0.4 | GO:0060022 | hard palate development(GO:0060022) |
0.1 | 0.6 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
0.1 | 0.5 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.1 | 0.1 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) |
0.1 | 0.2 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.1 | 2.1 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.1 | 0.2 | GO:0061004 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.1 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 0.2 | GO:0051794 | regulation of catagen(GO:0051794) |
0.1 | 0.3 | GO:0048664 | neuron fate determination(GO:0048664) |
0.1 | 0.2 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.1 | 0.3 | GO:0043133 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
0.1 | 0.1 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.1 | 0.9 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.1 | 0.3 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.1 | 1.9 | GO:0001964 | startle response(GO:0001964) |
0.1 | 0.4 | GO:0021571 | rhombomere 5 development(GO:0021571) |
0.1 | 2.1 | GO:1901381 | positive regulation of potassium ion transmembrane transport(GO:1901381) |
0.1 | 0.4 | GO:0071435 | potassium ion export(GO:0071435) |
0.1 | 0.2 | GO:0030576 | Cajal body organization(GO:0030576) |
0.1 | 0.3 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.1 | 0.3 | GO:0086067 | AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) AV node cell to bundle of His cell communication(GO:0086067) |
0.1 | 0.1 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
0.1 | 0.1 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.1 | 0.6 | GO:0048485 | sympathetic nervous system development(GO:0048485) |
0.1 | 1.3 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
0.1 | 0.2 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
0.1 | 0.6 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.1 | 0.8 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.1 | 0.4 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.1 | 0.1 | GO:0035106 | operant conditioning(GO:0035106) |
0.1 | 0.3 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.1 | 2.1 | GO:0010107 | potassium ion import(GO:0010107) |
0.1 | 0.1 | GO:1903278 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
0.1 | 0.4 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.1 | 0.2 | GO:0070253 | somatostatin secretion(GO:0070253) |
0.1 | 0.4 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
0.1 | 0.1 | GO:0051464 | positive regulation of cortisol secretion(GO:0051464) |
0.1 | 0.8 | GO:0060384 | innervation(GO:0060384) |
0.1 | 1.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.6 | GO:0031000 | response to caffeine(GO:0031000) |
0.1 | 0.3 | GO:1900086 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.1 | 0.4 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.1 | 0.2 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.1 | 0.3 | GO:1904304 | regulation of gastro-intestinal system smooth muscle contraction(GO:1904304) |
0.1 | 1.4 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.1 | 0.5 | GO:0021936 | regulation of cerebellar granule cell precursor proliferation(GO:0021936) |
0.1 | 0.2 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 2.8 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
0.1 | 0.4 | GO:2000544 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
0.1 | 0.1 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.1 | 0.3 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.1 | 1.3 | GO:0060292 | long term synaptic depression(GO:0060292) |
0.1 | 4.3 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 0.3 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.1 | 0.9 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.1 | 0.4 | GO:0070305 | response to cGMP(GO:0070305) |
0.1 | 0.1 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.1 | 0.2 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.1 | 0.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.1 | 0.4 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) |
0.1 | 0.6 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.1 | 0.2 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
0.1 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 0.9 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.1 | 0.2 | GO:0002339 | B cell selection(GO:0002339) |
0.1 | 0.1 | GO:0061205 | paramesonephric duct development(GO:0061205) |
0.1 | 0.9 | GO:1990403 | embryonic brain development(GO:1990403) |
0.1 | 0.2 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.1 | 0.1 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.1 | 0.2 | GO:1904180 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
0.1 | 0.4 | GO:0015871 | choline transport(GO:0015871) |
0.1 | 0.2 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.2 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.1 | 0.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.1 | 0.1 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.1 | 0.2 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
0.1 | 0.3 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.1 | 0.2 | GO:2000019 | negative regulation of male gonad development(GO:2000019) |
0.1 | 0.4 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.1 | 0.3 | GO:0097154 | GABAergic neuron differentiation(GO:0097154) |
0.1 | 0.1 | GO:0099625 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
0.1 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.1 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.1 | 0.3 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.1 | 0.2 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.1 | 0.2 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.1 | 0.2 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 0.2 | GO:2000617 | positive regulation of histone H3-K9 acetylation(GO:2000617) |
0.1 | 0.1 | GO:0060596 | mammary placode formation(GO:0060596) |
0.1 | 0.1 | GO:0031223 | auditory behavior(GO:0031223) |
0.1 | 0.3 | GO:0033504 | floor plate development(GO:0033504) |
0.1 | 0.3 | GO:0045345 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.1 | 0.8 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.1 | 0.3 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.1 | 0.2 | GO:0060005 | vestibular reflex(GO:0060005) |
0.1 | 0.2 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.1 | 0.7 | GO:0021884 | forebrain neuron development(GO:0021884) |
0.1 | 0.3 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.1 | 0.3 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.1 | 0.8 | GO:2001258 | negative regulation of cation channel activity(GO:2001258) |
0.1 | 0.2 | GO:0098739 | import across plasma membrane(GO:0098739) |
0.1 | 0.1 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.1 | 0.1 | GO:1902218 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.1 | 0.1 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
0.1 | 0.1 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.1 | 0.1 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.1 | 0.2 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.4 | GO:0060068 | vagina development(GO:0060068) |
0.1 | 0.3 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.1 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.5 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.2 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.1 | 0.1 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.1 | 0.6 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.1 | 0.2 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.1 | 0.1 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.1 | 0.4 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.1 | 0.1 | GO:1903984 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.1 | 0.3 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.1 | 0.3 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.1 | 0.3 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
0.1 | 0.1 | GO:0006868 | glutamine transport(GO:0006868) |
0.1 | 0.2 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
0.1 | 0.2 | GO:0001546 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
0.1 | 0.4 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.1 | 0.1 | GO:1902805 | positive regulation of synaptic vesicle transport(GO:1902805) |
0.1 | 0.2 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.3 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.1 | 0.1 | GO:0042713 | sperm ejaculation(GO:0042713) |
0.1 | 0.2 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.1 | 0.6 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.1 | 0.1 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.1 | 0.3 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.1 | 0.2 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.1 | 0.2 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.1 | 0.2 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.1 | 0.1 | GO:0060214 | endocardium formation(GO:0060214) |
0.1 | 0.1 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.1 | 0.2 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.1 | 0.1 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.1 | 4.3 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.1 | 0.4 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.1 | 0.3 | GO:0007614 | short-term memory(GO:0007614) |
0.1 | 0.2 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.1 | 0.1 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.1 | 0.3 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.1 | 0.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.1 | 0.1 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.1 | 0.3 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.1 | 0.1 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.1 | 0.3 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
0.1 | 0.2 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.1 | 0.2 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.1 | 0.6 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.1 | 0.2 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.1 | 0.1 | GO:1990035 | calcium ion import into cell(GO:1990035) |
0.1 | 0.1 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.1 | 0.1 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
0.1 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
0.1 | 0.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.1 | 0.2 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.1 | 0.1 | GO:0055015 | ventricular cardiac muscle cell development(GO:0055015) |
0.1 | 2.8 | GO:0071804 | cellular potassium ion transport(GO:0071804) |
0.1 | 0.4 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.1 | 0.1 | GO:0014029 | neural crest formation(GO:0014029) |
0.1 | 0.1 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.1 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.1 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.1 | 0.3 | GO:0032196 | transposition(GO:0032196) |
0.1 | 0.2 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.1 | 0.7 | GO:1903861 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.1 | 0.2 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.1 | 0.3 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.1 | 0.2 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.0 | 0.1 | GO:0007494 | midgut development(GO:0007494) |
0.0 | 0.1 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.0 | 2.5 | GO:0042472 | inner ear morphogenesis(GO:0042472) |
0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.0 | 0.2 | GO:0006477 | protein sulfation(GO:0006477) |
0.0 | 0.2 | GO:0035878 | nail development(GO:0035878) |
0.0 | 0.1 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
0.0 | 0.3 | GO:0035418 | protein localization to synapse(GO:0035418) |
0.0 | 0.1 | GO:0021895 | cerebral cortex neuron differentiation(GO:0021895) |
0.0 | 0.0 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.0 | 0.3 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.0 | 0.2 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 0.1 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.0 | 0.1 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.0 | 0.3 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.0 | 0.1 | GO:0043397 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.0 | 0.2 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.0 | 0.2 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.0 | 0.2 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
0.0 | 0.2 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.0 | 0.2 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
0.0 | 0.1 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.3 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.2 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
0.0 | 0.0 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.0 | 0.1 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.0 | 0.1 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.0 | 0.2 | GO:0014047 | glutamate secretion(GO:0014047) |
0.0 | 0.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.0 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.0 | 0.2 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.0 | 0.3 | GO:0034331 | cell junction maintenance(GO:0034331) |
0.0 | 0.1 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.0 | 0.1 | GO:0006524 | alanine catabolic process(GO:0006524) pyruvate family amino acid catabolic process(GO:0009080) |
0.0 | 0.5 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.0 | 0.0 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.0 | 0.1 | GO:0097503 | sialylation(GO:0097503) |
0.0 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.0 | 0.1 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) regulation of eosinophil degranulation(GO:0043309) |
0.0 | 0.6 | GO:0030901 | midbrain development(GO:0030901) |
0.0 | 0.2 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.0 | 0.1 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.0 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.0 | 0.2 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.0 | 0.1 | GO:0001956 | positive regulation of neurotransmitter secretion(GO:0001956) |
0.0 | 0.3 | GO:0051451 | myoblast migration(GO:0051451) |
0.0 | 0.4 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.0 | 0.4 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 0.1 | GO:0060600 | dichotomous subdivision of an epithelial terminal unit(GO:0060600) |
0.0 | 0.1 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.0 | 0.3 | GO:0030903 | notochord development(GO:0030903) |
0.0 | 0.1 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.0 | 0.1 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.0 | 0.4 | GO:0001553 | luteinization(GO:0001553) |
0.0 | 0.1 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.0 | 0.2 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
0.0 | 0.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.0 | 0.2 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.0 | 0.1 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.0 | 0.3 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.1 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.0 | 0.1 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.0 | 0.1 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.0 | 0.0 | GO:0010882 | regulation of cardiac muscle contraction by calcium ion signaling(GO:0010882) |
0.0 | 0.0 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.0 | 0.1 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.0 | 0.0 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
0.0 | 0.0 | GO:0051938 | L-glutamate import(GO:0051938) |
0.0 | 0.1 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
0.0 | 0.4 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.1 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.1 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
0.0 | 0.1 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.0 | 0.0 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
0.0 | 0.1 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.0 | 0.1 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.0 | GO:0002159 | desmosome assembly(GO:0002159) |
0.0 | 0.1 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.4 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.0 | 0.1 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.0 | 0.2 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.0 | 0.2 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.6 | GO:0051931 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
0.0 | 0.2 | GO:0015884 | folic acid transport(GO:0015884) |
0.0 | 0.0 | GO:0007412 | axon target recognition(GO:0007412) |
0.0 | 0.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.0 | 0.1 | GO:0072033 | renal vesicle formation(GO:0072033) |
0.0 | 0.4 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.0 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.1 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.0 | 0.3 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.0 | 0.1 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.1 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.0 | 0.1 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.0 | 0.0 | GO:0006971 | hypotonic response(GO:0006971) |
0.0 | 0.1 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
0.0 | 0.0 | GO:0032811 | negative regulation of epinephrine secretion(GO:0032811) |
0.0 | 0.3 | GO:0001976 | neurological system process involved in regulation of systemic arterial blood pressure(GO:0001976) |
0.0 | 0.2 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.1 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
0.0 | 0.1 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
0.0 | 0.2 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.0 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.1 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.0 | 0.1 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.0 | 0.1 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
0.0 | 0.1 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.0 | 0.0 | GO:0060231 | mesenchymal to epithelial transition(GO:0060231) |
0.0 | 0.3 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.0 | 0.1 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.0 | 0.1 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.0 | 0.0 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
0.0 | 0.0 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
0.0 | 0.1 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.1 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.1 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.0 | 0.0 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.0 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.0 | 0.1 | GO:0015874 | norepinephrine transport(GO:0015874) |
0.0 | 0.7 | GO:0019226 | transmission of nerve impulse(GO:0019226) |
0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.0 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.0 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.0 | 0.1 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.0 | 0.1 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.0 | 0.2 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.1 | GO:0030800 | negative regulation of cyclic nucleotide metabolic process(GO:0030800) |
0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.1 | GO:0008038 | neuron recognition(GO:0008038) |
0.0 | 0.3 | GO:0046549 | retinal cone cell development(GO:0046549) |
0.0 | 0.1 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
0.0 | 0.2 | GO:0035640 | exploration behavior(GO:0035640) |
0.0 | 0.4 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.1 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.0 | 0.1 | GO:0021554 | optic nerve development(GO:0021554) |
0.0 | 0.1 | GO:1902308 | regulation of peptidyl-serine dephosphorylation(GO:1902308) |
0.0 | 0.1 | GO:0048385 | regulation of retinoic acid receptor signaling pathway(GO:0048385) |
0.0 | 0.1 | GO:1901503 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.0 | 0.5 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
0.0 | 0.0 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.0 | 0.1 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.0 | 0.0 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.0 | 0.0 | GO:0051586 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.0 | 0.5 | GO:0045761 | regulation of adenylate cyclase activity(GO:0045761) |
0.0 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.1 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.0 | 0.5 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
0.0 | 0.1 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
0.0 | 0.2 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.0 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.0 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.0 | 0.0 | GO:0048818 | positive regulation of hair follicle maturation(GO:0048818) |
0.0 | 0.0 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
0.0 | 0.2 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.1 | GO:0030826 | regulation of cGMP biosynthetic process(GO:0030826) positive regulation of cGMP biosynthetic process(GO:0030828) |
0.0 | 0.1 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
0.0 | 0.2 | GO:0033622 | integrin activation(GO:0033622) |
0.0 | 0.1 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.0 | 0.1 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
0.0 | 0.1 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.0 | 0.0 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.0 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.0 | 1.0 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.1 | GO:0044793 | negative regulation by host of viral process(GO:0044793) |
0.0 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.0 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.0 | 0.1 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.0 | 0.1 | GO:0051546 | keratinocyte migration(GO:0051546) |
0.0 | 0.0 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.0 | 0.1 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.0 | GO:0009996 | negative regulation of cell fate specification(GO:0009996) |
0.0 | 0.0 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.1 | GO:0007343 | egg activation(GO:0007343) |
0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.0 | 0.0 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.0 | 0.1 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
0.0 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.0 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.2 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.0 | 1.8 | GO:0007601 | visual perception(GO:0007601) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.0 | GO:0060437 | lung growth(GO:0060437) |
0.0 | 0.0 | GO:0070091 | glucagon secretion(GO:0070091) |
0.0 | 0.0 | GO:0010996 | response to auditory stimulus(GO:0010996) |
0.0 | 0.1 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.0 | 0.2 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.0 | 0.1 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
0.0 | 0.1 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.1 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.0 | 0.0 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.0 | 0.0 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.0 | 0.2 | GO:2000209 | regulation of anoikis(GO:2000209) |
0.0 | 0.0 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) |
0.0 | 0.0 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
0.0 | 0.4 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
0.0 | 0.1 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
0.0 | 0.0 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.0 | 0.1 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.0 | 0.1 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
0.0 | 0.4 | GO:0007193 | adenylate cyclase-inhibiting G-protein coupled receptor signaling pathway(GO:0007193) |
0.0 | 0.0 | GO:0071679 | commissural neuron axon guidance(GO:0071679) |
0.0 | 0.1 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
0.0 | 0.4 | GO:0055013 | cardiac muscle cell development(GO:0055013) |
0.0 | 0.0 | GO:0019661 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.0 | 0.0 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.0 | 0.1 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
0.0 | 0.0 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.0 | GO:0071639 | positive regulation of monocyte chemotactic protein-1 production(GO:0071639) |
0.0 | 0.4 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.0 | 0.1 | GO:0010880 | regulation of release of sequestered calcium ion into cytosol by sarcoplasmic reticulum(GO:0010880) |
0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.0 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.2 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.0 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.0 | 0.0 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.0 | 0.0 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.0 | 0.0 | GO:2000412 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
0.0 | 0.5 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.0 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.0 | 0.0 | GO:1903115 | regulation of actin filament-based movement(GO:1903115) |
0.0 | 0.0 | GO:0072429 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.1 | GO:0060074 | synapse maturation(GO:0060074) |
0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.0 | 0.2 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.1 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
0.0 | 0.2 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.0 | 0.0 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.0 | 0.0 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.0 | 0.1 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
0.0 | 0.1 | GO:0046618 | drug export(GO:0046618) |
0.0 | 0.1 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.0 | 0.0 | GO:0034091 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
0.0 | 0.0 | GO:0046541 | saliva secretion(GO:0046541) |
0.0 | 0.1 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.0 | 0.0 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.0 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.0 | 0.0 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.0 | 0.0 | GO:0035799 | ureter maturation(GO:0035799) |
0.0 | 0.0 | GO:1904467 | regulation of tumor necrosis factor secretion(GO:1904467) positive regulation of tumor necrosis factor secretion(GO:1904469) tumor necrosis factor secretion(GO:1990774) |
0.0 | 0.3 | GO:0003341 | cilium movement(GO:0003341) |
0.0 | 0.1 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
0.0 | 0.0 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.0 | GO:0003180 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
0.0 | 0.0 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.0 | 0.0 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.0 | 0.0 | GO:0032594 | protein transport within lipid bilayer(GO:0032594) |
0.0 | 0.1 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
0.0 | 0.2 | GO:0021591 | ventricular system development(GO:0021591) |
0.0 | 0.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.0 | 0.0 | GO:0046864 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.0 | 0.0 | GO:0009136 | purine nucleoside diphosphate biosynthetic process(GO:0009136) purine ribonucleoside diphosphate biosynthetic process(GO:0009180) |
0.0 | 0.1 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.0 | 0.0 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.0 | GO:0030035 | microspike assembly(GO:0030035) |
0.0 | 0.0 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.0 | GO:0072201 | negative regulation of mesenchymal cell proliferation(GO:0072201) |
0.0 | 0.0 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
0.0 | 0.0 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
0.0 | 0.0 | GO:0015860 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.0 | 0.0 | GO:0042908 | xenobiotic transport(GO:0042908) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.0 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.3 | 0.3 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.3 | 1.9 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.3 | 0.8 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.2 | 1.9 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.2 | 2.4 | GO:0043194 | axon initial segment(GO:0043194) |
0.2 | 1.7 | GO:0005861 | troponin complex(GO:0005861) |
0.2 | 0.8 | GO:0000322 | storage vacuole(GO:0000322) |
0.2 | 1.0 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.2 | 1.5 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.2 | 0.6 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.2 | 2.2 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.2 | 0.5 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.2 | 1.6 | GO:0005883 | neurofilament(GO:0005883) |
0.2 | 0.2 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.2 | 0.6 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 2.3 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.4 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 4.0 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.1 | 1.2 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.1 | 1.9 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.6 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.1 | 0.4 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 6.1 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.1 | 2.7 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.1 | 1.1 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 0.1 | GO:0008328 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.1 | 2.1 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 2.1 | GO:0005922 | connexon complex(GO:0005922) |
0.1 | 0.3 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.1 | 0.4 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 1.7 | GO:0001741 | XY body(GO:0001741) |
0.1 | 2.9 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 1.5 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.1 | 0.3 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 3.0 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.1 | 0.4 | GO:1990696 | USH2 complex(GO:1990696) |
0.1 | 0.6 | GO:0032584 | growth cone membrane(GO:0032584) |
0.1 | 0.2 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
0.1 | 0.1 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.1 | 1.0 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 0.2 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.1 | 0.2 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.1 | 1.0 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.1 | 0.4 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 0.4 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 0.4 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 0.3 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.3 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 0.3 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 0.2 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.1 | 0.7 | GO:0032590 | dendrite membrane(GO:0032590) |
0.1 | 8.5 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.1 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.8 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.1 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 0.8 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.1 | 0.1 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.1 | 0.6 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 1.0 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
0.1 | 0.3 | GO:0016011 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
0.1 | 3.9 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.1 | GO:0016342 | catenin complex(GO:0016342) |
0.0 | 0.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.1 | GO:0033268 | node of Ranvier(GO:0033268) |
0.0 | 0.0 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.0 | 1.0 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 1.2 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.3 | GO:0005916 | fascia adherens(GO:0005916) |
0.0 | 0.1 | GO:0034706 | sodium channel complex(GO:0034706) |
0.0 | 0.3 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.4 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 0.3 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.3 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.6 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.0 | 1.1 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.0 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.0 | 0.3 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 4.0 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 1.1 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.3 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.1 | GO:0000802 | transverse filament(GO:0000802) |
0.0 | 0.2 | GO:0005587 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 0.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 0.3 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.1 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
0.0 | 0.1 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 9.0 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.0 | 0.3 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 0.2 | GO:0030677 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.0 | 0.0 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.0 | 0.0 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.0 | 0.2 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 1.1 | GO:0043195 | terminal bouton(GO:0043195) |
0.0 | 0.2 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.1 | GO:0005914 | spot adherens junction(GO:0005914) |
0.0 | 0.2 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.1 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.2 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.7 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.0 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 0.1 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.0 | 0.0 | GO:0043203 | axon hillock(GO:0043203) |
0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.0 | 0.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.0 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.0 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.0 | GO:0033010 | paranodal junction(GO:0033010) |
0.0 | 0.5 | GO:0001533 | cornified envelope(GO:0001533) |
0.0 | 0.0 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.1 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.0 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 2.6 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 1.1 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.9 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.6 | 1.9 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.5 | 0.9 | GO:0030172 | troponin C binding(GO:0030172) |
0.4 | 1.2 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.4 | 2.7 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.4 | 1.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.3 | 1.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.3 | 0.9 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.3 | 1.1 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.3 | 0.8 | GO:0051373 | FATZ binding(GO:0051373) |
0.3 | 0.8 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.2 | 1.0 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.2 | 0.7 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.2 | 0.4 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.2 | 0.6 | GO:0031014 | troponin T binding(GO:0031014) |
0.2 | 1.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.2 | 0.6 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.2 | 1.0 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.2 | 1.0 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.2 | 0.6 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.2 | 0.8 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.2 | 0.9 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.2 | 5.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.2 | 0.7 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.2 | 0.9 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.2 | 0.5 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.2 | 0.3 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.2 | 0.7 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.2 | 0.7 | GO:0031433 | telethonin binding(GO:0031433) |
0.2 | 1.3 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.2 | 0.8 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.2 | 0.8 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.2 | 0.5 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.2 | 1.7 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.2 | 1.2 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.1 | 3.6 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.1 | 3.0 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.3 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 1.5 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 0.8 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.1 | 0.3 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.1 | 1.6 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 3.3 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 0.4 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.1 | 0.4 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.1 | 1.6 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.1 | 0.8 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.1 | 0.5 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 1.4 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.1 | 0.4 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.1 | 1.6 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.1 | 0.5 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 1.1 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.1 | 0.1 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
0.1 | 0.4 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.1 | 0.3 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.1 | 0.4 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.1 | 0.4 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.4 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.1 | 0.3 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 0.4 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.1 | 0.5 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.1 | 0.4 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.1 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.1 | 0.3 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.1 | 0.2 | GO:0035939 | microsatellite binding(GO:0035939) |
0.1 | 0.5 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.1 | 1.2 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.1 | 0.2 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.1 | 2.0 | GO:0005249 | voltage-gated potassium channel activity(GO:0005249) |
0.1 | 0.4 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 1.0 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.4 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.1 | 0.2 | GO:0043121 | neurotrophin binding(GO:0043121) |
0.1 | 0.4 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.5 | GO:0031432 | titin binding(GO:0031432) |
0.1 | 3.0 | GO:0005109 | frizzled binding(GO:0005109) |
0.1 | 0.4 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 0.7 | GO:0022824 | transmitter-gated ion channel activity(GO:0022824) transmitter-gated channel activity(GO:0022835) |
0.1 | 0.2 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.1 | 0.9 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 0.5 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 0.5 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.1 | 0.2 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.1 | 0.4 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.3 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 2.1 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.1 | 0.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.1 | 0.2 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.1 | 0.3 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 0.6 | GO:0099604 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
0.1 | 1.6 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.1 | 1.9 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.1 | 1.1 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
0.1 | 0.4 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 0.2 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.1 | 0.2 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 0.5 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.1 | 0.3 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.1 | 0.2 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 0.2 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.1 | 0.1 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.1 | 0.6 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.1 | 0.2 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.1 | 0.3 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.1 | 0.5 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.1 | 0.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.2 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.1 | 0.3 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.1 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
0.1 | 0.1 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 0.2 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.1 | 0.2 | GO:0055100 | adiponectin binding(GO:0055100) |
0.1 | 0.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.1 | 0.2 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.1 | 0.5 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.1 | 0.2 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.1 | 2.6 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.1 | 0.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.1 | 0.6 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.8 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 0.3 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 0.8 | GO:0016917 | GABA receptor activity(GO:0016917) |
0.1 | 0.2 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.1 | 0.5 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.1 | 1.2 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.1 | 0.2 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.1 | 0.1 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.1 | 0.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 11.5 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.1 | 0.1 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
0.0 | 0.7 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.0 | 0.2 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.2 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.5 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.0 | GO:0005217 | intracellular ligand-gated ion channel activity(GO:0005217) |
0.0 | 0.7 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.5 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.3 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.4 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 1.1 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.0 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.0 | 0.4 | GO:0035254 | glutamate receptor binding(GO:0035254) |
0.0 | 0.1 | GO:0050693 | LBD domain binding(GO:0050693) |
0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.3 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.7 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.3 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 0.3 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.0 | 0.4 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.1 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.0 | 0.2 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.0 | 0.3 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.1 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.2 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.0 | 0.3 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.0 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
0.0 | 0.5 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.2 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.3 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.1 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.0 | 0.1 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.0 | 0.2 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.2 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 0.2 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.0 | 0.2 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.2 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.0 | 0.2 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 0.2 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.2 | GO:0018660 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.0 | 0.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.0 | 0.1 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.2 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.0 | 1.1 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.0 | 0.1 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.4 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.0 | 0.4 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.1 | GO:0004952 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) dopamine neurotransmitter receptor activity(GO:0004952) |
0.0 | 0.2 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.0 | 0.1 | GO:0070061 | fructose binding(GO:0070061) |
0.0 | 0.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.0 | 0.6 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.1 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.0 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 0.5 | GO:0044654 | dextrin alpha-glucosidase activity(GO:0044653) starch alpha-glucosidase activity(GO:0044654) beta-glucanase activity(GO:0052736) beta-6-sulfate-N-acetylglucosaminidase activity(GO:0052769) glucan endo-1,4-beta-glucosidase activity(GO:0052859) |
0.0 | 0.0 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.9 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.0 | 0.2 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.4 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.4 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.2 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.0 | 0.2 | GO:0022842 | leak channel activity(GO:0022840) potassium ion leak channel activity(GO:0022841) narrow pore channel activity(GO:0022842) |
0.0 | 0.6 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.0 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
0.0 | 0.0 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.1 | GO:0030553 | cGMP binding(GO:0030553) |
0.0 | 0.1 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.0 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.0 | 0.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.1 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.2 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.3 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 2.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.1 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.0 | 0.1 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.3 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
0.0 | 0.1 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.0 | 0.3 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.1 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.0 | 0.4 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.1 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.0 | 0.0 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.0 | 0.2 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.0 | 0.9 | GO:0044325 | ion channel binding(GO:0044325) |
0.0 | 0.0 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
0.0 | 0.0 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
0.0 | 0.0 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 0.1 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.0 | 0.5 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
0.0 | 0.0 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.0 | 0.2 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.0 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.0 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 0.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.0 | 0.1 | GO:0034889 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.0 | 0.1 | GO:0004083 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) |
0.0 | 0.0 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.0 | 0.3 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.0 | 0.2 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.3 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.5 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.1 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.1 | GO:0016454 | C-palmitoyltransferase activity(GO:0016454) |
0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.3 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.2 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.1 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 0.0 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.1 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.0 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.2 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.1 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.3 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.0 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.0 | GO:0034711 | inhibin binding(GO:0034711) |
0.0 | 0.0 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.0 | 0.0 | GO:0002134 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.0 | 0.0 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.0 | GO:0016751 | S-succinyltransferase activity(GO:0016751) |
0.0 | 0.0 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.0 | 0.8 | GO:0001653 | peptide receptor activity(GO:0001653) |
0.0 | 0.0 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
0.0 | 0.1 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.7 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.1 | 1.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 0.8 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 2.0 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 1.7 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.1 | 0.9 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.1 | 1.6 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 0.6 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 0.0 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.9 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.9 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.6 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.5 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.0 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 1.7 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.0 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.0 | 0.6 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.1 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.9 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.0 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.8 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.1 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.5 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.6 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.6 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 2.3 | NABA CORE MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
0.0 | 0.0 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.1 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.0 | 0.0 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 2.7 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.0 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.2 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.2 | 1.9 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.2 | 2.6 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.2 | 7.2 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.2 | 2.3 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.2 | 1.8 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.1 | 1.7 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.1 | 1.4 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 1.8 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 2.0 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 1.4 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.1 | 1.2 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.1 | 0.9 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.1 | 1.1 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 1.3 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 0.1 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.1 | 2.6 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 0.1 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.1 | 0.2 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.1 | 2.1 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 0.7 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 2.1 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
0.1 | 0.7 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.1 | 2.6 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.1 | 1.7 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.1 | 0.5 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.1 | 1.1 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 0.9 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.1 | 0.1 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
0.1 | 1.0 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.1 | 3.5 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.6 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.0 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.0 | 0.3 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.1 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.0 | 0.2 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
0.0 | 0.1 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.0 | 0.7 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.9 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.3 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.8 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.5 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.2 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 1.2 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 0.3 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.8 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.4 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.0 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.0 | 0.7 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
0.0 | 0.2 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.5 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 2.8 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
0.0 | 0.4 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.1 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.7 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.3 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.4 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.2 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 0.4 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
0.0 | 0.1 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |