Gene Symbol | Gene ID | Gene Info |
---|---|---|
Zic3
|
ENSMUSG00000067860.5 | Zic3 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Zic3 | chrX_58030083_58030980 | 112 | 0.977132 | 0.50 | 4.3e-05 | Click! |
Zic3 | chrX_58030987_58032527 | 747 | 0.743844 | 0.47 | 1.4e-04 | Click! |
Zic3 | chrX_58028680_58029480 | 1563 | 0.481654 | 0.42 | 7.7e-04 | Click! |
Zic3 | chrX_58029855_58030006 | 713 | 0.757501 | 0.42 | 9.2e-04 | Click! |
Zic3 | chrX_58027100_58027251 | 3468 | 0.309369 | 0.38 | 2.5e-03 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chrX_86191680_86192868 | 1.36 |
Nr0b1 |
nuclear receptor subfamily 0, group B, member 1 |
510 |
0.82 |
chr13_99446279_99447668 | 1.27 |
Map1b |
microtubule-associated protein 1B |
647 |
0.72 |
chr19_8838893_8839483 | 1.17 |
Gng3 |
guanine nucleotide binding protein (G protein), gamma 3 |
6 |
0.61 |
chr7_79504311_79505700 | 1.17 |
Mir9-3 |
microRNA 9-3 |
259 |
0.82 |
chr11_112784278_112785462 | 1.14 |
Sox9 |
SRY (sex determining region Y)-box 9 |
2646 |
0.24 |
chr7_79505833_79506958 | 1.07 |
Mir9-3 |
microRNA 9-3 |
1131 |
0.28 |
chr11_41999400_42000640 | 1.06 |
Gabrg2 |
gamma-aminobutyric acid (GABA) A receptor, subunit gamma 2 |
336 |
0.92 |
chr4_134017500_134018935 | 1.01 |
Gm13061 |
predicted gene 13061 |
70 |
0.63 |
chr12_29534253_29535510 | 0.96 |
Gm20208 |
predicted gene, 20208 |
10 |
0.8 |
chr11_69558887_69560206 | 0.95 |
Efnb3 |
ephrin B3 |
659 |
0.46 |
chr9_27154166_27155358 | 0.93 |
Jam3 |
junction adhesion molecule 3 |
631 |
0.73 |
chr17_47922305_47922943 | 0.92 |
Gm15556 |
predicted gene 15556 |
246 |
0.87 |
chr9_35423074_35423780 | 0.90 |
Cdon |
cell adhesion molecule-related/down-regulated by oncogenes |
161 |
0.95 |
chr14_98166607_98166990 | 0.90 |
Dach1 |
dachshund family transcription factor 1 |
2745 |
0.34 |
chr2_157561445_157562129 | 0.90 |
Gm23134 |
predicted gene, 23134 |
660 |
0.4 |
chr15_99704098_99705242 | 0.88 |
Gm34939 |
predicted gene, 34939 |
694 |
0.3 |
chr2_113828248_113829427 | 0.88 |
Scg5 |
secretogranin V |
75 |
0.97 |
chr13_83724722_83725570 | 0.88 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
2960 |
0.17 |
chr15_82255980_82257145 | 0.88 |
1500009C09Rik |
RIKEN cDNA 1500009C09 gene |
539 |
0.56 |
chr16_20629426_20630622 | 0.87 |
Ece2 |
endothelin converting enzyme 2 |
173 |
0.84 |
chr11_118908287_118909561 | 0.87 |
Rbfox3 |
RNA binding protein, fox-1 homolog (C. elegans) 3 |
626 |
0.73 |
chr10_106469534_106470969 | 0.86 |
Ppfia2 |
protein tyrosine phosphatase, receptor type, f polypeptide (PTPRF), interacting protein (liprin), alpha 2 |
88 |
0.97 |
chr5_103210548_103211780 | 0.84 |
Mapk10 |
mitogen-activated protein kinase 10 |
109 |
0.98 |
chr8_12385818_12386491 | 0.84 |
Sox1ot |
Sox1 overlapping transcript |
383 |
0.8 |
chr6_147475836_147476286 | 0.81 |
Gm6288 |
predicted gene 6288 |
15 |
0.54 |
chr2_152080491_152081480 | 0.80 |
Scrt2 |
scratch family zinc finger 2 |
544 |
0.7 |
chr18_77560987_77561705 | 0.80 |
Rnf165 |
ring finger protein 165 |
3263 |
0.29 |
chr1_129273098_129274282 | 0.80 |
Thsd7b |
thrombospondin, type I, domain containing 7B |
205 |
0.95 |
chr5_138275220_138276850 | 0.78 |
Gpc2 |
glypican 2 (cerebroglycan) |
2202 |
0.11 |
chr3_17787332_17788058 | 0.78 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
2226 |
0.29 |
chr12_49384961_49385944 | 0.78 |
Gm43517 |
predicted gene 43517 |
278 |
0.85 |
chr4_22486897_22487389 | 0.78 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
1223 |
0.42 |
chr4_154962435_154962707 | 0.78 |
Gm20421 |
predicted gene 20421 |
893 |
0.36 |
chr5_30712882_30713845 | 0.78 |
Dpysl5 |
dihydropyrimidinase-like 5 |
1462 |
0.33 |
chr5_120430812_120431653 | 0.77 |
Lhx5 |
LIM homeobox protein 5 |
467 |
0.48 |
chr12_49389746_49390677 | 0.76 |
3110039M20Rik |
RIKEN cDNA 3110039M20 gene |
448 |
0.75 |
chr11_87759834_87761999 | 0.75 |
Tspoap1 |
TSPO associated protein 1 |
329 |
0.75 |
chr2_180890379_180892235 | 0.75 |
Gm14342 |
predicted gene 14342 |
1647 |
0.19 |
chr7_79507974_79509311 | 0.74 |
A330074H02Rik |
RIKEN cDNA A330074H02 gene |
1720 |
0.18 |
chr15_76519928_76521866 | 0.74 |
Scrt1 |
scratch family zinc finger 1 |
1005 |
0.28 |
chr16_9994378_9995594 | 0.74 |
Grin2a |
glutamate receptor, ionotropic, NMDA2A (epsilon 1) |
63 |
0.98 |
chr11_32001099_32002296 | 0.74 |
Nsg2 |
neuron specific gene family member 2 |
1195 |
0.52 |
chr6_90781027_90782541 | 0.74 |
Iqsec1 |
IQ motif and Sec7 domain 1 |
188 |
0.94 |
chr4_63459368_63459716 | 0.74 |
Whrn |
whirlin |
1760 |
0.32 |
chr4_22487396_22488284 | 0.72 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
526 |
0.73 |
chr5_111427829_111429009 | 0.72 |
Gm43119 |
predicted gene 43119 |
4830 |
0.19 |
chr8_70119024_70120981 | 0.71 |
Ncan |
neurocan |
871 |
0.35 |
chr11_115958540_115958691 | 0.69 |
Sap30bpos |
SAP30 binding protein, opposite strand |
6510 |
0.1 |
chr11_108934976_108935464 | 0.69 |
Axin2 |
axin 2 |
3654 |
0.24 |
chr1_42711455_42712692 | 0.69 |
Pantr2 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 2 |
1381 |
0.34 |
chr5_121828742_121829564 | 0.69 |
Sh2b3 |
SH2B adaptor protein 3 |
412 |
0.73 |
chr15_8629446_8630315 | 0.68 |
Slc1a3 |
solute carrier family 1 (glial high affinity glutamate transporter), member 3 |
13367 |
0.19 |
chr10_81229656_81230911 | 0.68 |
Atcay |
ataxia, cerebellar, Cayman type |
502 |
0.53 |
chr2_49619321_49620607 | 0.68 |
Kif5c |
kinesin family member 5C |
666 |
0.78 |
chr7_78882466_78883900 | 0.68 |
Mir7-2 |
microRNA 7-2 |
5094 |
0.13 |
chr2_65566312_65566743 | 0.67 |
Scn3a |
sodium channel, voltage-gated, type III, alpha |
965 |
0.63 |
chr1_84694736_84695168 | 0.67 |
Mir5126 |
microRNA 5126 |
887 |
0.41 |
chr5_111418246_111419747 | 0.67 |
Mn1 |
meningioma 1 |
1554 |
0.34 |
chr13_97248475_97250229 | 0.67 |
Enc1 |
ectodermal-neural cortex 1 |
8247 |
0.17 |
chr4_103619552_103620735 | 0.66 |
Dab1 |
disabled 1 |
478 |
0.8 |
chr5_139557118_139557269 | 0.66 |
Uncx |
UNC homeobox |
13295 |
0.17 |
chr3_88206822_88208169 | 0.65 |
Gm3764 |
predicted gene 3764 |
183 |
0.86 |
chr9_91361494_91362853 | 0.65 |
Zic4 |
zinc finger protein of the cerebellum 4 |
240 |
0.8 |
chr13_36726546_36727935 | 0.64 |
Gm30177 |
predicted gene, 30177 |
18 |
0.97 |
chr14_96517868_96518996 | 0.64 |
Klhl1 |
kelch-like 1 |
670 |
0.78 |
chr8_93812106_93812875 | 0.64 |
Gnao1 |
guanine nucleotide binding protein, alpha O |
1177 |
0.35 |
chr6_112945034_112945954 | 0.64 |
Srgap3 |
SLIT-ROBO Rho GTPase activating protein 3 |
1260 |
0.31 |
chr13_42709652_42710400 | 0.64 |
Phactr1 |
phosphatase and actin regulator 1 |
445 |
0.88 |
chr19_59457691_59458368 | 0.64 |
Emx2 |
empty spiracles homeobox 2 |
343 |
0.66 |
chr13_98356794_98358725 | 0.64 |
Foxd1 |
forkhead box D1 |
3517 |
0.19 |
chr11_112783635_112784177 | 0.64 |
Sox9 |
SRY (sex determining region Y)-box 9 |
1682 |
0.31 |
chr14_12189998_12191323 | 0.64 |
Ptprg |
protein tyrosine phosphatase, receptor type, G |
717 |
0.71 |
chr3_62603065_62604257 | 0.63 |
Gpr149 |
G protein-coupled receptor 149 |
887 |
0.72 |
chr2_180889143_180889758 | 0.63 |
Gm14342 |
predicted gene 14342 |
210 |
0.87 |
chr17_25497321_25497627 | 0.63 |
Sstr5 |
somatostatin receptor 5 |
186 |
0.89 |
chr8_123413418_123414506 | 0.63 |
Tubb3 |
tubulin, beta 3 class III |
2372 |
0.11 |
chr8_94994139_94995207 | 0.62 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
77 |
0.95 |
chr5_19907724_19909563 | 0.62 |
Magi2 |
membrane associated guanylate kinase, WW and PDZ domain containing 2 |
682 |
0.82 |
chr11_22006485_22009037 | 0.62 |
Otx1 |
orthodenticle homeobox 1 |
4864 |
0.28 |
chr5_27048872_27050274 | 0.62 |
Dpp6 |
dipeptidylpeptidase 6 |
180 |
0.97 |
chr1_42697532_42698715 | 0.62 |
Pou3f3 |
POU domain, class 3, transcription factor 3 |
2355 |
0.2 |
chr4_124658606_124659175 | 0.62 |
Gm2164 |
predicted gene 2164 |
1721 |
0.21 |
chr5_112228060_112229152 | 0.62 |
Miat |
myocardial infarction associated transcript (non-protein coding) |
35 |
0.96 |
chr11_116919008_116919761 | 0.61 |
Mgat5b |
mannoside acetylglucosaminyltransferase 5, isoenzyme B |
521 |
0.75 |
chr5_115431565_115432258 | 0.61 |
Msi1 |
musashi RNA-binding protein 1 |
1306 |
0.22 |
chr4_42951254_42951979 | 0.60 |
Dnajb5 |
DnaJ heat shock protein family (Hsp40) member B5 |
1176 |
0.34 |
chr7_126822762_126823312 | 0.60 |
Fam57b |
family with sequence similarity 57, member B |
266 |
0.74 |
chr4_42670348_42671327 | 0.60 |
Il11ra2 |
interleukin 11 receptor, alpha chain 2 |
5074 |
0.14 |
chr11_120781042_120781786 | 0.60 |
Rfng |
RFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
2771 |
0.1 |
chr3_118433375_118434147 | 0.60 |
Gm26871 |
predicted gene, 26871 |
36 |
0.55 |
chr4_22497544_22499061 | 0.59 |
Gm30731 |
predicted gene, 30731 |
7754 |
0.16 |
chr8_114205602_114206260 | 0.59 |
Vat1l |
vesicle amine transport protein 1 like |
297 |
0.94 |
chr1_65311039_65312195 | 0.59 |
Pth2r |
parathyroid hormone 2 receptor |
360 |
0.89 |
chr11_104132159_104132471 | 0.59 |
Crhr1 |
corticotropin releasing hormone receptor 1 |
540 |
0.8 |
chr1_132192093_132192244 | 0.59 |
Gm29695 |
predicted gene, 29695 |
711 |
0.37 |
chr11_120272300_120272451 | 0.58 |
Gm47297 |
predicted gene, 47297 |
2112 |
0.18 |
chr9_122902673_122903816 | 0.58 |
Zkscan7 |
zinc finger with KRAB and SCAN domains 7 |
2 |
0.52 |
chr10_29143400_29144848 | 0.58 |
Soga3 |
SOGA family member 3 |
65 |
0.5 |
chr11_97451839_97451990 | 0.58 |
Arhgap23 |
Rho GTPase activating protein 23 |
216 |
0.92 |
chr10_81399790_81400870 | 0.58 |
Nfic |
nuclear factor I/C |
224 |
0.78 |
chr9_107593072_107593292 | 0.58 |
Ifrd2 |
interferon-related developmental regulator 2 |
555 |
0.37 |
chr11_3292958_3293238 | 0.58 |
Patz1 |
POZ (BTB) and AT hook containing zinc finger 1 |
230 |
0.88 |
chr2_35662845_35663372 | 0.58 |
Dab2ip |
disabled 2 interacting protein |
1489 |
0.47 |
chr10_49787984_49789251 | 0.58 |
Grik2 |
glutamate receptor, ionotropic, kainate 2 (beta 2) |
137 |
0.6 |
chr5_38318977_38320095 | 0.58 |
Drd5 |
dopamine receptor D5 |
169 |
0.91 |
chr14_66344363_66345813 | 0.57 |
Stmn4 |
stathmin-like 4 |
707 |
0.65 |
chr9_52188146_52188349 | 0.57 |
Zc3h12c |
zinc finger CCCH type containing 12C |
19675 |
0.2 |
chr6_77243534_77244121 | 0.57 |
Lrrtm1 |
leucine rich repeat transmembrane neuronal 1 |
905 |
0.69 |
chr8_89036575_89038609 | 0.57 |
Sall1 |
spalt like transcription factor 1 |
6570 |
0.23 |
chr17_35702700_35702891 | 0.56 |
Ddr1 |
discoidin domain receptor family, member 1 |
478 |
0.54 |
chr6_77978407_77979215 | 0.56 |
Ctnna2 |
catenin (cadherin associated protein), alpha 2 |
739 |
0.71 |
chr12_103314227_103315511 | 0.56 |
Fam181a |
family with sequence similarity 181, member A |
84 |
0.51 |
chr7_120504163_120504686 | 0.56 |
Gm9165 |
predicted gene 9165 |
234 |
0.92 |
chr19_44639795_44640874 | 0.56 |
Gm35460 |
predicted gene, 35460 |
25569 |
0.14 |
chr18_35831279_35831874 | 0.56 |
Gm29417 |
predicted gene 29417 |
483 |
0.61 |
chr3_156559836_156560180 | 0.56 |
4930570G19Rik |
RIKEN cDNA 4930570G19 gene |
1574 |
0.35 |
chr2_181715341_181715994 | 0.55 |
Oprl1 |
opioid receptor-like 1 |
35 |
0.95 |
chr11_59305420_59305715 | 0.55 |
Wnt9a |
wingless-type MMTV integration site family, member 9A |
1361 |
0.31 |
chr4_136834855_136835984 | 0.55 |
Ephb2 |
Eph receptor B2 |
424 |
0.84 |
chr2_116071729_116072658 | 0.55 |
2810405F15Rik |
RIKEN cDNA 2810405F15 gene |
3903 |
0.19 |
chr4_42173585_42174168 | 0.55 |
1700045I11Rik |
RIKEN cDNA 1700045I11 gene |
3031 |
0.11 |
chr5_111639366_111640356 | 0.55 |
Gm42489 |
predicted gene 42489 |
46245 |
0.13 |
chr1_42696247_42696979 | 0.55 |
Pou3f3 |
POU domain, class 3, transcription factor 3 |
845 |
0.43 |
chr15_82911159_82912454 | 0.55 |
Tcf20 |
transcription factor 20 |
301 |
0.87 |
chr1_20819294_20820247 | 0.54 |
Mcm3 |
minichromosome maintenance complex component 3 |
490 |
0.66 |
chr3_88222468_88223039 | 0.54 |
Gm3764 |
predicted gene 3764 |
89 |
0.92 |
chr3_7612569_7613686 | 0.54 |
Il7 |
interleukin 7 |
234 |
0.69 |
chr4_41694325_41694964 | 0.54 |
Cntfr |
ciliary neurotrophic factor receptor |
798 |
0.43 |
chr6_125161917_125163197 | 0.54 |
Gapdh |
glyceraldehyde-3-phosphate dehydrogenase |
30 |
0.93 |
chr2_18042311_18043883 | 0.54 |
Skida1 |
SKI/DACH domain containing 1 |
1475 |
0.25 |
chr5_111422795_111423499 | 0.54 |
Gm43119 |
predicted gene 43119 |
442 |
0.8 |
chr4_32982992_32983221 | 0.54 |
Rragd |
Ras-related GTP binding D |
49 |
0.96 |
chr11_97659601_97660315 | 0.54 |
Gm24158 |
predicted gene, 24158 |
369 |
0.45 |
chr10_42580702_42581378 | 0.54 |
Nr2e1 |
nuclear receptor subfamily 2, group E, member 1 |
266 |
0.91 |
chr5_120706498_120706989 | 0.54 |
Dtx1 |
deltex 1, E3 ubiquitin ligase |
854 |
0.44 |
chr5_33725265_33726907 | 0.53 |
Fgfr3 |
fibroblast growth factor receptor 3 |
2314 |
0.17 |
chr2_70561239_70561739 | 0.53 |
Gad1 |
glutamate decarboxylase 1 |
553 |
0.66 |
chr14_3948807_3949490 | 0.53 |
Gm3095 |
predicted gene 3095 |
14399 |
0.11 |
chr15_94403295_94404367 | 0.53 |
Adamts20 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 20 |
427 |
0.9 |
chr5_128602323_128602997 | 0.53 |
Fzd10 |
frizzled class receptor 10 |
1816 |
0.25 |
chr14_122463747_122464816 | 0.53 |
Zic5 |
zinc finger protein of the cerebellum 5 |
1396 |
0.29 |
chr4_126465012_126466992 | 0.53 |
Ago1 |
argonaute RISC catalytic subunit 1 |
2419 |
0.18 |
chr7_19301296_19302092 | 0.53 |
Gm26802 |
predicted gene, 26802 |
924 |
0.31 |
chr18_80985748_80986600 | 0.53 |
Sall3 |
spalt like transcription factor 3 |
362 |
0.76 |
chr15_87544354_87545329 | 0.53 |
Tafa5 |
TAFA chemokine like family member 5 |
542 |
0.87 |
chr1_34677886_34678995 | 0.53 |
Arhgef4 |
Rho guanine nucleotide exchange factor (GEF) 4 |
252 |
0.89 |
chr2_152081612_152083149 | 0.53 |
Scrt2 |
scratch family zinc finger 2 |
851 |
0.52 |
chr6_110645148_110646464 | 0.53 |
Gm20387 |
predicted gene 20387 |
110 |
0.67 |
chr1_6729327_6730832 | 0.53 |
St18 |
suppression of tumorigenicity 18 |
9 |
0.99 |
chr13_99443316_99444666 | 0.53 |
Map1b |
microtubule-associated protein 1B |
47 |
0.98 |
chr5_88887238_88887864 | 0.52 |
Slc4a4 |
solute carrier family 4 (anion exchanger), member 4 |
252 |
0.94 |
chr13_78182240_78182762 | 0.52 |
Gm38604 |
predicted gene, 38604 |
658 |
0.61 |
chr3_88458101_88459325 | 0.52 |
Sema4a |
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4A |
163 |
0.88 |
chr13_24604607_24605210 | 0.52 |
Gm11346 |
predicted gene 11346 |
17 |
0.98 |
chr5_110810144_110810295 | 0.52 |
Ulk1 |
unc-51 like kinase 1 |
122 |
0.94 |
chr19_6418703_6419936 | 0.52 |
Nrxn2 |
neurexin II |
554 |
0.44 |
chr1_172484027_172485046 | 0.52 |
Igsf9 |
immunoglobulin superfamily, member 9 |
2222 |
0.17 |
chr6_91720456_91720812 | 0.51 |
Slc6a6 |
solute carrier family 6 (neurotransmitter transporter, taurine), member 6 |
4325 |
0.15 |
chr13_81630063_81630959 | 0.51 |
Adgrv1 |
adhesion G protein-coupled receptor V1 |
2628 |
0.28 |
chr5_122048053_122048751 | 0.51 |
Gm15637 |
predicted gene 15637 |
20 |
0.9 |
chr8_94995272_94995731 | 0.51 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
160 |
0.93 |
chr13_51568504_51570156 | 0.51 |
Shc3 |
src homology 2 domain-containing transforming protein C3 |
89 |
0.98 |
chr2_143546820_143547517 | 0.51 |
Pcsk2os1 |
proprotein convertase subtilisin/kexin type 2, opposite strand 1 |
669 |
0.53 |
chr1_132541040_132543287 | 0.51 |
Cntn2 |
contactin 2 |
702 |
0.64 |
chrX_7187545_7188725 | 0.51 |
Clcn5 |
chloride channel, voltage-sensitive 5 |
538 |
0.71 |
chr16_13867665_13868465 | 0.51 |
Pdxdc1 |
pyridoxal-dependent decarboxylase domain containing 1 |
8082 |
0.14 |
chrX_99820772_99821586 | 0.51 |
Tmem28 |
transmembrane protein 28 |
158 |
0.97 |
chr15_73021529_73022598 | 0.51 |
Trappc9 |
trafficking protein particle complex 9 |
33747 |
0.18 |
chr6_6880959_6882181 | 0.51 |
Dlx5 |
distal-less homeobox 5 |
498 |
0.71 |
chr7_105787117_105787310 | 0.51 |
Dchs1 |
dachsous cadherin related 1 |
339 |
0.78 |
chr3_34377333_34377676 | 0.51 |
Gm38505 |
predicted gene, 38505 |
25792 |
0.17 |
chr1_172485277_172486996 | 0.51 |
Igsf9 |
immunoglobulin superfamily, member 9 |
3822 |
0.12 |
chr13_116302578_116304501 | 0.50 |
Isl1 |
ISL1 transcription factor, LIM/homeodomain |
188 |
0.96 |
chr2_32741082_32742388 | 0.50 |
Sh2d3c |
SH2 domain containing 3C |
243 |
0.72 |
chr13_54948877_54949361 | 0.50 |
Unc5a |
unc-5 netrin receptor A |
292 |
0.88 |
chr14_4649261_4650460 | 0.50 |
Gm3239 |
predicted gene 3239 |
14332 |
0.11 |
chr7_19345477_19345973 | 0.50 |
Ercc1 |
excision repair cross-complementing rodent repair deficiency, complementation group 1 |
565 |
0.48 |
chr4_148286849_148288201 | 0.50 |
Disp3 |
dispatched RND transporter family member 3 |
440 |
0.81 |
chr7_131966504_131967699 | 0.50 |
Gpr26 |
G protein-coupled receptor 26 |
641 |
0.75 |
chr2_146958423_146959712 | 0.50 |
Kiz |
kizuna centrosomal protein |
6184 |
0.26 |
chr5_92698277_92699272 | 0.50 |
Shroom3 |
shroom family member 3 |
15149 |
0.16 |
chr7_70347472_70349327 | 0.50 |
Gm44948 |
predicted gene 44948 |
703 |
0.54 |
chr8_12400578_12402091 | 0.50 |
Gm25239 |
predicted gene, 25239 |
4931 |
0.15 |
chr3_117574935_117575526 | 0.50 |
Plppr5 |
phospholipid phosphatase related 5 |
3 |
0.99 |
chr2_38340293_38341511 | 0.50 |
Lhx2 |
LIM homeobox protein 2 |
190 |
0.93 |
chr8_12396308_12397229 | 0.50 |
Gm25239 |
predicted gene, 25239 |
365 |
0.77 |
chr1_133906583_133907008 | 0.50 |
Optc |
opticin |
207 |
0.56 |
chr13_116309751_116310312 | 0.50 |
Isl1 |
ISL1 transcription factor, LIM/homeodomain |
342 |
0.9 |
chr14_52009953_52011160 | 0.50 |
Zfp219 |
zinc finger protein 219 |
19 |
0.94 |
chr11_94044930_94045437 | 0.50 |
Spag9 |
sperm associated antigen 9 |
818 |
0.6 |
chr9_106456260_106457377 | 0.50 |
Pcbp4 |
poly(rC) binding protein 4 |
721 |
0.42 |
chr3_88208231_88208654 | 0.50 |
Gm3764 |
predicted gene 3764 |
1030 |
0.28 |
chrX_58030987_58032527 | 0.50 |
Zic3 |
zinc finger protein of the cerebellum 3 |
747 |
0.74 |
chr7_18925442_18925859 | 0.49 |
Nova2 |
NOVA alternative splicing regulator 2 |
238 |
0.86 |
chr3_34641628_34643070 | 0.49 |
Gm42692 |
predicted gene 42692 |
915 |
0.41 |
chr11_108924512_108925408 | 0.49 |
Axin2 |
axin 2 |
1779 |
0.38 |
chr11_112782257_112783134 | 0.49 |
Sox9 |
SRY (sex determining region Y)-box 9 |
471 |
0.6 |
chrX_99142578_99143205 | 0.49 |
Efnb1 |
ephrin B1 |
4760 |
0.28 |
chr16_43505394_43505961 | 0.49 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
1980 |
0.41 |
chr4_136834052_136834430 | 0.49 |
Ephb2 |
Eph receptor B2 |
1602 |
0.38 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 2.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.5 | 2.9 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.5 | 1.5 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.5 | 4.3 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.5 | 1.4 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.5 | 1.4 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.4 | 1.2 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.4 | 1.2 | GO:0070384 | Harderian gland development(GO:0070384) |
0.4 | 1.2 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.4 | 1.5 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.3 | 1.0 | GO:0021586 | pons maturation(GO:0021586) |
0.3 | 1.0 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.3 | 1.0 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.3 | 0.7 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.3 | 1.0 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.3 | 1.0 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.3 | 1.3 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.3 | 1.6 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.3 | 0.3 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
0.3 | 1.8 | GO:0098598 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.3 | 1.5 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.3 | 0.9 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.3 | 1.5 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.3 | 0.3 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.3 | 1.7 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.3 | 0.9 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.3 | 0.3 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.3 | 1.1 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.3 | 0.5 | GO:0060166 | olfactory pit development(GO:0060166) |
0.3 | 1.1 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.3 | 0.5 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
0.3 | 0.5 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.3 | 1.3 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.3 | 1.8 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.2 | 1.2 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.2 | 1.2 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.2 | 0.7 | GO:0030070 | insulin processing(GO:0030070) |
0.2 | 0.5 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.2 | 1.6 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.2 | 0.7 | GO:0001546 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
0.2 | 0.7 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.2 | 0.5 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.2 | 0.7 | GO:0033058 | directional locomotion(GO:0033058) |
0.2 | 1.7 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.2 | 0.2 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.2 | 0.6 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.2 | 0.6 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.2 | 0.8 | GO:0030035 | microspike assembly(GO:0030035) |
0.2 | 0.4 | GO:0086017 | Purkinje myocyte action potential(GO:0086017) |
0.2 | 0.6 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.2 | 0.4 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.2 | 0.6 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.2 | 1.6 | GO:0021843 | substrate-independent telencephalic tangential migration(GO:0021826) interneuron migration from the subpallium to the cortex(GO:0021830) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
0.2 | 2.7 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) |
0.2 | 0.2 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.2 | 1.2 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.2 | 0.6 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
0.2 | 0.6 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.2 | 1.2 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.2 | 0.2 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
0.2 | 0.6 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.2 | 0.2 | GO:0022028 | tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
0.2 | 0.6 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.2 | 2.3 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.2 | 1.0 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.2 | 0.4 | GO:0060174 | limb bud formation(GO:0060174) |
0.2 | 1.5 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.2 | 1.0 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.2 | 0.8 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.2 | 0.6 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.2 | 0.6 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.2 | 1.8 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.2 | 0.9 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.2 | 1.3 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.2 | 0.5 | GO:1902805 | positive regulation of synaptic vesicle transport(GO:1902805) |
0.2 | 0.2 | GO:1904683 | regulation of metalloendopeptidase activity(GO:1904683) |
0.2 | 0.4 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
0.2 | 1.4 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.2 | 0.5 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.2 | 0.5 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.2 | 1.9 | GO:0047497 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.2 | 0.5 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.2 | 0.9 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
0.2 | 0.7 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.2 | 0.5 | GO:1901656 | glycoside transport(GO:1901656) |
0.2 | 0.5 | GO:0002568 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
0.2 | 0.3 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.2 | 0.2 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
0.2 | 0.5 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.2 | 0.2 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.2 | 0.6 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
0.2 | 0.3 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.2 | 0.8 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.2 | 0.3 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.2 | 1.2 | GO:0060179 | male mating behavior(GO:0060179) |
0.2 | 0.3 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.2 | 0.3 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.2 | 0.3 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.2 | 0.6 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.2 | 0.8 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.1 | 0.4 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.1 | 0.4 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.1 | 0.3 | GO:0007412 | axon target recognition(GO:0007412) |
0.1 | 2.5 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.1 | 0.7 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.1 | 0.1 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.1 | 0.4 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.1 | 0.9 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.1 | 0.1 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.1 | 0.6 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.1 | 1.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.1 | 0.4 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.1 | 0.3 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.1 | 0.1 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.1 | 0.3 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.1 | 0.8 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.6 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.1 | 0.3 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.1 | 0.3 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.7 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.1 | 0.3 | GO:0051795 | positive regulation of catagen(GO:0051795) |
0.1 | 0.4 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.1 | 0.1 | GO:1902913 | positive regulation of neuroepithelial cell differentiation(GO:1902913) |
0.1 | 0.7 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.4 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.1 | 0.5 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.1 | 0.8 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.1 | 0.4 | GO:0052203 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.1 | 0.4 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.1 | 0.4 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 0.3 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.1 | 0.1 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
0.1 | 0.4 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.1 | 1.1 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 0.1 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.1 | 0.4 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.1 | 0.4 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.1 | 0.6 | GO:0010996 | response to auditory stimulus(GO:0010996) |
0.1 | 0.6 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.1 | 0.4 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.1 | 0.4 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.1 | 0.4 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.1 | 0.6 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.1 | 0.4 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.4 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.1 | 0.6 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.1 | 0.4 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.1 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
0.1 | 0.5 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.1 | 3.8 | GO:0019228 | neuronal action potential(GO:0019228) |
0.1 | 0.6 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.1 | 0.3 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.1 | 0.5 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.1 | 1.5 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
0.1 | 0.2 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.1 | 0.7 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
0.1 | 0.3 | GO:0060685 | regulation of prostatic bud formation(GO:0060685) |
0.1 | 0.2 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.1 | 0.7 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.1 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.1 | 0.3 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.1 | 0.3 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 0.2 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
0.1 | 0.2 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.1 | 0.5 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.1 | 0.2 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.1 | 0.4 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.1 | 0.3 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.1 | 1.3 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
0.1 | 0.4 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.1 | 0.3 | GO:1904193 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.1 | 0.5 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.1 | 0.1 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.1 | 0.3 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.1 | 0.2 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.1 | 0.6 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.1 | 0.6 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.1 | 0.5 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.1 | GO:2000969 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.1 | 0.1 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.1 | 0.2 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.1 | 0.6 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
0.1 | 0.3 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.1 | 1.0 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.1 | 0.2 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.1 | 0.4 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.1 | 0.6 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.1 | 0.3 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.1 | 0.4 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.1 | 0.1 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.1 | 0.4 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
0.1 | 0.9 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.1 | 0.1 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.1 | 0.4 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.1 | 1.8 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.1 | 0.4 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
0.1 | 0.5 | GO:0090179 | planar cell polarity pathway involved in neural tube closure(GO:0090179) |
0.1 | 0.3 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.1 | 0.3 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.1 | 1.0 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.1 | 1.1 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.1 | 0.2 | GO:0035425 | autocrine signaling(GO:0035425) |
0.1 | 0.3 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.1 | 0.8 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.1 | 0.3 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.1 | 0.2 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.1 | 0.5 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.1 | 0.3 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.4 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.1 | 0.3 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.1 | 0.1 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.1 | 1.5 | GO:0001964 | startle response(GO:0001964) |
0.1 | 0.6 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.1 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.1 | 0.4 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.1 | 0.2 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.1 | 1.9 | GO:0035640 | exploration behavior(GO:0035640) |
0.1 | 0.3 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.1 | 0.3 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.1 | 0.5 | GO:0001975 | response to amphetamine(GO:0001975) |
0.1 | 0.3 | GO:0033122 | negative regulation of purine nucleotide catabolic process(GO:0033122) |
0.1 | 0.4 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.1 | 0.3 | GO:1903416 | response to glycoside(GO:1903416) |
0.1 | 2.2 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
0.1 | 0.1 | GO:0072553 | terminal button organization(GO:0072553) |
0.1 | 0.1 | GO:0090493 | catecholamine uptake(GO:0090493) dopamine uptake(GO:0090494) |
0.1 | 0.3 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.1 | 0.3 | GO:0060618 | nipple development(GO:0060618) |
0.1 | 0.4 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.1 | 0.2 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.1 | 0.2 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.1 | 0.2 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
0.1 | 0.3 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.1 | 0.3 | GO:0001927 | exocyst assembly(GO:0001927) |
0.1 | 0.3 | GO:0015744 | succinate transport(GO:0015744) |
0.1 | 0.1 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.1 | 0.4 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
0.1 | 0.3 | GO:0015755 | fructose transport(GO:0015755) |
0.1 | 0.2 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.1 | 0.1 | GO:0014894 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.1 | 0.2 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.1 | 0.5 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.1 | 0.3 | GO:0021636 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) |
0.1 | 0.8 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 0.3 | GO:0021756 | striatum development(GO:0021756) |
0.1 | 0.2 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.1 | 0.1 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.1 | 0.2 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.1 | 0.2 | GO:0097503 | sialylation(GO:0097503) |
0.1 | 0.2 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.1 | 0.2 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.1 | 0.1 | GO:0046101 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
0.1 | 0.2 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.1 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 0.2 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.1 | 0.2 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.1 | 0.3 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.1 | 0.6 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
0.1 | 0.9 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
0.1 | 0.2 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.1 | 0.2 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.1 | 0.2 | GO:0015747 | urate transport(GO:0015747) |
0.1 | 0.2 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.1 | 0.3 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.1 | 0.2 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.1 | 0.2 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.1 | 0.2 | GO:0038001 | paracrine signaling(GO:0038001) |
0.1 | 0.5 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.1 | 0.3 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.1 | 0.2 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
0.1 | 0.5 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
0.1 | 0.2 | GO:0006868 | glutamine transport(GO:0006868) |
0.1 | 0.2 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.1 | 0.2 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.1 | 0.4 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.1 | 0.4 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
0.1 | 0.4 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.1 | 1.3 | GO:0001539 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
0.1 | 0.2 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.1 | 0.2 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.1 | 0.4 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.1 | 1.7 | GO:0060359 | response to ammonium ion(GO:0060359) |
0.1 | 0.1 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.1 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.1 | 0.3 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.1 | 0.3 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.1 | 1.6 | GO:2001222 | regulation of neuron migration(GO:2001222) |
0.1 | 0.1 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 0.4 | GO:0015884 | folic acid transport(GO:0015884) |
0.1 | 0.1 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 0.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 0.4 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.1 | 0.1 | GO:0039663 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.1 | 0.9 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.1 | 0.1 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.1 | 2.2 | GO:0007019 | microtubule depolymerization(GO:0007019) |
0.1 | 0.1 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.1 | 0.6 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.1 | 0.1 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.1 | 0.4 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.1 | 0.1 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
0.1 | 0.2 | GO:0031049 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.1 | 0.5 | GO:0009650 | UV protection(GO:0009650) |
0.1 | 0.1 | GO:0032513 | regulation of protein phosphatase type 2B activity(GO:0032512) negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.1 | 0.4 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.1 | 0.1 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
0.1 | 0.5 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.1 | 0.2 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.1 | 0.3 | GO:0035989 | tendon development(GO:0035989) |
0.1 | 0.3 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.1 | 0.3 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.1 | 0.1 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.1 | 1.0 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.1 | 0.2 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.1 | 0.3 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.1 | 0.1 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.1 | 0.2 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.1 | 0.1 | GO:0055119 | relaxation of cardiac muscle(GO:0055119) |
0.1 | 0.1 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
0.1 | 0.1 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.1 | 0.3 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.1 | 0.3 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.1 | 0.1 | GO:0061083 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) negative regulation of protein folding(GO:1903333) |
0.1 | 0.6 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.1 | 0.2 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
0.1 | 0.1 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.1 | 1.3 | GO:0019226 | transmission of nerve impulse(GO:0019226) |
0.1 | 0.1 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
0.1 | 0.6 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.1 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.1 | 0.1 | GO:0060278 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
0.1 | 0.5 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.1 | 0.1 | GO:0010979 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
0.1 | 0.2 | GO:0071684 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.1 | 0.2 | GO:0048023 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.1 | 0.2 | GO:0032202 | telomere assembly(GO:0032202) |
0.1 | 0.1 | GO:1990144 | intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
0.1 | 0.2 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
0.1 | 0.1 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
0.1 | 0.1 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
0.1 | 0.1 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.1 | 0.1 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.1 | 0.1 | GO:0060029 | convergent extension involved in organogenesis(GO:0060029) |
0.1 | 0.2 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.1 | 0.1 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.1 | 0.5 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.2 | GO:0003139 | secondary heart field specification(GO:0003139) |
0.1 | 0.2 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
0.1 | 0.1 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.1 | 0.2 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.1 | 0.1 | GO:0070199 | establishment of protein localization to chromosome(GO:0070199) |
0.1 | 2.7 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 0.3 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
0.1 | 0.1 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.1 | 0.2 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.2 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.1 | 0.2 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 0.1 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.1 | 0.2 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.1 | 0.4 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.1 | 0.1 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.1 | 0.2 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.1 | 0.4 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.1 | 0.2 | GO:2001258 | negative regulation of cation channel activity(GO:2001258) |
0.1 | 4.1 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.1 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.2 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.1 | 0.2 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
0.1 | 0.1 | GO:0060139 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
0.1 | 0.2 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.1 | 0.2 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.1 | 0.3 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.1 | 0.1 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.1 | 0.2 | GO:0019042 | viral latency(GO:0019042) |
0.1 | 0.3 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.1 | 0.2 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
0.1 | 0.3 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.1 | 0.1 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
0.1 | 0.3 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.1 | 0.2 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.1 | 0.1 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.1 | 0.1 | GO:0097491 | cerebral cortex tangential migration using cell-axon interactions(GO:0021824) gonadotrophin-releasing hormone neuronal migration to the hypothalamus(GO:0021828) hypothalamic tangential migration using cell-axon interactions(GO:0021856) trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) facioacoustic ganglion development(GO:1903375) |
0.1 | 0.2 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
0.1 | 0.2 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.1 | 0.1 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.1 | 0.1 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
0.1 | 0.1 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.1 | 0.2 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.1 | 0.2 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.1 | 0.1 | GO:0021681 | cerebellar granular layer development(GO:0021681) |
0.1 | 0.8 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) |
0.1 | 0.6 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 0.1 | GO:0090381 | regulation of heart induction(GO:0090381) regulation of heart induction by canonical Wnt signaling pathway(GO:0100012) |
0.1 | 0.6 | GO:0047496 | vesicle transport along microtubule(GO:0047496) |
0.1 | 0.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 0.7 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.1 | 0.1 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
0.1 | 0.2 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.1 | 0.2 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.1 | 0.7 | GO:0051294 | establishment of spindle orientation(GO:0051294) |
0.1 | 0.5 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.1 | 0.4 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.1 | 0.4 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.1 | 0.1 | GO:0030421 | defecation(GO:0030421) |
0.1 | 0.3 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.1 | 0.3 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.1 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 0.1 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
0.1 | 0.2 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.1 | 0.2 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 0.2 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.0 | 0.1 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.1 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.0 | 0.4 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
0.0 | 0.2 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.0 | 0.1 | GO:1903998 | regulation of eating behavior(GO:1903998) |
0.0 | 0.1 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.0 | GO:0010511 | regulation of phosphatidylinositol biosynthetic process(GO:0010511) |
0.0 | 0.0 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
0.0 | 0.3 | GO:0007097 | nuclear migration(GO:0007097) |
0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.1 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.0 | 0.1 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.0 | 0.0 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.0 | 0.2 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 0.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.0 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.0 | 0.3 | GO:0015846 | polyamine transport(GO:0015846) |
0.0 | 0.3 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.4 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.1 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.0 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.4 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.0 | 0.2 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.0 | GO:0051464 | positive regulation of cortisol secretion(GO:0051464) positive regulation of glucocorticoid secretion(GO:2000851) |
0.0 | 0.2 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.0 | 0.1 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.0 | 0.1 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.0 | 0.2 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.1 | GO:0009177 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
0.0 | 0.1 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
0.0 | 0.0 | GO:0060027 | convergent extension involved in gastrulation(GO:0060027) |
0.0 | 0.1 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.0 | GO:0021794 | thalamus development(GO:0021794) |
0.0 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.0 | 0.1 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.0 | 0.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.5 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.1 | GO:0046606 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.0 | 0.0 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.0 | 0.3 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.0 | 0.7 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.6 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.0 | 0.3 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
0.0 | 0.3 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.0 | 0.1 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.0 | 0.1 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.0 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.0 | 0.1 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.0 | 0.3 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.2 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.2 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.0 | 0.6 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.0 | 0.3 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
0.0 | 0.2 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.0 | 0.1 | GO:0042713 | sperm ejaculation(GO:0042713) |
0.0 | 0.1 | GO:0033278 | cell proliferation in midbrain(GO:0033278) |
0.0 | 0.1 | GO:0009182 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.0 | 0.2 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.0 | 0.2 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.2 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.3 | GO:0045916 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
0.0 | 0.0 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.0 | 0.2 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.0 | 0.0 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.0 | 0.1 | GO:0002254 | kinin cascade(GO:0002254) |
0.0 | 0.2 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.0 | 0.1 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.0 | 0.1 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.0 | GO:0086012 | membrane depolarization during cardiac muscle cell action potential(GO:0086012) |
0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 0.1 | GO:0030432 | peristalsis(GO:0030432) |
0.0 | 0.2 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
0.0 | 0.2 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.0 | 0.1 | GO:1904504 | lipophagy(GO:0061724) regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.0 | 0.3 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.0 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.1 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.0 | 0.4 | GO:0002176 | male germ cell proliferation(GO:0002176) |
0.0 | 0.2 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
0.0 | 0.0 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.1 | GO:0071865 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
0.0 | 0.0 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.4 | GO:0021766 | hippocampus development(GO:0021766) |
0.0 | 0.1 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.0 | 0.1 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
0.0 | 0.2 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.0 | 0.3 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
0.0 | 0.4 | GO:0009209 | pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) |
0.0 | 0.3 | GO:1904321 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.0 | 0.2 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.0 | 2.1 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.1 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.0 | 0.1 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.0 | 0.0 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.0 | 0.1 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.0 | 0.1 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.1 | GO:0034443 | regulation of lipoprotein oxidation(GO:0034442) negative regulation of lipoprotein oxidation(GO:0034443) |
0.0 | 0.1 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.2 | GO:0046836 | glycolipid transport(GO:0046836) |
0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.1 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.0 | 0.0 | GO:0090383 | phagosome acidification(GO:0090383) |
0.0 | 0.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.0 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.0 | 0.1 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.0 | 0.1 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.0 | 0.3 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.2 | GO:1903817 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.5 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.0 | 0.1 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.0 | 0.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.0 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.0 | 0.4 | GO:0048011 | neurotrophin TRK receptor signaling pathway(GO:0048011) |
0.0 | 0.3 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.0 | 0.0 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.0 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.2 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.0 | 0.3 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.0 | 0.1 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.0 | 0.3 | GO:0060384 | innervation(GO:0060384) |
0.0 | 0.2 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.3 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.1 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.0 | 0.1 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
0.0 | 0.1 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.1 | GO:0070092 | glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
0.0 | 0.3 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.0 | 0.2 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.3 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.2 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.0 | 0.2 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.0 | 0.0 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.0 | 0.9 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.7 | GO:0060612 | adipose tissue development(GO:0060612) |
0.0 | 0.1 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
0.0 | 0.7 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.0 | 0.3 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.0 | 0.2 | GO:0008088 | axo-dendritic transport(GO:0008088) |
0.0 | 0.2 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.0 | 0.3 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.0 | 0.2 | GO:0071539 | protein localization to centrosome(GO:0071539) |
0.0 | 0.2 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
0.0 | 0.7 | GO:1901099 | negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
0.0 | 0.1 | GO:0031000 | response to caffeine(GO:0031000) |
0.0 | 0.1 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.0 | 0.1 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.0 | 0.1 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.0 | 0.2 | GO:0032594 | protein transport within lipid bilayer(GO:0032594) |
0.0 | 0.4 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.0 | 0.1 | GO:0046102 | inosine metabolic process(GO:0046102) inosine biosynthetic process(GO:0046103) |
0.0 | 0.3 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.0 | 0.1 | GO:0033504 | floor plate development(GO:0033504) |
0.0 | 0.0 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.0 | 0.1 | GO:0071042 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
0.0 | 0.0 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.0 | 0.6 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
0.0 | 0.0 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.0 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.2 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.1 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.0 | 0.2 | GO:0015874 | norepinephrine transport(GO:0015874) |
0.0 | 0.1 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
0.0 | 0.3 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.0 | 0.1 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.0 | 0.1 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
0.0 | 0.7 | GO:0010107 | potassium ion import(GO:0010107) |
0.0 | 0.0 | GO:0032230 | positive regulation of synaptic transmission, GABAergic(GO:0032230) |
0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.8 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.0 | 0.2 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.2 | GO:0018377 | protein myristoylation(GO:0018377) |
0.0 | 0.1 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.0 | 0.2 | GO:0043084 | penile erection(GO:0043084) |
0.0 | 0.4 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.2 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.0 | 0.0 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.1 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.6 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.0 | 0.9 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.0 | GO:0046909 | intermembrane transport(GO:0046909) |
0.0 | 0.2 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.0 | 0.2 | GO:0051256 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.0 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.0 | 0.1 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.0 | 0.1 | GO:0019243 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.2 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.8 | GO:0035249 | synaptic transmission, glutamatergic(GO:0035249) |
0.0 | 0.0 | GO:0051126 | negative regulation of actin nucleation(GO:0051126) |
0.0 | 0.1 | GO:0007525 | somatic muscle development(GO:0007525) |
0.0 | 0.1 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.0 | 0.2 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.0 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.0 | 0.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.1 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
0.0 | 0.3 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.0 | 0.0 | GO:1990035 | calcium ion import into cell(GO:1990035) |
0.0 | 0.0 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.0 | 0.0 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.0 | 0.3 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
0.0 | 0.0 | GO:0051231 | spindle elongation(GO:0051231) |
0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.1 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
0.0 | 0.3 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
0.0 | 0.1 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.1 | GO:0044803 | multi-organism membrane organization(GO:0044803) |
0.0 | 0.4 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.1 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.0 | 0.1 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.0 | 0.1 | GO:0040031 | snRNA modification(GO:0040031) |
0.0 | 0.0 | GO:0071504 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.0 | 0.7 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.0 | 0.1 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 0.0 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.0 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.0 | 0.0 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
0.0 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.2 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.0 | 0.1 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.1 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.0 | 0.1 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.0 | 0.5 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.5 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.2 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.3 | GO:0014002 | astrocyte development(GO:0014002) |
0.0 | 0.1 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.0 | 0.1 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.0 | 0.0 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.0 | 0.1 | GO:0021895 | cerebral cortex neuron differentiation(GO:0021895) |
0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.2 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.2 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.0 | 0.2 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.0 | 0.3 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.0 | 0.1 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.0 | 0.0 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.0 | 0.5 | GO:0007193 | adenylate cyclase-inhibiting G-protein coupled receptor signaling pathway(GO:0007193) |
0.0 | 0.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.0 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.4 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.2 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.0 | 0.0 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.0 | 0.1 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
0.0 | 0.0 | GO:0002158 | osteoclast proliferation(GO:0002158) |
0.0 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.0 | 0.1 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
0.0 | 0.0 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.0 | 0.0 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.0 | 0.0 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
0.0 | 0.5 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.0 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
0.0 | 0.5 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.0 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.0 | 0.0 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.0 | 0.0 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.0 | 0.0 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
0.0 | 0.1 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.0 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.0 | 0.0 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.0 | 0.0 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.0 | 0.1 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
0.0 | 0.3 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.1 | GO:0006388 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 0.0 | GO:0090671 | RNA localization to Cajal body(GO:0090670) telomerase RNA localization to Cajal body(GO:0090671) telomerase RNA localization(GO:0090672) |
0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.0 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.0 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.0 | 0.3 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.0 | 0.0 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.0 | 0.1 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.0 | 0.0 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.0 | 0.0 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.0 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.0 | 0.1 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.0 | 0.1 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) |
0.0 | 0.2 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.0 | 0.0 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.0 | 0.9 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.0 | GO:0010288 | response to lead ion(GO:0010288) |
0.0 | 0.1 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.0 | 0.1 | GO:0070417 | cellular response to cold(GO:0070417) |
0.0 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.0 | 0.0 | GO:0051176 | positive regulation of sulfur metabolic process(GO:0051176) |
0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.3 | GO:0061098 | positive regulation of protein tyrosine kinase activity(GO:0061098) |
0.0 | 0.0 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.0 | 0.2 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
0.0 | 0.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.0 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.0 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.0 | 0.0 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.0 | 0.1 | GO:0009134 | nucleoside diphosphate catabolic process(GO:0009134) |
0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.2 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
0.0 | 0.7 | GO:0051297 | centrosome organization(GO:0051297) |
0.0 | 0.0 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.0 | 0.4 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
0.0 | 0.1 | GO:0007614 | short-term memory(GO:0007614) |
0.0 | 0.2 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.0 | 0.3 | GO:0009268 | response to pH(GO:0009268) |
0.0 | 0.7 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.0 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.1 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.0 | 0.0 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
0.0 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.1 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.2 | GO:0035082 | axoneme assembly(GO:0035082) |
0.0 | 0.0 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.0 | 0.3 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.0 | 0.1 | GO:0009071 | serine family amino acid catabolic process(GO:0009071) |
0.0 | 0.3 | GO:0008542 | visual learning(GO:0008542) |
0.0 | 0.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.0 | 0.2 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.0 | 0.0 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.1 | GO:0097369 | sodium ion import(GO:0097369) |
0.0 | 0.2 | GO:0046174 | polyol catabolic process(GO:0046174) |
0.0 | 0.2 | GO:0042417 | dopamine metabolic process(GO:0042417) |
0.0 | 0.1 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.0 | 0.1 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
0.0 | 0.5 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.0 | 0.1 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.1 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.0 | 0.2 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.0 | 0.0 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.0 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.0 | 0.0 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
0.0 | 0.0 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.0 | 0.3 | GO:0097480 | synaptic vesicle transport(GO:0048489) establishment of synaptic vesicle localization(GO:0097480) |
0.0 | 0.1 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
0.0 | 0.0 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
0.0 | 0.0 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.0 | 0.1 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.0 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.0 | 0.0 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.0 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.0 | 0.3 | GO:0051985 | negative regulation of chromosome segregation(GO:0051985) |
0.0 | 0.0 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.0 | 0.1 | GO:1903514 | release of sequestered calcium ion into cytosol by sarcoplasmic reticulum(GO:0014808) calcium ion transport from endoplasmic reticulum to cytosol(GO:1903514) |
0.0 | 0.0 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.0 | 0.0 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.0 | 0.1 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.0 | 0.1 | GO:0071731 | response to nitric oxide(GO:0071731) |
0.0 | 0.1 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.0 | 0.0 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.0 | 0.1 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.1 | GO:0006400 | tRNA modification(GO:0006400) |
0.0 | 0.1 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.0 | 0.1 | GO:0006265 | DNA topological change(GO:0006265) |
0.0 | 0.0 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.0 | 0.0 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.0 | 0.0 | GO:0042321 | negative regulation of circadian sleep/wake cycle, sleep(GO:0042321) |
0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.4 | GO:1901998 | toxin transport(GO:1901998) |
0.0 | 0.4 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.1 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) |
0.0 | 0.2 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.0 | 0.0 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.0 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.0 | 0.2 | GO:0001578 | microtubule bundle formation(GO:0001578) |
0.0 | 0.0 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.0 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.0 | 0.0 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.0 | 0.0 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.0 | 0.2 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
0.0 | 0.3 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
0.0 | 0.1 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.0 | 0.0 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.0 | GO:0043380 | memory T cell differentiation(GO:0043379) regulation of memory T cell differentiation(GO:0043380) |
0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.0 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.0 | 0.1 | GO:0007603 | phototransduction, visible light(GO:0007603) |
0.0 | 0.0 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
0.0 | 0.0 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
0.0 | 0.1 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.0 | 0.2 | GO:0042255 | ribosome assembly(GO:0042255) |
0.0 | 0.0 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.0 | 0.0 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.0 | 0.0 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
0.0 | 0.4 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.0 | 0.0 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.0 | 0.1 | GO:0036120 | cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.0 | 0.0 | GO:0051140 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.0 | 0.1 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.0 | 0.1 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.0 | 0.0 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.0 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.0 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.0 | 0.1 | GO:0045056 | transcytosis(GO:0045056) |
0.0 | 0.8 | GO:0006457 | protein folding(GO:0006457) |
0.0 | 0.0 | GO:0097050 | type B pancreatic cell apoptotic process(GO:0097050) |
0.0 | 0.1 | GO:0010388 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.0 | 0.4 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.3 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.0 | 0.5 | GO:0008033 | tRNA processing(GO:0008033) |
0.0 | 0.1 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
0.0 | 0.0 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.0 | 0.0 | GO:0042320 | regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) circadian sleep/wake cycle, REM sleep(GO:0042747) |
0.0 | 0.0 | GO:0048024 | regulation of mRNA splicing, via spliceosome(GO:0048024) |
0.0 | 0.2 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.0 | 0.1 | GO:0042745 | circadian sleep/wake cycle(GO:0042745) |
0.0 | 0.0 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) |
0.0 | 0.1 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.0 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.0 | 0.0 | GO:0009162 | nucleoside monophosphate catabolic process(GO:0009125) deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
0.0 | 0.0 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.0 | 0.1 | GO:0018101 | protein citrullination(GO:0018101) |
0.0 | 0.1 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.0 | 0.1 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.0 | 0.0 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.1 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.0 | 0.1 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
0.0 | 0.1 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.0 | 0.0 | GO:0021884 | forebrain neuron development(GO:0021884) |
0.0 | 0.1 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.0 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.0 | 0.1 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.0 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.0 | 0.2 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.0 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.6 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.0 | 0.1 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.1 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.0 | 0.1 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.0 | 0.0 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.1 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.0 | 0.0 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
0.0 | 0.0 | GO:0038109 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.0 | 0.0 | GO:0002339 | B cell selection(GO:0002339) |
0.0 | 0.0 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
0.0 | 0.1 | GO:0002063 | chondrocyte development(GO:0002063) |
0.0 | 0.0 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.0 | 0.1 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.0 | 0.2 | GO:0032456 | endocytic recycling(GO:0032456) |
0.0 | 0.1 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.0 | 0.0 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.0 | 0.0 | GO:0043574 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
0.0 | 0.0 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
0.0 | 0.0 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 0.0 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
0.0 | 0.0 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
0.0 | 0.1 | GO:0019985 | translesion synthesis(GO:0019985) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.0 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.3 | 1.1 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.2 | 1.2 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.2 | 0.9 | GO:1990696 | USH2 complex(GO:1990696) |
0.2 | 0.8 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.2 | 0.6 | GO:0044393 | microspike(GO:0044393) |
0.2 | 0.6 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.2 | 1.6 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.2 | 0.6 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.2 | 0.7 | GO:0097452 | GAIT complex(GO:0097452) |
0.2 | 3.4 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.2 | 0.5 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.2 | 0.7 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.2 | 0.5 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.2 | 0.5 | GO:0097427 | microtubule bundle(GO:0097427) |
0.2 | 0.5 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.2 | 1.9 | GO:0043194 | axon initial segment(GO:0043194) |
0.2 | 2.2 | GO:0043196 | varicosity(GO:0043196) |
0.2 | 0.2 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.2 | 0.6 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.2 | 0.6 | GO:0071817 | MMXD complex(GO:0071817) |
0.2 | 2.0 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 0.6 | GO:0033010 | paranodal junction(GO:0033010) |
0.1 | 0.4 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.1 | 1.0 | GO:0033268 | node of Ranvier(GO:0033268) |
0.1 | 1.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 6.3 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.1 | 0.3 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.1 | 0.4 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.1 | 0.4 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 0.4 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.1 | 0.9 | GO:0032584 | growth cone membrane(GO:0032584) |
0.1 | 0.4 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 0.2 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 0.4 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.5 | GO:0042583 | chromaffin granule(GO:0042583) |
0.1 | 1.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.2 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 0.4 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 0.5 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 0.3 | GO:1990635 | proximal dendrite(GO:1990635) |
0.1 | 0.5 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.1 | 1.0 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 0.3 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.6 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 2.1 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.1 | 0.5 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.1 | 0.4 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 0.6 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 0.5 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.1 | 0.4 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 1.5 | GO:0031527 | filopodium membrane(GO:0031527) |
0.1 | 2.0 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.1 | 4.1 | GO:0043198 | dendritic shaft(GO:0043198) |
0.1 | 0.3 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 1.3 | GO:0071565 | nBAF complex(GO:0071565) |
0.1 | 0.3 | GO:0097470 | ribbon synapse(GO:0097470) |
0.1 | 0.4 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.2 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.3 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 0.3 | GO:0031417 | NatC complex(GO:0031417) |
0.1 | 0.4 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 0.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 0.2 | GO:0034706 | sodium channel complex(GO:0034706) |
0.1 | 1.5 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.1 | 1.0 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.1 | 0.3 | GO:0000938 | GARP complex(GO:0000938) |
0.1 | 2.1 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 0.2 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.1 | 0.2 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.1 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
0.1 | 0.8 | GO:0042555 | MCM complex(GO:0042555) |
0.1 | 4.1 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.1 | 0.2 | GO:0044327 | dendritic spine head(GO:0044327) |
0.1 | 0.2 | GO:0036396 | MIS complex(GO:0036396) |
0.1 | 1.9 | GO:0044298 | cell body membrane(GO:0044298) |
0.1 | 0.4 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.2 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.1 | 0.4 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.1 | 0.7 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.1 | 0.6 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.1 | 0.3 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 0.2 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.1 | 0.9 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.1 | 0.2 | GO:0035061 | interchromatin granule(GO:0035061) |
0.1 | 0.2 | GO:0016939 | kinesin II complex(GO:0016939) |
0.1 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 0.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 1.5 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.1 | 0.2 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 0.3 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.1 | 0.3 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.1 | 0.2 | GO:0072534 | perineuronal net(GO:0072534) |
0.1 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.2 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 0.3 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
0.1 | 0.2 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 0.8 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.1 | 0.4 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 0.2 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.1 | 0.3 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 0.3 | GO:0033503 | HULC complex(GO:0033503) |
0.1 | 0.3 | GO:0016012 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
0.1 | 0.6 | GO:0031512 | motile primary cilium(GO:0031512) |
0.1 | 0.4 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.2 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 0.5 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 0.3 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.5 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 0.7 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 0.4 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 0.2 | GO:0005745 | m-AAA complex(GO:0005745) |
0.1 | 0.6 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.1 | 0.2 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.1 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.3 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.0 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.0 | 3.9 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.2 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.0 | 3.6 | GO:0043679 | axon terminus(GO:0043679) |
0.0 | 0.6 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.0 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 0.1 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.0 | 6.4 | GO:0097060 | synaptic membrane(GO:0097060) |
0.0 | 0.4 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 0.4 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 1.0 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.2 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.2 | GO:0000235 | astral microtubule(GO:0000235) |
0.0 | 0.5 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.1 | GO:0005688 | U6 snRNP(GO:0005688) |
0.0 | 0.3 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.2 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.0 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.0 | 0.7 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.4 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.0 | 0.1 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.0 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.0 | GO:0035838 | growing cell tip(GO:0035838) |
0.0 | 0.2 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.2 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.3 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.3 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 1.2 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.7 | GO:0045120 | pronucleus(GO:0045120) |
0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.1 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 0.5 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.2 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
0.0 | 0.2 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.5 | GO:0034704 | calcium channel complex(GO:0034704) |
0.0 | 0.1 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.0 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.0 | 0.5 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.0 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.0 | 0.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.0 | 0.9 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.5 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.6 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.3 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.3 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.0 | 0.0 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.8 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.0 | 0.2 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 1.5 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.2 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.6 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.3 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 1.8 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.1 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.0 | 0.1 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.0 | 0.3 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.0 | 0.6 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 0.4 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.1 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.0 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.0 | 1.0 | GO:0015934 | large ribosomal subunit(GO:0015934) |
0.0 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.1 | GO:0071439 | clathrin complex(GO:0071439) |
0.0 | 0.1 | GO:0044447 | axoneme part(GO:0044447) |
0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.0 | 0.1 | GO:0005767 | secondary lysosome(GO:0005767) |
0.0 | 1.0 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
0.0 | 0.3 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.0 | 0.5 | GO:0030286 | dynein complex(GO:0030286) |
0.0 | 0.2 | GO:0030673 | axolemma(GO:0030673) |
0.0 | 0.7 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.2 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.1 | GO:0045495 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.0 | 0.3 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.0 | 0.0 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.2 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.3 | GO:0005652 | nuclear lamina(GO:0005652) |
0.0 | 0.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.0 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.0 | GO:0034705 | potassium channel complex(GO:0034705) |
0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 1.1 | GO:0070469 | respiratory chain(GO:0070469) |
0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.2 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 6.0 | GO:0045202 | synapse(GO:0045202) |
0.0 | 1.2 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.2 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
0.0 | 0.2 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.0 | 0.3 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.3 | GO:0043073 | male germ cell nucleus(GO:0001673) germ cell nucleus(GO:0043073) |
0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.3 | GO:0030894 | replisome(GO:0030894) |
0.0 | 0.1 | GO:0000802 | transverse filament(GO:0000802) |
0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.4 | GO:0030175 | filopodium(GO:0030175) |
0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.0 | GO:0000974 | Prp19 complex(GO:0000974) |
0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.0 | GO:0070069 | cytochrome complex(GO:0070069) |
0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.0 | 0.1 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.0 | 0.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 0.2 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.1 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.3 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.0 | 0.1 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 0.4 | GO:0005657 | replication fork(GO:0005657) |
0.0 | 1.0 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.1 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.0 | 0.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.0 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.2 | GO:0030914 | STAGA complex(GO:0030914) |
0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 0.2 | GO:0031082 | BLOC complex(GO:0031082) |
0.0 | 0.0 | GO:1990423 | RZZ complex(GO:1990423) |
0.0 | 0.0 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 0.0 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.9 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
0.0 | 0.1 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.0 | 0.2 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.0 | GO:0031261 | GINS complex(GO:0000811) DNA replication preinitiation complex(GO:0031261) |
0.0 | 0.0 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.1 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.0 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 0.3 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.5 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.0 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.0 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.0 | 0.1 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.1 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.1 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.0 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.0 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.0 | 0.0 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.0 | 1.4 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.3 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.1 | GO:0005859 | muscle myosin complex(GO:0005859) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.8 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.3 | 2.0 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.2 | 0.7 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.2 | 1.0 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.2 | 0.7 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.2 | 1.9 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.2 | 1.0 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.2 | 0.7 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.2 | 0.9 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.2 | 0.7 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.2 | 0.9 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.2 | 1.4 | GO:0030957 | Tat protein binding(GO:0030957) |
0.2 | 1.0 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.2 | 3.8 | GO:0008066 | glutamate receptor activity(GO:0008066) |
0.2 | 0.5 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.2 | 1.4 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.2 | 0.9 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.2 | 0.5 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.2 | 0.5 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.2 | 0.9 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.2 | 0.8 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.2 | 1.8 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.1 | 1.6 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 1.0 | GO:0004952 | dopamine neurotransmitter receptor activity(GO:0004952) |
0.1 | 0.4 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.1 | 0.6 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 0.4 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.1 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.1 | 0.4 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.1 | 0.3 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.1 | 0.4 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.1 | 0.5 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 1.1 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.1 | 0.4 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 0.9 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 0.8 | GO:0048495 | Roundabout binding(GO:0048495) |
0.1 | 0.4 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.4 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.1 | 1.7 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.1 | 0.9 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.1 | 4.5 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.1 | 2.4 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.1 | 0.8 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.1 | 0.1 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.1 | 0.8 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.1 | 0.3 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.1 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.1 | 0.3 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 0.3 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.1 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.1 | 0.6 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.1 | 0.4 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 0.7 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 0.3 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.1 | 0.5 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.1 | 0.5 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.1 | 0.4 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 0.4 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 0.5 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.6 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 0.5 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.1 | 1.0 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.1 | 0.1 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.1 | 0.4 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.1 | 0.3 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.1 | 0.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.1 | 0.3 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.1 | 0.5 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.1 | 0.3 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.1 | 0.2 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.1 | 0.3 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.1 | 0.3 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.1 | 0.4 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 0.3 | GO:0030911 | TPR domain binding(GO:0030911) |
0.1 | 0.2 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 0.4 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.1 | 1.2 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.1 | 0.7 | GO:0022824 | transmitter-gated ion channel activity(GO:0022824) transmitter-gated channel activity(GO:0022835) |
0.1 | 0.3 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 1.9 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 0.9 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.1 | 1.0 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.1 | 0.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.4 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.1 | 0.3 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 0.4 | GO:0045340 | mercury ion binding(GO:0045340) |
0.1 | 0.3 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.1 | 0.3 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 0.6 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 0.2 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 0.6 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.1 | 0.4 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 0.4 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.1 | 0.1 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
0.1 | 0.4 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.1 | 0.3 | GO:0051373 | FATZ binding(GO:0051373) |
0.1 | 0.3 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.1 | 0.3 | GO:0015556 | C4-dicarboxylate transmembrane transporter activity(GO:0015556) |
0.1 | 0.6 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.1 | 0.8 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.1 | 0.3 | GO:0035939 | microsatellite binding(GO:0035939) |
0.1 | 0.4 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.1 | 1.7 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 0.2 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 0.4 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.3 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.1 | 0.2 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.1 | 0.3 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.1 | 0.4 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.1 | 0.2 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.1 | 0.8 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.1 | 0.4 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.1 | 0.9 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.1 | 2.1 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.1 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.1 | 0.2 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.1 | 0.5 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.1 | 0.6 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.1 | 0.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.7 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.1 | 0.3 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.1 | 0.2 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.1 | 1.4 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.1 | 0.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 0.2 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.1 | 0.3 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.1 | 0.3 | GO:0070052 | collagen V binding(GO:0070052) |
0.1 | 0.3 | GO:0043515 | kinetochore binding(GO:0043515) |
0.1 | 0.5 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 0.1 | GO:0043398 | HLH domain binding(GO:0043398) |
0.1 | 0.3 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.1 | 0.3 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.1 | 0.2 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.1 | 1.7 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.1 | 0.8 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 0.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 1.2 | GO:0000217 | DNA secondary structure binding(GO:0000217) |
0.1 | 0.5 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.1 | 0.1 | GO:0016415 | octanoyltransferase activity(GO:0016415) |
0.1 | 1.6 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.1 | 0.1 | GO:0070538 | oleic acid binding(GO:0070538) |
0.1 | 0.7 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.1 | 0.3 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.1 | 0.9 | GO:1905030 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.1 | 0.4 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.1 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 1.2 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.1 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.1 | 0.3 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.1 | 0.4 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.1 | 0.3 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.1 | 1.0 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.1 | 2.2 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.1 | 0.2 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.1 | 0.2 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 0.1 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.1 | 0.2 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
0.1 | 0.2 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.1 | 1.1 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.2 | GO:0030548 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
0.1 | 0.3 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.1 | 0.5 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.2 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
0.1 | 0.3 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.1 | 0.6 | GO:0070628 | proteasome binding(GO:0070628) |
0.1 | 0.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.1 | 0.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.1 | 1.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.1 | 0.2 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 0.3 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.1 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
0.1 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 0.3 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.1 | 0.6 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.1 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.1 | 0.2 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 1.3 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.1 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 0.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 0.9 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.1 | 0.3 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 0.3 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 1.6 | GO:0019894 | kinesin binding(GO:0019894) |
0.1 | 0.3 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.1 | 0.3 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 0.7 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.1 | 0.2 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.1 | 0.1 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
0.1 | 1.1 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.1 | 0.2 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.1 | 0.4 | GO:0042300 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
0.1 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.1 | 0.6 | GO:0019841 | retinol binding(GO:0019841) |
0.1 | 0.3 | GO:0016775 | phosphotransferase activity, nitrogenous group as acceptor(GO:0016775) |
0.1 | 0.2 | GO:0002134 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.1 | 0.7 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.0 | 0.2 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.3 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.0 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.0 | 0.0 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.0 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.6 | GO:0031404 | chloride ion binding(GO:0031404) |
0.0 | 0.1 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.0 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.0 | 0.2 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) calcium-induced calcium release activity(GO:0048763) |
0.0 | 0.0 | GO:0032142 | single guanine insertion binding(GO:0032142) |
0.0 | 0.8 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.5 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.4 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 0.7 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.0 | 0.0 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.2 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.0 | 0.5 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.0 | 0.0 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.0 | 0.3 | GO:0034711 | inhibin binding(GO:0034711) |
0.0 | 0.3 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 1.3 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.0 | 0.3 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
0.0 | 0.1 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.2 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.2 | GO:0055103 | ligase regulator activity(GO:0055103) |
0.0 | 0.1 | GO:0004802 | transketolase activity(GO:0004802) |
0.0 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.4 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.0 | 0.4 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 1.3 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.1 | GO:0034806 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 0.2 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 0.4 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.1 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.0 | 0.1 | GO:0005119 | smoothened binding(GO:0005119) |
0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.0 | 0.1 | GO:0080084 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.0 | 0.2 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.0 | 0.2 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 0.6 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.0 | 0.1 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.0 | 0.2 | GO:0070061 | fructose binding(GO:0070061) |
0.0 | 0.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) calcium-dependent protein kinase regulator activity(GO:0010858) |
0.0 | 0.4 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.0 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.0 | 0.4 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.0 | 0.0 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.3 | GO:0070403 | NAD+ binding(GO:0070403) |
0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.2 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.0 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.2 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
0.0 | 0.6 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.4 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.0 | 0.4 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 2.2 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.1 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.7 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.0 | 0.8 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.4 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.0 | 0.0 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.0 | 1.9 | GO:0019905 | syntaxin binding(GO:0019905) |
0.0 | 0.1 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.0 | 0.6 | GO:0045296 | cadherin binding(GO:0045296) |
0.0 | 0.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.6 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.5 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.0 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.0 | 0.3 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 1.2 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.5 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 1.0 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.4 | GO:0030275 | LRR domain binding(GO:0030275) |
0.0 | 0.2 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.6 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.0 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.0 | 0.2 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.4 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.0 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.4 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.2 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.8 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.0 | 0.0 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.3 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.2 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.0 | 0.7 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.0 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.0 | 0.2 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 0.3 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.1 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.0 | 0.1 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.0 | 0.1 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.0 | 0.3 | GO:0046977 | TAP binding(GO:0046977) |
0.0 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.2 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.0 | 0.0 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.1 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.5 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.0 | 0.1 | GO:0005165 | neurotrophin receptor binding(GO:0005165) neurotrophin p75 receptor binding(GO:0005166) |
0.0 | 1.3 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.3 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.2 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.2 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.5 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.2 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.3 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.0 | 0.0 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.1 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 0.5 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.1 | GO:0019534 | toxin transporter activity(GO:0019534) |
0.0 | 0.2 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.3 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
0.0 | 0.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.1 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.0 | 1.2 | GO:0002039 | p53 binding(GO:0002039) |
0.0 | 0.1 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.2 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.3 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.0 | 1.1 | GO:0044823 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.2 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.2 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.1 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.7 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.1 | GO:0005272 | sodium channel activity(GO:0005272) |
0.0 | 1.4 | GO:0008186 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 2.6 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.0 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.0 | 0.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.1 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.1 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.0 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.0 | 0.5 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.0 | 0.0 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.0 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
0.0 | 0.3 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.0 | 0.0 | GO:0032356 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.0 | 0.2 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.0 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.2 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.0 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.0 | GO:0051870 | methotrexate binding(GO:0051870) |
0.0 | 0.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.2 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.0 | 0.0 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.0 | 0.1 | GO:0031433 | telethonin binding(GO:0031433) |
0.0 | 0.3 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.0 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.3 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.2 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 0.0 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
0.0 | 0.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.2 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.3 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.5 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.0 | 0.0 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.0 | 0.2 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.6 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.2 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.4 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.0 | 0.1 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.0 | 0.0 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.1 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.0 | GO:0016751 | S-succinyltransferase activity(GO:0016751) |
0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.0 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.0 | 0.5 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
0.0 | 0.2 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.0 | 0.1 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.3 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 0.1 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.1 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.1 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.0 | 0.2 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.2 | GO:0022839 | ion gated channel activity(GO:0022839) |
0.0 | 0.0 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.0 | 0.0 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.0 | 0.7 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
0.0 | 0.4 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.0 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.0 | 0.5 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.0 | 0.0 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.0 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 0.1 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.0 | 0.0 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.0 | 0.2 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 2.7 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.0 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.1 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.0 | 0.0 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.0 | 0.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.0 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.0 | 0.1 | GO:0070990 | snRNP binding(GO:0070990) U1 snRNP binding(GO:1990446) |
0.0 | 0.0 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.1 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.0 | 0.4 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
0.0 | 0.3 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
0.0 | 0.0 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.0 | 0.0 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.0 | 0.0 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.0 | 0.0 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.1 | GO:0008026 | ATP-dependent helicase activity(GO:0008026) purine NTP-dependent helicase activity(GO:0070035) |
0.0 | 0.2 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.0 | GO:0030519 | snoRNP binding(GO:0030519) |
0.0 | 0.0 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
0.0 | 0.1 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.1 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.0 | 0.2 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.0 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.0 | GO:0035173 | histone kinase activity(GO:0035173) |
0.0 | 0.2 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.1 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.0 | 0.1 | GO:0003678 | DNA helicase activity(GO:0003678) |
0.0 | 0.0 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.0 | 0.1 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.0 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.0 | 0.0 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.0 | 0.0 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.0 | GO:0038132 | neuregulin binding(GO:0038132) |
0.0 | 0.1 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.0 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.1 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.3 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 3.6 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.1 | 2.9 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.1 | 1.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 0.7 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.1 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.1 | 1.1 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 2.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 1.7 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 0.9 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.1 | 1.3 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.1 | 0.9 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 0.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 1.4 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.1 | 0.6 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 1.3 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 0.6 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.8 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 1.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.7 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.0 | 0.9 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.0 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.6 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.3 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.5 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 1.3 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.0 | 0.3 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.3 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.0 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.7 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.8 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.6 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.6 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.0 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.3 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.0 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.4 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.0 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.4 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.1 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 0.1 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.0 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.2 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.7 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.2 | 2.8 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.2 | 2.2 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.2 | 1.9 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.2 | 1.9 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
0.1 | 1.5 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 1.3 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.1 | 0.4 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.1 | 1.9 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 0.3 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.1 | 3.0 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 1.1 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 1.5 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 0.1 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.1 | 0.1 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
0.1 | 1.1 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.1 | 1.0 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.1 | 1.3 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.1 | 0.1 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
0.1 | 0.9 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.1 | 1.1 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 0.9 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.1 | 0.5 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 1.9 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.1 | 1.5 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 0.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 1.5 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.1 | 0.3 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.1 | 1.1 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.1 | 1.6 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.1 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 0.5 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.1 | 1.5 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 1.1 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.1 | 0.5 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.1 | 1.7 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.1 | 0.5 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.1 | 2.6 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 0.7 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 0.2 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.1 | 0.6 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.1 | 0.6 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.1 | 2.1 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 0.5 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 1.0 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 0.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.1 | 0.4 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.0 | 0.1 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
0.0 | 0.3 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 0.9 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.0 | 1.1 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.7 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.2 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 0.7 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.8 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.6 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.8 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.8 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
0.0 | 0.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.5 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.4 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.0 | 0.4 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 1.0 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.0 | 2.9 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.0 | 0.7 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.3 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.5 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 1.0 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.0 | 1.8 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.0 | 0.3 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.0 | 0.4 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.5 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 1.3 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.7 | REACTOME RNA POL III TRANSCRIPTION | Genes involved in RNA Polymerase III Transcription |
0.0 | 0.2 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.0 | 0.2 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.1 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.2 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.6 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.2 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.0 | 0.2 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 1.5 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 1.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.4 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.0 | 0.0 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.5 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
0.0 | 0.2 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 3.4 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.3 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 0.3 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
0.0 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 0.1 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 1.3 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.0 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.6 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.3 | REACTOME PROTEIN FOLDING | Genes involved in Protein folding |
0.0 | 0.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.4 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.2 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.0 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.0 | 0.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.0 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.0 | 0.6 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.0 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
0.0 | 0.0 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
0.0 | 0.0 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.1 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.2 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.1 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.1 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.3 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.1 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.0 | 0.2 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
0.0 | 0.0 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.0 | 0.0 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.0 | 0.0 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.1 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 0.1 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
0.0 | 0.0 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 0.1 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |