Gene Symbol | Gene ID | Gene Info |
---|---|---|
Sox11
|
ENSMUSG00000063632.5 | Sox11 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Sox11 | chr12_27390683_27390834 | 48184 | 0.181734 | -0.46 | 2.0e-04 | Click! |
Sox11 | chr12_27465931_27466167 | 123475 | 0.056683 | -0.45 | 2.9e-04 | Click! |
Sox11 | chr12_27411027_27411178 | 68528 | 0.130392 | -0.39 | 2.1e-03 | Click! |
Sox11 | chr12_27334769_27335068 | 7656 | 0.292233 | 0.34 | 8.7e-03 | Click! |
Sox11 | chr12_27410792_27410943 | 68293 | 0.130895 | -0.33 | 1.0e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr5_150260534_150260992 | 3.38 |
Fry |
FRY microtubule binding protein |
996 |
0.55 |
chr2_181767278_181768191 | 2.84 |
Myt1 |
myelin transcription factor 1 |
222 |
0.91 |
chr5_150261018_150262108 | 2.79 |
Fry |
FRY microtubule binding protein |
1796 |
0.34 |
chr15_95525022_95525792 | 2.76 |
Nell2 |
NEL-like 2 |
2771 |
0.35 |
chr3_108410436_108412210 | 2.71 |
Celsr2 |
cadherin, EGF LAG seven-pass G-type receptor 2 |
4229 |
0.11 |
chr2_65620767_65621991 | 2.58 |
Scn2a |
sodium channel, voltage-gated, type II, alpha |
568 |
0.82 |
chr3_17792584_17792950 | 2.58 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
1153 |
0.46 |
chr12_31711839_31712627 | 2.58 |
Gpr22 |
G protein-coupled receptor 22 |
1693 |
0.32 |
chr13_109928298_109928867 | 2.56 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
1738 |
0.46 |
chr1_9601164_9602408 | 2.53 |
Vxn |
vexin |
587 |
0.67 |
chr4_82501450_82502014 | 2.53 |
Nfib |
nuclear factor I/B |
2416 |
0.3 |
chr4_78209143_78209724 | 2.32 |
Ptprd |
protein tyrosine phosphatase, receptor type, D |
2306 |
0.29 |
chr10_57787071_57787893 | 2.30 |
Fabp7 |
fatty acid binding protein 7, brain |
2559 |
0.25 |
chr4_97584366_97584872 | 2.15 |
E130114P18Rik |
RIKEN cDNA E130114P18 gene |
1 |
0.98 |
chr18_64889550_64889704 | 2.11 |
Nedd4l |
neural precursor cell expressed, developmentally down-regulated gene 4-like |
598 |
0.62 |
chrX_166348094_166348432 | 2.09 |
Gpm6b |
glycoprotein m6b |
3421 |
0.29 |
chr1_66322822_66322976 | 1.95 |
Map2 |
microtubule-associated protein 2 |
797 |
0.63 |
chr3_158557848_158558063 | 1.92 |
Lrrc7 |
leucine rich repeat containing 7 |
3381 |
0.35 |
chr2_14740186_14740953 | 1.85 |
Gm10848 |
predicted gene 10848 |
847 |
0.36 |
chr1_84693950_84694415 | 1.80 |
Mir5126 |
microRNA 5126 |
1657 |
0.28 |
chr5_98184068_98184753 | 1.79 |
A730035I17Rik |
RIKEN cDNA A730035I17 gene |
800 |
0.59 |
chr2_79452354_79452909 | 1.76 |
Neurod1 |
neurogenic differentiation 1 |
4120 |
0.24 |
chr3_76075976_76076354 | 1.73 |
Fstl5 |
follistatin-like 5 |
582 |
0.8 |
chr7_51626624_51628140 | 1.73 |
Slc17a6 |
solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 6 |
2098 |
0.31 |
chr8_90958160_90958505 | 1.70 |
Chd9 |
chromodomain helicase DNA binding protein 9 |
2897 |
0.24 |
chr12_71049290_71050137 | 1.67 |
Arid4a |
AT rich interactive domain 4A (RBP1-like) |
1372 |
0.4 |
chr12_86880278_86881016 | 1.66 |
Irf2bpl |
interferon regulatory factor 2 binding protein-like |
4151 |
0.21 |
chr2_84371789_84371976 | 1.63 |
Calcrl |
calcitonin receptor-like |
3476 |
0.26 |
chr8_117259792_117260803 | 1.59 |
Cmip |
c-Maf inducing protein |
3180 |
0.33 |
chr15_85675143_85675686 | 1.58 |
Lncppara |
long noncoding RNA near Ppara |
21798 |
0.12 |
chr8_54956010_54956394 | 1.57 |
Gpm6a |
glycoprotein m6a |
1359 |
0.38 |
chr8_78432202_78432747 | 1.55 |
Pou4f2 |
POU domain, class 4, transcription factor 2 |
4171 |
0.24 |
chr9_4793875_4794307 | 1.55 |
Gria4 |
glutamate receptor, ionotropic, AMPA4 (alpha 4) |
1428 |
0.59 |
chr1_88698916_88699320 | 1.54 |
Arl4c |
ADP-ribosylation factor-like 4C |
2758 |
0.23 |
chr5_84281287_84281877 | 1.52 |
Epha5 |
Eph receptor A5 |
80484 |
0.11 |
chr7_62366195_62366527 | 1.51 |
Magel2 |
melanoma antigen, family L, 2 |
10649 |
0.18 |
chr8_94869714_94871671 | 1.49 |
Dok4 |
docking protein 4 |
512 |
0.65 |
chrX_166344665_166345995 | 1.47 |
Gpm6b |
glycoprotein m6b |
488 |
0.85 |
chr18_35799874_35800025 | 1.45 |
Ube2d2a |
ubiquitin-conjugating enzyme E2D 2A |
3 |
0.59 |
chr8_55941540_55941691 | 1.45 |
Glra3 |
glycine receptor, alpha 3 subunit |
790 |
0.67 |
chr12_31711352_31711698 | 1.45 |
Gpr22 |
G protein-coupled receptor 22 |
2401 |
0.25 |
chr12_72234504_72235243 | 1.43 |
Rtn1 |
reticulon 1 |
866 |
0.66 |
chr3_80798105_80798468 | 1.43 |
Gria2 |
glutamate receptor, ionotropic, AMPA2 (alpha 2) |
4293 |
0.29 |
chr18_35210523_35210985 | 1.42 |
Ctnna1 |
catenin (cadherin associated protein), alpha 1 |
4176 |
0.2 |
chr6_104492794_104494036 | 1.42 |
Cntn6 |
contactin 6 |
167 |
0.98 |
chr3_107039197_107039974 | 1.42 |
AI504432 |
expressed sequence AI504432 |
81 |
0.96 |
chr13_83737592_83739114 | 1.40 |
Gm33366 |
predicted gene, 33366 |
182 |
0.66 |
chr12_71048661_71048812 | 1.40 |
Arid4a |
AT rich interactive domain 4A (RBP1-like) |
395 |
0.84 |
chr8_94268148_94268983 | 1.40 |
Nup93 |
nucleoporin 93 |
41 |
0.96 |
chr1_165933135_165933347 | 1.37 |
Pou2f1 |
POU domain, class 2, transcription factor 1 |
1659 |
0.3 |
chr8_109245493_109246323 | 1.36 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
3958 |
0.33 |
chr7_51620788_51621096 | 1.36 |
Slc17a6 |
solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 6 |
1064 |
0.54 |
chr3_107040280_107040795 | 1.36 |
AI504432 |
expressed sequence AI504432 |
1033 |
0.48 |
chr5_135168984_135169293 | 1.33 |
Bcl7b |
B cell CLL/lymphoma 7B |
693 |
0.53 |
chrX_41063710_41063861 | 1.32 |
Gm14576 |
predicted gene 14576 |
135674 |
0.05 |
chrX_23283125_23283785 | 1.31 |
Klhl13 |
kelch-like 13 |
1374 |
0.57 |
chr2_158606690_158608449 | 1.31 |
Gm14204 |
predicted gene 14204 |
3021 |
0.15 |
chr4_13753841_13754203 | 1.29 |
Runx1t1 |
RUNX1 translocation partner 1 |
2725 |
0.4 |
chr13_21897738_21897959 | 1.28 |
Mir1983 |
microRNA 1983 |
799 |
0.35 |
chr4_109569491_109569667 | 1.28 |
Gm12811 |
predicted gene 12811 |
365 |
0.85 |
chr2_96319240_96319943 | 1.27 |
Lrrc4c |
leucine rich repeat containing 4C |
1375 |
0.61 |
chr14_122481093_122481670 | 1.27 |
Zic2 |
zinc finger protein of the cerebellum 2 |
3281 |
0.14 |
chr15_44746196_44747245 | 1.27 |
Sybu |
syntabulin (syntaxin-interacting) |
1068 |
0.56 |
chr4_33927284_33927435 | 1.26 |
Cnr1 |
cannabinoid receptor 1 (brain) |
1157 |
0.6 |
chr15_19201185_19201336 | 1.26 |
Gm18533 |
predicted gene, 18533 |
2986 |
0.27 |
chr18_25750468_25751272 | 1.26 |
Celf4 |
CUGBP, Elav-like family member 4 |
1822 |
0.41 |
chr15_30458403_30458947 | 1.26 |
Ctnnd2 |
catenin (cadherin associated protein), delta 2 |
887 |
0.67 |
chr1_166939793_166940071 | 1.25 |
Gm6286 |
predicted gene 6286 |
6426 |
0.24 |
chr8_54956899_54957247 | 1.23 |
Gpm6a |
glycoprotein m6a |
2230 |
0.24 |
chr5_20229632_20230055 | 1.22 |
Magi2 |
membrane associated guanylate kinase, WW and PDZ domain containing 2 |
1657 |
0.41 |
chr18_69598813_69599383 | 1.22 |
Tcf4 |
transcription factor 4 |
438 |
0.89 |
chr15_66283828_66283979 | 1.22 |
Kcnq3 |
potassium voltage-gated channel, subfamily Q, member 3 |
2148 |
0.3 |
chr7_123030358_123031784 | 1.21 |
Gm45846 |
predicted gene 45846 |
303 |
0.51 |
chr12_31710202_31710828 | 1.21 |
Gpr22 |
G protein-coupled receptor 22 |
3411 |
0.2 |
chr1_66323360_66324079 | 1.20 |
Map2 |
microtubule-associated protein 2 |
1617 |
0.37 |
chr5_90338412_90338948 | 1.19 |
Ankrd17 |
ankyrin repeat domain 17 |
1063 |
0.54 |
chr8_108535196_108536010 | 1.19 |
Gm39244 |
predicted gene, 39244 |
1344 |
0.54 |
chr2_181715341_181715994 | 1.19 |
Oprl1 |
opioid receptor-like 1 |
35 |
0.95 |
chr17_32808045_32808304 | 1.19 |
Zfp811 |
zinc finger protein 811 |
1668 |
0.15 |
chr12_49380979_49381171 | 1.18 |
Gm34304 |
predicted gene, 34304 |
810 |
0.46 |
chr15_72807706_72808811 | 1.18 |
Peg13 |
paternally expressed 13 |
2066 |
0.4 |
chr12_61525659_61526870 | 1.17 |
Lrfn5 |
leucine rich repeat and fibronectin type III domain containing 5 |
2316 |
0.3 |
chr13_85067537_85067966 | 1.16 |
Gm47745 |
predicted gene, 47745 |
26584 |
0.17 |
chr5_98182043_98182194 | 1.15 |
Prdm8 |
PR domain containing 8 |
1140 |
0.44 |
chr16_77594640_77595970 | 1.15 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
403 |
0.71 |
chr4_116878423_116878655 | 1.13 |
Zswim5 |
zinc finger SWIM-type containing 5 |
1163 |
0.29 |
chr4_33926104_33927188 | 1.13 |
Cnr1 |
cannabinoid receptor 1 (brain) |
444 |
0.88 |
chr14_119140059_119140210 | 1.13 |
Hs6st3 |
heparan sulfate 6-O-sulfotransferase 3 |
1793 |
0.39 |
chr7_60623066_60623220 | 1.13 |
Gm3198 |
predicted gene 3198 |
20748 |
0.24 |
chr9_110054589_110054957 | 1.13 |
Map4 |
microtubule-associated protein 4 |
2721 |
0.19 |
chr9_91361494_91362853 | 1.12 |
Zic4 |
zinc finger protein of the cerebellum 4 |
240 |
0.8 |
chr8_31916563_31917105 | 1.12 |
Nrg1 |
neuregulin 1 |
816 |
0.63 |
chr15_98983254_98984205 | 1.12 |
4930578M01Rik |
RIKEN cDNA 4930578M01 gene |
102 |
0.93 |
chr4_110290101_110291006 | 1.11 |
Elavl4 |
ELAV like RNA binding protein 4 |
281 |
0.95 |
chr14_108908379_108908530 | 1.11 |
Slitrk1 |
SLIT and NTRK-like family, member 1 |
5704 |
0.35 |
chr12_49386970_49387121 | 1.11 |
Gm43517 |
predicted gene 43517 |
1871 |
0.22 |
chr1_66388178_66389004 | 1.10 |
Map2 |
microtubule-associated protein 2 |
1580 |
0.42 |
chr14_55056074_55056891 | 1.10 |
Gm20687 |
predicted gene 20687 |
989 |
0.3 |
chr1_177555816_177556242 | 1.10 |
Gm37280 |
predicted gene, 37280 |
38493 |
0.14 |
chr9_41587766_41588181 | 1.09 |
Mir100hg |
Mir100 Mirlet7a-2 Mir125b-1 cluster host gene |
204 |
0.89 |
chr5_56149156_56149307 | 1.09 |
Gm43315 |
predicted gene 43315 |
8107 |
0.33 |
chr7_115823790_115824046 | 1.08 |
Sox6 |
SRY (sex determining region Y)-box 6 |
792 |
0.77 |
chr13_104914221_104914837 | 1.08 |
Gm4938 |
predicted pseudogene 4938 |
4251 |
0.27 |
chr2_55439535_55439810 | 1.08 |
Kcnj3 |
potassium inwardly-rectifying channel, subfamily J, member 3 |
2507 |
0.37 |
chrX_158924759_158924985 | 1.07 |
Gm5764 |
predicted gene 5764 |
91437 |
0.09 |
chr7_46399032_46399239 | 1.07 |
Kcnc1 |
potassium voltage gated channel, Shaw-related subfamily, member 1 |
1487 |
0.35 |
chr6_107532775_107533332 | 1.07 |
Lrrn1 |
leucine rich repeat protein 1, neuronal |
3285 |
0.29 |
chr1_132199896_132201879 | 1.07 |
Lemd1 |
LEM domain containing 1 |
76 |
0.95 |
chr5_20227904_20228343 | 1.06 |
Magi2 |
membrane associated guanylate kinase, WW and PDZ domain containing 2 |
63 |
0.98 |
chrX_48519996_48520368 | 1.06 |
Rab33a |
RAB33A, member RAS oncogene family |
897 |
0.55 |
chr3_107038303_107039010 | 1.06 |
AI504432 |
expressed sequence AI504432 |
848 |
0.54 |
chr15_92600107_92600467 | 1.05 |
Pdzrn4 |
PDZ domain containing RING finger 4 |
3161 |
0.38 |
chr2_15127556_15127757 | 1.04 |
Gm13313 |
predicted gene 13313 |
56 |
0.98 |
chr1_52231774_52231925 | 1.04 |
Gls |
glutaminase |
447 |
0.84 |
chr4_90781058_90781209 | 1.03 |
Gm12632 |
predicted gene 12632 |
75750 |
0.12 |
chr16_42336507_42337221 | 1.03 |
Gap43 |
growth associated protein 43 |
3787 |
0.3 |
chr3_45383889_45384379 | 1.02 |
Pcdh10 |
protocadherin 10 |
1501 |
0.35 |
chr6_36387954_36389412 | 1.02 |
9330158H04Rik |
RIKEN cDNA 9330158H04 gene |
234 |
0.74 |
chr5_117241784_117242411 | 1.01 |
Taok3 |
TAO kinase 3 |
1637 |
0.3 |
chr7_61310655_61310806 | 1.01 |
A230006K03Rik |
RIKEN cDNA A230006K03 gene |
983 |
0.69 |
chr17_64329718_64329909 | 1.01 |
Pja2 |
praja ring finger ubiquitin ligase 2 |
2052 |
0.38 |
chr3_34560367_34561122 | 1.00 |
Sox2ot |
SOX2 overlapping transcript (non-protein coding) |
352 |
0.85 |
chr13_84063384_84064052 | 1.00 |
Gm17750 |
predicted gene, 17750 |
1054 |
0.58 |
chr2_20964652_20964886 | 1.00 |
Arhgap21 |
Rho GTPase activating protein 21 |
2951 |
0.25 |
chr10_110453550_110454045 | 1.00 |
Nav3 |
neuron navigator 3 |
2407 |
0.34 |
chr3_17790851_17791260 | 1.00 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
1098 |
0.49 |
chrX_136591171_136591322 | 0.99 |
Tceal3 |
transcription elongation factor A (SII)-like 3 |
391 |
0.77 |
chr14_61645558_61645884 | 0.99 |
Dleu2 |
deleted in lymphocytic leukemia, 2 |
2901 |
0.12 |
chr13_8208366_8208661 | 0.99 |
Adarb2 |
adenosine deaminase, RNA-specific, B2 |
5591 |
0.19 |
chr1_15288505_15288656 | 0.98 |
Kcnb2 |
potassium voltage gated channel, Shab-related subfamily, member 2 |
1326 |
0.51 |
chr1_125912994_125913145 | 0.98 |
Lypd1 |
Ly6/Plaur domain containing 1 |
32 |
0.98 |
chr17_29883165_29884481 | 0.98 |
Mdga1 |
MAM domain containing glycosylphosphatidylinositol anchor 1 |
3659 |
0.2 |
chr13_83719687_83720586 | 0.98 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
1245 |
0.36 |
chr6_39874717_39875333 | 0.97 |
Tmem178b |
transmembrane protein 178B |
1954 |
0.27 |
chr6_25686466_25687390 | 0.97 |
Gpr37 |
G protein-coupled receptor 37 |
2864 |
0.38 |
chr10_109007772_109008002 | 0.97 |
Syt1 |
synaptotagmin I |
1213 |
0.6 |
chr10_92161472_92161916 | 0.97 |
Rmst |
rhabdomyosarcoma 2 associated transcript (non-coding RNA) |
1067 |
0.55 |
chr13_25268305_25268654 | 0.96 |
Nrsn1 |
neurensin 1 |
1491 |
0.51 |
chr2_47424914_47425131 | 0.96 |
Gm25959 |
predicted gene, 25959 |
116962 |
0.07 |
chr12_55307210_55307484 | 0.96 |
Prorp |
protein only RNase P catalytic subunit |
4061 |
0.16 |
chr8_109244278_109244568 | 0.96 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
5443 |
0.3 |
chr12_8497802_8497953 | 0.96 |
Rhob |
ras homolog family member B |
2132 |
0.25 |
chr16_77536184_77536608 | 0.96 |
Gm36963 |
predicted gene, 36963 |
3486 |
0.16 |
chr16_72030928_72031079 | 0.96 |
Gm49667 |
predicted gene, 49667 |
151959 |
0.04 |
chr12_46816152_46816702 | 0.95 |
Nova1 |
NOVA alternative splicing regulator 1 |
533 |
0.8 |
chr3_4796861_4798079 | 0.95 |
1110015O18Rik |
RIKEN cDNA 1110015O18 gene |
88 |
0.98 |
chr3_34651759_34652037 | 0.95 |
Sox2 |
SRY (sex determining region Y)-box 2 |
1493 |
0.26 |
chr1_119834815_119835233 | 0.95 |
Ptpn4 |
protein tyrosine phosphatase, non-receptor type 4 |
1975 |
0.23 |
chr18_6764698_6765166 | 0.95 |
Rab18 |
RAB18, member RAS oncogene family |
213 |
0.93 |
chr19_9133461_9133612 | 0.94 |
Gm9750 |
predicted gene 9750 |
1621 |
0.28 |
chr18_35215455_35215606 | 0.94 |
Lrrtm2 |
leucine rich repeat transmembrane neuronal 2 |
506 |
0.49 |
chr2_114012816_114014272 | 0.94 |
A530058N18Rik |
RIKEN cDNA A530058N18 gene |
19 |
0.54 |
chr9_96259805_96260438 | 0.94 |
Tfdp2 |
transcription factor Dp 2 |
836 |
0.59 |
chrX_100730829_100731418 | 0.94 |
Gdpd2 |
glycerophosphodiester phosphodiesterase domain containing 2 |
937 |
0.47 |
chr1_65188302_65188453 | 0.94 |
Pikfyve |
phosphoinositide kinase, FYVE type zinc finger containing |
1627 |
0.28 |
chr5_115432636_115432916 | 0.93 |
Msi1 |
musashi RNA-binding protein 1 |
616 |
0.49 |
chr3_107041271_107042100 | 0.93 |
AI504432 |
expressed sequence AI504432 |
2181 |
0.26 |
chr5_17220718_17220869 | 0.93 |
Gm6673 |
predicted gene 6673 |
7141 |
0.31 |
chr10_92160735_92161461 | 0.92 |
Rmst |
rhabdomyosarcoma 2 associated transcript (non-coding RNA) |
1663 |
0.4 |
chr2_6873585_6874006 | 0.92 |
Celf2 |
CUGBP, Elav-like family member 2 |
1198 |
0.49 |
chr5_103355438_103355843 | 0.92 |
5430427N15Rik |
RIKEN cDNA 5430427N15 gene |
1058 |
0.47 |
chr14_98156151_98156556 | 0.92 |
Dach1 |
dachshund family transcription factor 1 |
13190 |
0.24 |
chr6_55680133_55680881 | 0.92 |
Neurod6 |
neurogenic differentiation 6 |
756 |
0.69 |
chr4_15880938_15882113 | 0.91 |
Calb1 |
calbindin 1 |
259 |
0.9 |
chr7_48962741_48963105 | 0.91 |
Nav2 |
neuron navigator 2 |
3826 |
0.21 |
chr13_83984481_83985348 | 0.91 |
Gm4241 |
predicted gene 4241 |
3077 |
0.26 |
chr4_43656930_43657081 | 0.91 |
Hint2 |
histidine triad nucleotide binding protein 2 |
539 |
0.5 |
chr6_55679226_55679709 | 0.91 |
Neurod6 |
neurogenic differentiation 6 |
1796 |
0.39 |
chr18_69595338_69595620 | 0.91 |
Tcf4 |
transcription factor 4 |
1297 |
0.56 |
chr14_93883900_93884713 | 0.91 |
Pcdh9 |
protocadherin 9 |
1442 |
0.55 |
chr6_121130275_121131149 | 0.91 |
Mical3 |
microtubule associated monooxygenase, calponin and LIM domain containing 3 |
287 |
0.88 |
chr1_59765292_59765625 | 0.91 |
Bmpr2 |
bone morphogenetic protein receptor, type II (serine/threonine kinase) |
2058 |
0.25 |
chr7_42014121_42014272 | 0.90 |
Hmgb1-ps7 |
high-mobility group high mobility group box 1, pseudogene 7 |
6640 |
0.17 |
chr16_63903416_63903963 | 0.90 |
Epha3 |
Eph receptor A3 |
39514 |
0.19 |
chr9_51766782_51767242 | 0.90 |
Arhgap20 |
Rho GTPase activating protein 20 |
1352 |
0.52 |
chr14_122480308_122481080 | 0.89 |
Zic2 |
zinc finger protein of the cerebellum 2 |
2594 |
0.16 |
chr7_121394779_121395157 | 0.89 |
Gm36736 |
predicted gene, 36736 |
1867 |
0.33 |
chr2_52557337_52558561 | 0.89 |
Cacnb4 |
calcium channel, voltage-dependent, beta 4 subunit |
611 |
0.74 |
chr1_146145748_146145899 | 0.89 |
Gm5263 |
predicted gene 5263 |
274613 |
0.02 |
chr10_39372959_39373238 | 0.88 |
Fyn |
Fyn proto-oncogene |
3295 |
0.27 |
chr11_38938321_38938492 | 0.88 |
Gm23520 |
predicted gene, 23520 |
140129 |
0.05 |
chrX_23285148_23285871 | 0.88 |
Klhl13 |
kelch-like 13 |
50 |
0.99 |
chr5_84414084_84414723 | 0.88 |
Epha5 |
Eph receptor A5 |
2403 |
0.37 |
chr8_33747278_33748028 | 0.88 |
Smim18 |
small integral membrane protein 18 |
117 |
0.95 |
chr1_143639698_143639849 | 0.88 |
Cdc73 |
cell division cycle 73, Paf1/RNA polymerase II complex component |
808 |
0.44 |
chr8_34890130_34891317 | 0.88 |
Tnks |
tankyrase, TRF1-interacting ankyrin-related ADP-ribose polymerase |
572 |
0.8 |
chr1_147556449_147556600 | 0.87 |
Gm38284 |
predicted gene, 38284 |
40798 |
0.19 |
chr3_63851016_63851674 | 0.87 |
Plch1 |
phospholipase C, eta 1 |
14 |
0.97 |
chr5_19907724_19909563 | 0.87 |
Magi2 |
membrane associated guanylate kinase, WW and PDZ domain containing 2 |
682 |
0.82 |
chr16_7044618_7045201 | 0.87 |
Rbfox1 |
RNA binding protein, fox-1 homolog (C. elegans) 1 |
24937 |
0.29 |
chr1_6734529_6735444 | 0.87 |
St18 |
suppression of tumorigenicity 18 |
116 |
0.98 |
chr8_54958887_54959474 | 0.87 |
Gm45263 |
predicted gene 45263 |
639 |
0.67 |
chr2_4017802_4019015 | 0.87 |
Frmd4a |
FERM domain containing 4A |
664 |
0.68 |
chr18_69520312_69520687 | 0.87 |
Tcf4 |
transcription factor 4 |
661 |
0.78 |
chr4_13746200_13747057 | 0.86 |
Runx1t1 |
RUNX1 translocation partner 1 |
3192 |
0.37 |
chr5_33020714_33020865 | 0.85 |
Ywhah |
tyrosine 3-monooxygenase/tryptophan 5-monooxygenase activation protein, eta polypeptide |
1002 |
0.47 |
chr18_42895118_42895392 | 0.85 |
Ppp2r2b |
protein phosphatase 2, regulatory subunit B, beta |
3560 |
0.3 |
chr1_143644977_143645827 | 0.85 |
Cdc73 |
cell division cycle 73, Paf1/RNA polymerase II complex component |
2877 |
0.24 |
chr6_39874539_39874690 | 0.85 |
Tmem178b |
transmembrane protein 178B |
1543 |
0.32 |
chrX_23281963_23282663 | 0.84 |
Klhl13 |
kelch-like 13 |
2516 |
0.41 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.2 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.5 | 2.1 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.5 | 2.1 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.4 | 0.9 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.4 | 1.3 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.4 | 1.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.4 | 2.0 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
0.4 | 2.4 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.4 | 1.1 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.3 | 1.7 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.3 | 1.0 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.3 | 0.9 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.3 | 1.4 | GO:0034182 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
0.3 | 0.8 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.3 | 1.4 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.3 | 0.3 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.3 | 0.5 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.3 | 0.8 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.2 | 1.7 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.2 | 1.2 | GO:0021764 | amygdala development(GO:0021764) |
0.2 | 0.7 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.2 | 1.6 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.2 | 0.7 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.2 | 0.7 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.2 | 1.3 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.2 | 1.3 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.2 | 1.5 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.2 | 1.0 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.2 | 1.0 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.2 | 0.2 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.2 | 1.4 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.2 | 0.4 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.2 | 0.6 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.2 | 1.5 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.2 | 1.7 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.2 | 0.6 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.2 | 0.2 | GO:2000619 | regulation of histone H4-K16 acetylation(GO:2000618) negative regulation of histone H4-K16 acetylation(GO:2000619) |
0.2 | 2.4 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.2 | 1.3 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.2 | 1.1 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.2 | 0.5 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.2 | 1.1 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.2 | 0.4 | GO:0060066 | oviduct development(GO:0060066) |
0.2 | 0.3 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.2 | 0.7 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.2 | 2.2 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.2 | 0.5 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.2 | 0.3 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.2 | 1.5 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.2 | 0.8 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.2 | 0.5 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.2 | 2.1 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.2 | 0.3 | GO:0042420 | dopamine catabolic process(GO:0042420) |
0.2 | 1.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.2 | 1.1 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.2 | 0.6 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.2 | 0.2 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.2 | 0.2 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.2 | 0.8 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.2 | 0.5 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.2 | 0.6 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.2 | 0.6 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.2 | 0.3 | GO:0045963 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.2 | 1.5 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.1 | 0.6 | GO:0045964 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.1 | 1.0 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.1 | 0.4 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.1 | 0.6 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.1 | 0.4 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.1 | 0.4 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.1 | 0.5 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.1 | 0.9 | GO:0097264 | self proteolysis(GO:0097264) |
0.1 | 0.4 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.1 | 0.7 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.1 | 0.1 | GO:0021800 | cerebral cortex tangential migration(GO:0021800) |
0.1 | 0.5 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.1 | 0.4 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.1 | 0.6 | GO:1900094 | nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
0.1 | 0.5 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.1 | 0.5 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.1 | 0.5 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.1 | 0.1 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
0.1 | 0.9 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
0.1 | 0.9 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.1 | 0.6 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.1 | 0.6 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.1 | 0.5 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.1 | 0.2 | GO:0090259 | regulation of retinal ganglion cell axon guidance(GO:0090259) |
0.1 | 0.8 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 1.3 | GO:0007614 | short-term memory(GO:0007614) |
0.1 | 0.3 | GO:0042938 | dipeptide transport(GO:0042938) |
0.1 | 0.4 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.1 | 1.9 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.1 | 0.3 | GO:0061083 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
0.1 | 0.4 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.1 | 0.3 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.1 | 0.2 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
0.1 | 0.4 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.1 | 1.0 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
0.1 | 0.3 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.1 | 0.3 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.1 | 0.3 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.1 | 0.3 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.1 | 0.3 | GO:0048023 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.1 | 0.3 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.1 | 0.6 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.1 | 0.6 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.1 | 1.0 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.1 | 0.2 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.1 | 0.2 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.1 | 0.4 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 0.5 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.1 | 0.3 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.1 | 2.1 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 0.5 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 0.2 | GO:2001016 | positive regulation of skeletal muscle cell differentiation(GO:2001016) |
0.1 | 0.2 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.1 | 0.1 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.1 | 0.6 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.1 | 0.4 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.1 | 0.1 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.1 | 0.1 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.1 | 0.4 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.1 | 0.1 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.1 | 0.3 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
0.1 | 0.1 | GO:0036376 | sodium ion export from cell(GO:0036376) |
0.1 | 0.3 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.1 | 0.2 | GO:0021564 | vagus nerve development(GO:0021564) |
0.1 | 0.2 | GO:1900376 | regulation of melanin biosynthetic process(GO:0048021) negative regulation of melanin biosynthetic process(GO:0048022) regulation of secondary metabolite biosynthetic process(GO:1900376) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.1 | 0.4 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.1 | 0.9 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.1 | 0.3 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.1 | 0.2 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.1 | 0.5 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.1 | 0.3 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.1 | 0.3 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.1 | 0.1 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.1 | 0.2 | GO:0071472 | cellular response to salt stress(GO:0071472) |
0.1 | 0.2 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.1 | 0.4 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.1 | 0.2 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.1 | 0.2 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.1 | 0.3 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
0.1 | 0.2 | GO:0030070 | insulin processing(GO:0030070) |
0.1 | 0.1 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.1 | 0.4 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.1 | 0.9 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
0.1 | 0.2 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.1 | 1.1 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.1 | 0.2 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.1 | 0.5 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.6 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.1 | 0.5 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.1 | 0.2 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.3 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.1 | 0.5 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.1 | 0.2 | GO:1904220 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.1 | 0.5 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.1 | 0.5 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.1 | 0.1 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.1 | 0.2 | GO:0032100 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
0.1 | 0.1 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.1 | 0.4 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.1 | 0.2 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.1 | 0.2 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
0.1 | 0.1 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.1 | 1.2 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.1 | 0.2 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.1 | 0.4 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.2 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 0.4 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.1 | 0.2 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.1 | 0.6 | GO:0006273 | lagging strand elongation(GO:0006273) |
0.1 | 3.2 | GO:0061178 | regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061178) |
0.1 | 0.1 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.1 | 0.6 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.1 | 0.7 | GO:0001964 | startle response(GO:0001964) |
0.1 | 0.7 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.1 | 0.1 | GO:0071625 | vocalization behavior(GO:0071625) |
0.1 | 1.6 | GO:0071242 | cellular response to ammonium ion(GO:0071242) |
0.1 | 0.3 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.1 | 0.3 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.1 | 0.3 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.1 | 0.2 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.1 | 0.5 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.1 | 0.2 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.1 | 0.2 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.1 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 0.1 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.1 | 0.1 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.1 | 0.1 | GO:1903909 | regulation of receptor clustering(GO:1903909) positive regulation of receptor clustering(GO:1903911) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
0.1 | 0.3 | GO:0061590 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
0.1 | 0.1 | GO:1902308 | regulation of peptidyl-serine dephosphorylation(GO:1902308) |
0.1 | 0.2 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.1 | 0.1 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.3 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.1 | 0.2 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.1 | 0.3 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.1 | 0.3 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.1 | 0.5 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 0.4 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.1 | 0.3 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.1 | 0.2 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.1 | 0.2 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.1 | 0.2 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.1 | 0.2 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.1 | 0.1 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.1 | 0.2 | GO:1903679 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.1 | 0.5 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.1 | 0.2 | GO:0042891 | antibiotic transport(GO:0042891) |
0.1 | 1.4 | GO:0006491 | N-glycan processing(GO:0006491) |
0.1 | 0.4 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
0.1 | 0.3 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.1 | 3.7 | GO:0001578 | microtubule bundle formation(GO:0001578) |
0.1 | 0.2 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.1 | 0.2 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.1 | 0.1 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.1 | 0.2 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.1 | 0.1 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.1 | 1.1 | GO:1900449 | regulation of neurotransmitter receptor activity(GO:0099601) regulation of glutamate receptor signaling pathway(GO:1900449) |
0.1 | 0.4 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.1 | 0.2 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.1 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.2 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.1 | 0.2 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.1 | 0.4 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.1 | 0.4 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
0.1 | 1.2 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
0.1 | 2.4 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 0.4 | GO:0010642 | negative regulation of platelet-derived growth factor receptor signaling pathway(GO:0010642) |
0.1 | 0.2 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.1 | 0.1 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) |
0.1 | 0.2 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.1 | 0.2 | GO:0035627 | ceramide transport(GO:0035627) |
0.1 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.1 | 0.1 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.1 | 0.3 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.1 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.1 | 0.4 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.1 | 0.1 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
0.1 | 0.2 | GO:0007215 | glutamate receptor signaling pathway(GO:0007215) |
0.1 | 0.3 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
0.1 | 0.2 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
0.1 | 0.2 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.1 | 0.1 | GO:0032230 | positive regulation of synaptic transmission, GABAergic(GO:0032230) |
0.1 | 0.2 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.1 | 0.2 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.1 | 0.1 | GO:0046959 | habituation(GO:0046959) |
0.1 | 0.1 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.1 | 0.3 | GO:0071864 | positive regulation of cell proliferation in bone marrow(GO:0071864) |
0.1 | 0.2 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.2 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
0.0 | 0.2 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.0 | 0.9 | GO:0007616 | long-term memory(GO:0007616) |
0.0 | 0.2 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.0 | 0.2 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.0 | 0.0 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.0 | 0.2 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 0.1 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.0 | 0.1 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.0 | 0.2 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.0 | 0.3 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.0 | 0.5 | GO:1990403 | embryonic brain development(GO:1990403) |
0.0 | 0.1 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.0 | 0.2 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.0 | 0.3 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.2 | GO:0008228 | opsonization(GO:0008228) |
0.0 | 0.3 | GO:0051231 | spindle elongation(GO:0051231) |
0.0 | 0.1 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.0 | 0.9 | GO:0090659 | adult walking behavior(GO:0007628) walking behavior(GO:0090659) |
0.0 | 0.2 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 1.2 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.0 | 0.1 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.3 | GO:0015791 | polyol transport(GO:0015791) |
0.0 | 0.0 | GO:2001023 | regulation of response to drug(GO:2001023) |
0.0 | 0.2 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.5 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
0.0 | 0.6 | GO:0046688 | response to copper ion(GO:0046688) |
0.0 | 0.1 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.2 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.0 | 0.3 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.2 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.0 | 0.1 | GO:0032202 | telomere assembly(GO:0032202) |
0.0 | 0.0 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.0 | 0.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 0.0 | GO:0033058 | directional locomotion(GO:0033058) |
0.0 | 0.2 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.0 | 0.6 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.0 | 0.2 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.1 | GO:1902896 | terminal web assembly(GO:1902896) |
0.0 | 0.2 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.0 | 0.0 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.1 | GO:0086029 | Purkinje myocyte to ventricular cardiac muscle cell signaling(GO:0086029) Purkinje myocyte to ventricular cardiac muscle cell communication(GO:0086068) |
0.0 | 0.2 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.1 | GO:0032570 | response to progesterone(GO:0032570) |
0.0 | 0.5 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) regulation of microtubule depolymerization(GO:0031114) |
0.0 | 0.0 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.0 | 0.0 | GO:0021586 | pons maturation(GO:0021586) |
0.0 | 0.0 | GO:0061511 | centriole elongation(GO:0061511) |
0.0 | 0.5 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.0 | 0.2 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.0 | 0.2 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.0 | 0.1 | GO:1904357 | negative regulation of telomere maintenance via telomere lengthening(GO:1904357) |
0.0 | 0.1 | GO:0033024 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
0.0 | 0.3 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.0 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.0 | 0.2 | GO:0030432 | peristalsis(GO:0030432) |
0.0 | 0.2 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.0 | 0.0 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.2 | GO:0015816 | glycine transport(GO:0015816) |
0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.0 | GO:0030242 | pexophagy(GO:0030242) |
0.0 | 0.5 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.0 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.0 | 0.0 | GO:1903333 | negative regulation of protein folding(GO:1903333) |
0.0 | 0.0 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
0.0 | 0.0 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
0.0 | 0.0 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.0 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
0.0 | 0.3 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.0 | 0.1 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.0 | 0.2 | GO:0060179 | male mating behavior(GO:0060179) |
0.0 | 0.2 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.3 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.3 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.2 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.0 | 0.7 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.0 | 0.3 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.1 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.0 | 0.5 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
0.0 | 0.1 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.0 | 0.5 | GO:0006541 | glutamine metabolic process(GO:0006541) |
0.0 | 0.0 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.0 | 0.1 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.0 | 0.1 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.0 | 0.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.0 | 0.1 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.0 | 0.1 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.0 | 0.3 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.0 | 0.3 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.1 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.0 | 0.1 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.0 | 0.2 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.0 | 0.1 | GO:0071675 | regulation of mononuclear cell migration(GO:0071675) |
0.0 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.0 | 0.0 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.0 | 0.1 | GO:0014819 | regulation of skeletal muscle contraction(GO:0014819) |
0.0 | 0.2 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.0 | 0.2 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.0 | 0.1 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.0 | 2.5 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 0.1 | GO:0032763 | regulation of mast cell cytokine production(GO:0032763) |
0.0 | 0.0 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
0.0 | 0.1 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
0.0 | 0.1 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
0.0 | 0.1 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.0 | 0.4 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.0 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.0 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.0 | 0.1 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
0.0 | 0.1 | GO:0015808 | L-alanine transport(GO:0015808) |
0.0 | 0.4 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
0.0 | 0.2 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.0 | 0.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.1 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.0 | 0.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.0 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.3 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.0 | 0.2 | GO:0006573 | valine metabolic process(GO:0006573) |
0.0 | 0.5 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.5 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.2 | GO:0014059 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
0.0 | 0.1 | GO:1990000 | amyloid fibril formation(GO:1990000) |
0.0 | 0.1 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
0.0 | 0.0 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.0 | 0.3 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.0 | 2.4 | GO:0000910 | cytokinesis(GO:0000910) |
0.0 | 0.3 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.4 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
0.0 | 0.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.0 | 2.0 | GO:0007612 | learning(GO:0007612) |
0.0 | 0.1 | GO:0002468 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
0.0 | 0.1 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) |
0.0 | 0.3 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.0 | 0.2 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.0 | 0.1 | GO:0021794 | thalamus development(GO:0021794) |
0.0 | 0.1 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.0 | 0.1 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.0 | 0.1 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.0 | 0.3 | GO:0060074 | synapse maturation(GO:0060074) |
0.0 | 0.1 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.0 | 0.1 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
0.0 | 0.2 | GO:1904729 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
0.0 | 0.1 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.0 | 0.4 | GO:0006465 | signal peptide processing(GO:0006465) |
0.0 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.4 | GO:0045815 | positive regulation of gene expression, epigenetic(GO:0045815) |
0.0 | 0.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.0 | 0.1 | GO:0019042 | viral latency(GO:0019042) |
0.0 | 0.1 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.0 | 0.1 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.0 | 0.1 | GO:0043455 | regulation of secondary metabolic process(GO:0043455) |
0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.1 | GO:0072429 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.0 | 0.0 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.0 | 0.2 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.0 | 0.1 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.0 | 0.2 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 0.0 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.0 | 0.4 | GO:0090312 | positive regulation of protein deacetylation(GO:0090312) |
0.0 | 0.2 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.0 | 0.1 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.0 | 0.0 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.0 | 0.2 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.0 | 0.1 | GO:0052428 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.0 | 0.1 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.0 | 0.1 | GO:0009158 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
0.0 | 0.0 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.0 | 0.2 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.0 | 0.9 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.0 | 0.3 | GO:0046847 | filopodium assembly(GO:0046847) |
0.0 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
0.0 | 0.1 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.0 | 0.1 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
0.0 | 0.5 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
0.0 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.0 | 0.1 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.0 | 0.0 | GO:0072584 | caveolin-mediated endocytosis(GO:0072584) |
0.0 | 0.1 | GO:0070305 | response to cGMP(GO:0070305) |
0.0 | 0.1 | GO:0071569 | protein ufmylation(GO:0071569) protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.0 | 0.0 | GO:0072201 | negative regulation of mesenchymal cell proliferation(GO:0072201) |
0.0 | 0.5 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.1 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.0 | 0.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.0 | 0.0 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.0 | 0.1 | GO:0070857 | regulation of bile acid biosynthetic process(GO:0070857) |
0.0 | 0.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.3 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.0 | 0.1 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.0 | 0.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 1.4 | GO:0050770 | regulation of axonogenesis(GO:0050770) |
0.0 | 0.0 | GO:0070669 | response to interleukin-2(GO:0070669) |
0.0 | 0.1 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.0 | 0.1 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.0 | GO:2001279 | regulation of prostaglandin biosynthetic process(GO:0031392) regulation of unsaturated fatty acid biosynthetic process(GO:2001279) |
0.0 | 0.3 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
0.0 | 0.0 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.0 | 0.1 | GO:0070431 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.0 | 0.4 | GO:0043113 | receptor clustering(GO:0043113) |
0.0 | 0.1 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
0.0 | 0.1 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.0 | 0.0 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.0 | 0.0 | GO:0015840 | urea transport(GO:0015840) |
0.0 | 0.3 | GO:2001258 | negative regulation of cation channel activity(GO:2001258) |
0.0 | 0.0 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.0 | GO:0031958 | corticosteroid receptor signaling pathway(GO:0031958) |
0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.5 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
0.0 | 0.0 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
0.0 | 0.0 | GO:1904587 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.0 | 0.1 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.0 | 0.1 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.0 | GO:0009757 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.0 | 0.6 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.0 | GO:0032672 | interleukin-3 production(GO:0032632) regulation of interleukin-3 production(GO:0032672) |
0.0 | 0.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.0 | 0.1 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.1 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.0 | 0.1 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.0 | 0.3 | GO:0051926 | negative regulation of calcium ion transport(GO:0051926) |
0.0 | 0.2 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.0 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) negative regulation of DNA damage checkpoint(GO:2000002) |
0.0 | 0.0 | GO:2000347 | positive regulation of hepatocyte proliferation(GO:2000347) |
0.0 | 0.1 | GO:0001812 | positive regulation of type I hypersensitivity(GO:0001812) |
0.0 | 0.1 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.0 | 0.4 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.1 | GO:1902003 | beta-amyloid formation(GO:0034205) regulation of beta-amyloid formation(GO:1902003) regulation of amyloid precursor protein catabolic process(GO:1902991) |
0.0 | 0.2 | GO:0030449 | regulation of complement activation(GO:0030449) |
0.0 | 0.0 | GO:0043090 | amino acid import(GO:0043090) |
0.0 | 0.0 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.1 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
0.0 | 0.2 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.0 | 0.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.1 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.0 | 0.1 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.0 | 0.1 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.0 | 0.0 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.0 | 0.0 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.0 | 1.7 | GO:0071804 | cellular potassium ion transport(GO:0071804) potassium ion transmembrane transport(GO:0071805) |
0.0 | 0.1 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.0 | 0.0 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.0 | 0.0 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.0 | 0.2 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.0 | 0.1 | GO:0010637 | regulation of mitochondrial fusion(GO:0010635) negative regulation of mitochondrial fusion(GO:0010637) |
0.0 | 0.1 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.0 | 0.1 | GO:0002759 | regulation of antimicrobial humoral response(GO:0002759) |
0.0 | 0.0 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.0 | 0.1 | GO:0046831 | regulation of nucleobase-containing compound transport(GO:0032239) regulation of RNA export from nucleus(GO:0046831) |
0.0 | 0.0 | GO:0034370 | triglyceride-rich lipoprotein particle remodeling(GO:0034370) |
0.0 | 0.0 | GO:1902219 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.0 | 0.1 | GO:0045820 | negative regulation of glycolytic process(GO:0045820) |
0.0 | 0.0 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.0 | 0.1 | GO:0060632 | regulation of microtubule-based movement(GO:0060632) |
0.0 | 0.0 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.0 | 0.3 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
0.0 | 0.3 | GO:0016233 | telomere capping(GO:0016233) |
0.0 | 0.0 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
0.0 | 0.1 | GO:0042438 | melanin biosynthetic process(GO:0042438) |
0.0 | 0.1 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.0 | 0.2 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.2 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
0.0 | 0.1 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.0 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.0 | 0.3 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.1 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.0 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.0 | 0.0 | GO:0043267 | negative regulation of potassium ion transport(GO:0043267) |
0.0 | 0.1 | GO:0015755 | fructose transport(GO:0015755) |
0.0 | 0.1 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.2 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
0.0 | 0.5 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.0 | GO:0002238 | response to molecule of fungal origin(GO:0002238) |
0.0 | 0.0 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.0 | 0.0 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.0 | 0.1 | GO:0048675 | axon extension(GO:0048675) |
0.0 | 0.1 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.0 | 0.1 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
0.0 | 0.0 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.0 | 0.1 | GO:0006337 | nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) protein-DNA complex disassembly(GO:0032986) |
0.0 | 0.0 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.0 | 0.2 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.0 | 0.0 | GO:0090330 | regulation of platelet aggregation(GO:0090330) |
0.0 | 0.0 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.1 | GO:0032365 | intracellular lipid transport(GO:0032365) |
0.0 | 0.2 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.0 | 0.0 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.0 | 0.0 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
0.0 | 0.1 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.0 | 0.0 | GO:0002513 | tolerance induction to self antigen(GO:0002513) |
0.0 | 0.1 | GO:0009651 | response to salt stress(GO:0009651) |
0.0 | 0.1 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.0 | 0.3 | GO:0043001 | Golgi to plasma membrane protein transport(GO:0043001) |
0.0 | 0.0 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.0 | 0.0 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.0 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.0 | 0.0 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.0 | 0.1 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.0 | 0.2 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.0 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.0 | 0.2 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.0 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.0 | 0.0 | GO:0046836 | glycolipid transport(GO:0046836) |
0.0 | 0.2 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.0 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.0 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.0 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.0 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.0 | 0.0 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.0 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.0 | 0.0 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.0 | 0.3 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.1 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.0 | 0.0 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.0 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
0.0 | 0.0 | GO:1903242 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
0.0 | 0.0 | GO:2000425 | regulation of apoptotic cell clearance(GO:2000425) |
0.0 | 0.0 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.0 | 0.1 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.0 | 0.2 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 0.0 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.0 | 0.0 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
0.0 | 0.1 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.0 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.1 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
0.0 | 0.1 | GO:0048741 | skeletal muscle fiber development(GO:0048741) |
0.0 | 0.1 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
0.0 | 0.0 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.0 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.0 | 0.0 | GO:1904415 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.0 | 0.0 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.1 | GO:0032827 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.0 | 0.1 | GO:0035337 | fatty-acyl-CoA metabolic process(GO:0035337) |
0.0 | 0.1 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.0 | 0.0 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.0 | 0.0 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.0 | 0.0 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.2 | GO:0071173 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
0.0 | 0.1 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.0 | 0.1 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.0 | 0.2 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.0 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.0 | 0.0 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.0 | 0.1 | GO:0000272 | polysaccharide catabolic process(GO:0000272) |
0.0 | 0.0 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.0 | 0.1 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.0 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) |
0.0 | 0.0 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.0 | 0.1 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
0.0 | 0.0 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
0.0 | 0.0 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
0.0 | 0.0 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.1 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.0 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.0 | 0.1 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.0 | 0.0 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.0 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
0.0 | 0.5 | GO:1903311 | regulation of mRNA metabolic process(GO:1903311) |
0.0 | 0.0 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.0 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.1 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.1 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.0 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
0.0 | 0.1 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.0 | 0.1 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.0 | 0.0 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.0 | 0.0 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.0 | 0.0 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.0 | 0.0 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.0 | 0.2 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
0.0 | 0.0 | GO:0044838 | cell quiescence(GO:0044838) |
0.0 | 0.0 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.0 | 0.0 | GO:2000774 | positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
0.0 | 0.0 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.0 | 1.0 | GO:0006402 | mRNA catabolic process(GO:0006402) |
0.0 | 0.2 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
0.0 | 0.1 | GO:0071168 | protein localization to chromatin(GO:0071168) |
0.0 | 0.1 | GO:0001919 | regulation of receptor recycling(GO:0001919) |
0.0 | 0.5 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.0 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.0 | 0.0 | GO:0010885 | regulation of cholesterol storage(GO:0010885) positive regulation of cholesterol storage(GO:0010886) |
0.0 | 0.0 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.0 | 0.0 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.0 | 0.1 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.0 | 0.2 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.0 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.0 | 0.1 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 2.0 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.3 | 2.3 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.3 | 1.7 | GO:0005915 | zonula adherens(GO:0005915) |
0.2 | 2.0 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.2 | 1.6 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.2 | 2.4 | GO:0043194 | axon initial segment(GO:0043194) |
0.2 | 0.6 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.2 | 0.5 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.2 | 0.5 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.2 | 1.6 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.2 | 1.3 | GO:0043083 | synaptic cleft(GO:0043083) |
0.2 | 1.1 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.1 | 0.6 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 0.9 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.1 | 0.9 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 2.3 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.1 | 0.6 | GO:0097433 | dense body(GO:0097433) |
0.1 | 3.9 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.1 | 4.9 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.1 | 0.7 | GO:0032584 | growth cone membrane(GO:0032584) |
0.1 | 1.6 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 1.2 | GO:0031527 | filopodium membrane(GO:0031527) |
0.1 | 0.4 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.3 | GO:0031417 | NatC complex(GO:0031417) |
0.1 | 0.4 | GO:1990696 | USH2 complex(GO:1990696) |
0.1 | 1.6 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.4 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 0.8 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 0.9 | GO:0097449 | astrocyte projection(GO:0097449) |
0.1 | 0.9 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 0.3 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 0.3 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.1 | 2.7 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 0.8 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.1 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.4 | GO:0000805 | X chromosome(GO:0000805) |
0.1 | 10.7 | GO:0030427 | site of polarized growth(GO:0030427) |
0.1 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.1 | 0.3 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.1 | 0.3 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.1 | 0.3 | GO:0005818 | aster(GO:0005818) |
0.1 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
0.1 | 0.7 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 0.4 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.1 | 0.1 | GO:0044299 | C-fiber(GO:0044299) |
0.1 | 0.2 | GO:0071817 | MMXD complex(GO:0071817) |
0.1 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
0.1 | 1.8 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.1 | 0.6 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 0.2 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.1 | 3.5 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 0.6 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.1 | 1.5 | GO:0034707 | chloride channel complex(GO:0034707) |
0.1 | 0.6 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.5 | GO:0032797 | SMN complex(GO:0032797) |
0.1 | 0.2 | GO:0043219 | lateral loop(GO:0043219) |
0.1 | 0.2 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.1 | 0.1 | GO:0033270 | paranode region of axon(GO:0033270) |
0.1 | 0.3 | GO:0044327 | dendritic spine head(GO:0044327) |
0.1 | 1.0 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.0 | 0.1 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.4 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.1 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.0 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.0 | 0.4 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.4 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.7 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.0 | 0.6 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.3 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 5.5 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.0 | 1.0 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.2 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.0 | 0.3 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.2 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.2 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
0.0 | 0.2 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.0 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
0.0 | 0.3 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.3 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.5 | GO:0043205 | fibril(GO:0043205) |
0.0 | 0.4 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.3 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.0 | 0.4 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.2 | GO:0043203 | axon hillock(GO:0043203) |
0.0 | 0.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.0 | 0.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.0 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.2 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.3 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 2.1 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.0 | 4.4 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.6 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 1.4 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.0 | 0.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.3 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.0 | 0.4 | GO:0031011 | Ino80 complex(GO:0031011) |
0.0 | 1.7 | GO:0005643 | nuclear pore(GO:0005643) |
0.0 | 0.0 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.5 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 0.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
0.0 | 1.2 | GO:0043195 | terminal bouton(GO:0043195) |
0.0 | 0.1 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.0 | 0.1 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
0.0 | 1.5 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 0.0 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.2 | GO:0060091 | kinocilium(GO:0060091) |
0.0 | 0.1 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.4 | GO:0070461 | SAGA-type complex(GO:0070461) |
0.0 | 0.2 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.4 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.0 | GO:0097441 | basilar dendrite(GO:0097441) |
0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.1 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.0 | 1.4 | GO:0070382 | exocytic vesicle(GO:0070382) |
0.0 | 0.4 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.1 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.0 | GO:0033263 | CORVET complex(GO:0033263) |
0.0 | 0.3 | GO:0043198 | dendritic shaft(GO:0043198) |
0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
0.0 | 0.3 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.2 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.0 | 0.2 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.5 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 2.2 | GO:0043209 | myelin sheath(GO:0043209) |
0.0 | 0.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.1 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.1 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 0.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.2 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.0 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 0.4 | GO:0005844 | polysome(GO:0005844) |
0.0 | 0.0 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.0 | 0.2 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.3 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.0 | 0.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.3 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.0 | GO:0030897 | HOPS complex(GO:0030897) |
0.0 | 0.1 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
0.0 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.1 | GO:0000243 | commitment complex(GO:0000243) |
0.0 | 0.1 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.0 | 0.3 | GO:0032040 | small-subunit processome(GO:0032040) |
0.0 | 0.5 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.1 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 0.1 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.0 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 3.1 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.9 | 2.6 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.7 | 2.7 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.7 | 2.0 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.4 | 0.9 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.4 | 2.2 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.3 | 1.0 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.3 | 0.9 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.3 | 1.5 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.3 | 2.5 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.3 | 1.0 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.3 | 0.8 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.3 | 0.8 | GO:0004359 | glutaminase activity(GO:0004359) |
0.2 | 0.9 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.2 | 1.6 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.2 | 1.4 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.2 | 1.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.2 | 2.6 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.2 | 2.3 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.2 | 1.0 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.2 | 1.6 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.2 | 0.6 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.2 | 0.5 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.2 | 1.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.2 | 0.9 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.2 | 0.4 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.2 | 1.1 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.2 | 0.5 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.2 | 0.6 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.2 | 0.5 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.2 | 0.6 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.2 | 0.6 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.2 | 0.8 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 0.4 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.7 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.1 | 0.8 | GO:0048495 | Roundabout binding(GO:0048495) |
0.1 | 1.5 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.1 | 0.4 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 0.5 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.9 | GO:0019113 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 2.3 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.1 | 2.1 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 1.1 | GO:0051378 | serotonin binding(GO:0051378) |
0.1 | 0.3 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.1 | 1.9 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.1 | 0.1 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 0.9 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.1 | 0.7 | GO:0005499 | vitamin D binding(GO:0005499) |
0.1 | 0.4 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 0.7 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.2 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.1 | 0.3 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.1 | 0.3 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 0.5 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.1 | 0.3 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.1 | 0.4 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.6 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 1.8 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 0.4 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.1 | 0.6 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.1 | 0.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 2.0 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.1 | 1.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.1 | 0.3 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) glycine:sodium symporter activity(GO:0015375) |
0.1 | 0.2 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.1 | 0.3 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.1 | 0.5 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.1 | 0.2 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.1 | 0.3 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 2.3 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.1 | 0.2 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 0.2 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.1 | 0.4 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.1 | 0.2 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.1 | 0.3 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.4 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.1 | 0.3 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 0.3 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.1 | 0.1 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.1 | 0.3 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 0.2 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.1 | 0.9 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.3 | GO:0019808 | polyamine binding(GO:0019808) |
0.1 | 0.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.9 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.1 | 0.2 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.1 | 0.2 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.1 | 0.2 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.1 | 0.2 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.1 | 0.5 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 0.5 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.1 | 0.6 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 0.2 | GO:0034562 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.1 | 0.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.1 | 0.5 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.1 | 0.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.1 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 0.2 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 0.2 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 0.1 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.2 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.1 | 0.2 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.1 | 0.2 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 0.8 | GO:0017136 | NAD-dependent histone deacetylase activity(GO:0017136) |
0.1 | 0.4 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.1 | 1.4 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.1 | 0.2 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.1 | 0.3 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 0.2 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 0.2 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.1 | 0.4 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 0.2 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.0 | 0.3 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.5 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.0 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.2 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.0 | 0.4 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.0 | 0.5 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.5 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.4 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.0 | 0.3 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 1.3 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.0 | 0.4 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.5 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.3 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.2 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.0 | 0.1 | GO:0008066 | glutamate receptor activity(GO:0008066) |
0.0 | 0.2 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.0 | 0.3 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.1 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 0.2 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.3 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.0 | 0.2 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.0 | 0.1 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 0.3 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.1 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.0 | 0.1 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.0 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.3 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.3 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.5 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.0 | 0.4 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.0 | 1.2 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.5 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.5 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.7 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 1.0 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.2 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.0 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.0 | 0.2 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.0 | 0.2 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 0.3 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 0.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.3 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.0 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.0 | 0.3 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.0 | 0.2 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.5 | GO:0031402 | sodium ion binding(GO:0031402) |
0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.0 | 0.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.0 | 0.3 | GO:0034842 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.0 | 0.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.0 | 0.3 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.1 | GO:0004802 | transketolase activity(GO:0004802) |
0.0 | 0.5 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.3 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) sugar-phosphatase activity(GO:0050308) |
0.0 | 0.2 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
0.0 | 0.2 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.2 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.6 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.1 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.0 | 0.1 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
0.0 | 0.2 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.0 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.0 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.0 | 0.2 | GO:0003896 | DNA primase activity(GO:0003896) |
0.0 | 0.2 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.4 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.0 | 0.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.4 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.0 | 0.2 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.0 | 0.2 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.2 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.0 | 0.6 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.0 | 0.2 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.4 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.2 | GO:0002054 | nucleobase binding(GO:0002054) |
0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.4 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 0.2 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.0 | 0.8 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
0.0 | 0.1 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 1.2 | GO:0005262 | calcium channel activity(GO:0005262) |
0.0 | 0.7 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.2 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.0 | 0.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 3.7 | GO:0003729 | mRNA binding(GO:0003729) |
0.0 | 0.1 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.0 | 0.3 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.2 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.2 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 1.3 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 0.1 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.3 | GO:0022821 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) potassium ion antiporter activity(GO:0022821) |
0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.1 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.1 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.0 | 0.1 | GO:0000150 | recombinase activity(GO:0000150) |
0.0 | 0.2 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 1.7 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.6 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.0 | 0.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.1 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.0 | 0.1 | GO:1990459 | transferrin receptor binding(GO:1990459) |
0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.0 | 0.2 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.0 | 0.6 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.4 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.0 | 0.0 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.3 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.0 | 0.3 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.8 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.0 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 0.1 | GO:0004064 | arylesterase activity(GO:0004064) |
0.0 | 0.1 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.0 | GO:0070538 | oleic acid binding(GO:0070538) |
0.0 | 0.0 | GO:0051734 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) ATP-dependent polynucleotide kinase activity(GO:0051734) |
0.0 | 1.2 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.0 | 0.2 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.5 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.1 | GO:0001846 | opsonin binding(GO:0001846) |
0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.1 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.5 | GO:0018602 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.0 | 0.3 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 1.2 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
0.0 | 0.3 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.7 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.0 | 0.0 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.1 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.4 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.0 | 0.4 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.1 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 0.0 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.0 | 0.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.2 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.7 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.2 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.3 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 0.0 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.0 | 0.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.1 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 0.1 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.0 | 0.5 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.1 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.0 | 0.5 | GO:0050661 | NADP binding(GO:0050661) |
0.0 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.0 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.0 | 0.3 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.0 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.2 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.0 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.0 | 0.1 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.0 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.0 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.3 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.0 | 0.0 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.2 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 0.2 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.2 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 0.2 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.1 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.1 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.0 | 0.1 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.0 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.0 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.9 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.4 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.1 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.1 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.0 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.0 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.0 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.1 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.0 | 0.0 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 0.2 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.1 | GO:0033265 | choline binding(GO:0033265) |
0.0 | 0.1 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.0 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.0 | 0.0 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.0 | 0.3 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.0 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.0 | 0.1 | GO:0015922 | aspartate oxidase activity(GO:0015922) |
0.0 | 0.0 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.1 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.3 | GO:0051119 | sugar transmembrane transporter activity(GO:0051119) |
0.0 | 0.1 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.0 | 0.0 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.0 | 0.0 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.0 | 0.4 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.0 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.0 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 4.6 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 0.3 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 0.9 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 3.5 | PID LKB1 PATHWAY | LKB1 signaling events |
0.1 | 1.5 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 2.3 | PID AURORA B PATHWAY | Aurora B signaling |
0.1 | 0.6 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 0.1 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 1.1 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 1.1 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.6 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.5 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 2.3 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.5 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.8 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.7 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.2 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 1.1 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.9 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.9 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.4 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 1.0 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.2 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.0 | 0.7 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.3 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.4 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.3 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.6 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.4 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.3 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 0.0 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.0 | ST ADRENERGIC | Adrenergic Pathway |
0.0 | 0.2 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.2 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.5 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.0 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.2 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.1 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.5 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 0.3 | PID PLK1 PATHWAY | PLK1 signaling events |
0.0 | 0.1 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.5 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.2 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 0.6 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.2 | 4.6 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.2 | 3.2 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.2 | 4.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.2 | 2.9 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.2 | 0.3 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.1 | 2.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 2.3 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 1.2 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.1 | 1.2 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 1.1 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 1.1 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.1 | 0.9 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 0.7 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 0.6 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.1 | 1.0 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 0.1 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.1 | 0.1 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
0.1 | 0.9 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 1.1 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.1 | 1.1 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 2.4 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.1 | 0.4 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 2.3 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 0.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.1 | 1.7 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.1 | 1.0 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 0.4 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 0.2 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.9 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.3 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.1 | REACTOME GPCR DOWNSTREAM SIGNALING | Genes involved in GPCR downstream signaling |
0.0 | 0.6 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.9 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.5 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.1 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.0 | 0.3 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 0.9 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.0 | 0.5 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.4 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.5 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.5 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.4 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 0.6 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 0.8 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.0 | REACTOME GASTRIN CREB SIGNALLING PATHWAY VIA PKC AND MAPK | Genes involved in Gastrin-CREB signalling pathway via PKC and MAPK |
0.0 | 0.3 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.7 | REACTOME TRANSMISSION ACROSS CHEMICAL SYNAPSES | Genes involved in Transmission across Chemical Synapses |
0.0 | 0.4 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.2 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.1 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.0 | 0.2 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.4 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.3 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.4 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.0 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 4.9 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.7 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.6 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.4 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 0.0 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.0 | 0.3 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 0.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.0 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.0 | 0.4 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.3 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.5 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 0.0 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
0.0 | 0.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.4 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.7 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
0.0 | 0.7 | REACTOME SIGNALING BY NOTCH1 | Genes involved in Signaling by NOTCH1 |
0.0 | 0.0 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.0 | 0.3 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.2 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 0.0 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.1 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.2 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.2 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.0 | 0.0 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.0 | 0.2 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.0 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.0 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.2 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 0.2 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.0 | 0.2 | REACTOME ACTIVATION OF NMDA RECEPTOR UPON GLUTAMATE BINDING AND POSTSYNAPTIC EVENTS | Genes involved in Activation of NMDA receptor upon glutamate binding and postsynaptic events |
0.0 | 0.1 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.0 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.0 | 0.1 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 0.1 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.0 | 1.4 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |