Gene Symbol | Gene ID | Gene Info |
---|---|---|
Yy1
|
ENSMUSG00000021264.11 | Yy1 |
Yy2
|
ENSMUSG00000091736.2 | Yy2 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Yy1 | chr12_108793694_108794135 | 941 | 0.330032 | 0.36 | 4.7e-03 | Click! |
Yy1 | chr12_108793308_108793563 | 462 | 0.529509 | 0.36 | 4.7e-03 | Click! |
Yy1 | chr12_108795872_108796023 | 2974 | 0.139042 | 0.34 | 7.6e-03 | Click! |
Yy1 | chr12_108794317_108794798 | 1584 | 0.213606 | 0.32 | 1.3e-02 | Click! |
Yy1 | chr12_108796464_108796812 | 3665 | 0.126465 | 0.27 | 4.1e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr11_102360845_102363484 | 12.71 |
Slc4a1 |
solute carrier family 4 (anion exchanger), member 1 |
1540 |
0.24 |
chrX_105390628_105392456 | 10.56 |
5330434G04Rik |
RIKEN cDNA 5330434G04 gene |
212 |
0.93 |
chr2_158614356_158617139 | 9.23 |
Gm14205 |
predicted gene 14205 |
3927 |
0.13 |
chr8_84836764_84838739 | 8.98 |
Rad23a |
RAD23 homolog A, nucleotide excision repair protein |
296 |
0.75 |
chr10_62341499_62342686 | 8.88 |
Hk1 |
hexokinase 1 |
607 |
0.63 |
chr7_126702563_126704731 | 8.84 |
Coro1a |
coronin, actin binding protein 1A |
473 |
0.55 |
chr6_122391330_122392825 | 8.50 |
1700063H04Rik |
RIKEN cDNA 1700063H04 gene |
698 |
0.58 |
chr10_57784547_57786586 | 8.32 |
Fabp7 |
fatty acid binding protein 7, brain |
643 |
0.68 |
chr19_32237520_32237692 | 7.85 |
Sgms1 |
sphingomyelin synthase 1 |
1206 |
0.54 |
chr2_25264308_25268001 | 7.83 |
Tprn |
taperin |
1410 |
0.14 |
chr10_80298461_80300404 | 7.56 |
Apc2 |
APC regulator of WNT signaling pathway 2 |
341 |
0.69 |
chr11_87759834_87761999 | 7.50 |
Tspoap1 |
TSPO associated protein 1 |
329 |
0.75 |
chr8_94994139_94995207 | 7.42 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
77 |
0.95 |
chr10_80856664_80858456 | 7.32 |
Sppl2b |
signal peptide peptidase like 2B |
439 |
0.61 |
chr14_70625458_70627688 | 6.86 |
Dmtn |
dematin actin binding protein |
418 |
0.75 |
chr1_173332160_173333204 | 6.84 |
Ackr1 |
atypical chemokine receptor 1 (Duffy blood group) |
820 |
0.54 |
chr17_48449646_48450503 | 6.78 |
Tspo2 |
translocator protein 2 |
1 |
0.96 |
chr2_26485135_26488628 | 6.77 |
Notch1 |
notch 1 |
16383 |
0.09 |
chr1_132366786_132367836 | 6.75 |
Tmcc2 |
transmembrane and coiled-coil domains 2 |
239 |
0.89 |
chr17_35084460_35084651 | 6.62 |
Ly6g6f |
lymphocyte antigen 6 complex, locus G6F |
1055 |
0.18 |
chr15_76666348_76670076 | 6.56 |
Foxh1 |
forkhead box H1 |
1590 |
0.15 |
chr13_97066853_97067365 | 6.44 |
Fam169a |
family with sequence similarity 169, member A |
177 |
0.94 |
chr19_6048542_6051584 | 6.41 |
Mir6988 |
microRNA 6988 |
1271 |
0.15 |
chr4_154022768_154023789 | 6.39 |
Smim1 |
small integral membrane protein 1 |
1045 |
0.34 |
chr15_76249292_76250521 | 6.35 |
Mir6953 |
microRNA 6953 |
1715 |
0.14 |
chr8_94986231_94987228 | 6.35 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
1161 |
0.36 |
chr7_133700764_133701966 | 6.31 |
Uros |
uroporphyrinogen III synthase |
1173 |
0.35 |
chr7_141506053_141507038 | 6.20 |
Gm45416 |
predicted gene 45416 |
12058 |
0.08 |
chr17_12378732_12379615 | 6.08 |
Plg |
plasminogen |
514 |
0.75 |
chr2_103958009_103958847 | 6.04 |
Lmo2 |
LIM domain only 2 |
433 |
0.78 |
chrX_7638310_7639997 | 6.02 |
Syp |
synaptophysin |
152 |
0.88 |
chr11_69364290_69367679 | 5.99 |
Chd3 |
chromodomain helicase DNA binding protein 3 |
1205 |
0.24 |
chr5_123138345_123140456 | 5.96 |
AI480526 |
expressed sequence AI480526 |
53 |
0.85 |
chr5_116590520_116593206 | 5.96 |
Srrm4 |
serine/arginine repetitive matrix 4 |
46 |
0.98 |
chr4_110285468_110287125 | 5.95 |
Elavl4 |
ELAV like RNA binding protein 4 |
320 |
0.94 |
chr10_81497570_81499812 | 5.93 |
S1pr4 |
sphingosine-1-phosphate receptor 4 |
1441 |
0.16 |
chr19_6499251_6500132 | 5.93 |
Nrxn2 |
neurexin II |
1856 |
0.23 |
chr2_65620767_65621991 | 5.91 |
Scn2a |
sodium channel, voltage-gated, type II, alpha |
568 |
0.82 |
chr13_34127276_34127957 | 5.87 |
Tubb2b |
tubulin, beta 2B class IIB |
2738 |
0.15 |
chr2_84735706_84738103 | 5.83 |
Ypel4 |
yippee like 4 |
2677 |
0.11 |
chr4_148284201_148285628 | 5.78 |
Disp3 |
dispatched RND transporter family member 3 |
3051 |
0.22 |
chr13_78189592_78191761 | 5.78 |
Nr2f1 |
nuclear receptor subfamily 2, group F, member 1 |
233 |
0.9 |
chr4_133871871_133872343 | 5.78 |
Rps6ka1 |
ribosomal protein S6 kinase polypeptide 1 |
206 |
0.57 |
chr16_16558986_16560577 | 5.73 |
Fgd4 |
FYVE, RhoGEF and PH domain containing 4 |
209 |
0.94 |
chr10_80300884_80302968 | 5.71 |
Apc2 |
APC regulator of WNT signaling pathway 2 |
106 |
0.9 |
chr9_74861883_74864045 | 5.67 |
Onecut1 |
one cut domain, family member 1 |
1043 |
0.45 |
chr13_83727321_83728283 | 5.64 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
304 |
0.83 |
chr5_115945354_115946075 | 5.61 |
Cit |
citron |
417 |
0.82 |
chr11_21995570_21998947 | 5.59 |
Otx1 |
orthodenticle homeobox 1 |
4357 |
0.28 |
chr6_56921888_56922511 | 5.58 |
Nt5c3 |
5'-nucleotidase, cytosolic III |
1525 |
0.25 |
chr2_26576075_26576641 | 5.54 |
Egfl7 |
EGF-like domain 7 |
3656 |
0.11 |
chr4_9269280_9270516 | 5.52 |
Clvs1 |
clavesin 1 |
551 |
0.81 |
chr3_88221230_88222236 | 5.48 |
Gm3764 |
predicted gene 3764 |
931 |
0.32 |
chr2_127362687_127364202 | 5.48 |
Adra2b |
adrenergic receptor, alpha 2b |
158 |
0.94 |
chr6_41700699_41701150 | 5.46 |
Kel |
Kell blood group |
1756 |
0.24 |
chr1_177444257_177446079 | 5.45 |
Zbtb18 |
zinc finger and BTB domain containing 18 |
230 |
0.9 |
chr8_13061441_13062199 | 5.40 |
Proz |
protein Z, vitamin K-dependent plasma glycoprotein |
855 |
0.41 |
chr2_121035039_121035972 | 5.40 |
Epb42 |
erythrocyte membrane protein band 4.2 |
1176 |
0.33 |
chr16_77236731_77239778 | 5.39 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
1935 |
0.4 |
chr7_100465236_100467118 | 5.34 |
C2cd3 |
C2 calcium-dependent domain containing 3 |
770 |
0.37 |
chr5_37241461_37244349 | 5.28 |
Crmp1 |
collapsin response mediator protein 1 |
171 |
0.95 |
chr15_103250315_103251530 | 5.26 |
Nfe2 |
nuclear factor, erythroid derived 2 |
543 |
0.62 |
chr3_88208985_88210116 | 5.24 |
Gm3764 |
predicted gene 3764 |
78 |
0.92 |
chr13_63557270_63560459 | 5.21 |
Ptch1 |
patched 1 |
4951 |
0.16 |
chr12_111538188_111539436 | 5.19 |
Eif5 |
eukaryotic translation initiation factor 5 |
19 |
0.95 |
chr5_134915097_134915436 | 5.19 |
Cldn13 |
claudin 13 |
260 |
0.81 |
chr6_41703661_41704308 | 5.17 |
Kel |
Kell blood group |
355 |
0.81 |
chr3_108410436_108412210 | 5.15 |
Celsr2 |
cadherin, EGF LAG seven-pass G-type receptor 2 |
4229 |
0.11 |
chr1_172056022_172057415 | 5.12 |
Nhlh1 |
nescient helix loop helix 1 |
855 |
0.45 |
chr5_137570868_137571950 | 5.12 |
Tfr2 |
transferrin receptor 2 |
42 |
0.93 |
chr4_91380440_91381612 | 5.12 |
Elavl2 |
ELAV like RNA binding protein 1 |
4530 |
0.22 |
chr9_113970028_113970753 | 5.11 |
Gm47950 |
predicted gene, 47950 |
608 |
0.61 |
chr4_115059803_115061295 | 5.09 |
Tal1 |
T cell acute lymphocytic leukemia 1 |
1041 |
0.47 |
chr10_80270104_80272701 | 5.07 |
Dazap1 |
DAZ associated protein 1 |
6278 |
0.07 |
chr13_105444000_105445296 | 5.03 |
Htr1a |
5-hydroxytryptamine (serotonin) receptor 1A |
1009 |
0.69 |
chr8_120368836_120369597 | 4.97 |
Gm22715 |
predicted gene, 22715 |
74333 |
0.08 |
chr8_84934799_84937325 | 4.95 |
Mast1 |
microtubule associated serine/threonine kinase 1 |
1282 |
0.19 |
chr9_69758963_69761490 | 4.90 |
Foxb1 |
forkhead box B1 |
714 |
0.5 |
chr8_94985246_94986199 | 4.87 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
154 |
0.93 |
chr12_29533001_29533958 | 4.82 |
Myt1l |
myelin transcription factor 1-like |
94 |
0.96 |
chr5_38151138_38153189 | 4.81 |
Nsg1 |
neuron specific gene family member 1 |
6868 |
0.16 |
chr6_29696862_29697373 | 4.81 |
Tspan33 |
tetraspanin 33 |
2883 |
0.24 |
chr9_108825632_108827025 | 4.81 |
Celsr3 |
cadherin, EGF LAG seven-pass G-type receptor 3 |
8 |
0.91 |
chr7_51623529_51624502 | 4.81 |
Slc17a6 |
solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 6 |
1133 |
0.51 |
chr7_25153391_25155013 | 4.80 |
D930028M14Rik |
RIKEN cDNA D930028M14 gene |
867 |
0.45 |
chr19_4130763_4131308 | 4.78 |
Tmem134 |
transmembrane protein 134 |
3463 |
0.07 |
chr19_10015065_10016667 | 4.77 |
Rab3il1 |
RAB3A interacting protein (rabin3)-like 1 |
822 |
0.48 |
chr9_44801571_44803074 | 4.75 |
Ttc36 |
tetratricopeptide repeat domain 36 |
510 |
0.57 |
chr8_105322733_105323282 | 4.74 |
Lrrc29 |
leucine rich repeat containing 29 |
3252 |
0.08 |
chr9_110051810_110053856 | 4.73 |
Map4 |
microtubule-associated protein 4 |
781 |
0.54 |
chr17_25223383_25224499 | 4.73 |
Unkl |
unkempt family like zinc finger |
1162 |
0.27 |
chr7_141132681_141133038 | 4.71 |
Ptdss2 |
phosphatidylserine synthase 2 |
306 |
0.76 |
chr9_91369028_91370469 | 4.67 |
Zic4 |
zinc finger protein of the cerebellum 4 |
250 |
0.86 |
chr11_90676738_90677124 | 4.66 |
Tom1l1 |
target of myb1-like 1 (chicken) |
10648 |
0.2 |
chrX_85613609_85614890 | 4.66 |
Gm44378 |
predicted gene, 44378 |
25272 |
0.18 |
chr6_31612888_31614126 | 4.62 |
Gm43154 |
predicted gene 43154 |
8218 |
0.19 |
chr12_109455257_109457986 | 4.62 |
Dlk1 |
delta like non-canonical Notch ligand 1 |
2426 |
0.16 |
chr7_141196800_141198076 | 4.60 |
Lrrc56 |
leucine rich repeat containing 56 |
504 |
0.54 |
chr19_5093987_5095591 | 4.58 |
Cnih2 |
cornichon family AMPA receptor auxiliary protein 2 |
3593 |
0.08 |
chr17_35131032_35132104 | 4.57 |
Apom |
apolipoprotein M |
482 |
0.44 |
chr2_180235870_180236992 | 4.56 |
Lama5 |
laminin, alpha 5 |
10572 |
0.11 |
chr10_62326596_62327258 | 4.56 |
Hk1 |
hexokinase 1 |
840 |
0.58 |
chr12_4782113_4783372 | 4.55 |
Gm6682 |
predicted gene 6682 |
572 |
0.58 |
chr5_140607303_140609715 | 4.55 |
Lfng |
LFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
1189 |
0.34 |
chr16_92824962_92826063 | 4.54 |
Runx1 |
runt related transcription factor 1 |
266 |
0.94 |
chr6_86078066_86079298 | 4.54 |
Add2 |
adducin 2 (beta) |
598 |
0.65 |
chr5_64810297_64813272 | 4.53 |
Klf3 |
Kruppel-like factor 3 (basic) |
555 |
0.71 |
chr15_97379421_97380753 | 4.53 |
Pced1b |
PC-esterase domain containing 1B |
18870 |
0.24 |
chr9_44340460_44342952 | 4.53 |
Hmbs |
hydroxymethylbilane synthase |
473 |
0.51 |
chrX_133682515_133683917 | 4.52 |
Pcdh19 |
protocadherin 19 |
1775 |
0.49 |
chr4_130171697_130173536 | 4.52 |
Tinagl1 |
tubulointerstitial nephritis antigen-like 1 |
2075 |
0.27 |
chr12_29529828_29531185 | 4.49 |
Gm20208 |
predicted gene, 20208 |
609 |
0.74 |
chr6_13835523_13837039 | 4.49 |
Gpr85 |
G protein-coupled receptor 85 |
960 |
0.59 |
chr7_144238658_144240098 | 4.49 |
Shank2 |
SH3 and multiple ankyrin repeat domains 2 |
653 |
0.8 |
chr5_144760724_144761824 | 4.47 |
Tmem130 |
transmembrane protein 130 |
375 |
0.83 |
chr9_41072966_41074089 | 4.45 |
Ubash3b |
ubiquitin associated and SH3 domain containing, B |
5979 |
0.19 |
chr12_29537800_29538885 | 4.45 |
Myt1l |
myelin transcription factor 1-like |
3120 |
0.28 |
chr3_86797975_86798459 | 4.44 |
Dclk2 |
doublecortin-like kinase 2 |
205 |
0.94 |
chr1_78195176_78196209 | 4.44 |
Pax3 |
paired box 3 |
1146 |
0.55 |
chr15_78770199_78773461 | 4.43 |
Mfng |
MFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
64 |
0.96 |
chr1_172485277_172486996 | 4.40 |
Igsf9 |
immunoglobulin superfamily, member 9 |
3822 |
0.12 |
chr2_164967685_164969910 | 4.39 |
Slc12a5 |
solute carrier family 12, member 5 |
516 |
0.7 |
chr6_83185720_83187846 | 4.39 |
Dctn1 |
dynactin 1 |
837 |
0.39 |
chr2_45103994_45106973 | 4.38 |
Zeb2 |
zinc finger E-box binding homeobox 2 |
4593 |
0.23 |
chr6_90809120_90810568 | 4.36 |
Iqsec1 |
IQ motif and Sec7 domain 1 |
279 |
0.89 |
chr19_38162246_38162970 | 4.34 |
Pde6c |
phosphodiesterase 6C, cGMP specific, cone, alpha prime |
29662 |
0.13 |
chr6_146631894_146632967 | 4.34 |
Tm7sf3 |
transmembrane 7 superfamily member 3 |
2068 |
0.23 |
chr2_38351207_38353752 | 4.33 |
Lhx2 |
LIM homeobox protein 2 |
53 |
0.96 |
chr17_29493756_29495031 | 4.32 |
Pim1 |
proviral integration site 1 |
986 |
0.37 |
chr2_127369985_127371247 | 4.32 |
Adra2b |
adrenergic receptor, alpha 2b |
7330 |
0.15 |
chr4_156185280_156186798 | 4.32 |
Agrn |
agrin |
68 |
0.94 |
chr5_103769379_103770425 | 4.31 |
Aff1 |
AF4/FMR2 family, member 1 |
14457 |
0.2 |
chr18_64340633_64341751 | 4.30 |
Onecut2 |
one cut domain, family member 2 |
1172 |
0.45 |
chr8_41052368_41053980 | 4.29 |
Gm16193 |
predicted gene 16193 |
64 |
0.96 |
chr15_103332641_103334410 | 4.27 |
Zfp385a |
zinc finger protein 385A |
802 |
0.46 |
chr2_181081078_181081574 | 4.27 |
Kcnq2 |
potassium voltage-gated channel, subfamily Q, member 2 |
14095 |
0.13 |
chr11_94455571_94456396 | 4.27 |
Cacna1g |
calcium channel, voltage-dependent, T type, alpha 1G subunit |
17658 |
0.13 |
chr6_136854322_136855143 | 4.26 |
Art4 |
ADP-ribosyltransferase 4 |
3001 |
0.12 |
chrX_153498276_153500343 | 4.26 |
Ubqln2 |
ubiquilin 2 |
1082 |
0.51 |
chr6_31125380_31126701 | 4.26 |
5330406M23Rik |
RIKEN cDNA 5330406M23 gene |
15120 |
0.11 |
chr10_80604324_80605241 | 4.25 |
Gm49322 |
predicted gene, 49322 |
1239 |
0.18 |
chr8_84703616_84705950 | 4.25 |
Nfix |
nuclear factor I/X |
2933 |
0.13 |
chr7_142088584_142090929 | 4.23 |
Dusp8 |
dual specificity phosphatase 8 |
5516 |
0.09 |
chr3_94478073_94479450 | 4.22 |
Celf3 |
CUGBP, Elav-like family member 3 |
70 |
0.92 |
chr1_156213185_156214092 | 4.22 |
Fam163a |
family with sequence similarity 163, member A |
8612 |
0.17 |
chr19_45230983_45235468 | 4.21 |
Lbx1 |
ladybird homeobox 1 |
2587 |
0.27 |
chr8_33735092_33736026 | 4.21 |
Gtf2e2 |
general transcription factor II E, polypeptide 2 (beta subunit) |
2116 |
0.23 |
chr11_87756102_87757558 | 4.18 |
Mir142 |
microRNA 142 |
34 |
0.59 |
chr9_48340395_48340829 | 4.18 |
Nxpe2 |
neurexophilin and PC-esterase domain family, member 2 |
222 |
0.94 |
chr11_84520959_84524590 | 4.16 |
Lhx1 |
LIM homeobox protein 1 |
63 |
0.97 |
chr18_32556111_32556702 | 4.16 |
Gypc |
glycophorin C |
3574 |
0.26 |
chr14_55061871_55064122 | 4.15 |
Gm20687 |
predicted gene 20687 |
7503 |
0.08 |
chr1_42711455_42712692 | 4.15 |
Pantr2 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 2 |
1381 |
0.34 |
chr15_80255549_80256671 | 4.14 |
Atf4 |
activating transcription factor 4 |
587 |
0.6 |
chr11_116076531_116078496 | 4.14 |
Unc13d |
unc-13 homolog D |
77 |
0.94 |
chr7_143007094_143009025 | 4.12 |
Tspan32os |
tetraspanin 32, opposite strand |
26 |
0.96 |
chr10_80570596_80572042 | 4.12 |
Klf16 |
Kruppel-like factor 16 |
6002 |
0.08 |
chr11_87795995_87796587 | 4.09 |
Mpo |
myeloperoxidase |
1088 |
0.31 |
chr6_143832506_143833713 | 4.09 |
Sox5 |
SRY (sex determining region Y)-box 5 |
113979 |
0.06 |
chr2_31638722_31641540 | 4.08 |
Prdm12 |
PR domain containing 12 |
94 |
0.84 |
chr11_121437042_121437311 | 4.06 |
Fn3k |
fructosamine 3 kinase |
2208 |
0.21 |
chr5_116020427_116020960 | 4.06 |
Prkab1 |
protein kinase, AMP-activated, beta 1 non-catalytic subunit |
953 |
0.45 |
chr11_96940864_96941299 | 4.06 |
Pnpo |
pyridoxine 5'-phosphate oxidase |
2698 |
0.12 |
chr15_103253562_103255772 | 4.05 |
Nfe2 |
nuclear factor, erythroid derived 2 |
605 |
0.57 |
chr2_165882235_165884653 | 4.03 |
Zmynd8 |
zinc finger, MYND-type containing 8 |
766 |
0.54 |
chr7_143005720_143007083 | 4.00 |
Tspan32 |
tetraspanin 32 |
473 |
0.68 |
chr6_47245031_47245738 | 4.00 |
Cntnap2 |
contactin associated protein-like 2 |
931 |
0.71 |
chr11_78180253_78181436 | 4.00 |
Snord42a |
small nucleolar RNA, C/D box 42A |
519 |
0.33 |
chr19_55126480_55127385 | 3.99 |
Gpam |
glycerol-3-phosphate acyltransferase, mitochondrial |
271 |
0.92 |
chr9_103228079_103228881 | 3.99 |
Trf |
transferrin |
38 |
0.97 |
chr9_48338929_48340200 | 3.98 |
Nxpe2 |
neurexophilin and PC-esterase domain family, member 2 |
1270 |
0.48 |
chr5_97222612_97223731 | 3.98 |
Gm2861 |
predicted gene 2861 |
27585 |
0.16 |
chr5_115908055_115909691 | 3.98 |
Cit |
citron |
1403 |
0.37 |
chr15_83169748_83171160 | 3.97 |
Cyb5r3 |
cytochrome b5 reductase 3 |
52 |
0.95 |
chr11_54027468_54028820 | 3.95 |
Slc22a4 |
solute carrier family 22 (organic cation transporter), member 4 |
54 |
0.97 |
chr7_98176104_98177065 | 3.94 |
Gm16938 |
predicted gene, 16938 |
610 |
0.62 |
chr1_171225202_171226411 | 3.94 |
Apoa2 |
apolipoprotein A-II |
715 |
0.4 |
chr19_53258792_53259696 | 3.93 |
1700001K23Rik |
RIKEN cDNA 1700001K23 gene |
4024 |
0.18 |
chr4_62515406_62516411 | 3.92 |
Alad |
aminolevulinate, delta-, dehydratase |
3973 |
0.13 |
chr1_36071298_36072369 | 3.92 |
Hs6st1 |
heparan sulfate 6-O-sulfotransferase 1 |
3433 |
0.18 |
chr6_29694287_29695938 | 3.90 |
Tspan33 |
tetraspanin 33 |
878 |
0.58 |
chr5_115946520_115947438 | 3.90 |
Cit |
citron |
1682 |
0.33 |
chr12_27566196_27567004 | 3.90 |
Gm4166 |
predicted gene 4166 |
31601 |
0.22 |
chr9_44337580_44338161 | 3.90 |
Hmbs |
hydroxymethylbilane synthase |
105 |
0.88 |
chr15_82255980_82257145 | 3.89 |
1500009C09Rik |
RIKEN cDNA 1500009C09 gene |
539 |
0.56 |
chr9_106157450_106158063 | 3.89 |
Glyctk |
glycerate kinase |
354 |
0.7 |
chr5_35160468_35161280 | 3.89 |
Lrpap1 |
low density lipoprotein receptor-related protein associated protein 1 |
55108 |
0.11 |
chr1_75212400_75213683 | 3.89 |
Stk16 |
serine/threonine kinase 16 |
20 |
0.92 |
chr11_102469825_102470165 | 3.88 |
Itga2b |
integrin alpha 2b |
112 |
0.93 |
chr11_58948927_58950226 | 3.88 |
H2bu2 |
H2B.U histone 2 |
656 |
0.4 |
chr8_85380167_85381092 | 3.88 |
Mylk3 |
myosin light chain kinase 3 |
349 |
0.83 |
chr1_75215644_75216192 | 3.88 |
Tuba4a |
tubulin, alpha 4A |
1496 |
0.15 |
chr2_173021971_173023356 | 3.86 |
Rbm38 |
RNA binding motif protein 38 |
168 |
0.65 |
chr6_88116254_88117368 | 3.86 |
Mir6376 |
microRNA 6376 |
12553 |
0.13 |
chr16_81202167_81203211 | 3.85 |
Ncam2 |
neural cell adhesion molecule 2 |
1932 |
0.44 |
chr2_181768465_181769553 | 3.84 |
Myt1 |
myelin transcription factor 1 |
1497 |
0.33 |
chr10_80558524_80559049 | 3.83 |
Rexo1 |
REX1, RNA exonuclease 1 |
2774 |
0.12 |
chr7_132776252_132776889 | 3.83 |
Fam53b |
family with sequence similarity 53, member B |
346 |
0.89 |
chr4_119185391_119186249 | 3.82 |
Ermap |
erythroblast membrane-associated protein |
2927 |
0.12 |
chr11_95341129_95341703 | 3.81 |
Fam117a |
family with sequence similarity 117, member A |
1454 |
0.28 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
5.2 | 15.5 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
4.5 | 40.6 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
3.3 | 10.0 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
3.2 | 6.4 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
3.2 | 3.2 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
3.1 | 12.5 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
3.1 | 18.7 | GO:0031133 | regulation of axon diameter(GO:0031133) |
3.0 | 17.9 | GO:0033239 | negative regulation of cellular amine metabolic process(GO:0033239) |
2.8 | 5.7 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
2.7 | 11.0 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
2.7 | 8.1 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
2.6 | 10.5 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
2.5 | 9.9 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
2.5 | 2.5 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
2.5 | 7.4 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
2.4 | 12.1 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
2.4 | 7.3 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
2.4 | 7.1 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
2.3 | 2.3 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
2.2 | 46.6 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
2.2 | 12.9 | GO:0061620 | glycolytic process through glucose-6-phosphate(GO:0061620) |
2.1 | 10.7 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
2.1 | 6.4 | GO:0007386 | compartment pattern specification(GO:0007386) |
2.1 | 2.1 | GO:0001803 | type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
2.0 | 8.2 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
2.0 | 8.1 | GO:0032264 | IMP salvage(GO:0032264) |
2.0 | 12.0 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
2.0 | 6.0 | GO:0032910 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
2.0 | 9.8 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
2.0 | 7.8 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
1.9 | 1.9 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
1.9 | 3.9 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
1.9 | 7.7 | GO:0021778 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
1.9 | 7.7 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
1.9 | 5.7 | GO:0061511 | centriole elongation(GO:0061511) |
1.9 | 7.5 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
1.9 | 1.9 | GO:0036258 | multivesicular body assembly(GO:0036258) |
1.8 | 5.4 | GO:0000087 | mitotic M phase(GO:0000087) |
1.8 | 5.4 | GO:0072025 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
1.8 | 5.4 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
1.8 | 1.8 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
1.8 | 7.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
1.8 | 1.8 | GO:0010458 | exit from mitosis(GO:0010458) |
1.7 | 7.0 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
1.7 | 12.2 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
1.7 | 5.2 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
1.7 | 8.5 | GO:0071918 | urea transmembrane transport(GO:0071918) |
1.7 | 6.8 | GO:0002894 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
1.7 | 23.7 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
1.7 | 5.0 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
1.7 | 3.4 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
1.7 | 3.3 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
1.7 | 1.7 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
1.7 | 1.7 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
1.7 | 5.0 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
1.6 | 11.5 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
1.6 | 4.8 | GO:0042117 | monocyte activation(GO:0042117) |
1.6 | 11.2 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
1.6 | 4.7 | GO:0009139 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
1.5 | 7.7 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
1.5 | 1.5 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
1.5 | 4.5 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
1.5 | 5.9 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
1.5 | 7.4 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
1.5 | 4.4 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
1.5 | 7.4 | GO:0015879 | carnitine transport(GO:0015879) |
1.5 | 5.9 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
1.5 | 5.9 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
1.5 | 4.4 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
1.5 | 4.4 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
1.5 | 8.8 | GO:2001140 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
1.5 | 1.5 | GO:0006624 | vacuolar protein processing(GO:0006624) |
1.4 | 4.3 | GO:0040031 | snRNA modification(GO:0040031) |
1.4 | 4.3 | GO:0019042 | viral latency(GO:0019042) |
1.4 | 5.7 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
1.4 | 4.3 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
1.4 | 8.6 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
1.4 | 1.4 | GO:2000981 | negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of pro-B cell differentiation(GO:2000974) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
1.4 | 4.3 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
1.4 | 4.2 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
1.4 | 4.2 | GO:0001807 | regulation of type IV hypersensitivity(GO:0001807) |
1.4 | 5.6 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
1.4 | 4.2 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
1.4 | 4.2 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
1.4 | 1.4 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
1.4 | 4.2 | GO:0072017 | distal tubule development(GO:0072017) |
1.4 | 4.2 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
1.4 | 8.3 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
1.4 | 12.4 | GO:0043249 | erythrocyte maturation(GO:0043249) |
1.4 | 2.8 | GO:0021553 | olfactory nerve development(GO:0021553) |
1.4 | 4.1 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
1.4 | 2.8 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
1.4 | 2.8 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
1.4 | 6.9 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
1.4 | 2.7 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
1.4 | 19.0 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
1.4 | 4.1 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
1.3 | 1.3 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
1.3 | 6.7 | GO:0010587 | miRNA catabolic process(GO:0010587) |
1.3 | 5.4 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
1.3 | 2.7 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
1.3 | 4.0 | GO:0018343 | protein farnesylation(GO:0018343) |
1.3 | 14.6 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
1.3 | 6.6 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
1.3 | 4.0 | GO:0097503 | sialylation(GO:0097503) |
1.3 | 5.3 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
1.3 | 3.9 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
1.3 | 5.2 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
1.3 | 2.6 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
1.3 | 2.6 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
1.3 | 3.9 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
1.3 | 1.3 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
1.3 | 3.9 | GO:0071816 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
1.3 | 2.6 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
1.3 | 3.9 | GO:0042908 | xenobiotic transport(GO:0042908) |
1.3 | 7.7 | GO:0010985 | negative regulation of lipoprotein particle clearance(GO:0010985) |
1.3 | 2.6 | GO:0001555 | oocyte growth(GO:0001555) |
1.3 | 5.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
1.3 | 1.3 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
1.3 | 3.8 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
1.3 | 3.8 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
1.3 | 1.3 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
1.3 | 3.8 | GO:0009157 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
1.3 | 3.8 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
1.3 | 3.8 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
1.3 | 5.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
1.3 | 3.8 | GO:0002432 | granuloma formation(GO:0002432) |
1.3 | 6.3 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
1.3 | 3.8 | GO:0046618 | drug export(GO:0046618) |
1.3 | 6.3 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
1.3 | 3.8 | GO:0021586 | pons maturation(GO:0021586) |
1.2 | 1.2 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
1.2 | 3.7 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
1.2 | 8.7 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
1.2 | 3.7 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) negative regulation of DNA damage checkpoint(GO:2000002) |
1.2 | 6.2 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
1.2 | 4.9 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) regulation of mRNA polyadenylation(GO:1900363) negative regulation of mRNA polyadenylation(GO:1900364) |
1.2 | 3.6 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
1.2 | 4.9 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
1.2 | 3.6 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
1.2 | 7.2 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
1.2 | 2.4 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
1.2 | 6.0 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
1.2 | 3.6 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
1.2 | 2.4 | GO:0016075 | rRNA catabolic process(GO:0016075) |
1.2 | 1.2 | GO:0045764 | positive regulation of cellular amino acid metabolic process(GO:0045764) positive regulation of thyroid hormone generation(GO:2000611) |
1.2 | 4.7 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
1.2 | 3.5 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
1.2 | 2.4 | GO:0031635 | adenylate cyclase-inhibiting opioid receptor signaling pathway(GO:0031635) |
1.2 | 8.2 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
1.2 | 8.2 | GO:0045332 | phospholipid translocation(GO:0045332) |
1.2 | 1.2 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
1.2 | 7.0 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
1.2 | 1.2 | GO:0046208 | spermine catabolic process(GO:0046208) |
1.2 | 11.6 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
1.2 | 2.3 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
1.2 | 2.3 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
1.1 | 4.6 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
1.1 | 1.1 | GO:0016556 | mRNA modification(GO:0016556) |
1.1 | 1.1 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
1.1 | 3.4 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
1.1 | 2.3 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
1.1 | 6.9 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
1.1 | 3.4 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
1.1 | 8.0 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
1.1 | 3.4 | GO:0044027 | DNA hypermethylation(GO:0044026) hypermethylation of CpG island(GO:0044027) |
1.1 | 1.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
1.1 | 3.4 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
1.1 | 3.4 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
1.1 | 4.5 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
1.1 | 3.4 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
1.1 | 14.5 | GO:0048821 | erythrocyte development(GO:0048821) |
1.1 | 3.3 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
1.1 | 11.0 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
1.1 | 4.4 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
1.1 | 1.1 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
1.1 | 8.7 | GO:0034063 | stress granule assembly(GO:0034063) |
1.1 | 2.2 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
1.1 | 3.2 | GO:0015817 | histidine transport(GO:0015817) |
1.1 | 5.4 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
1.1 | 2.2 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
1.1 | 5.4 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
1.1 | 6.5 | GO:0006559 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
1.1 | 7.5 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
1.1 | 3.2 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
1.1 | 9.7 | GO:0032986 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
1.1 | 2.1 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
1.1 | 4.3 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
1.1 | 5.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
1.1 | 7.5 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
1.1 | 4.3 | GO:0032776 | DNA methylation on cytosine within a CG sequence(GO:0010424) DNA methylation on cytosine(GO:0032776) |
1.1 | 2.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
1.1 | 1.1 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
1.1 | 3.2 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
1.1 | 3.2 | GO:0070488 | neutrophil aggregation(GO:0070488) |
1.1 | 1.1 | GO:1903421 | regulation of synaptic vesicle recycling(GO:1903421) |
1.0 | 3.1 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
1.0 | 2.1 | GO:0007035 | vacuolar acidification(GO:0007035) |
1.0 | 25.1 | GO:0006270 | DNA replication initiation(GO:0006270) |
1.0 | 1.0 | GO:0061687 | detoxification of inorganic compound(GO:0061687) |
1.0 | 1.0 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
1.0 | 3.1 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
1.0 | 4.1 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
1.0 | 5.1 | GO:1902804 | negative regulation of synaptic vesicle transport(GO:1902804) |
1.0 | 2.1 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
1.0 | 1.0 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
1.0 | 7.2 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
1.0 | 2.0 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
1.0 | 3.1 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
1.0 | 8.2 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
1.0 | 17.3 | GO:0009299 | mRNA transcription(GO:0009299) |
1.0 | 4.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
1.0 | 5.1 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
1.0 | 2.0 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
1.0 | 6.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
1.0 | 3.0 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
1.0 | 3.0 | GO:2001271 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
1.0 | 8.1 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
1.0 | 3.0 | GO:0046865 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
1.0 | 3.0 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
1.0 | 3.0 | GO:1901475 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
1.0 | 5.0 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
1.0 | 6.0 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
1.0 | 3.0 | GO:0006562 | proline catabolic process(GO:0006562) |
1.0 | 3.0 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
1.0 | 12.9 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
1.0 | 5.9 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
1.0 | 13.8 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
1.0 | 1.0 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
1.0 | 2.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
1.0 | 2.0 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
1.0 | 1.0 | GO:2000317 | negative regulation of T-helper 17 type immune response(GO:2000317) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
1.0 | 1.9 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
1.0 | 5.8 | GO:0036514 | dopaminergic neuron axon guidance(GO:0036514) planar cell polarity pathway involved in axon guidance(GO:1904938) |
1.0 | 2.9 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
1.0 | 1.9 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
1.0 | 4.8 | GO:0036233 | glycine import(GO:0036233) |
1.0 | 4.8 | GO:0039532 | negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
1.0 | 6.7 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
1.0 | 6.7 | GO:0097286 | iron ion import(GO:0097286) |
0.9 | 1.9 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.9 | 5.7 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.9 | 2.8 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.9 | 3.8 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.9 | 1.9 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.9 | 1.9 | GO:0002866 | positive regulation of acute inflammatory response to antigenic stimulus(GO:0002866) |
0.9 | 5.6 | GO:0072526 | pyridine-containing compound catabolic process(GO:0072526) |
0.9 | 6.5 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.9 | 0.9 | GO:0006415 | translational termination(GO:0006415) |
0.9 | 4.6 | GO:0021764 | amygdala development(GO:0021764) |
0.9 | 9.2 | GO:0071625 | vocalization behavior(GO:0071625) |
0.9 | 3.7 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.9 | 1.8 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.9 | 13.8 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.9 | 2.8 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.9 | 2.7 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
0.9 | 6.4 | GO:0015825 | L-serine transport(GO:0015825) |
0.9 | 2.7 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.9 | 4.6 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.9 | 1.8 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
0.9 | 2.7 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.9 | 1.8 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.9 | 1.8 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
0.9 | 1.8 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.9 | 3.6 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.9 | 1.8 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.9 | 2.7 | GO:0070268 | cornification(GO:0070268) |
0.9 | 9.9 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.9 | 3.6 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.9 | 4.5 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.9 | 3.6 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.9 | 5.4 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.9 | 4.4 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.9 | 3.5 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.9 | 4.4 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.9 | 11.5 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.9 | 1.8 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.9 | 3.5 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.9 | 1.7 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.9 | 3.5 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.9 | 3.5 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.9 | 1.7 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.9 | 4.3 | GO:1900164 | nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
0.9 | 5.2 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.9 | 3.4 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.9 | 12.9 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.9 | 1.7 | GO:0002254 | kinin cascade(GO:0002254) |
0.9 | 2.6 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.9 | 5.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.9 | 1.7 | GO:0090270 | fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) |
0.9 | 7.7 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.9 | 9.4 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.9 | 5.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.8 | 4.2 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.8 | 14.4 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.8 | 2.5 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.8 | 27.9 | GO:0044784 | metaphase/anaphase transition of mitotic cell cycle(GO:0007091) metaphase/anaphase transition of cell cycle(GO:0044784) |
0.8 | 0.8 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.8 | 3.4 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.8 | 19.3 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.8 | 0.8 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
0.8 | 1.7 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
0.8 | 4.2 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.8 | 5.0 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.8 | 3.3 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.8 | 4.2 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.8 | 3.3 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.8 | 6.6 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
0.8 | 2.5 | GO:0007412 | axon target recognition(GO:0007412) |
0.8 | 2.5 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.8 | 2.5 | GO:0070649 | polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
0.8 | 2.5 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.8 | 3.3 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.8 | 4.9 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.8 | 4.1 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.8 | 0.8 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
0.8 | 1.6 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.8 | 1.6 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.8 | 0.8 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.8 | 1.6 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.8 | 0.8 | GO:1904814 | regulation of protein localization to chromosome, telomeric region(GO:1904814) positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
0.8 | 7.3 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.8 | 9.7 | GO:0031297 | replication fork processing(GO:0031297) |
0.8 | 1.6 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.8 | 4.0 | GO:0015816 | glycine transport(GO:0015816) |
0.8 | 1.6 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.8 | 12.0 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.8 | 2.4 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.8 | 0.8 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.8 | 0.8 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.8 | 2.4 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.8 | 5.6 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.8 | 1.6 | GO:0015677 | copper ion import(GO:0015677) |
0.8 | 2.4 | GO:0033668 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.8 | 3.2 | GO:2000510 | regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.8 | 3.2 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.8 | 1.6 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.8 | 2.4 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
0.8 | 2.4 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.8 | 1.6 | GO:0015684 | ferrous iron transport(GO:0015684) |
0.8 | 1.6 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.8 | 1.6 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.8 | 7.1 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.8 | 3.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.8 | 3.2 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
0.8 | 5.5 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.8 | 3.1 | GO:0019532 | oxalate transport(GO:0019532) |
0.8 | 3.9 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.8 | 3.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.8 | 2.3 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.8 | 3.9 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.8 | 0.8 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.8 | 3.9 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.8 | 3.9 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
0.8 | 2.3 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.8 | 3.1 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.8 | 1.5 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
0.8 | 9.1 | GO:0051601 | exocyst localization(GO:0051601) |
0.8 | 1.5 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.8 | 2.3 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.8 | 2.3 | GO:0034770 | histone H4-K20 methylation(GO:0034770) histone H4-K20 trimethylation(GO:0034773) |
0.8 | 16.7 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.8 | 5.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.8 | 5.3 | GO:0031126 | snoRNA 3'-end processing(GO:0031126) |
0.8 | 2.3 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.8 | 2.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.8 | 5.3 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.8 | 2.3 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.8 | 4.5 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.8 | 2.3 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.7 | 3.0 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
0.7 | 1.5 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.7 | 1.5 | GO:0034214 | protein hexamerization(GO:0034214) |
0.7 | 1.5 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.7 | 5.9 | GO:0010388 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.7 | 1.5 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.7 | 3.7 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
0.7 | 3.0 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.7 | 2.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.7 | 6.6 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
0.7 | 3.0 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.7 | 1.5 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.7 | 0.7 | GO:0010988 | regulation of low-density lipoprotein particle clearance(GO:0010988) |
0.7 | 0.7 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.7 | 3.7 | GO:1990173 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
0.7 | 2.9 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.7 | 2.9 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.7 | 2.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.7 | 1.5 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.7 | 1.5 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
0.7 | 3.6 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.7 | 2.9 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.7 | 4.4 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
0.7 | 5.1 | GO:1901409 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.7 | 3.6 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.7 | 3.6 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.7 | 2.9 | GO:0061615 | glycolytic process through fructose-6-phosphate(GO:0061615) |
0.7 | 18.1 | GO:0006414 | translational elongation(GO:0006414) |
0.7 | 0.7 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
0.7 | 2.2 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.7 | 5.0 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.7 | 3.6 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.7 | 2.9 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.7 | 2.9 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.7 | 2.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.7 | 0.7 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.7 | 1.4 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
0.7 | 3.6 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.7 | 1.4 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.7 | 2.1 | GO:0006534 | cysteine metabolic process(GO:0006534) |
0.7 | 5.7 | GO:0043248 | proteasome assembly(GO:0043248) |
0.7 | 2.1 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.7 | 2.8 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.7 | 0.7 | GO:0031498 | chromatin disassembly(GO:0031498) |
0.7 | 1.4 | GO:1904861 | excitatory synapse assembly(GO:1904861) |
0.7 | 0.7 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.7 | 5.6 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.7 | 2.1 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.7 | 3.5 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.7 | 7.0 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.7 | 3.5 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.7 | 2.1 | GO:0035973 | aggrephagy(GO:0035973) |
0.7 | 2.1 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
0.7 | 1.4 | GO:1904429 | regulation of t-circle formation(GO:1904429) positive regulation of t-circle formation(GO:1904431) |
0.7 | 4.2 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
0.7 | 0.7 | GO:0072718 | response to cisplatin(GO:0072718) |
0.7 | 1.4 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.7 | 15.9 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
0.7 | 2.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.7 | 2.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.7 | 1.4 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
0.7 | 2.1 | GO:0090343 | positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
0.7 | 2.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.7 | 6.2 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
0.7 | 4.8 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.7 | 2.1 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
0.7 | 1.4 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
0.7 | 2.0 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.7 | 6.8 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.7 | 5.4 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.7 | 2.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.7 | 1.3 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.7 | 18.8 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.7 | 0.7 | GO:0042023 | regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
0.7 | 2.7 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.7 | 2.0 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.7 | 0.7 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.7 | 0.7 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.7 | 2.0 | GO:0001969 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
0.7 | 0.7 | GO:0030242 | pexophagy(GO:0030242) |
0.7 | 5.3 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.7 | 6.6 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.7 | 0.7 | GO:0046101 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
0.7 | 2.0 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.7 | 4.0 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.7 | 3.3 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.7 | 27.6 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.7 | 4.6 | GO:0046498 | S-adenosylhomocysteine metabolic process(GO:0046498) |
0.7 | 5.2 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
0.7 | 5.2 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
0.7 | 11.1 | GO:0030488 | tRNA methylation(GO:0030488) |
0.7 | 2.0 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.7 | 0.7 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.7 | 0.7 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.6 | 3.2 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.6 | 1.3 | GO:0050779 | RNA destabilization(GO:0050779) |
0.6 | 2.6 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.6 | 1.9 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.6 | 3.2 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.6 | 1.3 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.6 | 5.1 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.6 | 1.9 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.6 | 5.1 | GO:0008216 | spermidine metabolic process(GO:0008216) |
0.6 | 1.9 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.6 | 11.5 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.6 | 1.3 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.6 | 1.9 | GO:0006116 | NADH oxidation(GO:0006116) |
0.6 | 1.3 | GO:0033762 | response to glucagon(GO:0033762) |
0.6 | 0.6 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
0.6 | 1.9 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.6 | 1.9 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.6 | 12.6 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
0.6 | 1.3 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.6 | 1.3 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.6 | 0.6 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.6 | 1.2 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
0.6 | 1.2 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
0.6 | 10.6 | GO:0048024 | regulation of mRNA splicing, via spliceosome(GO:0048024) |
0.6 | 0.6 | GO:0009219 | pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide metabolic process(GO:0009219) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.6 | 1.2 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.6 | 8.1 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
0.6 | 1.2 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
0.6 | 3.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.6 | 1.2 | GO:0006901 | vesicle coating(GO:0006901) |
0.6 | 1.9 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.6 | 1.2 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.6 | 3.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.6 | 1.8 | GO:1904587 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.6 | 7.4 | GO:0031629 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.6 | 12.9 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.6 | 8.0 | GO:0000154 | rRNA modification(GO:0000154) |
0.6 | 0.6 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.6 | 9.2 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.6 | 4.9 | GO:0034244 | negative regulation of DNA-templated transcription, elongation(GO:0032785) negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.6 | 10.4 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.6 | 0.6 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.6 | 2.4 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.6 | 4.3 | GO:0050684 | regulation of mRNA processing(GO:0050684) |
0.6 | 0.6 | GO:0072319 | vesicle uncoating(GO:0072319) |
0.6 | 1.2 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.6 | 1.2 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.6 | 1.8 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
0.6 | 3.0 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
0.6 | 4.2 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.6 | 1.2 | GO:0002442 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
0.6 | 0.6 | GO:1904833 | positive regulation of superoxide dismutase activity(GO:1901671) positive regulation of removal of superoxide radicals(GO:1904833) |
0.6 | 0.6 | GO:0071672 | negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
0.6 | 1.2 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.6 | 1.8 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.6 | 2.4 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.6 | 1.2 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
0.6 | 4.7 | GO:0009437 | carnitine metabolic process(GO:0009437) |
0.6 | 1.8 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.6 | 2.3 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.6 | 3.5 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.6 | 1.7 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.6 | 1.2 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.6 | 1.2 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.6 | 1.7 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.6 | 2.9 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
0.6 | 1.7 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.6 | 1.2 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.6 | 1.7 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.6 | 1.1 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
0.6 | 1.7 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.6 | 1.7 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.6 | 3.4 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.6 | 1.7 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.6 | 2.9 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.6 | 2.9 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.6 | 4.6 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.6 | 1.1 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.6 | 1.1 | GO:1902915 | histone H2A K63-linked ubiquitination(GO:0070535) negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.6 | 0.6 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.6 | 2.3 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.6 | 1.1 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.6 | 2.3 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.6 | 1.7 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.6 | 4.0 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.6 | 5.6 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.6 | 2.2 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.6 | 0.6 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.6 | 0.6 | GO:0090325 | regulation of locomotion involved in locomotory behavior(GO:0090325) |
0.6 | 0.6 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
0.6 | 1.7 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.6 | 8.9 | GO:0006298 | mismatch repair(GO:0006298) |
0.6 | 2.8 | GO:1904406 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
0.6 | 2.2 | GO:0051126 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
0.6 | 2.8 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.6 | 1.7 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.6 | 1.1 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.6 | 2.2 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.6 | 1.1 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.6 | 3.9 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.6 | 0.6 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.6 | 1.1 | GO:0007144 | female meiosis I(GO:0007144) |
0.6 | 2.8 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.6 | 1.7 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.6 | 1.7 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.5 | 2.7 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.5 | 3.8 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.5 | 2.2 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.5 | 1.1 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.5 | 1.1 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
0.5 | 0.5 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
0.5 | 1.6 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.5 | 3.3 | GO:0007549 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.5 | 1.1 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.5 | 0.5 | GO:0090135 | actin filament branching(GO:0090135) |
0.5 | 0.5 | GO:0042772 | DNA damage response, signal transduction resulting in transcription(GO:0042772) |
0.5 | 2.2 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.5 | 3.8 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.5 | 1.6 | GO:0009445 | putrescine metabolic process(GO:0009445) |
0.5 | 1.1 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.5 | 7.0 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.5 | 1.1 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.5 | 4.3 | GO:0048854 | brain morphogenesis(GO:0048854) |
0.5 | 2.7 | GO:0006547 | histidine metabolic process(GO:0006547) histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.5 | 1.1 | GO:0070671 | response to interleukin-12(GO:0070671) |
0.5 | 1.6 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.5 | 4.8 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
0.5 | 2.1 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.5 | 0.5 | GO:0001907 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.5 | 7.4 | GO:0044804 | nucleophagy(GO:0044804) |
0.5 | 2.7 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.5 | 2.1 | GO:0015846 | polyamine transport(GO:0015846) |
0.5 | 2.1 | GO:0035627 | ceramide transport(GO:0035627) |
0.5 | 4.2 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
0.5 | 3.7 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.5 | 1.0 | GO:0033121 | regulation of purine nucleotide catabolic process(GO:0033121) |
0.5 | 4.2 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.5 | 1.0 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.5 | 2.1 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) negative regulation of peptidyl-lysine acetylation(GO:2000757) |
0.5 | 0.5 | GO:1901679 | nucleotide transmembrane transport(GO:1901679) |
0.5 | 0.5 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.5 | 1.0 | GO:0000478 | endonucleolytic cleavage involved in rRNA processing(GO:0000478) |
0.5 | 2.6 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.5 | 2.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.5 | 1.6 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.5 | 0.5 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.5 | 3.1 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.5 | 2.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.5 | 4.1 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.5 | 0.5 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.5 | 3.1 | GO:0039529 | RIG-I signaling pathway(GO:0039529) |
0.5 | 3.1 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
0.5 | 1.5 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
0.5 | 2.0 | GO:0033599 | regulation of mammary gland epithelial cell proliferation(GO:0033599) |
0.5 | 2.5 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.5 | 0.5 | GO:0032239 | regulation of nucleobase-containing compound transport(GO:0032239) |
0.5 | 5.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.5 | 1.5 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
0.5 | 1.0 | GO:1903232 | melanosome assembly(GO:1903232) |
0.5 | 1.0 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.5 | 6.1 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.5 | 0.5 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
0.5 | 1.5 | GO:0032392 | DNA geometric change(GO:0032392) |
0.5 | 1.0 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.5 | 8.0 | GO:0021846 | cell proliferation in forebrain(GO:0021846) |
0.5 | 1.0 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.5 | 6.0 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.5 | 0.5 | GO:0097167 | response to ether(GO:0045472) circadian regulation of translation(GO:0097167) |
0.5 | 7.5 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.5 | 1.0 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.5 | 1.5 | GO:0018214 | protein carboxylation(GO:0018214) |
0.5 | 2.0 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
0.5 | 2.0 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
0.5 | 3.0 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.5 | 2.5 | GO:0000012 | single strand break repair(GO:0000012) |
0.5 | 5.0 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.5 | 1.0 | GO:0043144 | snoRNA processing(GO:0043144) |
0.5 | 0.5 | GO:0031062 | positive regulation of histone methylation(GO:0031062) |
0.5 | 2.0 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.5 | 4.5 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.5 | 2.0 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.5 | 1.0 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.5 | 1.0 | GO:0030576 | Cajal body organization(GO:0030576) |
0.5 | 1.5 | GO:0072402 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.5 | 2.5 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.5 | 6.4 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.5 | 1.0 | GO:0042891 | antibiotic transport(GO:0042891) |
0.5 | 1.5 | GO:0015744 | succinate transport(GO:0015744) |
0.5 | 12.8 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
0.5 | 1.0 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.5 | 2.9 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
0.5 | 6.3 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.5 | 1.5 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.5 | 0.5 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
0.5 | 2.9 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.5 | 1.0 | GO:0048261 | negative regulation of receptor-mediated endocytosis(GO:0048261) |
0.5 | 1.0 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.5 | 1.0 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
0.5 | 1.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.5 | 0.5 | GO:0051294 | establishment of spindle orientation(GO:0051294) |
0.5 | 19.2 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
0.5 | 1.4 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.5 | 1.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.5 | 1.9 | GO:0003072 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
0.5 | 0.5 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
0.5 | 1.4 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
0.5 | 17.6 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.5 | 4.7 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.5 | 0.5 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.5 | 1.4 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.5 | 0.5 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
0.5 | 0.5 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.5 | 0.9 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.5 | 1.4 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.5 | 0.9 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.5 | 3.3 | GO:0046415 | urate metabolic process(GO:0046415) |
0.5 | 0.5 | GO:0016553 | base conversion or substitution editing(GO:0016553) |
0.5 | 1.4 | GO:0048102 | autophagic cell death(GO:0048102) |
0.5 | 1.8 | GO:0046958 | nonassociative learning(GO:0046958) |
0.5 | 1.4 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
0.5 | 2.3 | GO:0006265 | DNA topological change(GO:0006265) |
0.5 | 2.8 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
0.5 | 0.9 | GO:0006903 | vesicle targeting(GO:0006903) |
0.5 | 0.5 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.5 | 1.4 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
0.5 | 1.8 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.5 | 1.4 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.5 | 0.9 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.5 | 1.4 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.5 | 2.7 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.5 | 2.7 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.5 | 0.5 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.5 | 0.5 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
0.5 | 7.7 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.5 | 14.5 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
0.5 | 3.2 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
0.5 | 14.9 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.5 | 1.4 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.5 | 1.8 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.5 | 4.1 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.5 | 25.7 | GO:0042254 | ribosome biogenesis(GO:0042254) |
0.4 | 1.3 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.4 | 3.1 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.4 | 33.6 | GO:0000375 | RNA splicing, via transesterification reactions(GO:0000375) |
0.4 | 20.6 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.4 | 2.7 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.4 | 12.4 | GO:0043488 | regulation of mRNA stability(GO:0043488) |
0.4 | 1.8 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.4 | 4.0 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
0.4 | 0.4 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.4 | 0.4 | GO:0016071 | mRNA metabolic process(GO:0016071) |
0.4 | 1.8 | GO:0019068 | virion assembly(GO:0019068) |
0.4 | 10.2 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
0.4 | 1.3 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.4 | 0.9 | GO:0001302 | replicative cell aging(GO:0001302) |
0.4 | 0.9 | GO:0031296 | B cell costimulation(GO:0031296) |
0.4 | 0.9 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
0.4 | 1.8 | GO:0042168 | heme metabolic process(GO:0042168) |
0.4 | 1.3 | GO:0090155 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
0.4 | 3.1 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.4 | 0.9 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
0.4 | 0.9 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.4 | 1.8 | GO:0015886 | heme transport(GO:0015886) |
0.4 | 1.3 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.4 | 0.9 | GO:0030449 | regulation of complement activation(GO:0030449) |
0.4 | 0.9 | GO:1902075 | cellular response to salt(GO:1902075) |
0.4 | 3.5 | GO:0045176 | apical protein localization(GO:0045176) |
0.4 | 1.7 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.4 | 12.2 | GO:1902653 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
0.4 | 5.2 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.4 | 0.4 | GO:1903313 | positive regulation of mRNA metabolic process(GO:1903313) |
0.4 | 0.4 | GO:0052803 | imidazole-containing compound metabolic process(GO:0052803) |
0.4 | 6.1 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.4 | 3.5 | GO:0006465 | signal peptide processing(GO:0006465) |
0.4 | 1.3 | GO:2000674 | regulation of type B pancreatic cell apoptotic process(GO:2000674) |
0.4 | 2.1 | GO:0046464 | neutral lipid catabolic process(GO:0046461) acylglycerol catabolic process(GO:0046464) |
0.4 | 0.4 | GO:0006188 | IMP biosynthetic process(GO:0006188) |
0.4 | 1.3 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.4 | 1.3 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
0.4 | 1.3 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.4 | 1.3 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.4 | 2.1 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.4 | 2.1 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.4 | 0.8 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.4 | 0.8 | GO:0070417 | cellular response to cold(GO:0070417) |
0.4 | 1.3 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.4 | 1.3 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.4 | 0.4 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.4 | 1.3 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.4 | 2.1 | GO:0000052 | citrulline metabolic process(GO:0000052) |
0.4 | 4.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.4 | 0.8 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.4 | 0.8 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.4 | 0.8 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.4 | 1.3 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.4 | 4.2 | GO:0016180 | snRNA processing(GO:0016180) |
0.4 | 1.3 | GO:0065002 | intracellular protein transmembrane transport(GO:0065002) protein transmembrane transport(GO:0071806) |
0.4 | 0.4 | GO:0051031 | tRNA transport(GO:0051031) |
0.4 | 2.1 | GO:0006477 | protein sulfation(GO:0006477) |
0.4 | 0.8 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.4 | 0.4 | GO:0070459 | prolactin secretion(GO:0070459) |
0.4 | 2.5 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.4 | 12.0 | GO:0051225 | spindle assembly(GO:0051225) |
0.4 | 1.6 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.4 | 0.8 | GO:0051299 | centrosome separation(GO:0051299) |
0.4 | 6.1 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.4 | 3.7 | GO:1901072 | glucosamine-containing compound catabolic process(GO:1901072) |
0.4 | 2.0 | GO:1903543 | regulation of exosomal secretion(GO:1903541) positive regulation of exosomal secretion(GO:1903543) |
0.4 | 0.4 | GO:0032366 | intracellular sterol transport(GO:0032366) |
0.4 | 3.7 | GO:0002921 | negative regulation of humoral immune response(GO:0002921) |
0.4 | 3.2 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.4 | 1.2 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
0.4 | 2.4 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.4 | 0.4 | GO:0010869 | regulation of receptor biosynthetic process(GO:0010869) |
0.4 | 0.8 | GO:1902308 | regulation of peptidyl-serine dephosphorylation(GO:1902308) |
0.4 | 1.6 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.4 | 0.4 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.4 | 2.4 | GO:0006896 | Golgi to endosome transport(GO:0006895) Golgi to vacuole transport(GO:0006896) |
0.4 | 0.4 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
0.4 | 0.8 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.4 | 2.0 | GO:0009642 | response to light intensity(GO:0009642) |
0.4 | 0.4 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.4 | 2.8 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.4 | 4.4 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.4 | 2.0 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.4 | 4.3 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.4 | 0.4 | GO:0043307 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
0.4 | 0.4 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.4 | 2.0 | GO:1904970 | brush border assembly(GO:1904970) |
0.4 | 0.8 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.4 | 0.4 | GO:0032831 | positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.4 | 32.1 | GO:0008380 | RNA splicing(GO:0008380) |
0.4 | 0.4 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.4 | 2.3 | GO:0043574 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
0.4 | 0.8 | GO:0048478 | replication fork protection(GO:0048478) |
0.4 | 11.3 | GO:0080171 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
0.4 | 1.6 | GO:0046348 | amino sugar catabolic process(GO:0046348) |
0.4 | 1.2 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.4 | 2.7 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
0.4 | 1.2 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.4 | 10.0 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.4 | 1.9 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.4 | 0.8 | GO:0080009 | mRNA methylation(GO:0080009) |
0.4 | 1.2 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.4 | 1.1 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.4 | 0.4 | GO:0043094 | cellular metabolic compound salvage(GO:0043094) |
0.4 | 1.5 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.4 | 0.4 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
0.4 | 0.8 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.4 | 1.1 | GO:0032415 | regulation of sodium:proton antiporter activity(GO:0032415) |
0.4 | 1.1 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.4 | 1.5 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.4 | 0.4 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.4 | 1.5 | GO:0061085 | regulation of histone H3-K27 methylation(GO:0061085) positive regulation of histone H3-K27 methylation(GO:0061087) |
0.4 | 6.3 | GO:0006491 | N-glycan processing(GO:0006491) |
0.4 | 3.0 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.4 | 3.0 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
0.4 | 2.2 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.4 | 0.7 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.4 | 8.1 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
0.4 | 0.7 | GO:1904415 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.4 | 0.7 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.4 | 0.4 | GO:1904729 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
0.4 | 8.4 | GO:0043967 | histone H4 acetylation(GO:0043967) |
0.4 | 0.4 | GO:0002524 | hypersensitivity(GO:0002524) |
0.4 | 0.4 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.4 | 0.4 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.4 | 1.1 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.4 | 10.5 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.4 | 6.5 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.4 | 2.2 | GO:0008214 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
0.4 | 0.4 | GO:0000279 | M phase(GO:0000279) |
0.4 | 0.4 | GO:0060166 | olfactory pit development(GO:0060166) |
0.4 | 1.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.4 | 3.6 | GO:0016926 | protein desumoylation(GO:0016926) |
0.4 | 3.2 | GO:0006568 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
0.4 | 3.6 | GO:0007093 | mitotic cell cycle checkpoint(GO:0007093) |
0.4 | 0.4 | GO:0006101 | citrate metabolic process(GO:0006101) |
0.4 | 1.4 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.4 | 1.1 | GO:0006921 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.4 | 1.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.4 | 0.4 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
0.4 | 0.7 | GO:0070444 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
0.4 | 2.5 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.4 | 0.4 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.4 | 3.9 | GO:0045116 | protein neddylation(GO:0045116) |
0.4 | 0.4 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.3 | 0.3 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.3 | 1.0 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.3 | 0.7 | GO:0033700 | phospholipid efflux(GO:0033700) |
0.3 | 0.3 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.3 | 2.1 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.3 | 1.4 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.3 | 3.8 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.3 | 0.3 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.3 | 0.3 | GO:0016572 | histone phosphorylation(GO:0016572) |
0.3 | 2.8 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.3 | 1.0 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.3 | 0.3 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.3 | 1.0 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.3 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
0.3 | 1.4 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.3 | 0.7 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.3 | 2.4 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.3 | 0.7 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.3 | 6.4 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
0.3 | 1.0 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.3 | 1.0 | GO:0046686 | response to cadmium ion(GO:0046686) |
0.3 | 3.7 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.3 | 0.7 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.3 | 1.3 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.3 | 0.7 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.3 | 2.0 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.3 | 1.0 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.3 | 0.7 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.3 | 1.3 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.3 | 0.7 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.3 | 2.3 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.3 | 0.7 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
0.3 | 0.3 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
0.3 | 0.3 | GO:0010390 | histone monoubiquitination(GO:0010390) |
0.3 | 0.7 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.3 | 1.6 | GO:1902254 | negative regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902254) |
0.3 | 0.7 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.3 | 1.6 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
0.3 | 10.8 | GO:0000077 | DNA damage checkpoint(GO:0000077) |
0.3 | 5.5 | GO:0006284 | base-excision repair(GO:0006284) |
0.3 | 0.3 | GO:0051503 | purine nucleotide transport(GO:0015865) adenine nucleotide transport(GO:0051503) |
0.3 | 1.6 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.3 | 0.6 | GO:0002215 | defense response to nematode(GO:0002215) |
0.3 | 0.3 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
0.3 | 4.8 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
0.3 | 1.0 | GO:2000019 | negative regulation of male gonad development(GO:2000019) |
0.3 | 0.3 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.3 | 4.8 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.3 | 3.2 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
0.3 | 5.1 | GO:0002902 | regulation of B cell apoptotic process(GO:0002902) |
0.3 | 1.0 | GO:1990542 | mitochondrial transmembrane transport(GO:1990542) |
0.3 | 0.6 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.3 | 0.6 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.3 | 1.6 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
0.3 | 0.3 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.3 | 0.6 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.3 | 0.3 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.3 | 1.6 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
0.3 | 1.6 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.3 | 12.0 | GO:0051028 | mRNA transport(GO:0051028) |
0.3 | 3.8 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
0.3 | 0.3 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.3 | 0.6 | GO:0008228 | opsonization(GO:0008228) |
0.3 | 14.4 | GO:0006413 | translational initiation(GO:0006413) |
0.3 | 0.6 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.3 | 0.3 | GO:0045815 | positive regulation of gene expression, epigenetic(GO:0045815) |
0.3 | 2.2 | GO:0019885 | antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
0.3 | 0.3 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.3 | 1.9 | GO:0072501 | cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.3 | 0.3 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.3 | 0.6 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.3 | 0.9 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.3 | 1.2 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.3 | 0.9 | GO:0006056 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.3 | 0.6 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) double-strand break repair via single-strand annealing(GO:0045002) |
0.3 | 1.8 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.3 | 7.6 | GO:0051297 | centrosome organization(GO:0051297) |
0.3 | 0.6 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
0.3 | 18.0 | GO:0006626 | protein targeting to mitochondrion(GO:0006626) |
0.3 | 0.6 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.3 | 0.6 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.3 | 0.6 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
0.3 | 2.1 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
0.3 | 3.0 | GO:0006040 | amino sugar metabolic process(GO:0006040) |
0.3 | 2.7 | GO:0031648 | protein destabilization(GO:0031648) |
0.3 | 0.6 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.3 | 1.2 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
0.3 | 0.6 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.3 | 0.3 | GO:0060174 | limb bud formation(GO:0060174) |
0.3 | 1.8 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
0.3 | 0.3 | GO:0009078 | alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) L-alanine metabolic process(GO:0042851) |
0.3 | 4.8 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.3 | 2.1 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.3 | 2.1 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.3 | 0.9 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
0.3 | 1.5 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
0.3 | 5.1 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.3 | 0.3 | GO:0021826 | substrate-independent telencephalic tangential migration(GO:0021826) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
0.3 | 0.6 | GO:0046060 | dATP metabolic process(GO:0046060) |
0.3 | 0.9 | GO:0016446 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.3 | 7.2 | GO:0032091 | negative regulation of protein binding(GO:0032091) |
0.3 | 3.9 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.3 | 0.6 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.3 | 1.5 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.3 | 0.6 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.3 | 0.3 | GO:0072289 | metanephric nephron tubule formation(GO:0072289) |
0.3 | 0.9 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.3 | 0.3 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.3 | 0.3 | GO:1903236 | regulation of leukocyte tethering or rolling(GO:1903236) |
0.3 | 1.5 | GO:0042730 | fibrinolysis(GO:0042730) |
0.3 | 0.9 | GO:0046836 | glycolipid transport(GO:0046836) |
0.3 | 0.9 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.3 | 5.8 | GO:0006829 | zinc II ion transport(GO:0006829) |
0.3 | 0.3 | GO:0032329 | serine transport(GO:0032329) D-amino acid transport(GO:0042940) |
0.3 | 2.3 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.3 | 8.3 | GO:0006397 | mRNA processing(GO:0006397) |
0.3 | 0.6 | GO:0051036 | regulation of endosome size(GO:0051036) |
0.3 | 0.3 | GO:0033047 | regulation of mitotic sister chromatid segregation(GO:0033047) |
0.3 | 0.6 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.3 | 0.6 | GO:1903299 | regulation of hexokinase activity(GO:1903299) |
0.3 | 3.1 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
0.3 | 4.0 | GO:0033108 | mitochondrial respiratory chain complex assembly(GO:0033108) |
0.3 | 0.3 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.3 | 0.6 | GO:0043400 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) |
0.3 | 5.9 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.3 | 3.1 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.3 | 0.8 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.3 | 0.6 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.3 | 1.4 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.3 | 0.3 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
0.3 | 0.3 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.3 | 1.1 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.3 | 3.3 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.3 | 0.8 | GO:0021984 | adenohypophysis development(GO:0021984) |
0.3 | 5.8 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.3 | 0.8 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.3 | 0.5 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.3 | 0.8 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
0.3 | 0.3 | GO:0002489 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway(GO:0002488) antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway, TAP-dependent(GO:0002489) |
0.3 | 0.8 | GO:0007000 | nucleolus organization(GO:0007000) |
0.3 | 2.4 | GO:0050716 | positive regulation of interleukin-1 secretion(GO:0050716) positive regulation of interleukin-1 beta secretion(GO:0050718) |
0.3 | 0.8 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
0.3 | 2.1 | GO:0031929 | TOR signaling(GO:0031929) |
0.3 | 0.5 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.3 | 0.3 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.3 | 0.8 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.3 | 0.3 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
0.3 | 0.3 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.3 | 0.5 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
0.3 | 0.5 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.3 | 1.3 | GO:0016559 | peroxisome fission(GO:0016559) |
0.3 | 0.5 | GO:1903332 | regulation of protein folding(GO:1903332) |
0.3 | 7.4 | GO:0006401 | RNA catabolic process(GO:0006401) |
0.3 | 2.3 | GO:0010608 | posttranscriptional regulation of gene expression(GO:0010608) |
0.3 | 0.3 | GO:0090148 | membrane fission(GO:0090148) |
0.3 | 2.5 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
0.3 | 1.8 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
0.3 | 0.3 | GO:0019359 | NAD biosynthetic process(GO:0009435) nicotinamide nucleotide biosynthetic process(GO:0019359) |
0.3 | 0.3 | GO:0051645 | Golgi localization(GO:0051645) |
0.3 | 1.0 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.3 | 1.8 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.3 | 2.3 | GO:0003417 | growth plate cartilage development(GO:0003417) |
0.2 | 0.7 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.2 | 0.7 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.2 | 0.7 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.2 | 0.2 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.2 | 0.7 | GO:0000726 | non-recombinational repair(GO:0000726) |
0.2 | 0.7 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.2 | 1.2 | GO:0002052 | positive regulation of neuroblast proliferation(GO:0002052) |
0.2 | 0.2 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.2 | 0.2 | GO:0046134 | pyrimidine nucleoside biosynthetic process(GO:0046134) |
0.2 | 25.3 | GO:0006281 | DNA repair(GO:0006281) |
0.2 | 1.2 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.2 | 4.4 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.2 | 4.2 | GO:0000819 | sister chromatid segregation(GO:0000819) |
0.2 | 0.7 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.2 | 1.2 | GO:0010259 | multicellular organism aging(GO:0010259) |
0.2 | 0.2 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.2 | 1.2 | GO:0000959 | mitochondrial RNA metabolic process(GO:0000959) |
0.2 | 1.0 | GO:0007143 | female meiotic division(GO:0007143) |
0.2 | 4.6 | GO:0016925 | protein sumoylation(GO:0016925) |
0.2 | 0.5 | GO:0010513 | positive regulation of phosphatidylinositol biosynthetic process(GO:0010513) |
0.2 | 1.4 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.2 | 1.2 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
0.2 | 1.2 | GO:0048169 | regulation of long-term neuronal synaptic plasticity(GO:0048169) |
0.2 | 0.7 | GO:0042424 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
0.2 | 4.1 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
0.2 | 0.2 | GO:0015809 | arginine transport(GO:0015809) |
0.2 | 1.4 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.2 | 0.2 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
0.2 | 7.5 | GO:0008033 | tRNA processing(GO:0008033) |
0.2 | 0.7 | GO:0032966 | negative regulation of collagen metabolic process(GO:0010713) negative regulation of collagen biosynthetic process(GO:0032966) negative regulation of multicellular organismal metabolic process(GO:0044252) |
0.2 | 5.1 | GO:0006611 | protein export from nucleus(GO:0006611) |
0.2 | 1.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.2 | 1.6 | GO:0018342 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
0.2 | 1.6 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
0.2 | 0.2 | GO:0051573 | negative regulation of histone H3-K9 methylation(GO:0051573) |
0.2 | 0.2 | GO:1902235 | regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902235) |
0.2 | 0.5 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.2 | 0.2 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.2 | 4.1 | GO:0015807 | L-amino acid transport(GO:0015807) |
0.2 | 0.5 | GO:0032100 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.2 | 0.2 | GO:1904747 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
0.2 | 0.2 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
0.2 | 0.2 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
0.2 | 1.1 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
0.2 | 0.5 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.2 | 0.7 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.2 | 0.5 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
0.2 | 0.2 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
0.2 | 0.4 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.2 | 0.7 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.2 | 0.2 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
0.2 | 0.4 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
0.2 | 1.5 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
0.2 | 1.8 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.2 | 0.7 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.2 | 0.4 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.2 | 1.9 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.2 | 0.2 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.2 | 0.4 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.2 | 2.6 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.2 | 0.2 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.2 | 0.2 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.2 | 1.1 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.2 | 1.3 | GO:0070897 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) DNA-templated transcriptional preinitiation complex assembly(GO:0070897) |
0.2 | 0.2 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.2 | 0.4 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.2 | 0.6 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.2 | 0.2 | GO:0009394 | 2'-deoxyribonucleotide metabolic process(GO:0009394) deoxyribose phosphate metabolic process(GO:0019692) |
0.2 | 0.2 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.2 | 0.6 | GO:0030035 | microspike assembly(GO:0030035) |
0.2 | 0.6 | GO:0090305 | nucleic acid phosphodiester bond hydrolysis(GO:0090305) |
0.2 | 0.4 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.2 | 1.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.2 | 0.4 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.2 | 0.2 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.2 | 1.0 | GO:0071539 | protein localization to centrosome(GO:0071539) |
0.2 | 1.2 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.2 | 1.0 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
0.2 | 2.4 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.2 | 0.4 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) |
0.2 | 0.4 | GO:0009629 | response to gravity(GO:0009629) |
0.2 | 0.2 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.2 | 1.2 | GO:0016266 | O-glycan processing(GO:0016266) |
0.2 | 0.8 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.2 | 0.4 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.2 | 2.4 | GO:0033344 | cholesterol efflux(GO:0033344) |
0.2 | 3.8 | GO:0048240 | sperm capacitation(GO:0048240) |
0.2 | 0.2 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.2 | 0.2 | GO:0030421 | defecation(GO:0030421) |
0.2 | 0.6 | GO:0071569 | protein ufmylation(GO:0071569) |
0.2 | 1.4 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
0.2 | 0.6 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.2 | 2.5 | GO:0007051 | spindle organization(GO:0007051) |
0.2 | 0.8 | GO:1902108 | regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902108) |
0.2 | 5.9 | GO:0009060 | aerobic respiration(GO:0009060) |
0.2 | 3.1 | GO:1901264 | carbohydrate derivative transport(GO:1901264) |
0.2 | 2.3 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
0.2 | 0.6 | GO:0015705 | iodide transport(GO:0015705) |
0.2 | 0.2 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.2 | 1.2 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.2 | 1.2 | GO:0007007 | inner mitochondrial membrane organization(GO:0007007) |
0.2 | 2.7 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.2 | 0.4 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.2 | 1.7 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.2 | 0.4 | GO:0072698 | protein localization to microtubule cytoskeleton(GO:0072698) |
0.2 | 0.2 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.2 | 0.6 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.2 | 0.4 | GO:0051305 | chromosome movement towards spindle pole(GO:0051305) |
0.2 | 8.4 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.2 | 0.4 | GO:0071863 | regulation of cell proliferation in bone marrow(GO:0071863) |
0.2 | 0.2 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
0.2 | 0.4 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.2 | 0.4 | GO:0032607 | interferon-alpha production(GO:0032607) |
0.2 | 0.2 | GO:0010042 | response to manganese ion(GO:0010042) |
0.2 | 0.2 | GO:0006595 | polyamine metabolic process(GO:0006595) |
0.2 | 0.6 | GO:0048069 | eye pigmentation(GO:0048069) |
0.2 | 5.0 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.2 | 0.4 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.2 | 0.2 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.2 | 1.8 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.2 | 8.1 | GO:0001678 | cellular glucose homeostasis(GO:0001678) |
0.2 | 0.2 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.2 | 0.2 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.2 | 0.2 | GO:0032371 | regulation of sterol transport(GO:0032371) regulation of cholesterol transport(GO:0032374) |
0.2 | 0.4 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.2 | 0.9 | GO:0045830 | positive regulation of isotype switching(GO:0045830) |
0.2 | 0.7 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.2 | 0.7 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.2 | 0.3 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.2 | 0.2 | GO:0031049 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.2 | 1.0 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.2 | 1.2 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.2 | 0.5 | GO:0007296 | vitellogenesis(GO:0007296) |
0.2 | 0.9 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
0.2 | 0.2 | GO:0065001 | specification of axis polarity(GO:0065001) |
0.2 | 0.8 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.2 | 1.1 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.2 | 0.5 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
0.2 | 0.3 | GO:0070163 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) |
0.2 | 1.3 | GO:0001782 | B cell homeostasis(GO:0001782) |
0.2 | 0.7 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.2 | 4.7 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.2 | 1.1 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.2 | 0.3 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.2 | 0.3 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
0.2 | 1.8 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
0.2 | 0.3 | GO:1904754 | vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
0.2 | 0.6 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.2 | 1.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.2 | 0.2 | GO:0007028 | cytoplasm organization(GO:0007028) |
0.2 | 0.2 | GO:0097195 | pilomotor reflex(GO:0097195) |
0.2 | 0.8 | GO:0007097 | nuclear migration(GO:0007097) |
0.2 | 1.1 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
0.2 | 0.2 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
0.1 | 0.4 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
0.1 | 0.6 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.1 | 0.3 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.1 | 0.4 | GO:0042026 | protein refolding(GO:0042026) |
0.1 | 0.9 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.3 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.1 | 0.3 | GO:0045990 | carbon catabolite regulation of transcription(GO:0045990) |
0.1 | 0.6 | GO:0046130 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.1 | 0.9 | GO:0051646 | mitochondrion localization(GO:0051646) |
0.1 | 0.3 | GO:0016574 | histone ubiquitination(GO:0016574) |
0.1 | 0.1 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
0.1 | 1.2 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.1 | 0.7 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.1 | 0.7 | GO:0042982 | amyloid precursor protein metabolic process(GO:0042982) |
0.1 | 0.3 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.1 | 0.1 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.1 | 0.1 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
0.1 | 0.1 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.1 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.1 | 0.4 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.1 | 0.1 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.1 | 0.1 | GO:0018196 | peptidyl-asparagine modification(GO:0018196) |
0.1 | 0.1 | GO:1903146 | regulation of mitophagy(GO:1903146) |
0.1 | 0.4 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.1 | 0.3 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
0.1 | 0.4 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.1 | 0.4 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.1 | 0.4 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.1 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 0.1 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
0.1 | 0.1 | GO:0018904 | ether metabolic process(GO:0018904) |
0.1 | 0.1 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
0.1 | 1.0 | GO:0042517 | positive regulation of tyrosine phosphorylation of Stat3 protein(GO:0042517) |
0.1 | 0.1 | GO:0019530 | taurine metabolic process(GO:0019530) |
0.1 | 0.2 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.1 | 1.8 | GO:0019835 | cytolysis(GO:0019835) |
0.1 | 0.6 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.1 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.1 | 0.2 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.1 | 0.2 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.1 | 1.1 | GO:0006342 | chromatin silencing(GO:0006342) |
0.1 | 0.1 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.1 | 0.1 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
0.1 | 0.1 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.1 | 0.1 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.1 | 0.5 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.1 | 1.6 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.3 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.1 | 3.1 | GO:0046488 | phosphatidylinositol metabolic process(GO:0046488) |
0.1 | 0.1 | GO:0051140 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.1 | 0.4 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
0.1 | 0.1 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.1 | 0.1 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.1 | 0.1 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.1 | 0.3 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.1 | 1.4 | GO:0006396 | RNA processing(GO:0006396) |
0.1 | 0.9 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
0.1 | 0.3 | GO:0006998 | nuclear envelope organization(GO:0006998) |
0.1 | 0.3 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.1 | 0.2 | GO:0015755 | fructose transport(GO:0015755) |
0.1 | 3.3 | GO:0007059 | chromosome segregation(GO:0007059) |
0.1 | 0.3 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.1 | 0.3 | GO:0002827 | positive regulation of T-helper 1 type immune response(GO:0002827) |
0.1 | 0.2 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.1 | 0.1 | GO:2000252 | negative regulation of feeding behavior(GO:2000252) |
0.1 | 0.2 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.1 | 0.2 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.1 | 0.4 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.1 | 0.8 | GO:0003351 | epithelial cilium movement(GO:0003351) |
0.1 | 0.2 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.1 | 1.3 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
0.1 | 0.6 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.1 | 1.0 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.1 | 0.2 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
0.1 | 0.5 | GO:0060736 | prostate gland growth(GO:0060736) |
0.1 | 1.9 | GO:0009813 | flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
0.1 | 0.1 | GO:1902253 | regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902253) |
0.1 | 0.2 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.1 | 0.2 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
0.1 | 0.4 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
0.1 | 0.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.1 | 0.2 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.1 | 0.3 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.1 | 0.1 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
0.1 | 0.2 | GO:0036005 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
0.1 | 0.5 | GO:0002369 | T cell cytokine production(GO:0002369) |
0.1 | 0.1 | GO:0036260 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
0.1 | 0.2 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
0.1 | 0.2 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.1 | 0.1 | GO:0048162 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
0.1 | 0.5 | GO:0051168 | nuclear export(GO:0051168) |
0.1 | 0.2 | GO:0006399 | tRNA metabolic process(GO:0006399) |
0.1 | 0.2 | GO:0009414 | response to water deprivation(GO:0009414) |
0.1 | 1.9 | GO:0007030 | Golgi organization(GO:0007030) |
0.1 | 0.1 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.1 | 1.7 | GO:0035036 | sperm-egg recognition(GO:0035036) |
0.1 | 0.3 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.1 | 0.4 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
0.1 | 0.2 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.1 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.1 | 0.2 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.1 | 0.1 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.1 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.1 | 0.1 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.1 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.5 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.1 | 0.3 | GO:0006817 | phosphate ion transport(GO:0006817) |
0.1 | 0.4 | GO:0050957 | equilibrioception(GO:0050957) |
0.1 | 0.1 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.1 | 0.1 | GO:0070071 | proton-transporting two-sector ATPase complex assembly(GO:0070071) |
0.1 | 0.4 | GO:0045577 | regulation of B cell differentiation(GO:0045577) |
0.1 | 0.1 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.1 | 0.1 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.1 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.1 | 0.4 | GO:0072376 | protein activation cascade(GO:0072376) |
0.1 | 0.2 | GO:0002803 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
0.1 | 0.1 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.1 | 0.1 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.1 | 0.2 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.1 | 0.1 | GO:0002407 | dendritic cell chemotaxis(GO:0002407) |
0.1 | 0.2 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.1 | 2.1 | GO:0006818 | hydrogen transport(GO:0006818) |
0.1 | 0.1 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
0.1 | 0.1 | GO:0044359 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) |
0.1 | 0.1 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.1 | 0.2 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
0.1 | 0.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.1 | 0.6 | GO:0010508 | positive regulation of autophagy(GO:0010508) |
0.1 | 0.2 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.1 | 0.2 | GO:0001842 | neural fold formation(GO:0001842) |
0.1 | 0.2 | GO:0009303 | rRNA transcription(GO:0009303) |
0.1 | 0.1 | GO:0070141 | response to UV-A(GO:0070141) |
0.1 | 0.2 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.1 | 0.1 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.1 | 0.3 | GO:1905145 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
0.1 | 5.6 | GO:0019236 | response to pheromone(GO:0019236) |
0.1 | 0.1 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.1 | 1.4 | GO:0030838 | positive regulation of actin filament polymerization(GO:0030838) |
0.1 | 0.5 | GO:0002381 | immunoglobulin production involved in immunoglobulin mediated immune response(GO:0002381) |
0.1 | 0.4 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.1 | 0.1 | GO:0032700 | negative regulation of interleukin-17 production(GO:0032700) |
0.1 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.6 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.0 | 1.2 | GO:1903901 | negative regulation of viral life cycle(GO:1903901) |
0.0 | 0.0 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
0.0 | 0.0 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
0.0 | 0.1 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
0.0 | 0.4 | GO:0021766 | hippocampus development(GO:0021766) |
0.0 | 0.2 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.0 | 0.1 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.1 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.0 | 0.0 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.0 | 0.2 | GO:0009072 | aromatic amino acid family metabolic process(GO:0009072) |
0.0 | 0.6 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
0.0 | 0.2 | GO:0097502 | protein mannosylation(GO:0035268) mannosylation(GO:0097502) |
0.0 | 0.2 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.0 | GO:0051657 | maintenance of organelle location(GO:0051657) |
0.0 | 6.7 | GO:0006412 | translation(GO:0006412) |
0.0 | 0.3 | GO:0006706 | steroid catabolic process(GO:0006706) |
0.0 | 0.1 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.0 | 0.0 | GO:0038093 | Fc receptor signaling pathway(GO:0038093) |
0.0 | 0.7 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
0.0 | 0.1 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
0.0 | 0.0 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
0.0 | 0.0 | GO:0051589 | negative regulation of neurotransmitter transport(GO:0051589) |
0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.1 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.0 | 0.3 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.0 | 0.1 | GO:0060416 | response to growth hormone(GO:0060416) |
0.0 | 0.0 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.0 | GO:2000849 | glucocorticoid secretion(GO:0035933) regulation of glucocorticoid secretion(GO:2000849) |
0.0 | 0.0 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
0.0 | 0.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.0 | GO:0009597 | detection of virus(GO:0009597) |
0.0 | 0.9 | GO:0042501 | serine phosphorylation of STAT protein(GO:0042501) |
0.0 | 0.2 | GO:0031639 | plasminogen activation(GO:0031639) |
0.0 | 0.1 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.0 | 0.0 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.0 | 0.0 | GO:0032048 | cardiolipin metabolic process(GO:0032048) phosphatidylglycerol metabolic process(GO:0046471) |
0.0 | 0.0 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.0 | 0.9 | GO:0050913 | sensory perception of bitter taste(GO:0050913) |
0.0 | 0.0 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.0 | 0.0 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.0 | 0.1 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
0.0 | 0.2 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.0 | 0.0 | GO:0086103 | G-protein coupled receptor signaling pathway involved in heart process(GO:0086103) |
0.0 | 0.0 | GO:0051873 | disruption by host of symbiont cells(GO:0051852) killing by host of symbiont cells(GO:0051873) |
0.0 | 0.1 | GO:0042635 | positive regulation of hair cycle(GO:0042635) |
0.0 | 0.1 | GO:0042503 | tyrosine phosphorylation of Stat3 protein(GO:0042503) |
0.0 | 0.0 | GO:1903867 | chorion development(GO:0060717) extraembryonic membrane development(GO:1903867) |
0.0 | 0.0 | GO:0015840 | urea transport(GO:0015840) |
0.0 | 0.1 | GO:0042461 | photoreceptor cell development(GO:0042461) |
0.0 | 0.0 | GO:1904705 | regulation of vascular smooth muscle cell proliferation(GO:1904705) positive regulation of vascular smooth muscle cell proliferation(GO:1904707) vascular smooth muscle cell proliferation(GO:1990874) |
0.0 | 0.2 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.0 | 0.0 | GO:0097283 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
0.0 | 0.1 | GO:0042537 | benzene-containing compound metabolic process(GO:0042537) |
0.0 | 0.0 | GO:0071725 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.0 | 2.8 | GO:0050907 | detection of chemical stimulus involved in sensory perception(GO:0050907) |
0.0 | 0.2 | GO:0030195 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
7.5 | 22.4 | GO:0097451 | glial limiting end-foot(GO:0097451) |
3.8 | 22.8 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
2.5 | 12.4 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
2.4 | 12.1 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
2.0 | 5.9 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
2.0 | 5.9 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
1.9 | 1.9 | GO:0005828 | kinetochore microtubule(GO:0005828) |
1.9 | 1.9 | GO:1990761 | growth cone lamellipodium(GO:1990761) growth cone filopodium(GO:1990812) |
1.8 | 5.5 | GO:0097413 | Lewy body(GO:0097413) |
1.8 | 10.9 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
1.8 | 14.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
1.8 | 10.8 | GO:0031258 | lamellipodium membrane(GO:0031258) |
1.8 | 8.8 | GO:0044326 | dendritic spine neck(GO:0044326) |
1.7 | 5.0 | GO:0097427 | microtubule bundle(GO:0097427) |
1.6 | 1.6 | GO:0001739 | sex chromatin(GO:0001739) |
1.6 | 6.4 | GO:0097524 | sperm plasma membrane(GO:0097524) |
1.5 | 4.6 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
1.5 | 4.5 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
1.5 | 1.5 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
1.5 | 5.9 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
1.5 | 7.4 | GO:0032133 | chromosome passenger complex(GO:0032133) |
1.5 | 8.7 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
1.4 | 4.1 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
1.4 | 8.2 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
1.3 | 14.8 | GO:0042555 | MCM complex(GO:0042555) |
1.3 | 5.2 | GO:0036449 | microtubule minus-end(GO:0036449) |
1.3 | 9.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
1.3 | 7.8 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
1.3 | 3.9 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
1.3 | 6.4 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
1.3 | 3.8 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
1.3 | 10.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
1.3 | 6.3 | GO:0005638 | lamin filament(GO:0005638) |
1.3 | 8.8 | GO:0031931 | TORC1 complex(GO:0031931) |
1.2 | 1.2 | GO:0097422 | tubular endosome(GO:0097422) |
1.2 | 1.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
1.2 | 6.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
1.2 | 4.9 | GO:1990130 | Iml1 complex(GO:1990130) |
1.2 | 9.7 | GO:0001650 | fibrillar center(GO:0001650) |
1.2 | 1.2 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
1.2 | 16.9 | GO:0001891 | phagocytic cup(GO:0001891) |
1.2 | 3.6 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
1.2 | 1.2 | GO:0000974 | Prp19 complex(GO:0000974) |
1.2 | 1.2 | GO:0098576 | lumenal side of membrane(GO:0098576) |
1.2 | 8.3 | GO:0005688 | U6 snRNP(GO:0005688) |
1.2 | 1.2 | GO:0097450 | astrocyte end-foot(GO:0097450) |
1.2 | 4.7 | GO:0045298 | tubulin complex(GO:0045298) |
1.2 | 5.9 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
1.2 | 8.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
1.2 | 5.8 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
1.2 | 3.5 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
1.2 | 22.0 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
1.2 | 6.9 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
1.2 | 4.6 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
1.1 | 8.0 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
1.1 | 19.4 | GO:0060077 | inhibitory synapse(GO:0060077) |
1.1 | 5.7 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
1.1 | 1.1 | GO:0044391 | ribosomal subunit(GO:0044391) |
1.1 | 5.7 | GO:0033093 | Weibel-Palade body(GO:0033093) |
1.1 | 4.5 | GO:0061574 | ASAP complex(GO:0061574) |
1.1 | 4.5 | GO:0005642 | annulate lamellae(GO:0005642) |
1.1 | 7.7 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
1.1 | 2.2 | GO:0046691 | intracellular canaliculus(GO:0046691) |
1.1 | 8.6 | GO:0044666 | MLL3/4 complex(GO:0044666) |
1.1 | 7.5 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
1.1 | 4.2 | GO:0032021 | NELF complex(GO:0032021) |
1.1 | 8.5 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
1.1 | 4.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
1.1 | 1.1 | GO:0031523 | Myb complex(GO:0031523) |
1.0 | 8.4 | GO:0001939 | female pronucleus(GO:0001939) |
1.0 | 4.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
1.0 | 1.0 | GO:0071141 | SMAD protein complex(GO:0071141) |
1.0 | 3.1 | GO:0000811 | GINS complex(GO:0000811) |
1.0 | 42.3 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
1.0 | 3.1 | GO:1990423 | RZZ complex(GO:1990423) |
1.0 | 3.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
1.0 | 2.0 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
1.0 | 3.0 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
1.0 | 8.0 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
1.0 | 5.0 | GO:0005579 | membrane attack complex(GO:0005579) |
1.0 | 4.0 | GO:0044308 | axonal spine(GO:0044308) |
1.0 | 3.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
1.0 | 3.9 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.9 | 3.8 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.9 | 2.8 | GO:0042583 | chromaffin granule(GO:0042583) |
0.9 | 4.6 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.9 | 1.8 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.9 | 2.8 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.9 | 16.5 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.9 | 2.7 | GO:0031417 | NatC complex(GO:0031417) |
0.9 | 56.6 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.9 | 3.6 | GO:0098536 | deuterosome(GO:0098536) |
0.9 | 6.3 | GO:0042382 | paraspeckles(GO:0042382) |
0.9 | 4.5 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.9 | 19.7 | GO:0090544 | BAF-type complex(GO:0090544) |
0.9 | 7.1 | GO:0005883 | neurofilament(GO:0005883) |
0.9 | 3.5 | GO:1990745 | EARP complex(GO:1990745) |
0.9 | 2.6 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.9 | 2.6 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.9 | 6.0 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.9 | 23.9 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.9 | 2.6 | GO:0097433 | dense body(GO:0097433) |
0.8 | 3.4 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.8 | 3.3 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.8 | 12.5 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.8 | 5.8 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.8 | 0.8 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.8 | 7.4 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.8 | 2.5 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.8 | 1.6 | GO:0030870 | Mre11 complex(GO:0030870) |
0.8 | 7.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.8 | 3.2 | GO:0000796 | condensin complex(GO:0000796) |
0.8 | 9.6 | GO:0045120 | pronucleus(GO:0045120) |
0.8 | 11.2 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.8 | 14.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.8 | 4.8 | GO:0034709 | methylosome(GO:0034709) |
0.8 | 5.5 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.8 | 2.3 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.8 | 10.1 | GO:0005682 | U5 snRNP(GO:0005682) |
0.8 | 4.6 | GO:0031415 | NatA complex(GO:0031415) |
0.8 | 3.9 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.8 | 1.5 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.8 | 2.3 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.8 | 2.3 | GO:0070552 | BRISC complex(GO:0070552) |
0.8 | 3.8 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.8 | 9.1 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.8 | 3.0 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.8 | 2.3 | GO:0016580 | Sin3 complex(GO:0016580) |
0.8 | 0.8 | GO:0005687 | U4 snRNP(GO:0005687) |
0.8 | 2.3 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.8 | 3.0 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.8 | 12.8 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.8 | 2.3 | GO:0071817 | MMXD complex(GO:0071817) |
0.7 | 3.7 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.7 | 3.7 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.7 | 2.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.7 | 3.7 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.7 | 2.2 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.7 | 4.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.7 | 17.4 | GO:0097228 | sperm principal piece(GO:0097228) |
0.7 | 14.5 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
0.7 | 2.2 | GO:0000805 | X chromosome(GO:0000805) |
0.7 | 15.2 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.7 | 2.2 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.7 | 13.6 | GO:0030904 | retromer complex(GO:0030904) |
0.7 | 3.6 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.7 | 7.8 | GO:0035102 | PRC1 complex(GO:0035102) |
0.7 | 17.7 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.7 | 6.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.7 | 0.7 | GO:0016234 | inclusion body(GO:0016234) |
0.7 | 13.3 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.7 | 18.9 | GO:0015030 | Cajal body(GO:0015030) |
0.7 | 2.8 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.7 | 21.5 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.7 | 5.5 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.7 | 1.4 | GO:0055087 | Ski complex(GO:0055087) |
0.7 | 1.4 | GO:1990635 | proximal dendrite(GO:1990635) |
0.7 | 11.0 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.7 | 6.2 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.7 | 4.1 | GO:0000812 | Swr1 complex(GO:0000812) |
0.7 | 28.5 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.7 | 5.4 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.7 | 2.7 | GO:0071797 | LUBAC complex(GO:0071797) |
0.7 | 2.7 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.7 | 2.0 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.7 | 2.0 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.7 | 5.4 | GO:0000346 | transcription export complex(GO:0000346) |
0.7 | 2.7 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.7 | 16.0 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.7 | 1.3 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.7 | 0.7 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.7 | 2.0 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.7 | 1.3 | GO:0030689 | Noc complex(GO:0030689) |
0.6 | 4.5 | GO:0034719 | SMN complex(GO:0032797) SMN-Sm protein complex(GO:0034719) |
0.6 | 1.3 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.6 | 5.8 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.6 | 24.2 | GO:0045171 | intercellular bridge(GO:0045171) |
0.6 | 6.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.6 | 1.3 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.6 | 1.2 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.6 | 4.4 | GO:0043203 | axon hillock(GO:0043203) |
0.6 | 8.7 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.6 | 3.7 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.6 | 1.8 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.6 | 9.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.6 | 1.8 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.6 | 1.8 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.6 | 1.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.6 | 5.5 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.6 | 6.7 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.6 | 4.2 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.6 | 1.8 | GO:0005745 | m-AAA complex(GO:0005745) |
0.6 | 1.2 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.6 | 6.6 | GO:0070603 | SWI/SNF superfamily-type complex(GO:0070603) |
0.6 | 4.2 | GO:0032584 | growth cone membrane(GO:0032584) |
0.6 | 12.5 | GO:0034451 | centriolar satellite(GO:0034451) |
0.6 | 9.5 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.6 | 25.4 | GO:0000502 | proteasome complex(GO:0000502) |
0.6 | 20.1 | GO:0016592 | mediator complex(GO:0016592) |
0.6 | 1.7 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.6 | 0.6 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.6 | 8.0 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.6 | 4.0 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.6 | 2.9 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.6 | 6.3 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.6 | 1.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.6 | 1.1 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
0.6 | 3.4 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.6 | 1.7 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
0.6 | 11.3 | GO:0035861 | site of double-strand break(GO:0035861) |
0.6 | 2.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.6 | 6.7 | GO:0030914 | STAGA complex(GO:0030914) |
0.6 | 3.9 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.6 | 9.4 | GO:0005844 | polysome(GO:0005844) |
0.6 | 2.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.5 | 6.0 | GO:0032039 | integrator complex(GO:0032039) |
0.5 | 1.6 | GO:0035061 | interchromatin granule(GO:0035061) |
0.5 | 1.6 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.5 | 1.6 | GO:0030891 | VCB complex(GO:0030891) |
0.5 | 0.5 | GO:0000322 | storage vacuole(GO:0000322) |
0.5 | 1.1 | GO:1990923 | PET complex(GO:1990923) |
0.5 | 0.5 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.5 | 4.9 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.5 | 3.2 | GO:0071986 | Ragulator complex(GO:0071986) |
0.5 | 1.6 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.5 | 3.2 | GO:0070938 | contractile ring(GO:0070938) |
0.5 | 2.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.5 | 0.5 | GO:0043194 | axon initial segment(GO:0043194) |
0.5 | 7.3 | GO:0000145 | exocyst(GO:0000145) |
0.5 | 1.6 | GO:0033269 | internode region of axon(GO:0033269) |
0.5 | 7.2 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.5 | 3.6 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.5 | 0.5 | GO:0044393 | microspike(GO:0044393) |
0.5 | 2.1 | GO:0089701 | U2AF(GO:0089701) |
0.5 | 1.5 | GO:0072487 | MSL complex(GO:0072487) |
0.5 | 0.5 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.5 | 24.8 | GO:0005795 | Golgi stack(GO:0005795) |
0.5 | 1.5 | GO:0097526 | U4/U6 x U5 tri-snRNP complex(GO:0046540) spliceosomal tri-snRNP complex(GO:0097526) |
0.5 | 26.5 | GO:0000776 | kinetochore(GO:0000776) |
0.5 | 2.5 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.5 | 4.0 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.5 | 2.5 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.5 | 1.0 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.5 | 29.6 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
0.5 | 1.5 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.5 | 1.0 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.5 | 2.9 | GO:0001741 | XY body(GO:0001741) |
0.5 | 4.8 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.5 | 5.3 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.5 | 2.9 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.5 | 3.4 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.5 | 7.2 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.5 | 3.8 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.5 | 11.0 | GO:0000792 | heterochromatin(GO:0000792) |
0.5 | 0.5 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.5 | 40.3 | GO:0005681 | spliceosomal complex(GO:0005681) |
0.5 | 1.9 | GO:0005686 | U2 snRNP(GO:0005686) |
0.5 | 19.8 | GO:0034399 | nuclear periphery(GO:0034399) |
0.5 | 4.7 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.5 | 1.4 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.5 | 1.4 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.5 | 6.5 | GO:0031519 | PcG protein complex(GO:0031519) |
0.5 | 0.5 | GO:0032010 | phagolysosome(GO:0032010) |
0.5 | 3.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.5 | 1.4 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.5 | 2.8 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.5 | 4.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.5 | 0.9 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.5 | 3.6 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.4 | 2.2 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.4 | 1.3 | GO:0072534 | perineuronal net(GO:0072534) |
0.4 | 2.2 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.4 | 1.8 | GO:0034991 | meiotic cohesin complex(GO:0030893) nuclear meiotic cohesin complex(GO:0034991) |
0.4 | 1.3 | GO:0042825 | TAP complex(GO:0042825) |
0.4 | 5.4 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.4 | 0.4 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.4 | 2.2 | GO:0071437 | invadopodium(GO:0071437) |
0.4 | 0.9 | GO:0008278 | cohesin complex(GO:0008278) |
0.4 | 4.8 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.4 | 1.3 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.4 | 4.3 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.4 | 27.3 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.4 | 2.2 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.4 | 17.7 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.4 | 13.4 | GO:0005811 | lipid particle(GO:0005811) |
0.4 | 0.9 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.4 | 1.3 | GO:0030673 | axolemma(GO:0030673) |
0.4 | 1.7 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.4 | 1.3 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.4 | 3.8 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.4 | 3.3 | GO:0070652 | HAUS complex(GO:0070652) |
0.4 | 3.7 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.4 | 10.0 | GO:0032590 | dendrite membrane(GO:0032590) |
0.4 | 1.7 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.4 | 14.4 | GO:0005643 | nuclear pore(GO:0005643) |
0.4 | 8.6 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.4 | 2.0 | GO:0070820 | tertiary granule(GO:0070820) |
0.4 | 2.0 | GO:0005827 | polar microtubule(GO:0005827) |
0.4 | 2.4 | GO:0030008 | TRAPP complex(GO:0030008) |
0.4 | 0.4 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.4 | 3.2 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.4 | 2.4 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.4 | 0.4 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.4 | 6.8 | GO:0043198 | dendritic shaft(GO:0043198) |
0.4 | 32.7 | GO:0072562 | blood microparticle(GO:0072562) |
0.4 | 21.1 | GO:0044438 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
0.4 | 3.9 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.4 | 76.7 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.4 | 1.6 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.4 | 9.2 | GO:1990204 | oxidoreductase complex(GO:1990204) |
0.4 | 2.7 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.4 | 8.8 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.4 | 2.3 | GO:0035859 | Seh1-associated complex(GO:0035859) |
0.4 | 18.3 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.4 | 3.4 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.4 | 1.9 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.4 | 1.5 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.4 | 101.7 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.4 | 15.4 | GO:0000922 | spindle pole(GO:0000922) |
0.4 | 1.9 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.4 | 8.3 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.4 | 0.4 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.4 | 1.5 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.4 | 3.3 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.4 | 2.2 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.4 | 0.4 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.4 | 1.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.4 | 2.5 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.4 | 2.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.3 | 1.4 | GO:0005840 | ribosome(GO:0005840) |
0.3 | 1.4 | GO:0043083 | synaptic cleft(GO:0043083) |
0.3 | 1.0 | GO:0036452 | ESCRT complex(GO:0036452) |
0.3 | 0.3 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.3 | 0.7 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.3 | 0.3 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.3 | 1.3 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.3 | 2.0 | GO:0016600 | flotillin complex(GO:0016600) |
0.3 | 5.5 | GO:0005771 | multivesicular body(GO:0005771) |
0.3 | 0.3 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.3 | 1.3 | GO:0070852 | cell body fiber(GO:0070852) |
0.3 | 1.0 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.3 | 0.6 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.3 | 3.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.3 | 1.0 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.3 | 1.0 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.3 | 1.9 | GO:0031527 | filopodium membrane(GO:0031527) |
0.3 | 4.2 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.3 | 1.0 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.3 | 1.9 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.3 | 0.9 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.3 | 0.6 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.3 | 1.2 | GO:0019814 | immunoglobulin complex(GO:0019814) B cell receptor complex(GO:0019815) |
0.3 | 14.2 | GO:0000793 | condensed chromosome(GO:0000793) |
0.3 | 0.6 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.3 | 6.4 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
0.3 | 2.1 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.3 | 2.7 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
0.3 | 0.9 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.3 | 0.9 | GO:0042827 | platelet dense granule(GO:0042827) |
0.3 | 1.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.3 | 0.6 | GO:0097225 | sperm midpiece(GO:0097225) |
0.3 | 0.3 | GO:0016342 | catenin complex(GO:0016342) |
0.3 | 0.6 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.3 | 2.6 | GO:0032806 | carboxy-terminal domain protein kinase complex(GO:0032806) |
0.3 | 1.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.3 | 0.3 | GO:0016939 | kinesin II complex(GO:0016939) |
0.3 | 0.9 | GO:0097449 | astrocyte projection(GO:0097449) |
0.3 | 2.5 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.3 | 0.6 | GO:0030897 | HOPS complex(GO:0030897) |
0.3 | 2.2 | GO:0044453 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
0.3 | 1.4 | GO:0042581 | specific granule(GO:0042581) |
0.3 | 0.3 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.3 | 0.8 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.3 | 7.2 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.3 | 4.1 | GO:0030684 | preribosome(GO:0030684) |
0.3 | 0.5 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.3 | 1.0 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.3 | 5.8 | GO:0031201 | SNARE complex(GO:0031201) |
0.3 | 0.5 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.3 | 8.8 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.3 | 0.5 | GO:0071942 | XPC complex(GO:0071942) |
0.2 | 1.0 | GO:0098687 | chromosomal region(GO:0098687) |
0.2 | 2.0 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.2 | 85.3 | GO:0005730 | nucleolus(GO:0005730) |
0.2 | 0.5 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.2 | 9.2 | GO:0005814 | centriole(GO:0005814) |
0.2 | 0.5 | GO:0000242 | pericentriolar material(GO:0000242) |
0.2 | 0.9 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.2 | 0.7 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.2 | 0.9 | GO:0005694 | chromosome(GO:0005694) |
0.2 | 0.7 | GO:0005869 | dynactin complex(GO:0005869) |
0.2 | 5.0 | GO:0005776 | autophagosome(GO:0005776) |
0.2 | 0.7 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.2 | 1.5 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.2 | 3.1 | GO:0044295 | axonal growth cone(GO:0044295) |
0.2 | 2.4 | GO:0031901 | early endosome membrane(GO:0031901) |
0.2 | 4.2 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.2 | 1.5 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.2 | 1.7 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.2 | 10.0 | GO:0005819 | spindle(GO:0005819) |
0.2 | 0.6 | GO:0005775 | vacuolar lumen(GO:0005775) |
0.2 | 13.5 | GO:0030426 | growth cone(GO:0030426) |
0.2 | 3.4 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.2 | 1.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.2 | 2.8 | GO:0016235 | aggresome(GO:0016235) |
0.2 | 5.3 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.2 | 6.1 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.2 | 0.8 | GO:0032994 | protein-lipid complex(GO:0032994) |
0.2 | 0.8 | GO:0071439 | clathrin complex(GO:0071439) |
0.2 | 6.7 | GO:0030496 | midbody(GO:0030496) |
0.2 | 0.2 | GO:0022626 | cytosolic ribosome(GO:0022626) |
0.2 | 0.8 | GO:0043196 | varicosity(GO:0043196) |
0.2 | 0.8 | GO:0035339 | SPOTS complex(GO:0035339) |
0.2 | 169.8 | GO:0005654 | nucleoplasm(GO:0005654) |
0.2 | 2.0 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.2 | 0.4 | GO:1990391 | DNA repair complex(GO:1990391) |
0.2 | 0.6 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.2 | 0.9 | GO:0031512 | motile primary cilium(GO:0031512) |
0.2 | 2.7 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.2 | 0.7 | GO:0005667 | transcription factor complex(GO:0005667) |
0.2 | 11.8 | GO:0000139 | Golgi membrane(GO:0000139) |
0.2 | 2.3 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.2 | 3.6 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.2 | 0.2 | GO:0042585 | germinal vesicle(GO:0042585) |
0.2 | 0.3 | GO:0032589 | neuron projection membrane(GO:0032589) |
0.2 | 1.5 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.2 | 0.3 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.2 | 1.5 | GO:0000786 | nucleosome(GO:0000786) |
0.2 | 1.2 | GO:0031209 | SCAR complex(GO:0031209) |
0.2 | 0.2 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.2 | 121.2 | GO:0005739 | mitochondrion(GO:0005739) |
0.2 | 2.0 | GO:0032587 | ruffle membrane(GO:0032587) |
0.2 | 1.1 | GO:0002102 | podosome(GO:0002102) |
0.2 | 1.5 | GO:0019866 | organelle inner membrane(GO:0019866) |
0.1 | 0.3 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.1 | 1.8 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.1 | 2.9 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.1 | 2.8 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.1 | 0.4 | GO:0044194 | cytolytic granule(GO:0044194) |
0.1 | 0.6 | GO:0030894 | replisome(GO:0030894) |
0.1 | 5.1 | GO:0031526 | brush border membrane(GO:0031526) |
0.1 | 0.5 | GO:0036128 | CatSper complex(GO:0036128) |
0.1 | 0.5 | GO:0002177 | manchette(GO:0002177) |
0.1 | 0.4 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.6 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 0.7 | GO:0036157 | outer dynein arm(GO:0036157) |
0.1 | 15.6 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
0.1 | 1.6 | GO:0033176 | proton-transporting V-type ATPase complex(GO:0033176) |
0.1 | 0.7 | GO:0097440 | apical dendrite(GO:0097440) |
0.1 | 0.2 | GO:0032437 | cuticular plate(GO:0032437) |
0.1 | 0.7 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 58.9 | GO:0005794 | Golgi apparatus(GO:0005794) |
0.1 | 0.1 | GO:0035838 | growing cell tip(GO:0035838) |
0.1 | 1.5 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.1 | 1.7 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.1 | 0.6 | GO:0033268 | node of Ranvier(GO:0033268) |
0.1 | 0.1 | GO:0030880 | RNA polymerase complex(GO:0030880) |
0.1 | 0.1 | GO:0070069 | cytochrome complex(GO:0070069) |
0.1 | 3.8 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 0.6 | GO:0010008 | endosome membrane(GO:0010008) |
0.1 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.2 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.1 | 1.5 | GO:0055037 | recycling endosome(GO:0055037) |
0.1 | 1.6 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.1 | 2.4 | GO:0043204 | perikaryon(GO:0043204) |
0.1 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.1 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.1 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 9.9 | GO:0000323 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.1 | 0.5 | GO:0030135 | coated vesicle(GO:0030135) |
0.1 | 1.2 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.0 | 0.3 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.2 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.0 | 2.9 | GO:0031975 | organelle envelope(GO:0031967) envelope(GO:0031975) |
0.0 | 14.5 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
0.0 | 84.5 | GO:0005634 | nucleus(GO:0005634) |
0.0 | 0.1 | GO:0061702 | inflammasome complex(GO:0061702) |
0.0 | 0.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.0 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.0 | GO:0030312 | external encapsulating structure(GO:0030312) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
3.4 | 10.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
3.4 | 13.4 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
3.0 | 9.1 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
2.7 | 13.7 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
2.7 | 5.4 | GO:0070644 | vitamin D response element binding(GO:0070644) |
2.5 | 7.6 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
2.5 | 10.0 | GO:0031720 | haptoglobin binding(GO:0031720) |
2.4 | 7.3 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
2.3 | 6.9 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
2.2 | 19.4 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
2.1 | 6.4 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
2.1 | 6.3 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
2.0 | 8.0 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
2.0 | 5.9 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
2.0 | 9.8 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
1.9 | 7.6 | GO:0015265 | urea channel activity(GO:0015265) |
1.9 | 5.6 | GO:0019862 | IgA binding(GO:0019862) |
1.8 | 5.5 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
1.8 | 1.8 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
1.7 | 8.7 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
1.7 | 3.5 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
1.7 | 5.2 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
1.7 | 6.7 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
1.6 | 1.6 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
1.6 | 14.6 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
1.6 | 9.7 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
1.6 | 4.8 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
1.6 | 6.4 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
1.6 | 4.7 | GO:0009041 | uridylate kinase activity(GO:0009041) |
1.6 | 9.4 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
1.5 | 6.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
1.5 | 10.7 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
1.5 | 6.0 | GO:0030911 | TPR domain binding(GO:0030911) |
1.5 | 10.4 | GO:0008097 | 5S rRNA binding(GO:0008097) |
1.5 | 7.4 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
1.5 | 4.4 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
1.5 | 4.4 | GO:0030519 | snoRNP binding(GO:0030519) |
1.4 | 5.8 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
1.4 | 4.3 | GO:0030350 | iron-responsive element binding(GO:0030350) |
1.4 | 5.7 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
1.4 | 7.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
1.4 | 5.6 | GO:1990715 | mRNA CDS binding(GO:1990715) |
1.4 | 5.5 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
1.3 | 3.9 | GO:0042731 | PH domain binding(GO:0042731) |
1.3 | 3.9 | GO:0030620 | U2 snRNA binding(GO:0030620) |
1.3 | 5.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
1.3 | 39.3 | GO:0030507 | spectrin binding(GO:0030507) |
1.3 | 3.8 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
1.3 | 3.8 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
1.3 | 1.3 | GO:0034618 | arginine binding(GO:0034618) |
1.2 | 2.5 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
1.2 | 6.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
1.2 | 3.7 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
1.2 | 3.7 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
1.2 | 3.7 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
1.2 | 6.0 | GO:0005499 | vitamin D binding(GO:0005499) |
1.2 | 10.8 | GO:0035198 | miRNA binding(GO:0035198) |
1.2 | 9.6 | GO:0033785 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
1.2 | 6.0 | GO:0000405 | bubble DNA binding(GO:0000405) |
1.2 | 1.2 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
1.2 | 7.1 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
1.2 | 5.9 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
1.2 | 3.5 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
1.2 | 8.2 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
1.2 | 4.6 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
1.2 | 3.5 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
1.1 | 3.4 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
1.1 | 4.6 | GO:0015232 | heme transporter activity(GO:0015232) |
1.1 | 3.4 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
1.1 | 5.7 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
1.1 | 1.1 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
1.1 | 1.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
1.1 | 6.8 | GO:0001164 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
1.1 | 1.1 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
1.1 | 3.3 | GO:0051731 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
1.1 | 16.5 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
1.1 | 4.4 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
1.1 | 3.3 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
1.1 | 1.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
1.1 | 3.3 | GO:0030621 | U4 snRNA binding(GO:0030621) |
1.1 | 5.4 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
1.1 | 6.5 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
1.1 | 9.7 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
1.1 | 6.4 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
1.1 | 1.1 | GO:0016429 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
1.1 | 5.3 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
1.0 | 2.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
1.0 | 1.0 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
1.0 | 1.0 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
1.0 | 4.1 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
1.0 | 3.1 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
1.0 | 3.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
1.0 | 6.1 | GO:0004064 | arylesterase activity(GO:0004064) |
1.0 | 7.1 | GO:0019957 | C-C chemokine binding(GO:0019957) |
1.0 | 14.2 | GO:0030275 | LRR domain binding(GO:0030275) |
1.0 | 9.1 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
1.0 | 12.1 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
1.0 | 2.0 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
1.0 | 8.0 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
1.0 | 3.0 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
1.0 | 3.0 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
1.0 | 2.0 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
1.0 | 2.9 | GO:0080084 | RNA polymerase III regulatory region DNA binding(GO:0001016) RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
1.0 | 1.0 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
1.0 | 2.9 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
1.0 | 17.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
1.0 | 1.0 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
1.0 | 4.8 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
1.0 | 1.9 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
1.0 | 2.9 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.9 | 7.5 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.9 | 1.9 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.9 | 3.7 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.9 | 4.7 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.9 | 2.8 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.9 | 4.6 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.9 | 1.8 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.9 | 0.9 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.9 | 0.9 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.9 | 2.8 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.9 | 2.8 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.9 | 4.6 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.9 | 7.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.9 | 4.6 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.9 | 2.7 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.9 | 9.8 | GO:0043176 | amine binding(GO:0043176) |
0.9 | 0.9 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.9 | 5.4 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.9 | 8.9 | GO:0048156 | tau protein binding(GO:0048156) |
0.9 | 13.3 | GO:0016594 | glycine binding(GO:0016594) |
0.9 | 7.9 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.9 | 2.6 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.9 | 1.8 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.9 | 27.2 | GO:0031491 | nucleosome binding(GO:0031491) |
0.9 | 3.5 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.9 | 2.6 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.9 | 2.6 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.9 | 1.7 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.9 | 3.4 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.9 | 2.6 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.9 | 12.0 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.9 | 3.4 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.8 | 7.6 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.8 | 2.5 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.8 | 4.2 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.8 | 2.5 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.8 | 0.8 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.8 | 3.4 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.8 | 6.7 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.8 | 2.5 | GO:0034857 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.8 | 6.6 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.8 | 3.3 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.8 | 4.1 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.8 | 4.1 | GO:0070728 | leucine binding(GO:0070728) |
0.8 | 5.7 | GO:0046790 | virion binding(GO:0046790) |
0.8 | 18.5 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.8 | 2.4 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.8 | 5.6 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.8 | 1.6 | GO:0034046 | poly(G) binding(GO:0034046) |
0.8 | 8.0 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.8 | 2.4 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.8 | 24.6 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.8 | 1.6 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.8 | 11.0 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.8 | 17.3 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.8 | 1.6 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.8 | 0.8 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
0.8 | 0.8 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
0.8 | 6.2 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.8 | 3.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.8 | 5.4 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.8 | 3.0 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
0.8 | 6.1 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.8 | 3.0 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.8 | 2.3 | GO:0003905 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.8 | 1.5 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
0.8 | 3.0 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.7 | 2.2 | GO:0005119 | smoothened binding(GO:0005119) |
0.7 | 36.7 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.7 | 3.0 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.7 | 6.0 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.7 | 2.2 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.7 | 0.7 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.7 | 1.5 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.7 | 0.7 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.7 | 2.9 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.7 | 2.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.7 | 6.5 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
0.7 | 2.2 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.7 | 4.3 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.7 | 2.2 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.7 | 4.3 | GO:0050733 | RS domain binding(GO:0050733) |
0.7 | 6.4 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.7 | 20.6 | GO:0019843 | rRNA binding(GO:0019843) |
0.7 | 9.9 | GO:0005521 | lamin binding(GO:0005521) |
0.7 | 2.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.7 | 0.7 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.7 | 11.8 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.7 | 0.7 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.7 | 2.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.7 | 8.3 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.7 | 5.5 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.7 | 2.8 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.7 | 5.5 | GO:0010857 | calcium-dependent protein kinase activity(GO:0010857) |
0.7 | 1.4 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.7 | 5.5 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.7 | 8.9 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.7 | 8.9 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.7 | 4.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.7 | 2.0 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.7 | 10.8 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.7 | 6.1 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.7 | 3.3 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.7 | 5.3 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.7 | 3.3 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.7 | 2.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.6 | 11.0 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.6 | 7.7 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.6 | 3.2 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.6 | 4.5 | GO:0003896 | DNA primase activity(GO:0003896) |
0.6 | 11.4 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.6 | 2.5 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.6 | 6.9 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.6 | 3.1 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.6 | 2.5 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.6 | 1.2 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.6 | 8.7 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.6 | 3.7 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.6 | 1.9 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.6 | 3.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.6 | 1.2 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.6 | 11.7 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.6 | 5.5 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.6 | 3.1 | GO:0008251 | tRNA-specific adenosine deaminase activity(GO:0008251) |
0.6 | 1.8 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.6 | 4.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.6 | 4.8 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.6 | 18.7 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.6 | 1.8 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.6 | 1.2 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.6 | 3.6 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
0.6 | 3.0 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.6 | 1.8 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.6 | 6.5 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.6 | 4.1 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.6 | 2.3 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.6 | 5.3 | GO:0031386 | protein tag(GO:0031386) |
0.6 | 3.5 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.6 | 3.5 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.6 | 6.4 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.6 | 95.9 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.6 | 9.3 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.6 | 6.4 | GO:0035173 | histone kinase activity(GO:0035173) |
0.6 | 3.5 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.6 | 7.5 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.6 | 1.7 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.6 | 4.6 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.6 | 2.9 | GO:0008199 | ferric iron binding(GO:0008199) |
0.6 | 6.8 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.6 | 2.8 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.6 | 2.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.6 | 0.6 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.6 | 0.6 | GO:0061650 | ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.6 | 53.7 | GO:0042393 | histone binding(GO:0042393) |
0.6 | 0.6 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.6 | 5.6 | GO:0004568 | chitinase activity(GO:0004568) |
0.6 | 1.7 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.6 | 12.2 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.6 | 4.5 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.6 | 1.7 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.6 | 3.3 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.6 | 3.3 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.5 | 1.6 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.5 | 2.7 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.5 | 2.2 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.5 | 1.6 | GO:0070061 | fructose binding(GO:0070061) |
0.5 | 2.7 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.5 | 5.4 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.5 | 12.9 | GO:0043022 | ribosome binding(GO:0043022) |
0.5 | 2.7 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.5 | 1.6 | GO:0019961 | interferon binding(GO:0019961) |
0.5 | 2.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.5 | 1.6 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.5 | 2.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.5 | 2.7 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.5 | 4.8 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.5 | 4.8 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.5 | 2.1 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.5 | 0.5 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.5 | 1.6 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.5 | 2.6 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.5 | 1.6 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.5 | 3.1 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.5 | 14.6 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
0.5 | 3.1 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.5 | 7.3 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
0.5 | 2.1 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.5 | 2.6 | GO:0043559 | insulin binding(GO:0043559) |
0.5 | 5.7 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.5 | 1.5 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.5 | 1.0 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.5 | 17.9 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.5 | 2.0 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.5 | 1.0 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.5 | 1.5 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.5 | 3.6 | GO:0033691 | sialic acid binding(GO:0033691) |
0.5 | 2.0 | GO:0034452 | dynactin binding(GO:0034452) |
0.5 | 1.0 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.5 | 11.0 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.5 | 1.5 | GO:0051425 | PTB domain binding(GO:0051425) |
0.5 | 5.4 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.5 | 1.0 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.5 | 3.4 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.5 | 2.9 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.5 | 20.9 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.5 | 10.2 | GO:0045502 | dynein binding(GO:0045502) |
0.5 | 2.4 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.5 | 42.5 | GO:0003729 | mRNA binding(GO:0003729) |
0.5 | 2.4 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.5 | 3.9 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.5 | 1.9 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.5 | 4.8 | GO:0034946 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.5 | 1.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.5 | 0.9 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.5 | 2.4 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.5 | 3.8 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.5 | 1.4 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.5 | 0.9 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.5 | 1.4 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.5 | 24.1 | GO:0004004 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.5 | 1.4 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.5 | 1.4 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.5 | 0.9 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.5 | 1.4 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.5 | 1.4 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.4 | 1.3 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.4 | 3.6 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.4 | 0.4 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.4 | 1.8 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.4 | 12.8 | GO:0000049 | tRNA binding(GO:0000049) |
0.4 | 27.6 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.4 | 1.3 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.4 | 1.3 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.4 | 13.4 | GO:0019213 | deacetylase activity(GO:0019213) |
0.4 | 0.9 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.4 | 1.7 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.4 | 4.3 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.4 | 9.5 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.4 | 13.3 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.4 | 14.2 | GO:0004527 | exonuclease activity(GO:0004527) |
0.4 | 1.3 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.4 | 1.7 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.4 | 0.4 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.4 | 3.8 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.4 | 2.1 | GO:0050542 | icosanoid binding(GO:0050542) arachidonic acid binding(GO:0050544) fatty acid derivative binding(GO:1901567) |
0.4 | 2.1 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.4 | 2.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.4 | 0.8 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.4 | 3.4 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.4 | 2.5 | GO:0016803 | ether hydrolase activity(GO:0016803) |
0.4 | 0.8 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.4 | 1.3 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.4 | 0.4 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.4 | 3.3 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
0.4 | 9.1 | GO:0016876 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.4 | 0.4 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.4 | 2.9 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
0.4 | 1.2 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.4 | 1.6 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.4 | 10.2 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.4 | 0.8 | GO:0070717 | poly-purine tract binding(GO:0070717) |
0.4 | 11.8 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.4 | 4.1 | GO:0015266 | protein channel activity(GO:0015266) |
0.4 | 1.2 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.4 | 4.9 | GO:0036222 | dITP diphosphatase activity(GO:0035870) XTP diphosphatase activity(GO:0036222) |
0.4 | 1.6 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.4 | 16.4 | GO:0051540 | iron-sulfur cluster binding(GO:0051536) metal cluster binding(GO:0051540) |
0.4 | 1.6 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.4 | 2.0 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.4 | 0.8 | GO:0089720 | caspase binding(GO:0089720) |
0.4 | 3.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.4 | 1.2 | GO:0030274 | LIM domain binding(GO:0030274) |
0.4 | 1.2 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.4 | 1.2 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.4 | 0.8 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.4 | 1.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.4 | 1.5 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.4 | 0.8 | GO:0019002 | GMP binding(GO:0019002) |
0.4 | 1.2 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.4 | 3.8 | GO:0005522 | profilin binding(GO:0005522) |
0.4 | 5.8 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.4 | 1.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.4 | 0.8 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.4 | 1.5 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.4 | 0.4 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.4 | 3.8 | GO:0031005 | filamin binding(GO:0031005) |
0.4 | 4.1 | GO:0001618 | virus receptor activity(GO:0001618) |
0.4 | 0.8 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.4 | 3.4 | GO:0016303 | 1-phosphatidylinositol-3-kinase activity(GO:0016303) |
0.4 | 1.5 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.4 | 10.0 | GO:0004386 | helicase activity(GO:0004386) |
0.4 | 10.4 | GO:0070888 | E-box binding(GO:0070888) |
0.4 | 0.7 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.4 | 3.0 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.4 | 7.8 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.4 | 4.1 | GO:0032183 | SUMO binding(GO:0032183) |
0.4 | 0.7 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.4 | 1.5 | GO:0015925 | galactosidase activity(GO:0015925) |
0.4 | 4.4 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.4 | 4.0 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.4 | 5.1 | GO:0052635 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) DNA-N1-methyladenine dioxygenase activity(GO:0043734) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.4 | 2.9 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.4 | 0.7 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.4 | 0.7 | GO:0000182 | rDNA binding(GO:0000182) |
0.4 | 1.8 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.4 | 7.2 | GO:0030331 | estrogen receptor binding(GO:0030331) |
0.4 | 1.4 | GO:0035473 | lipase binding(GO:0035473) |
0.4 | 3.9 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.4 | 1.4 | GO:0016972 | thiol oxidase activity(GO:0016972) |
0.4 | 10.7 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.4 | 0.7 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) apolipoprotein A-I receptor binding(GO:0034191) |
0.4 | 3.2 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.4 | 188.9 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
0.4 | 21.1 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.4 | 0.7 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.3 | 1.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.3 | 1.0 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.3 | 0.3 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.3 | 7.8 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.3 | 5.4 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
0.3 | 1.4 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.3 | 1.0 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.3 | 2.0 | GO:0030515 | snoRNA binding(GO:0030515) |
0.3 | 8.4 | GO:0015926 | glucosidase activity(GO:0015926) |
0.3 | 0.7 | GO:0010851 | cyclase regulator activity(GO:0010851) |
0.3 | 3.0 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.3 | 2.4 | GO:0050700 | CARD domain binding(GO:0050700) |
0.3 | 2.7 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.3 | 0.7 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.3 | 1.3 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.3 | 1.3 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.3 | 2.6 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.3 | 1.0 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.3 | 1.3 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.3 | 1.6 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.3 | 1.0 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.3 | 2.0 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.3 | 0.7 | GO:0003680 | AT DNA binding(GO:0003680) |
0.3 | 2.9 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.3 | 9.1 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
0.3 | 0.6 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.3 | 2.3 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.3 | 1.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.3 | 0.6 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) |
0.3 | 2.6 | GO:0019841 | retinol binding(GO:0019841) |
0.3 | 7.1 | GO:0005504 | fatty acid binding(GO:0005504) |
0.3 | 0.6 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.3 | 1.3 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.3 | 6.7 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.3 | 1.0 | GO:0097016 | L27 domain binding(GO:0097016) |
0.3 | 15.3 | GO:0008565 | protein transporter activity(GO:0008565) |
0.3 | 1.0 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.3 | 2.8 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.3 | 1.3 | GO:1901677 | phosphate transmembrane transporter activity(GO:1901677) |
0.3 | 0.6 | GO:0008494 | translation activator activity(GO:0008494) |
0.3 | 1.9 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.3 | 1.9 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.3 | 1.6 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.3 | 4.7 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
0.3 | 1.2 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.3 | 1.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.3 | 1.2 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.3 | 1.5 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.3 | 3.4 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.3 | 0.6 | GO:0015928 | fucosidase activity(GO:0015928) |
0.3 | 0.9 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.3 | 0.9 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.3 | 0.9 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.3 | 0.3 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.3 | 1.8 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
0.3 | 0.6 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.3 | 0.3 | GO:0016414 | O-octanoyltransferase activity(GO:0016414) |
0.3 | 2.4 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.3 | 12.7 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.3 | 4.1 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.3 | 2.4 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.3 | 1.2 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.3 | 0.6 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.3 | 0.3 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
0.3 | 0.9 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.3 | 0.3 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.3 | 7.5 | GO:0015485 | cholesterol binding(GO:0015485) |
0.3 | 5.5 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.3 | 0.6 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.3 | 0.9 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
0.3 | 12.0 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.3 | 0.9 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.3 | 0.6 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.3 | 0.3 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.3 | 1.4 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.3 | 2.5 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.3 | 2.5 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.3 | 1.9 | GO:0052890 | oxidoreductase activity, acting on the CH-CH group of donors, with a flavin as acceptor(GO:0052890) |
0.3 | 0.6 | GO:0031404 | chloride ion binding(GO:0031404) |
0.3 | 1.1 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.3 | 1.4 | GO:0070628 | proteasome binding(GO:0070628) |
0.3 | 1.6 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.3 | 0.8 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.3 | 1.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.3 | 0.8 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.3 | 1.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.3 | 0.8 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.3 | 0.5 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.3 | 0.8 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.3 | 6.1 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.3 | 1.6 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.3 | 0.5 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.3 | 2.1 | GO:0070402 | NADPH binding(GO:0070402) |
0.3 | 2.4 | GO:0010181 | FMN binding(GO:0010181) |
0.3 | 1.1 | GO:0052794 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.3 | 1.0 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.3 | 0.3 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
0.3 | 0.8 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.3 | 0.8 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.3 | 1.8 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.3 | 1.3 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.3 | 0.3 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.3 | 1.3 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.3 | 5.6 | GO:0019894 | kinesin binding(GO:0019894) |
0.3 | 1.0 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.3 | 1.0 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.3 | 33.0 | GO:0003924 | GTPase activity(GO:0003924) |
0.2 | 2.2 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.2 | 9.5 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.2 | 0.5 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.2 | 1.0 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.2 | 0.5 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.2 | 1.2 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.2 | 25.6 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.2 | 0.7 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.2 | 0.7 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.2 | 5.9 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.2 | 3.5 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.2 | 0.2 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.2 | 1.4 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.2 | 4.4 | GO:0008748 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
0.2 | 0.9 | GO:0055102 | lipase inhibitor activity(GO:0055102) |
0.2 | 7.8 | GO:0016627 | oxidoreductase activity, acting on the CH-CH group of donors(GO:0016627) |
0.2 | 0.9 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.2 | 3.4 | GO:0008483 | transaminase activity(GO:0008483) |
0.2 | 3.6 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.2 | 0.9 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.2 | 2.5 | GO:0016651 | oxidoreductase activity, acting on NAD(P)H(GO:0016651) |
0.2 | 1.3 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.2 | 4.4 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.2 | 0.7 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.2 | 7.0 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.2 | 0.9 | GO:0102344 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.2 | 0.4 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.2 | 1.7 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.2 | 0.6 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.2 | 0.2 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.2 | 0.4 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.2 | 3.6 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.2 | 0.6 | GO:0035197 | siRNA binding(GO:0035197) |
0.2 | 0.6 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.2 | 0.2 | GO:0030984 | kininogen binding(GO:0030984) |
0.2 | 1.5 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.2 | 3.5 | GO:0005537 | mannose binding(GO:0005537) |
0.2 | 0.8 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.2 | 0.6 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.2 | 0.4 | GO:0032190 | acrosin binding(GO:0032190) |
0.2 | 0.4 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.2 | 0.8 | GO:0031419 | cobalamin binding(GO:0031419) |
0.2 | 0.6 | GO:0030332 | cyclin binding(GO:0030332) |
0.2 | 1.8 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.2 | 0.8 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.2 | 1.4 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.2 | 0.2 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.2 | 0.6 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.2 | 4.1 | GO:0050699 | WW domain binding(GO:0050699) |
0.2 | 0.6 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.2 | 2.7 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.2 | 0.8 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.2 | 0.2 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.2 | 0.4 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.2 | 3.4 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.2 | 0.6 | GO:0042834 | peptidoglycan binding(GO:0042834) |
0.2 | 0.4 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.2 | 0.6 | GO:0055100 | adiponectin binding(GO:0055100) |
0.2 | 1.3 | GO:0032451 | demethylase activity(GO:0032451) |
0.2 | 32.7 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.2 | 0.4 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.2 | 7.4 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
0.2 | 0.2 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
0.2 | 0.7 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.2 | 45.3 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
0.2 | 0.9 | GO:0048019 | receptor antagonist activity(GO:0048019) |
0.2 | 0.7 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.2 | 0.5 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.2 | 0.4 | GO:0004096 | catalase activity(GO:0004096) |
0.2 | 2.7 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.2 | 1.6 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.2 | 1.1 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.2 | 7.1 | GO:0008168 | methyltransferase activity(GO:0008168) |
0.2 | 0.2 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.2 | 1.9 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.2 | 0.9 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
0.2 | 0.2 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.2 | 0.5 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
0.2 | 0.5 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
0.2 | 0.5 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.2 | 0.7 | GO:0052742 | phosphatidylinositol kinase activity(GO:0052742) |
0.2 | 0.8 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.2 | 2.3 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.2 | 1.0 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.2 | 0.5 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.2 | 2.6 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
0.2 | 3.8 | GO:0016836 | hydro-lyase activity(GO:0016836) |
0.2 | 1.0 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.2 | 2.5 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.2 | 1.9 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.2 | 0.5 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.2 | 0.3 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.2 | 2.9 | GO:0017171 | serine-type peptidase activity(GO:0008236) serine hydrolase activity(GO:0017171) |
0.1 | 11.0 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.1 | 0.7 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.1 | 0.1 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
0.1 | 0.4 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 0.7 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.1 | 1.0 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.1 | 0.4 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.1 | 0.6 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.1 | 1.0 | GO:0003796 | lysozyme activity(GO:0003796) |
0.1 | 1.1 | GO:0070513 | death domain binding(GO:0070513) |
0.1 | 0.3 | GO:0002046 | opsin binding(GO:0002046) |
0.1 | 3.5 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.1 | 0.8 | GO:0016667 | oxidoreductase activity, acting on a sulfur group of donors(GO:0016667) |
0.1 | 2.2 | GO:0030145 | manganese ion binding(GO:0030145) |
0.1 | 0.7 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 0.4 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 2.2 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.1 | 0.4 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.9 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.1 | 0.4 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 0.3 | GO:0050780 | dopamine receptor binding(GO:0050780) |
0.1 | 0.4 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.1 | 2.8 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.1 | 0.5 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 0.4 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.1 | 2.4 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.1 | 0.2 | GO:1901505 | carbohydrate derivative transporter activity(GO:1901505) |
0.1 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.1 | 7.9 | GO:0000287 | magnesium ion binding(GO:0000287) |
0.1 | 0.4 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.1 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.1 | 5.9 | GO:0017048 | Rho GTPase binding(GO:0017048) |
0.1 | 0.6 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.1 | 0.7 | GO:0015254 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
0.1 | 0.7 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.1 | 0.4 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
0.1 | 0.1 | GO:0070840 | dynein complex binding(GO:0070840) |
0.1 | 1.3 | GO:0030276 | clathrin binding(GO:0030276) |
0.1 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.1 | 0.2 | GO:0015250 | water channel activity(GO:0015250) |
0.1 | 7.2 | GO:0008234 | cysteine-type peptidase activity(GO:0008234) |
0.1 | 0.1 | GO:0016741 | transferase activity, transferring one-carbon groups(GO:0016741) |
0.1 | 0.2 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.1 | 14.3 | GO:0003723 | RNA binding(GO:0003723) |
0.1 | 1.2 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.1 | 0.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.1 | 0.6 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.1 | 1.5 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.1 | 0.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.5 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
0.1 | 0.3 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
0.1 | 0.3 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.1 | 1.0 | GO:0015179 | L-amino acid transmembrane transporter activity(GO:0015179) |
0.1 | 0.5 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.1 | 0.2 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.1 | 0.9 | GO:0051183 | vitamin transporter activity(GO:0051183) |
0.1 | 0.5 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.1 | 0.4 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 0.2 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.1 | 5.4 | GO:0004518 | nuclease activity(GO:0004518) |
0.1 | 0.3 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.1 | 0.2 | GO:0046915 | transition metal ion transmembrane transporter activity(GO:0046915) |
0.1 | 1.3 | GO:0051119 | sugar transmembrane transporter activity(GO:0051119) |
0.1 | 4.1 | GO:0008146 | sulfotransferase activity(GO:0008146) |
0.1 | 0.7 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.1 | 0.1 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.1 | 2.3 | GO:0051087 | chaperone binding(GO:0051087) |
0.1 | 1.9 | GO:0070330 | aromatase activity(GO:0070330) |
0.1 | 0.4 | GO:0098988 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) G-protein coupled glutamate receptor activity(GO:0098988) |
0.1 | 0.3 | GO:0038100 | nodal binding(GO:0038100) |
0.1 | 1.1 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.1 | 0.3 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.1 | 0.5 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
0.1 | 0.2 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 0.6 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 0.1 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.1 | 0.4 | GO:0019239 | deaminase activity(GO:0019239) |
0.1 | 0.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.1 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.1 | 0.5 | GO:0050661 | NADP binding(GO:0050661) |
0.1 | 0.4 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.1 | 0.3 | GO:0005048 | signal sequence binding(GO:0005048) |
0.1 | 0.3 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 5.6 | GO:0005550 | pheromone binding(GO:0005550) |
0.1 | 1.6 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.1 | 0.9 | GO:0016776 | phosphotransferase activity, phosphate group as acceptor(GO:0016776) |
0.1 | 0.6 | GO:0016410 | N-acyltransferase activity(GO:0016410) |
0.1 | 2.2 | GO:0008527 | taste receptor activity(GO:0008527) |
0.1 | 0.1 | GO:0004952 | dopamine neurotransmitter receptor activity(GO:0004952) |
0.1 | 0.2 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 2.7 | GO:0000149 | SNARE binding(GO:0000149) |
0.1 | 2.7 | GO:0052689 | carboxylic ester hydrolase activity(GO:0052689) |
0.1 | 0.2 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.1 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.0 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.0 | 0.5 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 0.2 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.0 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
0.0 | 0.1 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.0 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.0 | 0.1 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
0.0 | 0.1 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.0 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.0 | 0.1 | GO:0030345 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
0.0 | 0.6 | GO:0016503 | pheromone receptor activity(GO:0016503) |
0.0 | 0.7 | GO:0016853 | isomerase activity(GO:0016853) |
0.0 | 3.2 | GO:0003714 | transcription corepressor activity(GO:0003714) |
0.0 | 0.1 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
0.0 | 0.0 | GO:0097001 | ceramide binding(GO:0097001) |
0.0 | 0.5 | GO:0005548 | phospholipid transporter activity(GO:0005548) |
0.0 | 0.9 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.1 | GO:0004673 | phosphorelay sensor kinase activity(GO:0000155) protein histidine kinase activity(GO:0004673) |
0.0 | 0.4 | GO:0005186 | pheromone activity(GO:0005186) |
0.0 | 0.0 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.0 | 0.2 | GO:0018450 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.0 | 0.2 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.0 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.1 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 12.9 | GO:0004984 | olfactory receptor activity(GO:0004984) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 44.7 | PID LKB1 PATHWAY | LKB1 signaling events |
1.0 | 7.6 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.9 | 11.8 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.9 | 2.6 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.8 | 15.5 | PID ARF 3PATHWAY | Arf1 pathway |
0.8 | 6.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.8 | 19.7 | PID ATR PATHWAY | ATR signaling pathway |
0.8 | 8.6 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.8 | 31.3 | PID PLK1 PATHWAY | PLK1 signaling events |
0.8 | 18.7 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.8 | 53.4 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.7 | 12.5 | PID BARD1 PATHWAY | BARD1 signaling events |
0.7 | 0.7 | PID IFNG PATHWAY | IFN-gamma pathway |
0.7 | 2.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.7 | 19.8 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.7 | 31.4 | PID E2F PATHWAY | E2F transcription factor network |
0.7 | 9.8 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.6 | 14.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.6 | 1.3 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.6 | 19.7 | PID P53 REGULATION PATHWAY | p53 pathway |
0.6 | 11.7 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.6 | 26.6 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.6 | 8.1 | PID AURORA A PATHWAY | Aurora A signaling |
0.6 | 17.9 | PID ARF6 PATHWAY | Arf6 signaling events |
0.6 | 6.9 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.6 | 0.6 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.6 | 6.7 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.6 | 3.3 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.5 | 26.1 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.5 | 2.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.5 | 8.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.5 | 1.9 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.5 | 8.0 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.5 | 2.7 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.5 | 11.3 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.4 | 10.3 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.4 | 10.7 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.4 | 1.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.4 | 5.5 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.4 | 0.4 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.4 | 3.7 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.4 | 2.4 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.4 | 8.6 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.4 | 5.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.4 | 1.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.4 | 1.9 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.4 | 8.5 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.4 | 2.6 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.4 | 11.3 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.4 | 2.5 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.4 | 13.2 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.4 | 0.4 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.3 | 10.3 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.3 | 4.2 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.3 | 9.6 | PID CDC42 PATHWAY | CDC42 signaling events |
0.3 | 3.9 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.3 | 4.8 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.3 | 4.6 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.3 | 5.5 | PID RHOA PATHWAY | RhoA signaling pathway |
0.3 | 4.6 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.3 | 0.8 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.3 | 0.5 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.2 | 15.7 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.2 | 4.3 | PID AURORA B PATHWAY | Aurora B signaling |
0.2 | 0.9 | PID REELIN PATHWAY | Reelin signaling pathway |
0.2 | 0.5 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.2 | 1.7 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.2 | 3.4 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.2 | 2.4 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.2 | 0.4 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.2 | 0.5 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.2 | 1.5 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.2 | 2.7 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.2 | 1.8 | PID EPO PATHWAY | EPO signaling pathway |
0.2 | 1.0 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.2 | 0.2 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.2 | 1.5 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.2 | 3.5 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.2 | 1.9 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.2 | 1.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.1 | 1.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.1 | 2.0 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.1 | 1.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 1.8 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.1 | 2.5 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.1 | 3.5 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.1 | 1.7 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.1 | 1.0 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.1 | 2.7 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.1 | 1.0 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.1 | 0.7 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 0.9 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.1 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 0.2 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.8 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 1.5 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.8 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.1 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 0.0 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.3 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.6 | 36.9 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
1.8 | 8.9 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
1.5 | 25.3 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
1.3 | 15.8 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
1.3 | 11.5 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
1.2 | 1.2 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
1.2 | 19.4 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
1.2 | 2.3 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
1.1 | 91.4 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
1.1 | 18.6 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
1.0 | 4.2 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
1.0 | 10.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
1.0 | 17.3 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
1.0 | 15.0 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
1.0 | 2.0 | REACTOME E2F MEDIATED REGULATION OF DNA REPLICATION | Genes involved in E2F mediated regulation of DNA replication |
1.0 | 11.6 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
1.0 | 16.4 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
1.0 | 20.2 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
1.0 | 34.2 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.9 | 35.8 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.9 | 0.9 | REACTOME PLATELET ACTIVATION SIGNALING AND AGGREGATION | Genes involved in Platelet activation, signaling and aggregation |
0.9 | 14.9 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.9 | 0.9 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.9 | 18.3 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
0.9 | 2.7 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.9 | 7.9 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.9 | 5.3 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.9 | 27.0 | REACTOME TRANSLATION | Genes involved in Translation |
0.9 | 22.5 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.9 | 4.3 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
0.9 | 48.8 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.9 | 6.0 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.8 | 8.4 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.8 | 9.3 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.8 | 16.8 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.8 | 5.9 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.8 | 25.5 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.8 | 10.6 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.8 | 5.7 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.8 | 8.8 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.8 | 5.5 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.8 | 3.1 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.8 | 5.4 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.8 | 16.6 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.8 | 9.0 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.7 | 2.2 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
0.7 | 0.7 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
0.7 | 5.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.7 | 19.3 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.7 | 10.4 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.7 | 0.7 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
0.7 | 4.4 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.7 | 6.5 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.7 | 13.5 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.7 | 29.5 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.7 | 17.5 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.7 | 10.4 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.7 | 4.8 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.7 | 10.8 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.7 | 1.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.7 | 2.0 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.6 | 9.7 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.6 | 1.3 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.6 | 7.7 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.6 | 7.0 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.6 | 5.6 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.6 | 3.7 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.6 | 5.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.6 | 8.6 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.6 | 3.7 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.6 | 29.4 | REACTOME REGULATION OF MITOTIC CELL CYCLE | Genes involved in Regulation of mitotic cell cycle |
0.6 | 3.0 | REACTOME TELOMERE MAINTENANCE | Genes involved in Telomere Maintenance |
0.6 | 17.6 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.6 | 2.4 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.6 | 33.0 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.6 | 9.4 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.6 | 26.8 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.6 | 12.7 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.6 | 6.7 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.5 | 0.5 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
0.5 | 0.5 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.5 | 8.6 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.5 | 5.3 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.5 | 16.5 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.5 | 4.8 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.5 | 6.4 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.5 | 0.5 | REACTOME SIGNALING BY FGFR IN DISEASE | Genes involved in Signaling by FGFR in disease |
0.5 | 11.6 | REACTOME RNA POL II PRE TRANSCRIPTION EVENTS | Genes involved in RNA Polymerase II Pre-transcription Events |
0.5 | 9.4 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.5 | 3.7 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.5 | 2.6 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
0.5 | 7.2 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.5 | 4.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.5 | 2.6 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.5 | 5.6 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.5 | 1.5 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.5 | 8.5 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.5 | 13.5 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.5 | 3.5 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.5 | 2.0 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.5 | 4.9 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.5 | 8.4 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.5 | 3.9 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.5 | 5.3 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.5 | 4.8 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.5 | 6.3 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.5 | 4.8 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.5 | 7.1 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
0.5 | 3.3 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.5 | 2.3 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.5 | 12.5 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.5 | 9.7 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.5 | 8.1 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.4 | 10.3 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.4 | 1.7 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.4 | 2.9 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.4 | 0.8 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.4 | 19.7 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.4 | 4.3 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
0.4 | 2.3 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
0.4 | 4.6 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.4 | 9.6 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.4 | 4.9 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.4 | 4.9 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.4 | 1.9 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
0.4 | 5.6 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.4 | 1.5 | REACTOME DNA REPLICATION | Genes involved in DNA Replication |
0.4 | 15.4 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.4 | 43.8 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.4 | 23.1 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.4 | 2.8 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.3 | 7.6 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.3 | 9.0 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.3 | 3.4 | REACTOME NUCLEOTIDE EXCISION REPAIR | Genes involved in Nucleotide Excision Repair |
0.3 | 6.1 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.3 | 3.0 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.3 | 2.3 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.3 | 6.7 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.3 | 2.0 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.3 | 1.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.3 | 3.1 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.3 | 2.1 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.3 | 3.0 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.3 | 4.5 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.3 | 0.3 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.3 | 2.0 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.3 | 7.8 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.3 | 2.9 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.3 | 2.1 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.3 | 1.3 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.3 | 1.8 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
0.3 | 2.6 | REACTOME METABOLISM OF MRNA | Genes involved in Metabolism of mRNA |
0.3 | 3.3 | REACTOME METABOLISM OF RNA | Genes involved in Metabolism of RNA |
0.3 | 0.3 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
0.2 | 0.7 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.2 | 1.9 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.2 | 1.4 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
0.2 | 0.2 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.2 | 2.5 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.2 | 6.4 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.2 | 1.8 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.2 | 3.5 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.2 | 0.4 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.2 | 15.8 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.2 | 1.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.2 | 5.9 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.2 | 1.4 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.2 | 2.0 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.2 | 2.7 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.2 | 11.5 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.2 | 1.3 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.2 | 2.0 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.2 | 2.7 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.2 | 2.0 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.2 | 0.4 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.2 | 0.7 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.2 | 1.4 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
0.2 | 1.5 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.2 | 2.0 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.2 | 2.5 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.2 | 0.2 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.2 | 4.1 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
0.2 | 2.0 | REACTOME CLASS I MHC MEDIATED ANTIGEN PROCESSING PRESENTATION | Genes involved in Class I MHC mediated antigen processing & presentation |
0.2 | 1.9 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.1 | 1.3 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 1.6 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.1 | 0.9 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.1 | 1.8 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.1 | 1.3 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.1 | 0.3 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.1 | 0.3 | REACTOME HIV LIFE CYCLE | Genes involved in HIV Life Cycle |
0.1 | 1.8 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
0.1 | 1.6 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.1 | 0.9 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
0.1 | 1.6 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.1 | 0.5 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.1 | 0.9 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.1 | 3.3 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.1 | 2.1 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
0.1 | 2.4 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.1 | 3.5 | REACTOME PHOSPHOLIPID METABOLISM | Genes involved in Phospholipid metabolism |
0.1 | 4.6 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.1 | 1.7 | REACTOME KINESINS | Genes involved in Kinesins |
0.1 | 2.1 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 0.6 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.1 | 0.4 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.1 | 1.6 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 0.9 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.1 | 1.7 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.1 | 0.1 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.1 | 0.2 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
0.1 | 0.3 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 0.2 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 1.1 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.4 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.8 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.3 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.4 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.0 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.0 | 0.3 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.0 | 0.1 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.0 | 0.5 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |