Gene Symbol | Gene ID | Gene Info |
---|---|---|
Zfp110
|
ENSMUSG00000058638.7 | Zfp110 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Zfp110 | chr7_12834417_12835504 | 77 | 0.928609 | -0.57 | 1.6e-06 | Click! |
Zfp110 | chr7_12844167_12844318 | 7951 | 0.081157 | 0.51 | 3.2e-05 | Click! |
Zfp110 | chr7_12844827_12845048 | 8646 | 0.080176 | 0.47 | 1.5e-04 | Click! |
Zfp110 | chr7_12841716_12842371 | 5752 | 0.086128 | 0.40 | 1.5e-03 | Click! |
Zfp110 | chr7_12844624_12844781 | 8411 | 0.080490 | 0.40 | 1.6e-03 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr17_15544030_15544829 | 18.76 |
Gm18564 |
predicted gene, 18564 |
3387 |
0.13 |
chr4_136289985_136291056 | 15.88 |
Zfp46 |
zinc finger protein 46 |
4416 |
0.16 |
chr7_127444151_127444538 | 9.19 |
B130055M24Rik |
RIKEN cDNA B130055M24 gene |
4292 |
0.07 |
chr1_177446374_177448525 | 7.27 |
Zbtb18 |
zinc finger and BTB domain containing 18 |
1628 |
0.31 |
chr7_127610459_127611513 | 7.15 |
Zfp629 |
zinc finger protein 629 |
3374 |
0.09 |
chr8_3495839_3496662 | 7.08 |
Zfp358 |
zinc finger protein 358 |
1241 |
0.29 |
chr6_48595991_48598208 | 6.93 |
Repin1 |
replication initiator 1 |
2780 |
0.09 |
chr10_79067491_79067922 | 6.56 |
2610008E11Rik |
RIKEN cDNA 2610008E11 gene |
29819 |
0.12 |
chr6_48438163_48439393 | 6.05 |
Zfp467 |
zinc finger protein 467 |
5258 |
0.11 |
chr17_33334561_33334961 | 5.97 |
Zfp81 |
zinc finger protein 81 |
24107 |
0.11 |
chrX_73421886_73422408 | 5.67 |
Zfp92 |
zinc finger protein 92 |
10587 |
0.09 |
chr11_56459308_56460067 | 5.55 |
Gm12241 |
predicted gene 12241 |
338 |
0.92 |
chr7_127343063_127344206 | 5.30 |
Zfp768 |
zinc finger protein 768 |
1789 |
0.17 |
chr9_91363965_91365514 | 5.29 |
Zic1 |
zinc finger protein of the cerebellum 1 |
1029 |
0.35 |
chr7_27989606_27989918 | 5.14 |
Zfp850 |
zinc finger protein 850 |
3966 |
0.14 |
chr14_122475443_122476757 | 4.97 |
Zic2 |
zinc finger protein of the cerebellum 2 |
665 |
0.44 |
chr9_91378153_91379783 | 4.89 |
Zic4 |
zinc finger protein of the cerebellum 4 |
326 |
0.81 |
chr6_48024358_48025016 | 4.78 |
Zfp777 |
zinc finger protein 777 |
19556 |
0.12 |
chr1_154204657_154205754 | 4.76 |
Zfp648 |
zinc finger protein 648 |
4018 |
0.23 |
chrX_166346283_166346827 | 4.66 |
Gpm6b |
glycoprotein m6b |
1713 |
0.43 |
chr7_5029343_5032174 | 4.54 |
Zfp865 |
zinc finger protein 865 |
1434 |
0.15 |
chr12_20898505_20899124 | 4.53 |
Gm10478 |
predicted gene 10478 |
2176 |
0.25 |
chrX_143930842_143933141 | 4.36 |
Dcx |
doublecortin |
1059 |
0.64 |
chr5_143253242_143254446 | 4.33 |
Zfp316 |
zinc finger protein 316 |
2356 |
0.14 |
chr7_127235708_127236966 | 4.32 |
Zfp553 |
zinc finger protein 553 |
3043 |
0.09 |
chr7_127373332_127374447 | 4.24 |
Zfp747 |
zinc finger protein 747 |
2124 |
0.13 |
chr17_22715317_22715933 | 4.11 |
Gm20008 |
predicted gene, 20008 |
1312 |
0.38 |
chr7_127384624_127385805 | 3.99 |
9130019O22Rik |
RIKEN cDNA 9130019O22 gene |
1899 |
0.13 |
chr3_55782570_55784448 | 3.97 |
Nbea |
neurobeachin |
19 |
0.96 |
chr7_12970774_12970925 | 3.88 |
Zfp324 |
zinc finger protein 324 |
4746 |
0.08 |
chr7_27989412_27989590 | 3.74 |
Zfp850 |
zinc finger protein 850 |
3705 |
0.15 |
chr5_19909654_19909839 | 3.73 |
Magi2 |
membrane associated guanylate kinase, WW and PDZ domain containing 2 |
1785 |
0.52 |
chr13_65297362_65297513 | 3.57 |
Zfp369 |
zinc finger protein 369 |
4969 |
0.09 |
chr10_79067320_79067471 | 3.55 |
2610008E11Rik |
RIKEN cDNA 2610008E11 gene |
30130 |
0.12 |
chr4_110290101_110291006 | 3.49 |
Elavl4 |
ELAV like RNA binding protein 4 |
281 |
0.95 |
chr5_104582091_104582421 | 3.30 |
Thoc2l |
THO complex subunit 2-like |
41073 |
0.15 |
chr7_127391606_127392104 | 3.29 |
E430018J23Rik |
RIKEN cDNA E430018J23 gene |
1764 |
0.14 |
chrX_7919510_7921219 | 3.28 |
Pcsk1n |
proprotein convertase subtilisin/kexin type 1 inhibitor |
542 |
0.52 |
chr18_62324201_62324630 | 3.27 |
Htr4 |
5 hydroxytryptamine (serotonin) receptor 4 |
211 |
0.96 |
chr4_13747506_13748460 | 3.24 |
Runx1t1 |
RUNX1 translocation partner 1 |
3314 |
0.37 |
chrX_133684041_133684313 | 3.23 |
Pcdh19 |
protocadherin 19 |
814 |
0.75 |
chr8_106424413_106424720 | 3.18 |
Zfp90 |
zinc finger protein 90 |
9167 |
0.21 |
chr7_42705830_42705981 | 3.14 |
Gm17067 |
predicted gene 17067 |
464 |
0.75 |
chr7_78884387_78884983 | 3.13 |
Mir7-2 |
microRNA 7-2 |
3592 |
0.14 |
chr5_31199675_31199829 | 3.12 |
Zfp513 |
zinc finger protein 513 |
534 |
0.52 |
chr5_143254681_143255401 | 3.06 |
Zfp316 |
zinc finger protein 316 |
1159 |
0.28 |
chrX_143665506_143665657 | 2.99 |
Pak3 |
p21 (RAC1) activated kinase 3 |
164 |
0.97 |
chr7_12971176_12971458 | 2.98 |
Zfp324 |
zinc finger protein 324 |
5214 |
0.08 |
chrX_58030987_58032527 | 2.89 |
Zic3 |
zinc finger protein of the cerebellum 3 |
747 |
0.74 |
chr7_4919002_4919261 | 2.87 |
Nat14 |
N-acetyltransferase 14 |
2897 |
0.1 |
chr9_91361494_91362853 | 2.86 |
Zic4 |
zinc finger protein of the cerebellum 4 |
240 |
0.8 |
chr15_71727296_71727625 | 2.80 |
Fam135b |
family with sequence similarity 135, member B |
378 |
0.89 |
chr15_102983655_102984244 | 2.78 |
Hoxc8 |
homeobox C8 |
6658 |
0.08 |
chr8_122749580_122750238 | 2.78 |
C230057M02Rik |
RIKEN cDNA C230057M02 gene |
2416 |
0.16 |
chr7_127611519_127611936 | 2.77 |
Zfp629 |
zinc finger protein 629 |
2633 |
0.11 |
chr7_127444671_127444822 | 2.63 |
B130055M24Rik |
RIKEN cDNA B130055M24 gene |
3890 |
0.07 |
chr7_25081711_25082044 | 2.63 |
Zfp574 |
zinc finger protein 574 |
4593 |
0.13 |
chr14_122459435_122459783 | 2.61 |
Zic5 |
zinc finger protein of the cerebellum 5 |
412 |
0.76 |
chr8_85154369_85154520 | 2.60 |
Cks1brt |
CDC28 protein kinase 1b, retrogene |
2520 |
0.14 |
chr8_17534365_17535810 | 2.58 |
Csmd1 |
CUB and Sushi multiple domains 1 |
194 |
0.97 |
chr8_84946141_84946501 | 2.58 |
Rtbdn |
retbindin |
670 |
0.4 |
chr15_76911475_76911637 | 2.57 |
Zfp647 |
zinc finger protein 647 |
6454 |
0.1 |
chr7_30162383_30163031 | 2.57 |
Zfp146 |
zinc finger protein 146 |
6984 |
0.07 |
chr15_76911791_76912074 | 2.57 |
Zfp647 |
zinc finger protein 647 |
6078 |
0.1 |
chr5_119866311_119867490 | 2.56 |
Tbx5 |
T-box 5 |
30745 |
0.14 |
chr12_31711839_31712627 | 2.56 |
Gpr22 |
G protein-coupled receptor 22 |
1693 |
0.32 |
chr8_106424971_106425153 | 2.55 |
Zfp90 |
zinc finger protein 90 |
9663 |
0.2 |
chr9_91383318_91384518 | 2.53 |
Zic4 |
zinc finger protein of the cerebellum 4 |
1508 |
0.26 |
chr13_34126566_34127191 | 2.47 |
Tubb2b |
tubulin, beta 2B class IIB |
3476 |
0.13 |
chr11_50815240_50815391 | 2.46 |
Gm23392 |
predicted gene, 23392 |
5664 |
0.12 |
chr18_76855816_76857376 | 2.46 |
Skor2 |
SKI family transcriptional corepressor 2 |
191 |
0.96 |
chr7_80875721_80875966 | 2.42 |
Zscan2 |
zinc finger and SCAN domain containing 2 |
12947 |
0.11 |
chr6_85511342_85512700 | 2.37 |
Egr4 |
early growth response 4 |
1568 |
0.28 |
chr1_155750522_155750930 | 2.27 |
Lhx4 |
LIM homeobox protein 4 |
958 |
0.48 |
chr7_12907008_12907159 | 2.23 |
Zscan22 |
zinc finger and SCAN domain containing 22 |
9216 |
0.08 |
chr6_48025034_48025434 | 2.22 |
Zfp777 |
zinc finger protein 777 |
19009 |
0.12 |
chr14_122463747_122464816 | 2.18 |
Zic5 |
zinc finger protein of the cerebellum 5 |
1396 |
0.29 |
chr7_27750310_27750461 | 2.17 |
Zfp60 |
zinc finger protein 60 |
13429 |
0.12 |
chr15_76517568_76519917 | 2.14 |
Scrt1 |
scratch family zinc finger 1 |
3160 |
0.09 |
chr4_152021328_152021479 | 2.10 |
Zbtb48 |
zinc finger and BTB domain containing 48 |
703 |
0.5 |
chr17_33305364_33305515 | 2.10 |
Zfp422-ps |
zinc finger protein 422, pseudogene |
306 |
0.85 |
chr12_118848802_118850409 | 2.05 |
Sp8 |
trans-acting transcription factor 8 |
2019 |
0.36 |
chr5_31198865_31199664 | 2.05 |
Zfp513 |
zinc finger protein 513 |
1022 |
0.26 |
chr2_72055458_72056697 | 2.00 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
1092 |
0.57 |
chr6_23246500_23247034 | 1.97 |
Fezf1 |
Fez family zinc finger 1 |
1595 |
0.35 |
chr2_102448665_102449240 | 1.95 |
Fjx1 |
four jointed box 1 |
3547 |
0.29 |
chr12_112297423_112297574 | 1.95 |
Gm38123 |
predicted gene, 38123 |
52569 |
0.11 |
chr5_104583193_104583344 | 1.94 |
Thoc2l |
THO complex subunit 2-like |
42085 |
0.15 |
chr17_22852224_22852465 | 1.91 |
Zfp945 |
zinc finger protein 945 |
9375 |
0.15 |
chr16_77787990_77788627 | 1.91 |
Gm17333 |
predicted gene, 17333 |
58296 |
0.11 |
chr2_150341535_150341686 | 1.88 |
Gm10130 |
predicted gene 10130 |
17908 |
0.12 |
chr4_139818118_139818634 | 1.87 |
Pax7 |
paired box 7 |
14631 |
0.21 |
chr5_92959363_92959514 | 1.87 |
Shroom3 |
shroom family member 3 |
2601 |
0.27 |
chr8_95328841_95329043 | 1.85 |
Zfp319 |
zinc finger protein 319 |
3008 |
0.16 |
chr10_82061228_82061460 | 1.85 |
Zfp873 |
zinc finger protein 873 |
1085 |
0.34 |
chr14_103840123_103841623 | 1.85 |
Ednrb |
endothelin receptor type B |
2822 |
0.37 |
chr15_48786821_48787043 | 1.85 |
Csmd3 |
CUB and Sushi multiple domains 3 |
5001 |
0.31 |
chr17_78203801_78204307 | 1.84 |
Crim1 |
cysteine rich transmembrane BMP regulator 1 (chordin like) |
2989 |
0.19 |
chr1_74892200_74893701 | 1.84 |
Cryba2 |
crystallin, beta A2 |
58 |
0.95 |
chr3_17796803_17797144 | 1.83 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
1229 |
0.35 |
chr5_31200173_31200975 | 1.82 |
Zfp513 |
zinc finger protein 513 |
187 |
0.85 |
chr15_68931535_68932379 | 1.81 |
Khdrbs3 |
KH domain containing, RNA binding, signal transduction associated 3 |
1889 |
0.38 |
chr17_21929072_21929439 | 1.79 |
Zfp942 |
zinc finger protein 942 |
3767 |
0.13 |
chrX_166347339_166348040 | 1.78 |
Gpm6b |
glycoprotein m6b |
2847 |
0.32 |
chr9_22278965_22279249 | 1.78 |
Zfp810 |
zinc finger protein 810 |
4796 |
0.09 |
chr4_152021912_152022063 | 1.76 |
Zbtb48 |
zinc finger and BTB domain containing 48 |
119 |
0.93 |
chr6_47820791_47820942 | 1.74 |
Rpl35a-ps7 |
ribosomal protein L35A, pseudogene 7 |
5234 |
0.11 |
chr7_80875461_80875612 | 1.70 |
Zscan2 |
zinc finger and SCAN domain containing 2 |
12640 |
0.11 |
chr9_91388271_91388703 | 1.69 |
Zic4 |
zinc finger protein of the cerebellum 4 |
6077 |
0.13 |
chrX_73815504_73815739 | 1.69 |
Gm23615 |
predicted gene, 23615 |
6204 |
0.1 |
chr18_37851860_37852138 | 1.67 |
Diaph1 |
diaphanous related formin 1 |
1408 |
0.2 |
chr3_108535862_108537093 | 1.65 |
5330417C22Rik |
RIKEN cDNA 5330417C22 gene |
18 |
0.92 |
chr13_54747152_54747519 | 1.62 |
Gprin1 |
G protein-regulated inducer of neurite outgrowth 1 |
2334 |
0.19 |
chr5_138607120_138607381 | 1.61 |
Zfp68 |
zinc finger protein 68 |
193 |
0.77 |
chr7_12971488_12971639 | 1.60 |
Zfp324 |
zinc finger protein 324 |
5460 |
0.08 |
chr15_83083762_83084209 | 1.58 |
Serhl |
serine hydrolase-like |
5521 |
0.14 |
chr17_67499984_67500234 | 1.57 |
Gm36201 |
predicted gene, 36201 |
129223 |
0.05 |
chr7_39473035_39473186 | 1.56 |
Zfp939 |
zinc finger protein 939 |
13294 |
0.12 |
chr7_13043307_13044582 | 1.56 |
Ube2m |
ubiquitin-conjugating enzyme E2M |
5669 |
0.08 |
chr12_17903648_17903799 | 1.55 |
Gm49331 |
predicted gene, 49331 |
1334 |
0.29 |
chr7_121088688_121088839 | 1.54 |
Otoa |
otoancorin |
5339 |
0.11 |
chr2_10736719_10737810 | 1.54 |
Gm18547 |
predicted gene, 18547 |
156445 |
0.01 |
chr5_104813789_104813940 | 1.53 |
Zfp951 |
zinc finger protein 951 |
15093 |
0.21 |
chr7_30161316_30161833 | 1.53 |
Zfp146 |
zinc finger protein 146 |
8117 |
0.07 |
chr7_140922103_140923430 | 1.52 |
Nlrp6 |
NLR family, pyrin domain containing 6 |
660 |
0.42 |
chr14_70079421_70080436 | 1.52 |
Egr3 |
early growth response 3 |
1189 |
0.41 |
chr12_117805814_117806560 | 1.51 |
Cdca7l |
cell division cycle associated 7 like |
1898 |
0.37 |
chr5_38156003_38156268 | 1.51 |
Nsg1 |
neuron specific gene family member 1 |
2896 |
0.21 |
chr7_4920282_4920529 | 1.50 |
Nat14 |
N-acetyltransferase 14 |
1623 |
0.16 |
chr12_108205094_108205245 | 1.49 |
Ccnk |
cyclin K |
6084 |
0.22 |
chr5_104637557_104637793 | 1.49 |
Thoc2l |
THO complex subunit 2-like |
96492 |
0.07 |
chr17_24444801_24444952 | 1.49 |
E4f1 |
E4F transcription factor 1 |
342 |
0.69 |
chr12_18152092_18152243 | 1.48 |
Gm48354 |
predicted gene, 48354 |
8085 |
0.13 |
chr2_80128704_80129752 | 1.48 |
Pde1a |
phosphodiesterase 1A, calmodulin-dependent |
230 |
0.94 |
chrX_73353774_73353925 | 1.47 |
Zfp275 |
zinc finger protein 275 |
9381 |
0.1 |
chr7_30178257_30178408 | 1.46 |
Gm5113 |
predicted gene 5113 |
4902 |
0.08 |
chr1_34005827_34007047 | 1.46 |
Dst |
dystonin |
257 |
0.9 |
chr7_79593073_79593268 | 1.46 |
Gm45169 |
predicted gene 45169 |
557 |
0.58 |
chr17_14226357_14226508 | 1.44 |
Dact2 |
dishevelled-binding antagonist of beta-catenin 2 |
22128 |
0.14 |
chr13_62370176_62370459 | 1.44 |
Gm3604 |
predicted gene 3604 |
1619 |
0.21 |
chr7_29894584_29894764 | 1.43 |
Zfp27 |
zinc finger protein 27 |
4189 |
0.1 |
chr9_22278096_22278247 | 1.43 |
Zfp810 |
zinc finger protein 810 |
5732 |
0.09 |
chr5_110079333_110079484 | 1.43 |
Gm35315 |
predicted gene, 35315 |
1480 |
0.25 |
chr7_5036104_5036569 | 1.42 |
Zfp784 |
zinc finger protein 784 |
2110 |
0.1 |
chr10_81147958_81148233 | 1.42 |
Pias4 |
protein inhibitor of activated STAT 4 |
8029 |
0.07 |
chr11_116813927_116814556 | 1.40 |
Mxra7 |
matrix-remodelling associated 7 |
13762 |
0.1 |
chr1_77514026_77515085 | 1.40 |
Epha4 |
Eph receptor A4 |
524 |
0.56 |
chr9_99954804_99955263 | 1.40 |
Gm8641 |
predicted gene 8641 |
7644 |
0.2 |
chr2_30283222_30283435 | 1.39 |
Gm28038 |
predicted gene, 28038 |
2285 |
0.14 |
chr1_188002104_188003122 | 1.39 |
Esrrg |
estrogen-related receptor gamma |
4745 |
0.26 |
chr15_98977285_98979178 | 1.39 |
4930578M01Rik |
RIKEN cDNA 4930578M01 gene |
5117 |
0.09 |
chr6_117845413_117845564 | 1.38 |
Zfp637 |
zinc finger protein 637 |
2235 |
0.22 |
chr8_85154140_85154291 | 1.38 |
Cks1brt |
CDC28 protein kinase 1b, retrogene |
2291 |
0.15 |
chr10_119691270_119691421 | 1.37 |
Grip1 |
glutamate receptor interacting protein 1 |
709 |
0.71 |
chr17_33335220_33335437 | 1.37 |
Zfp81 |
zinc finger protein 81 |
23540 |
0.12 |
chr7_24105350_24105526 | 1.37 |
Zfp112 |
zinc finger protein 112 |
6876 |
0.09 |
chr13_49144376_49144939 | 1.36 |
Wnk2 |
WNK lysine deficient protein kinase 2 |
2575 |
0.3 |
chr7_24104365_24105198 | 1.36 |
Zfp180 |
zinc finger protein 180 |
7515 |
0.09 |
chr6_6575616_6576265 | 1.35 |
Sem1 |
SEM1, 26S proteasome complex subunit |
2718 |
0.32 |
chr12_56699459_56700760 | 1.34 |
Pax9 |
paired box 9 |
4380 |
0.18 |
chr5_104583344_104584482 | 1.33 |
Thoc2l |
THO complex subunit 2-like |
42730 |
0.15 |
chr2_3483151_3483302 | 1.33 |
Hspa14 |
heat shock protein 14 |
6936 |
0.11 |
chr8_106424729_106424945 | 1.31 |
Zfp90 |
zinc finger protein 90 |
9438 |
0.2 |
chr6_117130561_117131249 | 1.31 |
Gm43930 |
predicted gene, 43930 |
13420 |
0.19 |
chr7_127883476_127884433 | 1.30 |
Zfp646 |
zinc finger protein 646 |
4643 |
0.07 |
chr8_12388354_12388751 | 1.30 |
Gm45560 |
predicted gene 45560 |
1616 |
0.27 |
chr17_17264232_17264383 | 1.29 |
Gm5165 |
predicted gene 5165 |
1957 |
0.35 |
chr5_138455709_138455948 | 1.29 |
Zfp157 |
zinc finger protein 157 |
14288 |
0.12 |
chr1_38320013_38320646 | 1.29 |
Gm16151 |
predicted gene 16151 |
12427 |
0.22 |
chr1_55194644_55194919 | 1.29 |
Rftn2 |
raftlin family member 2 |
11708 |
0.13 |
chr11_21992790_21995427 | 1.29 |
Otx1 |
orthodenticle homeobox 1 |
7507 |
0.25 |
chr3_17787332_17788058 | 1.29 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
2226 |
0.29 |
chr9_44094070_44094336 | 1.28 |
Usp2 |
ubiquitin specific peptidase 2 |
1529 |
0.16 |
chr1_133188547_133188788 | 1.28 |
Plekha6 |
pleckstrin homology domain containing, family A member 6 |
7346 |
0.18 |
chr7_29792760_29793412 | 1.28 |
Gm6579 |
predicted gene 6579 |
6710 |
0.09 |
chr7_127405275_127405633 | 1.28 |
Zfp764 |
zinc finger protein 764 |
1329 |
0.18 |
chr7_24327051_24327202 | 1.27 |
AC159140.1 |
Zinc finger protein 264 (ZNF264) pseudogene |
667 |
0.42 |
chr3_50639926_50640198 | 1.27 |
Gm37199 |
predicted gene, 37199 |
11651 |
0.17 |
chr17_46269136_46269291 | 1.27 |
Tjap1 |
tight junction associated protein 1 |
595 |
0.56 |
chr12_24070376_24070527 | 1.27 |
9030624G23Rik |
RIKEN cDNA 9030624G23 gene |
26795 |
0.16 |
chr2_49621205_49621356 | 1.27 |
Kif5c |
kinesin family member 5C |
1982 |
0.42 |
chrX_69362591_69363214 | 1.26 |
Gm14705 |
predicted gene 14705 |
1633 |
0.4 |
chr7_5035782_5035973 | 1.26 |
4632433K11Rik |
RIKEN cDNA 4632433K11 gene |
1759 |
0.12 |
chr1_171224015_171224166 | 1.26 |
Apoa2 |
apolipoprotein A-II |
964 |
0.27 |
chr15_102970232_102971190 | 1.26 |
Mir196a-2 |
microRNA 196a-2 |
2639 |
0.11 |
chr7_133758654_133758805 | 1.25 |
Dhx32 |
DEAH (Asp-Glu-Ala-His) box polypeptide 32 |
743 |
0.55 |
chr3_99262563_99262714 | 1.25 |
Gm43120 |
predicted gene 43120 |
1353 |
0.4 |
chr2_167830754_167830905 | 1.25 |
1200007C13Rik |
RIKEN cDNA 1200007C13 gene |
2817 |
0.23 |
chr17_25253668_25254532 | 1.25 |
Baiap3 |
BAI1-associated protein 3 |
153 |
0.89 |
chr7_6189448_6190004 | 1.23 |
Zfp444 |
zinc finger protein 444 |
6150 |
0.1 |
chr9_41953271_41953922 | 1.23 |
Sorl1 |
sortilin-related receptor, LDLR class A repeats-containing |
20991 |
0.18 |
chr17_27685224_27686193 | 1.22 |
Pacsin1 |
protein kinase C and casein kinase substrate in neurons 1 |
469 |
0.71 |
chr15_75948207_75948447 | 1.21 |
Zfp623 |
zinc finger protein 623 |
7375 |
0.08 |
chr7_41544388_41544539 | 1.21 |
Gm6871 |
predicted gene 6871 |
16332 |
0.11 |
chr12_18028327_18028478 | 1.21 |
Gm49328 |
predicted gene, 49328 |
4335 |
0.14 |
chr1_78198236_78199501 | 1.20 |
Pax3 |
paired box 3 |
1734 |
0.41 |
chr7_42706274_42706425 | 1.20 |
Gm17067 |
predicted gene 17067 |
20 |
0.97 |
chr5_138455954_138456178 | 1.19 |
Zfp157 |
zinc finger protein 157 |
14526 |
0.12 |
chr7_49908791_49909470 | 1.19 |
Slc6a5 |
solute carrier family 6 (neurotransmitter transporter, glycine), member 5 |
1016 |
0.64 |
chr6_40049213_40049717 | 1.16 |
Gm37995 |
predicted gene, 37995 |
22571 |
0.17 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.9 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.7 | 2.0 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.6 | 3.1 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.6 | 1.7 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.4 | 1.3 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
0.4 | 2.6 | GO:0071910 | determination of liver left/right asymmetry(GO:0071910) |
0.4 | 3.2 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.3 | 3.2 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.3 | 1.6 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.3 | 0.8 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.3 | 1.0 | GO:0030035 | microspike assembly(GO:0030035) |
0.2 | 0.5 | GO:0060594 | mammary gland specification(GO:0060594) |
0.2 | 0.2 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
0.2 | 1.0 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.2 | 1.1 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.2 | 0.6 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.2 | 0.6 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.2 | 0.6 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.2 | 0.6 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.2 | 0.6 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.2 | 0.8 | GO:0021778 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.2 | 2.3 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
0.2 | 3.0 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
0.2 | 1.1 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.2 | 0.6 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.2 | 0.7 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.2 | 0.9 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.2 | 2.6 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.2 | 0.7 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.2 | 1.5 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.2 | 1.1 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.2 | 0.6 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.2 | 0.5 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.1 | 0.7 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.1 | 0.6 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.1 | 1.3 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.1 | 0.7 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.1 | 2.0 | GO:0061157 | mRNA destabilization(GO:0061157) |
0.1 | 0.4 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.1 | 0.4 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.1 | 0.7 | GO:0036233 | glycine import(GO:0036233) |
0.1 | 0.7 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 0.4 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.1 | 0.4 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.1 | 3.6 | GO:0001964 | startle response(GO:0001964) |
0.1 | 0.5 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
0.1 | 0.5 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.1 | 0.4 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.3 | GO:0009732 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.1 | 0.5 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.1 | 0.2 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.1 | 1.5 | GO:0097320 | membrane tubulation(GO:0097320) |
0.1 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
0.1 | 0.3 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.1 | 0.7 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.1 | 0.1 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.1 | 0.2 | GO:0061054 | dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
0.1 | 0.5 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.1 | 0.3 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.1 | 0.8 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.1 | 0.3 | GO:0061511 | centriole elongation(GO:0061511) |
0.1 | 0.6 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.1 | 0.8 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.1 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.1 | 0.9 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.3 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.1 | 0.8 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.1 | 0.2 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.1 | 0.5 | GO:0043587 | tongue morphogenesis(GO:0043587) |
0.1 | 0.3 | GO:0051794 | regulation of catagen(GO:0051794) |
0.1 | 0.5 | GO:0015816 | glycine transport(GO:0015816) |
0.1 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 0.4 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.1 | 0.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.1 | 1.1 | GO:0007614 | short-term memory(GO:0007614) |
0.1 | 0.5 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.1 | 0.1 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.1 | 0.7 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.1 | 0.3 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.1 | 0.5 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
0.1 | 0.2 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.1 | 0.5 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.1 | 0.1 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.1 | 0.3 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.1 | 0.2 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) glossopharyngeal nerve morphogenesis(GO:0021615) |
0.1 | 0.5 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.1 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.1 | 0.2 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.1 | 0.3 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.1 | 0.2 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.1 | 0.2 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.1 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.1 | 2.9 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
0.1 | 1.4 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.1 | 0.8 | GO:2000400 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
0.1 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.1 | 0.2 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.1 | 0.3 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.1 | 0.4 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 0.5 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
0.1 | 0.1 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.1 | 0.3 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.1 | 0.5 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.1 | 0.3 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.1 | 0.1 | GO:0021978 | telencephalon regionalization(GO:0021978) |
0.1 | 1.6 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
0.1 | 1.0 | GO:2001273 | glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
0.1 | 0.1 | GO:0001806 | type IV hypersensitivity(GO:0001806) |
0.1 | 0.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.1 | 3.8 | GO:1900006 | positive regulation of dendrite development(GO:1900006) |
0.1 | 0.2 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.1 | 0.4 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.1 | 0.1 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.1 | 0.5 | GO:2001054 | negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
0.1 | 0.2 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.1 | 0.2 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
0.1 | 0.2 | GO:1904995 | negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
0.1 | 0.4 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.1 | GO:0006868 | glutamine transport(GO:0006868) |
0.1 | 2.0 | GO:0021766 | hippocampus development(GO:0021766) |
0.1 | 0.1 | GO:0014055 | acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) |
0.1 | 0.4 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.1 | 3.1 | GO:0021510 | spinal cord development(GO:0021510) |
0.1 | 0.1 | GO:0060676 | ureteric bud formation(GO:0060676) |
0.1 | 0.5 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
0.1 | 0.3 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.1 | 0.2 | GO:0043309 | regulation of eosinophil degranulation(GO:0043309) |
0.1 | 0.2 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.2 | GO:0045713 | low-density lipoprotein particle receptor biosynthetic process(GO:0045713) |
0.1 | 0.2 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.1 | 1.5 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
0.1 | 0.8 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 0.2 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.1 | 0.5 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.1 | 0.1 | GO:0060066 | oviduct development(GO:0060066) |
0.1 | 0.2 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.1 | 0.2 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.1 | 0.3 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.1 | 0.5 | GO:0010842 | retina layer formation(GO:0010842) |
0.1 | 0.9 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.0 | 0.2 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.0 | 0.1 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.0 | 0.6 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.1 | GO:2000054 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.1 | GO:0048840 | otolith development(GO:0048840) |
0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.0 | 0.2 | GO:0052428 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.0 | 0.2 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.1 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 0.1 | GO:0010159 | specification of organ position(GO:0010159) |
0.0 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.2 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.5 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.0 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.0 | 3.4 | GO:0014020 | primary neural tube formation(GO:0014020) |
0.0 | 0.4 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.0 | 0.1 | GO:1903998 | regulation of eating behavior(GO:1903998) |
0.0 | 0.4 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.0 | 0.1 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 1.0 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.0 | 0.0 | GO:0022028 | tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
0.0 | 0.5 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.0 | 0.2 | GO:0038031 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.0 | 0.1 | GO:1902287 | semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
0.0 | 0.0 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
0.0 | 0.1 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.0 | 0.1 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.0 | 0.1 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.0 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.0 | 1.3 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
0.0 | 0.1 | GO:0051140 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.0 | 0.3 | GO:0071625 | vocalization behavior(GO:0071625) |
0.0 | 2.7 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
0.0 | 0.3 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.0 | 0.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.1 | GO:0052330 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
0.0 | 0.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.1 | GO:2000543 | positive regulation of gastrulation(GO:2000543) |
0.0 | 0.2 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.0 | 0.1 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.0 | 0.2 | GO:0006354 | DNA-templated transcription, elongation(GO:0006354) |
0.0 | 0.1 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.0 | 0.3 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.5 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
0.0 | 0.3 | GO:0048484 | enteric nervous system development(GO:0048484) |
0.0 | 1.0 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
0.0 | 0.2 | GO:0022605 | oogenesis stage(GO:0022605) |
0.0 | 0.0 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.1 | GO:0060527 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
0.0 | 0.1 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.0 | 0.1 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.0 | 0.0 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.0 | 0.6 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
0.0 | 0.3 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
0.0 | 0.1 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
0.0 | 0.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.1 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
0.0 | 0.3 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 2.7 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 2.9 | GO:0060041 | retina development in camera-type eye(GO:0060041) |
0.0 | 0.1 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
0.0 | 0.1 | GO:1990123 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.0 | 0.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.0 | 0.3 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.2 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.0 | 0.2 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.0 | 0.0 | GO:0021898 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.0 | 0.1 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.0 | 0.4 | GO:0006465 | signal peptide processing(GO:0006465) |
0.0 | 0.5 | GO:1903963 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
0.0 | 0.1 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.0 | 0.1 | GO:0015867 | ATP transport(GO:0015867) |
0.0 | 0.1 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.0 | 0.1 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.0 | 0.8 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.0 | 0.5 | GO:0006825 | copper ion transport(GO:0006825) |
0.0 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.0 | 1.1 | GO:0002088 | lens development in camera-type eye(GO:0002088) |
0.0 | 0.4 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.0 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.0 | 0.1 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.0 | 0.2 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
0.0 | 0.3 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.0 | 0.1 | GO:0010288 | response to lead ion(GO:0010288) |
0.0 | 0.1 | GO:0032763 | regulation of mast cell cytokine production(GO:0032763) |
0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.0 | 0.1 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.0 | 0.3 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
0.0 | 0.1 | GO:0090103 | cochlea morphogenesis(GO:0090103) |
0.0 | 0.0 | GO:0071725 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.0 | 0.0 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.0 | 0.1 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.0 | 0.2 | GO:0003352 | regulation of cilium movement(GO:0003352) |
0.0 | 0.0 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.0 | 0.4 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.1 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.0 | GO:0061526 | acetylcholine secretion(GO:0061526) |
0.0 | 0.1 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.0 | 0.5 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
0.0 | 0.3 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) |
0.0 | 0.0 | GO:0006114 | glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
0.0 | 0.1 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.0 | 0.1 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.0 | 0.2 | GO:0048643 | positive regulation of skeletal muscle tissue development(GO:0048643) |
0.0 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
0.0 | 0.1 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.0 | 0.2 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
0.0 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
0.0 | 0.0 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) regulation of androgen receptor activity(GO:2000823) |
0.0 | 0.1 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.0 | 1.6 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.0 | 0.1 | GO:0060074 | synapse maturation(GO:0060074) |
0.0 | 0.1 | GO:0014738 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
0.0 | 0.7 | GO:0009250 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
0.0 | 0.0 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
0.0 | 0.0 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.1 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.0 | 0.1 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.0 | 0.0 | GO:2000211 | negative regulation of cellular amine metabolic process(GO:0033239) regulation of glutamate metabolic process(GO:2000211) |
0.0 | 0.2 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.0 | 0.3 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
0.0 | 0.0 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
0.0 | 0.0 | GO:0038027 | apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
0.0 | 0.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.0 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.0 | 0.0 | GO:0033686 | positive regulation of gonadotropin secretion(GO:0032278) positive regulation of luteinizing hormone secretion(GO:0033686) |
0.0 | 0.1 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.0 | 0.0 | GO:0014824 | artery smooth muscle contraction(GO:0014824) |
0.0 | 0.2 | GO:0071398 | cellular response to fatty acid(GO:0071398) |
0.0 | 0.1 | GO:0060037 | pharyngeal system development(GO:0060037) |
0.0 | 0.0 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.0 | 0.1 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
0.0 | 0.0 | GO:0044805 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.0 | 0.1 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.0 | 0.1 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.0 | 0.0 | GO:0075136 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.0 | 0.1 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.0 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.0 | 0.3 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.2 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.0 | 0.1 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.0 | 0.0 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
0.0 | 0.1 | GO:0060033 | anatomical structure regression(GO:0060033) |
0.0 | 0.2 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.0 | 0.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.0 | 0.0 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.1 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.0 | 0.3 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.1 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
0.0 | 0.2 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.0 | 0.0 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.0 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.1 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.0 | 0.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.0 | 0.0 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.0 | 0.0 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.0 | 0.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.1 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.0 | 0.1 | GO:0061623 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.0 | 0.1 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.0 | 0.1 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
0.0 | 0.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.0 | 0.0 | GO:0008050 | female courtship behavior(GO:0008050) |
0.0 | 0.1 | GO:0001956 | positive regulation of neurotransmitter secretion(GO:0001956) |
0.0 | 0.0 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.0 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.0 | 0.0 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
0.0 | 0.0 | GO:1904746 | negative regulation of apoptotic process involved in morphogenesis(GO:1902338) negative regulation of apoptotic process involved in development(GO:1904746) |
0.0 | 0.1 | GO:0098815 | modulation of excitatory postsynaptic potential(GO:0098815) |
0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.0 | 0.1 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.0 | 0.1 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.0 | 0.0 | GO:0071679 | commissural neuron axon guidance(GO:0071679) |
0.0 | 0.0 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.0 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.0 | 0.2 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.0 | 0.0 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.0 | 0.2 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
0.0 | 0.0 | GO:1903416 | response to glycoside(GO:1903416) |
0.0 | 0.2 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.0 | 0.1 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
0.0 | 0.0 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
0.0 | 0.2 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.0 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.0 | 0.0 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.0 | 0.0 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.0 | 0.9 | GO:0035914 | skeletal muscle cell differentiation(GO:0035914) |
0.0 | 0.0 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.1 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.0 | 0.2 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 0.0 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.0 | 0.0 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.0 | 0.1 | GO:0015671 | oxygen transport(GO:0015671) |
0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.2 | GO:1901663 | quinone biosynthetic process(GO:1901663) |
0.0 | 0.0 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.0 | 0.0 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
0.0 | 0.1 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.1 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.2 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.1 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.0 | 0.0 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.0 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.1 | GO:0006983 | ER overload response(GO:0006983) |
0.0 | 0.1 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.0 | 0.0 | GO:0001555 | oocyte growth(GO:0001555) |
0.0 | 0.0 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
0.0 | 0.1 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.1 | GO:0071321 | response to cGMP(GO:0070305) cellular response to cGMP(GO:0071321) |
0.0 | 0.2 | GO:0030262 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.0 | 0.1 | GO:2000105 | positive regulation of DNA-dependent DNA replication(GO:2000105) |
0.0 | 0.4 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.0 | 0.5 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
0.0 | 0.0 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.0 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.0 | 0.0 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.0 | 0.0 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.0 | 0.4 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.0 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.0 | 0.0 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.1 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
0.0 | 0.1 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.0 | 0.2 | GO:0043507 | positive regulation of JUN kinase activity(GO:0043507) |
0.0 | 0.1 | GO:0032328 | alanine transport(GO:0032328) |
0.0 | 0.2 | GO:0009409 | response to cold(GO:0009409) |
0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.0 | 0.0 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) positive regulation of hepatocyte differentiation(GO:0070368) |
0.0 | 0.0 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.0 | 0.1 | GO:0051904 | establishment of melanosome localization(GO:0032401) melanosome transport(GO:0032402) pigment granule transport(GO:0051904) establishment of pigment granule localization(GO:0051905) |
0.0 | 0.1 | GO:0030049 | muscle filament sliding(GO:0030049) |
0.0 | 0.0 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
0.0 | 0.0 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.1 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.0 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.0 | 0.1 | GO:0031269 | pseudopodium assembly(GO:0031269) |
0.0 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.2 | GO:2001222 | regulation of neuron migration(GO:2001222) |
0.0 | 0.3 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.0 | GO:0051712 | positive regulation of killing of cells of other organism(GO:0051712) |
0.0 | 0.0 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
0.0 | 0.1 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.1 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.0 | 0.0 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.0 | 0.2 | GO:0009395 | phospholipid catabolic process(GO:0009395) |
0.0 | 0.1 | GO:0046040 | IMP metabolic process(GO:0046040) |
0.0 | 0.1 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
0.0 | 0.0 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.0 | 0.1 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.0 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 0.1 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
0.0 | 0.1 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.0 | 0.0 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.8 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.0 | 0.0 | GO:0009750 | response to fructose(GO:0009750) |
0.0 | 0.1 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.0 | 0.1 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.0 | 0.1 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.0 | 0.1 | GO:0033151 | V(D)J recombination(GO:0033151) |
0.0 | 0.2 | GO:0046470 | phosphatidylcholine metabolic process(GO:0046470) |
0.0 | 0.0 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.0 | 0.3 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
0.0 | 0.0 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.0 | 0.0 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.0 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) negative regulation of dendritic cell differentiation(GO:2001199) |
0.0 | 0.4 | GO:0008543 | fibroblast growth factor receptor signaling pathway(GO:0008543) |
0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.2 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
0.0 | 0.0 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.1 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.0 | 0.1 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
0.0 | 0.0 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.0 | 0.0 | GO:0061083 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) negative regulation of protein folding(GO:1903333) |
0.0 | 0.0 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) |
0.0 | 0.1 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.0 | 0.0 | GO:2001023 | regulation of response to drug(GO:2001023) |
0.0 | 0.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.0 | GO:0009414 | response to water deprivation(GO:0009414) |
0.0 | 0.0 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.0 | 0.0 | GO:0021904 | dorsal/ventral neural tube patterning(GO:0021904) |
0.0 | 0.0 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
0.0 | 0.0 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.0 | 0.0 | GO:0019062 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
0.0 | 0.1 | GO:0008216 | spermidine metabolic process(GO:0008216) |
0.0 | 0.0 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.0 | 0.0 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.0 | 0.2 | GO:0030033 | microvillus assembly(GO:0030033) |
0.0 | 0.0 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.0 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.0 | 0.0 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.0 | 0.0 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.0 | 0.0 | GO:0060956 | endocardium formation(GO:0060214) endocardial cell differentiation(GO:0060956) |
0.0 | 0.0 | GO:0051126 | negative regulation of actin nucleation(GO:0051126) |
0.0 | 0.0 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.1 | GO:0043278 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
0.0 | 0.0 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.0 | 0.0 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.0 | 0.0 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.0 | 0.2 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 0.0 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.1 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.0 | 0.0 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.0 | 0.0 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.0 | 0.2 | GO:0030574 | collagen catabolic process(GO:0030574) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.3 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.4 | 1.7 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.4 | 3.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.3 | 1.0 | GO:0044393 | microspike(GO:0044393) |
0.3 | 2.0 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.3 | 1.3 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.2 | 1.1 | GO:0033503 | HULC complex(GO:0033503) |
0.1 | 0.7 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 1.9 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 0.8 | GO:0045180 | basal cortex(GO:0045180) |
0.1 | 0.7 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.1 | 0.5 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.1 | 0.3 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.4 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 0.4 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.1 | 2.8 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 0.8 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 0.2 | GO:0035838 | growing cell tip(GO:0035838) |
0.1 | 0.4 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.1 | 0.5 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.1 | 0.4 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.1 | 0.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.1 | 0.4 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 0.7 | GO:0061702 | inflammasome complex(GO:0061702) |
0.1 | 0.5 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.5 | GO:0044327 | dendritic spine head(GO:0044327) |
0.1 | 1.0 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.4 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.3 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.9 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 0.2 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.2 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.3 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.2 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 0.2 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 1.1 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.2 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.3 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.5 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.0 | 0.2 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.4 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.0 | 0.3 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 1.1 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
0.0 | 0.9 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.0 | 0.1 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.5 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.3 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.6 | GO:0043198 | dendritic shaft(GO:0043198) |
0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.1 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.0 | 0.2 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 2.7 | GO:0030426 | growth cone(GO:0030426) |
0.0 | 0.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.2 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.6 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.3 | GO:0008328 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.0 | 0.0 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.0 | GO:0032279 | asymmetric synapse(GO:0032279) neuron to neuron synapse(GO:0098984) |
0.0 | 0.0 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
0.0 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 3.0 | GO:0005802 | trans-Golgi network(GO:0005802) |
0.0 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.0 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.0 | GO:0030891 | VCB complex(GO:0030891) |
0.0 | 0.3 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 0.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 0.1 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.2 | GO:0044453 | nuclear membrane part(GO:0044453) |
0.0 | 0.1 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.0 | 0.1 | GO:0070695 | FHF complex(GO:0070695) |
0.0 | 0.1 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.1 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 1.1 | GO:0043195 | terminal bouton(GO:0043195) |
0.0 | 0.3 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.0 | 0.7 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 0.2 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.0 | 0.4 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.0 | 0.2 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 0.4 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.1 | GO:0097449 | astrocyte projection(GO:0097449) |
0.0 | 0.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 3.5 | GO:0045121 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
0.0 | 0.8 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.0 | 0.0 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.3 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 0.1 | GO:0033263 | CORVET complex(GO:0033263) |
0.0 | 0.1 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.3 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.1 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.0 | 0.1 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.0 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.0 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.1 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.0 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.1 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.0 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.6 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 0.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 3.0 | GO:0030425 | dendrite(GO:0030425) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.1 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.1 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.9 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.4 | 1.1 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.4 | 1.1 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.3 | 2.7 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.3 | 3.5 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.2 | 0.7 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.2 | 1.1 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.2 | 0.6 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.2 | 0.8 | GO:0042731 | PH domain binding(GO:0042731) |
0.2 | 0.7 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.2 | 3.0 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.2 | 0.9 | GO:0005499 | vitamin D binding(GO:0005499) |
0.1 | 0.4 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.1 | 0.6 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.1 | 0.8 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.1 | 3.3 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.1 | 0.7 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 0.9 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.1 | 0.4 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.1 | 1.9 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.1 | 0.6 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.5 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.1 | 0.3 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.1 | 0.3 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.1 | 0.7 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 0.3 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.1 | 0.3 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.1 | 0.4 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.1 | 1.3 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.1 | 0.7 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.1 | 0.4 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 0.4 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.1 | 0.4 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.1 | 0.6 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 0.5 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.1 | 3.7 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.1 | 0.4 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.1 | 0.3 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 1.0 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.2 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.1 | 0.8 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.1 | 0.4 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 0.3 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 0.4 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 0.6 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 0.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 0.2 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.1 | 1.7 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.1 | 1.0 | GO:0031402 | sodium ion binding(GO:0031402) |
0.1 | 1.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.2 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.1 | 0.9 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.1 | 0.1 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.1 | 0.3 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.1 | 1.1 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 0.3 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
0.1 | 0.5 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 29.9 | GO:0000977 | RNA polymerase II regulatory region sequence-specific DNA binding(GO:0000977) |
0.1 | 0.6 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
0.1 | 0.4 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.1 | 0.5 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.1 | 0.4 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.4 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.3 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.2 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.0 | 0.1 | GO:0000987 | core promoter proximal region sequence-specific DNA binding(GO:0000987) |
0.0 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.1 | GO:0001642 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.2 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.5 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 0.5 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.9 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.2 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.0 | 0.1 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.2 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.4 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 1.0 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.0 | 19.5 | GO:0001071 | nucleic acid binding transcription factor activity(GO:0001071) transcription factor activity, sequence-specific DNA binding(GO:0003700) |
0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 1.5 | GO:0042826 | histone deacetylase binding(GO:0042826) |
0.0 | 0.3 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.0 | 0.2 | GO:0034865 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.3 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.0 | 0.1 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.0 | 0.1 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.1 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.1 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.0 | 0.3 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.3 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.0 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 2.8 | GO:0044212 | transcription regulatory region DNA binding(GO:0044212) |
0.0 | 0.1 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.0 | 0.5 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.0 | GO:0019863 | IgE binding(GO:0019863) |
0.0 | 0.1 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.0 | 0.2 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.0 | 0.1 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.0 | 0.1 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.2 | GO:0034819 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 3.3 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
0.0 | 0.3 | GO:0015266 | protein channel activity(GO:0015266) |
0.0 | 0.2 | GO:0043771 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
0.0 | 0.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.0 | 0.1 | GO:0022884 | protein transmembrane transporter activity(GO:0008320) macromolecule transmembrane transporter activity(GO:0022884) |
0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.0 | 0.2 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 0.5 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
0.0 | 0.8 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.1 | GO:0002134 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.0 | 0.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.1 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.0 | 0.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.0 | 0.3 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.0 | 0.4 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 0.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.0 | 0.2 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.0 | 0.7 | GO:0016753 | dihydrolipoamide branched chain acyltransferase activity(GO:0004147) palmitoleoyl [acyl-carrier-protein]-dependent acyltransferase activity(GO:0008951) serine O-acyltransferase activity(GO:0016412) O-succinyltransferase activity(GO:0016750) sinapoyltransferase activity(GO:0016752) O-sinapoyltransferase activity(GO:0016753) peptidyl-lysine N6-myristoyltransferase activity(GO:0018030) peptidyl-lysine N6-palmitoyltransferase activity(GO:0018031) benzoyl acetate-CoA thiolase activity(GO:0018711) 3-hydroxybutyryl-CoA thiolase activity(GO:0018712) 3-ketopimelyl-CoA thiolase activity(GO:0018713) N-palmitoyltransferase activity(GO:0019105) acyl-CoA N-acyltransferase activity(GO:0019186) protein-cysteine S-myristoyltransferase activity(GO:0019705) glucosaminyl-phosphotidylinositol O-acyltransferase activity(GO:0032216) ergosterol O-acyltransferase activity(GO:0034737) lanosterol O-acyltransferase activity(GO:0034738) naphthyl-2-oxomethyl-succinyl-CoA succinyl transferase activity(GO:0034848) 2,4,4-trimethyl-3-oxopentanoyl-CoA 2-C-propanoyl transferase activity(GO:0034851) 2-methylhexanoyl-CoA C-acetyltransferase activity(GO:0034915) butyryl-CoA 2-C-propionyltransferase activity(GO:0034919) 2,6-dimethyl-5-methylene-3-oxo-heptanoyl-CoA C-acetyltransferase activity(GO:0034945) L-2-aminoadipate N-acetyltransferase activity(GO:0043741) keto acid formate lyase activity(GO:0043806) azetidine-2-carboxylic acid acetyltransferase activity(GO:0046941) peptidyl-lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0052858) acetyl-CoA:L-lysine N6-acetyltransferase(GO:0090595) |
0.0 | 0.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.1 | GO:0018586 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.0 | 0.1 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.1 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.3 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.1 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.5 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.3 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.0 | 0.1 | GO:0048156 | tau protein binding(GO:0048156) |
0.0 | 0.1 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.9 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.1 | GO:0030275 | LRR domain binding(GO:0030275) |
0.0 | 0.2 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.1 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.1 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.0 | 0.1 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.2 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.1 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.0 | 0.1 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.0 | 0.9 | GO:0043765 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.3 | GO:0030506 | ankyrin binding(GO:0030506) |
0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.0 | 0.8 | GO:0008527 | taste receptor activity(GO:0008527) |
0.0 | 0.1 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.0 | 0.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.0 | 0.1 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.0 | 0.2 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) poly(U) RNA binding(GO:0008266) |
0.0 | 0.8 | GO:0015297 | antiporter activity(GO:0015297) |
0.0 | 0.1 | GO:0097001 | ceramide binding(GO:0097001) |
0.0 | 0.3 | GO:0004532 | exoribonuclease activity(GO:0004532) |
0.0 | 0.2 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.0 | 0.1 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.0 | 0.1 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.0 | 0.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.1 | GO:0002046 | opsin binding(GO:0002046) |
0.0 | 0.0 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.0 | 0.2 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) RNA polymerase activity(GO:0034062) |
0.0 | 0.2 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.3 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.0 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.2 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.4 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.0 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.0 | 0.7 | GO:0035257 | nuclear hormone receptor binding(GO:0035257) |
0.0 | 0.1 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.0 | 0.1 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.0 | 0.8 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.0 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.0 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 1.5 | GO:0017124 | SH3 domain binding(GO:0017124) |
0.0 | 0.7 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
0.0 | 0.1 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.0 | 0.0 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.0 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.0 | 0.0 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.0 | 0.1 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.0 | 0.1 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.1 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.0 | 0.0 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.1 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.0 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.0 | 0.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.2 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 8.8 | GO:0003677 | DNA binding(GO:0003677) |
0.0 | 0.0 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.0 | 0.0 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.0 | 0.0 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 0.0 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.0 | 0.0 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.2 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.0 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.4 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.0 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.0 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 0.1 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.0 | 0.0 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.0 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.0 | 0.0 | GO:0038132 | neuregulin binding(GO:0038132) |
0.0 | 0.0 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.1 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.0 | 0.0 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.0 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 0.2 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.1 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.0 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.0 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.3 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.0 | 0.0 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.0 | 0.0 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.0 | 0.0 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.0 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.0 | 0.0 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.0 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.0 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.3 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.1 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
0.0 | 0.0 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.0 | 0.1 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 1.1 | GO:0005088 | Ras guanyl-nucleotide exchange factor activity(GO:0005088) |
0.0 | 0.0 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.0 | 0.1 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.0 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.0 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.0 | 0.1 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.0 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 1.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.1 | GO:1901682 | sulfur compound transmembrane transporter activity(GO:1901682) |
0.0 | 0.0 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.2 | GO:0005537 | mannose binding(GO:0005537) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 3.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.1 | 3.9 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.1 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.1 | 0.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.4 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.0 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.8 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.2 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 1.5 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.0 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.7 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 1.3 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.5 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 1.0 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.9 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.0 | 1.0 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 0.2 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.3 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.0 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.1 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.0 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 0.1 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.2 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.2 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.1 | PID EPO PATHWAY | EPO signaling pathway |
0.0 | 0.4 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.3 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.0 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.1 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.0 | PID IL12 2PATHWAY | IL12-mediated signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 3.5 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.1 | 2.8 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 2.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.1 | 0.2 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 0.2 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.1 | 0.7 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.1 | 1.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 0.8 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.1 | 0.9 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.1 | 0.6 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 0.5 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 0.7 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.4 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 0.5 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.6 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.4 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 0.0 | REACTOME SIGNALING BY ILS | Genes involved in Signaling by Interleukins |
0.0 | 0.6 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.6 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.6 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.4 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 0.6 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.0 | 1.3 | REACTOME CDK MEDIATED PHOSPHORYLATION AND REMOVAL OF CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
0.0 | 0.4 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.1 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.3 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.3 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.3 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.0 | 1.1 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.1 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.0 | 0.2 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 0.5 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.0 | 0.6 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.0 | 0.4 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.2 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 0.0 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 0.2 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.0 | 0.0 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.5 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.1 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.0 | 0.4 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 2.0 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.0 | 0.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.2 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 0.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 0.2 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.0 | 0.2 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
0.0 | 0.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.3 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.4 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.3 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.0 | 0.0 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
0.0 | 0.3 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.4 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.1 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.5 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.0 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
0.0 | 0.1 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.2 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.2 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
0.0 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.3 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.0 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.0 | 0.5 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 0.0 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 0.1 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.3 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.0 | 0.1 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.2 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.3 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |