Gene Symbol | Gene ID | Gene Info |
---|---|---|
Tfeb
|
ENSMUSG00000023990.12 | Tfeb |
Usf1
|
ENSMUSG00000026641.7 | Usf1 |
Srebf1
|
ENSMUSG00000020538.9 | Srebf1 |
Usf2
|
ENSMUSG00000058239.7 | Usf2 |
Bhlhe41
|
ENSMUSG00000030256.5 | Bhlhe41 |
Srebf2
|
ENSMUSG00000022463.7 | Srebf2 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Bhlhe41 | chr6_145865172_145865840 | 52 | 0.967919 | 0.68 | 2.5e-09 | Click! |
Bhlhe41 | chr6_145866067_145866750 | 850 | 0.561646 | 0.50 | 5.3e-05 | Click! |
Bhlhe41 | chr6_145886508_145886659 | 21025 | 0.144968 | -0.17 | 1.9e-01 | Click! |
Bhlhe41 | chr6_145886331_145886482 | 20848 | 0.145326 | -0.03 | 8.4e-01 | Click! |
Bhlhe41 | chr6_145886668_145886852 | 21202 | 0.144609 | -0.02 | 8.6e-01 | Click! |
Srebf1 | chr11_60216424_60216575 | 4105 | 0.134814 | -0.50 | 4.0e-05 | Click! |
Srebf1 | chr11_60216900_60217373 | 3468 | 0.144771 | -0.50 | 4.3e-05 | Click! |
Srebf1 | chr11_60217632_60217783 | 2897 | 0.159237 | -0.44 | 4.1e-04 | Click! |
Srebf1 | chr11_60222693_60223414 | 472 | 0.704772 | 0.40 | 1.6e-03 | Click! |
Srebf1 | chr11_60218472_60218784 | 1976 | 0.209537 | -0.34 | 7.0e-03 | Click! |
Srebf2 | chr15_82146546_82146977 | 420 | 0.717015 | 0.39 | 2.0e-03 | Click! |
Srebf2 | chr15_82164018_82164169 | 16068 | 0.087443 | -0.27 | 3.7e-02 | Click! |
Srebf2 | chr15_82164218_82164773 | 16470 | 0.086884 | -0.26 | 4.2e-02 | Click! |
Srebf2 | chr15_82152137_82152288 | 4187 | 0.117882 | -0.23 | 7.1e-02 | Click! |
Srebf2 | chr15_82147329_82148216 | 241 | 0.858984 | 0.20 | 1.2e-01 | Click! |
Tfeb | chr17_47737108_47738630 | 59 | 0.951154 | 0.45 | 2.9e-04 | Click! |
Tfeb | chr17_47772059_47772210 | 2896 | 0.179949 | -0.37 | 3.5e-03 | Click! |
Tfeb | chr17_47743196_47743617 | 4503 | 0.125466 | -0.29 | 2.5e-02 | Click! |
Tfeb | chr17_47809903_47810054 | 20537 | 0.108864 | -0.29 | 2.6e-02 | Click! |
Tfeb | chr17_47769448_47769703 | 337 | 0.828039 | -0.25 | 5.5e-02 | Click! |
Usf1 | chr1_171411063_171411257 | 153 | 0.893271 | 0.63 | 6.2e-08 | Click! |
Usf1 | chr1_171415761_171415912 | 1494 | 0.200243 | -0.41 | 1.2e-03 | Click! |
Usf1 | chr1_171413555_171413706 | 1949 | 0.156252 | -0.37 | 3.8e-03 | Click! |
Usf1 | chr1_171411392_171412514 | 272 | 0.801448 | 0.35 | 5.8e-03 | Click! |
Usf1 | chr1_171414192_171414609 | 2719 | 0.120016 | -0.29 | 2.6e-02 | Click! |
Usf2 | chr7_30954547_30954698 | 828 | 0.287810 | -0.26 | 4.1e-02 | Click! |
Usf2 | chr7_30955780_30956931 | 116 | 0.747082 | 0.25 | 5.8e-02 | Click! |
Usf2 | chr7_30954288_30954439 | 1087 | 0.217293 | -0.22 | 8.7e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr5_104046345_104046782 | 11.11 |
Nudt9 |
nudix (nucleoside diphosphate linked moiety X)-type motif 9 |
37 |
0.92 |
chr4_34882920_34883280 | 7.65 |
Zfp292 |
zinc finger protein 292 |
140 |
0.94 |
chr1_191224508_191225332 | 7.14 |
D730003I15Rik |
RIKEN cDNA D730003I15 gene |
446 |
0.76 |
chr5_136170674_136171277 | 7.11 |
Orai2 |
ORAI calcium release-activated calcium modulator 2 |
262 |
0.85 |
chr4_118620317_118620501 | 5.48 |
Cfap57 |
cilia and flagella associated protein 57 |
4 |
0.85 |
chr17_44350674_44350845 | 5.46 |
Gm49872 |
predicted gene, 49872 |
17144 |
0.27 |
chr2_128278642_128278914 | 5.43 |
Morrbid |
myeloid RNA regulator of BCL2L11 induced cell death |
37221 |
0.18 |
chr17_47174837_47175202 | 5.21 |
Trerf1 |
transcriptional regulating factor 1 |
33803 |
0.17 |
chr11_70240091_70240373 | 5.15 |
Rnasek |
ribonuclease, RNase K |
390 |
0.4 |
chr8_35708075_35708343 | 5.10 |
1700015I17Rik |
RIKEN cDNA 1700015I17 gene |
11740 |
0.15 |
chr14_72603037_72603374 | 5.07 |
Fndc3a |
fibronectin type III domain containing 3A |
243 |
0.94 |
chr15_5009632_5010034 | 4.90 |
Gm25652 |
predicted gene, 25652 |
25527 |
0.15 |
chr6_145187575_145187803 | 4.90 |
Gm15543 |
predicted gene 15543 |
5414 |
0.12 |
chr6_116337716_116338029 | 4.90 |
Gm44957 |
predicted gene 44957 |
77 |
0.6 |
chr9_21367143_21367679 | 4.85 |
Ilf3 |
interleukin enhancer binding factor 3 |
460 |
0.65 |
chr9_113708285_113708476 | 4.79 |
Pdcd6ip |
programmed cell death 6 interacting protein |
121 |
0.97 |
chr6_145855324_145856436 | 4.73 |
Gm43909 |
predicted gene, 43909 |
7417 |
0.17 |
chr17_5006967_5007748 | 4.70 |
Arid1b |
AT rich interactive domain 1B (SWI-like) |
10928 |
0.24 |
chr14_101886064_101886474 | 4.56 |
Lmo7 |
LIM domain only 7 |
2150 |
0.43 |
chr18_76542618_76543294 | 4.55 |
Gm31933 |
predicted gene, 31933 |
89914 |
0.09 |
chr18_57785762_57786717 | 4.48 |
Gm19519 |
predicted gene, 19519 |
6094 |
0.27 |
chr18_21735322_21735581 | 4.46 |
Klhl14 |
kelch-like 14 |
80733 |
0.1 |
chr12_98215602_98215753 | 4.37 |
Galc |
galactosylceramidase |
851 |
0.61 |
chr10_67285482_67285677 | 4.36 |
Nrbf2 |
nuclear receptor binding factor 2 |
274 |
0.9 |
chr7_29168805_29169490 | 4.35 |
Spred3 |
sprouty-related EVH1 domain containing 3 |
500 |
0.5 |
chr19_33761196_33761926 | 4.25 |
Lipo3 |
lipase, member O3 |
390 |
0.81 |
chr18_12168572_12168723 | 4.22 |
Rmc1 |
regulator of MON1-CCZ1 |
70 |
0.96 |
chr3_126596101_126596252 | 4.18 |
Camk2d |
calcium/calmodulin-dependent protein kinase II, delta |
126 |
0.95 |
chr3_97768424_97768575 | 4.17 |
Pde4dip |
phosphodiesterase 4D interacting protein (myomegalin) |
490 |
0.81 |
chr1_40085892_40086401 | 4.15 |
Il1r2 |
interleukin 1 receptor, type II |
161 |
0.66 |
chr11_11461741_11462055 | 4.11 |
Spata48 |
spermatogenesis associated 48 |
196 |
0.78 |
chr3_41182227_41182448 | 4.05 |
Gm40038 |
predicted gene, 40038 |
9674 |
0.24 |
chr6_3344876_3345553 | 4.05 |
Gm20559 |
predicted gene, 20559 |
836 |
0.47 |
chr13_98589148_98589633 | 4.02 |
Gm4815 |
predicted gene 4815 |
24111 |
0.11 |
chr14_26579307_26579508 | 3.96 |
Dennd6a |
DENN/MADD domain containing 6A |
154 |
0.93 |
chr3_129330284_129331144 | 3.90 |
Enpep |
glutamyl aminopeptidase |
1550 |
0.35 |
chr13_41355674_41356040 | 3.88 |
Nedd9 |
neural precursor cell expressed, developmentally down-regulated gene 9 |
3390 |
0.18 |
chr5_93092272_93092423 | 3.85 |
Gm43173 |
predicted gene 43173 |
1004 |
0.28 |
chr8_77717432_77717888 | 3.77 |
4933431K23Rik |
RIKEN cDNA 4933431K23 gene |
5924 |
0.19 |
chr13_48624936_48625515 | 3.76 |
Ptpdc1 |
protein tyrosine phosphatase domain containing 1 |
284 |
0.88 |
chr5_110859375_110859531 | 3.70 |
Chek2 |
checkpoint kinase 2 |
6818 |
0.12 |
chr1_78537079_78538149 | 3.66 |
Mogat1 |
monoacylglycerol O-acyltransferase 1 |
14 |
0.97 |
chr9_41950850_41951266 | 3.64 |
Sorl1 |
sortilin-related receptor, LDLR class A repeats-containing |
23529 |
0.17 |
chr19_3325512_3326114 | 3.58 |
Cpt1a |
carnitine palmitoyltransferase 1a, liver |
2465 |
0.19 |
chr17_29503441_29503611 | 3.57 |
Pim1 |
proviral integration site 1 |
10119 |
0.1 |
chr3_130172624_130173051 | 3.57 |
Col25a1 |
collagen, type XXV, alpha 1 |
8054 |
0.19 |
chr5_31153570_31154229 | 3.56 |
Mpv17 |
MpV17 mitochondrial inner membrane protein |
157 |
0.87 |
chr3_130730536_130730827 | 3.54 |
Gm42997 |
predicted gene 42997 |
80 |
0.75 |
chr3_36613398_36613746 | 3.54 |
Bbs7 |
Bardet-Biedl syndrome 7 (human) |
95 |
0.96 |
chr2_70901174_70901930 | 3.53 |
Gm13632 |
predicted gene 13632 |
23723 |
0.18 |
chr15_102510791_102511103 | 3.51 |
Map3k12 |
mitogen-activated protein kinase kinase kinase 12 |
155 |
0.9 |
chr8_48224531_48225227 | 3.47 |
Gm32842 |
predicted gene, 32842 |
46106 |
0.16 |
chr2_121448558_121449187 | 3.45 |
Serf2 |
small EDRK-rich factor 2 |
323 |
0.7 |
chr6_100975965_100976485 | 3.45 |
Gm43941 |
predicted gene, 43941 |
15236 |
0.19 |
chr19_33589497_33590410 | 3.44 |
AC141640.1 |
renalase, FAD-dependent amine oxidase (Rnls) pseudogene |
54 |
0.82 |
chrX_134751410_134751672 | 3.44 |
Armcx6 |
armadillo repeat containing, X-linked 6 |
124 |
0.92 |
chr4_137664564_137664771 | 3.43 |
Rap1gap |
Rap1 GTPase-activating protein |
59 |
0.97 |
chr6_52838006_52838157 | 3.42 |
Gm15572 |
predicted gene 15572 |
5620 |
0.24 |
chrX_13070376_13070983 | 3.38 |
Usp9x |
ubiquitin specific peptidase 9, X chromosome |
819 |
0.63 |
chr11_61504872_61505054 | 3.37 |
B9d1os |
B9 protein domain 1, opposite strand |
96 |
0.61 |
chr11_101086944_101087265 | 3.32 |
Mlx |
MAX-like protein X |
173 |
0.87 |
chr2_72633750_72634151 | 3.30 |
Ak3l2-ps |
adenylate kinase 3-like 2, pseudogene |
14 |
0.97 |
chr10_33904707_33905726 | 3.29 |
Rsph4a |
radial spoke head 4 homolog A (Chlamydomonas) |
105 |
0.94 |
chr14_70780830_70781723 | 3.28 |
Dok2 |
docking protein 2 |
4566 |
0.21 |
chr7_127376058_127376333 | 3.27 |
Zfp747 |
zinc finger protein 747 |
145 |
0.88 |
chr14_34234629_34235167 | 3.21 |
Gm49201 |
predicted gene, 49201 |
3170 |
0.12 |
chrX_166344270_166344507 | 3.20 |
Gpm6b |
glycoprotein m6b |
304 |
0.92 |
chr18_20742498_20742670 | 3.20 |
B4galt6 |
UDP-Gal:betaGlcNAc beta 1,4-galactosyltransferase, polypeptide 6 |
3820 |
0.25 |
chr17_4266180_4266727 | 3.19 |
4930548J01Rik |
RIKEN cDNA 4930548J01 gene |
144340 |
0.05 |
chr13_85189150_85189414 | 3.16 |
Ccnh |
cyclin H |
126 |
0.97 |
chr13_46217950_46218678 | 3.14 |
Gm10113 |
predicted gene 10113 |
27268 |
0.21 |
chr17_87609597_87610246 | 3.09 |
Epcam |
epithelial cell adhesion molecule |
26058 |
0.15 |
chr8_85025253_85025568 | 3.07 |
Asna1 |
arsA arsenite transporter, ATP-binding, homolog 1 (bacterial) |
129 |
0.86 |
chr1_13660079_13660966 | 3.07 |
Lactb2 |
lactamase, beta 2 |
24 |
0.98 |
chr11_94653774_94653992 | 3.06 |
Eme1 |
essential meiotic structure-specific endonuclease 1 |
81 |
0.52 |
chr2_26586309_26586605 | 3.06 |
Egfl7 |
EGF-like domain 7 |
173 |
0.48 |
chr18_68194572_68195758 | 3.03 |
Gm18149 |
predicted gene, 18149 |
26198 |
0.16 |
chr5_111842492_111842876 | 3.03 |
Gm36535 |
predicted gene, 36535 |
49297 |
0.14 |
chr1_40085123_40085879 | 3.02 |
Gm16894 |
predicted gene, 16894 |
350 |
0.57 |
chr10_93432275_93432789 | 3.00 |
Mir7688 |
microRNA 7688 |
575 |
0.71 |
chr13_63240051_63241120 | 2.99 |
Aopep |
aminopeptidase O |
477 |
0.66 |
chr3_30969468_30969653 | 2.99 |
Phc3 |
polyhomeotic 3 |
145 |
0.94 |
chr11_7062972_7063404 | 2.98 |
Adcy1 |
adenylate cyclase 1 |
301 |
0.93 |
chr17_56184005_56184286 | 2.96 |
Mydgf |
myeloid derived growth factor |
225 |
0.86 |
chr4_48473425_48473716 | 2.96 |
Tex10 |
testis expressed gene 10 |
111 |
0.98 |
chr1_11329241_11329974 | 2.96 |
Gm37410 |
predicted gene, 37410 |
37357 |
0.16 |
chr14_50931048_50931199 | 2.95 |
Pnp |
purine-nucleoside phosphorylase |
41 |
0.75 |
chr2_37423090_37423323 | 2.94 |
Rc3h2 |
ring finger and CCCH-type zinc finger domains 2 |
303 |
0.84 |
chr9_98329654_98329987 | 2.94 |
Gm28530 |
predicted gene 28530 |
28170 |
0.17 |
chr5_66042748_66043009 | 2.93 |
Rbm47 |
RNA binding motif protein 47 |
11674 |
0.12 |
chr5_113082923_113083179 | 2.92 |
Crybb3 |
crystallin, beta B3 |
1467 |
0.26 |
chr6_3397083_3397740 | 2.92 |
Samd9l |
sterile alpha motif domain containing 9-like |
2161 |
0.27 |
chr9_71770064_71770216 | 2.91 |
Cgnl1 |
cingulin-like 1 |
1420 |
0.43 |
chr5_137533356_137533669 | 2.90 |
Gnb2 |
guanine nucleotide binding protein (G protein), beta 2 |
2 |
0.75 |
chr5_117087628_117088305 | 2.88 |
Suds3 |
suppressor of defective silencing 3 homolog (S. cerevisiae) |
10845 |
0.15 |
chr13_59010954_59011995 | 2.87 |
Gm34245 |
predicted gene, 34245 |
66822 |
0.09 |
chr11_55414045_55414717 | 2.87 |
Sparc |
secreted acidic cysteine rich glycoprotein |
5517 |
0.17 |
chr16_78264883_78265644 | 2.86 |
E330011O21Rik |
RIKEN cDNA E330011O21 gene |
689 |
0.65 |
chr11_119258770_119259101 | 2.86 |
Ccdc40 |
coiled-coil domain containing 40 |
8 |
0.96 |
chr11_21369138_21369449 | 2.86 |
Gm12043 |
predicted gene 12043 |
1107 |
0.33 |
chr1_167270814_167271307 | 2.86 |
Uck2 |
uridine-cytidine kinase 2 |
13541 |
0.11 |
chr18_12863377_12863831 | 2.85 |
Osbpl1a |
oxysterol binding protein-like 1A |
164 |
0.92 |
chr10_81643775_81643995 | 2.84 |
Ankrd24 |
ankyrin repeat domain 24 |
82 |
0.93 |
chr1_182983152_182983831 | 2.84 |
Gm38079 |
predicted gene, 38079 |
7215 |
0.21 |
chr3_90612813_90614040 | 2.83 |
S100a6 |
S100 calcium binding protein A6 (calcyclin) |
121 |
0.9 |
chr9_121890449_121890970 | 2.83 |
Ackr2 |
atypical chemokine receptor 2 |
7646 |
0.09 |
chr19_8921093_8921389 | 2.83 |
B3gat3 |
beta-1,3-glucuronyltransferase 3 (glucuronosyltransferase I) |
757 |
0.32 |
chr14_54962885_54964094 | 2.82 |
Myh6 |
myosin, heavy polypeptide 6, cardiac muscle, alpha |
3085 |
0.08 |
chr5_134745620_134746234 | 2.81 |
Gm30003 |
predicted gene, 30003 |
1115 |
0.35 |
chr1_34439512_34439753 | 2.80 |
Ccdc115 |
coiled-coil domain containing 115 |
40 |
0.71 |
chr17_28517451_28518182 | 2.79 |
Fkbp5 |
FK506 binding protein 5 |
289 |
0.75 |
chr4_46374743_46375167 | 2.76 |
Trmo |
tRNA methyltransferase O |
14463 |
0.12 |
chr6_100206731_100207328 | 2.75 |
Rybp |
RING1 and YY1 binding protein |
26102 |
0.16 |
chr10_41519256_41519430 | 2.75 |
Cd164 |
CD164 antigen |
71 |
0.95 |
chr15_56046666_56047015 | 2.73 |
Gm49212 |
predicted gene, 49212 |
2992 |
0.28 |
chr10_120421952_120422678 | 2.73 |
Mir763 |
microRNA 763 |
25795 |
0.15 |
chr17_64346137_64346566 | 2.73 |
Pja2 |
praja ring finger ubiquitin ligase 2 |
14435 |
0.23 |
chr2_166735459_166735766 | 2.72 |
Prex1 |
phosphatidylinositol-3,4,5-trisphosphate-dependent Rac exchange factor 1 |
21780 |
0.16 |
chr18_73863569_73864469 | 2.72 |
Mro |
maestro |
347 |
0.9 |
chr10_39172722_39173496 | 2.71 |
D030034A15Rik |
RIKEN cDNA D030034A15 gene |
143 |
0.94 |
chr5_117712315_117712578 | 2.69 |
Nos1 |
nitric oxide synthase 1, neuronal |
68586 |
0.11 |
chr18_54910548_54911126 | 2.69 |
Zfp608 |
zinc finger protein 608 |
15275 |
0.19 |
chr1_151096223_151096446 | 2.68 |
Gm19087 |
predicted gene, 19087 |
11581 |
0.13 |
chr13_67682587_67683510 | 2.68 |
Zfp738 |
zinc finger protein 738 |
419 |
0.69 |
chr18_38338959_38339316 | 2.67 |
Gnpda1 |
glucosamine-6-phosphate deaminase 1 |
134 |
0.93 |
chr13_64432086_64432773 | 2.65 |
1700015C15Rik |
RIKEN cDNA 1700015C15 gene |
27 |
0.54 |
chr5_137510183_137510419 | 2.65 |
Gm8066 |
predicted gene 8066 |
48 |
0.93 |
chr3_20035310_20035562 | 2.65 |
Hps3 |
HPS3, biogenesis of lysosomal organelles complex 2 subunit 1 |
121 |
0.96 |
chr5_123252018_123252327 | 2.64 |
Wdr66 |
WD repeat domain 66 |
70 |
0.95 |
chr19_58860202_58860974 | 2.64 |
Hspa12a |
heat shock protein 12A |
50 |
0.98 |
chr7_118594829_118595356 | 2.64 |
Tmc5 |
transmembrane channel-like gene family 5 |
2205 |
0.22 |
chr8_40331087_40331414 | 2.60 |
Fgf20 |
fibroblast growth factor 20 |
22919 |
0.16 |
chr17_31776985_31777136 | 2.60 |
Gm49999 |
predicted gene, 49999 |
12444 |
0.16 |
chr16_77593904_77594384 | 2.60 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
222 |
0.87 |
chr1_133181159_133182053 | 2.59 |
Plekha6 |
pleckstrin homology domain containing, family A member 6 |
285 |
0.9 |
chr16_31508918_31509507 | 2.59 |
Gm46560 |
predicted gene, 46560 |
825 |
0.58 |
chr18_34572685_34572948 | 2.59 |
Nme5 |
NME/NM23 family member 5 |
6267 |
0.14 |
chrX_136068142_136068431 | 2.57 |
Bex2 |
brain expressed X-linked 2 |
50 |
0.96 |
chr4_152096248_152097724 | 2.56 |
Plekhg5 |
pleckstrin homology domain containing, family G (with RhoGef domain) member 5 |
267 |
0.86 |
chr4_57611408_57611803 | 2.55 |
Pakap |
paralemmin A kinase anchor protein |
26218 |
0.23 |
chr17_70561249_70561849 | 2.54 |
Dlgap1 |
DLG associated protein 1 |
3 |
0.99 |
chr1_5082818_5083105 | 2.54 |
Atp6v1h |
ATPase, H+ transporting, lysosomal V1 subunit H |
119 |
0.96 |
chr15_59204218_59204369 | 2.53 |
Rpl7-ps8 |
ribosomal protein L7, pseudogene 8 |
6615 |
0.21 |
chr3_49753928_49755610 | 2.53 |
Pcdh18 |
protocadherin 18 |
695 |
0.72 |
chr2_117122936_117123249 | 2.53 |
Spred1 |
sprouty protein with EVH-1 domain 1, related sequence |
1454 |
0.46 |
chr5_21701634_21702060 | 2.52 |
Napepld |
N-acyl phosphatidylethanolamine phospholipase D |
451 |
0.75 |
chr10_117417525_117417769 | 2.52 |
Gm40770 |
predicted gene, 40770 |
3743 |
0.17 |
chr10_81059647_81060152 | 2.52 |
Sgta |
small glutamine-rich tetratricopeptide repeat (TPR)-containing, alpha |
216 |
0.84 |
chr11_110095691_110096084 | 2.52 |
Abca8a |
ATP-binding cassette, sub-family A (ABC1), member 8a |
50 |
0.98 |
chr6_87424489_87424700 | 2.50 |
Bmp10 |
bone morphogenetic protein 10 |
4400 |
0.17 |
chr17_87106697_87107199 | 2.50 |
Socs5 |
suppressor of cytokine signaling 5 |
731 |
0.62 |
chr11_70970532_70970985 | 2.50 |
Rpain |
RPA interacting protein |
229 |
0.78 |
chr7_42014121_42014272 | 2.50 |
Hmgb1-ps7 |
high-mobility group high mobility group box 1, pseudogene 7 |
6640 |
0.17 |
chr6_72097122_72097507 | 2.49 |
St3gal5 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 5 |
278 |
0.85 |
chr9_55326354_55326761 | 2.48 |
Nrg4 |
neuregulin 4 |
192 |
0.69 |
chr11_110379698_110380704 | 2.48 |
Map2k6 |
mitogen-activated protein kinase kinase 6 |
18921 |
0.23 |
chr4_134946237_134946557 | 2.48 |
Syf2 |
SYF2 homolog, RNA splicing factor (S. cerevisiae) |
15387 |
0.16 |
chr8_33927475_33928014 | 2.48 |
Rbpms |
RNA binding protein gene with multiple splicing |
1532 |
0.38 |
chr1_42918173_42918786 | 2.47 |
Mrps9 |
mitochondrial ribosomal protein S9 |
15422 |
0.18 |
chr11_113086902_113087643 | 2.46 |
2610035D17Rik |
RIKEN cDNA 2610035D17 gene |
85805 |
0.1 |
chr11_96697035_96697186 | 2.46 |
Skap1 |
src family associated phosphoprotein 1 |
11125 |
0.17 |
chr2_143034873_143035460 | 2.45 |
Snrpb2 |
U2 small nuclear ribonucleoprotein B |
27873 |
0.19 |
chr10_81232757_81232928 | 2.45 |
Zfr2 |
zinc finger RNA binding protein 2 |
313 |
0.7 |
chr11_60353035_60353731 | 2.45 |
Drc3 |
dynein regulatory complex subunit 3 |
3 |
0.89 |
chr3_137863805_137864316 | 2.44 |
Gm43403 |
predicted gene 43403 |
123 |
0.79 |
chr16_88290428_88290658 | 2.43 |
Grik1 |
glutamate receptor, ionotropic, kainate 1 |
278 |
0.94 |
chr13_15395796_15396044 | 2.42 |
Gm20043 |
predicted gene, 20043 |
20296 |
0.21 |
chr3_101300146_101300972 | 2.42 |
Gm10355 |
predicted gene 10355 |
6520 |
0.15 |
chr5_110102008_110102235 | 2.42 |
Plcxd1 |
phosphatidylinositol-specific phospholipase C, X domain containing 1 |
917 |
0.36 |
chr9_107618905_107619177 | 2.41 |
Gnai2 |
guanine nucleotide binding protein (G protein), alpha inhibiting 2 |
1569 |
0.15 |
chr11_43474037_43474863 | 2.39 |
C1qtnf2 |
C1q and tumor necrosis factor related protein 2 |
144 |
0.94 |
chr10_108433877_108434449 | 2.39 |
Gm36283 |
predicted gene, 36283 |
2502 |
0.28 |
chr5_35727822_35729089 | 2.39 |
Sh3tc1 |
SH3 domain and tetratricopeptide repeats 1 |
557 |
0.73 |
chr9_53383847_53384607 | 2.39 |
Poglut3 |
protein O-glucosyltransferase 3 |
202 |
0.93 |
chr7_19464526_19464717 | 2.38 |
Exoc3l2 |
exocyst complex component 3-like 2 |
1290 |
0.21 |
chr17_21845815_21846077 | 2.38 |
Zfp820 |
zinc finger protein 820 |
174 |
0.93 |
chr14_72531887_72532977 | 2.38 |
Mlnr-ps |
motilin receptor, pseudogene |
217 |
0.94 |
chr5_147408738_147409164 | 2.38 |
Gm6054 |
predicted gene 6054 |
31 |
0.92 |
chr12_84222267_84223066 | 2.38 |
Elmsan1 |
ELM2 and Myb/SANT-like domain containing 1 |
3785 |
0.13 |
chr17_49898701_49898901 | 2.38 |
Gm16554 |
predicted gene 16554 |
2834 |
0.25 |
chr5_103778295_103779131 | 2.38 |
Aff1 |
AF4/FMR2 family, member 1 |
5646 |
0.23 |
chr17_8592901_8593278 | 2.38 |
Gm15425 |
predicted gene 15425 |
24229 |
0.18 |
chr9_122732926_122733498 | 2.37 |
Topaz1 |
testis and ovary specific PAZ domain containing 1 |
14134 |
0.11 |
chr6_54120039_54120190 | 2.37 |
Chn2 |
chimerin 2 |
22394 |
0.18 |
chr19_6962393_6962544 | 2.36 |
Plcb3 |
phospholipase C, beta 3 |
1023 |
0.26 |
chr6_21822751_21823961 | 2.36 |
Tspan12 |
tetraspanin 12 |
28472 |
0.16 |
chr14_57746100_57746612 | 2.36 |
Lats2 |
large tumor suppressor 2 |
222 |
0.52 |
chr3_95701798_95702681 | 2.36 |
Adamtsl4 |
ADAMTS-like 4 |
14322 |
0.09 |
chr14_78536887_78537343 | 2.35 |
Akap11 |
A kinase (PRKA) anchor protein 11 |
307 |
0.91 |
chr6_127453308_127453577 | 2.35 |
Parp11 |
poly (ADP-ribose) polymerase family, member 11 |
178 |
0.94 |
chr16_92500436_92501049 | 2.34 |
Clic6 |
chloride intracellular channel 6 |
2608 |
0.22 |
chr7_19629476_19629768 | 2.34 |
Relb |
avian reticuloendotheliosis viral (v-rel) oncogene related B |
184 |
0.88 |
chrX_136958122_136958594 | 2.33 |
Tmsb15b2 |
thymosin beta 15b2 |
333 |
0.76 |
chr3_107278705_107279026 | 2.33 |
Lamtor5 |
late endosomal/lysosomal adaptor, MAPK and MTOR activator 5 |
7 |
0.97 |
chr11_85182876_85183668 | 2.33 |
1700125H20Rik |
RIKEN cDNA 1700125H20 gene |
12176 |
0.13 |
chr1_88700283_88700965 | 2.33 |
Arl4c |
ADP-ribosylation factor-like 4C |
1252 |
0.42 |
chr2_115483667_115484211 | 2.33 |
3110099E03Rik |
RIKEN cDNA 3110099E03 gene |
28262 |
0.21 |
chr5_118331339_118332508 | 2.33 |
Gm28563 |
predicted gene 28563 |
65407 |
0.09 |
chr13_66867979_66868968 | 2.32 |
Cbx3-ps4 |
chromobox 3, pseudogene 4 |
3949 |
0.09 |
chr9_66806165_66806354 | 2.31 |
Ppp1r2-ps4 |
protein phosphatase 1, regulatory (inhibitor) subunit 2, pseudogene 4 |
321 |
0.8 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.6 | 10.2 | GO:0009158 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
1.3 | 4.0 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
1.3 | 5.3 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
1.1 | 2.2 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
1.0 | 4.1 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
1.0 | 3.8 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.9 | 3.8 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.9 | 2.7 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.9 | 2.6 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.8 | 3.4 | GO:0032763 | regulation of mast cell cytokine production(GO:0032763) |
0.8 | 3.3 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
0.8 | 3.3 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.8 | 4.8 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.8 | 2.4 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.8 | 2.3 | GO:0015889 | cobalamin transport(GO:0015889) |
0.8 | 0.8 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
0.7 | 3.6 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.7 | 4.2 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.7 | 2.0 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.7 | 2.7 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.7 | 2.0 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.6 | 3.2 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.6 | 1.9 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.6 | 1.9 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.6 | 3.1 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.6 | 1.8 | GO:0009177 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
0.6 | 1.8 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.6 | 1.8 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.6 | 1.7 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.6 | 2.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.6 | 1.1 | GO:0002086 | diaphragm contraction(GO:0002086) |
0.5 | 7.1 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.5 | 2.7 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.5 | 1.6 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
0.5 | 1.6 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.5 | 0.5 | GO:0090259 | regulation of retinal ganglion cell axon guidance(GO:0090259) |
0.5 | 1.0 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.5 | 2.1 | GO:0060486 | Clara cell differentiation(GO:0060486) |
0.5 | 2.1 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.5 | 1.5 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.5 | 4.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.5 | 3.1 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.5 | 1.5 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.5 | 1.5 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.5 | 2.5 | GO:0070842 | aggresome assembly(GO:0070842) |
0.5 | 1.9 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.5 | 1.4 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.5 | 1.9 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.5 | 0.9 | GO:0036166 | phenotypic switching(GO:0036166) |
0.5 | 1.4 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.5 | 1.8 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.5 | 1.8 | GO:0044849 | estrous cycle(GO:0044849) |
0.5 | 0.9 | GO:0035789 | cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) regulation of metanephric mesenchymal cell migration(GO:2000589) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.5 | 1.4 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.4 | 0.9 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.4 | 2.7 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.4 | 1.3 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.4 | 5.8 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.4 | 1.3 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
0.4 | 0.9 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.4 | 1.3 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.4 | 1.3 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.4 | 0.4 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.4 | 1.3 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.4 | 1.7 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.4 | 2.5 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.4 | 1.2 | GO:0007525 | somatic muscle development(GO:0007525) |
0.4 | 5.3 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.4 | 1.2 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.4 | 3.2 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.4 | 2.0 | GO:0015808 | L-alanine transport(GO:0015808) |
0.4 | 1.6 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.4 | 1.6 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.4 | 0.4 | GO:1902947 | regulation of tau-protein kinase activity(GO:1902947) |
0.4 | 1.2 | GO:0032439 | endosome localization(GO:0032439) |
0.4 | 0.4 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.4 | 0.8 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.4 | 1.5 | GO:0015824 | proline transport(GO:0015824) |
0.4 | 0.7 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.4 | 0.7 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.4 | 2.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.4 | 1.5 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.4 | 3.7 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.4 | 1.5 | GO:0098828 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
0.4 | 1.8 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.4 | 0.7 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
0.4 | 1.1 | GO:0009211 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
0.4 | 2.1 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.4 | 1.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.4 | 1.8 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.3 | 1.0 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.3 | 2.4 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
0.3 | 0.3 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
0.3 | 2.0 | GO:0048069 | eye pigmentation(GO:0048069) |
0.3 | 4.8 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.3 | 1.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.3 | 1.0 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.3 | 0.7 | GO:0070384 | Harderian gland development(GO:0070384) |
0.3 | 0.7 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.3 | 1.0 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.3 | 1.0 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
0.3 | 1.3 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.3 | 0.3 | GO:0086042 | cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) |
0.3 | 1.7 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.3 | 1.3 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.3 | 2.6 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.3 | 1.6 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.3 | 1.0 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.3 | 0.6 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.3 | 1.6 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.3 | 0.6 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.3 | 1.0 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.3 | 0.6 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.3 | 1.3 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.3 | 0.6 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.3 | 0.9 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.3 | 0.6 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.3 | 0.6 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.3 | 0.6 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.3 | 0.3 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.3 | 1.5 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.3 | 1.8 | GO:0051256 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.3 | 0.3 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.3 | 0.6 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.3 | 0.9 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.3 | 0.9 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.3 | 0.9 | GO:1902219 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.3 | 1.2 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.3 | 1.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.3 | 0.6 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.3 | 0.9 | GO:0031296 | B cell costimulation(GO:0031296) |
0.3 | 0.9 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.3 | 2.6 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.3 | 1.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.3 | 1.1 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
0.3 | 1.4 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.3 | 1.1 | GO:0070391 | response to lipoteichoic acid(GO:0070391) cellular response to lipoteichoic acid(GO:0071223) |
0.3 | 1.1 | GO:0042891 | antibiotic transport(GO:0042891) |
0.3 | 2.8 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.3 | 1.7 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.3 | 0.8 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.3 | 1.9 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.3 | 1.9 | GO:1900746 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) |
0.3 | 0.5 | GO:0048320 | axial mesoderm formation(GO:0048320) |
0.3 | 0.8 | GO:1990000 | amyloid fibril formation(GO:1990000) |
0.3 | 0.8 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.3 | 2.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.3 | 0.8 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.3 | 1.9 | GO:0006265 | DNA topological change(GO:0006265) |
0.3 | 0.8 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
0.3 | 1.1 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.3 | 1.9 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.3 | 1.6 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.3 | 1.6 | GO:0042637 | catagen(GO:0042637) |
0.3 | 0.5 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.3 | 1.1 | GO:0015822 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.3 | 1.6 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.3 | 1.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.3 | 0.8 | GO:0042045 | epithelial fluid transport(GO:0042045) |
0.3 | 1.0 | GO:0048254 | snoRNA localization(GO:0048254) |
0.3 | 7.8 | GO:0090662 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.3 | 0.8 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.3 | 1.0 | GO:0060605 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.3 | 0.8 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.3 | 1.0 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.3 | 0.3 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.3 | 1.8 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.3 | 1.3 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.3 | 1.5 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.3 | 0.8 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.3 | 0.8 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.3 | 0.5 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.3 | 0.8 | GO:0030035 | microspike assembly(GO:0030035) |
0.3 | 0.8 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.2 | 1.0 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.2 | 0.7 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.2 | 1.2 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.2 | 0.5 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.2 | 1.2 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.2 | 1.2 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.2 | 0.2 | GO:0007494 | midgut development(GO:0007494) |
0.2 | 1.9 | GO:0006983 | ER overload response(GO:0006983) |
0.2 | 0.7 | GO:0021898 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.2 | 0.5 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) |
0.2 | 0.7 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.2 | 0.7 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.2 | 1.0 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
0.2 | 1.0 | GO:0051031 | tRNA transport(GO:0051031) |
0.2 | 1.2 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.2 | 4.3 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.2 | 0.7 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.2 | 1.4 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.2 | 0.5 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
0.2 | 0.5 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.2 | 0.9 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.2 | 0.9 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.2 | 5.1 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.2 | 1.4 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.2 | 0.5 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.2 | 0.9 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.2 | 1.1 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.2 | 0.4 | GO:0048087 | positive regulation of melanocyte differentiation(GO:0045636) positive regulation of developmental pigmentation(GO:0048087) positive regulation of pigment cell differentiation(GO:0050942) |
0.2 | 1.1 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.2 | 0.7 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.2 | 2.0 | GO:0045056 | transcytosis(GO:0045056) |
0.2 | 1.3 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.2 | 1.3 | GO:0031943 | regulation of glucocorticoid metabolic process(GO:0031943) |
0.2 | 1.8 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.2 | 1.8 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.2 | 0.4 | GO:0038109 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.2 | 0.7 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.2 | 0.9 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.2 | 0.9 | GO:0030091 | protein repair(GO:0030091) |
0.2 | 0.6 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.2 | 0.6 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.2 | 0.6 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.2 | 0.8 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.2 | 0.6 | GO:0034476 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
0.2 | 0.8 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.2 | 0.6 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.2 | 0.6 | GO:0065001 | specification of axis polarity(GO:0065001) |
0.2 | 0.8 | GO:2000343 | positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
0.2 | 0.6 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.2 | 0.4 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.2 | 0.4 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.2 | 0.4 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.2 | 1.2 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.2 | 0.2 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
0.2 | 0.2 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.2 | 1.2 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.2 | 0.8 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.2 | 0.8 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.2 | 1.2 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.2 | 1.8 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.2 | 0.4 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.2 | 0.4 | GO:0070948 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.2 | 1.0 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.2 | 0.6 | GO:0002254 | kinin cascade(GO:0002254) |
0.2 | 1.8 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
0.2 | 0.4 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
0.2 | 0.6 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.2 | 0.4 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.2 | 0.8 | GO:0060298 | positive regulation of sarcomere organization(GO:0060298) |
0.2 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
0.2 | 0.8 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.2 | 1.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.2 | 1.6 | GO:0042983 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
0.2 | 0.6 | GO:0030242 | pexophagy(GO:0030242) |
0.2 | 0.6 | GO:0031394 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
0.2 | 1.2 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.2 | 2.9 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
0.2 | 1.1 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
0.2 | 1.7 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.2 | 1.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.2 | 0.2 | GO:0032347 | regulation of aldosterone biosynthetic process(GO:0032347) |
0.2 | 0.6 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
0.2 | 0.9 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.2 | 0.8 | GO:0032308 | positive regulation of icosanoid secretion(GO:0032305) positive regulation of prostaglandin secretion(GO:0032308) |
0.2 | 0.4 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.2 | 0.9 | GO:0030049 | muscle filament sliding(GO:0030049) |
0.2 | 1.3 | GO:0090382 | phagosome maturation(GO:0090382) |
0.2 | 0.7 | GO:0021747 | cochlear nucleus development(GO:0021747) |
0.2 | 1.3 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.2 | 0.7 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.2 | 1.3 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.2 | 0.2 | GO:0071910 | determination of liver left/right asymmetry(GO:0071910) |
0.2 | 0.7 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.2 | 0.4 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.2 | 0.5 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) |
0.2 | 1.6 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
0.2 | 0.4 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
0.2 | 0.5 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.2 | 2.3 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
0.2 | 2.8 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.2 | 0.5 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.2 | 1.1 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.2 | 0.3 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.2 | 0.2 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.2 | 0.2 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.2 | 0.3 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.2 | 0.5 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.2 | 0.3 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.2 | 1.9 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.2 | 0.7 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
0.2 | 0.7 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.2 | 0.5 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.2 | 1.3 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.2 | 2.0 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.2 | 0.8 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.2 | 0.3 | GO:0009756 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.2 | 0.7 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.2 | 0.2 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
0.2 | 0.3 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.2 | 0.8 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.2 | 0.3 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.2 | 3.4 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.2 | 2.1 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.2 | 2.4 | GO:0051875 | melanosome localization(GO:0032400) pigment granule localization(GO:0051875) |
0.2 | 0.6 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.2 | 0.2 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.2 | 0.6 | GO:0006598 | polyamine catabolic process(GO:0006598) |
0.2 | 0.5 | GO:1900086 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.2 | 1.6 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.2 | 0.3 | GO:0043587 | tongue morphogenesis(GO:0043587) |
0.2 | 1.9 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.2 | 0.5 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.2 | 0.3 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.2 | 0.3 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.2 | 0.6 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.2 | 2.5 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.2 | 1.5 | GO:0009148 | pyrimidine nucleoside triphosphate biosynthetic process(GO:0009148) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) |
0.2 | 0.9 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.2 | 0.5 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.2 | 0.6 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.2 | 0.5 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
0.2 | 0.3 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.1 | 0.6 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.1 | 0.3 | GO:0003177 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
0.1 | 0.1 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.1 | 1.2 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 0.4 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.1 | 0.6 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.1 | 0.4 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 0.4 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.1 | 0.3 | GO:1902896 | terminal web assembly(GO:1902896) |
0.1 | 0.4 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.1 | 1.0 | GO:0070986 | left/right axis specification(GO:0070986) |
0.1 | 0.3 | GO:0006868 | glutamine transport(GO:0006868) |
0.1 | 1.9 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.1 | 1.9 | GO:0009303 | rRNA transcription(GO:0009303) |
0.1 | 0.4 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.1 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.1 | 0.4 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.1 | 0.4 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.1 | 1.1 | GO:0010388 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.1 | 0.7 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.1 | 0.4 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.1 | 0.6 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.1 | 1.0 | GO:0034626 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 2.7 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.1 | 0.3 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.1 | 0.7 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.1 | 0.4 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
0.1 | 0.8 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.1 | 0.6 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.1 | 0.7 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.1 | 0.6 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.1 | 0.3 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.1 | 1.1 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
0.1 | 0.7 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
0.1 | 0.1 | GO:0044857 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) |
0.1 | 0.3 | GO:0032351 | negative regulation of hormone metabolic process(GO:0032351) negative regulation of hormone biosynthetic process(GO:0032353) |
0.1 | 2.2 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
0.1 | 0.1 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.1 | 1.5 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
0.1 | 0.4 | GO:0051182 | coenzyme transport(GO:0051182) |
0.1 | 0.3 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 0.3 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.1 | 1.1 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.1 | 0.7 | GO:0090042 | tubulin deacetylation(GO:0090042) |
0.1 | 0.1 | GO:0036257 | multivesicular body organization(GO:0036257) multivesicular body assembly(GO:0036258) |
0.1 | 1.2 | GO:0051451 | myoblast migration(GO:0051451) |
0.1 | 0.4 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.1 | 0.3 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.1 | 0.3 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.1 | 0.7 | GO:0098596 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.1 | 0.3 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
0.1 | 0.3 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 0.3 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 0.4 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.1 | 3.2 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.1 | 2.4 | GO:0035329 | hippo signaling(GO:0035329) |
0.1 | 0.9 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
0.1 | 0.9 | GO:0001821 | histamine secretion(GO:0001821) |
0.1 | 0.4 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.1 | 0.8 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
0.1 | 0.6 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.1 | 0.6 | GO:0016093 | polyprenol metabolic process(GO:0016093) |
0.1 | 0.4 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
0.1 | 0.6 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.1 | 0.3 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.1 | 0.4 | GO:0021564 | vagus nerve development(GO:0021564) |
0.1 | 0.6 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.1 | 0.8 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.1 | 0.3 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.1 | 0.1 | GO:2000969 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.1 | 0.3 | GO:0021637 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) |
0.1 | 0.1 | GO:1990144 | intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
0.1 | 0.4 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.1 | 0.2 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.1 | 0.2 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.1 | 0.2 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.1 | 2.0 | GO:0022011 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
0.1 | 0.1 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
0.1 | 0.2 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.1 | 2.9 | GO:0035058 | nonmotile primary cilium assembly(GO:0035058) |
0.1 | 0.4 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.1 | 0.1 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 4.3 | GO:0035082 | axoneme assembly(GO:0035082) |
0.1 | 2.2 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.1 | 0.7 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.1 | 0.7 | GO:0016266 | O-glycan processing(GO:0016266) |
0.1 | 0.2 | GO:0001757 | somite specification(GO:0001757) |
0.1 | 0.6 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.1 | 0.4 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.1 | 0.8 | GO:0097264 | self proteolysis(GO:0097264) |
0.1 | 0.6 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.1 | 0.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.1 | 1.3 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.1 | 0.6 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.1 | 0.1 | GO:0070459 | prolactin secretion(GO:0070459) |
0.1 | 0.5 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.1 | 0.3 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
0.1 | 0.5 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.1 | 0.7 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
0.1 | 0.3 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.1 | 0.2 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
0.1 | 0.2 | GO:0055015 | ventricular cardiac muscle cell development(GO:0055015) |
0.1 | 0.6 | GO:0045762 | positive regulation of adenylate cyclase activity(GO:0045762) |
0.1 | 0.2 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.1 | 0.1 | GO:0051231 | spindle elongation(GO:0051231) |
0.1 | 0.2 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
0.1 | 0.3 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.1 | 0.1 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.1 | 0.1 | GO:0071715 | icosanoid transport(GO:0071715) fatty acid derivative transport(GO:1901571) |
0.1 | 0.6 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.1 | 0.6 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 0.2 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.1 | 0.3 | GO:0006244 | pyrimidine nucleotide catabolic process(GO:0006244) |
0.1 | 1.9 | GO:0045214 | sarcomere organization(GO:0045214) |
0.1 | 0.5 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.1 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
0.1 | 0.9 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
0.1 | 0.9 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.1 | 0.3 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.1 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.3 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.1 | 0.5 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
0.1 | 1.2 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
0.1 | 0.8 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
0.1 | 0.2 | GO:0051775 | response to redox state(GO:0051775) |
0.1 | 0.4 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.1 | 0.2 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.1 | 0.5 | GO:0060056 | mammary gland involution(GO:0060056) |
0.1 | 0.4 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.1 | GO:1901563 | response to camptothecin(GO:1901563) |
0.1 | 0.5 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.1 | 0.7 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
0.1 | 0.1 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
0.1 | 0.2 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
0.1 | 1.0 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.1 | 0.1 | GO:0071305 | cellular response to vitamin D(GO:0071305) |
0.1 | 0.6 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.1 | 0.3 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.6 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.1 | 0.3 | GO:0002681 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
0.1 | 0.2 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 0.1 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.1 | 1.0 | GO:0097320 | membrane tubulation(GO:0097320) |
0.1 | 0.3 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.1 | 0.3 | GO:0043312 | neutrophil degranulation(GO:0043312) |
0.1 | 0.1 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
0.1 | 0.4 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 1.0 | GO:0036260 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
0.1 | 0.2 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.1 | 0.4 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) |
0.1 | 0.4 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.1 | 0.1 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.1 | 1.6 | GO:0006359 | regulation of transcription from RNA polymerase III promoter(GO:0006359) |
0.1 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 0.2 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
0.1 | 0.1 | GO:0060463 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
0.1 | 0.4 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
0.1 | 0.1 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.1 | 0.4 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.1 | 0.6 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.1 | 0.3 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.1 | 0.2 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.1 | 0.5 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.1 | 0.1 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
0.1 | 1.6 | GO:0072337 | modified amino acid transport(GO:0072337) |
0.1 | 0.1 | GO:0090500 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) endocardial cushion to mesenchymal transition(GO:0090500) |
0.1 | 0.4 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.1 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
0.1 | 0.1 | GO:0035106 | operant conditioning(GO:0035106) |
0.1 | 0.7 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.1 | 0.3 | GO:0070831 | basement membrane assembly(GO:0070831) |
0.1 | 0.3 | GO:0006971 | hypotonic response(GO:0006971) |
0.1 | 0.2 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
0.1 | 0.3 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.1 | 0.2 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.1 | 0.4 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.1 | 0.6 | GO:0006007 | glucose catabolic process(GO:0006007) |
0.1 | 0.1 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.1 | 0.3 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.1 | 0.1 | GO:1901663 | quinone biosynthetic process(GO:1901663) |
0.1 | 0.3 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
0.1 | 0.1 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) |
0.1 | 0.2 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.1 | 0.7 | GO:0009650 | UV protection(GO:0009650) |
0.1 | 0.2 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.1 | 0.7 | GO:0001675 | acrosome assembly(GO:0001675) |
0.1 | 0.2 | GO:0061038 | uterus morphogenesis(GO:0061038) |
0.1 | 0.2 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.1 | 0.1 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.1 | 0.3 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.1 | 0.1 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.1 | 1.5 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.1 | 1.9 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
0.1 | 0.2 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.1 | 0.4 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.1 | 0.2 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.1 | 0.2 | GO:0014831 | gastro-intestinal system smooth muscle contraction(GO:0014831) |
0.1 | 1.4 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.1 | 0.3 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.1 | 0.2 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.3 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.1 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.3 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.1 | 0.4 | GO:0045176 | apical protein localization(GO:0045176) |
0.1 | 0.4 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.1 | 0.2 | GO:0070587 | negative regulation of heterotypic cell-cell adhesion(GO:0034115) regulation of cell-cell adhesion involved in gastrulation(GO:0070587) |
0.1 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
0.1 | 0.1 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.1 | 0.9 | GO:0030325 | adrenal gland development(GO:0030325) |
0.1 | 0.2 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.1 | 0.2 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.1 | 2.1 | GO:0001938 | positive regulation of endothelial cell proliferation(GO:0001938) |
0.1 | 0.1 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.1 | 0.4 | GO:0032288 | myelin assembly(GO:0032288) |
0.1 | 0.2 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
0.1 | 0.5 | GO:0045986 | negative regulation of smooth muscle contraction(GO:0045986) |
0.1 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.1 | 0.2 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 0.3 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.1 | 0.2 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.1 | 0.2 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.1 | 0.1 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.1 | 0.1 | GO:0006069 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.1 | 0.1 | GO:0048865 | stem cell fate commitment(GO:0048865) |
0.1 | 0.1 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
0.1 | 0.3 | GO:0009642 | response to light intensity(GO:0009642) |
0.1 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.1 | 0.1 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.1 | 0.4 | GO:0002024 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.1 | 0.3 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.1 | 0.1 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
0.1 | 0.1 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
0.1 | 0.1 | GO:1903802 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.1 | 0.1 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
0.1 | 0.2 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.1 | 0.3 | GO:0009597 | detection of virus(GO:0009597) |
0.1 | 0.1 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.1 | 0.2 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.1 | 0.1 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
0.1 | 0.6 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
0.1 | 0.4 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.2 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.1 | 0.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.1 | 0.1 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.1 | 0.1 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.1 | 0.1 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
0.1 | 0.4 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.1 | 0.4 | GO:0036315 | cellular response to sterol(GO:0036315) |
0.1 | 0.3 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.1 | 0.1 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.1 | 0.6 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.1 | 0.2 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.1 | 0.1 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
0.1 | 0.1 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.1 | 0.7 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.1 | 0.4 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.1 | 0.2 | GO:0001927 | exocyst assembly(GO:0001927) |
0.1 | 0.3 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.1 | 0.2 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.1 | 0.1 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.1 | 0.3 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.1 | 0.1 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.1 | 0.1 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.1 | 1.2 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
0.1 | 0.1 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
0.1 | 0.7 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.1 | 0.3 | GO:0015871 | choline transport(GO:0015871) |
0.1 | 0.3 | GO:0006531 | aspartate metabolic process(GO:0006531) |
0.1 | 0.3 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.1 | 0.1 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.1 | 0.2 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.1 | 0.3 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.1 | 0.3 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.1 | 0.2 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.1 | 0.1 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.1 | 0.7 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.3 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.1 | 0.3 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.1 | 0.1 | GO:0021756 | striatum development(GO:0021756) |
0.1 | 1.0 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.1 | 0.3 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.1 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
0.1 | 0.5 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.1 | 0.5 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.1 | 0.3 | GO:0036119 | response to platelet-derived growth factor(GO:0036119) |
0.1 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.1 | 1.4 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.1 | 0.1 | GO:0036480 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
0.1 | 0.2 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
0.1 | 0.1 | GO:0032506 | cytokinetic process(GO:0032506) |
0.1 | 0.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.1 | 0.2 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.1 | 0.6 | GO:0070233 | negative regulation of T cell apoptotic process(GO:0070233) |
0.1 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.1 | 0.3 | GO:0042737 | drug catabolic process(GO:0042737) |
0.1 | 0.3 | GO:0032875 | regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
0.1 | 0.1 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.1 | 0.3 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
0.1 | 0.1 | GO:0034351 | negative regulation of glial cell apoptotic process(GO:0034351) |
0.1 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.1 | 0.1 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.1 | 2.9 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.1 | 0.1 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.1 | 0.4 | GO:1904152 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.1 | 0.8 | GO:0042026 | protein refolding(GO:0042026) |
0.1 | 0.1 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.1 | 0.1 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
0.1 | 0.5 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.1 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.3 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.1 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.1 | 0.1 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.1 | 0.1 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.1 | 0.2 | GO:0002934 | desmosome organization(GO:0002934) |
0.1 | 0.1 | GO:0097113 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.1 | 0.1 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.1 | 0.2 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.2 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.1 | 0.1 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.1 | 0.2 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.1 | 1.9 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.1 | 0.1 | GO:0072125 | negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
0.1 | 0.3 | GO:0070253 | somatostatin secretion(GO:0070253) |
0.1 | 1.9 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
0.1 | 0.2 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.1 | 0.2 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
0.1 | 0.3 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
0.1 | 0.1 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.1 | 0.1 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.1 | 0.2 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.1 | 0.1 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.7 | GO:0060043 | regulation of cardiac muscle cell proliferation(GO:0060043) |
0.1 | 0.2 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.1 | 0.2 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.1 | 0.2 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.1 | 0.2 | GO:0009624 | response to nematode(GO:0009624) |
0.1 | 1.7 | GO:0006513 | protein monoubiquitination(GO:0006513) |
0.1 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.1 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.1 | 0.2 | GO:0055012 | ventricular cardiac muscle cell differentiation(GO:0055012) |
0.1 | 0.5 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
0.1 | 0.2 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.1 | 0.2 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.1 | 0.1 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.2 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.1 | 0.1 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
0.1 | 0.4 | GO:0032098 | regulation of appetite(GO:0032098) |
0.1 | 0.4 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 1.6 | GO:0006998 | nuclear envelope organization(GO:0006998) |
0.1 | 0.1 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.1 | 0.4 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.1 | 0.5 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.1 | 0.3 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.1 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
0.1 | 0.2 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
0.1 | 0.1 | GO:0060437 | lung growth(GO:0060437) |
0.1 | 0.1 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.1 | 0.2 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.1 | 0.1 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.1 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.1 | 0.1 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.1 | 0.3 | GO:0051546 | keratinocyte migration(GO:0051546) |
0.1 | 0.4 | GO:0002931 | response to ischemia(GO:0002931) |
0.0 | 0.8 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
0.0 | 0.4 | GO:0071548 | response to dexamethasone(GO:0071548) |
0.0 | 0.1 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) |
0.0 | 0.2 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.0 | 0.0 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.0 | 0.1 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.0 | 0.2 | GO:0051043 | regulation of membrane protein ectodomain proteolysis(GO:0051043) |
0.0 | 0.1 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
0.0 | 0.3 | GO:0031272 | regulation of pseudopodium assembly(GO:0031272) positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.1 | GO:0001765 | membrane raft assembly(GO:0001765) |
0.0 | 0.0 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.0 | GO:0071313 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.0 | 0.3 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.0 | 0.1 | GO:0060831 | smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:0060831) |
0.0 | 0.2 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.0 | 0.1 | GO:0045345 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.0 | 0.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.0 | 1.0 | GO:0048008 | platelet-derived growth factor receptor signaling pathway(GO:0048008) |
0.0 | 0.1 | GO:0071816 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.0 | 0.2 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
0.0 | 1.4 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.0 | 0.8 | GO:0033173 | calcineurin-NFAT signaling cascade(GO:0033173) |
0.0 | 0.2 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.0 | 0.1 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.0 | 1.5 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.0 | 0.0 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
0.0 | 3.4 | GO:0007266 | Rho protein signal transduction(GO:0007266) |
0.0 | 0.9 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
0.0 | 1.0 | GO:0003341 | cilium movement(GO:0003341) |
0.0 | 0.0 | GO:0003256 | regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003256) |
0.0 | 0.2 | GO:0046033 | AMP metabolic process(GO:0046033) |
0.0 | 0.1 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.0 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.0 | 0.9 | GO:0006101 | citrate metabolic process(GO:0006101) |
0.0 | 0.2 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.0 | 0.0 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.0 | 0.0 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.1 | GO:0046130 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.0 | 0.4 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.5 | GO:0051931 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
0.0 | 0.6 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
0.0 | 0.1 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.0 | 0.1 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
0.0 | 0.4 | GO:0010447 | response to acidic pH(GO:0010447) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.1 | GO:0035425 | autocrine signaling(GO:0035425) |
0.0 | 0.5 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.1 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
0.0 | 0.1 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.0 | 0.4 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.1 | GO:0001812 | positive regulation of type I hypersensitivity(GO:0001812) |
0.0 | 0.5 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.3 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.0 | 0.2 | GO:0090314 | positive regulation of protein targeting to membrane(GO:0090314) |
0.0 | 0.1 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.0 | 0.5 | GO:0032733 | positive regulation of interleukin-10 production(GO:0032733) |
0.0 | 1.0 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
0.0 | 0.2 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.0 | 0.2 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.0 | 0.3 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.0 | 0.1 | GO:0072350 | tricarboxylic acid metabolic process(GO:0072350) |
0.0 | 0.1 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.1 | GO:0071838 | cell proliferation in bone marrow(GO:0071838) |
0.0 | 0.2 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.0 | 0.1 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.0 | 0.1 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
0.0 | 0.0 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.0 | 0.1 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.0 | 0.2 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
0.0 | 0.2 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
0.0 | 0.1 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.0 | 0.1 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
0.0 | 1.7 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
0.0 | 0.1 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.0 | 0.1 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.0 | 0.3 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.0 | 0.3 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
0.0 | 0.2 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.0 | 0.0 | GO:0035376 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.2 | GO:0032781 | positive regulation of ATPase activity(GO:0032781) |
0.0 | 0.0 | GO:0061317 | canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:0061317) |
0.0 | 0.3 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.0 | 0.3 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.0 | 0.1 | GO:0060632 | regulation of microtubule-based movement(GO:0060632) |
0.0 | 0.2 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.0 | 0.4 | GO:0006220 | pyrimidine nucleotide metabolic process(GO:0006220) |
0.0 | 0.3 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.0 | 0.0 | GO:0072198 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.0 | 0.4 | GO:0030033 | microvillus assembly(GO:0030033) |
0.0 | 0.3 | GO:0098719 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.1 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.0 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.0 | 0.0 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.0 | 0.2 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.0 | 0.3 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.0 | 0.1 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.1 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:0034650 | cortisol metabolic process(GO:0034650) |
0.0 | 0.2 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
0.0 | 0.8 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
0.0 | 0.0 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
0.0 | 0.0 | GO:0007567 | parturition(GO:0007567) |
0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.0 | 0.1 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.0 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.0 | 0.1 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.0 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.0 | 0.3 | GO:0019321 | pentose metabolic process(GO:0019321) |
0.0 | 0.1 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.0 | 0.1 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.0 | 0.2 | GO:0006999 | nuclear pore organization(GO:0006999) |
0.0 | 0.0 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
0.0 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
0.0 | 0.1 | GO:0046070 | dGTP metabolic process(GO:0046070) |
0.0 | 0.1 | GO:0050812 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
0.0 | 0.1 | GO:2000109 | macrophage apoptotic process(GO:0071888) regulation of macrophage apoptotic process(GO:2000109) |
0.0 | 0.2 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.0 | 0.0 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.0 | 0.1 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
0.0 | 0.1 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.0 | 0.2 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.1 | GO:0048662 | negative regulation of smooth muscle cell proliferation(GO:0048662) |
0.0 | 0.0 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.0 | 0.1 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.0 | 0.0 | GO:0032306 | regulation of prostaglandin secretion(GO:0032306) |
0.0 | 0.0 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.2 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.0 | 0.1 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.0 | 0.1 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
0.0 | 0.1 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
0.0 | 0.1 | GO:0050703 | interleukin-1 alpha secretion(GO:0050703) |
0.0 | 0.0 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.0 | 0.1 | GO:0015732 | prostaglandin transport(GO:0015732) |
0.0 | 0.0 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.0 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.0 | 0.2 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.0 | 0.1 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.0 | 0.0 | GO:0032621 | interleukin-18 production(GO:0032621) |
0.0 | 0.0 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.1 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.0 | 0.2 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.0 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.5 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
0.0 | 0.3 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.1 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
0.0 | 0.4 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.1 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.3 | GO:0046549 | retinal cone cell development(GO:0046549) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.1 | GO:0070100 | regulation of chemokine-mediated signaling pathway(GO:0070099) negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.0 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.1 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.0 | 0.5 | GO:0010107 | potassium ion import(GO:0010107) |
0.0 | 0.1 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
0.0 | 0.2 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
0.0 | 0.0 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
0.0 | 0.1 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
0.0 | 0.0 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.0 | 0.1 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) |
0.0 | 0.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.0 | 1.4 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 0.0 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.0 | 0.1 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
0.0 | 0.1 | GO:0021764 | amygdala development(GO:0021764) |
0.0 | 0.0 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
0.0 | 0.0 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
0.0 | 0.2 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.2 | GO:0090169 | regulation of spindle assembly(GO:0090169) |
0.0 | 0.0 | GO:0043217 | myelin maintenance(GO:0043217) |
0.0 | 0.0 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.0 | 0.2 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.2 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
0.0 | 0.2 | GO:0032324 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.0 | 0.1 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.0 | 0.0 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
0.0 | 0.2 | GO:0023058 | adaptation of signaling pathway(GO:0023058) |
0.0 | 0.1 | GO:0045297 | mating plug formation(GO:0042628) single-organism reproductive behavior(GO:0044704) post-mating behavior(GO:0045297) |
0.0 | 0.1 | GO:0070589 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.1 | GO:0044036 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
0.0 | 0.1 | GO:1901550 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.0 | 0.2 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 0.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.1 | GO:0033688 | regulation of osteoblast proliferation(GO:0033688) |
0.0 | 0.5 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
0.0 | 0.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.0 | 0.1 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.0 | 0.0 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.1 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.2 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
0.0 | 0.0 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.0 | 0.1 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.9 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.2 | GO:0009268 | response to pH(GO:0009268) |
0.0 | 0.2 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
0.0 | 0.1 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.0 | 0.4 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.0 | 0.2 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.1 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.0 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.1 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
0.0 | 0.1 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
0.0 | 0.0 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
0.0 | 0.0 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.0 | 0.1 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
0.0 | 0.3 | GO:1900004 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
0.0 | 0.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.0 | GO:0070668 | negative regulation of mast cell apoptotic process(GO:0033026) mast cell proliferation(GO:0070662) regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.0 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 0.2 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
0.0 | 0.2 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
0.0 | 0.0 | GO:0032252 | secretory granule localization(GO:0032252) |
0.0 | 0.1 | GO:2000505 | regulation of energy homeostasis(GO:2000505) |
0.0 | 0.1 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.0 | 0.8 | GO:0071427 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.0 | 0.1 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
0.0 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.5 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.3 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.1 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.0 | 0.1 | GO:0060117 | auditory receptor cell development(GO:0060117) |
0.0 | 0.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.0 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 0.7 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
0.0 | 0.1 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
0.0 | 0.0 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.0 | 1.9 | GO:0006813 | potassium ion transport(GO:0006813) |
0.0 | 1.9 | GO:0060271 | cilium morphogenesis(GO:0060271) |
0.0 | 0.0 | GO:0002740 | negative regulation of cytokine secretion involved in immune response(GO:0002740) |
0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.2 | GO:0035337 | fatty-acyl-CoA metabolic process(GO:0035337) |
0.0 | 0.4 | GO:0061512 | protein localization to cilium(GO:0061512) |
0.0 | 0.0 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.0 | 0.0 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 0.7 | GO:0007006 | mitochondrial membrane organization(GO:0007006) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.2 | GO:0002090 | regulation of receptor internalization(GO:0002090) |
0.0 | 0.0 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
0.0 | 0.1 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.0 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.1 | GO:1901660 | calcium ion export(GO:1901660) |
0.0 | 0.0 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.0 | 0.1 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
0.0 | 0.1 | GO:1903859 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.0 | 0.3 | GO:0060325 | face morphogenesis(GO:0060325) |
0.0 | 0.1 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.0 | 0.1 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
0.0 | 0.1 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.0 | 0.1 | GO:0031055 | chromatin remodeling at centromere(GO:0031055) pericentric heterochromatin assembly(GO:0031508) |
0.0 | 0.1 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.0 | 0.0 | GO:0098739 | import across plasma membrane(GO:0098739) |
0.0 | 0.0 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.0 | 0.1 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.0 | 0.0 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
0.0 | 0.0 | GO:0032831 | positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.0 | 0.2 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.1 | GO:0046039 | GTP metabolic process(GO:0046039) |
0.0 | 0.1 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.0 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.0 | 0.4 | GO:0043473 | pigmentation(GO:0043473) |
0.0 | 0.0 | GO:1903748 | negative regulation of protein targeting to mitochondrion(GO:1903215) negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
0.0 | 0.0 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.0 | 0.4 | GO:0008637 | apoptotic mitochondrial changes(GO:0008637) |
0.0 | 0.0 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.0 | 0.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.1 | GO:0007207 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.0 | 0.1 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.0 | 0.0 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.0 | 0.0 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.0 | 0.0 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.0 | 0.0 | GO:0061042 | vascular wound healing(GO:0061042) |
0.0 | 0.0 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.0 | 0.0 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.0 | 0.0 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.0 | 0.0 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.0 | GO:0060008 | Sertoli cell differentiation(GO:0060008) |
0.0 | 0.1 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.0 | 0.4 | GO:0006611 | protein export from nucleus(GO:0006611) |
0.0 | 0.0 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.0 | 0.2 | GO:2000649 | regulation of sodium ion transmembrane transporter activity(GO:2000649) |
0.0 | 0.0 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) positive regulation of osteoclast proliferation(GO:0090290) |
0.0 | 0.1 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.0 | 0.0 | GO:0061450 | trophoblast cell migration(GO:0061450) |
0.0 | 0.1 | GO:0015867 | ATP transport(GO:0015867) |
0.0 | 0.0 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.0 | 0.0 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.0 | 0.1 | GO:0007530 | sex determination(GO:0007530) |
0.0 | 0.0 | GO:0060022 | hard palate development(GO:0060022) |
0.0 | 0.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.0 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.0 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.2 | GO:0031279 | regulation of cyclase activity(GO:0031279) |
0.0 | 0.0 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.0 | 0.0 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.0 | 0.0 | GO:0070305 | response to cGMP(GO:0070305) |
0.0 | 0.3 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.0 | 0.0 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.1 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
0.0 | 0.0 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.0 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
0.0 | 0.0 | GO:0097461 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.0 | 0.2 | GO:0016079 | synaptic vesicle exocytosis(GO:0016079) |
0.0 | 0.0 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.0 | 0.2 | GO:0007099 | centriole replication(GO:0007099) |
0.0 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
0.0 | 0.0 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
0.0 | 0.1 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.0 | 0.0 | GO:0018158 | protein oxidation(GO:0018158) |
0.0 | 0.1 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.0 | 0.4 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
0.0 | 0.0 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.0 | 0.1 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.0 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.0 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.0 | 0.0 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.0 | 0.0 | GO:0043462 | regulation of ATPase activity(GO:0043462) |
0.0 | 0.0 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.0 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.0 | 0.0 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.0 | 0.5 | GO:0000725 | double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
0.0 | 0.3 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 0.0 | GO:0051176 | positive regulation of sulfur metabolic process(GO:0051176) |
0.0 | 0.0 | GO:0097354 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
0.0 | 0.1 | GO:0006582 | melanin metabolic process(GO:0006582) |
0.0 | 0.1 | GO:0030800 | negative regulation of cyclic nucleotide metabolic process(GO:0030800) |
0.0 | 0.0 | GO:2001169 | regulation of ATP biosynthetic process(GO:2001169) |
0.0 | 0.1 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
0.0 | 0.1 | GO:0097205 | renal filtration(GO:0097205) |
0.0 | 0.0 | GO:0044793 | negative regulation by host of viral process(GO:0044793) |
0.0 | 0.0 | GO:0070669 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) response to interleukin-2(GO:0070669) |
0.0 | 0.0 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.0 | 0.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.0 | GO:0006266 | DNA ligation(GO:0006266) |
0.0 | 0.0 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.2 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
0.0 | 0.1 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.0 | 0.0 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.0 | 0.0 | GO:0046865 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.0 | 0.4 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.0 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.0 | 0.0 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.0 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.0 | 0.0 | GO:0097709 | connective tissue replacement involved in inflammatory response wound healing(GO:0002248) connective tissue replacement(GO:0097709) |
0.0 | 0.0 | GO:1901317 | regulation of sperm motility(GO:1901317) |
0.0 | 0.1 | GO:0032411 | positive regulation of transporter activity(GO:0032411) |
0.0 | 0.1 | GO:0007602 | phototransduction(GO:0007602) |
0.0 | 0.0 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.0 | 0.0 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
0.0 | 0.0 | GO:0072606 | interleukin-8 secretion(GO:0072606) |
0.0 | 0.2 | GO:0030520 | intracellular estrogen receptor signaling pathway(GO:0030520) |
0.0 | 0.0 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
0.0 | 0.1 | GO:0009067 | aspartate family amino acid biosynthetic process(GO:0009067) |
0.0 | 0.0 | GO:0061082 | myeloid leukocyte cytokine production(GO:0061082) |
0.0 | 0.1 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.0 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.0 | 0.0 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
0.0 | 0.1 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
0.0 | 0.1 | GO:0015908 | fatty acid transport(GO:0015908) |
0.0 | 0.0 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.0 | 0.0 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.0 | 0.1 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
0.0 | 0.0 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.0 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.0 | 0.2 | GO:0006400 | tRNA modification(GO:0006400) |
0.0 | 0.0 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.0 | 0.7 | GO:0098779 | mitophagy in response to mitochondrial depolarization(GO:0098779) response to mitochondrial depolarisation(GO:0098780) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 2.6 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.7 | 4.9 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.6 | 3.8 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.6 | 2.5 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.6 | 3.4 | GO:0071986 | Ragulator complex(GO:0071986) |
0.5 | 1.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.5 | 2.0 | GO:0005955 | calcineurin complex(GO:0005955) |
0.5 | 3.0 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.5 | 1.4 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.4 | 2.1 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.4 | 2.5 | GO:0031983 | vesicle lumen(GO:0031983) |
0.4 | 1.2 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.4 | 3.3 | GO:0034464 | BBSome(GO:0034464) |
0.4 | 1.5 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.4 | 1.5 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.4 | 1.5 | GO:0071953 | elastic fiber(GO:0071953) |
0.4 | 0.8 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.4 | 1.8 | GO:0005827 | polar microtubule(GO:0005827) |
0.4 | 3.6 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.3 | 2.4 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.3 | 4.0 | GO:0043194 | axon initial segment(GO:0043194) |
0.3 | 1.6 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.3 | 1.9 | GO:0005915 | zonula adherens(GO:0005915) |
0.3 | 3.9 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.3 | 1.9 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.3 | 4.6 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.3 | 0.3 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.3 | 1.2 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.3 | 1.7 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.3 | 1.4 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.3 | 0.8 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.3 | 0.8 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.3 | 1.4 | GO:0070695 | FHF complex(GO:0070695) |
0.3 | 2.9 | GO:0035102 | PRC1 complex(GO:0035102) |
0.3 | 1.0 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.2 | 1.2 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.2 | 1.9 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.2 | 1.5 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.2 | 3.1 | GO:0005916 | fascia adherens(GO:0005916) |
0.2 | 0.5 | GO:0001739 | sex chromatin(GO:0001739) |
0.2 | 1.4 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.2 | 0.7 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.2 | 0.4 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.2 | 1.1 | GO:0005638 | lamin filament(GO:0005638) |
0.2 | 1.5 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
0.2 | 1.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.2 | 3.9 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.2 | 3.2 | GO:0031082 | BLOC complex(GO:0031082) |
0.2 | 4.4 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.2 | 0.6 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.2 | 1.4 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.2 | 1.4 | GO:0030056 | hemidesmosome(GO:0030056) |
0.2 | 0.2 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.2 | 0.4 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.2 | 0.6 | GO:0097443 | sorting endosome(GO:0097443) |
0.2 | 0.6 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.2 | 0.8 | GO:0070876 | SOSS complex(GO:0070876) |
0.2 | 2.5 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.2 | 2.3 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.2 | 0.6 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.2 | 1.7 | GO:0097542 | ciliary tip(GO:0097542) |
0.2 | 6.5 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.2 | 8.3 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.2 | 1.5 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.2 | 0.5 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.2 | 0.7 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.2 | 0.2 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.2 | 3.0 | GO:0097440 | apical dendrite(GO:0097440) |
0.2 | 1.9 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.2 | 1.2 | GO:0070938 | contractile ring(GO:0070938) |
0.2 | 2.4 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.2 | 8.2 | GO:0032587 | ruffle membrane(GO:0032587) |
0.2 | 0.7 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.2 | 0.2 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.2 | 0.5 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.2 | 1.2 | GO:0005861 | troponin complex(GO:0005861) |
0.2 | 1.4 | GO:0045240 | dihydrolipoyl dehydrogenase complex(GO:0045240) |
0.1 | 0.7 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.1 | 0.6 | GO:0030478 | actin cap(GO:0030478) |
0.1 | 1.8 | GO:0032426 | stereocilium tip(GO:0032426) |
0.1 | 0.1 | GO:0044393 | microspike(GO:0044393) |
0.1 | 0.1 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.1 | 0.7 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 2.6 | GO:0031941 | filamentous actin(GO:0031941) |
0.1 | 1.4 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.1 | 0.7 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.1 | 1.4 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.1 | 0.4 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.5 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.1 | 1.8 | GO:0036038 | MKS complex(GO:0036038) |
0.1 | 1.3 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 1.9 | GO:0030914 | STAGA complex(GO:0030914) |
0.1 | 1.6 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.1 | 0.9 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 2.0 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.1 | 0.5 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 1.5 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 0.4 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.1 | 0.7 | GO:0070847 | core mediator complex(GO:0070847) |
0.1 | 0.5 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.1 | 0.4 | GO:1990357 | terminal web(GO:1990357) |
0.1 | 0.5 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 9.6 | GO:0030027 | lamellipodium(GO:0030027) |
0.1 | 0.6 | GO:0030990 | intraciliary transport particle(GO:0030990) |
0.1 | 0.6 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 0.5 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.1 | 0.2 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 0.5 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.1 | 0.5 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 0.9 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.1 | 1.0 | GO:0072687 | meiotic spindle(GO:0072687) |
0.1 | 0.2 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.5 | GO:0035363 | histone locus body(GO:0035363) |
0.1 | 0.5 | GO:0097433 | dense body(GO:0097433) |
0.1 | 2.5 | GO:0032420 | stereocilium(GO:0032420) |
0.1 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.3 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 0.2 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.1 | 0.3 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.1 | 0.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.1 | 0.9 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.1 | 0.2 | GO:0005642 | annulate lamellae(GO:0005642) |
0.1 | 0.2 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 12.8 | GO:0030427 | site of polarized growth(GO:0030427) |
0.1 | 0.7 | GO:0033270 | paranode region of axon(GO:0033270) |
0.1 | 1.5 | GO:0051233 | spindle midzone(GO:0051233) |
0.1 | 0.4 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.1 | 0.9 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.1 | 0.6 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.1 | 1.2 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.1 | 0.3 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.5 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 0.5 | GO:0002177 | manchette(GO:0002177) |
0.1 | 0.7 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.1 | 1.3 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.1 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
0.1 | 0.7 | GO:0036157 | outer dynein arm(GO:0036157) |
0.1 | 0.8 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.1 | 0.4 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 2.0 | GO:0032040 | small-subunit processome(GO:0032040) |
0.1 | 0.8 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.1 | 0.4 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.1 | 9.1 | GO:0001669 | acrosomal vesicle(GO:0001669) |
0.1 | 0.8 | GO:0071439 | clathrin complex(GO:0071439) |
0.1 | 0.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 0.5 | GO:0005796 | Golgi lumen(GO:0005796) |
0.1 | 0.3 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.1 | 4.8 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.1 | 1.1 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.1 | 0.9 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.1 | 2.5 | GO:0016459 | myosin complex(GO:0016459) |
0.1 | 0.2 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 0.5 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 0.2 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 0.2 | GO:0042583 | chromaffin granule(GO:0042583) |
0.1 | 0.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 2.7 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.1 | 0.5 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.1 | 0.2 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 1.2 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.1 | 1.2 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.1 | 0.4 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.4 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.1 | 0.2 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 0.7 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
0.1 | 0.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 1.8 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 1.2 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 0.9 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 4.7 | GO:0055037 | recycling endosome(GO:0055037) |
0.1 | 0.9 | GO:0033391 | chromatoid body(GO:0033391) |
0.1 | 0.1 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
0.1 | 1.6 | GO:0031901 | early endosome membrane(GO:0031901) |
0.1 | 0.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.1 | 12.6 | GO:0045121 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
0.1 | 0.3 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 0.2 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.1 | 0.2 | GO:0043511 | inhibin complex(GO:0043511) |
0.1 | 1.3 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.1 | 0.2 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.1 | 0.5 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.1 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.3 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.1 | 0.3 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 0.2 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.1 | 5.2 | GO:0030139 | endocytic vesicle(GO:0030139) |
0.1 | 0.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 0.5 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.1 | 0.2 | GO:0097342 | ripoptosome(GO:0097342) |
0.1 | 2.5 | GO:0005871 | kinesin complex(GO:0005871) |
0.1 | 6.8 | GO:0005765 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
0.1 | 3.6 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.1 | 0.1 | GO:0071564 | npBAF complex(GO:0071564) |
0.1 | 0.7 | GO:0030315 | T-tubule(GO:0030315) |
0.1 | 0.3 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.1 | 0.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 1.1 | GO:0034707 | chloride channel complex(GO:0034707) |
0.1 | 0.2 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 2.6 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.2 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.1 | 3.7 | GO:0016605 | PML body(GO:0016605) |
0.1 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.1 | 0.2 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.1 | 0.4 | GO:0030008 | TRAPP complex(GO:0030008) |
0.1 | 0.2 | GO:0097651 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.1 | 11.1 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.1 | 0.3 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.2 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
0.1 | 0.3 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.1 | 0.3 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 1.1 | GO:0035861 | site of double-strand break(GO:0035861) |
0.1 | 0.3 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 0.2 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 4.2 | GO:0005769 | early endosome(GO:0005769) |
0.1 | 0.5 | GO:0060170 | ciliary membrane(GO:0060170) |
0.1 | 1.3 | GO:0042383 | sarcolemma(GO:0042383) |
0.1 | 0.2 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.1 | 0.3 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.1 | 5.8 | GO:0043292 | contractile fiber(GO:0043292) |
0.1 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
0.1 | 0.4 | GO:0042382 | paraspeckles(GO:0042382) |
0.1 | 0.4 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.1 | 0.4 | GO:0005869 | dynactin complex(GO:0005869) |
0.1 | 0.5 | GO:0014704 | intercalated disc(GO:0014704) |
0.1 | 5.8 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.1 | 0.1 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.1 | 0.2 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.3 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 1.0 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 0.3 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.1 | 0.1 | GO:0034705 | potassium channel complex(GO:0034705) |
0.1 | 0.1 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.0 | 0.0 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.5 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 1.2 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 2.2 | GO:0030496 | midbody(GO:0030496) |
0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 1.1 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.3 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.5 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.4 | GO:0097228 | sperm principal piece(GO:0097228) |
0.0 | 1.1 | GO:0001726 | ruffle(GO:0001726) |
0.0 | 0.0 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.0 | 0.4 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.3 | GO:0042588 | zymogen granule(GO:0042588) |
0.0 | 0.2 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.0 | 0.3 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 0.2 | GO:0005688 | U6 snRNP(GO:0005688) |
0.0 | 0.9 | GO:0031256 | leading edge membrane(GO:0031256) |
0.0 | 0.0 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.0 | 0.4 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.0 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.0 | 0.2 | GO:0005652 | nuclear lamina(GO:0005652) |
0.0 | 0.6 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.0 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.0 | 0.3 | GO:0098651 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 0.4 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.0 | 0.3 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.5 | GO:0031252 | cell leading edge(GO:0031252) |
0.0 | 1.0 | GO:0036126 | sperm flagellum(GO:0036126) |
0.0 | 2.2 | GO:0043296 | apical junction complex(GO:0043296) |
0.0 | 2.7 | GO:0005604 | basement membrane(GO:0005604) |
0.0 | 0.2 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.2 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.9 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.4 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 0.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.1 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.0 | 0.3 | GO:0030686 | 90S preribosome(GO:0030686) |
0.0 | 0.5 | GO:0000145 | exocyst(GO:0000145) |
0.0 | 0.0 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.2 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.0 | 0.5 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.4 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 3.8 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.3 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 6.0 | GO:0030055 | cell-substrate junction(GO:0030055) |
0.0 | 0.1 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.4 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.3 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.2 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.0 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
0.0 | 6.8 | GO:0048471 | perinuclear region of cytoplasm(GO:0048471) |
0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 3.6 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.0 | 2.2 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.0 | 8.3 | GO:0044429 | mitochondrial part(GO:0044429) |
0.0 | 0.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.1 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
0.0 | 1.4 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.1 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.0 | 0.5 | GO:0016528 | sarcoplasm(GO:0016528) |
0.0 | 1.0 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.6 | GO:0005770 | late endosome(GO:0005770) |
0.0 | 0.1 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 0.4 | GO:0005884 | actin filament(GO:0005884) |
0.0 | 1.7 | GO:0005819 | spindle(GO:0005819) |
0.0 | 1.5 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.1 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.0 | 1.0 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 3.3 | GO:0005768 | endosome(GO:0005768) |
0.0 | 0.4 | GO:0030684 | preribosome(GO:0030684) |
0.0 | 0.9 | GO:0031526 | brush border membrane(GO:0031526) |
0.0 | 0.1 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 0.0 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.1 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 1.4 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 15.2 | GO:0005739 | mitochondrion(GO:0005739) |
0.0 | 0.1 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.0 | GO:1990752 | microtubule end(GO:1990752) |
0.0 | 0.2 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.0 | 0.1 | GO:0005774 | vacuolar membrane(GO:0005774) |
0.0 | 1.0 | GO:0001533 | cornified envelope(GO:0001533) |
0.0 | 0.1 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.0 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.0 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
0.0 | 0.0 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.0 | 0.0 | GO:1990635 | proximal dendrite(GO:1990635) |
0.0 | 0.5 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.0 | 3.5 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.3 | GO:0045178 | basal part of cell(GO:0045178) |
0.0 | 0.1 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.0 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.0 | 0.0 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 0.6 | GO:0005643 | nuclear pore(GO:0005643) |
0.0 | 0.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 0.1 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.0 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.6 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.5 | 10.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
1.5 | 4.5 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
1.0 | 2.0 | GO:0004630 | phospholipase D activity(GO:0004630) |
1.0 | 3.8 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
0.9 | 3.8 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.9 | 2.7 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.8 | 5.1 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.8 | 3.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.8 | 2.3 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.7 | 2.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.6 | 1.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.6 | 2.6 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.6 | 0.6 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.6 | 4.3 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.6 | 1.8 | GO:0043398 | HLH domain binding(GO:0043398) |
0.6 | 1.8 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.6 | 1.8 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.6 | 4.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.6 | 2.4 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.6 | 2.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.6 | 2.9 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.5 | 1.6 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.5 | 2.1 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.5 | 6.8 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.5 | 2.1 | GO:0102344 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.5 | 2.6 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.5 | 2.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.5 | 2.0 | GO:0035276 | ethanol binding(GO:0035276) |
0.5 | 1.5 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.5 | 1.4 | GO:0070905 | serine binding(GO:0070905) |
0.5 | 1.8 | GO:0071253 | connexin binding(GO:0071253) |
0.4 | 1.8 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.4 | 1.8 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.4 | 1.7 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.4 | 2.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.4 | 1.2 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.4 | 1.2 | GO:0030172 | troponin C binding(GO:0030172) |
0.4 | 1.6 | GO:0030911 | TPR domain binding(GO:0030911) |
0.4 | 2.0 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.4 | 3.6 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.4 | 2.3 | GO:0043426 | MRF binding(GO:0043426) |
0.4 | 1.5 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.4 | 1.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.4 | 1.1 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.4 | 1.4 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.4 | 1.4 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.4 | 0.7 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.4 | 3.5 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.4 | 2.1 | GO:0016936 | galactoside binding(GO:0016936) |
0.3 | 1.4 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.3 | 1.0 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.3 | 1.0 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.3 | 6.6 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.3 | 7.1 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.3 | 2.7 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.3 | 1.3 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.3 | 2.6 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.3 | 1.0 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.3 | 3.1 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.3 | 0.9 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.3 | 0.9 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.3 | 0.9 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.3 | 0.9 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.3 | 0.6 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.3 | 0.9 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.3 | 0.9 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.3 | 1.7 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.3 | 1.2 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.3 | 1.2 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.3 | 1.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.3 | 6.8 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.3 | 1.4 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.3 | 0.8 | GO:0031433 | telethonin binding(GO:0031433) |
0.3 | 3.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.3 | 3.3 | GO:0044548 | S100 protein binding(GO:0044548) |
0.3 | 1.4 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.3 | 4.1 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.3 | 3.3 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.3 | 1.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.3 | 1.3 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.3 | 4.3 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.3 | 1.6 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.3 | 0.8 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.3 | 1.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.3 | 2.3 | GO:0034865 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.3 | 0.5 | GO:0070538 | oleic acid binding(GO:0070538) |
0.3 | 3.0 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.2 | 0.7 | GO:0035939 | microsatellite binding(GO:0035939) |
0.2 | 5.5 | GO:0043726 | phosphohistidine phosphatase activity(GO:0008969) inositol-1,3,4-trisphosphate 4-phosphatase activity(GO:0017161) NADP phosphatase activity(GO:0019178) 5-amino-6-(5-phosphoribitylamino)uracil phosphatase activity(GO:0043726) phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-3,4-bisphosphate 4-phosphatase activity(GO:0052828) inositol-1,3,4-trisphosphate 1-phosphatase activity(GO:0052829) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) phosphatidylinositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052867) IDP phosphatase activity(GO:1990003) |
0.2 | 1.5 | GO:0038132 | neuregulin binding(GO:0038132) |
0.2 | 1.0 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.2 | 1.2 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.2 | 0.7 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.2 | 0.5 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.2 | 0.7 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.2 | 0.9 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.2 | 16.2 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.2 | 1.4 | GO:0031419 | cobalamin binding(GO:0031419) |
0.2 | 1.6 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.2 | 2.0 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.2 | 0.7 | GO:0089720 | caspase binding(GO:0089720) |
0.2 | 0.9 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.2 | 0.7 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.2 | 0.7 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.2 | 0.7 | GO:0019002 | GMP binding(GO:0019002) |
0.2 | 0.7 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.2 | 0.4 | GO:0050692 | DBD domain binding(GO:0050692) |
0.2 | 0.9 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.2 | 0.6 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.2 | 0.6 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.2 | 1.0 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.2 | 0.6 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.2 | 0.8 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.2 | 0.8 | GO:0052796 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.2 | 6.5 | GO:0015485 | cholesterol binding(GO:0015485) |
0.2 | 0.6 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.2 | 1.0 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.2 | 3.3 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.2 | 5.0 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.2 | 1.9 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.2 | 0.6 | GO:0030519 | snoRNP binding(GO:0030519) |
0.2 | 0.4 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.2 | 0.9 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.2 | 0.7 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.2 | 0.9 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.2 | 0.6 | GO:0008142 | oxysterol binding(GO:0008142) |
0.2 | 0.9 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.2 | 0.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.2 | 0.9 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.2 | 1.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.2 | 1.4 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.2 | 0.5 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.2 | 0.7 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.2 | 1.2 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.2 | 5.1 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.2 | 1.4 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.2 | 4.6 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.2 | 3.6 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.2 | 0.5 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.2 | 0.5 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.2 | 0.7 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.2 | 0.2 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.2 | 1.3 | GO:0010181 | FMN binding(GO:0010181) |
0.2 | 1.7 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.2 | 0.8 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.2 | 1.0 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.2 | 2.2 | GO:0030553 | cGMP binding(GO:0030553) |
0.2 | 1.0 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.2 | 0.3 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.2 | 0.3 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.2 | 0.5 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.2 | 1.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.2 | 4.3 | GO:0042805 | actinin binding(GO:0042805) |
0.2 | 1.7 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.2 | 0.5 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.2 | 1.2 | GO:0038191 | neuropilin binding(GO:0038191) |
0.2 | 0.3 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.2 | 0.9 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.2 | 0.5 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.2 | 0.6 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.2 | 1.2 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.1 | 0.7 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 0.6 | GO:0030984 | kininogen binding(GO:0030984) |
0.1 | 0.6 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
0.1 | 1.5 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 0.7 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.1 | 0.9 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.1 | 1.6 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.1 | 0.3 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.1 | 0.4 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.1 | 1.4 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) sugar-phosphatase activity(GO:0050308) |
0.1 | 1.0 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.1 | 0.8 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.6 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.1 | 0.6 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.1 | 1.7 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
0.1 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 0.8 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.1 | 2.5 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.1 | 2.7 | GO:0015928 | fucosidase activity(GO:0015928) |
0.1 | 0.3 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
0.1 | 0.7 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 0.8 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 2.0 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.1 | 0.4 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 0.1 | GO:0008579 | JUN kinase phosphatase activity(GO:0008579) |
0.1 | 0.3 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.1 | 0.5 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.1 | 0.5 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.3 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.1 | 0.9 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
0.1 | 0.1 | GO:0032564 | dATP binding(GO:0032564) |
0.1 | 0.4 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.1 | 0.5 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.1 | 1.1 | GO:0070513 | death domain binding(GO:0070513) |
0.1 | 1.0 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.1 | 0.5 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.1 | 2.2 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.1 | 0.4 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.1 | 0.2 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.1 | 0.4 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.1 | 0.2 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.1 | 1.5 | GO:0008143 | poly(A) binding(GO:0008143) |
0.1 | 4.8 | GO:0005088 | Ras guanyl-nucleotide exchange factor activity(GO:0005088) |
0.1 | 0.5 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.1 | 0.6 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.1 | 0.2 | GO:0034618 | arginine binding(GO:0034618) |
0.1 | 6.7 | GO:0004004 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.1 | 1.1 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 0.3 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 0.9 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 0.1 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
0.1 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.1 | 0.2 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 1.7 | GO:0030332 | cyclin binding(GO:0030332) |
0.1 | 0.6 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.1 | 3.3 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.1 | 0.3 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.1 | 0.3 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.1 | 0.3 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.4 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.1 | 0.2 | GO:0009374 | biotin binding(GO:0009374) |
0.1 | 0.4 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.1 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.1 | 2.6 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.1 | 0.8 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 0.5 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.1 | 1.2 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 2.6 | GO:0050699 | WW domain binding(GO:0050699) |
0.1 | 0.6 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.1 | 0.7 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 0.4 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.1 | 1.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.1 | 0.1 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
0.1 | 1.1 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.1 | 0.6 | GO:0031432 | titin binding(GO:0031432) |
0.1 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 0.2 | GO:0032356 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.1 | 0.4 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.7 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 0.6 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.1 | 0.2 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.1 | 0.4 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 0.2 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.1 | 0.2 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.1 | 0.3 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.1 | 0.8 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.1 | 0.2 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.1 | 0.4 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.1 | 1.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 1.6 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.1 | 0.1 | GO:0051380 | norepinephrine binding(GO:0051380) |
0.1 | 2.3 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 0.2 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.5 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.1 | 1.4 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.1 | 0.3 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.1 | 0.2 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.1 | 0.6 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.1 | 1.0 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
0.1 | 0.6 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.1 | 0.5 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 0.2 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.1 | 0.3 | GO:0043888 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.1 | 0.5 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.1 | 0.2 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.1 | 0.4 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.4 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.1 | 0.6 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.1 | 0.7 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.1 | 0.2 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.1 | 0.7 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.1 | 7.7 | GO:0003774 | motor activity(GO:0003774) |
0.1 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 1.7 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.1 | 0.5 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 1.0 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 0.6 | GO:0035240 | dopamine binding(GO:0035240) |
0.1 | 0.2 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
0.1 | 3.9 | GO:0008081 | phosphoric diester hydrolase activity(GO:0008081) |
0.1 | 1.8 | GO:0001968 | fibronectin binding(GO:0001968) |
0.1 | 0.7 | GO:0035250 | UDP-galactosyltransferase activity(GO:0035250) |
0.1 | 0.2 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.1 | 0.2 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 0.2 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.1 | 0.3 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.1 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
0.1 | 1.2 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 3.7 | GO:0019003 | GDP binding(GO:0019003) |
0.1 | 0.2 | GO:0043495 | protein anchor(GO:0043495) |
0.1 | 0.1 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
0.1 | 0.2 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.1 | 0.2 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.1 | 0.9 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.1 | 0.4 | GO:0017099 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.1 | 0.2 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.1 | 0.5 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.1 | 0.3 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.1 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.5 | GO:0050544 | arachidonic acid binding(GO:0050544) |
0.1 | 2.0 | GO:0043914 | NADPH:sulfur oxidoreductase activity(GO:0043914) |
0.1 | 0.7 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 0.7 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.1 | 0.1 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.1 | 2.6 | GO:0032947 | protein complex scaffold(GO:0032947) |
0.1 | 0.4 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.1 | 0.4 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.1 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.1 | 0.3 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.1 | 1.1 | GO:0015026 | coreceptor activity(GO:0015026) |
0.1 | 0.6 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 0.1 | GO:0008649 | rRNA methyltransferase activity(GO:0008649) rRNA (uridine) methyltransferase activity(GO:0016436) |
0.1 | 0.2 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.1 | 0.4 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 0.3 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.1 | 0.8 | GO:0072349 | modified amino acid transmembrane transporter activity(GO:0072349) |
0.1 | 0.4 | GO:0015288 | porin activity(GO:0015288) |
0.1 | 0.3 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.1 | 2.1 | GO:0052770 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.1 | 1.0 | GO:0043531 | ADP binding(GO:0043531) |
0.1 | 0.3 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.1 | 0.1 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.1 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.3 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 0.1 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.1 | 1.1 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.1 | 0.6 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.1 | 2.1 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.1 | 0.2 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.1 | 4.1 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.1 | 0.3 | GO:0018741 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.1 | 0.8 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.1 | 0.1 | GO:0070840 | dynein complex binding(GO:0070840) |
0.1 | 0.1 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.1 | 0.6 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.1 | 1.0 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.1 | 0.1 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.1 | 0.3 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.1 | 0.4 | GO:0031996 | thioesterase binding(GO:0031996) |
0.1 | 0.5 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.1 | 1.5 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.1 | 0.1 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
0.1 | 0.9 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.1 | 0.9 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.1 | 0.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.1 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.1 | GO:0008425 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
0.1 | 0.2 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
0.1 | 0.6 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.1 | 0.1 | GO:0035671 | enone reductase activity(GO:0035671) |
0.1 | 0.1 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 0.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 1.1 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 0.4 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
0.1 | 0.4 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.1 | 0.3 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.4 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.1 | 0.2 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.1 | 0.6 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.1 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.1 | 0.2 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.1 | 0.3 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.1 | 1.0 | GO:0016859 | cis-trans isomerase activity(GO:0016859) |
0.1 | 0.9 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.1 | 0.8 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.1 | 0.3 | GO:0030371 | translation repressor activity(GO:0030371) |
0.1 | 0.5 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.1 | 0.1 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.1 | 0.3 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.1 | 0.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.1 | 0.2 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.1 | 0.2 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.1 | 0.3 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
0.1 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.1 | 0.9 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 0.2 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.1 | 0.1 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 0.5 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 1.0 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.1 | 1.2 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.1 | 0.4 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.1 | 0.2 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.1 | 0.6 | GO:0015078 | hydrogen ion transmembrane transporter activity(GO:0015078) |
0.1 | 0.3 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.1 | 0.2 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 0.9 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.1 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.1 | 0.2 | GO:0018656 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) phenanthrene 9,10-monooxygenase activity(GO:0018636) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 0.2 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.1 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.0 | 0.2 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.0 | 0.4 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
0.0 | 0.2 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.0 | 0.2 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.0 | 4.0 | GO:0017124 | SH3 domain binding(GO:0017124) |
0.0 | 0.5 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.0 | 0.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.2 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.0 | 0.3 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.0 | 0.5 | GO:0051378 | serotonin binding(GO:0051378) |
0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 8.0 | GO:0017016 | Ras GTPase binding(GO:0017016) |
0.0 | 1.8 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 3.0 | GO:0005249 | voltage-gated potassium channel activity(GO:0005249) |
0.0 | 0.6 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.0 | 0.1 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
0.0 | 0.1 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.4 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.1 | GO:0008378 | galactosyltransferase activity(GO:0008378) |
0.0 | 0.2 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.0 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.2 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.0 | 0.1 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.0 | 0.2 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.0 | 0.1 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.0 | 0.3 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.5 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.4 | GO:0005542 | folic acid binding(GO:0005542) |
0.0 | 0.1 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.1 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.0 | 0.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.3 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.9 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.3 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.1 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
0.0 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.2 | GO:0008251 | tRNA-specific adenosine deaminase activity(GO:0008251) |
0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.0 | 0.2 | GO:0019864 | IgG binding(GO:0019864) |
0.0 | 0.2 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.0 | 0.1 | GO:0036033 | mediator complex binding(GO:0036033) |
0.0 | 0.2 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.4 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 8.1 | GO:0016879 | ligase activity, forming carbon-nitrogen bonds(GO:0016879) |
0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.2 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.0 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.1 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.0 | 0.4 | GO:0045296 | cadherin binding(GO:0045296) |
0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 1.8 | GO:0008013 | beta-catenin binding(GO:0008013) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.4 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.4 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.0 | 0.1 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 1.6 | GO:0030165 | PDZ domain binding(GO:0030165) |
0.0 | 0.2 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 1.0 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.0 | 0.4 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.6 | GO:0005537 | mannose binding(GO:0005537) |
0.0 | 0.0 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.0 | 0.5 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.4 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.6 | GO:0031543 | peptidyl-proline dioxygenase activity(GO:0031543) |
0.0 | 1.1 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.3 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.0 | 0.1 | GO:0016531 | copper chaperone activity(GO:0016531) |
0.0 | 0.3 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.2 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.1 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.0 | 2.0 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) ubiquitin-like protein ligase activity(GO:0061659) |
0.0 | 0.0 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.0 | 0.2 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.3 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.0 | 0.3 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.0 | 0.0 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.2 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.0 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 0.3 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.0 | 0.2 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.0 | 2.8 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
0.0 | 2.3 | GO:0019783 | ubiquitin-like protein-specific protease activity(GO:0019783) |
0.0 | 0.1 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.0 | 0.2 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.0 | 0.0 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.0 | 0.2 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 0.1 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
0.0 | 0.3 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.0 | 0.0 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.0 | 0.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.0 | 0.1 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.1 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
0.0 | 0.5 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.0 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.0 | 2.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.0 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.0 | 0.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 1.4 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 0.0 | GO:0070728 | leucine binding(GO:0070728) |
0.0 | 1.5 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.0 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.0 | 0.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.2 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.0 | 0.4 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.1 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.2 | GO:0070990 | snRNP binding(GO:0070990) |
0.0 | 0.2 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.0 | 0.6 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 0.1 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.2 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 2.3 | GO:0004553 | hydrolase activity, hydrolyzing O-glycosyl compounds(GO:0004553) |
0.0 | 0.1 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.1 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
0.0 | 0.1 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.0 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.0 | 0.4 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.0 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.0 | 0.4 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.1 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.0 | 0.1 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.0 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.0 | 0.1 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.1 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.0 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.0 | 0.3 | GO:0005186 | pheromone activity(GO:0005186) |
0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.0 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.0 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.3 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.0 | 0.1 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.2 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.0 | 0.2 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.0 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.4 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 1.5 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.0 | 0.3 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.0 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.0 | 0.0 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.0 | 0.1 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.0 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) |
0.0 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.0 | 0.2 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.0 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
0.0 | 0.2 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 0.0 | GO:0048030 | disaccharide binding(GO:0048030) |
0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 1.3 | GO:0003924 | GTPase activity(GO:0003924) |
0.0 | 0.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.3 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.8 | GO:0008234 | cysteine-type peptidase activity(GO:0008234) |
0.0 | 0.0 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.0 | 0.1 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.0 | 0.0 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.0 | 0.1 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
0.0 | 0.0 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.0 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.1 | GO:0051213 | dioxygenase activity(GO:0051213) |
0.0 | 0.0 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.0 | 0.0 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.0 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.1 | GO:0015922 | aspartate oxidase activity(GO:0015922) |
0.0 | 0.0 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.0 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.0 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.4 | 6.9 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.3 | 4.4 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.3 | 4.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.3 | 7.6 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.2 | 5.2 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.2 | 1.9 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.2 | 2.6 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.2 | 2.4 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.2 | 4.2 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.2 | 5.7 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.2 | 2.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.2 | 0.3 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.2 | 3.6 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.2 | 3.0 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.2 | 2.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.2 | 1.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 6.5 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.1 | 0.3 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.1 | 2.5 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 1.7 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 4.8 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.1 | 1.0 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.1 | 1.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 2.0 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 0.7 | ST GAQ PATHWAY | G alpha q Pathway |
0.1 | 1.2 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.1 | 2.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.1 | 4.6 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.1 | 2.3 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.1 | 2.1 | PID SHP2 PATHWAY | SHP2 signaling |
0.1 | 2.3 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.1 | 0.9 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 0.1 | ST STAT3 PATHWAY | STAT3 Pathway |
0.1 | 3.0 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.1 | 1.9 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.1 | 0.5 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.1 | 1.2 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.1 | 0.9 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.1 | 0.3 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 0.3 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.1 | 1.3 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 4.0 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.1 | 1.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.1 | 2.2 | PID BARD1 PATHWAY | BARD1 signaling events |
0.1 | 1.4 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 0.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.1 | 1.6 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.1 | 1.5 | PID ENDOTHELIN PATHWAY | Endothelins |
0.1 | 1.4 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.1 | 1.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 0.4 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.1 | 0.6 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.1 | 2.4 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.1 | 0.3 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 0.4 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 0.3 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 4.4 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.1 | 1.4 | PID RAS PATHWAY | Regulation of Ras family activation |
0.1 | 1.1 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 0.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 1.9 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.1 | 1.1 | PID INSULIN PATHWAY | Insulin Pathway |
0.1 | 0.3 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.1 | 0.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 0.1 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.1 | 1.4 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.1 | 1.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 0.3 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.1 | 1.0 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.1 | 0.3 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.1 | 0.7 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 0.9 | PID ATM PATHWAY | ATM pathway |
0.1 | 0.2 | PID FOXO PATHWAY | FoxO family signaling |
0.1 | 0.2 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.1 | 0.6 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 7.4 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 1.3 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.1 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 0.1 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 1.3 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.3 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.1 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 1.5 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.3 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 1.2 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
0.0 | 0.5 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.0 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.1 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 7.0 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.1 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.4 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.4 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.7 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.3 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.4 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.3 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.1 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.2 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.5 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.2 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 0.1 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 0.3 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.3 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.1 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 0.0 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.1 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.4 | 5.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.3 | 7.3 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.3 | 0.3 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.3 | 2.9 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.3 | 2.6 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.3 | 3.2 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.3 | 5.5 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.3 | 2.7 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.3 | 3.8 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.3 | 6.4 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.3 | 5.6 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.2 | 2.7 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.2 | 2.4 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.2 | 3.9 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.2 | 9.3 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.2 | 2.5 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.2 | 1.6 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.2 | 2.4 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.2 | 6.8 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.2 | 3.9 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.2 | 3.9 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.2 | 1.4 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.2 | 1.0 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.2 | 2.3 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.2 | 3.0 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.2 | 4.1 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.2 | 2.2 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.2 | 1.6 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.2 | 1.9 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.2 | 3.0 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.2 | 1.5 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.2 | 1.6 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.1 | 0.1 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.1 | 1.3 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.1 | 1.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 1.0 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 0.4 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.1 | 5.4 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 1.7 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 0.9 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.1 | 0.5 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 0.1 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.1 | 1.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.1 | 0.5 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.1 | 1.4 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.1 | 3.6 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.1 | 2.3 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 2.5 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.1 | 0.6 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 0.9 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 1.2 | REACTOME INTEGRIN ALPHAIIB BETA3 SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
0.1 | 0.1 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.1 | 0.8 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 3.1 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.1 | 0.6 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 0.4 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.1 | 1.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 1.4 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.1 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.1 | 1.4 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.1 | 2.6 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.1 | 1.0 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 1.0 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.1 | 0.7 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.1 | 2.1 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.1 | 0.8 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
0.1 | 2.1 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 2.5 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.1 | 0.9 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.1 | 0.9 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.1 | 1.9 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.1 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.1 | 1.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 1.5 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.1 | 1.2 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.1 | 0.9 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.1 | 1.4 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.1 | 1.9 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 5.8 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.1 | 0.5 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 0.7 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.1 | 0.4 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.1 | 0.2 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.1 | 0.5 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 0.8 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.1 | 1.2 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.1 | 0.2 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.1 | 0.6 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 0.4 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.1 | 0.3 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.1 | 0.2 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.1 | 1.8 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
0.1 | 1.1 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.1 | 1.3 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
0.1 | 1.0 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 0.8 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 0.1 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.1 | 0.5 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 1.6 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.1 | 0.7 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.1 | 0.2 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
0.1 | 0.2 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.1 | 0.7 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.1 | 0.8 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.1 | 0.5 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.1 | 2.6 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.1 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.1 | 0.1 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.1 | 0.2 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.1 | 0.2 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 0.6 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
0.1 | 0.2 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.1 | 0.4 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 1.0 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
0.0 | 0.4 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.0 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.0 | 0.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.5 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.0 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.1 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.0 | 0.1 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.4 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.2 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.0 | 0.5 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.8 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.0 | 0.5 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
0.0 | 0.3 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.0 | 1.0 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.0 | 0.1 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 0.5 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.3 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.0 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.0 | 0.6 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 1.9 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.7 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.6 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.1 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.0 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
0.0 | 0.3 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.2 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.1 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
0.0 | 0.4 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.0 | 0.4 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.0 | 0.2 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.8 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.2 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.0 | 0.2 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.4 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.0 | 0.1 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.0 | 0.2 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 1.6 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.3 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.5 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.0 | 0.4 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
0.0 | 0.0 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.0 | 0.3 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.4 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.2 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.4 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.0 | 0.2 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.7 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.4 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.0 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.0 | 0.0 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.8 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.0 | 0.8 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 3.2 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.7 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.0 | 0.2 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
0.0 | 0.1 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.1 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 0.0 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.0 | 0.2 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.5 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.0 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.1 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.2 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.0 | 0.3 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.1 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.0 | 0.1 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.3 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.3 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 0.1 | REACTOME TRANSPORT OF GLUCOSE AND OTHER SUGARS BILE SALTS AND ORGANIC ACIDS METAL IONS AND AMINE COMPOUNDS | Genes involved in Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compounds |