Gene Symbol | Gene ID | Gene Info |
---|---|---|
Tead1
|
ENSMUSG00000055320.10 | Tead1 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Tead1 | chr7_112742068_112742484 | 231 | 0.938154 | 0.71 | 2.0e-10 | Click! |
Tead1 | chr7_112807297_112807678 | 32147 | 0.190564 | 0.70 | 4.5e-10 | Click! |
Tead1 | chr7_112742800_112743435 | 1072 | 0.550639 | 0.66 | 8.1e-09 | Click! |
Tead1 | chr7_112696903_112698024 | 5765 | 0.179459 | 0.65 | 2.1e-08 | Click! |
Tead1 | chr7_112743476_112744128 | 1757 | 0.383760 | 0.61 | 2.2e-07 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr2_163394440_163394815 | 6.66 |
Jph2 |
junctophilin 2 |
3322 |
0.18 |
chr2_80037645_80038971 | 6.63 |
Pde1a |
phosphodiesterase 1A, calmodulin-dependent |
721 |
0.79 |
chr11_57833423_57834227 | 6.52 |
Hand1 |
heart and neural crest derivatives expressed 1 |
1007 |
0.48 |
chr2_77863739_77864315 | 6.08 |
Gm13727 |
predicted gene 13727 |
17440 |
0.17 |
chr9_67046772_67047178 | 5.83 |
Tpm1 |
tropomyosin 1, alpha |
2143 |
0.29 |
chr1_46887596_46888189 | 5.09 |
Slc39a10 |
solute carrier family 39 (zinc transporter), member 10 |
178 |
0.94 |
chr14_54994142_54994440 | 4.98 |
Myh7 |
myosin, heavy polypeptide 7, cardiac muscle, beta |
252 |
0.78 |
chr8_47134944_47136227 | 4.89 |
E330018M18Rik |
RIKEN cDNA E330018M18 gene |
66 |
0.98 |
chr2_76980555_76980961 | 4.81 |
Ttn |
titin |
576 |
0.81 |
chr14_20667325_20668286 | 4.74 |
Synpo2l |
synaptopodin 2-like |
501 |
0.59 |
chr16_95456632_95459094 | 4.74 |
Erg |
ETS transcription factor |
1382 |
0.55 |
chr8_61901105_61901625 | 4.40 |
Palld |
palladin, cytoskeletal associated protein |
1304 |
0.42 |
chr12_73910432_73911326 | 4.30 |
Hif1a |
hypoxia inducible factor 1, alpha subunit |
2975 |
0.22 |
chr2_31748983_31749534 | 4.27 |
Abl1 |
c-abl oncogene 1, non-receptor tyrosine kinase |
10685 |
0.15 |
chr10_39612918_39613668 | 4.15 |
Traf3ip2 |
TRAF3 interacting protein 2 |
359 |
0.48 |
chr4_62620787_62622274 | 3.91 |
Rgs3 |
regulator of G-protein signaling 3 |
1948 |
0.3 |
chr3_138064815_138065971 | 3.90 |
1110002E22Rik |
RIKEN cDNA 1110002E22 gene |
341 |
0.81 |
chr11_103096614_103097909 | 3.84 |
Plcd3 |
phospholipase C, delta 3 |
4330 |
0.13 |
chr16_85549016_85550538 | 3.83 |
Cyyr1 |
cysteine and tyrosine-rich protein 1 |
640 |
0.75 |
chr5_115524008_115524776 | 3.79 |
Pxn |
paxillin |
4087 |
0.11 |
chr1_51267082_51267481 | 3.76 |
Cavin2 |
caveolae associated 2 |
21845 |
0.18 |
chr1_62382875_62383107 | 3.69 |
Pard3bos3 |
par-3 family cell polarity regulator beta, opposite strand 3 |
116270 |
0.06 |
chr19_24859802_24860526 | 3.68 |
Pgm5 |
phosphoglucomutase 5 |
1488 |
0.33 |
chr3_30546274_30547260 | 3.66 |
Mecom |
MDS1 and EVI1 complex locus |
1241 |
0.35 |
chr8_105305363_105306677 | 3.60 |
Elmo3 |
engulfment and cell motility 3 |
325 |
0.64 |
chr10_79776981_79777609 | 3.59 |
Fstl3 |
follistatin-like 3 |
3 |
0.93 |
chr15_102255144_102256158 | 3.57 |
Rarg |
retinoic acid receptor, gamma |
1698 |
0.19 |
chr17_86536044_86537023 | 3.57 |
Gm10309 |
predicted gene 10309 |
31301 |
0.19 |
chr17_35549775_35550249 | 3.50 |
Cdsn |
corneodesmosin |
2116 |
0.13 |
chrX_6578805_6579490 | 3.50 |
Shroom4 |
shroom family member 4 |
1861 |
0.5 |
chr5_24425894_24426175 | 3.41 |
Slc4a2 |
solute carrier family 4 (anion exchanger), member 2 |
749 |
0.37 |
chr4_98727774_98728475 | 3.33 |
L1td1 |
LINE-1 type transposase domain containing 1 |
1331 |
0.39 |
chr9_79975154_79975866 | 3.30 |
Filip1 |
filamin A interacting protein 1 |
2149 |
0.3 |
chr8_57315271_57316273 | 3.27 |
Hand2os1 |
Hand2, opposite strand 1 |
62 |
0.96 |
chr17_79451074_79451933 | 3.25 |
Cdc42ep3 |
CDC42 effector protein (Rho GTPase binding) 3 |
96412 |
0.07 |
chr14_34583875_34584279 | 3.23 |
Ldb3 |
LIM domain binding 3 |
4404 |
0.14 |
chr15_58761976_58762309 | 3.22 |
Gm20712 |
predicted gene 20712 |
19809 |
0.17 |
chr1_135767259_135767492 | 3.19 |
Phlda3 |
pleckstrin homology like domain, family A, member 3 |
241 |
0.9 |
chr8_77516976_77517233 | 3.17 |
0610038B21Rik |
RIKEN cDNA 0610038B21 gene |
48 |
0.92 |
chr19_21882066_21882836 | 3.16 |
Gm50130 |
predicted gene, 50130 |
48695 |
0.12 |
chr1_45311354_45311591 | 3.15 |
Col3a1 |
collagen, type III, alpha 1 |
66 |
0.69 |
chr9_102779295_102779863 | 3.14 |
Gm47416 |
predicted gene, 47416 |
8084 |
0.13 |
chr5_144257814_144258808 | 3.11 |
2900089D17Rik |
RIKEN cDNA 2900089D17 gene |
2125 |
0.2 |
chr11_72406421_72408105 | 3.11 |
Smtnl2 |
smoothelin-like 2 |
4155 |
0.15 |
chr3_123233703_123235038 | 3.11 |
Synpo2 |
synaptopodin 2 |
1726 |
0.3 |
chr2_120152582_120152955 | 3.10 |
Ehd4 |
EH-domain containing 4 |
1694 |
0.34 |
chr10_124288216_124288691 | 3.04 |
Gm47837 |
predicted gene, 47837 |
69591 |
0.14 |
chr13_73261804_73262144 | 2.98 |
Irx4 |
Iroquois homeobox 4 |
1477 |
0.36 |
chr7_112956295_112957421 | 2.96 |
Rassf10 |
Ras association (RalGDS/AF-6) domain family (N-terminal) member 10 |
2896 |
0.26 |
chr6_34599135_34600037 | 2.95 |
Cald1 |
caldesmon 1 |
966 |
0.58 |
chr15_32243549_32243700 | 2.95 |
Snhg18 |
small nucleolar RNA host gene 18 |
1038 |
0.33 |
chr9_54633905_54634405 | 2.92 |
Acsbg1 |
acyl-CoA synthetase bubblegum family member 1 |
9003 |
0.16 |
chr18_50064692_50065534 | 2.91 |
C030005K06Rik |
RIKEN cDNA C030005K06 gene |
11269 |
0.19 |
chr13_53293118_53293480 | 2.90 |
Ror2 |
receptor tyrosine kinase-like orphan receptor 2 |
7175 |
0.26 |
chr7_4163531_4164895 | 2.89 |
Cdc42ep5 |
CDC42 effector protein (Rho GTPase binding) 5 |
229 |
0.84 |
chr16_4641802_4643186 | 2.89 |
Dnaja3 |
DnaJ heat shock protein family (Hsp40) member A3 |
2505 |
0.16 |
chr10_79989757_79990308 | 2.89 |
Cnn2 |
calponin 2 |
1409 |
0.18 |
chr10_39613682_39614138 | 2.87 |
Gm16364 |
predicted gene 16364 |
228 |
0.85 |
chr8_104103651_104104513 | 2.86 |
Gm29682 |
predicted gene, 29682 |
1791 |
0.25 |
chr6_91795276_91796520 | 2.85 |
Grip2 |
glutamate receptor interacting protein 2 |
346 |
0.87 |
chr10_77448991_77449142 | 2.84 |
Gm35920 |
predicted gene, 35920 |
8851 |
0.17 |
chr18_35720849_35722653 | 2.84 |
Ecscr |
endothelial cell surface expressed chemotaxis and apoptosis regulator |
260 |
0.83 |
chr9_79951917_79952095 | 2.83 |
Filip1 |
filamin A interacting protein 1 |
10027 |
0.19 |
chr18_75374458_75376171 | 2.83 |
Smad7 |
SMAD family member 7 |
400 |
0.87 |
chr8_11314471_11315722 | 2.82 |
Col4a1 |
collagen, type IV, alpha 1 |
2270 |
0.23 |
chr1_183680023_183680360 | 2.81 |
Gm8214 |
predicted gene 8214 |
1940 |
0.43 |
chr1_155740599_155741706 | 2.81 |
Lhx4 |
LIM homeobox protein 4 |
875 |
0.54 |
chr6_72233456_72234176 | 2.78 |
Atoh8 |
atonal bHLH transcription factor 8 |
721 |
0.64 |
chr1_171439042_171439737 | 2.77 |
F11r |
F11 receptor |
1810 |
0.19 |
chr4_155283351_155284055 | 2.74 |
Prkcz |
protein kinase C, zeta |
10661 |
0.16 |
chr5_74161401_74162605 | 2.74 |
A330058E17Rik |
RIKEN cDNA A330058E17 gene |
14047 |
0.14 |
chr2_166080710_166081069 | 2.74 |
Sulf2 |
sulfatase 2 |
2770 |
0.25 |
chr16_72376892_72377380 | 2.74 |
Gm49670 |
predicted gene, 49670 |
4695 |
0.32 |
chr17_70997929_70998765 | 2.73 |
Myl12a |
myosin, light chain 12A, regulatory, non-sarcomeric |
216 |
0.88 |
chr3_130303184_130303881 | 2.72 |
Gm22682 |
predicted gene, 22682 |
98067 |
0.07 |
chr6_135066774_135067479 | 2.72 |
Gprc5a |
G protein-coupled receptor, family C, group 5, member A |
1475 |
0.35 |
chr10_120760564_120761091 | 2.72 |
4921513I03Rik |
RIKEN cDNA 4921513I03 gene |
4905 |
0.14 |
chr18_23415065_23416860 | 2.72 |
Dtna |
dystrobrevin alpha |
452 |
0.9 |
chr17_75464750_75466038 | 2.71 |
Rasgrp3 |
RAS, guanyl releasing protein 3 |
92 |
0.98 |
chr13_43503231_43504130 | 2.70 |
Gm47683 |
predicted gene, 47683 |
3513 |
0.17 |
chr19_25384536_25385064 | 2.67 |
Kank1 |
KN motif and ankyrin repeat domains 1 |
10503 |
0.22 |
chr1_189729470_189729621 | 2.67 |
Ptpn14 |
protein tyrosine phosphatase, non-receptor type 14 |
1270 |
0.47 |
chr14_54964935_54965983 | 2.67 |
Myh6 |
myosin, heavy polypeptide 6, cardiac muscle, alpha |
1115 |
0.21 |
chr13_42300942_42302770 | 2.64 |
Edn1 |
endothelin 1 |
380 |
0.88 |
chr4_41781755_41782325 | 2.63 |
Ccl27a |
chemokine (C-C motif) ligand 27A |
7793 |
0.1 |
chr19_36732841_36733325 | 2.63 |
Ppp1r3c |
protein phosphatase 1, regulatory subunit 3C |
3570 |
0.26 |
chr11_54961866_54962416 | 2.62 |
Tnip1 |
TNFAIP3 interacting protein 1 |
768 |
0.6 |
chr8_106510659_106512038 | 2.61 |
Cdh3 |
cadherin 3 |
457 |
0.8 |
chr10_84387728_84389218 | 2.59 |
Nuak1 |
NUAK family, SNF1-like kinase, 1 |
3915 |
0.24 |
chr14_105802599_105803428 | 2.59 |
Gm22406 |
predicted gene, 22406 |
13895 |
0.22 |
chr13_38145014_38146012 | 2.55 |
Dsp |
desmoplakin |
5781 |
0.18 |
chr2_6352474_6353269 | 2.55 |
Usp6nl |
USP6 N-terminal like |
138 |
0.96 |
chr10_108433877_108434449 | 2.53 |
Gm36283 |
predicted gene, 36283 |
2502 |
0.28 |
chr8_75039022_75039302 | 2.53 |
Gm45822 |
predicted gene 45822 |
5221 |
0.14 |
chr18_75372210_75374418 | 2.52 |
Smad7 |
SMAD family member 7 |
1600 |
0.41 |
chr2_84634714_84636973 | 2.52 |
Ctnnd1 |
catenin (cadherin associated protein), delta 1 |
2262 |
0.17 |
chr5_99570397_99571191 | 2.51 |
Gm16228 |
predicted gene 16228 |
40639 |
0.12 |
chr10_117046957_117047576 | 2.51 |
Lrrc10 |
leucine rich repeat containing 10 |
1925 |
0.23 |
chr5_92387344_92388012 | 2.51 |
Art3 |
ADP-ribosyltransferase 3 |
85 |
0.95 |
chr18_35719935_35720496 | 2.51 |
Ecscr |
endothelial cell surface expressed chemotaxis and apoptosis regulator |
1276 |
0.27 |
chr16_91169710_91170388 | 2.51 |
Gm49613 |
predicted gene, 49613 |
5285 |
0.13 |
chr9_63896615_63896826 | 2.48 |
Gm18541 |
predicted gene, 18541 |
1545 |
0.41 |
chr8_109105027_109105682 | 2.48 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
30109 |
0.23 |
chr16_4520531_4520944 | 2.47 |
Srl |
sarcalumenin |
2326 |
0.24 |
chr12_85462042_85462315 | 2.47 |
Fos |
FBJ osteosarcoma oncogene |
11712 |
0.15 |
chr4_123562890_123563226 | 2.46 |
Macf1 |
microtubule-actin crosslinking factor 1 |
1636 |
0.39 |
chr4_76424850_76425037 | 2.46 |
Ptprd |
protein tyrosine phosphatase, receptor type, D |
25037 |
0.18 |
chr1_135324343_135325907 | 2.45 |
Lmod1 |
leiomodin 1 (smooth muscle) |
318 |
0.83 |
chr4_42744577_42745017 | 2.45 |
Gm12395 |
predicted gene 12395 |
8204 |
0.12 |
chr2_30995683_30996883 | 2.44 |
Usp20 |
ubiquitin specific peptidase 20 |
235 |
0.9 |
chr12_12581337_12581713 | 2.41 |
AC107703.1 |
novel transcript |
88392 |
0.08 |
chr19_47228729_47229498 | 2.38 |
Neurl1a |
neuralized E3 ubiquitin protein ligase 1A |
202 |
0.9 |
chr16_85132591_85133705 | 2.38 |
Gm49226 |
predicted gene, 49226 |
15681 |
0.18 |
chr12_31270509_31272027 | 2.36 |
Lamb1 |
laminin B1 |
5388 |
0.14 |
chr16_87784062_87784739 | 2.36 |
2810407A14Rik |
RIKEN cDNA 2810407A14 gene |
325 |
0.91 |
chr6_128142274_128142425 | 2.35 |
Tspan9 |
tetraspanin 9 |
1204 |
0.34 |
chr2_27327324_27327475 | 2.35 |
AA645442 |
expressed sequence AA645442 |
695 |
0.66 |
chr4_135828508_135829035 | 2.35 |
Gm13000 |
predicted gene 13000 |
24907 |
0.1 |
chr9_24777033_24778375 | 2.33 |
Gm29824 |
predicted gene, 29824 |
1237 |
0.44 |
chr6_93727701_93728102 | 2.33 |
Magi1 |
membrane associated guanylate kinase, WW and PDZ domain containing 1 |
64638 |
0.11 |
chr3_146122486_146122688 | 2.33 |
Mcoln3 |
mucolipin 3 |
915 |
0.51 |
chr10_53339922_53340236 | 2.32 |
Pln |
phospholamban |
2374 |
0.19 |
chr11_55358100_55358650 | 2.31 |
Fat2 |
FAT atypical cadherin 2 |
21811 |
0.16 |
chr19_5690804_5690955 | 2.30 |
Map3k11 |
mitogen-activated protein kinase kinase kinase 11 |
382 |
0.55 |
chr1_12875347_12875986 | 2.30 |
Sulf1 |
sulfatase 1 |
32875 |
0.18 |
chr1_182137335_182137621 | 2.29 |
Srp9 |
signal recognition particle 9 |
6779 |
0.16 |
chr17_31746430_31747010 | 2.29 |
Gm49999 |
predicted gene, 49999 |
42784 |
0.09 |
chr8_11274416_11274985 | 2.27 |
Col4a1 |
collagen, type IV, alpha 1 |
4956 |
0.19 |
chr5_32140229_32140654 | 2.27 |
Fosl2 |
fos-like antigen 2 |
4268 |
0.18 |
chrX_106921813_106922604 | 2.27 |
Lpar4 |
lysophosphatidic acid receptor 4 |
1583 |
0.46 |
chr4_42641270_42641698 | 2.26 |
Gm2564 |
predicted gene 2564 |
11587 |
0.11 |
chr16_25802324_25803670 | 2.25 |
Trp63 |
transformation related protein 63 |
1081 |
0.63 |
chr10_71158552_71158735 | 2.24 |
Bicc1 |
BicC family RNA binding protein 1 |
1047 |
0.39 |
chr4_41932832_41933308 | 2.23 |
Gm20878 |
predicted gene, 20878 |
8502 |
0.1 |
chr6_37431066_37431432 | 2.22 |
Creb3l2 |
cAMP responsive element binding protein 3-like 2 |
10897 |
0.27 |
chr5_76856634_76858112 | 2.21 |
C530008M17Rik |
RIKEN cDNA C530008M17 gene |
1469 |
0.39 |
chr4_42144109_42144527 | 2.21 |
Gm13299 |
predicted gene 13299 |
9117 |
0.08 |
chr3_83783793_83784421 | 2.20 |
Gm26771 |
predicted gene, 26771 |
5849 |
0.18 |
chr13_51174511_51174977 | 2.20 |
Nxnl2 |
nucleoredoxin-like 2 |
3685 |
0.2 |
chr5_140383583_140384027 | 2.19 |
Snx8 |
sorting nexin 8 |
1072 |
0.42 |
chr15_93916852_93917122 | 2.19 |
9430014N10Rik |
RIKEN cDNA 9430014N10 gene |
10124 |
0.25 |
chr2_180472536_180472908 | 2.19 |
Slco4a1 |
solute carrier organic anion transporter family, member 4a1 |
293 |
0.89 |
chr13_63273798_63275383 | 2.18 |
Gm47585 |
predicted gene, 47585 |
990 |
0.28 |
chr4_42285071_42285539 | 2.18 |
Gm21980 |
predicted gene 21980 |
8536 |
0.09 |
chr15_94649341_94650048 | 2.17 |
Tmem117 |
transmembrane protein 117 |
20444 |
0.19 |
chr8_126566580_126567229 | 2.17 |
Gm26759 |
predicted gene, 26759 |
66 |
0.98 |
chr8_84202337_84202869 | 2.15 |
Gm37352 |
predicted gene, 37352 |
1734 |
0.12 |
chr14_21982014_21982200 | 2.13 |
Zfp503 |
zinc finger protein 503 |
7494 |
0.15 |
chr14_104901295_104901545 | 2.12 |
Gm24280 |
predicted gene, 24280 |
70007 |
0.12 |
chr2_168161513_168162089 | 2.10 |
E130018N17Rik |
RIKEN cDNA E130018N17 gene |
7288 |
0.12 |
chr8_57319308_57320679 | 2.10 |
Hand2os1 |
Hand2, opposite strand 1 |
63 |
0.94 |
chr11_40573794_40573945 | 2.10 |
Gm12136 |
predicted gene 12136 |
3344 |
0.26 |
chr4_45507239_45507624 | 2.09 |
Gm22518 |
predicted gene, 22518 |
6879 |
0.16 |
chr5_107268343_107269204 | 2.08 |
Gm42900 |
predicted gene 42900 |
12269 |
0.13 |
chr4_126278113_126279456 | 2.08 |
Col8a2 |
collagen, type VIII, alpha 2 |
8009 |
0.12 |
chr9_117192572_117193164 | 2.07 |
Rbms3 |
RNA binding motif, single stranded interacting protein |
58729 |
0.13 |
chr15_98602773_98603359 | 2.07 |
Adcy6 |
adenylate cyclase 6 |
1665 |
0.2 |
chr2_72390434_72390929 | 2.06 |
Rpl36a-ps4 |
ribosomal protein L36A, pseudogene 4 |
30434 |
0.18 |
chr3_97289091_97289336 | 2.03 |
Bcl9 |
B cell CLL/lymphoma 9 |
8704 |
0.18 |
chr4_123564242_123564871 | 2.03 |
Macf1 |
microtubule-actin crosslinking factor 1 |
138 |
0.96 |
chr4_154238534_154239219 | 2.03 |
Megf6 |
multiple EGF-like-domains 6 |
1351 |
0.38 |
chr14_45920825_45921382 | 2.03 |
Gm15220 |
predicted gene 15220 |
1638 |
0.35 |
chr3_20153383_20154068 | 2.02 |
Gyg |
glycogenin |
1344 |
0.46 |
chr11_95836903_95837597 | 2.02 |
Gngt2 |
guanine nucleotide binding protein (G protein), gamma transducing activity polypeptide 2 |
34 |
0.94 |
chr19_38025173_38025379 | 2.02 |
Myof |
myoferlin |
18075 |
0.14 |
chr7_110296987_110297779 | 2.02 |
Gm9132 |
predicted gene 9132 |
4618 |
0.2 |
chr8_13490087_13490346 | 2.01 |
Gas6 |
growth arrest specific 6 |
4274 |
0.18 |
chr19_8989213_8990851 | 2.01 |
Ahnak |
AHNAK nucleoprotein (desmoyokin) |
737 |
0.46 |
chr15_12010211_12011091 | 2.00 |
Sub1 |
SUB1 homolog, transcriptional regulator |
13668 |
0.16 |
chr19_43938283_43938823 | 2.00 |
Dnmbp |
dynamin binding protein |
1619 |
0.29 |
chr7_136406153_136406730 | 1.99 |
Gm36849 |
predicted gene, 36849 |
53077 |
0.14 |
chr1_172219218_172219923 | 1.99 |
Casq1 |
calsequestrin 1 |
145 |
0.91 |
chr6_119044058_119044327 | 1.98 |
Cacna1c |
calcium channel, voltage-dependent, L type, alpha 1C subunit |
35815 |
0.21 |
chr3_9752138_9752706 | 1.97 |
Gm16337 |
predicted gene 16337 |
5185 |
0.24 |
chr12_80885315_80886140 | 1.96 |
Susd6 |
sushi domain containing 6 |
17019 |
0.13 |
chr4_32304196_32305639 | 1.96 |
Bach2it1 |
BTB and CNC homology 2, intronic transcript 1 |
53156 |
0.13 |
chr12_36718089_36718314 | 1.96 |
Mir5099 |
microRNA 5099 |
98004 |
0.07 |
chr2_105129293_105129444 | 1.96 |
Wt1 |
Wilms tumor 1 homolog |
1432 |
0.37 |
chr19_5050501_5051991 | 1.95 |
Rin1 |
Ras and Rab interactor 1 |
413 |
0.61 |
chr19_45154432_45155006 | 1.94 |
Tlx1 |
T cell leukemia, homeobox 1 |
3250 |
0.19 |
chr3_98024143_98024879 | 1.93 |
Gm42819 |
predicted gene 42819 |
6176 |
0.19 |
chr9_105520039_105521535 | 1.93 |
Atp2c1 |
ATPase, Ca++-sequestering |
360 |
0.86 |
chr8_107545084_107547731 | 1.93 |
Wwp2 |
WW domain containing E3 ubiquitin protein ligase 2 |
1395 |
0.4 |
chr18_61360516_61360966 | 1.92 |
Gm25301 |
predicted gene, 25301 |
37072 |
0.11 |
chr14_105392318_105392563 | 1.92 |
5430440P10Rik |
RIKEN cDNA 5430440P10 gene |
35119 |
0.16 |
chr10_63784878_63785391 | 1.92 |
Ctnna3 |
catenin (cadherin associated protein), alpha 3 |
35921 |
0.22 |
chr18_6237993_6238710 | 1.92 |
Gm41664 |
predicted gene, 41664 |
2463 |
0.24 |
chr5_137312995_137314595 | 1.92 |
Trip6 |
thyroid hormone receptor interactor 6 |
369 |
0.68 |
chr16_17797005_17798693 | 1.91 |
Scarf2 |
scavenger receptor class F, member 2 |
499 |
0.64 |
chr1_180703341_180703767 | 1.91 |
Mixl1 |
Mix1 homeobox-like 1 (Xenopus laevis) |
6520 |
0.13 |
chr5_124729611_124730204 | 1.90 |
Dnah10 |
dynein, axonemal, heavy chain 10 |
4822 |
0.15 |
chr11_90032564_90033760 | 1.90 |
Tmem100 |
transmembrane protein 100 |
2814 |
0.31 |
chr18_50052955_50054309 | 1.89 |
C030005K06Rik |
RIKEN cDNA C030005K06 gene |
27 |
0.85 |
chr4_136649051_136649935 | 1.88 |
Gm37583 |
predicted gene, 37583 |
9911 |
0.12 |
chr4_58205681_58206908 | 1.87 |
Svep1 |
sushi, von Willebrand factor type A, EGF and pentraxin domain containing 1 |
302 |
0.94 |
chr3_79180068_79180481 | 1.87 |
Rapgef2 |
Rap guanine nucleotide exchange factor (GEF) 2 |
1066 |
0.53 |
chr15_96743991_96744746 | 1.87 |
Gm8888 |
predicted gene 8888 |
22710 |
0.17 |
chr15_78844291_78845201 | 1.87 |
Cdc42ep1 |
CDC42 effector protein (Rho GTPase binding) 1 |
2122 |
0.16 |
chr5_51899593_51900300 | 1.86 |
Gm42617 |
predicted gene 42617 |
6732 |
0.18 |
chr3_145648599_145649990 | 1.86 |
Ccn1 |
cellular communication network factor 1 |
687 |
0.54 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 4.5 | GO:0048769 | sarcomerogenesis(GO:0048769) |
1.1 | 2.3 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
1.1 | 4.3 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
1.0 | 4.0 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
1.0 | 3.9 | GO:0060298 | positive regulation of sarcomere organization(GO:0060298) |
0.9 | 1.8 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.9 | 4.4 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.8 | 2.5 | GO:0051794 | regulation of catagen(GO:0051794) |
0.8 | 3.3 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.8 | 2.4 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.7 | 2.2 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.7 | 4.9 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.7 | 5.4 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.6 | 2.5 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.6 | 4.2 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.6 | 3.0 | GO:0060157 | urinary bladder development(GO:0060157) |
0.6 | 1.7 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.5 | 1.6 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.5 | 2.7 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.5 | 1.6 | GO:0060435 | bronchiole development(GO:0060435) |
0.5 | 1.5 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.5 | 2.4 | GO:0032196 | transposition(GO:0032196) |
0.5 | 3.3 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.5 | 1.4 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.5 | 0.9 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.5 | 3.6 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.4 | 1.7 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.4 | 0.9 | GO:2000668 | dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
0.4 | 0.9 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.4 | 1.7 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.4 | 1.3 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
0.4 | 0.8 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
0.4 | 1.3 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.4 | 0.4 | GO:0003176 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
0.4 | 2.0 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.4 | 1.6 | GO:0007494 | midgut development(GO:0007494) |
0.4 | 1.2 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.4 | 1.2 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.4 | 1.1 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.4 | 1.1 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
0.4 | 1.9 | GO:1901628 | positive regulation of postsynaptic membrane organization(GO:1901628) |
0.4 | 0.7 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.4 | 2.9 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.4 | 1.5 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.4 | 2.5 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.4 | 1.1 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.4 | 1.1 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.3 | 2.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.3 | 4.8 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.3 | 2.0 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.3 | 1.0 | GO:0072093 | metanephric renal vesicle formation(GO:0072093) |
0.3 | 1.3 | GO:2000065 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.3 | 1.3 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.3 | 1.3 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.3 | 0.6 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.3 | 1.6 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.3 | 1.8 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.3 | 1.5 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.3 | 2.9 | GO:0098911 | regulation of ventricular cardiac muscle cell action potential(GO:0098911) |
0.3 | 0.6 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.3 | 0.6 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.3 | 0.9 | GO:0051594 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.3 | 1.1 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.3 | 1.1 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.3 | 0.6 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.3 | 1.7 | GO:0086005 | ventricular cardiac muscle cell action potential(GO:0086005) |
0.3 | 0.5 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.3 | 4.3 | GO:0001946 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
0.3 | 1.9 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.3 | 0.8 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.3 | 1.0 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.3 | 1.8 | GO:0097264 | self proteolysis(GO:0097264) |
0.3 | 1.6 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.3 | 1.3 | GO:0031394 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
0.3 | 0.3 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) |
0.3 | 0.8 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.3 | 0.5 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.2 | 1.0 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.2 | 0.7 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.2 | 1.5 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.2 | 2.9 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
0.2 | 0.2 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
0.2 | 1.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.2 | 0.9 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
0.2 | 2.4 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.2 | 0.7 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.2 | 2.6 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.2 | 0.7 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.2 | 0.7 | GO:0061356 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.2 | 2.5 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
0.2 | 0.5 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
0.2 | 0.7 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.2 | 0.9 | GO:1903519 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
0.2 | 1.8 | GO:0060068 | vagina development(GO:0060068) |
0.2 | 0.9 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.2 | 0.7 | GO:0065001 | specification of axis polarity(GO:0065001) |
0.2 | 0.4 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.2 | 1.1 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.2 | 0.9 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.2 | 0.9 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.2 | 0.6 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.2 | 0.6 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.2 | 0.8 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
0.2 | 0.6 | GO:0001757 | somite specification(GO:0001757) |
0.2 | 0.8 | GO:0009838 | abscission(GO:0009838) |
0.2 | 1.9 | GO:0014820 | tonic smooth muscle contraction(GO:0014820) artery smooth muscle contraction(GO:0014824) |
0.2 | 0.8 | GO:0060005 | vestibular reflex(GO:0060005) |
0.2 | 1.4 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.2 | 0.8 | GO:0030578 | PML body organization(GO:0030578) |
0.2 | 2.2 | GO:0014850 | response to muscle activity(GO:0014850) |
0.2 | 0.6 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.2 | 0.8 | GO:0003177 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
0.2 | 0.6 | GO:0072107 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
0.2 | 0.6 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.2 | 0.6 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.2 | 0.6 | GO:0030035 | microspike assembly(GO:0030035) |
0.2 | 0.8 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.2 | 0.6 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.2 | 0.9 | GO:0030913 | paranodal junction assembly(GO:0030913) |
0.2 | 1.8 | GO:0001553 | luteinization(GO:0001553) |
0.2 | 0.5 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.2 | 0.4 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.2 | 0.2 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.2 | 1.2 | GO:0072102 | glomerulus morphogenesis(GO:0072102) |
0.2 | 1.1 | GO:2000343 | positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
0.2 | 0.2 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
0.2 | 0.5 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.2 | 0.7 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.2 | 0.9 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.2 | 1.0 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.2 | 0.3 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.2 | 0.3 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
0.2 | 0.8 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.2 | 0.5 | GO:0009629 | response to gravity(GO:0009629) |
0.2 | 0.2 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
0.2 | 0.3 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.2 | 0.2 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.2 | 0.3 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
0.2 | 0.6 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
0.2 | 1.3 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.2 | 2.2 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.2 | 3.5 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
0.2 | 0.2 | GO:0038027 | apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
0.2 | 0.8 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.2 | 2.0 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
0.2 | 0.5 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.2 | 0.2 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.2 | 0.5 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.2 | 0.5 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.2 | 0.3 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.2 | 0.8 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.1 | 0.3 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.1 | 0.3 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) |
0.1 | 0.6 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
0.1 | 0.9 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.1 | 0.6 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.1 | 0.6 | GO:0042713 | sperm ejaculation(GO:0042713) |
0.1 | 1.9 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.1 | 0.4 | GO:0032803 | low-density lipoprotein particle receptor catabolic process(GO:0032802) regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
0.1 | 0.7 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.1 | 1.0 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.1 | 0.4 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.1 | 0.3 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.1 | 1.4 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
0.1 | 0.1 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.1 | 0.1 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
0.1 | 1.6 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.1 | 0.8 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
0.1 | 1.9 | GO:0048385 | regulation of retinoic acid receptor signaling pathway(GO:0048385) |
0.1 | 0.3 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.1 | 1.2 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.1 | 0.7 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.3 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
0.1 | 0.7 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.1 | 0.1 | GO:1903598 | positive regulation of gap junction assembly(GO:1903598) |
0.1 | 0.5 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.1 | 0.1 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.1 | 0.5 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.1 | 1.8 | GO:0006907 | pinocytosis(GO:0006907) |
0.1 | 0.3 | GO:0072048 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.1 | 0.1 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.1 | 0.4 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.1 | 0.3 | GO:0050957 | equilibrioception(GO:0050957) |
0.1 | 0.4 | GO:0032763 | regulation of mast cell cytokine production(GO:0032763) |
0.1 | 2.2 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
0.1 | 0.8 | GO:1901077 | regulation of relaxation of muscle(GO:1901077) |
0.1 | 2.1 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.6 | GO:1901341 | positive regulation of store-operated calcium channel activity(GO:1901341) |
0.1 | 0.5 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.1 | 0.6 | GO:0032308 | positive regulation of icosanoid secretion(GO:0032305) positive regulation of prostaglandin secretion(GO:0032308) |
0.1 | 0.4 | GO:0045601 | regulation of endothelial cell differentiation(GO:0045601) |
0.1 | 0.2 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.1 | 0.4 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.1 | 0.4 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 0.8 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.1 | 1.0 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.1 | 0.8 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.1 | 0.6 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.1 | 0.8 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.1 | 0.7 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.1 | 0.5 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.1 | 0.5 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.1 | 0.5 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.6 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.1 | 0.5 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
0.1 | 0.5 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.1 | 0.5 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.1 | 0.5 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.1 | 2.8 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
0.1 | 0.4 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.1 | 0.4 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
0.1 | 0.3 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.1 | 0.1 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.1 | 0.3 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.1 | 0.8 | GO:0032060 | bleb assembly(GO:0032060) |
0.1 | 0.2 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.1 | 0.6 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
0.1 | 0.2 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.1 | 0.3 | GO:0007525 | somatic muscle development(GO:0007525) |
0.1 | 0.4 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.1 | 0.8 | GO:0003091 | renal water homeostasis(GO:0003091) |
0.1 | 2.2 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.1 | 0.1 | GO:0035793 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.1 | 0.3 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
0.1 | 0.5 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.1 | 0.2 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.1 | 0.3 | GO:0070836 | caveola assembly(GO:0070836) |
0.1 | 1.0 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.1 | 0.5 | GO:0003215 | cardiac right ventricle morphogenesis(GO:0003215) |
0.1 | 0.3 | GO:0072174 | metanephric tubule formation(GO:0072174) |
0.1 | 0.6 | GO:0060900 | embryonic camera-type eye formation(GO:0060900) |
0.1 | 0.1 | GO:0031272 | regulation of pseudopodium assembly(GO:0031272) |
0.1 | 0.1 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.1 | 0.1 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.1 | 0.3 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.1 | 0.1 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.1 | 0.3 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.1 | 0.3 | GO:0060437 | lung growth(GO:0060437) |
0.1 | 0.3 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.1 | 0.3 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.1 | 1.5 | GO:0032292 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
0.1 | 0.7 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.1 | 0.4 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.1 | 0.3 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.1 | 0.2 | GO:0001555 | oocyte growth(GO:0001555) |
0.1 | 0.2 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
0.1 | 0.2 | GO:0060596 | mammary placode formation(GO:0060596) |
0.1 | 0.1 | GO:0031944 | negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
0.1 | 0.3 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.1 | 2.8 | GO:0009250 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
0.1 | 0.1 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.1 | 0.4 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.1 | GO:0061047 | positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.1 | 0.9 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.1 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.3 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.1 | 0.1 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
0.1 | 1.4 | GO:0045214 | sarcomere organization(GO:0045214) |
0.1 | 0.3 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.2 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.1 | 0.1 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
0.1 | 0.2 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
0.1 | 0.3 | GO:2001201 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.1 | 0.2 | GO:0010880 | regulation of release of sequestered calcium ion into cytosol by sarcoplasmic reticulum(GO:0010880) |
0.1 | 0.3 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.1 | 0.1 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.1 | 0.5 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
0.1 | 0.3 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.2 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.1 | 0.2 | GO:1902075 | cellular response to salt(GO:1902075) |
0.1 | 0.1 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
0.1 | 1.0 | GO:0048010 | vascular endothelial growth factor receptor signaling pathway(GO:0048010) |
0.1 | 0.4 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.1 | 0.3 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.1 | 0.4 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.1 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.1 | 0.3 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
0.1 | 0.8 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
0.1 | 0.7 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.1 | 0.4 | GO:0070141 | response to UV-A(GO:0070141) |
0.1 | 1.1 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
0.1 | 0.2 | GO:0043587 | tongue morphogenesis(GO:0043587) |
0.1 | 0.3 | GO:0002606 | positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
0.1 | 0.4 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
0.1 | 0.3 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.1 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
0.1 | 0.2 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.1 | 0.3 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.1 | 0.2 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
0.1 | 0.3 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.1 | 0.7 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 0.2 | GO:0048069 | eye pigmentation(GO:0048069) |
0.1 | 0.3 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.1 | 0.4 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.1 | 0.2 | GO:0033504 | floor plate development(GO:0033504) |
0.1 | 0.1 | GO:0060536 | cartilage morphogenesis(GO:0060536) |
0.1 | 0.2 | GO:0036394 | amylase secretion(GO:0036394) |
0.1 | 0.5 | GO:0051775 | response to redox state(GO:0051775) |
0.1 | 0.3 | GO:0046959 | habituation(GO:0046959) |
0.1 | 0.2 | GO:0007512 | adult heart development(GO:0007512) |
0.1 | 1.3 | GO:0033198 | response to ATP(GO:0033198) |
0.1 | 0.5 | GO:0060613 | fat pad development(GO:0060613) |
0.1 | 0.3 | GO:2000394 | regulation of lamellipodium morphogenesis(GO:2000392) positive regulation of lamellipodium morphogenesis(GO:2000394) |
0.1 | 0.2 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.2 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.1 | 0.2 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.1 | 0.5 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.1 | 0.2 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
0.1 | 0.7 | GO:0022038 | corpus callosum development(GO:0022038) |
0.1 | 0.1 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
0.1 | 0.1 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.1 | 0.4 | GO:0048368 | lateral mesoderm development(GO:0048368) |
0.1 | 0.1 | GO:2001225 | regulation of chloride transport(GO:2001225) |
0.1 | 0.2 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
0.1 | 0.2 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.1 | 0.4 | GO:0015671 | oxygen transport(GO:0015671) |
0.1 | 0.1 | GO:0043622 | cortical microtubule organization(GO:0043622) |
0.1 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.1 | GO:0034214 | protein hexamerization(GO:0034214) |
0.1 | 0.4 | GO:0070873 | regulation of glycogen metabolic process(GO:0070873) |
0.1 | 0.1 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.1 | 0.4 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.1 | 0.5 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.1 | 0.1 | GO:0022009 | central nervous system vasculogenesis(GO:0022009) |
0.1 | 0.6 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.1 | 0.2 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.1 | 0.4 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.1 | 0.1 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.1 | 0.1 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.1 | 0.1 | GO:0014901 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
0.1 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.7 | GO:0042491 | auditory receptor cell differentiation(GO:0042491) |
0.1 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
0.1 | 0.2 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.1 | 0.4 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.1 | 0.2 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.1 | 0.1 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
0.1 | 0.2 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.1 | 0.1 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.1 | 0.1 | GO:0009414 | response to water deprivation(GO:0009414) |
0.1 | 0.5 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.1 | 0.1 | GO:0001705 | ectoderm formation(GO:0001705) |
0.1 | 0.3 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.1 | 0.1 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.1 | 0.3 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 0.1 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.1 | 0.3 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.1 | 0.2 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.1 | 0.3 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
0.1 | 0.1 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.1 | 0.3 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.1 | 0.1 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.1 | 0.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.1 | 0.2 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.1 | 0.1 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.1 | 0.8 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.1 | 0.5 | GO:1901016 | regulation of potassium ion transmembrane transporter activity(GO:1901016) |
0.1 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.1 | 0.8 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
0.1 | 0.1 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.1 | 0.3 | GO:0002158 | osteoclast proliferation(GO:0002158) |
0.1 | 0.3 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.1 | 0.1 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.1 | 0.7 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.1 | 0.3 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
0.1 | 0.2 | GO:0016093 | polyprenol metabolic process(GO:0016093) |
0.1 | 0.1 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.1 | 0.1 | GO:0045608 | negative regulation of auditory receptor cell differentiation(GO:0045608) |
0.1 | 0.4 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.1 | 0.1 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.1 | 0.1 | GO:1903596 | regulation of gap junction assembly(GO:1903596) |
0.1 | 0.1 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.1 | 0.2 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
0.1 | 0.4 | GO:0036035 | osteoclast development(GO:0036035) |
0.1 | 0.2 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.1 | 0.2 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
0.1 | 0.5 | GO:0097205 | renal filtration(GO:0097205) |
0.1 | 0.6 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.1 | 0.3 | GO:0072711 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
0.1 | 0.3 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.1 | 0.1 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.1 | 0.3 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.1 | 0.2 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.1 | 0.2 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.1 | 0.5 | GO:0060438 | trachea development(GO:0060438) |
0.1 | 0.2 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.1 | 0.2 | GO:0043369 | T-helper cell lineage commitment(GO:0002295) alpha-beta T cell lineage commitment(GO:0002363) CD4-positive or CD8-positive, alpha-beta T cell lineage commitment(GO:0043369) CD4-positive, alpha-beta T cell lineage commitment(GO:0043373) T-helper 17 cell lineage commitment(GO:0072540) |
0.1 | 0.2 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.1 | GO:0010958 | regulation of amino acid import(GO:0010958) |
0.1 | 2.2 | GO:0006940 | regulation of smooth muscle contraction(GO:0006940) |
0.1 | 0.3 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
0.1 | 0.1 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
0.1 | 0.5 | GO:0035994 | response to muscle stretch(GO:0035994) |
0.1 | 0.3 | GO:0032461 | positive regulation of protein oligomerization(GO:0032461) |
0.1 | 0.1 | GO:0060426 | lung vasculature development(GO:0060426) |
0.1 | 0.2 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
0.1 | 0.1 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.1 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.1 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.1 | 0.3 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
0.1 | 0.2 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.1 | 0.2 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
0.1 | 0.1 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.1 | 0.2 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.1 | 0.8 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.1 | 0.5 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.1 | 0.2 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.1 | 0.2 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.1 | 0.1 | GO:0090335 | regulation of brown fat cell differentiation(GO:0090335) |
0.1 | 0.2 | GO:0042045 | epithelial fluid transport(GO:0042045) |
0.1 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.1 | 0.2 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.1 | GO:0048143 | astrocyte activation(GO:0048143) |
0.1 | 0.4 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.1 | 0.3 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.1 | 0.2 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.1 | 0.2 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.1 | 0.2 | GO:0042520 | positive regulation of tyrosine phosphorylation of Stat4 protein(GO:0042520) |
0.1 | 0.2 | GO:0097283 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
0.1 | 0.2 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 0.4 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
0.1 | 0.4 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
0.0 | 0.1 | GO:0061623 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.0 | 0.2 | GO:2000637 | positive regulation of gene silencing by miRNA(GO:2000637) |
0.0 | 0.3 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.0 | 0.0 | GO:0035425 | autocrine signaling(GO:0035425) |
0.0 | 0.1 | GO:0071731 | response to nitric oxide(GO:0071731) |
0.0 | 0.6 | GO:0010884 | positive regulation of lipid storage(GO:0010884) |
0.0 | 0.1 | GO:0030421 | defecation(GO:0030421) |
0.0 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.0 | 0.2 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.1 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.0 | 0.1 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.0 | 0.1 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.0 | 0.2 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.0 | 0.0 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
0.0 | 0.0 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.0 | 0.0 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
0.0 | 0.3 | GO:0014037 | Schwann cell differentiation(GO:0014037) |
0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.1 | GO:0032570 | response to progesterone(GO:0032570) |
0.0 | 0.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.2 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.0 | 0.1 | GO:2000544 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
0.0 | 0.5 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.0 | 0.6 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.0 | 0.1 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.0 | 0.1 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.0 | 0.3 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
0.0 | 0.5 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.0 | 0.0 | GO:0045408 | regulation of interleukin-6 biosynthetic process(GO:0045408) |
0.0 | 0.0 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.0 | 0.7 | GO:0048535 | lymph node development(GO:0048535) |
0.0 | 0.1 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.0 | 0.4 | GO:0010922 | positive regulation of phosphatase activity(GO:0010922) |
0.0 | 0.4 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.1 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.0 | 0.1 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.0 | 0.9 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.0 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.0 | 0.0 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.0 | 0.1 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.0 | 1.2 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
0.0 | 0.8 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
0.0 | 0.5 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.0 | 1.8 | GO:0002062 | chondrocyte differentiation(GO:0002062) |
0.0 | 0.0 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.0 | 0.1 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
0.0 | 0.2 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.0 | 0.2 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.2 | GO:0009597 | detection of virus(GO:0009597) |
0.0 | 0.1 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.0 | 0.1 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
0.0 | 0.1 | GO:0046060 | dATP metabolic process(GO:0046060) |
0.0 | 0.2 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.0 | 0.2 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.0 | 0.4 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 0.1 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.1 | GO:0045991 | carbon catabolite activation of transcription(GO:0045991) |
0.0 | 0.1 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.0 | 0.2 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
0.0 | 0.4 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
0.0 | 0.1 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.0 | 0.3 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.0 | 0.1 | GO:0030501 | positive regulation of bone mineralization(GO:0030501) |
0.0 | 0.0 | GO:0070431 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.0 | 0.2 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.2 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.0 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.0 | 0.1 | GO:0090148 | membrane fission(GO:0090148) |
0.0 | 0.3 | GO:0030033 | microvillus assembly(GO:0030033) |
0.0 | 0.0 | GO:0014829 | vascular smooth muscle contraction(GO:0014829) |
0.0 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.0 | 0.1 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.0 | 0.0 | GO:0060605 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.0 | 0.0 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.0 | 0.0 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.0 | 0.2 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 1.2 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.2 | GO:0097152 | mesenchymal cell apoptotic process(GO:0097152) |
0.0 | 0.2 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.4 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
0.0 | 0.1 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.0 | 0.1 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.0 | 0.3 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.0 | 0.1 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.0 | 0.1 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.0 | 0.1 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.0 | 0.2 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
0.0 | 0.0 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.0 | 0.1 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.0 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.1 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) |
0.0 | 0.1 | GO:0071600 | otic vesicle morphogenesis(GO:0071600) |
0.0 | 0.2 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.0 | 0.1 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
0.0 | 0.0 | GO:0035608 | protein deglutamylation(GO:0035608) |
0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.0 | 0.1 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
0.0 | 0.5 | GO:0009303 | rRNA transcription(GO:0009303) |
0.0 | 0.2 | GO:0014072 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
0.0 | 0.1 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.0 | 0.1 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.0 | 0.5 | GO:0003351 | epithelial cilium movement(GO:0003351) |
0.0 | 0.2 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
0.0 | 0.1 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.0 | 0.1 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.2 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.0 | 0.2 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.0 | 0.1 | GO:0021747 | cochlear nucleus development(GO:0021747) |
0.0 | 0.1 | GO:0060037 | pharyngeal system development(GO:0060037) |
0.0 | 0.1 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.0 | 0.1 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
0.0 | 0.0 | GO:1902262 | apoptotic process involved in patterning of blood vessels(GO:1902262) |
0.0 | 0.0 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.0 | 0.7 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
0.0 | 0.2 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.0 | 0.0 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.0 | 0.2 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
0.0 | 0.1 | GO:2000303 | regulation of ceramide biosynthetic process(GO:2000303) |
0.0 | 0.8 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.0 | 0.3 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 0.0 | GO:0060463 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
0.0 | 0.7 | GO:0045668 | negative regulation of osteoblast differentiation(GO:0045668) |
0.0 | 0.0 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.0 | 0.2 | GO:0030575 | nuclear body organization(GO:0030575) |
0.0 | 0.3 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.0 | 0.1 | GO:0060307 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
0.0 | 0.1 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.0 | 0.1 | GO:0071402 | cellular response to lipoprotein particle stimulus(GO:0071402) |
0.0 | 0.0 | GO:0019660 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.0 | 0.2 | GO:0060177 | regulation of angiotensin metabolic process(GO:0060177) |
0.0 | 0.3 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.6 | GO:0048255 | mRNA stabilization(GO:0048255) |
0.0 | 1.2 | GO:0010508 | positive regulation of autophagy(GO:0010508) |
0.0 | 0.0 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
0.0 | 0.1 | GO:0051458 | corticotropin secretion(GO:0051458) |
0.0 | 0.1 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
0.0 | 0.2 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.0 | GO:0060676 | ureteric bud formation(GO:0060676) |
0.0 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.2 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.0 | 0.2 | GO:0043545 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.0 | 0.0 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.0 | 0.4 | GO:0072661 | protein targeting to plasma membrane(GO:0072661) |
0.0 | 0.1 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.1 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
0.0 | 0.1 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.0 | 0.1 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.1 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.1 | GO:0090383 | phagosome acidification(GO:0090383) |
0.0 | 0.1 | GO:0046125 | thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.0 | 0.2 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
0.0 | 0.2 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.0 | 0.0 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
0.0 | 0.1 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.3 | GO:0016556 | mRNA modification(GO:0016556) |
0.0 | 0.1 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
0.0 | 0.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.1 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.0 | 0.3 | GO:0060074 | synapse maturation(GO:0060074) |
0.0 | 0.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.2 | GO:0003081 | regulation of systemic arterial blood pressure by renin-angiotensin(GO:0003081) |
0.0 | 0.1 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.0 | 0.1 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
0.0 | 0.3 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.0 | 0.3 | GO:0035329 | hippo signaling(GO:0035329) |
0.0 | 0.2 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
0.0 | 0.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.0 | 0.1 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.0 | GO:0060460 | left lung morphogenesis(GO:0060460) |
0.0 | 0.0 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.0 | 0.0 | GO:1905208 | negative regulation of cardiocyte differentiation(GO:1905208) |
0.0 | 0.1 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.0 | 0.1 | GO:0046049 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.0 | 0.1 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.0 | 0.1 | GO:0002892 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
0.0 | 0.2 | GO:0032964 | collagen biosynthetic process(GO:0032964) |
0.0 | 0.1 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.0 | 0.1 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
0.0 | 0.0 | GO:0070920 | regulation of production of small RNA involved in gene silencing by RNA(GO:0070920) |
0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.1 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.1 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.0 | 0.0 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) |
0.0 | 0.1 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.4 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.0 | 0.0 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.0 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.0 | 0.1 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.0 | 0.1 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.3 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.0 | 0.1 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.0 | 0.3 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.1 | GO:0090270 | fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) |
0.0 | 0.1 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.1 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.0 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.0 | 0.0 | GO:0045064 | T-helper 2 cell differentiation(GO:0045064) |
0.0 | 0.1 | GO:0010592 | positive regulation of lamellipodium assembly(GO:0010592) |
0.0 | 0.0 | GO:0032831 | positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.0 | 0.1 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
0.0 | 0.1 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.0 | 0.1 | GO:0043312 | neutrophil degranulation(GO:0043312) |
0.0 | 0.1 | GO:0045404 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.0 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
0.0 | 0.4 | GO:0070207 | protein homotrimerization(GO:0070207) |
0.0 | 0.0 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.0 | 0.1 | GO:0060022 | hard palate development(GO:0060022) |
0.0 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.1 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.0 | 0.1 | GO:0033687 | osteoblast proliferation(GO:0033687) |
0.0 | 0.0 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.0 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.0 | 0.0 | GO:0021557 | oculomotor nerve development(GO:0021557) trochlear nerve development(GO:0021558) |
0.0 | 0.0 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
0.0 | 0.0 | GO:1903935 | response to sodium arsenite(GO:1903935) |
0.0 | 0.0 | GO:0031269 | pseudopodium assembly(GO:0031269) |
0.0 | 0.1 | GO:0006216 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.0 | 0.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.0 | 0.0 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.0 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.1 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) regulation of NADP metabolic process(GO:1902031) |
0.0 | 0.1 | GO:0010544 | negative regulation of platelet activation(GO:0010544) |
0.0 | 0.2 | GO:0002828 | regulation of type 2 immune response(GO:0002828) |
0.0 | 0.0 | GO:1903514 | release of sequestered calcium ion into cytosol by sarcoplasmic reticulum(GO:0014808) calcium ion transport from endoplasmic reticulum to cytosol(GO:1903514) |
0.0 | 0.1 | GO:0007603 | phototransduction, visible light(GO:0007603) |
0.0 | 0.1 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
0.0 | 0.0 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.1 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.0 | 0.2 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.1 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.0 | 0.0 | GO:1904749 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.0 | 0.0 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.0 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.0 | 0.1 | GO:0070572 | positive regulation of neuron projection regeneration(GO:0070572) |
0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.0 | 0.0 | GO:0002676 | regulation of chronic inflammatory response(GO:0002676) |
0.0 | 0.0 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.0 | 0.1 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
0.0 | 0.0 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.0 | 0.0 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.0 | 0.2 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
0.0 | 0.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.0 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.0 | 0.0 | GO:0032495 | response to muramyl dipeptide(GO:0032495) |
0.0 | 0.1 | GO:0090312 | positive regulation of protein deacetylation(GO:0090312) |
0.0 | 0.0 | GO:0061081 | positive regulation of myeloid leukocyte cytokine production involved in immune response(GO:0061081) |
0.0 | 0.1 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 0.0 | GO:0071699 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.0 | 0.0 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.0 | 0.0 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
0.0 | 0.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.0 | 0.1 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.0 | 0.0 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.0 | 0.3 | GO:1903146 | regulation of mitophagy(GO:1903146) |
0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.1 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.0 | 0.1 | GO:0046641 | positive regulation of alpha-beta T cell proliferation(GO:0046641) |
0.0 | 0.3 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
0.0 | 0.1 | GO:0015888 | thiamine transport(GO:0015888) |
0.0 | 0.1 | GO:0015840 | urea transport(GO:0015840) urea transmembrane transport(GO:0071918) |
0.0 | 0.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.0 | 0.1 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.0 | 0.1 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.0 | 0.0 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.0 | 0.1 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
0.0 | 0.0 | GO:0090071 | regulation of ribosome biogenesis(GO:0090069) negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.0 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.0 | 0.1 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.0 | 0.0 | GO:0051944 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.0 | 0.0 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.0 | 0.0 | GO:0042226 | interleukin-6 biosynthetic process(GO:0042226) |
0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.3 | GO:0002066 | columnar/cuboidal epithelial cell development(GO:0002066) |
0.0 | 0.2 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.0 | GO:0048880 | sensory system development(GO:0048880) |
0.0 | 0.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.0 | GO:0003266 | cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) regulation of secondary heart field cardioblast proliferation(GO:0003266) |
0.0 | 0.0 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.0 | 0.3 | GO:0006301 | postreplication repair(GO:0006301) |
0.0 | 0.0 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.0 | 0.1 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
0.0 | 0.4 | GO:0009395 | phospholipid catabolic process(GO:0009395) |
0.0 | 0.2 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.0 | 0.1 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.3 | GO:0032355 | response to estradiol(GO:0032355) |
0.0 | 0.1 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) negative regulation of sprouting angiogenesis(GO:1903671) |
0.0 | 0.1 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.0 | 0.1 | GO:0010165 | response to X-ray(GO:0010165) |
0.0 | 0.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.0 | 0.0 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.0 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
0.0 | 0.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.4 | GO:0001895 | retina homeostasis(GO:0001895) |
0.0 | 0.0 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.0 | 0.5 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.0 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.0 | 0.0 | GO:2000425 | regulation of apoptotic cell clearance(GO:2000425) |
0.0 | 0.0 | GO:0032070 | regulation of deoxyribonuclease activity(GO:0032070) |
0.0 | 0.0 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.0 | 0.0 | GO:0015819 | lysine transport(GO:0015819) |
0.0 | 0.0 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.0 | 0.0 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.0 | 0.0 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.0 | 0.0 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
0.0 | 0.1 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.0 | 0.0 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
0.0 | 0.0 | GO:0048539 | bone marrow development(GO:0048539) |
0.0 | 0.1 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.0 | 0.2 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
0.0 | 0.1 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
0.0 | 0.1 | GO:1990090 | response to nerve growth factor(GO:1990089) cellular response to nerve growth factor stimulus(GO:1990090) |
0.0 | 0.1 | GO:0015808 | L-alanine transport(GO:0015808) |
0.0 | 0.1 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.0 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.0 | GO:0045047 | protein targeting to ER(GO:0045047) |
0.0 | 0.0 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
0.0 | 0.0 | GO:0019471 | 4-hydroxyproline metabolic process(GO:0019471) |
0.0 | 0.0 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.0 | 0.1 | GO:0051156 | glucose 6-phosphate metabolic process(GO:0051156) |
0.0 | 0.0 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.0 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.0 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
0.0 | 0.1 | GO:0031055 | chromatin remodeling at centromere(GO:0031055) CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.0 | GO:0046075 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
0.0 | 0.0 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.1 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
0.0 | 0.0 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
0.0 | 0.0 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.0 | 0.3 | GO:0003341 | cilium movement(GO:0003341) |
0.0 | 0.0 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.0 | 0.0 | GO:0032328 | alanine transport(GO:0032328) |
0.0 | 0.1 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.0 | 0.1 | GO:0060746 | parental behavior(GO:0060746) |
0.0 | 0.1 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.0 | 0.0 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.0 | GO:0006498 | N-terminal protein lipidation(GO:0006498) |
0.0 | 0.1 | GO:0014823 | response to activity(GO:0014823) |
0.0 | 0.0 | GO:1903224 | regulation of endodermal cell differentiation(GO:1903224) |
0.0 | 0.0 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.0 | 0.1 | GO:0007343 | egg activation(GO:0007343) |
0.0 | 0.0 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 0.0 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.0 | 0.0 | GO:0042635 | positive regulation of hair cycle(GO:0042635) |
0.0 | 0.0 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 0.0 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.0 | 0.0 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.0 | 0.0 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.1 | GO:1901409 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.0 | 0.0 | GO:0032692 | negative regulation of interleukin-1 production(GO:0032692) |
0.0 | 0.1 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.0 | 0.0 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
0.0 | 0.0 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.0 | 0.0 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.0 | 0.0 | GO:1904238 | pericyte cell differentiation(GO:1904238) |
0.0 | 0.0 | GO:0060433 | bronchus development(GO:0060433) |
0.0 | 0.1 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
0.0 | 0.1 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
0.0 | 0.0 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.0 | 0.0 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
0.0 | 0.2 | GO:0048247 | lymphocyte chemotaxis(GO:0048247) |
0.0 | 0.0 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
0.0 | 0.0 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.0 | 0.0 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 0.1 | GO:0048753 | pigment granule organization(GO:0048753) |
0.0 | 0.0 | GO:0032714 | negative regulation of interleukin-5 production(GO:0032714) |
0.0 | 0.1 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.0 | GO:0046110 | xanthine catabolic process(GO:0009115) xanthine metabolic process(GO:0046110) |
0.0 | 0.1 | GO:2000050 | regulation of non-canonical Wnt signaling pathway(GO:2000050) |
0.0 | 0.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.0 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 10.0 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.7 | 3.0 | GO:0030478 | actin cap(GO:0030478) |
0.7 | 4.4 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.7 | 5.3 | GO:0016460 | myosin II complex(GO:0016460) |
0.5 | 1.5 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.4 | 2.0 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.4 | 1.2 | GO:0005914 | spot adherens junction(GO:0005914) |
0.4 | 2.5 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.3 | 2.8 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.3 | 1.2 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.3 | 0.9 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.3 | 2.3 | GO:0030056 | hemidesmosome(GO:0030056) |
0.3 | 0.9 | GO:0097427 | microtubule bundle(GO:0097427) |
0.3 | 0.8 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.2 | 5.4 | GO:0036379 | myofilament(GO:0036379) |
0.2 | 0.7 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.2 | 1.4 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.2 | 1.8 | GO:0045179 | apical cortex(GO:0045179) |
0.2 | 1.3 | GO:0005915 | zonula adherens(GO:0005915) |
0.2 | 0.6 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.2 | 3.2 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.2 | 1.5 | GO:0043034 | costamere(GO:0043034) |
0.2 | 1.1 | GO:0031983 | vesicle lumen(GO:0031983) |
0.2 | 0.5 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.2 | 0.7 | GO:0071953 | elastic fiber(GO:0071953) |
0.2 | 0.5 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.2 | 0.9 | GO:0031430 | M band(GO:0031430) |
0.2 | 2.0 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.2 | 1.3 | GO:0042587 | glycogen granule(GO:0042587) |
0.2 | 8.1 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.2 | 0.5 | GO:0043293 | apoptosome(GO:0043293) |
0.2 | 0.5 | GO:0032437 | cuticular plate(GO:0032437) |
0.1 | 2.3 | GO:0002102 | podosome(GO:0002102) |
0.1 | 0.4 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.1 | 0.6 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.1 | 0.7 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 0.3 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 0.3 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.5 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 11.0 | GO:0031674 | I band(GO:0031674) |
0.1 | 0.9 | GO:0090543 | Flemming body(GO:0090543) |
0.1 | 0.5 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.7 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 0.2 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.1 | 0.3 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 0.3 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 0.4 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.1 | 1.9 | GO:0097440 | apical dendrite(GO:0097440) |
0.1 | 0.7 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.4 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.1 | 1.2 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.1 | 1.7 | GO:0030057 | desmosome(GO:0030057) |
0.1 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
0.1 | 0.4 | GO:0031528 | microvillus membrane(GO:0031528) |
0.1 | 0.3 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.1 | 0.7 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.4 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 0.4 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 6.9 | GO:0005604 | basement membrane(GO:0005604) |
0.1 | 0.2 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.6 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 0.2 | GO:0099738 | cell cortex region(GO:0099738) |
0.1 | 0.9 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.2 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.7 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.1 | 0.1 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 0.5 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.1 | 0.3 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.1 | 0.2 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.3 | GO:0035339 | SPOTS complex(GO:0035339) |
0.1 | 0.2 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.1 | 0.4 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.1 | 0.2 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.1 | 5.1 | GO:0043296 | apical junction complex(GO:0043296) |
0.1 | 0.7 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.1 | 0.5 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.8 | GO:0030017 | sarcomere(GO:0030017) |
0.1 | 0.2 | GO:1990635 | proximal dendrite(GO:1990635) |
0.1 | 0.3 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.1 | 0.3 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.1 | 0.2 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.1 | 0.3 | GO:0032982 | myosin filament(GO:0032982) |
0.1 | 0.2 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.1 | 0.2 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.1 | 0.3 | GO:0016589 | NURF complex(GO:0016589) |
0.1 | 0.2 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 0.4 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.1 | 0.4 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.1 | 0.2 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 4.6 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 0.4 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 0.4 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.3 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 0.1 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.1 | GO:1990696 | USH2 complex(GO:1990696) |
0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.0 | 0.4 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.4 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.8 | GO:0042588 | zymogen granule(GO:0042588) |
0.0 | 0.3 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 3.3 | GO:0036064 | ciliary basal body(GO:0036064) |
0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 1.4 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.4 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 10.9 | GO:0005925 | focal adhesion(GO:0005925) |
0.0 | 0.2 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.0 | 0.3 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.1 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.2 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
0.0 | 1.2 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.3 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 2.9 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.0 | 0.1 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.3 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.3 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.0 | 0.2 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
0.0 | 0.6 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
0.0 | 2.5 | GO:0001669 | acrosomal vesicle(GO:0001669) |
0.0 | 0.5 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.0 | 1.5 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 1.6 | GO:0031526 | brush border membrane(GO:0031526) |
0.0 | 0.4 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.2 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 0.3 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.0 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.0 | 5.6 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.0 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
0.0 | 0.6 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.1 | GO:0051286 | cell tip(GO:0051286) |
0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.1 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.0 | 0.2 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.1 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.0 | 0.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.0 | 0.0 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
0.0 | 0.1 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.2 | GO:0030897 | HOPS complex(GO:0030897) |
0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.0 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.0 | 0.0 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.1 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.0 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.0 | 0.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.0 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.1 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.0 | GO:0000235 | astral microtubule(GO:0000235) |
0.0 | 0.7 | GO:0098862 | cluster of actin-based cell projections(GO:0098862) |
0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.1 | GO:0005858 | axonemal dynein complex(GO:0005858) |
0.0 | 0.0 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.0 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.3 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.6 | 4.8 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
1.5 | 6.0 | GO:0031433 | telethonin binding(GO:0031433) |
0.8 | 2.5 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.8 | 8.7 | GO:0048185 | activin binding(GO:0048185) |
0.6 | 1.9 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.5 | 3.3 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.5 | 5.8 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.5 | 5.5 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.5 | 2.8 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.4 | 2.6 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.4 | 1.3 | GO:0030172 | troponin C binding(GO:0030172) |
0.4 | 0.4 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.4 | 1.2 | GO:0048030 | disaccharide binding(GO:0048030) |
0.4 | 2.0 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.4 | 1.2 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.4 | 1.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.4 | 1.9 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.3 | 4.2 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.3 | 1.0 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.3 | 2.4 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.3 | 1.2 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.3 | 0.9 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.3 | 0.9 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.3 | 0.8 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.3 | 0.8 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.3 | 1.3 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.2 | 2.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.2 | 1.5 | GO:0030274 | LIM domain binding(GO:0030274) |
0.2 | 1.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.2 | 2.4 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.2 | 1.6 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.2 | 0.7 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.2 | 0.8 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.2 | 0.4 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.2 | 1.2 | GO:0038132 | neuregulin binding(GO:0038132) |
0.2 | 0.4 | GO:0070538 | oleic acid binding(GO:0070538) |
0.2 | 4.4 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.2 | 0.8 | GO:0042731 | PH domain binding(GO:0042731) |
0.2 | 2.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.2 | 0.6 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.2 | 0.6 | GO:0035939 | microsatellite binding(GO:0035939) |
0.2 | 0.8 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.2 | 0.9 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.2 | 1.3 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.2 | 0.6 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.2 | 0.7 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.2 | 0.6 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.2 | 0.4 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.2 | 0.5 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.2 | 0.4 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.2 | 0.5 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.2 | 0.5 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.2 | 1.2 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.2 | 1.7 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.2 | 0.7 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.2 | 0.7 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.2 | 0.8 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.2 | 0.8 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.2 | 0.2 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.2 | 1.4 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.2 | 0.6 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.1 | 0.4 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.1 | 4.3 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.1 | 0.3 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.1 | 1.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.3 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 0.4 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.1 | 0.4 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.1 | 0.6 | GO:0070052 | collagen V binding(GO:0070052) |
0.1 | 0.5 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.1 | 0.3 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.1 | 1.6 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.1 | 1.6 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.1 | 2.0 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.1 | 0.4 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 2.8 | GO:0044688 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.1 | 1.3 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.1 | 0.4 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.1 | 0.4 | GO:0051870 | methotrexate binding(GO:0051870) |
0.1 | 0.4 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.1 | 0.5 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 0.4 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.1 | 0.2 | GO:0051373 | FATZ binding(GO:0051373) |
0.1 | 0.5 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.5 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.1 | 6.0 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.1 | 0.4 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) RNA polymerase II transcription corepressor binding(GO:0001226) |
0.1 | 0.3 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.1 | 0.6 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 1.2 | GO:0051393 | alpha-actinin binding(GO:0051393) |
0.1 | 0.3 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 0.7 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.1 | 0.4 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 1.2 | GO:0016918 | retinal binding(GO:0016918) |
0.1 | 3.0 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.1 | 0.4 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.1 | 0.9 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 1.0 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.1 | 0.3 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.1 | 0.3 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.1 | 0.4 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.1 | 3.3 | GO:0045182 | translation regulator activity(GO:0045182) |
0.1 | 0.8 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.1 | 2.4 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
0.1 | 0.6 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.1 | 0.3 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.1 | 0.7 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 6.5 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.1 | 0.5 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.1 | 0.3 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 0.6 | GO:0015288 | porin activity(GO:0015288) |
0.1 | 1.2 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.3 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 0.9 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 0.5 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.1 | 3.1 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.1 | 0.3 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.1 | 0.6 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.1 | 0.8 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.1 | 0.3 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.1 | 0.4 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.1 | 0.6 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 1.4 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.1 | 1.8 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.1 | 0.2 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.1 | 0.3 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 0.6 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.1 | 0.2 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.1 | 0.2 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.1 | 0.9 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.1 | 0.4 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 0.2 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.1 | 0.2 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
0.1 | 0.5 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.1 | 0.8 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 0.4 | GO:0033265 | choline binding(GO:0033265) |
0.1 | 0.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.1 | 0.3 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 0.4 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.1 | 1.5 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.1 | 0.4 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.1 | 0.6 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.1 | 0.2 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.1 | 0.3 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.1 | 0.1 | GO:0031014 | troponin T binding(GO:0031014) |
0.1 | 1.2 | GO:0001968 | fibronectin binding(GO:0001968) |
0.1 | 0.8 | GO:0051400 | BH domain binding(GO:0051400) |
0.1 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.1 | 0.3 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.3 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.1 | 4.5 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.1 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 0.7 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.1 | 0.3 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 0.3 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.1 | 0.1 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.1 | 0.8 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.1 | 2.5 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
0.1 | 0.5 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
0.1 | 0.5 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.1 | 0.2 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 1.1 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.1 | 0.2 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.1 | 2.3 | GO:0005088 | Ras guanyl-nucleotide exchange factor activity(GO:0005088) |
0.1 | 0.2 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.1 | 0.2 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.1 | 0.5 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.1 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.1 | 0.2 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 0.2 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.1 | 0.5 | GO:0044548 | S100 protein binding(GO:0044548) |
0.1 | 0.2 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.1 | 0.3 | GO:0039706 | co-receptor binding(GO:0039706) |
0.1 | 0.3 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.1 | 0.3 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.1 | 0.2 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.1 | 0.2 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.1 | 0.7 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.1 | 0.2 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.1 | 0.9 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.1 | 0.3 | GO:0042805 | actinin binding(GO:0042805) |
0.1 | 0.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.3 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.1 | 0.2 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.1 | 0.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 0.3 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.1 | 3.8 | GO:0005178 | integrin binding(GO:0005178) |
0.1 | 0.2 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 0.2 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.1 | 0.9 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.1 | 0.1 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.1 | 0.3 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.1 | 0.3 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.1 | 0.3 | GO:0016936 | galactoside binding(GO:0016936) |
0.1 | 0.2 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.0 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.0 | 0.2 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 0.1 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.2 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.4 | GO:0035591 | signaling adaptor activity(GO:0035591) |
0.0 | 0.2 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.2 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.2 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.0 | 0.3 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.5 | GO:0005536 | glucose binding(GO:0005536) |
0.0 | 0.8 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 2.5 | GO:0050839 | cell adhesion molecule binding(GO:0050839) |
0.0 | 0.3 | GO:0035240 | dopamine binding(GO:0035240) |
0.0 | 0.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.0 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.0 | 0.2 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 1.0 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.0 | 0.3 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 2.2 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
0.0 | 1.2 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.0 | 0.3 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.3 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.0 | 0.1 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.0 | 0.1 | GO:0005148 | prolactin receptor binding(GO:0005148) |
0.0 | 0.3 | GO:0034865 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.2 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 0.3 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.1 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.0 | 1.0 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.4 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.0 | 0.0 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.1 | GO:0016419 | S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
0.0 | 0.8 | GO:0098531 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
0.0 | 0.4 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.8 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.2 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.2 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.0 | 0.4 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.1 | GO:0034548 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
0.0 | 0.1 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.1 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.0 | 0.1 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.0 | 0.2 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.0 | 0.7 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.6 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.2 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.2 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.1 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.0 | 0.6 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.2 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.0 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 0.1 | GO:0004802 | transketolase activity(GO:0004802) |
0.0 | 0.2 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.0 | 0.2 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.2 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.0 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
0.0 | 0.3 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 0.3 | GO:0070403 | NAD+ binding(GO:0070403) |
0.0 | 0.1 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.4 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.0 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.0 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.0 | 0.2 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.1 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.0 | 0.1 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.0 | 0.1 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.0 | 0.1 | GO:0036033 | mediator complex binding(GO:0036033) |
0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.0 | 0.1 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
0.0 | 0.5 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.0 | 0.4 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.2 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.0 | 0.4 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.2 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.0 | 0.1 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
0.0 | 0.3 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.7 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
0.0 | 0.1 | GO:0043830 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
0.0 | 0.0 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.0 | 0.2 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.0 | 0.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.0 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.0 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.3 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.0 | 0.2 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.3 | GO:0031402 | sodium ion binding(GO:0031402) |
0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.2 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.0 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.0 | 0.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.3 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.2 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.0 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.0 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.0 | 0.1 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.0 | 0.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 0.0 | GO:0051380 | norepinephrine binding(GO:0051380) |
0.0 | 0.1 | GO:0018631 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.0 | 0.4 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 0.0 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 1.2 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.0 | 0.1 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.0 | 0.0 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.0 | 0.0 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.1 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.0 | 0.1 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 0.6 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.0 | 0.0 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.1 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 0.1 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.1 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.0 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.0 | 0.2 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.0 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.0 | 0.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.2 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.0 | 0.0 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.0 | 0.1 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.0 | 4.8 | GO:0003779 | actin binding(GO:0003779) |
0.0 | 0.3 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.0 | 0.3 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.1 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.0 | 0.0 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.1 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.0 | 0.1 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.0 | 0.4 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.0 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.1 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.0 | 0.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.2 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.0 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.0 | 0.0 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.0 | 0.2 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
0.0 | 0.3 | GO:0032867 | C-3 sterol dehydrogenase (C-4 sterol decarboxylase) activity(GO:0000252) mevaldate reductase activity(GO:0004495) gluconate dehydrogenase activity(GO:0008875) epoxide dehydrogenase activity(GO:0018451) 5-exo-hydroxycamphor dehydrogenase activity(GO:0018452) 2-hydroxytetrahydrofuran dehydrogenase activity(GO:0018453) acetoin dehydrogenase activity(GO:0019152) phenylcoumaran benzylic ether reductase activity(GO:0032442) D-xylose:NADP reductase activity(GO:0032866) L-arabinose:NADP reductase activity(GO:0032867) D-arabinitol dehydrogenase, D-ribulose forming (NADP+) activity(GO:0033709) (R)-(-)-1,2,3,4-tetrahydronaphthol dehydrogenase activity(GO:0034831) 3-hydroxymenthone dehydrogenase activity(GO:0034840) very long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0035380) dihydrotestosterone 17-beta-dehydrogenase activity(GO:0035410) (R)-2-hydroxyisocaproate dehydrogenase activity(GO:0043713) L-arabinose 1-dehydrogenase (NADP+) activity(GO:0044103) L-xylulose reductase (NAD+) activity(GO:0044105) 3-ketoglucose-reductase activity(GO:0048258) D-arabinitol dehydrogenase, D-xylulose forming (NADP+) activity(GO:0052677) |
0.0 | 0.2 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.4 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
0.0 | 0.0 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
0.0 | 0.6 | GO:0034930 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) heparan sulfate 2-O-sulfotransferase activity(GO:0004394) HNK-1 sulfotransferase activity(GO:0016232) heparan sulfate 6-O-sulfotransferase activity(GO:0017095) trans-9R,10R-dihydrodiolphenanthrene sulfotransferase activity(GO:0018721) 1-phenanthrol sulfotransferase activity(GO:0018722) 3-phenanthrol sulfotransferase activity(GO:0018723) 4-phenanthrol sulfotransferase activity(GO:0018724) trans-3,4-dihydrodiolphenanthrene sulfotransferase activity(GO:0018725) 9-phenanthrol sulfotransferase activity(GO:0018726) 2-phenanthrol sulfotransferase activity(GO:0018727) phenanthrol sulfotransferase activity(GO:0019111) 1-hydroxypyrene sulfotransferase activity(GO:0034930) proteoglycan sulfotransferase activity(GO:0050698) cholesterol sulfotransferase activity(GO:0051922) hydroxyjasmonate sulfotransferase activity(GO:0080131) |
0.0 | 0.0 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.0 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.0 | 0.0 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.4 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.0 | 0.0 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
0.0 | 0.1 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.0 | 0.0 | GO:0019862 | IgA binding(GO:0019862) |
0.0 | 0.2 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.0 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.0 | 0.0 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.0 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.0 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.0 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.0 | 0.0 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.0 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.0 | 0.1 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.0 | 0.1 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.0 | 0.0 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.0 | 0.1 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.1 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.0 | 0.1 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.0 | 0.0 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.1 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.0 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.0 | 0.1 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.0 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.0 | 0.3 | GO:0070330 | aromatase activity(GO:0070330) |
0.0 | 0.1 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.1 | GO:0051183 | vitamin transporter activity(GO:0051183) |
0.0 | 0.0 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.0 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
0.0 | 0.2 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.1 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.0 | 0.0 | GO:0004675 | transmembrane receptor protein serine/threonine kinase activity(GO:0004675) |
0.0 | 0.2 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.0 | 0.4 | GO:0008527 | taste receptor activity(GO:0008527) |
0.0 | 0.1 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.0 | 0.1 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 0.1 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.0 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 0.2 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 7.2 | PID RAS PATHWAY | Regulation of Ras family activation |
0.2 | 1.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.2 | 8.7 | NABA COLLAGENS | Genes encoding collagen proteins |
0.2 | 2.1 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.2 | 1.3 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.2 | 4.4 | PID ALK1 PATHWAY | ALK1 signaling events |
0.1 | 8.1 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.1 | 4.4 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.1 | 3.5 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 0.1 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.1 | 3.4 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.1 | 0.5 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.1 | 1.1 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 0.9 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 2.0 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 1.9 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 1.6 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.1 | 2.7 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.1 | 0.2 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.1 | 0.7 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.1 | 2.3 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.1 | 0.1 | ST ADRENERGIC | Adrenergic Pathway |
0.1 | 0.4 | ST STAT3 PATHWAY | STAT3 Pathway |
0.1 | 1.4 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.1 | 1.5 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.1 | 0.4 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.1 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.3 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 0.4 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.1 | 0.8 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.1 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 1.3 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.1 | 1.6 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.1 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.1 | 0.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.1 | 2.1 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 1.2 | PID FGF PATHWAY | FGF signaling pathway |
0.1 | 1.8 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.1 | 0.8 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.1 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.3 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.2 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 1.8 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.5 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.2 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.1 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.5 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.2 | PID EPO PATHWAY | EPO signaling pathway |
0.0 | 0.9 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.5 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.2 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 0.4 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.0 | 1.3 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
0.0 | 0.3 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 0.3 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 1.1 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 1.1 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.4 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.1 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.3 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.3 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.3 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 4.2 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.2 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.1 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.4 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.0 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 0.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.9 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.3 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.0 | 0.3 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 0.3 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.3 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 0.1 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.9 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.0 | 0.4 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 5.1 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.3 | PID RHOA PATHWAY | RhoA signaling pathway |
0.0 | 0.0 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.0 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.9 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.0 | 0.0 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.0 | 0.0 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.0 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 3.0 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.2 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.1 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.2 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.0 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.0 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.0 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.0 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 1.5 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.1 | PID IL1 PATHWAY | IL1-mediated signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 10.5 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.4 | 7.5 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.3 | 4.6 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.2 | 1.8 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.2 | 3.2 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.2 | 10.7 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.2 | 4.2 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.2 | 4.3 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.2 | 1.0 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 1.2 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.1 | 1.1 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 1.5 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.1 | 0.7 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 2.2 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 2.5 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 1.2 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.1 | 1.0 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.1 | 0.5 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.1 | 0.2 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
0.1 | 0.8 | REACTOME OPSINS | Genes involved in Opsins |
0.1 | 3.9 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.1 | 0.1 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.1 | 1.8 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.1 | 2.3 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
0.1 | 1.0 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.1 | 1.0 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.1 | 0.5 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.1 | 0.2 | REACTOME CD28 CO STIMULATION | Genes involved in CD28 co-stimulation |
0.1 | 0.2 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.1 | 0.7 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.1 | 0.3 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.1 | 0.5 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.1 | 1.4 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.1 | 2.1 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.1 | 1.7 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.1 | 0.8 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.1 | 2.4 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.1 | 0.7 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.1 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.1 | 0.5 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 2.2 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.6 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.1 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.0 | 0.7 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
0.0 | 0.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 0.5 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.0 | 0.5 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.0 | 0.5 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.0 | 0.0 | REACTOME CDK MEDIATED PHOSPHORYLATION AND REMOVAL OF CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
0.0 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.4 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.0 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.1 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
0.0 | 0.7 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.3 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.9 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.0 | 0.2 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.0 | 0.6 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.2 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 0.1 | REACTOME P75NTR SIGNALS VIA NFKB | Genes involved in p75NTR signals via NF-kB |
0.0 | 0.7 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.6 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.0 | 0.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.5 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.2 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.0 | 0.5 | REACTOME NEGATIVE REGULATION OF FGFR SIGNALING | Genes involved in Negative regulation of FGFR signaling |
0.0 | 0.5 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.3 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.0 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.0 | 0.9 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.3 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.2 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
0.0 | 0.2 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
0.0 | 0.1 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.0 | 0.2 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.0 | 0.1 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.2 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.2 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.0 | 0.3 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 2.0 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.3 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 0.3 | REACTOME GPCR LIGAND BINDING | Genes involved in GPCR ligand binding |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.0 | 0.9 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 1.2 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 1.6 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.2 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.2 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.6 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.4 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.6 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 0.0 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.0 | 0.9 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.9 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.0 | 0.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.0 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
0.0 | 0.1 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.0 | 0.4 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 1.7 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.3 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.0 | 0.1 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 0.3 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.1 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.5 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.0 | 0.2 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.3 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.3 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.1 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.0 | 0.2 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
0.0 | 0.1 | REACTOME INNATE IMMUNE SYSTEM | Genes involved in Innate Immune System |
0.0 | 0.1 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 1.3 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.1 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.0 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 0.1 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |