Gene Symbol | Gene ID | Gene Info |
---|---|---|
Tcf7l1
|
ENSMUSG00000055799.7 | Tcf7l1 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Tcf7l1 | chr6_72787250_72787695 | 1126 | 0.473361 | 0.60 | 3.8e-07 | Click! |
Tcf7l1 | chr6_72676953_72678018 | 6081 | 0.114362 | 0.51 | 3.1e-05 | Click! |
Tcf7l1 | chr6_72678577_72678728 | 7248 | 0.111414 | 0.49 | 6.0e-05 | Click! |
Tcf7l1 | chr6_72795575_72795748 | 6407 | 0.182998 | 0.46 | 2.5e-04 | Click! |
Tcf7l1 | chr6_72678778_72678972 | 7471 | 0.111001 | 0.44 | 3.8e-04 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr3_83767702_83768200 | 2.77 |
Sfrp2 |
secreted frizzled-related protein 2 |
1098 |
0.49 |
chr1_162221739_162222251 | 2.41 |
Mir214 |
microRNA 214 |
1373 |
0.34 |
chr17_67949642_67951057 | 2.27 |
Arhgap28 |
Rho GTPase activating protein 28 |
591 |
0.83 |
chr8_92353342_92354327 | 2.24 |
Crnde |
colorectal neoplasia differentially expressed (non-protein coding) |
1930 |
0.3 |
chr3_81038821_81039521 | 2.20 |
Gm16000 |
predicted gene 16000 |
1266 |
0.36 |
chr13_53233948_53234299 | 2.06 |
Ror2 |
receptor tyrosine kinase-like orphan receptor 2 |
41535 |
0.18 |
chr12_27060576_27062882 | 2.06 |
Gm9866 |
predicted gene 9866 |
53266 |
0.17 |
chr13_113045737_113046449 | 1.99 |
Gpx8 |
glutathione peroxidase 8 (putative) |
300 |
0.78 |
chr4_108218802_108219449 | 1.96 |
Zyg11a |
zyg-11 family member A, cell cycle regulator |
1077 |
0.46 |
chr3_66977838_66980287 | 1.95 |
Shox2 |
short stature homeobox 2 |
251 |
0.9 |
chr1_168426195_168428871 | 1.90 |
Pbx1 |
pre B cell leukemia homeobox 1 |
3971 |
0.3 |
chr1_89991921_89993000 | 1.89 |
Asb18 |
ankyrin repeat and SOCS box-containing 18 |
3992 |
0.25 |
chr4_58547810_58548269 | 1.82 |
Lpar1 |
lysophosphatidic acid receptor 1 |
362 |
0.88 |
chr11_85893420_85894146 | 1.82 |
Tbx4 |
T-box 4 |
2982 |
0.23 |
chr11_108961665_108962161 | 1.81 |
Axin2 |
axin 2 |
18292 |
0.18 |
chr3_30008541_30009027 | 1.79 |
Mecom |
MDS1 and EVI1 complex locus |
2655 |
0.27 |
chr17_67995810_67996542 | 1.79 |
Arhgap28 |
Rho GTPase activating protein 28 |
7944 |
0.29 |
chr10_111335849_111336733 | 1.76 |
Gm40761 |
predicted gene, 40761 |
833 |
0.64 |
chr1_12577058_12577720 | 1.69 |
Gm2383 |
predicted gene 2383 |
11812 |
0.23 |
chr18_65583033_65584701 | 1.69 |
Zfp532 |
zinc finger protein 532 |
70 |
0.95 |
chr3_66977406_66977696 | 1.67 |
Shox2 |
short stature homeobox 2 |
896 |
0.56 |
chr18_80992032_80992813 | 1.64 |
Gm7503 |
predicted gene 7503 |
4961 |
0.14 |
chr14_122405563_122407290 | 1.64 |
Gm5089 |
predicted gene 5089 |
317 |
0.87 |
chr12_12581337_12581713 | 1.63 |
AC107703.1 |
novel transcript |
88392 |
0.08 |
chr2_18042311_18043883 | 1.63 |
Skida1 |
SKI/DACH domain containing 1 |
1475 |
0.25 |
chr2_70471639_70472718 | 1.62 |
Sp5 |
trans-acting transcription factor 5 |
2745 |
0.2 |
chr9_71894270_71894567 | 1.59 |
Tcf12 |
transcription factor 12 |
1567 |
0.26 |
chr10_61977984_61979348 | 1.58 |
Col13a1 |
collagen, type XIII, alpha 1 |
407 |
0.84 |
chr9_58112357_58112641 | 1.57 |
Ccdc33 |
coiled-coil domain containing 33 |
1861 |
0.24 |
chr13_55961047_55961307 | 1.55 |
Gm47071 |
predicted gene, 47071 |
41088 |
0.14 |
chr6_52233543_52234485 | 1.51 |
Hoxa10 |
homeobox A10 |
690 |
0.34 |
chr3_31097203_31098928 | 1.51 |
Skil |
SKI-like |
1232 |
0.48 |
chr8_90670264_90671001 | 1.48 |
Gm45639 |
predicted gene 45639 |
4326 |
0.23 |
chr7_107690409_107690593 | 1.48 |
Ppfibp2 |
PTPRF interacting protein, binding protein 2 (liprin beta 2) |
25190 |
0.14 |
chr11_120695675_120696313 | 1.47 |
Aspscr1 |
alveolar soft part sarcoma chromosome region, candidate 1 (human) |
6520 |
0.06 |
chr3_58158331_58159098 | 1.46 |
1700007F19Rik |
RIKEN cDNA 1700007F19 gene |
5093 |
0.2 |
chr6_51591921_51593175 | 1.46 |
Gm22914 |
predicted gene, 22914 |
29084 |
0.18 |
chr17_48431455_48432112 | 1.45 |
Apobec2 |
apolipoprotein B mRNA editing enzyme, catalytic polypeptide 2 |
835 |
0.47 |
chr9_107377664_107378199 | 1.43 |
Cacna2d2 |
calcium channel, voltage-dependent, alpha 2/delta subunit 2 |
21681 |
0.09 |
chr1_91351519_91351937 | 1.42 |
Klhl30 |
kelch-like 30 |
712 |
0.52 |
chr5_37826544_37829286 | 1.41 |
Msx1 |
msh homeobox 1 |
3332 |
0.25 |
chr2_169961241_169962453 | 1.40 |
AY702102 |
cDNA sequence AY702102 |
1140 |
0.63 |
chr9_76235972_76237521 | 1.40 |
Gfral |
GDNF family receptor alpha like |
23089 |
0.22 |
chr3_89337115_89337287 | 1.40 |
4731419I09Rik |
RIKEN cDNA 4731419I09 gene |
649 |
0.33 |
chr12_52745277_52746125 | 1.39 |
Gm47488 |
predicted gene, 47488 |
7407 |
0.25 |
chr3_19644566_19645227 | 1.39 |
Trim55 |
tripartite motif-containing 55 |
388 |
0.83 |
chr11_108923092_108924343 | 1.39 |
Axin2 |
axin 2 |
536 |
0.8 |
chr9_49206351_49206862 | 1.37 |
Gm4894 |
predicted gene 4894 |
43925 |
0.16 |
chr17_70847820_70848429 | 1.37 |
Tgif1 |
TGFB-induced factor homeobox 1 |
954 |
0.38 |
chr12_12581725_12581943 | 1.37 |
AC107703.1 |
novel transcript |
88083 |
0.08 |
chr10_29531790_29532289 | 1.36 |
Gm48159 |
predicted gene, 48159 |
2678 |
0.23 |
chr7_133185743_133186492 | 1.35 |
4930483O08Rik |
RIKEN cDNA 4930483O08 gene |
57866 |
0.1 |
chr3_5222045_5223052 | 1.34 |
Zfhx4 |
zinc finger homeodomain 4 |
1043 |
0.46 |
chr8_57333046_57334560 | 1.34 |
Gm34030 |
predicted gene, 34030 |
584 |
0.59 |
chr7_116037985_116038967 | 1.34 |
Sox6 |
SRY (sex determining region Y)-box 6 |
268 |
0.81 |
chr12_56718151_56718927 | 1.33 |
Pax9 |
paired box 9 |
22810 |
0.14 |
chr15_85207415_85208734 | 1.32 |
Fbln1 |
fibulin 1 |
2069 |
0.32 |
chr3_30007396_30007925 | 1.31 |
Mecom |
MDS1 and EVI1 complex locus |
3779 |
0.24 |
chr3_58333756_58334409 | 1.31 |
Gm43730 |
predicted gene 43730 |
18772 |
0.18 |
chr6_52241080_52241510 | 1.30 |
Hoxa10 |
homeobox A10 |
441 |
0.54 |
chr12_9577276_9578110 | 1.30 |
Osr1 |
odd-skipped related transcription factor 1 |
3252 |
0.23 |
chr11_57830920_57832176 | 1.30 |
Hand1 |
heart and neural crest derivatives expressed 1 |
599 |
0.69 |
chr8_88451041_88451845 | 1.30 |
Gm45497 |
predicted gene 45497 |
60322 |
0.11 |
chr18_65393472_65393826 | 1.29 |
Alpk2 |
alpha-kinase 2 |
245 |
0.87 |
chr9_60940402_60940694 | 1.27 |
Gm47923 |
predicted gene, 47923 |
21325 |
0.18 |
chr2_74660449_74661396 | 1.27 |
Evx2 |
even-skipped homeobox 2 |
1365 |
0.18 |
chr7_96645272_96646140 | 1.26 |
Tenm4 |
teneurin transmembrane protein 4 |
1534 |
0.45 |
chr19_8962149_8962300 | 1.25 |
Tut1 |
terminal uridylyl transferase 1, U6 snRNA-specific |
1620 |
0.16 |
chr12_107758591_107758804 | 1.24 |
4930465M20Rik |
RIKEN cDNA 4930465M20 gene |
23201 |
0.21 |
chr4_72204195_72205177 | 1.24 |
C630043F03Rik |
RIKEN cDNA C630043F03 gene |
3338 |
0.25 |
chr6_23382210_23383537 | 1.24 |
Cadps2 |
Ca2+-dependent activator protein for secretion 2 |
26954 |
0.22 |
chr4_139641708_139642637 | 1.23 |
Mir7020 |
microRNA 7020 |
1870 |
0.27 |
chr2_33714996_33715766 | 1.22 |
9430024E24Rik |
RIKEN cDNA 9430024E24 gene |
3518 |
0.24 |
chr2_170400566_170401621 | 1.22 |
Bcas1os1 |
breast carcinoma amplified sequence 1, opposite strand 1 |
4088 |
0.2 |
chr13_93687408_93687559 | 1.21 |
Dmgdh |
dimethylglycine dehydrogenase precursor |
13050 |
0.13 |
chr3_131738069_131738640 | 1.20 |
Gm29865 |
predicted gene, 29865 |
21451 |
0.25 |
chr4_86053372_86054934 | 1.20 |
Adamtsl1 |
ADAMTS-like 1 |
133 |
0.97 |
chr7_70329985_70330488 | 1.19 |
Gm29683 |
predicted gene, 29683 |
7586 |
0.13 |
chr5_113796469_113797793 | 1.19 |
Tmem119 |
transmembrane protein 119 |
3315 |
0.13 |
chr11_114639672_114640149 | 1.18 |
Gm11689 |
predicted gene 11689 |
24698 |
0.15 |
chr1_166282308_166283309 | 1.18 |
5330438I03Rik |
RIKEN cDNA 5330438I03 gene |
26777 |
0.14 |
chr5_74197172_74198949 | 1.18 |
Rasl11b |
RAS-like, family 11, member B |
169 |
0.94 |
chr8_102783050_102783452 | 1.18 |
Gm45258 |
predicted gene 45258 |
2209 |
0.27 |
chr18_75982438_75983235 | 1.17 |
1700003O11Rik |
RIKEN cDNA 1700003O11 gene |
32841 |
0.2 |
chr17_83352564_83353256 | 1.16 |
Eml4 |
echinoderm microtubule associated protein like 4 |
1695 |
0.45 |
chr2_83714472_83715111 | 1.16 |
Itgav |
integrin alpha V |
9606 |
0.15 |
chr13_21996613_21997784 | 1.15 |
Prss16 |
protease, serine 16 (thymus) |
8024 |
0.06 |
chr7_4516649_4516857 | 1.15 |
Tnnt1 |
troponin T1, skeletal, slow |
371 |
0.69 |
chr4_86911632_86912362 | 1.15 |
Acer2 |
alkaline ceramidase 2 |
18694 |
0.21 |
chrX_50633413_50633572 | 1.15 |
Firre |
functional intergenic repeating RNA element |
1574 |
0.52 |
chr13_63557270_63560459 | 1.14 |
Ptch1 |
patched 1 |
4951 |
0.16 |
chr15_83723881_83724305 | 1.14 |
Scube1 |
signal peptide, CUB domain, EGF-like 1 |
833 |
0.67 |
chr3_123233703_123235038 | 1.14 |
Synpo2 |
synaptopodin 2 |
1726 |
0.3 |
chr1_163358681_163359585 | 1.14 |
Gm24940 |
predicted gene, 24940 |
43150 |
0.12 |
chr2_30902041_30902192 | 1.14 |
Ptges |
prostaglandin E synthase |
328 |
0.84 |
chr10_22813360_22814229 | 1.14 |
Gm10824 |
predicted gene 10824 |
1955 |
0.28 |
chr12_73545089_73545329 | 1.13 |
Tmem30b |
transmembrane protein 30B |
1183 |
0.42 |
chr2_154950882_154951033 | 1.11 |
a |
nonagouti |
223 |
0.94 |
chr12_22029733_22030842 | 1.11 |
Gm22908 |
predicted gene, 22908 |
10626 |
0.28 |
chr11_119514733_119515649 | 1.10 |
Endov |
endonuclease V |
13213 |
0.13 |
chr2_51140113_51141649 | 1.10 |
Rnd3 |
Rho family GTPase 3 |
8213 |
0.26 |
chr14_32825387_32825835 | 1.10 |
Fam170b |
family with sequence similarity 170, member B |
8351 |
0.18 |
chr4_121230932_121231762 | 1.10 |
Gm12890 |
predicted gene 12890 |
3874 |
0.2 |
chr18_74431017_74431395 | 1.09 |
Myo5b |
myosin VB |
9730 |
0.17 |
chr1_183147252_183147892 | 1.09 |
Disp1 |
dispatched RND transporter family member 1 |
41 |
0.98 |
chr2_165899109_165899334 | 1.09 |
Zmynd8 |
zinc finger, MYND-type containing 8 |
205 |
0.91 |
chr16_22160432_22161001 | 1.08 |
Igf2bp2 |
insulin-like growth factor 2 mRNA binding protein 2 |
734 |
0.66 |
chr19_43387421_43387870 | 1.08 |
Hpse2 |
heparanase 2 |
609 |
0.73 |
chr14_20713816_20713967 | 1.08 |
Zswim8 |
zinc finger SWIM-type containing 8 |
1384 |
0.21 |
chr19_45270509_45270801 | 1.08 |
Gm28578 |
predicted gene 28578 |
32682 |
0.13 |
chr15_98001331_98003530 | 1.08 |
Col2a1 |
collagen, type II, alpha 1 |
543 |
0.74 |
chr12_40471563_40472715 | 1.08 |
Dock4 |
dedicator of cytokinesis 4 |
25803 |
0.2 |
chr10_50895645_50896998 | 1.07 |
Sim1 |
single-minded family bHLH transcription factor 1 |
670 |
0.79 |
chr4_138981021_138981387 | 1.07 |
Tmco4 |
transmembrane and coiled-coil domains 4 |
8295 |
0.16 |
chr4_126149981_126150132 | 1.07 |
Eva1b |
eva-1 homolog B (C. elegans) |
1524 |
0.24 |
chr7_70118110_70119248 | 1.06 |
Gm35325 |
predicted gene, 35325 |
88756 |
0.08 |
chr6_97311036_97312726 | 1.06 |
Frmd4b |
FERM domain containing 4B |
499 |
0.83 |
chr11_116242001_116242194 | 1.05 |
Evpl |
envoplakin |
4020 |
0.11 |
chr8_57313557_57314958 | 1.05 |
Hand2os1 |
Hand2, opposite strand 1 |
391 |
0.8 |
chr15_86875042_86876223 | 1.04 |
Gm49466 |
predicted gene, 49466 |
48450 |
0.14 |
chr3_66972322_66972982 | 1.04 |
Shox2 |
short stature homeobox 2 |
5795 |
0.18 |
chr10_39659521_39660014 | 1.04 |
2900078I11Rik |
RIKEN cDNA 2900078I11 gene |
1341 |
0.31 |
chr12_82122852_82123243 | 1.03 |
n-R5s62 |
nuclear encoded rRNA 5S 62 |
27421 |
0.18 |
chr8_126825863_126826208 | 1.03 |
A630001O12Rik |
RIKEN cDNA A630001O12 gene |
13198 |
0.21 |
chr3_107582504_107583767 | 1.02 |
Alx3 |
aristaless-like homeobox 3 |
11896 |
0.14 |
chr8_54078767_54079427 | 1.02 |
Vegfc |
vascular endothelial growth factor C |
1318 |
0.62 |
chr13_55837410_55837678 | 1.02 |
Pitx1 |
paired-like homeodomain transcription factor 1 |
1352 |
0.29 |
chr7_49522042_49523415 | 1.02 |
Nav2 |
neuron navigator 2 |
25464 |
0.21 |
chr19_34253411_34255499 | 1.02 |
Acta2 |
actin, alpha 2, smooth muscle, aorta |
225 |
0.92 |
chr6_64799057_64799968 | 1.02 |
Atoh1 |
atonal bHLH transcription factor 1 |
70387 |
0.11 |
chr3_130922899_130923995 | 1.01 |
Gm43349 |
predicted gene 43349 |
1390 |
0.29 |
chr13_53161014_53161165 | 1.01 |
Ror2 |
receptor tyrosine kinase-like orphan receptor 2 |
114569 |
0.06 |
chr1_78186833_78187893 | 1.00 |
Pax3 |
paired box 3 |
9475 |
0.23 |
chr13_58399497_58400209 | 1.00 |
Hnrnpk |
heterogeneous nuclear ribonucleoprotein K |
1412 |
0.27 |
chr2_172738845_172739767 | 1.00 |
Gm22773 |
predicted gene, 22773 |
125035 |
0.05 |
chr14_65091967_65092355 | 1.00 |
Extl3 |
exostosin-like glycosyltransferase 3 |
5944 |
0.22 |
chr3_131136488_131137676 | 1.00 |
Gm42449 |
predicted gene 42449 |
297 |
0.9 |
chr13_113879783_113881155 | 0.99 |
Arl15 |
ADP-ribosylation factor-like 15 |
85847 |
0.07 |
chr11_117462034_117462758 | 0.99 |
Gm34418 |
predicted gene, 34418 |
20201 |
0.13 |
chr12_23188694_23189971 | 0.99 |
Gm47385 |
predicted gene, 47385 |
66 |
0.96 |
chr5_63872176_63872327 | 0.99 |
0610040J01Rik |
RIKEN cDNA 0610040J01 gene |
4058 |
0.24 |
chr9_112118202_112119292 | 0.99 |
Mir128-2 |
microRNA 128-2 |
36 |
0.99 |
chr7_142553039_142553484 | 0.98 |
Nctc1 |
non-coding transcript 1 |
5335 |
0.11 |
chr16_21206453_21207154 | 0.98 |
Ephb3 |
Eph receptor B3 |
2048 |
0.28 |
chr6_148598605_148599513 | 0.98 |
Gm6313 |
predicted gene 6313 |
10674 |
0.2 |
chr13_56159603_56160215 | 0.98 |
Gm25148 |
predicted gene, 25148 |
7691 |
0.15 |
chr1_41274730_41275991 | 0.98 |
4930448I06Rik |
RIKEN cDNA 4930448I06 gene |
94108 |
0.09 |
chr6_16316653_16317675 | 0.98 |
Gm3148 |
predicted gene 3148 |
79537 |
0.1 |
chr14_27044544_27045365 | 0.98 |
Il17rd |
interleukin 17 receptor D |
5698 |
0.22 |
chr1_162209586_162210036 | 0.97 |
Dnm3os |
dynamin 3, opposite strand |
7812 |
0.17 |
chr8_114504562_114505288 | 0.97 |
Wwox |
WW domain-containing oxidoreductase |
56715 |
0.13 |
chr3_57912102_57912755 | 0.97 |
Gm24531 |
predicted gene, 24531 |
9759 |
0.16 |
chr13_60455009_60455742 | 0.96 |
Gm35333 |
predicted gene, 35333 |
20644 |
0.15 |
chr18_11049995_11051717 | 0.96 |
Gata6os |
GATA binding protein 6, opposite strand |
631 |
0.64 |
chr4_57569383_57569972 | 0.96 |
Pakap |
paralemmin A kinase anchor protein |
1347 |
0.55 |
chr11_5411797_5411948 | 0.96 |
Znrf3 |
zinc and ring finger 3 |
30132 |
0.16 |
chr11_104578496_104579513 | 0.96 |
Myl4 |
myosin, light polypeptide 4 |
1321 |
0.29 |
chr6_114918164_114918712 | 0.95 |
Vgll4 |
vestigial like family member 4 |
3378 |
0.29 |
chrX_81072516_81073729 | 0.95 |
Tmem47 |
transmembrane protein 47 |
2406 |
0.44 |
chr5_37895892_37896442 | 0.95 |
Gm20052 |
predicted gene, 20052 |
1460 |
0.47 |
chr18_20718515_20718666 | 0.95 |
B4galt6 |
UDP-Gal:betaGlcNAc beta 1,4-galactosyltransferase, polypeptide 6 |
27814 |
0.15 |
chr11_104318691_104319872 | 0.95 |
Mapt |
microtubule-associated protein tau |
1248 |
0.44 |
chr14_61056252_61057429 | 0.95 |
Gm41168 |
predicted gene, 41168 |
6587 |
0.22 |
chrX_106486432_106486627 | 0.95 |
Fndc3c1 |
fibronectin type III domain containing 3C1 |
1128 |
0.49 |
chr10_29533072_29533937 | 0.95 |
Gm48159 |
predicted gene, 48159 |
1213 |
0.41 |
chr13_21261031_21261182 | 0.94 |
Gpx5 |
glutathione peroxidase 5 |
31625 |
0.1 |
chr13_58450895_58451149 | 0.94 |
Gm47918 |
predicted gene, 47918 |
8001 |
0.16 |
chr2_165653526_165654033 | 0.94 |
Eya2 |
EYA transcriptional coactivator and phosphatase 2 |
1519 |
0.4 |
chr11_116418561_116418712 | 0.94 |
Rnf157 |
ring finger protein 157 |
5604 |
0.12 |
chr9_61445868_61446257 | 0.94 |
Gm34322 |
predicted gene, 34322 |
3471 |
0.23 |
chr2_127729042_127730365 | 0.94 |
Mall |
mal, T cell differentiation protein-like |
229 |
0.9 |
chr12_33966605_33968831 | 0.93 |
Twist1 |
twist basic helix-loop-helix transcription factor 1 |
10047 |
0.22 |
chr4_148867031_148867313 | 0.93 |
Casz1 |
castor zinc finger 1 |
22209 |
0.17 |
chr13_63241575_63242090 | 0.93 |
Aopep |
aminopeptidase O |
1724 |
0.2 |
chr5_140128978_140129129 | 0.93 |
Mad1l1 |
MAD1 mitotic arrest deficient 1-like 1 |
13587 |
0.15 |
chr9_108949763_108950025 | 0.93 |
Gm37284 |
predicted gene, 37284 |
647 |
0.46 |
chr11_97671303_97671454 | 0.93 |
Mllt6 |
myeloid/lymphoid or mixed-lineage leukemia; translocated to, 6 |
4674 |
0.09 |
chr2_93696696_93696847 | 0.92 |
Ext2 |
exostosin glycosyltransferase 2 |
7738 |
0.24 |
chr2_70443440_70444378 | 0.92 |
Rpl9-ps7 |
ribosomal protein L9, pseudogene 7 |
15073 |
0.16 |
chrX_134685068_134685790 | 0.92 |
B230119M05Rik |
RIKEN cDNA B230119M05 gene |
1033 |
0.28 |
chr13_15466077_15468087 | 0.92 |
Gli3 |
GLI-Kruppel family member GLI3 |
3102 |
0.22 |
chr6_91214897_91215048 | 0.92 |
Fbln2 |
fibulin 2 |
2141 |
0.24 |
chr7_38074216_38075175 | 0.92 |
Gm30684 |
predicted gene, 30684 |
12995 |
0.15 |
chr3_146939564_146940256 | 0.92 |
Ttll7 |
tubulin tyrosine ligase-like family, member 7 |
4010 |
0.3 |
chr10_125922070_125922221 | 0.92 |
Lrig3 |
leucine-rich repeats and immunoglobulin-like domains 3 |
44023 |
0.2 |
chr18_75372210_75374418 | 0.92 |
Smad7 |
SMAD family member 7 |
1600 |
0.41 |
chr1_186701083_186701809 | 0.92 |
Tgfb2 |
transforming growth factor, beta 2 |
2887 |
0.19 |
chr7_97804738_97804889 | 0.92 |
Pak1 |
p21 (RAC1) activated kinase 1 |
16272 |
0.19 |
chr18_82888592_82889295 | 0.91 |
Gm30889 |
predicted gene, 30889 |
13135 |
0.14 |
chr16_30242575_30242913 | 0.91 |
Gm49645 |
predicted gene, 49645 |
12408 |
0.14 |
chr12_86829544_86829695 | 0.91 |
Gm10095 |
predicted gene 10095 |
16848 |
0.18 |
chr13_53308848_53310270 | 0.91 |
Ror2 |
receptor tyrosine kinase-like orphan receptor 2 |
23435 |
0.2 |
chr11_5897192_5898699 | 0.91 |
Myl7 |
myosin, light polypeptide 7, regulatory |
837 |
0.46 |
chr5_92997077_92997228 | 0.91 |
Gm6450 |
predicted gene 6450 |
6679 |
0.16 |
chr13_95618922_95619073 | 0.91 |
F2r |
coagulation factor II (thrombin) receptor |
510 |
0.76 |
chr2_59599141_59599456 | 0.90 |
Tanc1 |
tetratricopeptide repeat, ankyrin repeat and coiled-coil containing 1 |
12744 |
0.23 |
chr8_10925988_10926640 | 0.90 |
3930402G23Rik |
RIKEN cDNA 3930402G23 gene |
2130 |
0.17 |
chr4_32530444_32532006 | 0.90 |
Bach2 |
BTB and CNC homology, basic leucine zipper transcription factor 2 |
29720 |
0.15 |
chr8_92761797_92762731 | 0.90 |
Gapdh-ps16 |
glyceraldehyde-3-phosphate dehydrogenase, pseudogene 16 |
45289 |
0.12 |
chr10_77165337_77166528 | 0.90 |
Col18a1 |
collagen, type XVIII, alpha 1 |
616 |
0.74 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 1.4 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.7 | 2.0 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
0.6 | 1.8 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
0.6 | 2.3 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.5 | 3.1 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.5 | 1.0 | GO:0070384 | Harderian gland development(GO:0070384) |
0.4 | 1.7 | GO:0003166 | bundle of His development(GO:0003166) |
0.4 | 1.3 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.4 | 1.2 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.4 | 1.5 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.4 | 2.2 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.4 | 1.1 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
0.3 | 1.4 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
0.3 | 1.0 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.3 | 0.9 | GO:0060594 | mammary gland specification(GO:0060594) |
0.3 | 0.9 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.3 | 1.2 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.3 | 1.1 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.3 | 0.8 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.3 | 0.8 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.3 | 0.8 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.2 | 0.7 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.2 | 0.5 | GO:0072277 | metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
0.2 | 0.7 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.2 | 0.5 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.2 | 0.7 | GO:0061004 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.2 | 0.7 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
0.2 | 0.5 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.2 | 0.5 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.2 | 2.6 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.2 | 1.2 | GO:0061551 | trigeminal ganglion development(GO:0061551) |
0.2 | 0.7 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.2 | 0.7 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
0.2 | 1.1 | GO:0014721 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
0.2 | 0.7 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.2 | 0.2 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.2 | 1.3 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.2 | 0.7 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.2 | 1.7 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.2 | 0.6 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.2 | 1.0 | GO:0014028 | notochord formation(GO:0014028) |
0.2 | 0.6 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.2 | 1.0 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.2 | 1.4 | GO:0060539 | diaphragm development(GO:0060539) |
0.2 | 1.8 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.2 | 0.6 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.2 | 0.6 | GO:0032439 | endosome localization(GO:0032439) |
0.2 | 0.2 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.2 | 0.8 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.2 | 0.2 | GO:0060435 | bronchiole development(GO:0060435) |
0.2 | 0.9 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.2 | 0.6 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.2 | 0.7 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.2 | 0.6 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.2 | 0.9 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.2 | 0.5 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.2 | 0.7 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
0.2 | 0.5 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.2 | 0.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.2 | 0.2 | GO:0035290 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
0.2 | 0.5 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.2 | 0.5 | GO:2001201 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.2 | 0.5 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.2 | 0.7 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.2 | 0.7 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.2 | 0.2 | GO:0010159 | specification of organ position(GO:0010159) |
0.2 | 0.9 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.2 | 0.7 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.2 | 0.2 | GO:0003164 | His-Purkinje system development(GO:0003164) |
0.2 | 0.5 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.2 | 0.6 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.2 | 0.3 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.2 | 0.5 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.2 | 1.4 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.2 | 0.5 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.2 | 0.2 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
0.2 | 3.4 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
0.2 | 0.2 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.2 | 0.6 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.2 | 0.9 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.1 | 0.4 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.1 | 0.7 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.4 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.1 | 0.3 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.1 | 0.7 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.1 | 0.9 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.1 | 0.1 | GO:1901166 | neural crest cell migration involved in autonomic nervous system development(GO:1901166) |
0.1 | 1.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.1 | 0.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 2.1 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.1 | 1.0 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.1 | 0.3 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.1 | 0.5 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.1 | 0.3 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.1 | 0.5 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
0.1 | 0.3 | GO:0061055 | myotome development(GO:0061055) |
0.1 | 0.4 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
0.1 | 0.7 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
0.1 | 0.1 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.1 | 0.4 | GO:0003192 | mitral valve formation(GO:0003192) |
0.1 | 0.3 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.1 | 0.3 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.1 | 0.1 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.1 | 0.1 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.1 | 0.7 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.1 | 0.1 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
0.1 | 0.7 | GO:0015671 | oxygen transport(GO:0015671) |
0.1 | 0.1 | GO:0003160 | endocardium morphogenesis(GO:0003160) |
0.1 | 0.4 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.1 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 0.4 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.1 | 0.4 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.1 | 0.2 | GO:0003190 | atrioventricular valve formation(GO:0003190) |
0.1 | 0.6 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.1 | 0.3 | GO:0003174 | mitral valve development(GO:0003174) mitral valve morphogenesis(GO:0003183) |
0.1 | 0.9 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.1 | 0.3 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
0.1 | 0.4 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 0.4 | GO:0018101 | protein citrullination(GO:0018101) |
0.1 | 0.3 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.1 | 0.2 | GO:0021550 | medulla oblongata development(GO:0021550) |
0.1 | 0.3 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.1 | 0.5 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.1 | 0.5 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.1 | 0.3 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.1 | 0.5 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.1 | 0.3 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.1 | 0.7 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.1 | 0.3 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.1 | 0.5 | GO:0048842 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
0.1 | 1.0 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
0.1 | 0.6 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.1 | 0.4 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.1 | 0.7 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.1 | 0.3 | GO:2000542 | negative regulation of gastrulation(GO:2000542) |
0.1 | 0.4 | GO:0003207 | cardiac chamber formation(GO:0003207) |
0.1 | 0.3 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.1 | 0.3 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
0.1 | 0.3 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.1 | 0.1 | GO:0003215 | cardiac right ventricle morphogenesis(GO:0003215) |
0.1 | 0.3 | GO:1904259 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
0.1 | 0.4 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.1 | 0.1 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.1 | 0.2 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
0.1 | 0.3 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.1 | 0.4 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.1 | 0.2 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.1 | 0.4 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.1 | 0.5 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.1 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.1 | 0.2 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
0.1 | 0.2 | GO:0060166 | olfactory pit development(GO:0060166) |
0.1 | 0.3 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.1 | 0.3 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.3 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.1 | 0.3 | GO:0015744 | succinate transport(GO:0015744) |
0.1 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.1 | 0.4 | GO:0032909 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
0.1 | 0.5 | GO:0030903 | notochord development(GO:0030903) |
0.1 | 0.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.1 | 0.4 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.1 | 0.2 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.1 | 0.4 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.1 | 0.2 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.1 | 0.5 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.1 | 0.3 | GO:0002606 | positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
0.1 | 0.2 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.1 | 0.2 | GO:0060534 | trachea cartilage development(GO:0060534) |
0.1 | 0.2 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.1 | 0.6 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.8 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.1 | 0.2 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.1 | 0.6 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
0.1 | 0.2 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.1 | 0.2 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.1 | 0.3 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.1 | 0.3 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.1 | 0.1 | GO:0061047 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.1 | 0.4 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
0.1 | 0.7 | GO:0048664 | neuron fate determination(GO:0048664) |
0.1 | 0.2 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.1 | 0.2 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.1 | 0.2 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.1 | 0.2 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.1 | 0.3 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.1 | 0.4 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.1 | 0.2 | GO:0060850 | regulation of transcription involved in cell fate commitment(GO:0060850) |
0.1 | 0.2 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.1 | 0.2 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.1 | 0.1 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.1 | 0.3 | GO:2000347 | positive regulation of hepatocyte proliferation(GO:2000347) |
0.1 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 0.4 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 0.1 | GO:1904238 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) pericyte cell differentiation(GO:1904238) |
0.1 | 0.9 | GO:0016556 | mRNA modification(GO:0016556) |
0.1 | 0.1 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.1 | 0.2 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.1 | 0.1 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.1 | 1.6 | GO:0055010 | ventricular cardiac muscle tissue morphogenesis(GO:0055010) |
0.1 | 0.3 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.1 | 0.1 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.1 | 0.2 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.1 | 0.2 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.1 | 0.1 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.1 | 0.3 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.1 | 0.2 | GO:0030049 | muscle filament sliding(GO:0030049) |
0.1 | 0.1 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.1 | 0.2 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.1 | 0.2 | GO:0032348 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.1 | 0.3 | GO:0021569 | rhombomere 3 development(GO:0021569) |
0.1 | 0.2 | GO:0060482 | lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
0.1 | 0.1 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.1 | 0.1 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
0.1 | 0.7 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
0.1 | 0.1 | GO:0002604 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) |
0.1 | 0.3 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.1 | 0.3 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
0.1 | 0.3 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
0.1 | 0.2 | GO:0044805 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.1 | 0.1 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
0.1 | 0.2 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.1 | 0.3 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.1 | 0.2 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.1 | 0.2 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.1 | 0.4 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.1 | 0.2 | GO:0072497 | mesenchymal stem cell differentiation(GO:0072497) |
0.1 | 1.0 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.7 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.1 | 0.2 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.1 | 0.4 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.1 | 0.2 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.1 | 0.2 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) |
0.1 | 0.1 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.1 | 0.1 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.1 | 0.2 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.1 | 0.1 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
0.1 | 0.2 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.1 | 0.3 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
0.1 | 0.1 | GO:0050713 | negative regulation of interleukin-1 beta secretion(GO:0050713) |
0.1 | 0.4 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.1 | 0.2 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
0.1 | 0.6 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 0.8 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.1 | 0.4 | GO:0060914 | heart formation(GO:0060914) |
0.1 | 0.5 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.1 | 0.6 | GO:0060384 | innervation(GO:0060384) |
0.1 | 0.2 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
0.1 | 0.1 | GO:0006808 | regulation of nitrogen utilization(GO:0006808) |
0.1 | 0.8 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
0.1 | 0.2 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.1 | 0.1 | GO:0010536 | positive regulation of activation of JAK2 kinase activity(GO:0010535) positive regulation of activation of Janus kinase activity(GO:0010536) |
0.1 | 0.6 | GO:0031268 | pseudopodium organization(GO:0031268) |
0.1 | 0.1 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.1 | 0.5 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.1 | 0.1 | GO:1901213 | regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901213) |
0.1 | 0.2 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.1 | 0.2 | GO:0046697 | decidualization(GO:0046697) |
0.1 | 0.2 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.1 | 0.1 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.1 | 0.3 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.1 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.1 | 0.3 | GO:0006116 | NADH oxidation(GO:0006116) |
0.1 | 0.2 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.1 | 0.2 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
0.1 | 0.2 | GO:0007412 | axon target recognition(GO:0007412) |
0.1 | 0.5 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
0.1 | 0.2 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.1 | 0.4 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
0.1 | 0.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.2 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.1 | 0.4 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.1 | 0.1 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.1 | 0.1 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.1 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.1 | 0.9 | GO:0014829 | vascular smooth muscle contraction(GO:0014829) |
0.1 | 0.3 | GO:0097264 | self proteolysis(GO:0097264) |
0.1 | 0.1 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.1 | 0.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.3 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
0.1 | 0.1 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.1 | 0.3 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
0.1 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.1 | 0.1 | GO:0014029 | neural crest formation(GO:0014029) |
0.1 | 0.2 | GO:0031017 | exocrine pancreas development(GO:0031017) |
0.1 | 0.2 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.1 | 0.2 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
0.0 | 0.4 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.2 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.0 | 0.1 | GO:0071415 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.0 | 1.4 | GO:0060612 | adipose tissue development(GO:0060612) |
0.0 | 0.3 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 0.2 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.0 | 0.0 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.0 | 0.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.0 | 0.4 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.2 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.0 | 0.1 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.0 | 0.1 | GO:0003163 | sinoatrial node development(GO:0003163) |
0.0 | 0.1 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.0 | 0.1 | GO:0060526 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
0.0 | 0.0 | GO:0042322 | negative regulation of circadian sleep/wake cycle, REM sleep(GO:0042322) |
0.0 | 0.2 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.0 | 0.3 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.4 | GO:0010880 | regulation of release of sequestered calcium ion into cytosol by sarcoplasmic reticulum(GO:0010880) |
0.0 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.8 | GO:0046457 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
0.0 | 0.0 | GO:0001710 | mesodermal cell fate commitment(GO:0001710) |
0.0 | 0.0 | GO:0043587 | tongue morphogenesis(GO:0043587) |
0.0 | 0.0 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.2 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
0.0 | 0.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 0.1 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
0.0 | 0.1 | GO:0090042 | tubulin deacetylation(GO:0090042) |
0.0 | 0.1 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.0 | 0.0 | GO:0009757 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.0 | 0.3 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.1 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.2 | GO:0098911 | regulation of ventricular cardiac muscle cell action potential(GO:0098911) |
0.0 | 0.0 | GO:0051794 | regulation of catagen(GO:0051794) |
0.0 | 0.6 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.0 | 0.0 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.0 | 0.1 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.3 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.0 | 0.1 | GO:1902075 | cellular response to salt(GO:1902075) |
0.0 | 0.5 | GO:0055013 | cardiac muscle cell development(GO:0055013) |
0.0 | 0.2 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.1 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.0 | 0.0 | GO:0002432 | granuloma formation(GO:0002432) |
0.0 | 0.1 | GO:0006868 | glutamine transport(GO:0006868) |
0.0 | 0.2 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.0 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.1 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.0 | 0.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.0 | 0.2 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.0 | 0.1 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
0.0 | 0.3 | GO:0051307 | meiotic chromosome separation(GO:0051307) |
0.0 | 0.2 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
0.0 | 0.1 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.0 | 0.6 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.2 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.0 | 0.1 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.0 | 0.0 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.0 | 0.1 | GO:0009212 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
0.0 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.2 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.0 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
0.0 | 0.0 | GO:0060027 | convergent extension involved in gastrulation(GO:0060027) |
0.0 | 0.3 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
0.0 | 0.1 | GO:0070295 | renal water absorption(GO:0070295) |
0.0 | 0.1 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.0 | 0.0 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
0.0 | 0.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.1 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.0 | 0.1 | GO:0033504 | floor plate development(GO:0033504) |
0.0 | 0.0 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.0 | 0.0 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.0 | 0.4 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.0 | 0.0 | GO:2000909 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
0.0 | 0.5 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
0.0 | 0.2 | GO:0006692 | prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
0.0 | 0.1 | GO:0032415 | regulation of sodium:proton antiporter activity(GO:0032415) |
0.0 | 0.3 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.0 | 0.1 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.0 | 0.2 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.0 | 0.1 | GO:0072396 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) |
0.0 | 0.3 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.0 | 0.2 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.3 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.0 | 0.0 | GO:0003383 | apical constriction(GO:0003383) |
0.0 | 0.1 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.0 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.0 | 0.5 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
0.0 | 0.1 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.0 | 0.1 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.0 | 1.1 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) |
0.0 | 0.1 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.0 | 0.1 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
0.0 | 0.0 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.0 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.0 | 0.2 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
0.0 | 0.2 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.0 | 0.1 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.0 | 0.1 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.0 | 0.0 | GO:0070099 | regulation of chemokine-mediated signaling pathway(GO:0070099) |
0.0 | 0.1 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.0 | 0.1 | GO:0060900 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) embryonic camera-type eye formation(GO:0060900) |
0.0 | 0.2 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.0 | 0.4 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
0.0 | 0.1 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
0.0 | 0.3 | GO:0044793 | negative regulation by host of viral process(GO:0044793) |
0.0 | 0.0 | GO:0009174 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.0 | 0.1 | GO:0022038 | corpus callosum development(GO:0022038) |
0.0 | 0.1 | GO:0000087 | mitotic M phase(GO:0000087) |
0.0 | 0.1 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
0.0 | 0.2 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
0.0 | 0.3 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.3 | GO:0001865 | NK T cell differentiation(GO:0001865) |
0.0 | 0.9 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
0.0 | 0.1 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.0 | 0.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.0 | 0.8 | GO:0010761 | fibroblast migration(GO:0010761) |
0.0 | 0.6 | GO:2000279 | negative regulation of DNA biosynthetic process(GO:2000279) |
0.0 | 0.3 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.0 | 0.2 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.0 | 0.3 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.0 | 0.0 | GO:0010002 | cardioblast differentiation(GO:0010002) |
0.0 | 0.1 | GO:0001807 | regulation of type IV hypersensitivity(GO:0001807) |
0.0 | 0.0 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.0 | 0.1 | GO:0031033 | myosin filament organization(GO:0031033) |
0.0 | 0.0 | GO:0010979 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
0.0 | 0.0 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.0 | 0.6 | GO:0046677 | response to antibiotic(GO:0046677) |
0.0 | 0.3 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.0 | 0.1 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.0 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.1 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.0 | 0.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.2 | GO:1903817 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
0.0 | 0.0 | GO:0035789 | cell migration involved in kidney development(GO:0035787) cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) regulation of metanephric mesenchymal cell migration(GO:2000589) |
0.0 | 0.1 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.0 | 0.1 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
0.0 | 0.0 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
0.0 | 0.1 | GO:1903053 | regulation of extracellular matrix organization(GO:1903053) |
0.0 | 0.1 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.0 | 0.0 | GO:1903911 | positive regulation of receptor clustering(GO:1903911) |
0.0 | 0.2 | GO:0048484 | enteric nervous system development(GO:0048484) |
0.0 | 0.1 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.0 | 0.2 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
0.0 | 0.1 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.2 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.0 | 0.1 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.0 | 0.0 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.0 | 0.0 | GO:2000619 | negative regulation of histone H4-K16 acetylation(GO:2000619) |
0.0 | 0.1 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.0 | 0.3 | GO:0000737 | DNA catabolic process, endonucleolytic(GO:0000737) |
0.0 | 0.3 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.0 | 0.1 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
0.0 | 0.1 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.0 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.3 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.0 | 0.1 | GO:0060177 | regulation of angiotensin levels in blood(GO:0002002) regulation of angiotensin metabolic process(GO:0060177) |
0.0 | 0.1 | GO:0052042 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
0.0 | 0.3 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.3 | GO:0035329 | hippo signaling(GO:0035329) |
0.0 | 0.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.0 | 0.2 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.2 | GO:1902166 | regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902165) negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
0.0 | 0.0 | GO:0042637 | catagen(GO:0042637) |
0.0 | 0.3 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.1 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.0 | 0.2 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.0 | 0.1 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.0 | 0.2 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.0 | 0.0 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.0 | 0.0 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.0 | 0.0 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
0.0 | 0.1 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.0 | 0.4 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.0 | 0.2 | GO:0002585 | positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
0.0 | 0.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.0 | 0.0 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
0.0 | 0.3 | GO:0060135 | maternal process involved in female pregnancy(GO:0060135) |
0.0 | 0.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.0 | 0.0 | GO:0033080 | immature T cell proliferation in thymus(GO:0033080) regulation of immature T cell proliferation in thymus(GO:0033084) |
0.0 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.0 | 0.1 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.0 | 0.2 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.0 | 0.1 | GO:0032252 | secretory granule localization(GO:0032252) |
0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.1 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.0 | 0.1 | GO:2000553 | positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.0 | 0.1 | GO:0043366 | beta selection(GO:0043366) |
0.0 | 0.1 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
0.0 | 0.0 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.0 | 0.1 | GO:0032811 | regulation of epinephrine secretion(GO:0014060) negative regulation of epinephrine secretion(GO:0032811) |
0.0 | 0.1 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.0 | 0.1 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.0 | 0.6 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
0.0 | 0.2 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.0 | 0.0 | GO:0045683 | negative regulation of epidermis development(GO:0045683) |
0.0 | 1.4 | GO:0035108 | appendage morphogenesis(GO:0035107) limb morphogenesis(GO:0035108) |
0.0 | 0.0 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.0 | 0.0 | GO:0015817 | histidine transport(GO:0015817) |
0.0 | 0.1 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.0 | 0.1 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.0 | 0.1 | GO:0070842 | aggresome assembly(GO:0070842) |
0.0 | 0.1 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.0 | 0.1 | GO:1903333 | negative regulation of protein folding(GO:1903333) |
0.0 | 0.0 | GO:0010882 | regulation of cardiac muscle contraction by calcium ion signaling(GO:0010882) |
0.0 | 0.1 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.0 | 0.2 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
0.0 | 0.2 | GO:0042983 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
0.0 | 0.1 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.0 | 0.1 | GO:0018158 | protein oxidation(GO:0018158) |
0.0 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.1 | GO:0061525 | hindgut development(GO:0061525) |
0.0 | 0.0 | GO:0072148 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) epithelial cell fate commitment(GO:0072148) |
0.0 | 0.1 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
0.0 | 0.0 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
0.0 | 0.1 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.0 | 0.2 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.0 | 0.0 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.0 | 0.1 | GO:0051451 | myoblast migration(GO:0051451) |
0.0 | 0.0 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.0 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.0 | 0.1 | GO:0070296 | sarcoplasmic reticulum calcium ion transport(GO:0070296) |
0.0 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.0 | GO:0072695 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
0.0 | 0.1 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.0 | 0.0 | GO:0072710 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
0.0 | 0.1 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
0.0 | 0.2 | GO:0060307 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
0.0 | 0.1 | GO:0015888 | thiamine transport(GO:0015888) |
0.0 | 0.0 | GO:0034214 | protein hexamerization(GO:0034214) |
0.0 | 0.1 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.0 | 0.0 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
0.0 | 0.1 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.0 | 0.1 | GO:0007097 | nuclear migration(GO:0007097) |
0.0 | 0.1 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.1 | GO:0051026 | chiasma assembly(GO:0051026) |
0.0 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.0 | 0.0 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.0 | 0.1 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.0 | 0.0 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.0 | 0.1 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.0 | 0.0 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.0 | 0.4 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
0.0 | 0.1 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.1 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.0 | 0.0 | GO:0035697 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) |
0.0 | 0.0 | GO:0061038 | uterus morphogenesis(GO:0061038) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.1 | GO:0030432 | peristalsis(GO:0030432) |
0.0 | 0.0 | GO:0032075 | positive regulation of nuclease activity(GO:0032075) |
0.0 | 0.1 | GO:0043307 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
0.0 | 0.1 | GO:1901550 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.0 | GO:0072193 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) kidney smooth muscle tissue development(GO:0072194) |
0.0 | 0.3 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.1 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.0 | 0.1 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.0 | 0.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.0 | 0.0 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.0 | 0.0 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.0 | 0.1 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.0 | 0.1 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.1 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
0.0 | 0.2 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.0 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.0 | 0.3 | GO:0006071 | glycerol metabolic process(GO:0006071) |
0.0 | 0.2 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.1 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.0 | 0.2 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.1 | GO:1904738 | vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) |
0.0 | 0.1 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.0 | 0.0 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.0 | 0.0 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.0 | 0.0 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.0 | 0.1 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.0 | 0.0 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.2 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.0 | GO:0033275 | actin-myosin filament sliding(GO:0033275) |
0.0 | 0.1 | GO:0051775 | response to redox state(GO:0051775) |
0.0 | 0.1 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
0.0 | 0.1 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.0 | 0.1 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.0 | 0.0 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.0 | 0.0 | GO:0090427 | activation of meiosis(GO:0090427) |
0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.1 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.0 | 0.1 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.0 | 0.1 | GO:0036303 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
0.0 | 0.1 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.4 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.0 | 0.2 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
0.0 | 0.1 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
0.0 | 0.0 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.0 | 0.3 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
0.0 | 0.0 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.0 | 0.1 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.0 | 0.2 | GO:0032329 | serine transport(GO:0032329) |
0.0 | 0.0 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.0 | 0.0 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.0 | 0.0 | GO:0075136 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.0 | 0.3 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.0 | 0.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.3 | GO:0050654 | chondroitin sulfate proteoglycan metabolic process(GO:0050654) |
0.0 | 0.1 | GO:0021513 | spinal cord dorsal/ventral patterning(GO:0021513) |
0.0 | 0.0 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.0 | 0.0 | GO:0019054 | modulation by virus of host process(GO:0019054) |
0.0 | 0.0 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.0 | 0.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.0 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.0 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
0.0 | 0.0 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.0 | 0.0 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
0.0 | 0.1 | GO:0060412 | ventricular septum morphogenesis(GO:0060412) |
0.0 | 0.2 | GO:0001967 | suckling behavior(GO:0001967) |
0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.1 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.2 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.0 | 0.2 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.1 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.1 | GO:0001803 | type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
0.0 | 0.2 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
0.0 | 0.0 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.0 | 0.2 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
0.0 | 0.1 | GO:0048311 | mitochondrion distribution(GO:0048311) |
0.0 | 0.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.1 | GO:0090103 | cochlea morphogenesis(GO:0090103) |
0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.0 | 0.0 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.0 | 0.0 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.0 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
0.0 | 0.0 | GO:1905208 | negative regulation of cardiocyte differentiation(GO:1905208) negative regulation of cardiac muscle cell differentiation(GO:2000726) |
0.0 | 0.0 | GO:0032096 | negative regulation of response to food(GO:0032096) |
0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.0 | 0.0 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
0.0 | 0.1 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
0.0 | 0.1 | GO:0021544 | subpallium development(GO:0021544) |
0.0 | 0.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.0 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
0.0 | 0.1 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
0.0 | 0.0 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
0.0 | 0.1 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
0.0 | 0.0 | GO:1901723 | negative regulation of cell proliferation involved in kidney development(GO:1901723) |
0.0 | 0.1 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.0 | 0.0 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.0 | 0.3 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.0 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.0 | 0.1 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.0 | 0.2 | GO:0051084 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
0.0 | 0.0 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
0.0 | 0.0 | GO:0070092 | regulation of glucagon secretion(GO:0070092) |
0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.0 | 0.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.0 | 0.0 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.0 | 0.1 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.0 | 0.1 | GO:0046836 | glycolipid transport(GO:0046836) |
0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.2 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.0 | 0.0 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
0.0 | 0.1 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.0 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.0 | 0.1 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 0.0 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.0 | 0.0 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.1 | GO:0070841 | inclusion body assembly(GO:0070841) |
0.0 | 0.0 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.0 | 0.2 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
0.0 | 0.0 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
0.0 | 0.1 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.0 | 0.3 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
0.0 | 0.1 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.0 | 0.0 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.0 | GO:0036258 | multivesicular body assembly(GO:0036258) |
0.0 | 0.0 | GO:0045023 | G0 to G1 transition(GO:0045023) regulation of G0 to G1 transition(GO:0070316) |
0.0 | 0.1 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.0 | 0.2 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
0.0 | 0.1 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
0.0 | 0.0 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.0 | GO:0032462 | regulation of protein homooligomerization(GO:0032462) |
0.0 | 0.1 | GO:0003416 | endochondral bone growth(GO:0003416) |
0.0 | 0.0 | GO:0014874 | response to stimulus involved in regulation of muscle adaptation(GO:0014874) |
0.0 | 0.1 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
0.0 | 0.1 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.0 | 0.1 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
0.0 | 0.1 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.0 | 0.1 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.1 | GO:0090383 | phagosome acidification(GO:0090383) |
0.0 | 0.1 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.0 | 0.1 | GO:0071569 | protein ufmylation(GO:0071569) |
0.0 | 0.1 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.1 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 0.0 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
0.0 | 0.1 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.0 | 0.1 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.0 | 0.1 | GO:0060179 | male mating behavior(GO:0060179) |
0.0 | 0.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.0 | 0.0 | GO:2000644 | low-density lipoprotein particle receptor catabolic process(GO:0032802) regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) regulation of receptor catabolic process(GO:2000644) |
0.0 | 0.0 | GO:0070305 | response to cGMP(GO:0070305) |
0.0 | 0.0 | GO:0014900 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.0 | 0.1 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.0 | 0.0 | GO:1902415 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
0.0 | 0.1 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.0 | 0.0 | GO:0002580 | regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) |
0.0 | 0.1 | GO:0046886 | positive regulation of hormone biosynthetic process(GO:0046886) |
0.0 | 0.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.0 | 0.0 | GO:0090399 | replicative senescence(GO:0090399) |
0.0 | 0.0 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 0.2 | GO:0032410 | negative regulation of transporter activity(GO:0032410) |
0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.0 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.1 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.0 | 0.0 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.0 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.0 | 0.1 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.0 | GO:0002086 | diaphragm contraction(GO:0002086) |
0.0 | 0.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.0 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
0.0 | 0.2 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.0 | 0.1 | GO:0007350 | blastoderm segmentation(GO:0007350) |
0.0 | 0.1 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.0 | 0.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 0.0 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.0 | 0.0 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.1 | GO:0032964 | collagen biosynthetic process(GO:0032964) |
0.0 | 0.0 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
0.0 | 0.0 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.0 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.0 | GO:0008355 | olfactory learning(GO:0008355) |
0.0 | 0.0 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.0 | 0.1 | GO:0060444 | branching involved in mammary gland duct morphogenesis(GO:0060444) |
0.0 | 0.0 | GO:0070428 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
0.0 | 0.0 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.0 | 0.0 | GO:0033483 | gas homeostasis(GO:0033483) |
0.0 | 0.0 | GO:0007228 | signal transduction downstream of smoothened(GO:0007227) positive regulation of hh target transcription factor activity(GO:0007228) |
0.0 | 0.0 | GO:0030825 | positive regulation of cGMP metabolic process(GO:0030825) |
0.0 | 0.0 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.0 | 0.0 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.0 | 0.0 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.0 | 0.1 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.0 | 0.0 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.0 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.0 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.0 | 0.0 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
0.0 | 0.0 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.0 | 0.1 | GO:0042711 | maternal behavior(GO:0042711) |
0.0 | 0.0 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.0 | 0.3 | GO:0015914 | phospholipid transport(GO:0015914) |
0.0 | 0.0 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.0 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.0 | 0.0 | GO:0035994 | response to muscle stretch(GO:0035994) |
0.0 | 0.0 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.0 | 0.1 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.0 | 0.0 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.3 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.0 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.0 | 0.0 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.0 | 0.0 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
0.0 | 0.1 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.0 | 0.0 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.0 | 0.0 | GO:0035112 | genitalia morphogenesis(GO:0035112) |
0.0 | 0.1 | GO:0006356 | regulation of transcription from RNA polymerase I promoter(GO:0006356) |
0.0 | 0.0 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
0.0 | 0.0 | GO:0051573 | negative regulation of histone H3-K9 methylation(GO:0051573) |
0.0 | 0.0 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.0 | 0.0 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.3 | GO:0009395 | phospholipid catabolic process(GO:0009395) |
0.0 | 0.1 | GO:0032506 | cytokinetic process(GO:0032506) |
0.0 | 0.1 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.0 | GO:0048291 | isotype switching to IgG isotypes(GO:0048291) regulation of isotype switching to IgG isotypes(GO:0048302) |
0.0 | 0.0 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.1 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.0 | 0.0 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
0.0 | 0.2 | GO:0007569 | cell aging(GO:0007569) |
0.0 | 0.2 | GO:0007602 | phototransduction(GO:0007602) |
0.0 | 0.1 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.1 | GO:0070633 | transepithelial transport(GO:0070633) |
0.0 | 0.0 | GO:0034650 | cortisol metabolic process(GO:0034650) |
0.0 | 0.0 | GO:0045410 | positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
0.0 | 0.0 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.0 | 0.0 | GO:0032799 | low-density lipoprotein receptor particle metabolic process(GO:0032799) |
0.0 | 0.0 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.0 | 0.4 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
0.0 | 0.3 | GO:0007129 | synapsis(GO:0007129) |
0.0 | 0.1 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.2 | 1.2 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.2 | 0.6 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.2 | 0.6 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.2 | 1.4 | GO:0005861 | troponin complex(GO:0005861) |
0.2 | 1.9 | GO:0005916 | fascia adherens(GO:0005916) |
0.2 | 0.5 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.2 | 1.8 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 0.4 | GO:0035838 | growing cell tip(GO:0035838) |
0.1 | 0.4 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 0.6 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.1 | 0.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 0.3 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 0.4 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.1 | 0.5 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.1 | 0.4 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.1 | 0.3 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.4 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.4 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.3 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.7 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.3 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 0.5 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
0.1 | 0.3 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 0.2 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.1 | 0.3 | GO:0071953 | elastic fiber(GO:0071953) |
0.1 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.8 | GO:0001527 | microfibril(GO:0001527) |
0.1 | 0.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.6 | GO:0045179 | apical cortex(GO:0045179) |
0.1 | 0.2 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.6 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.1 | 0.2 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 0.3 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 0.6 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 0.4 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 0.2 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.1 | 0.3 | GO:0097452 | GAIT complex(GO:0097452) |
0.1 | 3.5 | GO:0016459 | myosin complex(GO:0016459) |
0.1 | 0.3 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.1 | 0.2 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.1 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.1 | 0.5 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.1 | 0.2 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.1 | 0.5 | GO:0036128 | CatSper complex(GO:0036128) |
0.1 | 0.2 | GO:0035339 | SPOTS complex(GO:0035339) |
0.1 | 0.2 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.3 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.1 | 0.6 | GO:0031512 | motile primary cilium(GO:0031512) |
0.1 | 0.5 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.7 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 0.7 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.1 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
0.0 | 1.5 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.9 | GO:0043218 | compact myelin(GO:0043218) |
0.0 | 3.1 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.2 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.0 | 0.1 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.0 | 0.2 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.0 | 0.3 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.0 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.0 | GO:0072588 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
0.0 | 0.3 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.0 | 0.3 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.1 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.0 | 0.5 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.4 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.2 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.3 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.0 | 0.2 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.2 | GO:0045180 | basal cortex(GO:0045180) |
0.0 | 0.1 | GO:1990423 | RZZ complex(GO:1990423) |
0.0 | 0.0 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.0 | 0.8 | GO:0090568 | nuclear transcriptional repressor complex(GO:0090568) |
0.0 | 0.9 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.0 | 0.2 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.1 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.0 | 0.1 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.1 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.5 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 1.0 | GO:0014704 | intercalated disc(GO:0014704) |
0.0 | 0.6 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
0.0 | 0.4 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.5 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.5 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.3 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.2 | GO:0001939 | female pronucleus(GO:0001939) |
0.0 | 0.1 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
0.0 | 0.2 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.0 | 0.4 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.0 | 0.3 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.1 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 0.4 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.1 | GO:0043203 | axon hillock(GO:0043203) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.0 | 8.2 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.2 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.1 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.1 | GO:0032010 | phagolysosome(GO:0032010) |
0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.3 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.0 | 0.5 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.1 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 0.4 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.1 | GO:0042827 | platelet dense granule(GO:0042827) |
0.0 | 0.4 | GO:0051233 | spindle midzone(GO:0051233) |
0.0 | 0.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.0 | 6.1 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.2 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.2 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.1 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.0 | 0.1 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.1 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.1 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 0.1 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.3 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.1 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.4 | GO:0060170 | ciliary membrane(GO:0060170) |
0.0 | 0.0 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.1 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 0.2 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.0 | 0.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.0 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.0 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.2 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.0 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.0 | 0.0 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.0 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.0 | 0.0 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.4 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 0.4 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.0 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.0 | 0.1 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.0 | 0.1 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.1 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.0 | 0.3 | GO:0030686 | 90S preribosome(GO:0030686) |
0.0 | 0.4 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 0.0 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.1 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.0 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.4 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.0 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.0 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.0 | 0.0 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.6 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.6 | GO:0036126 | sperm flagellum(GO:0036126) |
0.0 | 0.0 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.0 | 0.0 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.0 | 0.1 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 0.0 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.0 | 0.3 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.0 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.0 | 0.1 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.1 | GO:0036379 | myofilament(GO:0036379) |
0.0 | 0.2 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.0 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.0 | 0.0 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.0 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
0.0 | 0.4 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.0 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.4 | 1.1 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.4 | 1.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.3 | 1.0 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.3 | 1.7 | GO:0071253 | connexin binding(GO:0071253) |
0.3 | 0.6 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.3 | 1.1 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.2 | 0.7 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.2 | 0.7 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.2 | 1.0 | GO:0031014 | troponin T binding(GO:0031014) |
0.2 | 0.7 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.2 | 0.7 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.2 | 0.7 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.2 | 1.3 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.2 | 1.3 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.2 | 2.4 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.2 | 0.6 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.2 | 1.5 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.2 | 0.6 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.2 | 0.8 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.2 | 0.6 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.2 | 0.5 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.2 | 2.1 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.2 | 0.9 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.2 | 2.6 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.2 | 0.9 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.2 | 0.3 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.2 | 0.5 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 1.3 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.1 | 0.7 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 0.5 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.1 | 0.5 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 0.5 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.1 | 0.2 | GO:0030172 | troponin C binding(GO:0030172) |
0.1 | 1.5 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.1 | 0.5 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.1 | 2.4 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 1.3 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.1 | 0.3 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.1 | 0.3 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.1 | 0.5 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 0.6 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.1 | 0.9 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.1 | 0.9 | GO:0039706 | co-receptor binding(GO:0039706) |
0.1 | 0.4 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.1 | 0.3 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.1 | 0.4 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.4 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 0.3 | GO:0004103 | choline kinase activity(GO:0004103) |
0.1 | 0.5 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.1 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.1 | 0.5 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.1 | 0.3 | GO:0005119 | smoothened binding(GO:0005119) |
0.1 | 0.3 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.1 | 2.6 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.1 | 0.4 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 0.6 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.1 | 0.2 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.1 | 0.6 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.3 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.1 | 0.2 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 0.2 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.1 | 0.6 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.5 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.1 | 0.4 | GO:1990254 | keratin filament binding(GO:1990254) |
0.1 | 0.3 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.3 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.1 | 0.6 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.1 | 0.2 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.5 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.1 | 0.4 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 0.2 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.1 | 0.2 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.2 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 0.3 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.1 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.1 | 0.1 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.1 | 0.3 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.1 | 0.2 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.1 | 0.4 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.1 | 0.2 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.1 | 0.2 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.1 | 0.8 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.1 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.1 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 0.2 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.2 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.1 | 0.4 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.1 | 0.2 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.1 | 6.5 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.1 | 0.7 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 0.2 | GO:0008142 | oxysterol binding(GO:0008142) |
0.1 | 0.2 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.1 | 0.4 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 0.3 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
0.1 | 0.2 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.1 | 0.2 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.1 | 0.6 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.1 | 0.2 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.1 | 0.3 | GO:0038132 | neuregulin binding(GO:0038132) |
0.1 | 0.9 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 0.4 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 0.2 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.1 | 0.4 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.1 | 0.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.1 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.1 | 0.2 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.1 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 0.1 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.0 | 0.2 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.4 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.0 | 0.5 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.0 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 2.1 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 0.2 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.0 | 0.9 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.4 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.2 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.0 | 0.3 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.3 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.3 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.2 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
0.0 | 0.1 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.0 | 0.2 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.2 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.0 | 0.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.2 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.1 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.0 | 0.2 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.0 | 1.6 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
0.0 | 0.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.0 | 0.0 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.2 | GO:0004675 | transmembrane receptor protein serine/threonine kinase activity(GO:0004675) |
0.0 | 0.3 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.1 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.5 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.0 | 0.2 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.0 | 0.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.0 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.0 | 0.5 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.2 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.0 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.4 | GO:0051378 | serotonin binding(GO:0051378) |
0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.2 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.5 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.0 | 0.2 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.0 | 0.5 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.4 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 1.0 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.1 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.0 | 0.2 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.3 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.0 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.2 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.0 | 0.0 | GO:0048185 | activin binding(GO:0048185) |
0.0 | 0.1 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.0 | 0.2 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.0 | 0.2 | GO:0018498 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.0 | 0.9 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.3 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.2 | GO:0046790 | virion binding(GO:0046790) |
0.0 | 0.1 | GO:0034902 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.0 | 0.3 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.1 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.0 | 0.5 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.0 | 0.2 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.1 | GO:0034935 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.3 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.2 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 0.1 | GO:0043888 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.0 | 1.7 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.0 | 0.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.1 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.0 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.0 | 0.2 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.0 | 0.1 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.3 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.0 | 0.1 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) RNA polymerase II transcription corepressor binding(GO:0001226) |
0.0 | 0.1 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.0 | 0.3 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.6 | GO:0000907 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.0 | 0.1 | GO:0003680 | AT DNA binding(GO:0003680) |
0.0 | 0.5 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.0 | 0.1 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.1 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.5 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.0 | GO:1901474 | azole transporter activity(GO:0045118) azole transmembrane transporter activity(GO:1901474) |
0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.1 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.0 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.4 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.0 | 0.2 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.0 | 0.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.1 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.0 | 0.6 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.0 | 0.3 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.1 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.0 | 0.2 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.1 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.3 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.0 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.0 | 0.3 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.0 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.0 | 0.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.4 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.0 | 0.1 | GO:0070840 | dynein complex binding(GO:0070840) |
0.0 | 0.1 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.0 | 0.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.0 | 0.0 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.0 | 0.3 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.2 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.1 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.0 | 1.4 | GO:0042826 | histone deacetylase binding(GO:0042826) |
0.0 | 0.0 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 0.2 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.1 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.0 | 0.3 | GO:0031404 | chloride ion binding(GO:0031404) |
0.0 | 0.3 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.1 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.0 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.0 | 0.2 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.3 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.5 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.3 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.2 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.0 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.0 | 0.5 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.1 | GO:0016936 | galactoside binding(GO:0016936) |
0.0 | 0.0 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.3 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.2 | GO:0008143 | poly(A) binding(GO:0008143) |
0.0 | 0.7 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 0.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.4 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.1 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.0 | 1.8 | GO:0003774 | motor activity(GO:0003774) |
0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.0 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.0 | 0.1 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 0.3 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.0 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.0 | 0.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.4 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.1 | GO:0033265 | choline binding(GO:0033265) |
0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.3 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.0 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
0.0 | 0.1 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.0 | 0.1 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.0 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.2 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.0 | 0.2 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.2 | GO:0034842 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.3 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.1 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.0 | 0.1 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.0 | 0.1 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.0 | 0.1 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.0 | 0.0 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.0 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.0 | 0.2 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.0 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.0 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.7 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.0 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
0.0 | 0.1 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.0 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.0 | 0.1 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 0.2 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 1.5 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.0 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.0 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.0 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.0 | 0.1 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.0 | 0.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 0.0 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.2 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.0 | 1.3 | GO:0008201 | heparin binding(GO:0008201) |
0.0 | 0.6 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.0 | GO:0031433 | telethonin binding(GO:0031433) |
0.0 | 0.2 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.0 | 0.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.4 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.1 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.0 | 0.0 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.0 | 0.0 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.1 | GO:0070403 | NAD+ binding(GO:0070403) |
0.0 | 0.0 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.0 | 0.1 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.0 | 0.0 | GO:0036122 | BMP binding(GO:0036122) |
0.0 | 0.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.0 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.0 | 0.0 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.0 | 0.0 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) |
0.0 | 0.1 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.0 | 0.0 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.0 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.1 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.0 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.1 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.0 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.0 | 0.3 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.1 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.0 | 0.0 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.0 | 0.1 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.1 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.0 | 0.1 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.0 | 0.0 | GO:1904680 | peptide transmembrane transporter activity(GO:1904680) |
0.0 | 0.0 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.0 | 0.1 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.0 | 0.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
0.0 | 0.1 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.0 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.0 | 0.0 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 0.7 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.2 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 0.4 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 5.9 | NABA COLLAGENS | Genes encoding collagen proteins |
0.1 | 0.9 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 0.7 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.1 | 2.5 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 0.3 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.1 | 3.7 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.1 | 0.1 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.1 | 0.6 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.1 | 2.1 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.1 | 0.7 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 1.0 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 1.8 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 2.5 | PID BMP PATHWAY | BMP receptor signaling |
0.1 | 1.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 0.2 | PID ALK1 PATHWAY | ALK1 signaling events |
0.1 | 0.4 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 1.3 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.8 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 1.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 1.6 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.2 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.0 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 2.5 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 1.1 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.5 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.4 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 1.0 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.3 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.9 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.2 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 0.8 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.6 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.0 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.8 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.5 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.4 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.2 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.0 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.5 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.0 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.3 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.2 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.0 | 4.4 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.2 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.1 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.3 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.2 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.6 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 0.4 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.0 | 0.3 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 0.3 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 2.0 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.4 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.2 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.0 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.2 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 0.1 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.2 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.2 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 1.7 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 0.3 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.1 | 3.6 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 1.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 0.4 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 2.7 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 1.6 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.1 | 5.4 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.1 | 0.8 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.1 | 1.1 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.1 | 0.2 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.1 | 1.3 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 1.4 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
0.1 | 0.9 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.1 | 1.3 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 0.6 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.1 | 0.4 | REACTOME OPSINS | Genes involved in Opsins |
0.1 | 0.3 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.1 | 0.1 | REACTOME PI3K EVENTS IN ERBB2 SIGNALING | Genes involved in PI3K events in ERBB2 signaling |
0.1 | 0.5 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.0 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.0 | 0.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.5 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.5 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 1.2 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.5 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.0 | 0.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.3 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 0.4 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.0 | 0.4 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.0 | 0.3 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.0 | 0.0 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.0 | 0.4 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.4 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.1 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.0 | 0.3 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 1.6 | REACTOME HEPARAN SULFATE HEPARIN HS GAG METABOLISM | Genes involved in Heparan sulfate/heparin (HS-GAG) metabolism |
0.0 | 0.2 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.6 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.3 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.0 | 0.4 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.1 | REACTOME CLEAVAGE OF GROWING TRANSCRIPT IN THE TERMINATION REGION | Genes involved in Cleavage of Growing Transcript in the Termination Region |
0.0 | 0.5 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
0.0 | 0.8 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.5 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.0 | 0.0 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
0.0 | 0.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.1 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.0 | 0.2 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.0 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.0 | 1.1 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.2 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 3.8 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
0.0 | 0.0 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.0 | 1.5 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.0 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.0 | 0.3 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.0 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.0 | 0.0 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
0.0 | 0.1 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.0 | 0.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 1.5 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.5 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.0 | 0.3 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.0 | 0.3 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.0 | 0.0 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
0.0 | 0.0 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
0.0 | 1.7 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.0 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.3 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.3 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.9 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.3 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
0.0 | 0.2 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.3 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.0 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.3 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.2 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.0 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.0 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |