Gene Symbol | Gene ID | Gene Info |
---|---|---|
Zbtb7a
|
ENSMUSG00000035011.9 | zinc finger and BTB domain containing 7a |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
chr10_81134024_81134646 | Zbtb7a | 885 | 0.324227 | -0.49 | 6.3e-05 | Click! |
chr10_81135061_81135250 | Zbtb7a | 65 | 0.925063 | -0.46 | 2.6e-04 | Click! |
chr10_81140191_81141251 | Zbtb7a | 2768 | 0.103109 | -0.44 | 4.1e-04 | Click! |
chr10_81139604_81140150 | Zbtb7a | 1924 | 0.138261 | -0.43 | 5.3e-04 | Click! |
chr10_81135262_81135422 | Zbtb7a | 122 | 0.898441 | -0.41 | 1.3e-03 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr5_111421306_111422790 | 6.77 |
Gm43119 |
predicted gene 43119 |
1541 |
0.35 |
chr5_136881600_136883223 | 5.41 |
Col26a1 |
collagen, type XXVI, alpha 1 |
332 |
0.82 |
chr1_5916517_5917959 | 5.06 |
Npbwr1 |
neuropeptides B/W receptor 1 |
160 |
0.97 |
chr16_9994378_9995594 | 4.75 |
Grin2a |
glutamate receptor, ionotropic, NMDA2A (epsilon 1) |
63 |
0.98 |
chr18_35964551_35965976 | 4.43 |
Psd2 |
pleckstrin and Sec7 domain containing 2 |
158 |
0.94 |
chr6_29507052_29508272 | 4.31 |
Gm26627 |
predicted gene, 26627 |
63 |
0.76 |
chr1_112416380_112417130 | 4.31 |
Gm18406 |
predicted gene, 18406 |
11900 |
0.27 |
chr4_25799045_25800424 | 4.13 |
Fut9 |
fucosyltransferase 9 |
121 |
0.96 |
chr14_6286765_6287923 | 4.13 |
Gm3411 |
predicted gene 3411 |
94 |
0.95 |
chr6_145047358_145048434 | 4.05 |
Bcat1 |
branched chain aminotransferase 1, cytosolic |
43 |
0.82 |
chrX_170674573_170675954 | 3.99 |
Asmt |
acetylserotonin O-methyltransferase |
2619 |
0.41 |
chr15_100871055_100872065 | 3.98 |
Scn8a |
sodium channel, voltage-gated, type VIII, alpha |
140 |
0.96 |
chr7_57509014_57510202 | 3.98 |
Gabra5 |
gamma-aminobutyric acid (GABA) A receptor, subunit alpha 5 |
237 |
0.95 |
chr19_59459141_59460287 | 3.97 |
Emx2 |
empty spiracles homeobox 2 |
195 |
0.89 |
chr8_119447111_119447961 | 3.90 |
Necab2 |
N-terminal EF-hand calcium binding protein 2 |
817 |
0.56 |
chr4_103619552_103620735 | 3.88 |
Dab1 |
disabled 1 |
478 |
0.8 |
chr7_79052729_79053830 | 3.88 |
Gm26633 |
predicted gene, 26633 |
44 |
0.71 |
chr11_74589375_74590721 | 3.87 |
Rap1gap2 |
RAP1 GTPase activating protein 2 |
76 |
0.97 |
chr17_27513325_27513568 | 3.81 |
Grm4 |
glutamate receptor, metabotropic 4 |
40 |
0.95 |
chr3_127695352_127695879 | 3.70 |
Gm16238 |
predicted gene 16238 |
3095 |
0.15 |
chr13_51566607_51568077 | 3.69 |
Shc3 |
src homology 2 domain-containing transforming protein C3 |
258 |
0.94 |
chr16_35542503_35542768 | 3.69 |
Sema5b |
sema domain, seven thrombospondin repeats (type 1 and type 1-like), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 5B |
1064 |
0.49 |
chr17_7025121_7026216 | 3.68 |
Gm1604b |
predicted gene 1604b |
100 |
0.96 |
chr5_81021302_81022876 | 3.67 |
Adgrl3 |
adhesion G protein-coupled receptor L3 |
279 |
0.95 |
chr16_92605494_92606418 | 3.65 |
Gm26626 |
predicted gene, 26626 |
6858 |
0.22 |
chr3_17793389_17793789 | 3.61 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
331 |
0.86 |
chr13_89742774_89742925 | 3.61 |
Vcan |
versican |
340 |
0.89 |
chr13_83724722_83725570 | 3.58 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
2960 |
0.17 |
chr5_121828742_121829564 | 3.55 |
Sh2b3 |
SH2B adaptor protein 3 |
412 |
0.73 |
chr19_27217816_27218252 | 3.53 |
Vldlr |
very low density lipoprotein receptor |
576 |
0.77 |
chr16_19760235_19761489 | 3.52 |
B3gnt5 |
UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 5 |
192 |
0.94 |
chr9_45370028_45371246 | 3.51 |
Fxyd6 |
FXYD domain-containing ion transport regulator 6 |
195 |
0.91 |
chr2_180499681_180501159 | 3.45 |
Ntsr1 |
neurotensin receptor 1 |
193 |
0.93 |
chr6_86028425_86029744 | 3.43 |
Add2 |
adducin 2 (beta) |
337 |
0.8 |
chr18_69521278_69522871 | 3.40 |
Tcf4 |
transcription factor 4 |
73 |
0.98 |
chr14_122473606_122474524 | 3.35 |
2610035F20Rik |
RIKEN cDNA 2610035F20 gene |
486 |
0.63 |
chr14_49524944_49526079 | 3.32 |
Slc35f4 |
solute carrier family 35, member F4 |
342 |
0.88 |
chr11_71032311_71033699 | 3.32 |
6330403K07Rik |
RIKEN cDNA 6330403K07 gene |
508 |
0.64 |
chr8_8658122_8658842 | 3.28 |
Efnb2 |
ephrin B2 |
2757 |
0.13 |
chr6_70956025_70957311 | 3.25 |
Foxi3 |
forkhead box I3 |
62 |
0.97 |
chr5_113372968_113373691 | 3.25 |
Aym1 |
activator of yeast meiotic promoters 1 |
16035 |
0.14 |
chr12_5373829_5374490 | 3.19 |
Klhl29 |
kelch-like 29 |
1523 |
0.37 |
chr13_28884130_28884975 | 3.18 |
2610307P16Rik |
RIKEN cDNA 2610307P16 gene |
792 |
0.63 |
chr1_137902800_137903236 | 3.17 |
Gm4258 |
predicted gene 4258 |
4420 |
0.1 |
chr3_25143527_25144623 | 3.13 |
Gm37136 |
predicted gene, 37136 |
7 |
0.71 |
chr17_8100471_8101617 | 3.10 |
Gm1604a |
predicted gene 1604A |
159 |
0.95 |
chrX_103066797_103067364 | 3.08 |
Pabpc1l2a-ps |
poly(A) binding protein, cytoplasmic 1-like 2A, pseudogene |
100 |
0.94 |
chr11_3331744_3332343 | 3.08 |
Pik3ip1 |
phosphoinositide-3-kinase interacting protein 1 |
29 |
0.93 |
chr16_94124910_94125992 | 3.07 |
Sim2 |
single-minded family bHLH transcription factor 2 |
270 |
0.88 |
chrX_103013572_103014168 | 3.07 |
Pabpc1l2b-ps |
poly(A) binding protein, cytoplasmic 1-like 2B, pseudogene |
172 |
0.91 |
chr2_70561239_70561739 | 3.05 |
Gad1 |
glutamate decarboxylase 1 |
553 |
0.66 |
chr13_78202666_78203848 | 3.01 |
A830082K12Rik |
RIKEN cDNA A830082K12 gene |
470 |
0.74 |
chr15_78947966_78948802 | 2.99 |
Triobp |
TRIO and F-actin binding protein |
139 |
0.9 |
chr19_5039775_5039987 | 2.99 |
B4gat1 |
beta-1,4-glucuronyltransferase 1 |
974 |
0.21 |
chr1_42696247_42696979 | 2.98 |
Pou3f3 |
POU domain, class 3, transcription factor 3 |
845 |
0.43 |
chr3_45379351_45381850 | 2.98 |
Pcdh10 |
protocadherin 10 |
2033 |
0.25 |
chr4_133250837_133251842 | 2.97 |
Map3k6 |
mitogen-activated protein kinase kinase kinase 6 |
490 |
0.68 |
chr17_73709252_73710812 | 2.94 |
Galnt14 |
polypeptide N-acetylgalactosaminyltransferase 14 |
34 |
0.98 |
chr5_142960410_142961450 | 2.90 |
Fscn1 |
fascin actin-bundling protein 1 |
87 |
0.97 |
chr18_80985748_80986600 | 2.89 |
Sall3 |
spalt like transcription factor 3 |
362 |
0.76 |
chr2_71545478_71546282 | 2.89 |
Dlx2 |
distal-less homeobox 2 |
70 |
0.96 |
chr8_12396308_12397229 | 2.88 |
Gm25239 |
predicted gene, 25239 |
365 |
0.77 |
chr7_79500711_79501247 | 2.88 |
Mir9-3hg |
Mir9-3 host gene |
858 |
0.39 |
chr18_77564268_77564635 | 2.88 |
Rnf165 |
ring finger protein 165 |
158 |
0.96 |
chr4_154632829_154634203 | 2.86 |
Prdm16 |
PR domain containing 16 |
3281 |
0.16 |
chr5_49524881_49525095 | 2.86 |
Kcnip4 |
Kv channel interacting protein 4 |
81 |
0.97 |
chrX_140277670_140278583 | 2.85 |
Gm15046 |
predicted gene 15046 |
264 |
0.93 |
chr7_105425216_105426515 | 2.84 |
Cckbr |
cholecystokinin B receptor |
48 |
0.95 |
chr2_25877424_25878675 | 2.84 |
Kcnt1 |
potassium channel, subfamily T, member 1 |
168 |
0.93 |
chr3_87999404_88000408 | 2.82 |
Bcan |
brevican |
272 |
0.82 |
chr3_32818331_32818492 | 2.81 |
Usp13 |
ubiquitin specific peptidase 13 (isopeptidase T-3) |
700 |
0.7 |
chr17_46486770_46487488 | 2.81 |
Ttbk1 |
tau tubulin kinase 1 |
546 |
0.61 |
chr8_4216103_4217573 | 2.81 |
Prr36 |
proline rich 36 |
74 |
0.93 |
chr7_126248023_126249285 | 2.79 |
Sbk1 |
SH3-binding kinase 1 |
208 |
0.69 |
chr10_14759598_14760682 | 2.79 |
Nmbr |
neuromedin B receptor |
17 |
0.91 |
chr8_66687402_66688613 | 2.78 |
Npy5r |
neuropeptide Y receptor Y5 |
40 |
0.98 |
chr17_43954528_43954986 | 2.78 |
Rcan2 |
regulator of calcineurin 2 |
1506 |
0.53 |
chr2_6881874_6882908 | 2.78 |
Gm13389 |
predicted gene 13389 |
1879 |
0.3 |
chr11_115381918_115383155 | 2.77 |
Cdr2l |
cerebellar degeneration-related protein 2-like |
620 |
0.51 |
chr5_88583963_88584847 | 2.77 |
Rufy3 |
RUN and FYVE domain containing 3 |
611 |
0.7 |
chr9_51765374_51766248 | 2.77 |
Arhgap20 |
Rho GTPase activating protein 20 |
151 |
0.97 |
chr5_135077129_135077753 | 2.75 |
Vps37d |
vacuolar protein sorting 37D |
825 |
0.4 |
chr7_92234907_92236280 | 2.73 |
Dlg2 |
discs large MAGUK scaffold protein 2 |
466 |
0.88 |
chr2_21367263_21369086 | 2.71 |
Gpr158 |
G protein-coupled receptor 158 |
607 |
0.59 |
chr1_193369065_193370282 | 2.70 |
Camk1g |
calcium/calmodulin-dependent protein kinase I gamma |
552 |
0.7 |
chrX_74328789_74330084 | 2.70 |
Plxna3 |
plexin A3 |
370 |
0.67 |
chr11_80479429_80480178 | 2.70 |
Cdk5r1 |
cyclin-dependent kinase 5, regulatory subunit 1 (p35) |
2747 |
0.26 |
chr1_65311039_65312195 | 2.69 |
Pth2r |
parathyroid hormone 2 receptor |
360 |
0.89 |
chr12_29534253_29535510 | 2.68 |
Gm20208 |
predicted gene, 20208 |
10 |
0.8 |
chr13_96130949_96131570 | 2.67 |
Sv2c |
synaptic vesicle glycoprotein 2c |
1318 |
0.36 |
chr7_34652839_34652990 | 2.65 |
Kctd15 |
potassium channel tetramerisation domain containing 15 |
77 |
0.75 |
chr18_52528299_52529738 | 2.65 |
Gm41724 |
predicted gene, 41724 |
357 |
0.68 |
chr12_69907745_69908880 | 2.65 |
Atl1 |
atlastin GTPase 1 |
580 |
0.65 |
chr11_81152519_81153660 | 2.64 |
Asic2 |
acid-sensing (proton-gated) ion channel 2 |
232 |
0.96 |
chr9_111689605_111690769 | 2.63 |
Stac |
src homology three (SH3) and cysteine rich domain |
38 |
0.98 |
chr5_111418246_111419747 | 2.62 |
Mn1 |
meningioma 1 |
1554 |
0.34 |
chr13_99515862_99516832 | 2.61 |
Map1b |
microtubule-associated protein 1B |
171 |
0.64 |
chr3_107101641_107102643 | 2.60 |
Kcna2 |
potassium voltage-gated channel, shaker-related subfamily, member 2 |
540 |
0.71 |
chr16_67617739_67618070 | 2.60 |
Cadm2 |
cell adhesion molecule 2 |
2589 |
0.35 |
chr14_34822420_34823516 | 2.60 |
Grid1 |
glutamate receptor, ionotropic, delta 1 |
2860 |
0.27 |
chr9_35422384_35422637 | 2.59 |
Cdon |
cell adhesion molecule-related/down-regulated by oncogenes |
952 |
0.52 |
chr14_4855192_4856263 | 2.59 |
Gm3264 |
predicted gene 3264 |
151 |
0.94 |
chr8_125897868_125898882 | 2.58 |
Pcnx2 |
pecanex homolog 2 |
58 |
0.88 |
chr14_65952886_65954310 | 2.55 |
Scara3 |
scavenger receptor class A, member 3 |
337 |
0.86 |
chr2_132384388_132385624 | 2.55 |
Prokr2 |
prokineticin receptor 2 |
394 |
0.86 |
chr12_29937955_29939229 | 2.55 |
Pxdn |
peroxidasin |
542 |
0.84 |
chr3_154663659_154664932 | 2.54 |
Erich3 |
glutamate rich 3 |
436 |
0.82 |
chr2_67565793_67566876 | 2.53 |
B3galt1 |
UDP-Gal:betaGlcNAc beta 1,3-galactosyltransferase, polypeptide 1 |
463 |
0.84 |
chr7_27928706_27929806 | 2.53 |
Zfp974 |
zinc finger protein 974 |
174 |
0.89 |
chr3_26331036_26332158 | 2.52 |
Nlgn1 |
neuroligin 1 |
273 |
0.58 |
chr7_79498955_79500626 | 2.50 |
Mir9-3hg |
Mir9-3 host gene |
236 |
0.84 |
chr11_72050460_72051216 | 2.50 |
Pitpnm3 |
PITPNM family member 3 |
1211 |
0.4 |
chrX_105120425_105121695 | 2.50 |
Magee1 |
melanoma antigen, family E, 1 |
682 |
0.64 |
chr15_89523769_89524635 | 2.49 |
Shank3 |
SH3 and multiple ankyrin repeat domains 3 |
120 |
0.84 |
chr18_35214570_35215443 | 2.48 |
Lrrtm2 |
leucine rich repeat transmembrane neuronal 2 |
2 |
0.52 |
chrX_135035488_135036479 | 2.48 |
3632454L22Rik |
RIKEN cDNA 3632454L22 gene |
165 |
0.95 |
chr6_91284906_91285893 | 2.48 |
Fbln2 |
fibulin 2 |
19520 |
0.17 |
chr19_48205901_48206676 | 2.47 |
Sorcs3 |
sortilin-related VPS10 domain containing receptor 3 |
263 |
0.94 |
chr16_13867665_13868465 | 2.46 |
Pdxdc1 |
pyridoxal-dependent decarboxylase domain containing 1 |
8082 |
0.14 |
chr5_37245879_37246957 | 2.46 |
Crmp1 |
collapsin response mediator protein 1 |
573 |
0.76 |
chr4_116404856_116405098 | 2.45 |
Mast2 |
microtubule associated serine/threonine kinase 2 |
1009 |
0.55 |
chr2_107290303_107291116 | 2.44 |
Kcna4 |
potassium voltage-gated channel, shaker-related subfamily, member 4 |
70 |
0.99 |
chr2_94246278_94247531 | 2.44 |
Mir670hg |
MIR670 host gene (non-protein coding) |
3566 |
0.17 |
chr5_73006697_73007924 | 2.44 |
Slc10a4 |
solute carrier family 10 (sodium/bile acid cotransporter family), member 4 |
407 |
0.74 |
chr6_127887234_127888691 | 2.43 |
Tspan11 |
tetraspanin 11 |
190 |
0.93 |
chr6_115134946_115135613 | 2.43 |
Syn2 |
synapsin II |
329 |
0.57 |
chr7_131966504_131967699 | 2.42 |
Gpr26 |
G protein-coupled receptor 26 |
641 |
0.75 |
chr3_82547675_82549001 | 2.41 |
Npy2r |
neuropeptide Y receptor Y2 |
254 |
0.94 |
chr15_78119178_78120215 | 2.41 |
A730060N03Rik |
RIKEN cDNA A730060N03 gene |
10 |
0.83 |
chr7_62376325_62378263 | 2.41 |
Magel2 |
melanoma antigen, family L, 2 |
284 |
0.9 |
chr3_108414928_108416069 | 2.39 |
Celsr2 |
cadherin, EGF LAG seven-pass G-type receptor 2 |
54 |
0.94 |
chr9_87739615_87740838 | 2.39 |
Gm37374 |
predicted gene, 37374 |
206 |
0.93 |
chr2_25242509_25243012 | 2.39 |
Rnf208 |
ring finger protein 208 |
169 |
0.6 |
chr5_69340481_69341683 | 2.38 |
Gm24368 |
predicted gene, 24368 |
299 |
0.7 |
chrX_73503094_73503593 | 2.37 |
Atp2b3 |
ATPase, Ca++ transporting, plasma membrane 3 |
257 |
0.88 |
chr6_4746473_4747107 | 2.37 |
Sgce |
sarcoglycan, epsilon |
273 |
0.69 |
chr9_66512511_66514532 | 2.37 |
Fbxl22 |
F-box and leucine-rich repeat protein 22 |
1088 |
0.47 |
chr19_7419148_7419720 | 2.36 |
2700081O15Rik |
RIKEN cDNA 2700081O15 gene |
656 |
0.54 |
chr12_116485430_116485708 | 2.36 |
Ptprn2 |
protein tyrosine phosphatase, receptor type, N polypeptide 2 |
151 |
0.94 |
chr6_122562744_122563029 | 2.36 |
Gm16557 |
predicted gene 16557 |
587 |
0.57 |
chr17_85857753_85858489 | 2.35 |
Gm29418 |
predicted gene 29418 |
34077 |
0.19 |
chr9_40963623_40964656 | 2.35 |
Jhy |
junctional cadherin complex regulator |
21 |
0.97 |
chr12_26414133_26415268 | 2.34 |
Mir6538 |
microRNA 6538 |
310 |
0.58 |
chr17_85623199_85624146 | 2.34 |
Six3 |
sine oculis-related homeobox 3 |
2641 |
0.19 |
chr2_38351207_38353752 | 2.34 |
Lhx2 |
LIM homeobox protein 2 |
53 |
0.96 |
chr15_20448699_20449797 | 2.34 |
Cdh12 |
cadherin 12 |
17 |
0.53 |
chr1_134987532_134988305 | 2.33 |
Ube2t |
ubiquitin-conjugating enzyme E2T |
15962 |
0.15 |
chr3_138742334_138742884 | 2.33 |
Tspan5 |
tetraspanin 5 |
104 |
0.97 |
chr5_143179955_143180742 | 2.31 |
Rbak |
RB-associated KRAB zinc finger |
382 |
0.58 |
chr17_28075625_28076391 | 2.31 |
4930526A20Rik |
RIKEN cDNA 4930526A20 gene |
347 |
0.74 |
chr9_29961907_29962940 | 2.30 |
Ntm |
neurotrimin |
696 |
0.81 |
chr7_51880136_51880838 | 2.30 |
Gas2 |
growth arrest specific 2 |
156 |
0.95 |
chr8_99415302_99416849 | 2.30 |
Cdh8 |
cadherin 8 |
244 |
0.77 |
chr2_33717798_33718695 | 2.30 |
9430024E24Rik |
RIKEN cDNA 9430024E24 gene |
653 |
0.72 |
chr1_15892115_15893165 | 2.29 |
Sbspon |
somatomedin B and thrombospondin, type 1 domain containing |
82 |
0.98 |
chr2_32430451_32431664 | 2.29 |
Slc25a25 |
solute carrier family 25 (mitochondrial carrier, phosphate carrier), member 25 |
47 |
0.95 |
chr2_25304614_25305911 | 2.29 |
Grin1 |
glutamate receptor, ionotropic, NMDA1 (zeta 1) |
135 |
0.87 |
chr3_89226055_89227441 | 2.29 |
Mtx1 |
metaxin 1 |
304 |
0.42 |
chr12_8498312_8498553 | 2.29 |
Rhob |
ras homolog family member B |
1577 |
0.32 |
chrX_60892404_60893251 | 2.28 |
Sox3 |
SRY (sex determining region Y)-box 3 |
603 |
0.52 |
chr14_84444241_84444671 | 2.28 |
Pcdh17 |
protocadherin 17 |
893 |
0.66 |
chrX_141724333_141725770 | 2.28 |
Irs4 |
insulin receptor substrate 4 |
212 |
0.49 |
chr7_98729436_98730428 | 2.28 |
Gm19656 |
predicted gene, 19656 |
1172 |
0.38 |
chr3_33844299_33844658 | 2.28 |
Ccdc39 |
coiled-coil domain containing 39 |
168 |
0.94 |
chr16_63857163_63857952 | 2.26 |
Epha3 |
Eph receptor A3 |
5856 |
0.31 |
chr7_19054026_19055076 | 2.26 |
Rsph6a |
radial spoke head 6 homolog A (Chlamydomonas) |
139 |
0.89 |
chr4_85205164_85206256 | 2.26 |
Sh3gl2 |
SH3-domain GRB2-like 2 |
175 |
0.96 |
chr12_14150946_14151678 | 2.26 |
Lratd1 |
LRAT domain containing 1 |
37 |
0.98 |
chr3_156559836_156560180 | 2.26 |
4930570G19Rik |
RIKEN cDNA 4930570G19 gene |
1574 |
0.35 |
chr7_18925442_18925859 | 2.26 |
Nova2 |
NOVA alternative splicing regulator 2 |
238 |
0.86 |
chr4_49844475_49845850 | 2.25 |
Grin3a |
glutamate receptor ionotropic, NMDA3A |
387 |
0.91 |
chr18_61691759_61692669 | 2.25 |
Gm38165 |
predicted gene, 38165 |
170 |
0.91 |
chr6_114130915_114132167 | 2.24 |
Slc6a11 |
solute carrier family 6 (neurotransmitter transporter, GABA), member 11 |
122 |
0.97 |
chr2_32311532_32312331 | 2.23 |
Dnm1 |
dynamin 1 |
958 |
0.33 |
chr12_70827053_70827698 | 2.23 |
Frmd6 |
FERM domain containing 6 |
1686 |
0.31 |
chr7_62348312_62349429 | 2.23 |
Ndn |
necdin |
2301 |
0.3 |
chr1_74855603_74856370 | 2.23 |
Cdk5r2 |
cyclin-dependent kinase 5, regulatory subunit 2 (p39) |
1052 |
0.36 |
chr11_54067769_54068952 | 2.23 |
Pdlim4 |
PDZ and LIM domain 4 |
572 |
0.71 |
chr4_127988222_127989180 | 2.23 |
Csmd2 |
CUB and Sushi multiple domains 2 |
657 |
0.77 |
chr12_86989498_86990698 | 2.22 |
Zdhhc22 |
zinc finger, DHHC-type containing 22 |
332 |
0.85 |
chrX_95711409_95712620 | 2.22 |
Zc3h12b |
zinc finger CCCH-type containing 12B |
336 |
0.89 |
chr6_6863513_6864355 | 2.21 |
Dlx6 |
distal-less homeobox 6 |
136 |
0.91 |
chr12_14494450_14494789 | 2.21 |
Gm9847 |
predicted pseudogene 9847 |
58 |
0.96 |
chr10_76960868_76961875 | 2.20 |
Pcbp3 |
poly(rC) binding protein 3 |
417 |
0.81 |
chr14_64590608_64591000 | 2.19 |
Mir124a-1 |
microRNA 124a-1 |
147 |
0.74 |
chr2_36102229_36104264 | 2.19 |
Lhx6 |
LIM homeobox protein 6 |
346 |
0.82 |
chr1_161142334_161143114 | 2.19 |
Ankrd45 |
ankyrin repeat domain 45 |
1 |
0.96 |
chrX_69360459_69361451 | 2.19 |
Aff2 |
AF4/FMR2 family, member 2 |
255 |
0.57 |
chr16_28564192_28565135 | 2.17 |
Fgf12 |
fibroblast growth factor 12 |
288 |
0.94 |
chr9_24952660_24953051 | 2.17 |
Gm48255 |
predicted gene, 48255 |
118 |
0.95 |
chr14_72531887_72532977 | 2.17 |
Mlnr-ps |
motilin receptor, pseudogene |
217 |
0.94 |
chr9_44720453_44721434 | 2.17 |
Phldb1 |
pleckstrin homology like domain, family B, member 1 |
444 |
0.64 |
chr5_38318977_38320095 | 2.16 |
Drd5 |
dopamine receptor D5 |
169 |
0.91 |
chr10_120899036_120899464 | 2.16 |
Gm4473 |
predicted gene 4473 |
93 |
0.58 |
chr6_105676979_105678296 | 2.16 |
Cntn4 |
contactin 4 |
23 |
0.52 |
chr3_63295316_63296270 | 2.15 |
Mme |
membrane metallo endopeptidase |
79 |
0.98 |
chr5_33725265_33726907 | 2.15 |
Fgfr3 |
fibroblast growth factor receptor 3 |
2314 |
0.17 |
chr1_133182089_133183065 | 2.15 |
Plekha6 |
pleckstrin homology domain containing, family A member 6 |
1256 |
0.44 |
chrX_153498276_153500343 | 2.15 |
Ubqln2 |
ubiquilin 2 |
1082 |
0.51 |
chr16_21204815_21205166 | 2.14 |
Ephb3 |
Eph receptor B3 |
235 |
0.92 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.1 | 6.2 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
2.0 | 2.0 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
1.9 | 5.7 | GO:0021586 | pons maturation(GO:0021586) |
1.8 | 5.4 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
1.8 | 5.3 | GO:0033058 | directional locomotion(GO:0033058) |
1.6 | 4.8 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
1.5 | 6.0 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
1.3 | 1.3 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
1.3 | 4.0 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
1.3 | 5.3 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
1.3 | 4.0 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
1.2 | 3.7 | GO:1990123 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
1.2 | 3.7 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
1.2 | 3.6 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
1.2 | 7.2 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
1.2 | 5.9 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
1.2 | 2.4 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
1.2 | 4.7 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
1.1 | 3.4 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
1.1 | 4.4 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
1.1 | 3.3 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
1.0 | 2.0 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
1.0 | 4.0 | GO:0006551 | leucine metabolic process(GO:0006551) |
1.0 | 1.0 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
1.0 | 3.0 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
1.0 | 1.0 | GO:0010970 | establishment of localization by movement along microtubule(GO:0010970) |
1.0 | 2.9 | GO:0035910 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
1.0 | 3.9 | GO:0030035 | microspike assembly(GO:0030035) |
1.0 | 5.7 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
1.0 | 2.9 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
1.0 | 2.9 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.9 | 0.9 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.9 | 2.8 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.9 | 2.7 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.9 | 2.7 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.9 | 2.6 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.9 | 0.9 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.9 | 5.2 | GO:0032811 | negative regulation of epinephrine secretion(GO:0032811) |
0.9 | 4.3 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.9 | 0.9 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.8 | 1.7 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.8 | 2.5 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.8 | 0.8 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.8 | 2.4 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.8 | 3.1 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.8 | 2.3 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.8 | 2.3 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.8 | 3.8 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.8 | 4.6 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.8 | 2.3 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.8 | 16.6 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.8 | 1.5 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.8 | 3.0 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.8 | 0.8 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.7 | 2.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.7 | 0.7 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
0.7 | 1.5 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.7 | 6.7 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.7 | 2.9 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.7 | 2.9 | GO:0002278 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.7 | 2.2 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.7 | 6.3 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.7 | 6.3 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.7 | 2.8 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.7 | 2.0 | GO:0030070 | insulin processing(GO:0030070) |
0.7 | 8.1 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.7 | 2.0 | GO:0050955 | thermoception(GO:0050955) |
0.7 | 2.0 | GO:0021636 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) |
0.7 | 1.3 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.7 | 4.6 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.7 | 1.3 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.7 | 2.6 | GO:0046909 | intermembrane transport(GO:0046909) |
0.6 | 0.6 | GO:1902837 | amino acid import into cell(GO:1902837) |
0.6 | 1.9 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.6 | 4.4 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.6 | 9.4 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.6 | 1.9 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.6 | 1.2 | GO:0070384 | Harderian gland development(GO:0070384) |
0.6 | 0.6 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.6 | 1.2 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
0.6 | 1.8 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.6 | 0.6 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
0.6 | 2.5 | GO:0030091 | protein repair(GO:0030091) |
0.6 | 2.5 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.6 | 1.8 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
0.6 | 1.8 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.6 | 1.8 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
0.6 | 1.8 | GO:0071504 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.6 | 2.4 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
0.6 | 2.4 | GO:0008038 | neuron recognition(GO:0008038) |
0.6 | 1.8 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
0.6 | 1.8 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.6 | 2.3 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.6 | 3.5 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.6 | 1.7 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
0.6 | 0.6 | GO:0099624 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
0.6 | 1.1 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.6 | 1.7 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.6 | 1.1 | GO:0060174 | limb bud formation(GO:0060174) |
0.6 | 1.7 | GO:0001757 | somite specification(GO:0001757) |
0.6 | 2.8 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.6 | 1.7 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.6 | 1.7 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.5 | 1.6 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.5 | 1.1 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.5 | 1.6 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.5 | 1.6 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.5 | 0.5 | GO:0030815 | negative regulation of cyclic nucleotide metabolic process(GO:0030800) negative regulation of cAMP metabolic process(GO:0030815) |
0.5 | 1.6 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.5 | 2.1 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
0.5 | 1.0 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.5 | 2.6 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.5 | 0.5 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.5 | 3.1 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.5 | 1.5 | GO:1905065 | positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
0.5 | 2.0 | GO:0098596 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.5 | 0.5 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
0.5 | 1.5 | GO:0044849 | estrous cycle(GO:0044849) |
0.5 | 1.0 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.5 | 1.5 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.5 | 1.0 | GO:0015755 | fructose transport(GO:0015755) |
0.5 | 0.5 | GO:0060073 | micturition(GO:0060073) |
0.5 | 16.4 | GO:0019228 | neuronal action potential(GO:0019228) |
0.5 | 2.0 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.5 | 1.5 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.5 | 2.0 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
0.5 | 1.5 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.5 | 4.8 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.5 | 1.4 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.5 | 0.5 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
0.5 | 0.5 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.5 | 2.4 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.5 | 1.9 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
0.5 | 1.9 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.5 | 1.4 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.5 | 5.2 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.5 | 1.0 | GO:0060166 | olfactory pit development(GO:0060166) |
0.5 | 2.4 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.5 | 0.5 | GO:0071313 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.5 | 0.9 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.5 | 0.9 | GO:0051944 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.5 | 0.9 | GO:1903984 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.5 | 0.9 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.5 | 2.7 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.5 | 1.4 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.5 | 0.9 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
0.4 | 0.9 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
0.4 | 2.2 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.4 | 3.1 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.4 | 0.9 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.4 | 1.7 | GO:0048505 | regulation of timing of cell differentiation(GO:0048505) |
0.4 | 1.3 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.4 | 0.9 | GO:0015888 | thiamine transport(GO:0015888) |
0.4 | 0.4 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
0.4 | 0.4 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.4 | 0.8 | GO:0043134 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
0.4 | 1.3 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.4 | 2.1 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
0.4 | 1.7 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.4 | 1.3 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.4 | 1.3 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.4 | 0.8 | GO:0086043 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.4 | 1.3 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.4 | 1.3 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.4 | 0.8 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.4 | 0.8 | GO:0002339 | B cell selection(GO:0002339) |
0.4 | 0.4 | GO:0072497 | mesenchymal stem cell differentiation(GO:0072497) |
0.4 | 1.2 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.4 | 1.6 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
0.4 | 1.6 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.4 | 1.2 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.4 | 1.6 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.4 | 2.4 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.4 | 0.8 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.4 | 0.4 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.4 | 5.6 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.4 | 2.0 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.4 | 0.8 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.4 | 1.2 | GO:0060437 | lung growth(GO:0060437) |
0.4 | 0.4 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.4 | 0.8 | GO:2001201 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.4 | 1.2 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.4 | 1.6 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
0.4 | 1.6 | GO:2000987 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
0.4 | 0.4 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.4 | 1.2 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.4 | 1.2 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
0.4 | 0.8 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.4 | 3.1 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.4 | 0.8 | GO:0044805 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.4 | 2.3 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.4 | 5.0 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.4 | 1.9 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) negative regulation of Schwann cell proliferation(GO:0010626) |
0.4 | 3.5 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.4 | 4.2 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.4 | 2.3 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.4 | 0.8 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.4 | 2.7 | GO:0042637 | catagen(GO:0042637) |
0.4 | 0.4 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.4 | 1.1 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
0.4 | 0.8 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.4 | 2.2 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.4 | 1.1 | GO:0010255 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.4 | 0.7 | GO:0035935 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.4 | 1.1 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.4 | 1.5 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.4 | 1.5 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.4 | 1.5 | GO:0060120 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
0.4 | 2.9 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.4 | 2.9 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.4 | 2.5 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.4 | 1.4 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.4 | 1.1 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.4 | 0.7 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.4 | 0.7 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.4 | 1.1 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.4 | 1.4 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
0.3 | 0.3 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.3 | 0.7 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
0.3 | 1.0 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
0.3 | 1.0 | GO:1902805 | positive regulation of synaptic vesicle transport(GO:1902805) |
0.3 | 1.4 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.3 | 2.0 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.3 | 0.3 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.3 | 0.7 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.3 | 0.7 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.3 | 1.0 | GO:0007412 | axon target recognition(GO:0007412) |
0.3 | 1.0 | GO:0030242 | pexophagy(GO:0030242) |
0.3 | 1.0 | GO:0010996 | response to auditory stimulus(GO:0010996) |
0.3 | 1.0 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.3 | 0.3 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.3 | 0.3 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.3 | 1.0 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.3 | 0.7 | GO:0048242 | epinephrine secretion(GO:0048242) |
0.3 | 2.3 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.3 | 0.7 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
0.3 | 1.0 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.3 | 0.7 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.3 | 0.3 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.3 | 16.8 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.3 | 0.6 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.3 | 1.3 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.3 | 0.9 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.3 | 1.9 | GO:0015884 | folic acid transport(GO:0015884) |
0.3 | 2.5 | GO:0032094 | response to food(GO:0032094) |
0.3 | 0.9 | GO:0052422 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.3 | 0.9 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.3 | 0.6 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.3 | 0.9 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.3 | 2.7 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.3 | 0.3 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
0.3 | 0.9 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.3 | 0.9 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.3 | 0.3 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.3 | 1.2 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.3 | 0.9 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
0.3 | 0.3 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.3 | 0.3 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.3 | 2.3 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
0.3 | 3.2 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.3 | 1.2 | GO:0071649 | regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
0.3 | 22.7 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.3 | 0.6 | GO:0021779 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.3 | 0.9 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.3 | 0.3 | GO:0033504 | floor plate development(GO:0033504) |
0.3 | 1.2 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.3 | 1.1 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.3 | 0.6 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.3 | 0.6 | GO:0070141 | response to UV-A(GO:0070141) |
0.3 | 0.3 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.3 | 1.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.3 | 0.8 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.3 | 1.7 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
0.3 | 1.1 | GO:0014028 | notochord formation(GO:0014028) |
0.3 | 1.1 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
0.3 | 1.1 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.3 | 0.8 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.3 | 1.1 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.3 | 2.5 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.3 | 0.8 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.3 | 1.1 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.3 | 0.8 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.3 | 0.5 | GO:0030432 | peristalsis(GO:0030432) |
0.3 | 0.5 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.3 | 0.8 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.3 | 0.5 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.3 | 0.5 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.3 | 2.9 | GO:0036065 | fucosylation(GO:0036065) |
0.3 | 2.1 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
0.3 | 0.3 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
0.3 | 1.1 | GO:0031000 | response to caffeine(GO:0031000) |
0.3 | 2.9 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.3 | 1.3 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.3 | 0.5 | GO:0048254 | snoRNA localization(GO:0048254) |
0.3 | 0.5 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.3 | 0.8 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.3 | 0.3 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.3 | 2.6 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.3 | 1.5 | GO:0022605 | oogenesis stage(GO:0022605) |
0.3 | 0.8 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.3 | 1.0 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.3 | 0.5 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.3 | 2.3 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.3 | 0.3 | GO:1903935 | response to sodium arsenite(GO:1903935) |
0.3 | 2.0 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.3 | 0.5 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.3 | 1.0 | GO:0060685 | regulation of prostatic bud formation(GO:0060685) |
0.2 | 0.5 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.2 | 0.7 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.2 | 0.5 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.2 | 2.0 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.2 | 1.7 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.2 | 0.5 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.2 | 0.7 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.2 | 0.5 | GO:0007619 | courtship behavior(GO:0007619) |
0.2 | 2.2 | GO:0060074 | synapse maturation(GO:0060074) |
0.2 | 0.5 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.2 | 1.0 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.2 | 0.2 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
0.2 | 1.0 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
0.2 | 0.5 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.2 | 0.7 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.2 | 0.7 | GO:0021978 | telencephalon regionalization(GO:0021978) |
0.2 | 3.3 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
0.2 | 1.9 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.2 | 1.2 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.2 | 1.4 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.2 | 0.7 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.2 | 1.2 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.2 | 0.2 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
0.2 | 0.5 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.2 | 0.5 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.2 | 5.0 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
0.2 | 0.7 | GO:0021843 | substrate-independent telencephalic tangential migration(GO:0021826) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
0.2 | 1.4 | GO:0006108 | malate metabolic process(GO:0006108) |
0.2 | 0.5 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
0.2 | 0.7 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.2 | 0.2 | GO:2000437 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
0.2 | 1.8 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.2 | 1.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.2 | 2.7 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.2 | 1.8 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.2 | 0.5 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.2 | 1.6 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
0.2 | 1.8 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.2 | 0.4 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.2 | 1.3 | GO:0061001 | regulation of dendritic spine morphogenesis(GO:0061001) |
0.2 | 0.7 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.2 | 0.7 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.2 | 1.3 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
0.2 | 0.4 | GO:0033240 | positive regulation of cellular amine metabolic process(GO:0033240) |
0.2 | 0.9 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.2 | 0.2 | GO:0009584 | detection of visible light(GO:0009584) |
0.2 | 0.7 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.2 | 0.4 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.2 | 0.6 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.2 | 0.9 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.2 | 1.3 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.2 | 1.3 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.2 | 1.3 | GO:1903961 | positive regulation of anion transmembrane transport(GO:1903961) |
0.2 | 3.0 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
0.2 | 1.3 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.2 | 0.4 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.2 | 0.6 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.2 | 1.7 | GO:1990001 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.2 | 0.8 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.2 | 0.2 | GO:0014848 | urinary tract smooth muscle contraction(GO:0014848) |
0.2 | 0.2 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
0.2 | 0.4 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.2 | 0.4 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.2 | 0.6 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.2 | 2.3 | GO:0060384 | innervation(GO:0060384) |
0.2 | 0.2 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.2 | 5.4 | GO:0035249 | synaptic transmission, glutamatergic(GO:0035249) |
0.2 | 0.8 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.2 | 23.6 | GO:0071805 | potassium ion transmembrane transport(GO:0071805) |
0.2 | 1.2 | GO:0019336 | phenol-containing compound catabolic process(GO:0019336) |
0.2 | 1.4 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
0.2 | 0.6 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.2 | 0.6 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.2 | 1.4 | GO:0030049 | muscle filament sliding(GO:0030049) |
0.2 | 1.2 | GO:0014002 | astrocyte development(GO:0014002) |
0.2 | 0.4 | GO:0090135 | actin filament branching(GO:0090135) |
0.2 | 1.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.2 | 0.6 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.2 | 1.0 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.2 | 0.6 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.2 | 1.0 | GO:0051775 | response to redox state(GO:0051775) |
0.2 | 0.8 | GO:0035989 | tendon development(GO:0035989) |
0.2 | 0.6 | GO:1990035 | calcium ion import into cell(GO:1990035) |
0.2 | 0.6 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.2 | 0.4 | GO:1904683 | regulation of metalloendopeptidase activity(GO:1904683) negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
0.2 | 1.2 | GO:0032048 | cardiolipin metabolic process(GO:0032048) |
0.2 | 0.6 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.2 | 0.4 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.2 | 2.4 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.2 | 0.6 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
0.2 | 1.2 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.2 | 0.6 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.2 | 0.4 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.2 | 1.0 | GO:0009249 | protein lipoylation(GO:0009249) |
0.2 | 0.2 | GO:0036118 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.2 | 1.0 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.2 | 0.6 | GO:0070268 | cornification(GO:0070268) |
0.2 | 0.4 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.2 | 1.1 | GO:0016264 | gap junction assembly(GO:0016264) |
0.2 | 0.8 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.2 | 1.5 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.2 | 0.8 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.2 | 0.2 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.2 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
0.2 | 0.2 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
0.2 | 0.6 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.2 | 0.9 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
0.2 | 0.8 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.2 | 0.2 | GO:0007418 | ventral midline development(GO:0007418) |
0.2 | 1.3 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.2 | 1.7 | GO:0042670 | retinal cone cell differentiation(GO:0042670) |
0.2 | 1.7 | GO:0007603 | phototransduction, visible light(GO:0007603) |
0.2 | 0.2 | GO:0040031 | snRNA modification(GO:0040031) |
0.2 | 0.2 | GO:0031947 | negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
0.2 | 1.5 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.2 | 0.7 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.2 | 0.6 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.2 | 0.6 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.2 | 0.6 | GO:0002934 | desmosome organization(GO:0002934) |
0.2 | 1.1 | GO:0060317 | cardiac epithelial to mesenchymal transition(GO:0060317) |
0.2 | 1.1 | GO:0043084 | penile erection(GO:0043084) |
0.2 | 1.5 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.2 | 0.7 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
0.2 | 0.4 | GO:0030421 | defecation(GO:0030421) |
0.2 | 0.7 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.2 | 0.2 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.2 | 0.5 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.2 | 0.4 | GO:0032439 | endosome localization(GO:0032439) |
0.2 | 0.5 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
0.2 | 1.4 | GO:0007616 | long-term memory(GO:0007616) |
0.2 | 0.5 | GO:0022010 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
0.2 | 1.8 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.2 | 1.1 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.2 | 0.7 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.2 | 0.2 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.2 | 0.3 | GO:0086091 | regulation of heart rate by cardiac conduction(GO:0086091) |
0.2 | 1.2 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.2 | 0.9 | GO:2001258 | negative regulation of cation channel activity(GO:2001258) |
0.2 | 1.0 | GO:0000338 | protein deneddylation(GO:0000338) |
0.2 | 0.2 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.2 | 0.3 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.2 | 0.7 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.2 | 0.5 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.2 | 0.2 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
0.2 | 0.5 | GO:0014831 | gastro-intestinal system smooth muscle contraction(GO:0014831) |
0.2 | 0.8 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
0.2 | 0.5 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.2 | 0.3 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.2 | 0.3 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.2 | 0.8 | GO:0051444 | negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
0.2 | 1.0 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.2 | 0.3 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.2 | 2.6 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
0.2 | 0.6 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.2 | 1.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.2 | 0.5 | GO:0070977 | ossification involved in bone maturation(GO:0043931) bone maturation(GO:0070977) |
0.2 | 0.6 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.2 | 1.0 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.2 | 0.5 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.2 | 0.2 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
0.2 | 0.5 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.2 | 2.2 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.2 | 0.6 | GO:0015867 | ATP transport(GO:0015867) |
0.2 | 0.8 | GO:0042756 | drinking behavior(GO:0042756) |
0.2 | 0.3 | GO:0045713 | low-density lipoprotein particle receptor biosynthetic process(GO:0045713) regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.2 | 2.5 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.2 | 0.2 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
0.2 | 0.3 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.2 | 0.2 | GO:0032762 | mast cell cytokine production(GO:0032762) |
0.2 | 1.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.2 | 0.8 | GO:0001964 | startle response(GO:0001964) |
0.2 | 0.3 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.2 | 1.5 | GO:0098743 | cartilage condensation(GO:0001502) cell aggregation(GO:0098743) |
0.2 | 0.3 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.2 | 0.3 | GO:0009629 | response to gravity(GO:0009629) |
0.2 | 0.2 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.2 | 0.3 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.2 | 1.2 | GO:0045357 | interferon-beta biosynthetic process(GO:0045350) regulation of interferon-beta biosynthetic process(GO:0045357) |
0.2 | 0.5 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.2 | 0.2 | GO:1900221 | regulation of beta-amyloid clearance(GO:1900221) negative regulation of beta-amyloid clearance(GO:1900222) |
0.2 | 0.5 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.1 | 0.6 | GO:1900102 | negative regulation of endoplasmic reticulum unfolded protein response(GO:1900102) |
0.1 | 0.3 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.1 | 0.6 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.1 | 0.3 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.1 | 0.4 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.1 | 0.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.1 | 1.0 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.1 | 0.7 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 8.0 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.1 | 0.6 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.1 | 0.3 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.1 | 0.3 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
0.1 | 0.1 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.1 | 0.7 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.1 | 1.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.1 | 0.6 | GO:0038001 | paracrine signaling(GO:0038001) |
0.1 | 0.4 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.1 | 1.3 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.1 | 0.6 | GO:0060029 | convergent extension involved in organogenesis(GO:0060029) |
0.1 | 1.0 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.1 | 2.1 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.1 | 0.8 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.1 | 3.8 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.1 | 0.4 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.1 | 0.1 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
0.1 | 0.6 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 1.2 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.1 | 0.5 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.1 | 1.4 | GO:0051926 | negative regulation of calcium ion transport(GO:0051926) |
0.1 | 0.5 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.1 | 0.4 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.5 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.1 | 0.3 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.1 | 0.5 | GO:0034350 | regulation of glial cell apoptotic process(GO:0034350) negative regulation of glial cell apoptotic process(GO:0034351) |
0.1 | 0.3 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.1 | 0.4 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
0.1 | 0.5 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.1 | 1.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.1 | 0.3 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.1 | 0.3 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.1 | 0.3 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
0.1 | 1.6 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 0.1 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.1 | 0.8 | GO:0045986 | negative regulation of smooth muscle contraction(GO:0045986) |
0.1 | 0.3 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.1 | 0.5 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.1 | 0.3 | GO:0032224 | regulation of synaptic transmission, cholinergic(GO:0032222) positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.1 | 0.3 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.1 | 1.6 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.1 | 0.4 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.1 | 0.4 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.1 | 0.4 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 0.4 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.8 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.1 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.1 | 0.5 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
0.1 | 0.8 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.4 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
0.1 | 0.3 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.1 | 0.9 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.1 | 0.4 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.1 | 0.4 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.1 | 0.9 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.1 | 0.4 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.1 | 0.9 | GO:0051181 | cofactor transport(GO:0051181) |
0.1 | 0.6 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.1 | 2.1 | GO:0061512 | protein localization to cilium(GO:0061512) |
0.1 | 0.4 | GO:0035627 | ceramide transport(GO:0035627) |
0.1 | 0.5 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.1 | 0.4 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.1 | 1.0 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
0.1 | 0.1 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.1 | 0.1 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.1 | 0.2 | GO:2000847 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.1 | 0.1 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.1 | 0.1 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
0.1 | 0.1 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.1 | 0.2 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.1 | 1.1 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
0.1 | 0.2 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.1 | 0.5 | GO:0009650 | UV protection(GO:0009650) |
0.1 | 1.1 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.1 | 0.5 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
0.1 | 0.6 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
0.1 | 0.2 | GO:0042505 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.1 | 0.6 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.1 | 0.4 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.1 | 0.5 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.1 | 0.2 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.1 | 0.8 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.1 | 0.5 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.1 | 3.0 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.1 | 1.2 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) positive regulation of protein localization to plasma membrane(GO:1903078) positive regulation of protein localization to cell periphery(GO:1904377) |
0.1 | 0.5 | GO:0051305 | chromosome movement towards spindle pole(GO:0051305) |
0.1 | 0.8 | GO:0007628 | adult walking behavior(GO:0007628) walking behavior(GO:0090659) |
0.1 | 0.2 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.1 | 1.4 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 0.8 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.1 | 0.2 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.1 | 0.6 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.1 | 0.1 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
0.1 | 0.6 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.1 | 0.1 | GO:0015819 | lysine transport(GO:0015819) |
0.1 | 1.0 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
0.1 | 0.5 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.2 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
0.1 | 0.3 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.1 | 0.9 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.1 | 6.7 | GO:0006836 | neurotransmitter transport(GO:0006836) |
0.1 | 0.3 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 0.3 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.1 | 1.6 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.1 | 2.4 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
0.1 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.1 | 0.1 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.1 | 0.3 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.1 | 0.2 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.1 | 0.3 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.1 | 0.3 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
0.1 | 1.6 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.1 | 0.2 | GO:0051350 | negative regulation of lyase activity(GO:0051350) |
0.1 | 0.1 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.1 | 0.3 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.1 | 1.7 | GO:0007274 | neuromuscular synaptic transmission(GO:0007274) |
0.1 | 1.0 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
0.1 | 0.3 | GO:0009174 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.1 | 0.4 | GO:0051013 | microtubule severing(GO:0051013) |
0.1 | 1.4 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.1 | 0.6 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.2 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.1 | 0.5 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.1 | 0.3 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
0.1 | 0.5 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.1 | 1.4 | GO:0045761 | regulation of adenylate cyclase activity(GO:0045761) |
0.1 | 0.2 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.1 | 0.3 | GO:1902308 | regulation of peptidyl-serine dephosphorylation(GO:1902308) |
0.1 | 0.4 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 1.1 | GO:0048385 | regulation of retinoic acid receptor signaling pathway(GO:0048385) |
0.1 | 0.1 | GO:0072679 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
0.1 | 0.3 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.1 | GO:0046959 | habituation(GO:0046959) |
0.1 | 0.1 | GO:0021756 | striatum development(GO:0021756) |
0.1 | 0.5 | GO:0001963 | synaptic transmission, dopaminergic(GO:0001963) |
0.1 | 0.8 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.1 | 0.5 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.1 | 0.2 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.1 | 0.2 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.1 | 0.2 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.1 | 0.1 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.1 | 0.2 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.1 | 0.2 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.1 | 1.0 | GO:0035176 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
0.1 | 0.2 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.1 | 0.2 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
0.1 | 1.4 | GO:0010165 | response to X-ray(GO:0010165) |
0.1 | 0.7 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.1 | 0.3 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 0.2 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 2.2 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
0.1 | 0.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.1 | 0.6 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.1 | 0.7 | GO:0014003 | oligodendrocyte development(GO:0014003) |
0.1 | 0.8 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.1 | 0.3 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) |
0.1 | 0.4 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.1 | 0.2 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
0.1 | 0.2 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
0.1 | 0.2 | GO:0071866 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
0.1 | 0.3 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.1 | 0.7 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.1 | 0.1 | GO:0045932 | negative regulation of muscle contraction(GO:0045932) |
0.1 | 1.9 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.1 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.9 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.1 | 0.1 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
0.1 | 2.3 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.1 | 0.2 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
0.1 | 0.2 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.1 | 1.2 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.1 | 0.1 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.1 | 0.3 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
0.1 | 0.4 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.1 | 0.2 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.1 | 1.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.1 | 0.3 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.1 | 0.3 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.1 | 0.2 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.1 | 0.3 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.1 | 0.7 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
0.1 | 0.1 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.1 | 0.3 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.1 | 6.0 | GO:0030705 | cytoskeleton-dependent intracellular transport(GO:0030705) |
0.1 | 0.2 | GO:0014824 | artery smooth muscle contraction(GO:0014824) |
0.1 | 0.1 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.1 | 0.2 | GO:0060292 | long term synaptic depression(GO:0060292) |
0.1 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.1 | 0.3 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.1 | 0.5 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.1 | 0.1 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.1 | 0.5 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.1 | 0.5 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.1 | 0.6 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
0.1 | 0.1 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.1 | 0.2 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.1 | 0.2 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.1 | 0.3 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.1 | 0.4 | GO:0019740 | nitrogen utilization(GO:0019740) |
0.1 | 0.4 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.1 | 0.4 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.1 | 0.1 | GO:0060013 | righting reflex(GO:0060013) |
0.1 | 0.8 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.1 | 0.3 | GO:0007567 | parturition(GO:0007567) |
0.1 | 0.2 | GO:0071397 | cellular response to sterol(GO:0036315) cellular response to cholesterol(GO:0071397) |
0.1 | 0.3 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.1 | 0.6 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.1 | 1.0 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.1 | 0.2 | GO:0032056 | positive regulation of translation in response to stress(GO:0032056) positive regulation of translational initiation in response to stress(GO:0032058) |
0.1 | 0.1 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.1 | 0.4 | GO:0032324 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.1 | 0.7 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.3 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.1 | 1.4 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.1 | 0.2 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
0.1 | 1.2 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.1 | 0.5 | GO:0046113 | purine nucleobase catabolic process(GO:0006145) nucleobase catabolic process(GO:0046113) |
0.1 | 0.2 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.1 | 0.1 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.1 | 0.3 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 0.7 | GO:0006241 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.1 | 0.4 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.1 | 0.4 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.1 | 0.6 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.1 | 0.1 | GO:0010544 | negative regulation of platelet activation(GO:0010544) |
0.1 | 0.1 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.1 | 0.3 | GO:0035418 | protein localization to synapse(GO:0035418) |
0.1 | 1.7 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.1 | 0.5 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.1 | 0.4 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.1 | 0.2 | GO:0048478 | replication fork protection(GO:0048478) |
0.1 | 0.1 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
0.1 | 0.1 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.1 | 0.4 | GO:1902176 | negative regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902176) |
0.1 | 0.2 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.1 | 0.4 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.1 | 0.3 | GO:0033762 | response to glucagon(GO:0033762) |
0.1 | 0.6 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.1 | 0.2 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.1 | 0.5 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.1 | 0.2 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
0.1 | 1.9 | GO:0051985 | negative regulation of chromosome segregation(GO:0051985) |
0.1 | 0.2 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.1 | 0.2 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
0.1 | 0.7 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
0.1 | 0.2 | GO:0042220 | response to cocaine(GO:0042220) |
0.1 | 0.3 | GO:0000012 | single strand break repair(GO:0000012) |
0.1 | 0.2 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.1 | 0.3 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.1 | 0.2 | GO:0001976 | neurological system process involved in regulation of systemic arterial blood pressure(GO:0001976) |
0.1 | 0.1 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.1 | 0.2 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
0.1 | 0.2 | GO:0036215 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.1 | 1.6 | GO:0048278 | vesicle docking(GO:0048278) |
0.1 | 0.1 | GO:1901160 | primary amino compound metabolic process(GO:1901160) |
0.1 | 0.3 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.1 | 1.1 | GO:0050654 | chondroitin sulfate proteoglycan metabolic process(GO:0050654) |
0.1 | 0.3 | GO:0009217 | purine deoxyribonucleoside triphosphate catabolic process(GO:0009217) |
0.1 | 1.5 | GO:1902850 | mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
0.1 | 0.1 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.1 | 0.1 | GO:0018119 | peptidyl-cysteine S-nitrosylation(GO:0018119) |
0.1 | 0.3 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.1 | 0.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.1 | GO:0032831 | positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.1 | 0.4 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.1 | 0.4 | GO:1990173 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
0.1 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 0.4 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.1 | 0.4 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
0.1 | 0.2 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.1 | 0.1 | GO:0042482 | positive regulation of odontogenesis(GO:0042482) |
0.1 | 0.3 | GO:0042417 | dopamine metabolic process(GO:0042417) |
0.1 | 0.2 | GO:0008216 | spermidine metabolic process(GO:0008216) |
0.1 | 0.1 | GO:0019064 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.1 | 0.1 | GO:0051299 | centrosome separation(GO:0051299) |
0.1 | 0.2 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.1 | 0.1 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
0.1 | 0.2 | GO:0072015 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
0.1 | 0.1 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 0.3 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.1 | 0.1 | GO:0009642 | response to light intensity(GO:0009642) |
0.1 | 0.3 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.1 | 0.1 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.1 | 0.2 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
0.1 | 0.3 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.1 | 0.2 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.1 | 0.9 | GO:0008347 | glial cell migration(GO:0008347) |
0.1 | 0.3 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.1 | 0.2 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.1 | 0.1 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
0.1 | 0.5 | GO:0010447 | response to acidic pH(GO:0010447) |
0.1 | 0.2 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.1 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.1 | 1.0 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
0.1 | 0.5 | GO:0051642 | centrosome localization(GO:0051642) |
0.1 | 0.3 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.1 | 0.1 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.1 | 0.2 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
0.1 | 0.1 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
0.1 | 1.8 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.1 | 0.3 | GO:1990592 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.1 | 0.6 | GO:0021766 | hippocampus development(GO:0021766) |
0.1 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.1 | 0.2 | GO:0006983 | ER overload response(GO:0006983) |
0.1 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.1 | 0.1 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
0.1 | 0.2 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.1 | 0.3 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 0.1 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.1 | 0.5 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
0.1 | 0.2 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.1 | 0.4 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.1 | 0.1 | GO:0010511 | regulation of phosphatidylinositol biosynthetic process(GO:0010511) |
0.1 | 0.1 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.1 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.1 | 0.2 | GO:0046689 | response to mercury ion(GO:0046689) |
0.1 | 0.2 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.2 | GO:0046541 | saliva secretion(GO:0046541) |
0.1 | 0.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.1 | 0.6 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.1 | 0.1 | GO:1902775 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.1 | 0.2 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.1 | 0.1 | GO:1904181 | positive regulation of mitochondrial depolarization(GO:0051901) positive regulation of membrane depolarization(GO:1904181) |
0.1 | 0.1 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
0.1 | 0.4 | GO:0098661 | inorganic anion transmembrane transport(GO:0098661) |
0.1 | 1.4 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.1 | 0.3 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.1 | 0.1 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.1 | 0.2 | GO:0043416 | regulation of skeletal muscle tissue regeneration(GO:0043416) |
0.1 | 0.1 | GO:0051031 | tRNA transport(GO:0051031) |
0.1 | 0.1 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.1 | 0.2 | GO:0018214 | protein carboxylation(GO:0018214) |
0.1 | 0.6 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.1 | 0.1 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.1 | 0.3 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.1 | 0.3 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
0.1 | 1.1 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.1 | 0.2 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.1 | 0.2 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.1 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.1 | GO:0071316 | cellular response to nicotine(GO:0071316) |
0.1 | 0.1 | GO:0021558 | trochlear nerve development(GO:0021558) |
0.1 | 0.4 | GO:0009268 | response to pH(GO:0009268) |
0.1 | 0.7 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
0.1 | 0.2 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.1 | GO:0001941 | postsynaptic membrane organization(GO:0001941) |
0.1 | 0.2 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.1 | 0.3 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.1 | 0.8 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
0.1 | 0.4 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
0.1 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.1 | 0.4 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.1 | 1.0 | GO:0007193 | adenylate cyclase-inhibiting G-protein coupled receptor signaling pathway(GO:0007193) |
0.1 | 0.1 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.1 | 2.2 | GO:0008277 | regulation of G-protein coupled receptor protein signaling pathway(GO:0008277) |
0.1 | 0.3 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.1 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.1 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.1 | 0.3 | GO:0030238 | male sex determination(GO:0030238) |
0.1 | 0.2 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.0 | 0.0 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.0 | 0.2 | GO:0070197 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.1 | GO:0071684 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.0 | 0.4 | GO:0009134 | nucleoside diphosphate catabolic process(GO:0009134) |
0.0 | 0.0 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
0.0 | 0.1 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.0 | 0.0 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.0 | 0.2 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.5 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.0 | GO:1990000 | amyloid fibril formation(GO:1990000) |
0.0 | 0.0 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.0 | 0.3 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
0.0 | 0.1 | GO:1903020 | positive regulation of glycoprotein metabolic process(GO:1903020) |
0.0 | 0.2 | GO:0060033 | anatomical structure regression(GO:0060033) |
0.0 | 0.2 | GO:1901317 | regulation of sperm motility(GO:1901317) |
0.0 | 0.1 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.0 | 0.0 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
0.0 | 0.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.3 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
0.0 | 0.3 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.0 | 0.7 | GO:0031529 | ruffle organization(GO:0031529) |
0.0 | 1.0 | GO:0015991 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.0 | 0.5 | GO:0043516 | regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043516) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.1 | GO:2001223 | negative regulation of neuron migration(GO:2001223) |
0.0 | 0.0 | GO:0009209 | pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) |
0.0 | 0.7 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.7 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 0.1 | GO:0060004 | reflex(GO:0060004) |
0.0 | 0.1 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.0 | 0.1 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.0 | 0.1 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.0 | 0.1 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.3 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.0 | 0.1 | GO:0016075 | rRNA catabolic process(GO:0016075) |
0.0 | 0.3 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
0.0 | 0.2 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.0 | 0.0 | GO:0021895 | cerebral cortex neuron differentiation(GO:0021895) |
0.0 | 0.1 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
0.0 | 0.5 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.4 | GO:0042094 | interleukin-2 biosynthetic process(GO:0042094) |
0.0 | 0.1 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.1 | GO:0072429 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.0 | 0.0 | GO:0090399 | replicative senescence(GO:0090399) |
0.0 | 0.2 | GO:0046135 | pyrimidine nucleoside catabolic process(GO:0046135) |
0.0 | 0.1 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.0 | 0.0 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.0 | 0.0 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
0.0 | 0.1 | GO:0002580 | regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.0 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.0 | 0.1 | GO:0048023 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.0 | 0.1 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.0 | 0.1 | GO:0070243 | regulation of thymocyte apoptotic process(GO:0070243) negative regulation of thymocyte apoptotic process(GO:0070244) |
0.0 | 0.2 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.0 | 0.0 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
0.0 | 0.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.0 | 0.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.0 | 0.1 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
0.0 | 0.6 | GO:0006760 | folic acid-containing compound metabolic process(GO:0006760) |
0.0 | 0.7 | GO:0060612 | adipose tissue development(GO:0060612) |
0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
0.0 | 0.1 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) negative regulation of DNA damage checkpoint(GO:2000002) |
0.0 | 0.1 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.0 | 0.0 | GO:0006868 | glutamine transport(GO:0006868) |
0.0 | 0.2 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.1 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.0 | 0.1 | GO:0035728 | response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
0.0 | 0.1 | GO:0044241 | lipid digestion(GO:0044241) |
0.0 | 0.2 | GO:0035082 | axoneme assembly(GO:0035082) |
0.0 | 0.1 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.0 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.0 | 0.0 | GO:0052151 | killing by symbiont of host cells(GO:0001907) induction of programmed cell death(GO:0012502) disruption by symbiont of host cell(GO:0044004) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
0.0 | 0.4 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.0 | 0.3 | GO:0017158 | regulation of calcium ion-dependent exocytosis(GO:0017158) |
0.0 | 0.1 | GO:0002220 | innate immune response activating cell surface receptor signaling pathway(GO:0002220) |
0.0 | 1.3 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.0 | 0.0 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
0.0 | 0.3 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
0.0 | 0.1 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
0.0 | 1.2 | GO:1905037 | autophagosome organization(GO:1905037) |
0.0 | 0.0 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) |
0.0 | 0.4 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.0 | 0.1 | GO:0002445 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
0.0 | 0.6 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.0 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.0 | 0.1 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.0 | 0.0 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.0 | 0.0 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.0 | 0.1 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.0 | 0.0 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
0.0 | 0.1 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.0 | 0.1 | GO:0061038 | uterus morphogenesis(GO:0061038) |
0.0 | 0.1 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.0 | 0.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.2 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.1 | GO:0006563 | L-serine metabolic process(GO:0006563) |
0.0 | 0.0 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.0 | 0.1 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.0 | GO:0035425 | autocrine signaling(GO:0035425) |
0.0 | 0.0 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.0 | 0.1 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.0 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) |
0.0 | 0.1 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
0.0 | 0.3 | GO:0042775 | mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
0.0 | 0.0 | GO:1901299 | negative regulation of hydrogen peroxide-mediated programmed cell death(GO:1901299) |
0.0 | 0.0 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.0 | 0.0 | GO:0002434 | immune complex clearance(GO:0002434) |
0.0 | 0.0 | GO:0072757 | cellular response to camptothecin(GO:0072757) |
0.0 | 0.1 | GO:0039532 | negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
0.0 | 0.1 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
0.0 | 0.0 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 1.2 | GO:0007018 | microtubule-based movement(GO:0007018) |
0.0 | 0.2 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.0 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.0 | 0.0 | GO:0051231 | spindle elongation(GO:0051231) |
0.0 | 0.1 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.0 | 0.2 | GO:0018126 | protein hydroxylation(GO:0018126) |
0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.0 | GO:0001802 | type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
0.0 | 0.0 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.0 | 0.0 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.0 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.1 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.0 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
0.0 | 0.0 | GO:0050802 | regulation of circadian sleep/wake cycle, sleep(GO:0045187) circadian sleep/wake cycle, sleep(GO:0050802) |
0.0 | 0.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.0 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.0 | 0.0 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.0 | 0.1 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.1 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.0 | 0.1 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.0 | 0.2 | GO:0006999 | nuclear pore organization(GO:0006999) |
0.0 | 0.1 | GO:0019243 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.3 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.0 | 0.2 | GO:0061640 | cytoskeleton-dependent cytokinesis(GO:0061640) |
0.0 | 0.0 | GO:0036093 | germ cell proliferation(GO:0036093) |
0.0 | 0.0 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.0 | 0.0 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.5 | GO:0043039 | tRNA aminoacylation(GO:0043039) |
0.0 | 0.0 | GO:0043038 | amino acid activation(GO:0043038) |
0.0 | 0.1 | GO:0016556 | mRNA modification(GO:0016556) |
0.0 | 0.0 | GO:0071639 | positive regulation of monocyte chemotactic protein-1 production(GO:0071639) |
0.0 | 0.1 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.0 | 0.0 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.0 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.0 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.0 | 0.0 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.0 | 0.0 | GO:0048548 | regulation of pinocytosis(GO:0048548) |
0.0 | 0.1 | GO:0042511 | positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.0 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
0.0 | 0.0 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.0 | 0.0 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.0 | 0.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.0 | GO:0042117 | monocyte activation(GO:0042117) |
0.0 | 0.0 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.0 | GO:0046836 | glycolipid transport(GO:0046836) |
0.0 | 0.0 | GO:0070092 | regulation of glucagon secretion(GO:0070092) |
0.0 | 0.0 | GO:0070316 | G0 to G1 transition(GO:0045023) regulation of G0 to G1 transition(GO:0070316) |
0.0 | 0.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.0 | 0.0 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.0 | 0.0 | GO:0009624 | response to nematode(GO:0009624) |
0.0 | 0.1 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
0.0 | 0.0 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
0.0 | 0.0 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.0 | 0.1 | GO:0034394 | protein localization to cell surface(GO:0034394) |
0.0 | 0.1 | GO:0033273 | response to vitamin(GO:0033273) |
0.0 | 0.0 | GO:0048521 | negative regulation of behavior(GO:0048521) |
0.0 | 0.0 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.0 | 0.0 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.0 | 0.2 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.0 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.0 | 0.0 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.0 | 0.4 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.1 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.1 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
0.0 | 0.0 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.4 | 4.3 | GO:0032280 | symmetric synapse(GO:0032280) |
1.2 | 14.7 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
1.2 | 3.5 | GO:0044393 | microspike(GO:0044393) |
1.1 | 3.3 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
1.1 | 3.2 | GO:0072534 | perineuronal net(GO:0072534) |
1.0 | 4.8 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.9 | 11.4 | GO:0043194 | axon initial segment(GO:0043194) |
0.9 | 4.4 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.9 | 0.9 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.8 | 0.8 | GO:0005883 | neurofilament(GO:0005883) |
0.8 | 15.0 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.8 | 2.5 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.8 | 2.5 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.8 | 1.6 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.8 | 7.7 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.7 | 2.8 | GO:0044308 | axonal spine(GO:0044308) |
0.7 | 4.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.6 | 3.0 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.6 | 2.3 | GO:0071817 | MMXD complex(GO:0071817) |
0.6 | 0.6 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.6 | 3.4 | GO:0043083 | synaptic cleft(GO:0043083) |
0.6 | 2.2 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.5 | 1.1 | GO:1990635 | proximal dendrite(GO:1990635) |
0.5 | 1.6 | GO:0043293 | apoptosome(GO:0043293) |
0.5 | 2.1 | GO:0000322 | storage vacuole(GO:0000322) |
0.5 | 1.5 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.5 | 2.0 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.5 | 30.7 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.5 | 4.2 | GO:0036156 | inner dynein arm(GO:0036156) |
0.5 | 1.9 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.4 | 1.8 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.4 | 1.3 | GO:0048179 | activin receptor complex(GO:0048179) |
0.4 | 3.5 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.4 | 2.6 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.4 | 1.6 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.4 | 1.6 | GO:0071953 | elastic fiber(GO:0071953) |
0.4 | 3.2 | GO:0001520 | outer dense fiber(GO:0001520) |
0.4 | 10.0 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.4 | 8.9 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.4 | 1.2 | GO:0097443 | sorting endosome(GO:0097443) |
0.4 | 0.4 | GO:0008328 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.4 | 0.4 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.4 | 5.2 | GO:0043196 | varicosity(GO:0043196) |
0.4 | 9.0 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.4 | 2.9 | GO:0043198 | dendritic shaft(GO:0043198) |
0.4 | 1.4 | GO:1990696 | USH2 complex(GO:1990696) |
0.3 | 2.0 | GO:0043203 | axon hillock(GO:0043203) |
0.3 | 2.6 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.3 | 0.9 | GO:0032010 | phagolysosome(GO:0032010) |
0.3 | 0.9 | GO:0035838 | growing cell tip(GO:0035838) |
0.3 | 2.1 | GO:0071437 | invadopodium(GO:0071437) |
0.3 | 2.1 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.3 | 0.9 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.3 | 3.0 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.3 | 0.3 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.3 | 1.2 | GO:0032021 | NELF complex(GO:0032021) |
0.3 | 0.9 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.3 | 0.9 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.3 | 0.9 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.3 | 0.3 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.3 | 1.4 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.3 | 6.8 | GO:0044295 | axonal growth cone(GO:0044295) |
0.3 | 3.1 | GO:0031512 | motile primary cilium(GO:0031512) |
0.3 | 1.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.3 | 1.7 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.3 | 2.5 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.3 | 0.8 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.3 | 1.6 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.3 | 1.6 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.3 | 3.5 | GO:0034706 | sodium channel complex(GO:0034706) |
0.3 | 1.3 | GO:0005827 | polar microtubule(GO:0005827) |
0.3 | 1.9 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.3 | 0.3 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.3 | 7.7 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.3 | 0.8 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.2 | 0.7 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.2 | 1.5 | GO:0005915 | zonula adherens(GO:0005915) |
0.2 | 1.5 | GO:0032584 | growth cone membrane(GO:0032584) |
0.2 | 2.9 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.2 | 0.5 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.2 | 0.7 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.2 | 1.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.2 | 0.9 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.2 | 0.7 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.2 | 0.7 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.2 | 0.7 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.2 | 6.3 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.2 | 2.7 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.2 | 0.4 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.2 | 35.3 | GO:0097060 | synaptic membrane(GO:0097060) |
0.2 | 3.7 | GO:0044298 | cell body membrane(GO:0044298) |
0.2 | 1.5 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.2 | 14.3 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.2 | 1.7 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.2 | 0.4 | GO:0097470 | ribbon synapse(GO:0097470) |
0.2 | 0.6 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.2 | 0.6 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.2 | 0.2 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.2 | 0.2 | GO:0000125 | PCAF complex(GO:0000125) |
0.2 | 1.2 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.2 | 0.4 | GO:0016342 | catenin complex(GO:0016342) |
0.2 | 2.3 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.2 | 1.9 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.2 | 1.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.2 | 3.3 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.2 | 2.8 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.2 | 1.9 | GO:0001527 | microfibril(GO:0001527) |
0.2 | 0.9 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.2 | 1.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.2 | 1.6 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.2 | 1.6 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.2 | 0.4 | GO:0097441 | basilar dendrite(GO:0097441) |
0.2 | 0.7 | GO:0005818 | astral microtubule(GO:0000235) aster(GO:0005818) |
0.2 | 0.4 | GO:0071439 | clathrin complex(GO:0071439) |
0.2 | 0.7 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.2 | 1.6 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.2 | 8.5 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.2 | 0.7 | GO:0002177 | manchette(GO:0002177) |
0.2 | 0.3 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.2 | 2.2 | GO:0043679 | axon terminus(GO:0043679) |
0.2 | 0.5 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.2 | 1.4 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.2 | 1.8 | GO:0097440 | apical dendrite(GO:0097440) |
0.2 | 0.6 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.2 | 1.9 | GO:0034704 | calcium channel complex(GO:0034704) |
0.2 | 3.0 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.2 | 0.8 | GO:0097433 | dense body(GO:0097433) |
0.2 | 0.5 | GO:0045298 | tubulin complex(GO:0045298) |
0.2 | 5.2 | GO:0030315 | T-tubule(GO:0030315) |
0.2 | 2.8 | GO:0005771 | multivesicular body(GO:0005771) |
0.2 | 4.4 | GO:0005921 | gap junction(GO:0005921) |
0.1 | 1.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.1 | 9.8 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.1 | 0.3 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.1 | 1.9 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.1 | 1.7 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.1 | 0.1 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.1 | 0.4 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.1 | 0.4 | GO:0097513 | myosin II filament(GO:0097513) |
0.1 | 4.6 | GO:0043296 | apical junction complex(GO:0043296) |
0.1 | 0.7 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.1 | 0.1 | GO:0097546 | ciliary base(GO:0097546) |
0.1 | 0.7 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 1.0 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 1.7 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.1 | 0.8 | GO:0030008 | TRAPP complex(GO:0030008) |
0.1 | 0.6 | GO:0097342 | ripoptosome(GO:0097342) |
0.1 | 1.2 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.1 | 2.2 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.1 | 0.7 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 0.5 | GO:0005796 | Golgi lumen(GO:0005796) |
0.1 | 0.6 | GO:0030897 | HOPS complex(GO:0030897) |
0.1 | 0.5 | GO:0032437 | cuticular plate(GO:0032437) |
0.1 | 0.5 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.6 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.1 | 0.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 0.4 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 4.5 | GO:0043195 | terminal bouton(GO:0043195) |
0.1 | 1.0 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 31.3 | GO:0045202 | synapse(GO:0045202) |
0.1 | 0.4 | GO:0030286 | dynein complex(GO:0030286) |
0.1 | 0.6 | GO:0045180 | basal cortex(GO:0045180) |
0.1 | 0.1 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 0.6 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 0.8 | GO:0070187 | telosome(GO:0070187) |
0.1 | 1.8 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.1 | 5.1 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.1 | 0.2 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 1.6 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.1 | 6.1 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 0.7 | GO:0014704 | intercalated disc(GO:0014704) |
0.1 | 0.3 | GO:0031527 | filopodium membrane(GO:0031527) |
0.1 | 0.3 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.1 | 0.5 | GO:0001940 | male pronucleus(GO:0001940) |
0.1 | 5.4 | GO:0030426 | growth cone(GO:0030426) |
0.1 | 0.3 | GO:0030990 | intraciliary transport particle(GO:0030990) |
0.1 | 0.2 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 0.8 | GO:0005861 | troponin complex(GO:0005861) |
0.1 | 3.7 | GO:0005871 | kinesin complex(GO:0005871) |
0.1 | 0.3 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.1 | 0.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 0.2 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.1 | 3.4 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.1 | 1.9 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.1 | 1.2 | GO:0030914 | STAGA complex(GO:0030914) |
0.1 | 0.9 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.1 | 1.1 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.1 | 1.2 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.1 | 0.9 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.1 | 0.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.1 | 0.7 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.1 | 0.5 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 2.9 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.1 | 0.2 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.3 | GO:0043511 | inhibin complex(GO:0043511) |
0.1 | 0.5 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.1 | 2.9 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.1 | 0.5 | GO:0005652 | nuclear lamina(GO:0005652) |
0.1 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
0.1 | 0.2 | GO:0033010 | paranodal junction(GO:0033010) |
0.1 | 0.2 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.1 | 0.4 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.3 | GO:0000938 | GARP complex(GO:0000938) |
0.1 | 0.5 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.1 | 0.9 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 21.2 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.1 | 6.6 | GO:0072372 | primary cilium(GO:0072372) |
0.1 | 0.3 | GO:0030057 | desmosome(GO:0030057) |
0.1 | 1.1 | GO:0036038 | MKS complex(GO:0036038) |
0.1 | 0.2 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 0.6 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 0.7 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 1.8 | GO:0034707 | chloride channel complex(GO:0034707) |
0.1 | 0.2 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.1 | 1.5 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.1 | 0.6 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.7 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.1 | 0.2 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.1 | 0.2 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.1 | 0.8 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.1 | 3.1 | GO:0043204 | perikaryon(GO:0043204) |
0.1 | 2.6 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.1 | 0.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.1 | 1.0 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.1 | 0.4 | GO:0031430 | M band(GO:0031430) |
0.1 | 0.6 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.1 | 2.1 | GO:0005581 | collagen trimer(GO:0005581) |
0.1 | 0.3 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.1 | 0.1 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 0.4 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.1 | 0.2 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.2 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 1.2 | GO:0005686 | U2 snRNP(GO:0005686) |
0.1 | 0.3 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 1.2 | GO:0031201 | SNARE complex(GO:0031201) |
0.1 | 20.3 | GO:0043005 | neuron projection(GO:0043005) |
0.1 | 0.2 | GO:0005745 | m-AAA complex(GO:0005745) |
0.1 | 5.1 | GO:0043209 | myelin sheath(GO:0043209) |
0.1 | 1.1 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.1 | 0.3 | GO:0034709 | methylosome(GO:0034709) |
0.1 | 0.2 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.1 | 0.4 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.1 | 0.4 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.1 | 0.2 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 0.2 | GO:0005687 | U4 snRNP(GO:0005687) |
0.1 | 0.2 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.1 | 0.4 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.1 | 0.9 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.1 | 0.3 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.1 | 2.0 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
0.1 | 0.2 | GO:0033503 | HULC complex(GO:0033503) |
0.1 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.7 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.0 | 0.2 | GO:0099738 | apical cortex(GO:0045179) cell cortex region(GO:0099738) |
0.0 | 1.1 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.1 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.0 | 0.4 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
0.0 | 5.0 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.5 | GO:0045120 | pronucleus(GO:0045120) |
0.0 | 0.8 | GO:0005770 | late endosome(GO:0005770) |
0.0 | 1.5 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.0 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 1.0 | GO:0032040 | small-subunit processome(GO:0032040) |
0.0 | 1.3 | GO:0005901 | caveola(GO:0005901) |
0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.0 | 1.4 | GO:0030018 | Z disc(GO:0030018) |
0.0 | 0.2 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.1 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.0 | 0.4 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.3 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 2.2 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.0 | 0.2 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.2 | GO:0070069 | cytochrome complex(GO:0070069) |
0.0 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.5 | GO:0044438 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.6 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.0 | 0.6 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 2.3 | GO:0043235 | receptor complex(GO:0043235) |
0.0 | 0.7 | GO:0005776 | autophagosome(GO:0005776) |
0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.0 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.0 | 0.3 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.0 | 0.3 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.0 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.0 | 0.2 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 0.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.2 | GO:0070469 | respiratory chain(GO:0070469) |
0.0 | 0.2 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 0.3 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.3 | GO:0070822 | Sin3-type complex(GO:0070822) |
0.0 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 3.5 | GO:0005929 | cilium(GO:0005929) |
0.0 | 0.2 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.0 | 0.2 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.1 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.9 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.2 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.1 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 0.1 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.1 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.0 | 17.2 | GO:0005887 | integral component of plasma membrane(GO:0005887) |
0.0 | 0.3 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.0 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.6 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.2 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.0 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 2.3 | GO:0005774 | vacuolar membrane(GO:0005774) |
0.0 | 0.1 | GO:0030677 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.2 | GO:0030686 | 90S preribosome(GO:0030686) |
0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.0 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 0.0 | GO:0034702 | ion channel complex(GO:0034702) |
0.0 | 0.1 | GO:0019814 | immunoglobulin complex(GO:0019814) immunoglobulin complex, circulating(GO:0042571) |
0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.2 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.1 | GO:0070938 | contractile ring(GO:0070938) |
0.0 | 0.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 0.6 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.1 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 0.5 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.0 | GO:0033263 | CORVET complex(GO:0033263) |
0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.0 | GO:0030870 | Mre11 complex(GO:0030870) |
0.0 | 0.0 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
0.0 | 1.2 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.0 | 0.3 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 49.7 | GO:0016021 | integral component of membrane(GO:0016021) |
0.0 | 0.0 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.1 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.7 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.0 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.0 | 0.1 | GO:0070652 | HAUS complex(GO:0070652) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.4 | 11.3 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
1.3 | 5.3 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
1.3 | 3.8 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
1.2 | 1.2 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
1.2 | 1.2 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
1.1 | 1.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
1.1 | 3.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
1.1 | 10.5 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.9 | 2.8 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.9 | 3.7 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.9 | 3.7 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.9 | 3.6 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.8 | 2.5 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.8 | 7.3 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.8 | 2.4 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.8 | 15.0 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.8 | 2.3 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.8 | 2.3 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.8 | 3.8 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.8 | 2.3 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.7 | 3.0 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.7 | 2.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.7 | 5.1 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.7 | 2.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.7 | 7.4 | GO:0008066 | glutamate receptor activity(GO:0008066) |
0.7 | 2.0 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.7 | 4.0 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.6 | 1.9 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.6 | 1.9 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.6 | 2.4 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.6 | 3.6 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.6 | 3.0 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.6 | 1.8 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.6 | 2.9 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.6 | 1.7 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.6 | 7.9 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.6 | 1.7 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.6 | 2.3 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.6 | 2.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.6 | 2.2 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.6 | 1.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.5 | 3.3 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.5 | 1.6 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.5 | 5.9 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.5 | 1.6 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.5 | 2.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.5 | 1.5 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.5 | 3.0 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.5 | 1.5 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.5 | 1.5 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.5 | 1.0 | GO:0097016 | L27 domain binding(GO:0097016) |
0.5 | 2.5 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.5 | 1.5 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.5 | 2.0 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.5 | 1.0 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.5 | 0.5 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.5 | 4.3 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.5 | 1.4 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.5 | 3.7 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.5 | 13.3 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.5 | 0.5 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.5 | 2.3 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.5 | 5.4 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.4 | 1.3 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.4 | 0.9 | GO:0030172 | troponin C binding(GO:0030172) |
0.4 | 4.4 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.4 | 1.3 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.4 | 1.3 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.4 | 3.5 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.4 | 1.3 | GO:0051373 | FATZ binding(GO:0051373) |
0.4 | 4.8 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.4 | 1.3 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.4 | 1.6 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.4 | 1.2 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
0.4 | 1.2 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.4 | 6.0 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.4 | 2.7 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.4 | 10.9 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.4 | 0.8 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.4 | 1.2 | GO:0005167 | neurotrophin receptor binding(GO:0005165) neurotrophin TRK receptor binding(GO:0005167) |
0.4 | 1.9 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.4 | 3.4 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.4 | 10.2 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.4 | 3.0 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.4 | 1.5 | GO:0031433 | telethonin binding(GO:0031433) |
0.4 | 0.7 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.4 | 1.9 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.4 | 16.0 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.4 | 4.8 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.4 | 3.7 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.4 | 7.6 | GO:0031420 | alkali metal ion binding(GO:0031420) |
0.4 | 1.1 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.4 | 2.2 | GO:0048495 | Roundabout binding(GO:0048495) |
0.4 | 3.9 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.4 | 0.7 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.3 | 6.8 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.3 | 7.1 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.3 | 1.0 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.3 | 1.3 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.3 | 3.7 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.3 | 1.7 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.3 | 1.0 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.3 | 4.3 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.3 | 0.7 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.3 | 1.0 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.3 | 1.0 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.3 | 1.6 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.3 | 1.3 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.3 | 0.9 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.3 | 0.3 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.3 | 1.2 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.3 | 1.9 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.3 | 1.2 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.3 | 1.2 | GO:0038100 | nodal binding(GO:0038100) |
0.3 | 0.6 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.3 | 0.3 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.3 | 1.8 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.3 | 0.6 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.3 | 0.9 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.3 | 1.5 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.3 | 5.1 | GO:0008483 | transaminase activity(GO:0008483) |
0.3 | 0.9 | GO:0035939 | microsatellite binding(GO:0035939) |
0.3 | 1.5 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.3 | 2.4 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.3 | 1.2 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.3 | 1.5 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.3 | 2.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.3 | 1.8 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.3 | 0.9 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.3 | 2.6 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.3 | 1.7 | GO:0031432 | titin binding(GO:0031432) |
0.3 | 1.1 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.3 | 0.3 | GO:0003678 | DNA helicase activity(GO:0003678) |
0.3 | 0.9 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.3 | 3.4 | GO:0015643 | toxic substance binding(GO:0015643) |
0.3 | 1.1 | GO:0070052 | collagen V binding(GO:0070052) |
0.3 | 1.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.3 | 1.4 | GO:0045545 | syndecan binding(GO:0045545) |
0.3 | 0.6 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.3 | 1.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.3 | 1.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.3 | 3.3 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.3 | 6.8 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.3 | 1.3 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.3 | 1.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.3 | 1.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.3 | 1.6 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.3 | 0.8 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.3 | 1.0 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.3 | 0.8 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
0.3 | 1.8 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.3 | 1.3 | GO:0099604 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
0.3 | 0.3 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.3 | 1.3 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.3 | 1.8 | GO:0030957 | Tat protein binding(GO:0030957) |
0.3 | 0.8 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.2 | 1.2 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.2 | 1.0 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.2 | 1.5 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.2 | 5.5 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.2 | 0.5 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.2 | 0.7 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.2 | 0.2 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.2 | 1.4 | GO:0015288 | porin activity(GO:0015288) |
0.2 | 0.7 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.2 | 1.8 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.2 | 6.0 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.2 | 1.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.2 | 1.4 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.2 | 0.5 | GO:0043398 | HLH domain binding(GO:0043398) |
0.2 | 0.2 | GO:0004952 | dopamine neurotransmitter receptor activity(GO:0004952) |
0.2 | 2.9 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.2 | 2.7 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.2 | 3.3 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.2 | 1.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.2 | 0.6 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.2 | 6.0 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.2 | 0.9 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.2 | 1.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.2 | 2.1 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.2 | 0.6 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.2 | 1.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.2 | 2.9 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.2 | 0.6 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.2 | 0.8 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.2 | 2.1 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.2 | 0.2 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.2 | 0.6 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.2 | 2.2 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.2 | 0.8 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.2 | 0.4 | GO:0016769 | transferase activity, transferring nitrogenous groups(GO:0016769) |
0.2 | 0.6 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.2 | 2.4 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.2 | 1.0 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.2 | 0.6 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.2 | 0.6 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.2 | 1.2 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.2 | 1.7 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.2 | 4.6 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.2 | 2.5 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.2 | 0.2 | GO:0022842 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
0.2 | 2.8 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.2 | 0.6 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.2 | 0.8 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.2 | 0.6 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.2 | 0.2 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.2 | 1.7 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
0.2 | 0.6 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.2 | 0.6 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.2 | 0.7 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.2 | 0.2 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.2 | 0.5 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.2 | 2.0 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.2 | 0.7 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.2 | 0.5 | GO:0018542 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.2 | 1.6 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.2 | 0.9 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.2 | 4.0 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.2 | 1.0 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.2 | 2.1 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.2 | 0.2 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.2 | 1.0 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.2 | 4.6 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.2 | 0.5 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.2 | 5.4 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.2 | 0.3 | GO:0002054 | nucleobase binding(GO:0002054) |
0.2 | 1.2 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.2 | 1.3 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.2 | 0.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.2 | 0.8 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.2 | 2.4 | GO:0051393 | alpha-actinin binding(GO:0051393) |
0.2 | 0.3 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.2 | 1.3 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.2 | 2.9 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.2 | 0.2 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.2 | 0.5 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.2 | 0.3 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.2 | 0.5 | GO:0052622 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.2 | 0.6 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.2 | 0.8 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.2 | 0.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.2 | 0.9 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.2 | 0.6 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.2 | 1.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.2 | 0.5 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.2 | 0.5 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.2 | 0.3 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.2 | 0.5 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.1 | 0.4 | GO:0004935 | adrenergic receptor activity(GO:0004935) |
0.1 | 0.9 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.1 | 0.4 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 1.0 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.1 | 1.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 0.6 | GO:1990254 | keratin filament binding(GO:1990254) |
0.1 | 3.5 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.1 | 1.0 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 0.4 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.1 | 0.6 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 0.9 | GO:0034889 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.1 | 0.6 | GO:0046625 | sphingolipid binding(GO:0046625) |
0.1 | 0.6 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.1 | 14.1 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.1 | 1.4 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.1 | 2.1 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.1 | 0.4 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.1 | 1.2 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.1 | 3.7 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
0.1 | 0.4 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 0.8 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 0.7 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.1 | 2.0 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.1 | 3.1 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.1 | 1.6 | GO:0015026 | coreceptor activity(GO:0015026) |
0.1 | 0.8 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 5.9 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
0.1 | 0.7 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.1 | 0.7 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 1.6 | GO:0070403 | NAD+ binding(GO:0070403) |
0.1 | 0.4 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 1.2 | GO:0042562 | hormone binding(GO:0042562) |
0.1 | 0.4 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.1 | 1.0 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 2.4 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.1 | 2.2 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.1 | 0.5 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.1 | 1.4 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.1 | 0.3 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.1 | 1.2 | GO:0048038 | quinone binding(GO:0048038) |
0.1 | 2.2 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.1 | 1.7 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 1.4 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.1 | 0.4 | GO:0089720 | caspase binding(GO:0089720) |
0.1 | 7.2 | GO:0008378 | galactosyltransferase activity(GO:0008378) |
0.1 | 0.7 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 0.5 | GO:0009374 | biotin binding(GO:0009374) |
0.1 | 1.2 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.1 | 0.5 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.1 | 2.0 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.1 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.1 | 0.4 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.1 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.1 | 0.3 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.1 | 4.5 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.1 | 1.2 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
0.1 | 1.0 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 1.9 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.1 | 0.3 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.1 | 0.5 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.1 | 0.9 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.1 | 0.8 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 1.1 | GO:0022821 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) potassium ion antiporter activity(GO:0022821) |
0.1 | 0.6 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.1 | 0.7 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 0.3 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.1 | 3.5 | GO:0019894 | kinesin binding(GO:0019894) |
0.1 | 0.9 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.1 | 0.2 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.1 | 0.2 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.1 | 0.1 | GO:0070538 | oleic acid binding(GO:0070538) |
0.1 | 0.1 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.1 | 2.6 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.1 | 0.7 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.4 | GO:0016885 | ligase activity, forming carbon-carbon bonds(GO:0016885) |
0.1 | 0.8 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.1 | 0.1 | GO:0034929 | fluorene oxygenase activity(GO:0018585) mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.1 | 0.4 | GO:0042805 | actinin binding(GO:0042805) |
0.1 | 0.2 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.1 | 0.4 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.1 | 1.2 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.1 | 1.4 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.1 | 0.5 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.1 | 0.4 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.1 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 0.3 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.1 | 4.4 | GO:0019905 | syntaxin binding(GO:0019905) |
0.1 | 0.2 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 0.2 | GO:0030984 | kininogen binding(GO:0030984) |
0.1 | 0.5 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.1 | 0.4 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.3 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.3 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.1 | 0.5 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.1 | 0.8 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 0.5 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.1 | 1.1 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.1 | 0.3 | GO:0043515 | kinetochore binding(GO:0043515) |
0.1 | 0.2 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.1 | 0.4 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.3 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.1 | 0.3 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 0.3 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.1 | 3.5 | GO:0017022 | myosin binding(GO:0017022) |
0.1 | 1.7 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.1 | 0.6 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.1 | 0.9 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.1 | 0.3 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.1 | 0.1 | GO:0016429 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
0.1 | 0.9 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.1 | 0.3 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.1 | 0.4 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.1 | 0.3 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.3 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.1 | 0.3 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.1 | 0.5 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 0.7 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 0.8 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.1 | 0.1 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.1 | 0.8 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.1 | 1.5 | GO:0052736 | dextrin alpha-glucosidase activity(GO:0044653) starch alpha-glucosidase activity(GO:0044654) beta-glucanase activity(GO:0052736) beta-6-sulfate-N-acetylglucosaminidase activity(GO:0052769) glucan endo-1,4-beta-glucosidase activity(GO:0052859) |
0.1 | 5.1 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.1 | 0.2 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.1 | 0.4 | GO:0050542 | icosanoid binding(GO:0050542) icosatetraenoic acid binding(GO:0050543) arachidonic acid binding(GO:0050544) fatty acid derivative binding(GO:1901567) |
0.1 | 1.1 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.1 | 0.4 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.1 | 0.4 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.1 | 0.6 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.1 | 0.5 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.1 | 0.2 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.1 | 0.3 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.2 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.1 | 0.5 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.1 | 0.1 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.1 | 0.9 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 0.1 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
0.1 | 2.3 | GO:0016247 | channel regulator activity(GO:0016247) |
0.1 | 2.5 | GO:0015485 | cholesterol binding(GO:0015485) |
0.1 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.1 | 1.1 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.2 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.1 | 0.2 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.1 | 0.7 | GO:0031404 | chloride ion binding(GO:0031404) |
0.1 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.1 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 1.3 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.1 | 0.2 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.1 | 0.4 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
0.1 | 1.2 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.1 | 0.2 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.1 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.1 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.1 | 0.3 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.1 | 5.8 | GO:0003774 | motor activity(GO:0003774) |
0.1 | 1.8 | GO:0052770 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.1 | 0.2 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
0.1 | 1.4 | GO:0005254 | chloride channel activity(GO:0005254) |
0.1 | 0.3 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 1.0 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.1 | 0.5 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 1.4 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.1 | 2.1 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.1 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.1 | 0.1 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.1 | 0.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 0.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.1 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.4 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 1.8 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.1 | 0.2 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.1 | 0.9 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.1 | 0.5 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.2 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.1 | 1.3 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 0.2 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.1 | 0.6 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 0.2 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.1 | 0.3 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.1 | 0.2 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.1 | 1.0 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.1 | 0.2 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
0.1 | 0.2 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.1 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.4 | GO:0034824 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.1 | 0.5 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.1 | 0.6 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.1 | 0.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.1 | 0.2 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.1 | 0.3 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 0.1 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.1 | 0.2 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.1 | 0.6 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.1 | 2.0 | GO:0008009 | chemokine activity(GO:0008009) |
0.1 | 0.1 | GO:0070061 | fructose binding(GO:0070061) |
0.1 | 0.4 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.3 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.1 | 0.2 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.1 | 1.0 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.1 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.1 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
0.1 | 0.2 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.1 | 0.9 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.1 | 0.2 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.1 | 0.7 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.1 | 0.3 | GO:0018857 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.1 | 0.2 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.1 | 0.6 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.1 | 0.2 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 0.2 | GO:0015116 | sulfate transmembrane transporter activity(GO:0015116) |
0.1 | 1.3 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
0.1 | 0.3 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.1 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 1.4 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.9 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.2 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.2 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.0 | 0.1 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.0 | 0.5 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.3 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.9 | GO:0022839 | ion gated channel activity(GO:0022839) |
0.0 | 0.2 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.0 | 0.2 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.0 | 0.1 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.7 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.0 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.0 | 0.0 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.0 | 0.7 | GO:0035254 | glutamate receptor binding(GO:0035254) |
0.0 | 0.3 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.3 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.0 | 0.0 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.0 | 0.2 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.1 | GO:0050694 | galactose 3-O-sulfotransferase activity(GO:0050694) |
0.0 | 0.3 | GO:0008237 | metallopeptidase activity(GO:0008237) |
0.0 | 0.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.0 | 0.3 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.2 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.1 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.0 | 0.8 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.0 | 0.9 | GO:0030170 | pyridoxal phosphate binding(GO:0030170) |
0.0 | 0.2 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.0 | 0.5 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.0 | 0.5 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 2.7 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.0 | 2.1 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
0.0 | 0.5 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.0 | GO:0035671 | enone reductase activity(GO:0035671) |
0.0 | 0.1 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
0.0 | 0.4 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.0 | 12.9 | GO:0005509 | calcium ion binding(GO:0005509) |
0.0 | 0.3 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.7 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.0 | 0.6 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.0 | 0.6 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.0 | 0.1 | GO:0016840 | carbon-nitrogen lyase activity(GO:0016840) |
0.0 | 0.4 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.0 | 0.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.0 | 0.2 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) |
0.0 | 1.1 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.0 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.0 | 0.7 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.4 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.1 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.0 | 0.3 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.0 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.3 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.0 | GO:0015927 | trehalase activity(GO:0015927) |
0.0 | 0.2 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.0 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.1 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.1 | GO:0016726 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.1 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.0 | 0.3 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.1 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.0 | 0.2 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.1 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.0 | 0.1 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.0 | 0.2 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.2 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.6 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
0.0 | 0.0 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 1.3 | GO:0005216 | ion channel activity(GO:0005216) |
0.0 | 6.0 | GO:0032561 | guanyl ribonucleotide binding(GO:0032561) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.1 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.0 | 0.8 | GO:0043765 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.0 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.7 | GO:0044325 | ion channel binding(GO:0044325) |
0.0 | 0.1 | GO:0015266 | protein channel activity(GO:0015266) |
0.0 | 0.2 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.0 | 0.0 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.0 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.1 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 0.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.4 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.0 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.5 | GO:0001653 | peptide receptor activity(GO:0001653) |
0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 0.1 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.1 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.0 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.0 | 0.0 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 1.1 | GO:0004896 | cytokine receptor activity(GO:0004896) |
0.0 | 0.1 | GO:0051184 | cofactor transporter activity(GO:0051184) |
0.0 | 0.1 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.0 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.2 | GO:0000217 | DNA secondary structure binding(GO:0000217) |
0.0 | 0.1 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.0 | 0.2 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.4 | GO:0008238 | exopeptidase activity(GO:0008238) |
0.0 | 0.0 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
0.0 | 0.0 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.3 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.9 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 0.1 | GO:0044466 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.0 | 0.0 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.0 | 0.0 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
0.0 | 0.7 | GO:0019843 | rRNA binding(GO:0019843) |
0.0 | 0.0 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.0 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.9 | GO:0070035 | ATP-dependent helicase activity(GO:0008026) purine NTP-dependent helicase activity(GO:0070035) |
0.0 | 0.0 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.0 | 0.0 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.0 | 0.0 | GO:0005402 | cation:sugar symporter activity(GO:0005402) |
0.0 | 0.0 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.0 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 13.9 | PID REELIN PATHWAY | Reelin signaling pathway |
0.4 | 0.9 | ST ADRENERGIC | Adrenergic Pathway |
0.4 | 12.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.3 | 4.4 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.3 | 0.3 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.3 | 9.3 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.3 | 10.2 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.3 | 6.5 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.3 | 0.5 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.2 | 5.2 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.2 | 6.2 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.2 | 2.9 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.2 | 3.0 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.2 | 4.8 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.2 | 2.8 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.2 | 3.1 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.2 | 0.4 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.2 | 30.0 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.2 | 1.4 | PID ENDOTHELIN PATHWAY | Endothelins |
0.2 | 1.5 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.2 | 2.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.2 | 0.6 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.2 | 6.5 | NABA COLLAGENS | Genes encoding collagen proteins |
0.1 | 0.7 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.1 | 0.9 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 0.8 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 2.1 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.1 | 0.7 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.1 | 0.8 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.1 | 0.1 | PID IGF1 PATHWAY | IGF1 pathway |
0.1 | 0.9 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.1 | 1.0 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.1 | 1.2 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 2.2 | PID MYC PATHWAY | C-MYC pathway |
0.1 | 6.3 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.1 | 4.2 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.1 | 0.9 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 0.6 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.1 | 1.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 0.7 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.1 | 1.4 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 1.2 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 0.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.1 | 1.9 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 0.5 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.1 | 2.0 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.1 | 0.4 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.1 | 1.4 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.1 | 1.1 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.1 | 0.4 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.1 | 1.2 | PID RAS PATHWAY | Regulation of Ras family activation |
0.1 | 1.4 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.1 | 0.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.1 | 2.3 | PID BMP PATHWAY | BMP receptor signaling |
0.1 | 0.2 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.1 | 1.6 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.1 | 1.0 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.1 | 0.5 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.1 | 11.2 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.1 | 0.2 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.3 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 1.7 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.7 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.3 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.5 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.6 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.3 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.4 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 0.2 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.9 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.5 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.5 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.4 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.7 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.0 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 4.2 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.1 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.1 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 16.2 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
1.0 | 12.4 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.8 | 0.8 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.7 | 10.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.7 | 7.7 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.7 | 8.4 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.6 | 0.6 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.6 | 9.8 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.5 | 7.6 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.5 | 3.6 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.4 | 3.4 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.4 | 1.2 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.4 | 17.3 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.4 | 1.6 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.4 | 3.8 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.4 | 6.1 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.3 | 3.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.3 | 1.4 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.3 | 3.8 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.3 | 1.7 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.3 | 2.0 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.3 | 2.3 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.3 | 0.3 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
0.3 | 5.9 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.3 | 5.8 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.3 | 0.9 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.3 | 6.9 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.3 | 1.2 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.3 | 1.2 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.3 | 4.7 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.3 | 3.2 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.3 | 6.7 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.3 | 5.8 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.3 | 5.1 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.3 | 2.6 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.3 | 4.1 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.3 | 1.8 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.3 | 3.8 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.3 | 0.5 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.2 | 3.8 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.2 | 4.3 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.2 | 2.5 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.2 | 0.4 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.2 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.2 | 0.6 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.2 | 0.8 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.2 | 4.7 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.2 | 32.1 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.2 | 1.4 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.2 | 0.8 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.2 | 3.0 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
0.2 | 3.8 | REACTOME KINESINS | Genes involved in Kinesins |
0.2 | 1.4 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.2 | 1.4 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.2 | 1.5 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.2 | 1.5 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
0.2 | 2.3 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.2 | 1.5 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.2 | 3.1 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.2 | 0.3 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
0.2 | 1.4 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.2 | 1.4 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 1.5 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.1 | 0.6 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.1 | 3.7 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.1 | 2.7 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 0.7 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.1 | 1.4 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 0.9 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.1 | 8.5 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.1 | 1.7 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 1.2 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.1 | 5.7 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
0.1 | 2.6 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 3.2 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.1 | 1.6 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.1 | 1.4 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 1.7 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.1 | 2.1 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.1 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
0.1 | 0.4 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.1 | 0.8 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.1 | 0.7 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.1 | 4.0 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.1 | 1.2 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.1 | 0.3 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
0.1 | 2.6 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.1 | 1.2 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.1 | 1.7 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 0.3 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.1 | 1.0 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.1 | 0.7 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.1 | 2.1 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 0.5 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 0.6 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.1 | 4.2 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 1.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 0.8 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.1 | 4.7 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 0.6 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.1 | 1.1 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.1 | 0.8 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.1 | 1.1 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
0.1 | 2.0 | REACTOME TELOMERE MAINTENANCE | Genes involved in Telomere Maintenance |
0.1 | 0.6 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 1.1 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 2.1 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.1 | 0.3 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.1 | 0.4 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 0.7 | REACTOME DNA STRAND ELONGATION | Genes involved in DNA strand elongation |
0.1 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.1 | 0.9 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 1.4 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.1 | 1.7 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.1 | 0.6 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.1 | 0.6 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 0.4 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 0.6 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 0.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.1 | 0.1 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.1 | 0.5 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.1 | 0.3 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 0.3 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.1 | 1.1 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.1 | 1.4 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.1 | 0.7 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.1 | 0.6 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.1 | 0.6 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.1 | 1.1 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.1 | 0.6 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.1 | 0.9 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 1.8 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 1.9 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
0.0 | 1.0 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.0 | 2.3 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.5 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.0 | 0.4 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.4 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.1 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.2 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.0 | 0.3 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.3 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.3 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.7 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.3 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 1.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.9 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 1.5 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 1.1 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.2 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.6 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
0.0 | 0.4 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 1.2 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.1 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.1 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.0 | 0.3 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.0 | 0.0 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.0 | 0.1 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.1 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.0 | 0.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.2 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.1 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.0 | 0.0 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.0 | 0.1 | REACTOME SIGNALLING TO ERKS | Genes involved in Signalling to ERKs |
0.0 | 0.1 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.1 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 0.0 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 0.0 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.0 | 0.0 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |