Gene Symbol | Gene ID | Gene Info |
---|---|---|
Sp2
|
ENSMUSG00000018678.6 | Sp2 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Sp2 | chr11_96975058_96975209 | 2578 | 0.135759 | -0.44 | 4.6e-04 | Click! |
Sp2 | chr11_96978110_96978612 | 650 | 0.509226 | 0.41 | 1.1e-03 | Click! |
Sp2 | chr11_96975300_96975485 | 2319 | 0.146717 | -0.37 | 3.4e-03 | Click! |
Sp2 | chr11_96996917_96998027 | 14513 | 0.076037 | 0.30 | 2.1e-02 | Click! |
Sp2 | chr11_96969046_96969729 | 722 | 0.465030 | 0.27 | 3.6e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr16_36989294_36990265 | 1.57 |
Fbxo40 |
F-box protein 40 |
688 |
0.6 |
chr8_57333046_57334560 | 1.45 |
Gm34030 |
predicted gene, 34030 |
584 |
0.59 |
chr11_5897192_5898699 | 1.14 |
Myl7 |
myosin, light polypeptide 7, regulatory |
837 |
0.46 |
chr5_135903163_135904024 | 1.12 |
Gm42533 |
predicted gene 42533 |
7107 |
0.11 |
chr1_74067852_74069114 | 1.11 |
Tns1 |
tensin 1 |
22868 |
0.17 |
chr5_113799288_113800716 | 1.03 |
Tmem119 |
transmembrane protein 119 |
444 |
0.69 |
chr7_45337299_45338455 | 1.03 |
Hrc |
histidine rich calcium binding protein |
2530 |
0.09 |
chr9_24773249_24774873 | 1.01 |
Tbx20 |
T-box 20 |
223 |
0.92 |
chr8_24396308_24396531 | 1.00 |
Gm30692 |
predicted gene, 30692 |
15760 |
0.15 |
chr11_114542855_114543103 | 0.98 |
4932435O22Rik |
RIKEN cDNA 4932435O22 gene |
94119 |
0.07 |
chrX_95477898_95478308 | 0.95 |
Asb12 |
ankyrin repeat and SOCS box-containing 12 |
26 |
0.98 |
chr3_68467947_68469189 | 0.94 |
Schip1 |
schwannomin interacting protein 1 |
385 |
0.89 |
chr7_24499513_24500150 | 0.93 |
Cadm4 |
cell adhesion molecule 4 |
130 |
0.91 |
chr8_119465172_119465323 | 0.92 |
Necab2 |
N-terminal EF-hand calcium binding protein 2 |
12815 |
0.14 |
chr14_76810574_76811534 | 0.91 |
Gm48968 |
predicted gene, 48968 |
21767 |
0.16 |
chr5_119832754_119833593 | 0.91 |
Tbx5 |
T-box 5 |
505 |
0.67 |
chrX_50842048_50842328 | 0.89 |
Stk26 |
serine/threonine kinase 26 |
747 |
0.77 |
chr18_11058575_11059292 | 0.88 |
Gata6 |
GATA binding protein 6 |
114 |
0.97 |
chr17_26838158_26839992 | 0.86 |
Nkx2-5 |
NK2 homeobox 5 |
2490 |
0.17 |
chr10_66919897_66921448 | 0.86 |
Gm26576 |
predicted gene, 26576 |
370 |
0.51 |
chr5_106784649_106785188 | 0.84 |
Gm8365 |
predicted gene 8365 |
46154 |
0.12 |
chr3_81835306_81835496 | 0.84 |
A830029E22Rik |
RIKEN cDNA A830029E22 gene |
33376 |
0.16 |
chr7_19011655_19012657 | 0.83 |
Irf2bp1 |
interferon regulatory factor 2 binding protein 1 |
8112 |
0.07 |
chr7_6281290_6281447 | 0.83 |
Gm45069 |
predicted gene 45069 |
2242 |
0.17 |
chr15_76697284_76698616 | 0.82 |
Gpt |
glutamic pyruvic transaminase, soluble |
112 |
0.9 |
chr10_25362380_25362856 | 0.81 |
Epb41l2 |
erythrocyte membrane protein band 4.1 like 2 |
2762 |
0.27 |
chr12_54316589_54317566 | 0.80 |
Gm47552 |
predicted gene, 47552 |
62 |
0.97 |
chr14_31934286_31934676 | 0.78 |
D830044D21Rik |
RIKEN cDNA D830044D21 gene |
27953 |
0.16 |
chr11_104578496_104579513 | 0.77 |
Myl4 |
myosin, light polypeptide 4 |
1321 |
0.29 |
chr7_17060653_17061482 | 0.76 |
Hif3a |
hypoxia inducible factor 3, alpha subunit |
1317 |
0.27 |
chr4_144404354_144405079 | 0.76 |
Pramef12os |
PRAME family member 12, opposite strand |
152 |
0.91 |
chr2_92544618_92544769 | 0.75 |
Gm13817 |
predicted gene 13817 |
3713 |
0.17 |
chr19_34252361_34253134 | 0.75 |
Acta2 |
actin, alpha 2, smooth muscle, aorta |
1483 |
0.35 |
chr13_101801319_101801849 | 0.75 |
Pik3r1 |
phosphoinositide-3-kinase regulatory subunit 1 |
33367 |
0.15 |
chr15_12738543_12738694 | 0.75 |
Pdzd2 |
PDZ domain containing 2 |
1306 |
0.38 |
chr6_4582147_4582570 | 0.74 |
Gm18289 |
predicted gene, 18289 |
10642 |
0.13 |
chr17_71000355_71000717 | 0.73 |
Myl12a |
myosin, light chain 12A, regulatory, non-sarcomeric |
1481 |
0.21 |
chr10_80930756_80931388 | 0.72 |
Gadd45b |
growth arrest and DNA-damage-inducible 45 beta |
260 |
0.83 |
chr2_14823792_14824714 | 0.72 |
Cacnb2 |
calcium channel, voltage-dependent, beta 2 subunit |
161 |
0.94 |
chr11_58402025_58402300 | 0.71 |
Gm12252 |
predicted gene 12252 |
5647 |
0.09 |
chr2_180387025_180387876 | 0.71 |
B230312C02Rik |
RIKEN cDNA B230312C02 gene |
1565 |
0.24 |
chr9_59691561_59692603 | 0.71 |
Gramd2 |
GRAM domain containing 2 |
11938 |
0.13 |
chr4_126609467_126610319 | 0.71 |
5730409E04Rik |
RIKEN cDNA 5730409E04Rik gene |
39 |
0.96 |
chr11_102216821_102217399 | 0.70 |
Hdac5 |
histone deacetylase 5 |
1818 |
0.19 |
chr8_78054594_78054969 | 0.70 |
Gm29895 |
predicted gene, 29895 |
10771 |
0.25 |
chr8_70072397_70073269 | 0.70 |
Tm6sf2 |
transmembrane 6 superfamily member 2 |
91 |
0.93 |
chr13_38145014_38146012 | 0.69 |
Dsp |
desmoplakin |
5781 |
0.18 |
chr19_24271529_24271942 | 0.68 |
Fxn |
frataxin |
6436 |
0.18 |
chr4_152274165_152275032 | 0.68 |
Gpr153 |
G protein-coupled receptor 153 |
236 |
0.89 |
chr4_96077056_96077940 | 0.68 |
Cyp2j13 |
cytochrome P450, family 2, subfamily j, polypeptide 13 |
26 |
0.97 |
chr3_51709485_51709758 | 0.68 |
Gm10729 |
predicted gene 10729 |
15850 |
0.12 |
chr15_50889499_50889791 | 0.68 |
Trps1 |
transcriptional repressor GATA binding 1 |
46 |
0.91 |
chr17_73297644_73297900 | 0.68 |
E330032C10Rik |
RIKEN cDNA E330032C10 gene |
45227 |
0.14 |
chr10_87858890_87859041 | 0.68 |
Igf1 |
insulin-like growth factor 1 |
103 |
0.97 |
chr1_156473026_156473676 | 0.68 |
Soat1 |
sterol O-acyltransferase 1 |
846 |
0.57 |
chr2_34249301_34250564 | 0.68 |
C79798 |
expressed sequence C79798 |
37839 |
0.16 |
chr8_57331786_57332929 | 0.66 |
5033428I22Rik |
RIKEN cDNA 5033428I22 gene |
78 |
0.95 |
chr17_48960005_48960829 | 0.66 |
Lrfn2 |
leucine rich repeat and fibronectin type III domain containing 2 |
28038 |
0.23 |
chr18_60646910_60648302 | 0.66 |
Synpo |
synaptopodin |
666 |
0.69 |
chr11_94498570_94500249 | 0.65 |
Epn3 |
epsin 3 |
289 |
0.85 |
chr5_32137287_32137577 | 0.65 |
Fosl2 |
fos-like antigen 2 |
1259 |
0.39 |
chr2_10296121_10296386 | 0.65 |
Sfmbt2 |
Scm-like with four mbt domains 2 |
74257 |
0.03 |
chr7_142657905_142658056 | 0.64 |
Igf2 |
insulin-like growth factor 2 |
484 |
0.63 |
chr6_124717857_124719000 | 0.64 |
Mir200c |
microRNA 200c |
38 |
0.7 |
chr3_36613398_36613746 | 0.64 |
Bbs7 |
Bardet-Biedl syndrome 7 (human) |
95 |
0.96 |
chr5_102724663_102726037 | 0.64 |
Arhgap24 |
Rho GTPase activating protein 24 |
377 |
0.93 |
chr10_79614025_79614445 | 0.64 |
C2cd4c |
C2 calcium-dependent domain containing 4C |
210 |
0.87 |
chr2_93695850_93696662 | 0.64 |
Ext2 |
exostosin glycosyltransferase 2 |
8253 |
0.24 |
chr16_21282099_21282250 | 0.64 |
Gm16863 |
predicted gene, 16863 |
14698 |
0.15 |
chr8_104395929_104396146 | 0.63 |
Cmtm4 |
CKLF-like MARVEL transmembrane domain containing 4 |
230 |
0.87 |
chr12_107752581_107752862 | 0.63 |
4930465M20Rik |
RIKEN cDNA 4930465M20 gene |
17225 |
0.23 |
chr7_19165805_19166461 | 0.63 |
Gipr |
gastric inhibitory polypeptide receptor |
6 |
0.94 |
chr3_101130504_101130991 | 0.63 |
Ptgfrn |
prostaglandin F2 receptor negative regulator |
20469 |
0.17 |
chr19_42936859_42937183 | 0.63 |
Hps1 |
HPS1, biogenesis of lysosomal organelles complex 3 subunit 1 |
157043 |
0.03 |
chr2_94263215_94263820 | 0.63 |
Mir670hg |
MIR670 host gene (non-protein coding) |
1091 |
0.4 |
chr9_21225354_21225714 | 0.62 |
Gm16754 |
predicted gene, 16754 |
131 |
0.92 |
chr18_61663767_61665554 | 0.62 |
Carmn |
cardiac mesoderm enhancer-associated non-coding RNA |
830 |
0.45 |
chr7_46097834_46098538 | 0.62 |
Kcnj11 |
potassium inwardly rectifying channel, subfamily J, member 11 |
240 |
0.86 |
chr5_77217622_77217775 | 0.62 |
Spink2 |
serine peptidase inhibitor, Kazal type 2 |
6227 |
0.15 |
chr18_11062388_11062539 | 0.62 |
Gata6 |
GATA binding protein 6 |
3416 |
0.28 |
chr14_99578342_99579719 | 0.61 |
Gm49225 |
predicted gene, 49225 |
40986 |
0.14 |
chr10_69781382_69781628 | 0.61 |
Ank3 |
ankyrin 3, epithelial |
4009 |
0.36 |
chr3_55461381_55462661 | 0.61 |
Dclk1 |
doublecortin-like kinase 1 |
49 |
0.97 |
chr6_108827897_108828048 | 0.61 |
Edem1 |
ER degradation enhancer, mannosidase alpha-like 1 |
669 |
0.74 |
chr13_113292829_113293866 | 0.60 |
BC067074 |
cDNA sequence BC067074 |
188 |
0.95 |
chr6_29434692_29436459 | 0.60 |
Flnc |
filamin C, gamma |
2299 |
0.16 |
chr8_120190890_120191531 | 0.60 |
Fam92b |
family with sequence similarity 92, member B |
13744 |
0.14 |
chr10_111505898_111506222 | 0.60 |
Phlda1 |
pleckstrin homology like domain, family A, member 1 |
226 |
0.87 |
chr17_47595052_47595203 | 0.60 |
Ccnd3 |
cyclin D3 |
371 |
0.76 |
chr9_79716645_79717059 | 0.59 |
Col12a1 |
collagen, type XII, alpha 1 |
1642 |
0.36 |
chr18_35087329_35087764 | 0.59 |
Gm3587 |
predicted gene 3587 |
77 |
0.97 |
chr12_27082398_27083433 | 0.59 |
Gm9866 |
predicted gene 9866 |
32080 |
0.24 |
chr17_86963948_86964147 | 0.59 |
Rhoq |
ras homolog family member Q |
755 |
0.54 |
chr10_107488735_107489121 | 0.58 |
Myf5 |
myogenic factor 5 |
2794 |
0.24 |
chr2_35691764_35692937 | 0.58 |
Dab2ip |
disabled 2 interacting protein |
17 |
0.98 |
chr14_76448877_76449030 | 0.58 |
Tsc22d1 |
TSC22 domain family, member 1 |
10020 |
0.25 |
chr15_103513734_103514562 | 0.58 |
Pde1b |
phosphodiesterase 1B, Ca2+-calmodulin dependent |
772 |
0.56 |
chr1_46853790_46854389 | 0.57 |
Slc39a10 |
solute carrier family 39 (zinc transporter), member 10 |
43 |
0.97 |
chr11_100414739_100415249 | 0.57 |
P3h4 |
prolyl 3-hydroxylase family member 4 (non-enzymatic) |
158 |
0.82 |
chr2_17524087_17524279 | 0.57 |
Nebl |
nebulette |
4141 |
0.26 |
chr18_65924855_65925508 | 0.57 |
Gm50119 |
predicted gene, 50119 |
585 |
0.55 |
chr11_8663041_8663192 | 0.57 |
Tns3 |
tensin 3 |
1419 |
0.58 |
chr5_16553245_16554447 | 0.57 |
Hgf |
hepatocyte growth factor |
60 |
0.98 |
chr4_40473442_40473626 | 0.57 |
Tmem215 |
transmembrane protein 215 |
404 |
0.85 |
chr11_61956514_61956712 | 0.57 |
Specc1 |
sperm antigen with calponin homology and coiled-coil domains 1 |
150 |
0.93 |
chr3_58417834_58418696 | 0.57 |
Tsc22d2 |
TSC22 domain family, member 2 |
781 |
0.64 |
chr11_101964785_101965427 | 0.57 |
Sost |
sclerostin |
1909 |
0.18 |
chr1_59253538_59253849 | 0.56 |
Cdk15 |
cyclin-dependent kinase 15 |
3213 |
0.23 |
chr7_27508119_27508545 | 0.56 |
Gm15541 |
predicted gene 15541 |
210 |
0.73 |
chr16_90405638_90406139 | 0.56 |
Hunk |
hormonally upregulated Neu-associated kinase |
5344 |
0.2 |
chr3_94821524_94822050 | 0.56 |
Gm15263 |
predicted gene 15263 |
11190 |
0.12 |
chr3_97312002_97312654 | 0.56 |
Bcl9 |
B cell CLL/lymphoma 9 |
14411 |
0.18 |
chr12_112810091_112810242 | 0.56 |
Clba1 |
clathrin binding box of aftiphilin containing 1 |
1191 |
0.31 |
chr17_26844031_26845183 | 0.56 |
Nkx2-5 |
NK2 homeobox 5 |
402 |
0.75 |
chr10_107122668_107124037 | 0.56 |
Acss3 |
acyl-CoA synthetase short-chain family member 3 |
231 |
0.93 |
chr8_105305363_105306677 | 0.55 |
Elmo3 |
engulfment and cell motility 3 |
325 |
0.64 |
chr15_97338209_97338935 | 0.55 |
Pced1b |
PC-esterase domain containing 1B |
22630 |
0.2 |
chr12_108004209_108004402 | 0.55 |
Bcl11b |
B cell leukemia/lymphoma 11B |
703 |
0.79 |
chr8_81856704_81856908 | 0.55 |
Inpp4b |
inositol polyphosphate-4-phosphatase, type II |
438 |
0.87 |
chr5_101669401_101669635 | 0.55 |
Nkx6-1 |
NK6 homeobox 1 |
4522 |
0.21 |
chr7_44969922_44970287 | 0.55 |
6530437J22Rik |
RIKEN cDNA 6530437J22 gene |
325 |
0.68 |
chr3_51552828_51553029 | 0.55 |
Setd7 |
SET domain containing (lysine methyltransferase) 7 |
1608 |
0.23 |
chr3_69042248_69042550 | 0.55 |
Trim59 |
tripartite motif-containing 59 |
2316 |
0.19 |
chr17_56275991_56276741 | 0.55 |
Ticam1 |
toll-like receptor adaptor molecule 1 |
420 |
0.69 |
chr12_76478471_76479247 | 0.55 |
Gm47053 |
predicted gene, 47053 |
13496 |
0.12 |
chr2_180385943_180386992 | 0.54 |
B230312C02Rik |
RIKEN cDNA B230312C02 gene |
582 |
0.63 |
chr15_6742331_6742757 | 0.54 |
Rictor |
RPTOR independent companion of MTOR, complex 2 |
34161 |
0.18 |
chr2_7080605_7081856 | 0.54 |
Celf2 |
CUGBP, Elav-like family member 2 |
12 |
0.99 |
chr15_76899395_76899602 | 0.54 |
Commd5 |
COMM domain containing 5 |
412 |
0.7 |
chr13_23488410_23488875 | 0.54 |
Btn2a2 |
butyrophilin, subfamily 2, member A2 |
188 |
0.84 |
chr1_59252853_59253313 | 0.54 |
Cdk15 |
cyclin-dependent kinase 15 |
3823 |
0.21 |
chr16_88561792_88563295 | 0.53 |
Cldn8 |
claudin 8 |
640 |
0.64 |
chr3_93556301_93556452 | 0.53 |
S100a10 |
S100 calcium binding protein A10 (calpactin) |
1213 |
0.35 |
chr3_149509086_149509484 | 0.53 |
Gm30382 |
predicted gene, 30382 |
63984 |
0.14 |
chr13_3694695_3695373 | 0.53 |
Gm23084 |
predicted gene, 23084 |
46497 |
0.1 |
chr19_44740845_44741002 | 0.53 |
Gm35610 |
predicted gene, 35610 |
430 |
0.79 |
chr17_9905595_9906679 | 0.53 |
Gm34799 |
predicted gene, 34799 |
23630 |
0.17 |
chr2_156774819_156776414 | 0.53 |
Myl9 |
myosin, light polypeptide 9, regulatory |
159 |
0.92 |
chr18_58555596_58556916 | 0.53 |
Slc27a6 |
solute carrier family 27 (fatty acid transporter), member 6 |
1 |
0.99 |
chr2_36230119_36231737 | 0.53 |
Ptgs1 |
prostaglandin-endoperoxide synthase 1 |
372 |
0.79 |
chr13_16020895_16021475 | 0.53 |
B230303A05Rik |
RIKEN cDNA B230303A05 gene |
2175 |
0.22 |
chr10_61715304_61715815 | 0.53 |
Aifm2 |
apoptosis-inducing factor, mitochondrion-associated 2 |
227 |
0.9 |
chr13_95523594_95523766 | 0.52 |
F2rl1 |
coagulation factor II (thrombin) receptor-like 1 |
1547 |
0.34 |
chrX_48143101_48144179 | 0.52 |
Sash3 |
SAM and SH3 domain containing 3 |
2796 |
0.26 |
chr3_148336099_148336635 | 0.52 |
Gm23131 |
predicted gene, 23131 |
17851 |
0.28 |
chr3_93523131_93523282 | 0.52 |
S100a11 |
S100 calcium binding protein A11 |
2718 |
0.16 |
chr17_32166185_32166590 | 0.52 |
Notch3 |
notch 3 |
465 |
0.73 |
chr2_32728246_32729219 | 0.52 |
Sh2d3c |
SH2 domain containing 3C |
1026 |
0.27 |
chr3_95903186_95903443 | 0.52 |
Car14 |
carbonic anhydrase 14 |
434 |
0.65 |
chr16_44616167_44616479 | 0.52 |
Boc |
biregional cell adhesion molecule-related/down-regulated by oncogenes (Cdon) binding protein |
57426 |
0.11 |
chr19_43729441_43730557 | 0.52 |
Entpd7 |
ectonucleoside triphosphate diphosphohydrolase 7 |
3632 |
0.16 |
chr19_55596258_55596409 | 0.51 |
Tcf7l2 |
transcription factor 7 like 2, T cell specific, HMG box |
145487 |
0.04 |
chr15_85297584_85298676 | 0.51 |
Fbln1 |
fibulin 1 |
34676 |
0.14 |
chr7_125933670_125934371 | 0.51 |
D430042O09Rik |
RIKEN cDNA D430042O09 gene |
68749 |
0.1 |
chr10_94344468_94344902 | 0.51 |
Tmcc3 |
transmembrane and coiled coil domains 3 |
32548 |
0.16 |
chr12_105981623_105981921 | 0.51 |
Vrk1 |
vaccinia related kinase 1 |
28456 |
0.18 |
chr10_63203190_63203876 | 0.51 |
Mypn |
myopalladin |
419 |
0.79 |
chr8_45627436_45629381 | 0.51 |
Sorbs2 |
sorbin and SH3 domain containing 2 |
207 |
0.94 |
chr6_48676062_48676718 | 0.51 |
Gimap9 |
GTPase, IMAP family member 9 |
261 |
0.79 |
chr6_137142437_137143268 | 0.51 |
Rerg |
RAS-like, estrogen-regulated, growth-inhibitor |
2789 |
0.27 |
chr6_71823790_71824040 | 0.51 |
Mrpl35 |
mitochondrial ribosomal protein L35 |
105 |
0.94 |
chr4_137370049_137370667 | 0.51 |
Cdc42 |
cell division cycle 42 |
12638 |
0.12 |
chr1_43005796_43006609 | 0.50 |
Gpr45 |
G protein-coupled receptor 45 |
25858 |
0.14 |
chrX_136639746_136640106 | 0.50 |
Tceal3 |
transcription elongation factor A (SII)-like 3 |
26449 |
0.11 |
chr14_21682688_21683321 | 0.50 |
Dupd1 |
dual specificity phosphatase and pro isomerase domain containing 1 |
20098 |
0.16 |
chr1_33362665_33362993 | 0.50 |
Gm7933 |
predicted gene 7933 |
8502 |
0.2 |
chr12_73448708_73448859 | 0.50 |
Gm33929 |
predicted gene, 33929 |
465 |
0.79 |
chr4_148723962_148724113 | 0.50 |
Gm13203 |
predicted gene 13203 |
10334 |
0.19 |
chr6_72233456_72234176 | 0.50 |
Atoh8 |
atonal bHLH transcription factor 8 |
721 |
0.64 |
chr19_53794096_53794765 | 0.50 |
Rbm20 |
RNA binding motif protein 20 |
1122 |
0.48 |
chr17_10309111_10309652 | 0.49 |
Qk |
quaking |
9980 |
0.24 |
chr12_109527551_109529007 | 0.49 |
Gm27528 |
predicted gene, 27528 |
2613 |
0.08 |
chr13_38153771_38154277 | 0.49 |
Gm10129 |
predicted gene 10129 |
2232 |
0.25 |
chr5_125245154_125246158 | 0.49 |
Gm32585 |
predicted gene, 32585 |
27159 |
0.15 |
chr10_39613682_39614138 | 0.49 |
Gm16364 |
predicted gene 16364 |
228 |
0.85 |
chr4_57130293_57130444 | 0.49 |
Epb41l4b |
erythrocyte membrane protein band 4.1 like 4b |
7824 |
0.23 |
chr6_101375313_101375657 | 0.49 |
Pdzrn3 |
PDZ domain containing RING finger 3 |
1857 |
0.32 |
chr2_92370128_92371627 | 0.49 |
Large2 |
LARGE xylosyl- and glucuronyltransferase 2 |
109 |
0.93 |
chr17_57264956_57265836 | 0.48 |
Gm46575 |
predicted gene, 46575 |
2526 |
0.17 |
chr2_76069049_76070775 | 0.48 |
Pde11a |
phosphodiesterase 11A |
63869 |
0.11 |
chr8_111731089_111731726 | 0.48 |
Bcar1 |
breast cancer anti-estrogen resistance 1 |
698 |
0.67 |
chr5_96375638_96375837 | 0.48 |
Fras1 |
Fraser extracellular matrix complex subunit 1 |
1302 |
0.55 |
chr8_57316775_57317469 | 0.48 |
Hand2os1 |
Hand2, opposite strand 1 |
1288 |
0.34 |
chr10_39612918_39613668 | 0.48 |
Traf3ip2 |
TRAF3 interacting protein 2 |
359 |
0.48 |
chr11_33932101_33932385 | 0.48 |
Kcnmb1 |
potassium large conductance calcium-activated channel, subfamily M, beta member 1 |
30770 |
0.2 |
chr17_72920336_72921423 | 0.47 |
Lbh |
limb-bud and heart |
309 |
0.93 |
chr16_92398225_92398526 | 0.47 |
Rcan1 |
regulator of calcineurin 1 |
1603 |
0.3 |
chr15_76205535_76206787 | 0.47 |
Plec |
plectin |
160 |
0.89 |
chr8_104602083_104602837 | 0.47 |
Cdh16 |
cadherin 16 |
10804 |
0.09 |
chr5_116288340_116288561 | 0.47 |
Ccdc60 |
coiled-coil domain containing 60 |
513 |
0.69 |
chr7_115216953_115217567 | 0.47 |
Gm27684 |
predicted gene, 27684 |
44987 |
0.16 |
chr10_22273651_22274398 | 0.47 |
H60b |
histocompatibility 60b |
678 |
0.55 |
chr8_34074786_34075453 | 0.47 |
Dctn6 |
dynactin 6 |
17806 |
0.11 |
chr3_116968200_116969270 | 0.47 |
Palmd |
palmdelphin |
8 |
0.89 |
chr3_89215230_89216068 | 0.47 |
Thbs3 |
thrombospondin 3 |
416 |
0.53 |
chr12_99257345_99258179 | 0.47 |
Gm19898 |
predicted gene, 19898 |
12091 |
0.17 |
chr18_61639240_61640029 | 0.47 |
Bvht |
braveheart long non-coding RNA |
19 |
0.96 |
chr17_48430197_48430460 | 0.47 |
Apobec2 |
apolipoprotein B mRNA editing enzyme, catalytic polypeptide 2 |
2290 |
0.18 |
chr11_55031162_55031901 | 0.47 |
Anxa6 |
annexin A6 |
1884 |
0.3 |
chr15_56694253_56695303 | 0.47 |
Has2 |
hyaluronan synthase 2 |
239 |
0.85 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 2.0 | GO:0003166 | bundle of His development(GO:0003166) |
0.4 | 1.1 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.3 | 1.6 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.3 | 0.9 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.3 | 0.8 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.2 | 0.7 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.2 | 0.8 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.2 | 1.0 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
0.2 | 0.4 | GO:0070384 | Harderian gland development(GO:0070384) |
0.2 | 0.4 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.2 | 0.6 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.2 | 0.5 | GO:1900135 | positive regulation of renin secretion into blood stream(GO:1900135) |
0.2 | 0.5 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.2 | 0.5 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.2 | 0.5 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.2 | 0.7 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.2 | 1.0 | GO:0090500 | endocardial cushion to mesenchymal transition(GO:0090500) |
0.2 | 0.2 | GO:0072008 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
0.2 | 0.5 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.2 | 0.5 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.1 | 1.0 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.1 | 0.4 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.1 | 0.4 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.1 | 0.3 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.1 | 0.4 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.1 | 0.4 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.1 | 0.4 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 0.4 | GO:0060737 | prostate epithelial cord elongation(GO:0060523) prostate gland morphogenetic growth(GO:0060737) |
0.1 | 0.4 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.4 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
0.1 | 0.3 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.1 | 0.3 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.1 | 0.5 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.1 | 0.3 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.1 | 0.2 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.1 | 0.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.1 | 0.3 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.1 | 0.4 | GO:0008228 | opsonization(GO:0008228) |
0.1 | 0.5 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.1 | 0.3 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.1 | 0.3 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.1 | 0.5 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
0.1 | 0.4 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.1 | 0.4 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.1 | 0.5 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.3 | GO:0003195 | tricuspid valve development(GO:0003175) tricuspid valve morphogenesis(GO:0003186) tricuspid valve formation(GO:0003195) |
0.1 | 0.2 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
0.1 | 0.7 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.3 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.1 | 0.2 | GO:0021856 | cerebral cortex tangential migration using cell-axon interactions(GO:0021824) gonadotrophin-releasing hormone neuronal migration to the hypothalamus(GO:0021828) hypothalamic tangential migration using cell-axon interactions(GO:0021856) facioacoustic ganglion development(GO:1903375) |
0.1 | 0.3 | GO:0072198 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) |
0.1 | 0.2 | GO:0071504 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.1 | 0.1 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) |
0.1 | 0.3 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.1 | 0.6 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.1 | 0.3 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.1 | 0.6 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.1 | 0.3 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.1 | 0.4 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.1 | 0.4 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.3 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
0.1 | 0.2 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
0.1 | 0.3 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
0.1 | 0.3 | GO:0003257 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) |
0.1 | 0.7 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.1 | 0.3 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.1 | 0.7 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.1 | 0.4 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.1 | 0.1 | GO:0086029 | Purkinje myocyte to ventricular cardiac muscle cell signaling(GO:0086029) Purkinje myocyte to ventricular cardiac muscle cell communication(GO:0086068) |
0.1 | 0.3 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.1 | 0.2 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.1 | 0.2 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.1 | 0.6 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.1 | 0.2 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.1 | 0.5 | GO:0036006 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
0.1 | 0.4 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.1 | 0.3 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.1 | 0.2 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.1 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.1 | 0.2 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.1 | 0.3 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
0.1 | 0.2 | GO:0015755 | fructose transport(GO:0015755) |
0.1 | 0.2 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
0.1 | 0.2 | GO:0007525 | somatic muscle development(GO:0007525) |
0.1 | 0.4 | GO:0035989 | tendon development(GO:0035989) |
0.1 | 0.4 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.1 | 0.5 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.1 | 0.2 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.1 | 0.2 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.4 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.1 | 0.4 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.1 | 0.2 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.1 | 0.4 | GO:1904259 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
0.1 | 0.6 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
0.1 | 0.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.1 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
0.1 | 0.2 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
0.1 | 0.2 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
0.1 | 0.4 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 0.6 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.1 | 0.1 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.1 | 0.3 | GO:2000794 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
0.1 | 0.2 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.1 | 0.1 | GO:0060437 | lung growth(GO:0060437) |
0.1 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.3 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
0.1 | 0.1 | GO:0072107 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
0.1 | 0.4 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.1 | 0.2 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.1 | 0.1 | GO:1904192 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.4 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.1 | 0.2 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.1 | 0.4 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.1 | 0.1 | GO:0003176 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
0.1 | 0.2 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.1 | 0.3 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 0.5 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.1 | 0.2 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.1 | 0.2 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.1 | 1.1 | GO:0008210 | estrogen metabolic process(GO:0008210) |
0.1 | 0.2 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.2 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.1 | 0.1 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) |
0.1 | 0.3 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
0.1 | 0.2 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.1 | 0.1 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
0.1 | 0.2 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.1 | 0.2 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.1 | 0.2 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.1 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.2 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.1 | 0.2 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.1 | 0.2 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.1 | 0.3 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.1 | 0.2 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.1 | 0.5 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 0.2 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.1 | 0.2 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.1 | 0.1 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) |
0.1 | 0.2 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.1 | 0.1 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.1 | 0.8 | GO:0070875 | positive regulation of glycogen metabolic process(GO:0070875) |
0.1 | 0.2 | GO:0032908 | transforming growth factor beta1 production(GO:0032905) regulation of transforming growth factor beta1 production(GO:0032908) |
0.1 | 0.2 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.2 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
0.1 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.2 | GO:0030421 | defecation(GO:0030421) |
0.1 | 0.3 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.1 | 0.4 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.1 | 0.4 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.1 | 0.3 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.1 | 0.2 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.1 | 0.1 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.1 | 0.2 | GO:0006868 | glutamine transport(GO:0006868) |
0.1 | 0.2 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.1 | 0.2 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.1 | 0.2 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.1 | 0.2 | GO:1903753 | negative regulation of p38MAPK cascade(GO:1903753) |
0.1 | 0.5 | GO:0010560 | positive regulation of glycoprotein biosynthetic process(GO:0010560) |
0.1 | 0.1 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.1 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.2 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.0 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
0.0 | 0.2 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.0 | 0.1 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 1.0 | GO:0033198 | response to ATP(GO:0033198) |
0.0 | 0.2 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.0 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.3 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.0 | 0.1 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.0 | 0.2 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.0 | 0.2 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.1 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.0 | 0.3 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.0 | 0.2 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.0 | 0.1 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.0 | 0.2 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.0 | 0.1 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.0 | 0.2 | GO:0060613 | fat pad development(GO:0060613) |
0.0 | 0.1 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.0 | 0.5 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.0 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
0.0 | 0.3 | GO:1902893 | regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902893) positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
0.0 | 0.1 | GO:0001787 | natural killer cell proliferation(GO:0001787) |
0.0 | 0.2 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
0.0 | 0.5 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.0 | 1.0 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.0 | 0.2 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.0 | 0.0 | GO:0048371 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.0 | 0.7 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.0 | 0.1 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.0 | 0.0 | GO:0050904 | diapedesis(GO:0050904) |
0.0 | 0.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.0 | 0.3 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.0 | 0.2 | GO:0015867 | ATP transport(GO:0015867) |
0.0 | 0.1 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.0 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.0 | 0.2 | GO:0032344 | regulation of aldosterone metabolic process(GO:0032344) |
0.0 | 0.0 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.0 | 0.2 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.0 | 0.5 | GO:0002053 | positive regulation of mesenchymal cell proliferation(GO:0002053) |
0.0 | 0.5 | GO:0002829 | negative regulation of type 2 immune response(GO:0002829) |
0.0 | 0.2 | GO:0060022 | hard palate development(GO:0060022) |
0.0 | 0.2 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.0 | 0.3 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.1 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.0 | 0.2 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.0 | 0.2 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.0 | 0.1 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.0 | 0.0 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.0 | 0.1 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.0 | 0.1 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.0 | 0.1 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.0 | 0.0 | GO:0021898 | commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.0 | 0.1 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.9 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
0.0 | 0.0 | GO:0051182 | coenzyme transport(GO:0051182) |
0.0 | 0.2 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
0.0 | 0.3 | GO:0018119 | peptidyl-cysteine S-nitrosylation(GO:0018119) |
0.0 | 0.1 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.0 | 0.1 | GO:0045964 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.0 | 0.2 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.2 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.0 | 0.1 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.0 | 0.2 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.0 | 0.1 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.0 | 0.1 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
0.0 | 0.2 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.0 | 0.1 | GO:0001999 | renal response to blood flow involved in circulatory renin-angiotensin regulation of systemic arterial blood pressure(GO:0001999) |
0.0 | 0.1 | GO:1902805 | positive regulation of synaptic vesicle transport(GO:1902805) positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.0 | 0.1 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.0 | 0.1 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.0 | 0.2 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.0 | 0.2 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.1 | GO:0043587 | tongue morphogenesis(GO:0043587) |
0.0 | 0.3 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.0 | 0.4 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
0.0 | 0.3 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.0 | 0.4 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.0 | 0.1 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.0 | 0.1 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.0 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.0 | 0.2 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
0.0 | 0.2 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
0.0 | 0.6 | GO:0033173 | calcineurin-NFAT signaling cascade(GO:0033173) |
0.0 | 0.1 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
0.0 | 0.1 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.0 | 0.1 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.1 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
0.0 | 0.0 | GO:0003383 | apical constriction(GO:0003383) |
0.0 | 0.3 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
0.0 | 0.1 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.3 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.1 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.0 | 0.2 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.1 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
0.0 | 0.4 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.0 | 0.1 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.0 | 0.0 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.0 | 0.2 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.0 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.0 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.3 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.0 | 0.1 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.0 | 0.1 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.0 | 0.1 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
0.0 | 0.1 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.0 | 0.2 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
0.0 | 0.0 | GO:1901201 | regulation of extracellular matrix assembly(GO:1901201) |
0.0 | 0.1 | GO:0000087 | mitotic M phase(GO:0000087) |
0.0 | 0.2 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.3 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.0 | 0.2 | GO:0002076 | osteoblast development(GO:0002076) |
0.0 | 0.2 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.1 | GO:0051665 | membrane raft localization(GO:0051665) |
0.0 | 0.0 | GO:0071335 | hair follicle cell proliferation(GO:0071335) regulation of hair follicle cell proliferation(GO:0071336) |
0.0 | 0.2 | GO:0044331 | cell-cell adhesion mediated by cadherin(GO:0044331) |
0.0 | 0.1 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.0 | 0.1 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.2 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.1 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
0.0 | 0.1 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
0.0 | 0.2 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.1 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.0 | 0.1 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.2 | GO:0035743 | CD4-positive, alpha-beta T cell cytokine production(GO:0035743) |
0.0 | 0.3 | GO:0043931 | ossification involved in bone maturation(GO:0043931) |
0.0 | 0.4 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.2 | GO:0071711 | basement membrane organization(GO:0071711) |
0.0 | 0.1 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.0 | 0.2 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
0.0 | 0.2 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.0 | 0.0 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) |
0.0 | 0.1 | GO:0014891 | striated muscle atrophy(GO:0014891) |
0.0 | 0.1 | GO:0070294 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
0.0 | 0.1 | GO:0051546 | keratinocyte migration(GO:0051546) |
0.0 | 0.1 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
0.0 | 0.2 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.0 | 0.4 | GO:0031958 | corticosteroid receptor signaling pathway(GO:0031958) |
0.0 | 0.3 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.1 | GO:2000726 | negative regulation of cardiac muscle cell differentiation(GO:2000726) |
0.0 | 0.1 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.0 | 0.1 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.0 | 0.3 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
0.0 | 0.6 | GO:1903205 | regulation of hydrogen peroxide-induced cell death(GO:1903205) |
0.0 | 0.1 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.0 | 0.2 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.0 | 0.1 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
0.0 | 0.1 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.0 | 0.1 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.0 | 0.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.1 | GO:0060431 | primary lung bud formation(GO:0060431) |
0.0 | 0.1 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.0 | 0.1 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.0 | 0.1 | GO:2000121 | regulation of removal of superoxide radicals(GO:2000121) |
0.0 | 0.1 | GO:0021557 | oculomotor nerve development(GO:0021557) |
0.0 | 0.1 | GO:1902170 | cellular response to reactive nitrogen species(GO:1902170) |
0.0 | 0.2 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.0 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.0 | 0.1 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.0 | 0.4 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.1 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.0 | 0.0 | GO:0031944 | negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
0.0 | 0.1 | GO:1904994 | regulation of leukocyte adhesion to vascular endothelial cell(GO:1904994) |
0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.0 | 0.0 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.0 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.0 | 0.2 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.0 | 0.1 | GO:1900040 | regulation of interleukin-2 secretion(GO:1900040) |
0.0 | 0.2 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 0.1 | GO:0006562 | proline catabolic process(GO:0006562) |
0.0 | 0.1 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.4 | GO:0060285 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
0.0 | 0.2 | GO:0002726 | positive regulation of T cell cytokine production(GO:0002726) |
0.0 | 0.0 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.0 | 0.1 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.1 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.0 | 0.2 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.7 | GO:0003341 | cilium movement(GO:0003341) |
0.0 | 0.1 | GO:0002254 | kinin cascade(GO:0002254) |
0.0 | 0.0 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.0 | 0.0 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.0 | 0.1 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.0 | 0.0 | GO:0061004 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.0 | 0.0 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
0.0 | 0.0 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.0 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.0 | 0.0 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.0 | 0.0 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.0 | GO:0071415 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.0 | 0.0 | GO:0036484 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
0.0 | 0.1 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.0 | 0.0 | GO:0060459 | left lung development(GO:0060459) left lung morphogenesis(GO:0060460) |
0.0 | 0.3 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.1 | GO:0042737 | drug catabolic process(GO:0042737) |
0.0 | 0.0 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.2 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 0.1 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.0 | 0.0 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.0 | 0.0 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
0.0 | 0.1 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.0 | 0.0 | GO:0030952 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) establishment or maintenance of cytoskeleton polarity(GO:0030952) |
0.0 | 0.2 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.0 | 0.1 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.0 | 0.1 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.0 | 0.0 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.0 | 0.1 | GO:0071364 | cellular response to epidermal growth factor stimulus(GO:0071364) |
0.0 | 0.1 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.0 | 0.1 | GO:0009158 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.2 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.0 | 0.1 | GO:0034392 | negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.2 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.0 | 0.0 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.0 | 0.3 | GO:0006706 | steroid catabolic process(GO:0006706) |
0.0 | 0.2 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.0 | 0.0 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.0 | 0.0 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.0 | GO:0048289 | isotype switching to IgE isotypes(GO:0048289) regulation of isotype switching to IgE isotypes(GO:0048293) |
0.0 | 0.0 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.0 | 0.0 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.0 | 0.1 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.0 | 0.1 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.0 | 0.0 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
0.0 | 0.1 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.0 | GO:0003256 | regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003256) |
0.0 | 0.0 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.0 | 0.4 | GO:0060612 | adipose tissue development(GO:0060612) |
0.0 | 0.0 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.0 | 0.2 | GO:0032328 | alanine transport(GO:0032328) |
0.0 | 0.1 | GO:0044351 | macropinocytosis(GO:0044351) |
0.0 | 0.1 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.0 | 0.1 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.1 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.0 | 0.2 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.0 | 0.0 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.0 | 0.1 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.0 | 0.1 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.0 | 0.3 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.0 | 0.0 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) positive regulation of cellular pH reduction(GO:0032849) |
0.0 | 0.1 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.0 | 0.1 | GO:0090153 | regulation of sphingolipid biosynthetic process(GO:0090153) regulation of membrane lipid metabolic process(GO:1905038) |
0.0 | 0.3 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
0.0 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.1 | GO:1900364 | regulation of mRNA polyadenylation(GO:1900363) negative regulation of mRNA polyadenylation(GO:1900364) |
0.0 | 0.1 | GO:0060396 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.2 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.0 | 0.0 | GO:0048548 | regulation of pinocytosis(GO:0048548) |
0.0 | 0.1 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.0 | 0.0 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.0 | 0.0 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
0.0 | 0.1 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.0 | 0.2 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.1 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.0 | GO:2000858 | mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) regulation of aldosterone secretion(GO:2000858) |
0.0 | 0.2 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.1 | GO:0090399 | replicative senescence(GO:0090399) |
0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.0 | 0.1 | GO:0036315 | cellular response to sterol(GO:0036315) |
0.0 | 0.1 | GO:0002693 | positive regulation of cellular extravasation(GO:0002693) |
0.0 | 0.2 | GO:0035337 | fatty-acyl-CoA metabolic process(GO:0035337) |
0.0 | 0.3 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
0.0 | 0.1 | GO:0021756 | striatum development(GO:0021756) |
0.0 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.1 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.2 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
0.0 | 0.2 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.2 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.0 | 0.0 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.0 | 0.1 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.0 | 0.1 | GO:0010002 | cardioblast differentiation(GO:0010002) |
0.0 | 0.0 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.0 | 0.1 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.0 | 0.1 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.0 | 0.1 | GO:1901031 | regulation of response to reactive oxygen species(GO:1901031) |
0.0 | 0.1 | GO:0042416 | dopamine biosynthetic process(GO:0042416) |
0.0 | 0.1 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
0.0 | 0.6 | GO:0048661 | positive regulation of smooth muscle cell proliferation(GO:0048661) |
0.0 | 0.1 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.0 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.2 | GO:0090266 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
0.0 | 0.2 | GO:1902571 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
0.0 | 0.1 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
0.0 | 0.1 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.0 | 0.2 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
0.0 | 0.1 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.0 | 0.1 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.0 | 0.0 | GO:0072277 | metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
0.0 | 0.0 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
0.0 | 0.0 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.0 | 0.1 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.0 | 0.0 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.0 | 0.1 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.0 | 0.3 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.0 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.0 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.1 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.0 | 0.0 | GO:0051775 | response to redox state(GO:0051775) |
0.0 | 0.1 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.0 | 0.1 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.0 | 0.0 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.0 | 0.0 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.0 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.0 | 0.1 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.0 | 0.0 | GO:0008354 | germ cell migration(GO:0008354) |
0.0 | 0.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.0 | 0.0 | GO:1990000 | amyloid fibril formation(GO:1990000) |
0.0 | 0.2 | GO:0046457 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.0 | GO:0042322 | negative regulation of circadian sleep/wake cycle, REM sleep(GO:0042322) |
0.0 | 0.0 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.0 | 0.2 | GO:0051383 | kinetochore organization(GO:0051383) |
0.0 | 0.2 | GO:0090312 | positive regulation of protein deacetylation(GO:0090312) |
0.0 | 0.1 | GO:0006477 | protein sulfation(GO:0006477) |
0.0 | 0.0 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.1 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.0 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.1 | GO:2000647 | negative regulation of stem cell proliferation(GO:2000647) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.0 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.0 | 0.1 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.0 | 0.0 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.0 | 0.2 | GO:0051642 | centrosome localization(GO:0051642) |
0.0 | 0.1 | GO:0009713 | catechol-containing compound biosynthetic process(GO:0009713) catecholamine biosynthetic process(GO:0042423) |
0.0 | 0.1 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
0.0 | 0.2 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
0.0 | 0.0 | GO:0046016 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
0.0 | 0.0 | GO:0035425 | autocrine signaling(GO:0035425) |
0.0 | 0.1 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
0.0 | 0.1 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.0 | 0.0 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.0 | 0.1 | GO:0015884 | folic acid transport(GO:0015884) |
0.0 | 0.0 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.1 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.3 | GO:0098840 | intraciliary transport(GO:0042073) protein transport along microtubule(GO:0098840) |
0.0 | 0.1 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.0 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.0 | 0.1 | GO:0060947 | cardiac vascular smooth muscle cell differentiation(GO:0060947) |
0.0 | 0.1 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.0 | 0.0 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
0.0 | 0.0 | GO:0099624 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
0.0 | 0.0 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.0 | 1.1 | GO:0001676 | long-chain fatty acid metabolic process(GO:0001676) |
0.0 | 0.2 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.0 | 0.0 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.1 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.0 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.2 | GO:0014829 | vascular smooth muscle contraction(GO:0014829) |
0.0 | 0.1 | GO:0000338 | protein deneddylation(GO:0000338) |
0.0 | 0.1 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.0 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.0 | 0.0 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
0.0 | 0.0 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.0 | 0.0 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.0 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.0 | 0.1 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.0 | 0.0 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.0 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.0 | 0.0 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.0 | 0.0 | GO:0003093 | regulation of glomerular filtration(GO:0003093) |
0.0 | 0.2 | GO:0035058 | nonmotile primary cilium assembly(GO:0035058) |
0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.1 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.0 | 0.1 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.0 | 0.0 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.0 | 0.0 | GO:1902990 | telomere maintenance via semi-conservative replication(GO:0032201) mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.0 | 0.0 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.0 | 0.0 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.0 | 0.1 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.2 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.2 | GO:0045601 | regulation of endothelial cell differentiation(GO:0045601) |
0.0 | 0.1 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.1 | GO:0071467 | cellular response to pH(GO:0071467) |
0.0 | 0.0 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.0 | GO:0003203 | endocardial cushion morphogenesis(GO:0003203) |
0.0 | 0.2 | GO:0046834 | lipid phosphorylation(GO:0046834) |
0.0 | 0.0 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.0 | 0.0 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 0.0 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.0 | 0.1 | GO:0048339 | paraxial mesoderm development(GO:0048339) |
0.0 | 0.2 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.0 | GO:0070508 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
0.0 | 0.2 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
0.0 | 0.0 | GO:0046655 | folic acid metabolic process(GO:0046655) |
0.0 | 0.1 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 0.0 | GO:0060312 | regulation of blood vessel remodeling(GO:0060312) |
0.0 | 0.1 | GO:0016556 | mRNA modification(GO:0016556) |
0.0 | 0.0 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.0 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.0 | 0.0 | GO:0090032 | negative regulation of steroid hormone biosynthetic process(GO:0090032) |
0.0 | 0.0 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.0 | GO:0010155 | regulation of proton transport(GO:0010155) |
0.0 | 0.0 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.0 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) |
0.0 | 0.0 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.1 | GO:0007097 | nuclear migration(GO:0007097) |
0.0 | 0.0 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.0 | 0.0 | GO:0050812 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
0.0 | 0.3 | GO:0007173 | epidermal growth factor receptor signaling pathway(GO:0007173) |
0.0 | 0.0 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.0 | 0.0 | GO:0006848 | pyruvate transport(GO:0006848) |
0.0 | 0.0 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
0.0 | 0.0 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.0 | 0.0 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.0 | 0.1 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.0 | 0.0 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.5 | GO:0050818 | regulation of coagulation(GO:0050818) |
0.0 | 0.1 | GO:0097186 | amelogenesis(GO:0097186) |
0.0 | 0.0 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
0.0 | 0.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.1 | GO:0007379 | segment specification(GO:0007379) |
0.0 | 0.1 | GO:0018208 | peptidyl-proline modification(GO:0018208) |
0.0 | 0.1 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.0 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.0 | 0.1 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.0 | 0.0 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.0 | 0.1 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.0 | 0.0 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.0 | 0.2 | GO:0043297 | apical junction assembly(GO:0043297) |
0.0 | 0.0 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.0 | 0.0 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.0 | GO:0021800 | cerebral cortex tangential migration(GO:0021800) |
0.0 | 0.0 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.0 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.0 | GO:0019532 | oxalate transport(GO:0019532) |
0.0 | 0.0 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
0.0 | 0.0 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.0 | 0.0 | GO:1901163 | regulation of trophoblast cell migration(GO:1901163) negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.0 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.0 | 0.0 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.8 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.2 | 0.8 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.1 | 0.8 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 0.4 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 0.7 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.1 | 0.1 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.1 | 0.4 | GO:0071953 | elastic fiber(GO:0071953) |
0.1 | 0.3 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.1 | 0.6 | GO:0097342 | ripoptosome(GO:0097342) |
0.1 | 0.3 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.3 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 0.9 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 0.2 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 0.6 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.1 | 0.4 | GO:1990462 | omegasome(GO:1990462) |
0.1 | 0.5 | GO:0005861 | troponin complex(GO:0005861) |
0.1 | 0.2 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.1 | 0.6 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 0.2 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 0.4 | GO:0045180 | basal cortex(GO:0045180) |
0.1 | 0.2 | GO:0097452 | GAIT complex(GO:0097452) |
0.1 | 0.3 | GO:0032982 | myosin filament(GO:0032982) |
0.1 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.4 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.0 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.2 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.0 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.0 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.0 | 0.3 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.2 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 1.9 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.2 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
0.0 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.6 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.1 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.0 | 0.6 | GO:0016460 | myosin II complex(GO:0016460) |
0.0 | 0.2 | GO:0005587 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 0.1 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.0 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 0.2 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
0.0 | 0.1 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.2 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.2 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 0.1 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.1 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.5 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.0 | 0.1 | GO:0000235 | astral microtubule(GO:0000235) |
0.0 | 0.3 | GO:0060091 | kinocilium(GO:0060091) |
0.0 | 0.4 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 0.2 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 0.2 | GO:0071439 | clathrin complex(GO:0071439) |
0.0 | 0.0 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.0 | 0.0 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.1 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 0.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.0 | 0.0 | GO:0005652 | nuclear lamina(GO:0005652) |
0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.4 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.3 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.5 | GO:0031672 | A band(GO:0031672) |
0.0 | 0.3 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.4 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 1.3 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.0 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.0 | 0.3 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.0 | 0.1 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.0 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.0 | 0.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.5 | GO:0031902 | late endosome membrane(GO:0031902) |
0.0 | 0.1 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 1.3 | GO:0005604 | basement membrane(GO:0005604) |
0.0 | 0.2 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.2 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.0 | 0.2 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 0.2 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.8 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.0 | 0.2 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 1.0 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
0.0 | 0.1 | GO:0016011 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
0.0 | 0.3 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.0 | 0.4 | GO:0008305 | integrin complex(GO:0008305) |
0.0 | 0.4 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.3 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.0 | 0.1 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.3 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.2 | GO:0097228 | sperm principal piece(GO:0097228) |
0.0 | 0.1 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
0.0 | 0.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.4 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.0 | 0.1 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.0 | 0.1 | GO:1990246 | uniplex complex(GO:1990246) |
0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.0 | GO:1990635 | proximal dendrite(GO:1990635) |
0.0 | 0.1 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.3 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.2 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.2 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.1 | GO:0033010 | paranodal junction(GO:0033010) |
0.0 | 0.3 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 0.2 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 0.0 | GO:0097441 | basilar dendrite(GO:0097441) |
0.0 | 0.0 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.1 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 0.1 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.4 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.1 | GO:0000243 | commitment complex(GO:0000243) |
0.0 | 0.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.0 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.0 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.3 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.6 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.0 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.0 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 0.4 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
0.0 | 0.0 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.0 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.6 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.2 | 0.8 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.2 | 0.6 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.2 | 0.5 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.2 | 0.5 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.2 | 0.5 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.1 | 0.7 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.4 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.1 | 0.5 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 0.4 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.1 | 0.5 | GO:0031014 | troponin T binding(GO:0031014) |
0.1 | 0.3 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.1 | 0.3 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.1 | 0.3 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 0.2 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.1 | 0.4 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.1 | 0.2 | GO:0035939 | microsatellite binding(GO:0035939) |
0.1 | 1.3 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.1 | 0.5 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.3 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 0.6 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.1 | 0.5 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.1 | 0.7 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.1 | 0.5 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.1 | 0.6 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.2 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.1 | 0.3 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.4 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.1 | 0.2 | GO:0089720 | caspase binding(GO:0089720) |
0.1 | 0.8 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.1 | 0.2 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 0.5 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.1 | 0.6 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.4 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.1 | 0.3 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 0.2 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.1 | 0.4 | GO:0048495 | Roundabout binding(GO:0048495) |
0.1 | 0.2 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.1 | 0.4 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 0.2 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.1 | 0.2 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.1 | 0.3 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.1 | 0.2 | GO:0051373 | FATZ binding(GO:0051373) |
0.1 | 0.2 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.1 | 1.5 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.1 | 0.4 | GO:0034526 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 0.2 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.1 | 0.2 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 0.2 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 0.7 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.1 | 0.2 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.4 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.0 | 0.4 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.0 | 0.2 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.2 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.2 | GO:0030911 | TPR domain binding(GO:0030911) |
0.0 | 0.4 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.1 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.0 | 0.0 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.0 | 0.3 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.7 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.0 | 0.2 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.0 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 0.2 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.5 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.4 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.2 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.7 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.6 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
0.0 | 0.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.2 | GO:0046790 | virion binding(GO:0046790) |
0.0 | 0.9 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.3 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.0 | 0.2 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.0 | 0.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.2 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.0 | 0.3 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.1 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.0 | 0.1 | GO:0042834 | peptidoglycan binding(GO:0042834) |
0.0 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.0 | 1.0 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.1 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.0 | 0.1 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.0 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.0 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.0 | 0.2 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 1.0 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.1 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.0 | 0.3 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.3 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.0 | 0.3 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.4 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.1 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.0 | 0.3 | GO:0008329 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.6 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
0.0 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.1 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.0 | 0.5 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 1.0 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.0 | 0.2 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.4 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.1 | GO:0022821 | potassium ion antiporter activity(GO:0022821) |
0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.2 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.2 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.0 | 0.3 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.3 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.0 | 0.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.0 | 0.0 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.0 | 0.6 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 1.0 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
0.0 | 0.2 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.1 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.1 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.1 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.0 | 0.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 0.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.0 | 0.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 0.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.0 | 0.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.0 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.1 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.0 | 0.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.3 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.4 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.4 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.4 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.0 | GO:0070697 | activin receptor binding(GO:0070697) |
0.0 | 0.1 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.1 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.0 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.0 | 0.2 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
0.0 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 0.0 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.0 | 0.1 | GO:0002054 | nucleobase binding(GO:0002054) |
0.0 | 0.0 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.0 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.1 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.0 | 0.1 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.0 | 0.2 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.1 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.3 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.2 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.0 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.0 | 0.0 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.0 | 0.4 | GO:0004120 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.0 | 0.2 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.1 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.0 | 0.1 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.2 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.1 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.0 | 0.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 1.9 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 1.6 | GO:0005178 | integrin binding(GO:0005178) |
0.0 | 0.1 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.0 | 0.2 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
0.0 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.0 | 0.2 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 0.2 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.0 | 0.1 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.0 | 0.2 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.0 | 0.1 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.1 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.0 | 0.0 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.0 | 0.1 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
0.0 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.1 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.0 | 0.1 | GO:0016936 | galactoside binding(GO:0016936) |
0.0 | 0.1 | GO:0018854 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.0 | GO:1990188 | euchromatin binding(GO:1990188) |
0.0 | 0.4 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.0 | GO:0048030 | disaccharide binding(GO:0048030) |
0.0 | 0.8 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.0 | 0.4 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 0.2 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.9 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.0 | 0.0 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.1 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.0 | 0.2 | GO:0034979 | NAD-dependent protein deacetylase activity(GO:0034979) |
0.0 | 0.0 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
0.0 | 0.2 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.0 | 0.2 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.3 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.0 | 0.1 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.0 | 0.3 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.0 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.0 | 0.1 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.0 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.2 | GO:0004601 | peroxidase activity(GO:0004601) |
0.0 | 0.2 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.0 | 0.0 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.4 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.1 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.1 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.0 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.1 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.0 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.0 | 0.0 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.0 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.1 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.0 | 0.2 | GO:0005542 | folic acid binding(GO:0005542) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.1 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 0.0 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.3 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.2 | GO:0043139 | 5'-3' DNA helicase activity(GO:0043139) |
0.0 | 0.0 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.0 | 0.1 | GO:0008200 | ion channel inhibitor activity(GO:0008200) |
0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.0 | 0.0 | GO:0030172 | troponin C binding(GO:0030172) |
0.0 | 0.5 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
0.0 | 0.0 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.0 | 0.1 | GO:0016803 | ether hydrolase activity(GO:0016803) |
0.0 | 0.0 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.0 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.0 | 0.0 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.1 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.0 | 0.0 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.0 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.0 | 0.0 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) sugar-phosphatase activity(GO:0050308) |
0.0 | 0.1 | GO:0050544 | arachidonic acid binding(GO:0050544) |
0.0 | 0.3 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
0.0 | 0.0 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.0 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.0 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.0 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.1 | GO:0071949 | FAD binding(GO:0071949) |
0.0 | 0.3 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
0.0 | 0.0 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.0 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.0 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.0 | 0.0 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.1 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.0 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.0 | GO:0018812 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 1.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 0.4 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.1 | 0.2 | ST STAT3 PATHWAY | STAT3 Pathway |
0.1 | 0.5 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.1 | 2.4 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.6 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 2.1 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 2.4 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.9 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.2 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 1.0 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.2 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.1 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.0 | 1.4 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.5 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.9 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 1.4 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.5 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.7 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.7 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 1.0 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 4.9 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.3 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.0 | 0.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.0 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.0 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.5 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 1.0 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.3 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.4 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.3 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.2 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.4 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.2 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 0.3 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.3 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 0.9 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.0 | 0.3 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.7 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.3 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.2 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.2 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 3.0 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.2 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 0.4 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.2 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.2 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.2 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.3 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.1 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.0 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.3 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.0 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.2 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.0 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.3 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.2 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 0.2 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.0 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.0 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.2 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.2 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.0 | PID S1P S1P1 PATHWAY | S1P1 pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.2 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.1 | 1.7 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 1.0 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.1 | 1.0 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.1 | 0.7 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.1 | 0.6 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 1.0 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.1 | 0.6 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 1.1 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.5 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.5 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.6 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.6 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.0 | 0.4 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 1.9 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.0 | 0.3 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 1.7 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 1.0 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 0.5 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 0.3 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.7 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 0.3 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.0 | 0.5 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.0 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.5 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.7 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.3 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.0 | 0.2 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.0 | 0.4 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.0 | 0.3 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 0.3 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.3 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.3 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 0.7 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.4 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.3 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.4 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.1 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
0.0 | 0.2 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.0 | 0.5 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 0.2 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.2 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.5 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.1 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 1.0 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.0 | 1.2 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.1 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.2 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.3 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.0 | 0.3 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.3 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.0 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.0 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
0.0 | 0.1 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.1 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.0 | 0.4 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.3 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 0.1 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.1 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.2 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.0 | 0.2 | REACTOME SIGNALING BY NOTCH1 | Genes involved in Signaling by NOTCH1 |
0.0 | 0.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 0.3 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.2 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.0 | 0.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.1 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.0 | 0.0 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 0.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.0 | 0.0 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.0 | 0.0 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.0 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
0.0 | 0.0 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.1 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.0 | 0.0 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |