| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Barhl2
|
ENSMUSG00000034384.10 | BarH like homeobox 2 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr5_106421045_106421196 | Barhl2 | 37046 | 0.110182 | 0.41 | 2.1e-03 | Click! |
| chr5_106459300_106459451 | Barhl2 | 1209 | 0.443932 | 0.35 | 8.7e-03 | Click! |
| chr5_106446700_106446872 | Barhl2 | 11380 | 0.164905 | 0.31 | 2.0e-02 | Click! |
| chr5_106458759_106459169 | Barhl2 | 798 | 0.607785 | 0.27 | 5.0e-02 | Click! |
| chr5_106458544_106458736 | Barhl2 | 474 | 0.791821 | 0.22 | 1.1e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chrX_58445733_58445903 | 4.25 |
Gm14645 |
predicted gene 14645 |
17743 |
0.26 |
| chr1_137838327_137838702 | 3.28 |
Gm37293 |
predicted gene, 37293 |
26665 |
0.12 |
| chr4_81573852_81574133 | 3.16 |
Gm11765 |
predicted gene 11765 |
112260 |
0.06 |
| chr3_57919632_57919807 | 3.15 |
Gm24531 |
predicted gene, 24531 |
2468 |
0.24 |
| chr1_92437708_92437923 | 2.80 |
Gm7837 |
predicted gene 7837 |
7283 |
0.14 |
| chr5_111843170_111843321 | 2.65 |
Gm36535 |
predicted gene, 36535 |
49858 |
0.13 |
| chr2_125617408_125617804 | 2.61 |
Cep152 |
centrosomal protein 152 |
7507 |
0.23 |
| chr10_49256416_49256586 | 2.57 |
Grik2 |
glutamate receptor, ionotropic, kainate 2 (beta 2) |
13465 |
0.18 |
| chr14_12338097_12338549 | 2.51 |
Gm24578 |
predicted gene, 24578 |
4419 |
0.14 |
| chr1_114528683_114528871 | 2.45 |
9330185C12Rik |
RIKEN cDNA 9330185C12 gene |
564643 |
0.0 |
| chr18_67497794_67498327 | 2.33 |
Spire1 |
spire type actin nucleation factor 1 |
331 |
0.86 |
| chr7_96832704_96833057 | 2.32 |
Gm44633 |
predicted gene 44633 |
14574 |
0.14 |
| chr6_32373945_32374204 | 2.22 |
Plxna4os3 |
plexin A4, opposite strand 3 |
70161 |
0.11 |
| chr6_32374215_32374393 | 2.22 |
Plxna4os3 |
plexin A4, opposite strand 3 |
70391 |
0.11 |
| chr14_75473590_75473918 | 2.22 |
Siah3 |
siah E3 ubiquitin protein ligase family member 3 |
17772 |
0.22 |
| chr19_16138184_16138350 | 2.21 |
Gnaq |
guanine nucleotide binding protein, alpha q polypeptide |
4971 |
0.24 |
| chr4_97610459_97610638 | 2.20 |
E130114P18Rik |
RIKEN cDNA E130114P18 gene |
25912 |
0.21 |
| chr16_74582674_74582854 | 2.18 |
Gm49671 |
predicted gene, 49671 |
23498 |
0.21 |
| chr14_69057889_69058040 | 2.15 |
Gm41192 |
predicted gene, 41192 |
28312 |
0.15 |
| chr2_26594675_26595827 | 2.14 |
Egfl7 |
EGF-like domain 7 |
3104 |
0.11 |
| chr13_107407430_107407612 | 2.13 |
Apoo-ps |
apolipoprotein O, pseudogene |
7208 |
0.24 |
| chr5_25666091_25666467 | 2.12 |
Gm10062 |
predicted gene 10062 |
4997 |
0.15 |
| chr4_97910237_97910414 | 2.12 |
Nfia |
nuclear factor I/A |
708 |
0.8 |
| chr9_5752747_5752938 | 2.10 |
Gm48506 |
predicted gene, 48506 |
43937 |
0.19 |
| chr8_45844478_45844814 | 2.09 |
Gm25309 |
predicted gene, 25309 |
19957 |
0.13 |
| chr7_57366083_57366265 | 2.06 |
Gabrg3 |
gamma-aminobutyric acid (GABA) A receptor, subunit gamma 3 |
20697 |
0.19 |
| chr17_70363622_70363956 | 2.05 |
Dlgap1 |
DLG associated protein 1 |
61005 |
0.15 |
| chr8_36014873_36015024 | 2.05 |
Rps12-ps24 |
ribosomal protein S12, pseudogene 24 |
10805 |
0.2 |
| chr9_112215550_112215701 | 2.05 |
Arpp21 |
cyclic AMP-regulated phosphoprotein, 21 |
1636 |
0.38 |
| chr1_78593919_78594147 | 2.04 |
5730419F03Rik |
RIKEN cDNA 5730419F03 gene |
15475 |
0.15 |
| chr4_125545547_125545968 | 2.03 |
Mir692-2 |
microRNA 692-2 |
41008 |
0.15 |
| chr18_78495605_78496010 | 2.00 |
4931439C15Rik |
RIKEN cDNA 4931439C15 gene |
18657 |
0.22 |
| chr18_21758402_21758612 | 1.99 |
Klhl14 |
kelch-like 14 |
103789 |
0.07 |
| chr10_58673093_58673451 | 1.97 |
Edar |
ectodysplasin-A receptor |
2382 |
0.26 |
| chr3_62917028_62917179 | 1.96 |
Gm9701 |
predicted gene 9701 |
7130 |
0.32 |
| chr15_72773133_72773360 | 1.95 |
Peg13 |
paternally expressed 13 |
37078 |
0.16 |
| chr14_59888192_59888343 | 1.94 |
Gm9013 |
predicted gene 9013 |
152224 |
0.04 |
| chr5_37064804_37064985 | 1.89 |
Jakmip1 |
janus kinase and microtubule interacting protein 1 |
13978 |
0.15 |
| chr9_100440100_100440330 | 1.87 |
Gm28166 |
predicted gene 28166 |
10107 |
0.15 |
| chr9_37624094_37624272 | 1.87 |
Siae |
sialic acid acetylesterase |
2529 |
0.17 |
| chr2_126034433_126034611 | 1.86 |
Fgf7 |
fibroblast growth factor 7 |
136 |
0.97 |
| chr13_107247476_107247653 | 1.85 |
Gm2726 |
predicted gene 2726 |
32627 |
0.2 |
| chr12_74527171_74527557 | 1.82 |
Gm47618 |
predicted gene, 47618 |
66736 |
0.13 |
| chr5_73585426_73585577 | 1.82 |
Lrrc66 |
leucine rich repeat containing 66 |
44811 |
0.11 |
| chr13_112116190_112116341 | 1.82 |
Gm31104 |
predicted gene, 31104 |
21851 |
0.19 |
| chr18_14935746_14935914 | 1.81 |
Gm9474 |
predicted gene 9474 |
11719 |
0.2 |
| chr12_51001240_51001391 | 1.79 |
Gm40421 |
predicted gene, 40421 |
3558 |
0.25 |
| chr19_15052959_15053110 | 1.76 |
Gm5513 |
predicted pseudogene 5513 |
92268 |
0.1 |
| chr16_79870693_79870877 | 1.76 |
Rps19-ps12 |
ribosomal protein S19, pseudogene 12 |
44086 |
0.2 |
| chr5_37768904_37769238 | 1.76 |
Cytl1 |
cytokine-like 1 |
31791 |
0.15 |
| chr15_41082521_41082910 | 1.73 |
Gm49524 |
predicted gene, 49524 |
84755 |
0.09 |
| chr3_80802510_80803270 | 1.73 |
Gria2 |
glutamate receptor, ionotropic, AMPA2 (alpha 2) |
55 |
0.98 |
| chr15_39828831_39829007 | 1.72 |
Dpys |
dihydropyrimidinase |
28548 |
0.17 |
| chr4_22973635_22973800 | 1.72 |
1700025O08Rik |
RIKEN cDNA 1700025O08 gene |
35282 |
0.23 |
| chr8_78340927_78341109 | 1.71 |
Ttc29 |
tetratricopeptide repeat domain 29 |
49964 |
0.15 |
| chr1_168383801_168384185 | 1.70 |
Gm38381 |
predicted gene, 38381 |
33185 |
0.17 |
| chr9_46913430_46913613 | 1.69 |
2900052N01Rik |
RIKEN cDNA 2900052N01 gene |
28 |
0.98 |
| chr18_80100127_80100278 | 1.69 |
Gm21886 |
predicted gene, 21886 |
10240 |
0.1 |
| chr11_37464151_37464313 | 1.69 |
Gm12128 |
predicted gene 12128 |
194757 |
0.03 |
| chrX_56651870_56652063 | 1.69 |
Slc9a6 |
solute carrier family 9 (sodium/hydrogen exchanger), member 6 |
6118 |
0.19 |
| chr13_84349427_84349610 | 1.68 |
Gm26927 |
predicted gene, 26927 |
9405 |
0.23 |
| chr4_6912973_6913331 | 1.68 |
Tox |
thymocyte selection-associated high mobility group box |
77331 |
0.11 |
| chr8_7946619_7946770 | 1.67 |
Gm45160 |
predicted gene 45160 |
38674 |
0.19 |
| chr19_50077525_50077676 | 1.67 |
Rpl13a-ps1 |
ribosomal protein 13A, pseudogene 1 |
46865 |
0.16 |
| chr5_96421588_96421772 | 1.67 |
Gm33050 |
predicted gene, 33050 |
36063 |
0.17 |
| chr1_63459266_63459417 | 1.66 |
Adam23 |
a disintegrin and metallopeptidase domain 23 |
11278 |
0.21 |
| chr5_5341676_5341872 | 1.64 |
Gm43728 |
predicted gene 43728 |
30151 |
0.15 |
| chr10_17202862_17203093 | 1.64 |
Gm25382 |
predicted gene, 25382 |
86173 |
0.09 |
| chr17_10399002_10399153 | 1.64 |
A230009B12Rik |
RIKEN cDNA A230009B12 gene |
57139 |
0.13 |
| chr13_19668619_19668818 | 1.62 |
Gm47606 |
predicted gene, 47606 |
5216 |
0.18 |
| chr19_27509937_27510103 | 1.62 |
Gm50101 |
predicted gene, 50101 |
2488 |
0.38 |
| chr1_66395305_66395711 | 1.62 |
Map2 |
microtubule-associated protein 2 |
8497 |
0.21 |
| chr11_43961539_43961690 | 1.62 |
Gm12153 |
predicted gene 12153 |
2525 |
0.38 |
| chr3_83446129_83446447 | 1.62 |
Gm38096 |
predicted gene, 38096 |
42886 |
0.19 |
| chr16_18130661_18130812 | 1.61 |
Rtn4r |
reticulon 4 receptor |
3094 |
0.17 |
| chr7_139140415_139140566 | 1.61 |
Stk32c |
serine/threonine kinase 32C |
48027 |
0.1 |
| chr2_159755636_159756011 | 1.59 |
Gm11445 |
predicted gene 11445 |
22384 |
0.25 |
| chr9_45626192_45626360 | 1.59 |
Gm22069 |
predicted gene, 22069 |
8536 |
0.21 |
| chr3_145885311_145885687 | 1.59 |
Rpl36a-ps2 |
ribosomal protein L36A, pseudogene 2 |
6479 |
0.2 |
| chr12_3930532_3930741 | 1.58 |
Gm9088 |
predicted gene 9088 |
1404 |
0.35 |
| chr11_24095326_24095654 | 1.58 |
Bcl11a |
B cell CLL/lymphoma 11A (zinc finger protein) |
14820 |
0.14 |
| chr15_74194149_74194481 | 1.57 |
Gm15387 |
predicted gene 15387 |
99982 |
0.07 |
| chr2_167158974_167159179 | 1.56 |
1110018N20Rik |
RIKEN cDNA 1110018N20 gene |
29626 |
0.1 |
| chr17_4040209_4040609 | 1.56 |
4930470H14Rik |
RIKEN cDNA 4930470H14 gene |
42586 |
0.19 |
| chr10_86457747_86457979 | 1.56 |
Syn3 |
synapsin III |
34034 |
0.11 |
| chr5_97537996_97538189 | 1.55 |
Gk2 |
glycerol kinase 2 |
81071 |
0.1 |
| chr16_39402570_39402749 | 1.54 |
Gm36903 |
predicted gene, 36903 |
44090 |
0.18 |
| chr2_10216601_10216792 | 1.54 |
Itih5 |
inter-alpha (globulin) inhibitor H5 |
63125 |
0.05 |
| chr12_12432821_12432972 | 1.53 |
4921511I17Rik |
RIKEN cDNA 4921511I17 gene |
40281 |
0.2 |
| chr1_89739598_89739966 | 1.53 |
Agap1 |
ArfGAP with GTPase domain, ankyrin repeat and PH domain 1 |
49381 |
0.14 |
| chr7_46048797_46048961 | 1.53 |
Nomo1 |
nodal modulator 1 |
1242 |
0.33 |
| chr4_120332488_120332703 | 1.52 |
Foxo6os |
forkhead box O6, opposite strand |
41245 |
0.15 |
| chr13_20901279_20901480 | 1.52 |
Gm25605 |
predicted gene, 25605 |
56625 |
0.11 |
| chr10_6871541_6871702 | 1.52 |
Oprm1 |
opioid receptor, mu 1 |
82522 |
0.09 |
| chr13_96132470_96133258 | 1.51 |
Sv2c |
synaptic vesicle glycoprotein 2c |
287 |
0.67 |
| chr12_12274214_12274394 | 1.50 |
Fam49a |
family with sequence similarity 49, member A |
12115 |
0.28 |
| chr3_96575222_96575957 | 1.50 |
Gm16253 |
predicted gene 16253 |
1395 |
0.19 |
| chr6_22548957_22549264 | 1.50 |
Gm43630 |
predicted gene 43630 |
73808 |
0.11 |
| chr9_46350452_46350942 | 1.49 |
Gm31374 |
predicted gene, 31374 |
7922 |
0.12 |
| chr5_73951353_73951504 | 1.49 |
C78283 |
expressed sequence C78283 |
5047 |
0.2 |
| chr6_90802159_90802328 | 1.49 |
Gm44105 |
predicted gene, 44105 |
7768 |
0.16 |
| chrX_10422521_10422672 | 1.46 |
4933416E14Rik |
RIKEN cDNA 4933416E14 gene |
5358 |
0.27 |
| chr7_49041415_49041740 | 1.46 |
Gm45207 |
predicted gene 45207 |
21004 |
0.18 |
| chr3_146769647_146769812 | 1.45 |
Prkacb |
protein kinase, cAMP dependent, catalytic, beta |
532 |
0.77 |
| chr6_141050341_141050632 | 1.44 |
Gm43927 |
predicted gene, 43927 |
42201 |
0.17 |
| chr4_116911044_116911195 | 1.42 |
Gm26355 |
predicted gene, 26355 |
6482 |
0.1 |
| chr10_84413358_84413695 | 1.42 |
Nuak1 |
NUAK family, SNF1-like kinase, 1 |
21138 |
0.15 |
| chr9_87883201_87883375 | 1.42 |
Gm25528 |
predicted gene, 25528 |
5299 |
0.28 |
| chr13_84754156_84754454 | 1.42 |
Gm26913 |
predicted gene, 26913 |
63364 |
0.15 |
| chr15_37672637_37672815 | 1.41 |
Gm15942 |
predicted gene 15942 |
27978 |
0.15 |
| chr1_169283472_169283649 | 1.41 |
Gm37839 |
predicted gene, 37839 |
64072 |
0.14 |
| chr5_144289897_144290072 | 1.40 |
Baiap2l1 |
BAI1-associated protein 2-like 1 |
1077 |
0.43 |
| chr18_77226640_77226851 | 1.40 |
Gm15957 |
predicted gene 15957 |
7418 |
0.19 |
| chr5_88583308_88583633 | 1.39 |
Rufy3 |
RUN and FYVE domain containing 3 |
43 |
0.97 |
| chrX_42361720_42361910 | 1.39 |
Gm14619 |
predicted gene 14619 |
14303 |
0.27 |
| chr2_71244927_71245170 | 1.39 |
Dync1i2 |
dynein cytoplasmic 1 intermediate chain 2 |
10249 |
0.21 |
| chr19_28828117_28828268 | 1.38 |
Slc1a1 |
solute carrier family 1 (neuronal/epithelial high affinity glutamate transporter, system Xag), member 1 |
6857 |
0.16 |
| chr7_142459385_142459826 | 1.37 |
Lsp1 |
lymphocyte specific 1 |
1204 |
0.3 |
| chr3_127713195_127713375 | 1.37 |
1500005C15Rik |
RIKEN cDNA 1500005C15 gene |
3742 |
0.13 |
| chr7_129403065_129403253 | 1.37 |
Gm33027 |
predicted gene, 33027 |
69 |
0.99 |
| chr6_126106442_126106593 | 1.37 |
Ntf3 |
neurotrophin 3 |
58443 |
0.15 |
| chr2_46465481_46465632 | 1.37 |
Gm13470 |
predicted gene 13470 |
22846 |
0.24 |
| chr7_29071400_29071669 | 1.37 |
Gm26604 |
predicted gene, 26604 |
69 |
0.87 |
| chr3_9779707_9779923 | 1.37 |
Gm16337 |
predicted gene 16337 |
22208 |
0.18 |
| chr11_8456656_8457180 | 1.36 |
Tns3 |
tensin 3 |
11757 |
0.29 |
| chr6_30572801_30573105 | 1.36 |
Gm13781 |
predicted gene 13781 |
3082 |
0.16 |
| chr2_140840265_140840416 | 1.36 |
Calr-ps |
calreticulin, pseudogene |
115909 |
0.06 |
| chr8_14660294_14660574 | 1.35 |
Dlgap2 |
DLG associated protein 2 |
82319 |
0.09 |
| chr2_28867499_28867725 | 1.34 |
Ddx31 |
DEAD/H (Asp-Glu-Ala-Asp/His) box polypeptide 31 |
10471 |
0.15 |
| chr10_109010922_109011131 | 1.32 |
Syt1 |
synaptotagmin I |
44 |
0.99 |
| chr8_61178831_61178982 | 1.32 |
Gm16178 |
predicted gene 16178 |
15742 |
0.18 |
| chr4_107211676_107211827 | 1.32 |
Ldlrad1 |
low density lipoprotein receptor class A domain containing 1 |
2571 |
0.19 |
| chr15_84260463_84260650 | 1.32 |
Parvb |
parvin, beta |
3416 |
0.2 |
| chr2_93955513_93955665 | 1.32 |
Gm13889 |
predicted gene 13889 |
1460 |
0.33 |
| chr1_178855936_178856309 | 1.31 |
Kif26b |
kinesin family member 26B |
57684 |
0.13 |
| chr17_4177609_4177825 | 1.30 |
4930548J01Rik |
RIKEN cDNA 4930548J01 gene |
55604 |
0.16 |
| chr14_79917350_79917514 | 1.30 |
Gm49542 |
predicted gene, 49542 |
18965 |
0.15 |
| chr1_194586883_194587101 | 1.29 |
Plxna2 |
plexin A2 |
31226 |
0.18 |
| chr15_59954395_59954606 | 1.29 |
Gm7083 |
predicted gene 7083 |
23222 |
0.16 |
| chr15_26021931_26022113 | 1.28 |
Zfp622 |
zinc finger protein 622 |
26986 |
0.18 |
| chr5_16004397_16004581 | 1.28 |
Gm43000 |
predicted gene 43000 |
6650 |
0.21 |
| chr2_65981991_65982350 | 1.28 |
Gm13617 |
predicted gene 13617 |
28100 |
0.18 |
| chr8_118004421_118004600 | 1.27 |
Gm25200 |
predicted gene, 25200 |
116444 |
0.06 |
| chr9_58439214_58439365 | 1.27 |
4930461G14Rik |
RIKEN cDNA 4930461G14 gene |
15833 |
0.17 |
| chr2_106781887_106782038 | 1.27 |
Gm22813 |
predicted gene, 22813 |
27373 |
0.19 |
| chr2_42370348_42370499 | 1.26 |
Mir6336 |
microRNA 6336 |
77145 |
0.12 |
| chr2_106499568_106499880 | 1.26 |
Gm14015 |
predicted gene 14015 |
23379 |
0.23 |
| chr6_65725786_65725937 | 1.25 |
Ndnf |
neuron-derived neurotrophic factor |
24431 |
0.16 |
| chr3_26003308_26003504 | 1.25 |
Nlgn1 |
neuroligin 1 |
130328 |
0.06 |
| chr3_79144216_79144367 | 1.25 |
Rapgef2 |
Rap guanine nucleotide exchange factor (GEF) 2 |
686 |
0.74 |
| chr4_98578155_98578507 | 1.25 |
Gm22625 |
predicted gene, 22625 |
20466 |
0.18 |
| chr17_88670045_88670274 | 1.25 |
Gtf2a1l |
general transcription factor IIA, 1-like |
1463 |
0.38 |
| chr15_59973915_59974066 | 1.25 |
Gm7083 |
predicted gene 7083 |
3732 |
0.23 |
| chr2_167158780_167158962 | 1.24 |
1110018N20Rik |
RIKEN cDNA 1110018N20 gene |
29831 |
0.1 |
| chr12_35231888_35232586 | 1.24 |
Mir680-3 |
microRNA 680-3 |
37340 |
0.17 |
| chr2_168253889_168254106 | 1.24 |
Gm14237 |
predicted gene 14237 |
11567 |
0.11 |
| chr7_61939801_61940302 | 1.23 |
Mir344-2 |
microRNA 344-2 |
55 |
0.95 |
| chr9_121107968_121108295 | 1.23 |
Ulk4 |
unc-51-like kinase 4 |
394 |
0.89 |
| chr8_25466020_25466321 | 1.22 |
Gm10689 |
predicted gene 10689 |
11897 |
0.11 |
| chr5_139516523_139516674 | 1.22 |
4930500L23Rik |
RIKEN cDNA 4930500L23 gene |
7151 |
0.16 |
| chr17_11131050_11131201 | 1.22 |
Gm28505 |
predicted gene 28505 |
41657 |
0.18 |
| chr11_93581467_93581679 | 1.22 |
Gm11502 |
predicted gene 11502 |
69186 |
0.12 |
| chr1_73830788_73831006 | 1.22 |
Gm29183 |
predicted gene 29183 |
11020 |
0.18 |
| chr5_63579498_63579649 | 1.21 |
Nwd2 |
NACHT and WD repeat domain containing 2 |
69529 |
0.11 |
| chr13_81107553_81107707 | 1.21 |
Gm18517 |
predicted gene, 18517 |
20066 |
0.15 |
| chr14_59737148_59737645 | 1.20 |
Gm19716 |
predicted gene, 19716 |
94848 |
0.07 |
| chr10_97122786_97122972 | 1.20 |
Gm48555 |
predicted gene, 48555 |
16295 |
0.23 |
| chr9_40345578_40345834 | 1.20 |
Gramd1b |
GRAM domain containing 1B |
584 |
0.6 |
| chr5_90987721_90988058 | 1.20 |
Epgn |
epithelial mitogen |
39575 |
0.11 |
| chr19_21781154_21781434 | 1.20 |
Cemip2 |
cell migration inducing hyaluronidase 2 |
2906 |
0.29 |
| chr8_12126295_12126640 | 1.19 |
A230072I06Rik |
RIKEN cDNA A230072I06 gene |
152352 |
0.03 |
| chr14_79089504_79089804 | 1.19 |
Gm49011 |
predicted gene, 49011 |
16055 |
0.16 |
| chr16_26662914_26663065 | 1.19 |
Il1rap |
interleukin 1 receptor accessory protein |
38833 |
0.2 |
| chr9_79885334_79885485 | 1.18 |
Gm3211 |
predicted gene 3211 |
27791 |
0.15 |
| chr15_8806377_8806617 | 1.18 |
Slc1a3 |
solute carrier family 1 (glial high affinity glutamate transporter), member 3 |
95733 |
0.07 |
| chr4_47881615_47881766 | 1.18 |
Gm22670 |
predicted gene, 22670 |
39065 |
0.17 |
| chr17_69303567_69303898 | 1.18 |
Gm36487 |
predicted gene, 36487 |
12262 |
0.17 |
| chr11_85766250_85766706 | 1.17 |
Mir5110 |
microRNA 5110 |
5776 |
0.14 |
| chr12_29697672_29697847 | 1.17 |
C630031E19Rik |
RIKEN cDNA C630031E19 gene |
11314 |
0.29 |
| chr3_137057018_137057194 | 1.17 |
Gm26107 |
predicted gene, 26107 |
10786 |
0.25 |
| chr1_89689890_89690088 | 1.17 |
4933400F21Rik |
RIKEN cDNA 4933400F21 gene |
6081 |
0.27 |
| chr13_10053430_10053581 | 1.16 |
Gm47411 |
predicted gene, 47411 |
1657 |
0.41 |
| chr7_46454340_46454758 | 1.16 |
Gm22969 |
predicted gene, 22969 |
4136 |
0.19 |
| chr4_141867396_141867802 | 1.16 |
Efhd2 |
EF hand domain containing 2 |
7321 |
0.11 |
| chr14_77174629_77174832 | 1.16 |
Enox1 |
ecto-NOX disulfide-thiol exchanger 1 |
17950 |
0.22 |
| chr18_55549339_55549538 | 1.15 |
Gm37337 |
predicted gene, 37337 |
32324 |
0.23 |
| chr19_19246912_19247248 | 1.15 |
Gm25437 |
predicted gene, 25437 |
28819 |
0.17 |
| chr5_30769084_30769345 | 1.15 |
Dpysl5 |
dihydropyrimidinase-like 5 |
8916 |
0.12 |
| chr7_118676928_118677079 | 1.15 |
Gm45236 |
predicted gene 45236 |
11542 |
0.13 |
| chr1_167448697_167448869 | 1.15 |
Lrrc52 |
leucine rich repeat containing 52 |
17997 |
0.19 |
| chr9_103584960_103585175 | 1.14 |
Gm38032 |
predicted gene, 38032 |
15097 |
0.14 |
| chrX_93377714_93377865 | 1.14 |
Arx |
aristaless related homeobox |
91279 |
0.08 |
| chr14_87338045_87338220 | 1.14 |
Gm23278 |
predicted gene, 23278 |
8113 |
0.25 |
| chr7_54634148_54634330 | 1.14 |
Gm6290 |
predicted gene 6290 |
23041 |
0.27 |
| chr4_45654435_45654657 | 1.14 |
Gm12408 |
predicted gene 12408 |
14018 |
0.16 |
| chr12_40073717_40073868 | 1.14 |
Arl4aos |
ADP-ribosylation factor-like 4A, opposite strand |
35693 |
0.13 |
| chr13_25251900_25252051 | 1.14 |
Nrsn1 |
neurensin 1 |
10707 |
0.25 |
| chr2_158600616_158600810 | 1.14 |
Gm14204 |
predicted gene 14204 |
9877 |
0.12 |
| chr12_50120718_50121171 | 1.14 |
Gm40418 |
predicted gene, 40418 |
635 |
0.84 |
| chr7_62085144_62085467 | 1.14 |
Mir344i |
microRNA 344i |
5 |
0.97 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.8 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
| 0.5 | 2.0 | GO:0060437 | lung growth(GO:0060437) |
| 0.4 | 1.3 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.4 | 1.2 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
| 0.3 | 1.0 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
| 0.3 | 1.0 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.3 | 0.8 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
| 0.3 | 0.8 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.3 | 2.0 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.2 | 1.0 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.2 | 1.5 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.2 | 0.7 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.2 | 0.7 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.2 | 0.7 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.2 | 0.7 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.2 | 0.9 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.2 | 0.7 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.2 | 0.8 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
| 0.2 | 0.8 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.2 | 0.6 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.2 | 0.4 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.2 | 0.6 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.2 | 0.6 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
| 0.2 | 0.6 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.2 | 0.6 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
| 0.2 | 1.3 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.2 | 1.3 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.2 | 1.1 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.2 | 0.9 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.2 | 0.5 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.2 | 0.7 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.2 | 0.5 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.2 | 0.5 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.2 | 0.2 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.2 | 0.5 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.2 | 0.6 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.2 | 0.3 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
| 0.2 | 0.5 | GO:0072092 | ureteric bud invasion(GO:0072092) |
| 0.2 | 0.5 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.2 | 2.1 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.2 | 0.8 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.2 | 0.5 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.2 | 0.6 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.2 | 2.0 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.2 | 0.2 | GO:0061642 | chemoattraction of axon(GO:0061642) |
| 0.2 | 1.2 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.1 | 0.9 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.1 | 0.4 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.1 | 0.9 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
| 0.1 | 0.4 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.1 | 0.3 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.1 | 1.6 | GO:0060013 | righting reflex(GO:0060013) |
| 0.1 | 0.4 | GO:1904936 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.1 | 0.6 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 0.4 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.1 | 0.4 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 0.4 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.1 | 0.3 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 0.1 | 0.4 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
| 0.1 | 0.7 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
| 0.1 | 0.5 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.1 | 1.2 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 | 2.3 | GO:0060074 | synapse maturation(GO:0060074) |
| 0.1 | 0.4 | GO:0030242 | pexophagy(GO:0030242) |
| 0.1 | 0.5 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.1 | 0.2 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.1 | 0.2 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
| 0.1 | 2.0 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.1 | 0.3 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.1 | 0.3 | GO:1904468 | negative regulation of tumor necrosis factor secretion(GO:1904468) |
| 0.1 | 0.3 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.1 | 0.3 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
| 0.1 | 0.2 | GO:0061055 | myotome development(GO:0061055) |
| 0.1 | 0.3 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.1 | 0.2 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 0.1 | 0.3 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.1 | 0.5 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.1 | 0.4 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
| 0.1 | 0.8 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.1 | 0.4 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 0.3 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.1 | 0.3 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.1 | 0.3 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.1 | 0.1 | GO:0048320 | axial mesoderm formation(GO:0048320) |
| 0.1 | 0.4 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.1 | 0.2 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.1 | 0.2 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.1 | 0.5 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.1 | 0.1 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
| 0.1 | 0.4 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
| 0.1 | 0.4 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 | 0.4 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.1 | 0.3 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.1 | 0.2 | GO:0046959 | habituation(GO:0046959) |
| 0.1 | 0.4 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.1 | 0.2 | GO:0060174 | limb bud formation(GO:0060174) |
| 0.1 | 0.2 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
| 0.1 | 0.3 | GO:0043309 | regulation of eosinophil degranulation(GO:0043309) |
| 0.1 | 0.5 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.1 | 0.3 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 0.3 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
| 0.1 | 0.3 | GO:0021747 | cochlear nucleus development(GO:0021747) |
| 0.1 | 0.1 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
| 0.1 | 0.7 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
| 0.1 | 0.4 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.1 | 0.3 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.1 | 0.1 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
| 0.1 | 0.4 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.1 | 0.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.1 | 0.3 | GO:0071699 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.1 | 0.7 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.1 | 0.2 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.1 | 0.4 | GO:0060605 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.1 | 0.9 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.1 | 0.6 | GO:0030432 | peristalsis(GO:0030432) |
| 0.1 | 0.3 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.1 | 0.2 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
| 0.1 | 0.5 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.1 | 0.1 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
| 0.1 | 0.2 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
| 0.1 | 0.3 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.1 | 0.1 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.1 | 0.2 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.1 | 0.2 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.1 | 0.2 | GO:0032100 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
| 0.1 | 1.1 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
| 0.1 | 0.1 | GO:0035290 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
| 0.1 | 0.2 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.1 | 0.2 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
| 0.1 | 0.4 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
| 0.1 | 0.2 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.1 | 0.2 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 0.1 | 0.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.1 | 0.1 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.1 | 0.3 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.1 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.1 | 0.4 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.1 | 0.2 | GO:0001807 | regulation of type IV hypersensitivity(GO:0001807) |
| 0.1 | 0.4 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 | 0.3 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.1 | 0.2 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.1 | 0.4 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.1 | 0.2 | GO:1901656 | glycoside transport(GO:1901656) |
| 0.1 | 0.2 | GO:0002339 | B cell selection(GO:0002339) |
| 0.1 | 0.2 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.1 | 0.2 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
| 0.1 | 0.7 | GO:0007614 | short-term memory(GO:0007614) |
| 0.1 | 1.1 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.1 | 0.2 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
| 0.1 | 0.2 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
| 0.1 | 0.3 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.1 | 0.3 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
| 0.1 | 0.2 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.1 | 0.2 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.1 | 0.1 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.1 | 0.4 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.1 | 0.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.1 | 0.2 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.1 | 0.3 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 | 0.3 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.1 | 0.2 | GO:0071313 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
| 0.1 | 0.2 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.1 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 | 0.8 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.1 | 0.2 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
| 0.1 | 0.3 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
| 0.1 | 0.1 | GO:1990123 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
| 0.1 | 0.4 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
| 0.1 | 0.1 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.1 | 0.1 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.1 | 0.2 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.1 | 0.1 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
| 0.1 | 0.1 | GO:0030202 | heparin metabolic process(GO:0030202) |
| 0.1 | 0.4 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.1 | 0.2 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.1 | 0.2 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
| 0.1 | 0.2 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.1 | 0.2 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.1 | 0.2 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.1 | 0.6 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
| 0.1 | 0.2 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
| 0.1 | 0.1 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.2 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.1 | 0.2 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.1 | 1.1 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.1 | 0.3 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
| 0.1 | 0.1 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.1 | 0.2 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.1 | 0.1 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.1 | 0.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 | 0.2 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.1 | 0.2 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
| 0.1 | 0.3 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.1 | 0.4 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.1 | 0.1 | GO:2000969 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
| 0.1 | 0.2 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.1 | 0.1 | GO:0072093 | metanephric renal vesicle formation(GO:0072093) |
| 0.1 | 0.2 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.1 | 0.8 | GO:0044346 | fibroblast apoptotic process(GO:0044346) |
| 0.1 | 0.2 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.1 | 0.3 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.0 | 0.1 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.0 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.0 | 0.2 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.0 | 0.2 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.0 | 0.1 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.0 | 0.1 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
| 0.0 | 0.2 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.0 | 0.2 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
| 0.0 | 0.4 | GO:0071404 | cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
| 0.0 | 0.0 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
| 0.0 | 0.1 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.0 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.0 | 0.1 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.0 | 0.1 | GO:0048370 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
| 0.0 | 0.0 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
| 0.0 | 0.1 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
| 0.0 | 0.1 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
| 0.0 | 0.2 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.0 | 0.3 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.0 | 0.2 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.0 | 0.2 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.3 | GO:0014824 | artery smooth muscle contraction(GO:0014824) |
| 0.0 | 0.1 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
| 0.0 | 0.3 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 0.0 | 0.3 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.0 | 0.3 | GO:0036499 | PERK-mediated unfolded protein response(GO:0036499) |
| 0.0 | 0.0 | GO:1903011 | negative regulation of bone development(GO:1903011) |
| 0.0 | 0.1 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.0 | 0.1 | GO:0060486 | Clara cell differentiation(GO:0060486) |
| 0.0 | 0.2 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.0 | 0.1 | GO:0032347 | negative regulation of aldosterone metabolic process(GO:0032345) regulation of aldosterone biosynthetic process(GO:0032347) negative regulation of aldosterone biosynthetic process(GO:0032348) regulation of cortisol biosynthetic process(GO:2000064) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 0.0 | 0.1 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 0.1 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.0 | 0.1 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 | 0.3 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
| 0.0 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.0 | 0.3 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.0 | 0.0 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.0 | 0.4 | GO:1904406 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.0 | 0.1 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
| 0.0 | 0.0 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.0 | 0.2 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.0 | 0.4 | GO:0021542 | dentate gyrus development(GO:0021542) |
| 0.0 | 0.1 | GO:0090148 | membrane fission(GO:0090148) |
| 0.0 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.0 | 0.6 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.0 | 0.1 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.0 | 0.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.0 | 0.2 | GO:0035646 | endosome to melanosome transport(GO:0035646) cellular pigment accumulation(GO:0043482) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.0 | 0.1 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 0.0 | 0.2 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.0 | 0.5 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.0 | 0.1 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
| 0.0 | 0.3 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
| 0.0 | 0.1 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.0 | 0.2 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.0 | 0.3 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.0 | 0.2 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.0 | 0.0 | GO:0097195 | pilomotor reflex(GO:0097195) |
| 0.0 | 0.2 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
| 0.0 | 0.6 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.0 | 0.0 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 | 0.2 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.0 | 0.1 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
| 0.0 | 0.1 | GO:0032252 | secretory granule localization(GO:0032252) |
| 0.0 | 0.1 | GO:0090325 | regulation of locomotion involved in locomotory behavior(GO:0090325) |
| 0.0 | 0.1 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 0.0 | 0.1 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.0 | 0.2 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.0 | 0.0 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.0 | 1.0 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.1 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.0 | 0.2 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 | 0.1 | GO:0060947 | cardiac vascular smooth muscle cell differentiation(GO:0060947) |
| 0.0 | 0.1 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
| 0.0 | 0.1 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.0 | 0.1 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 0.0 | 0.3 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
| 0.0 | 0.1 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.0 | 0.1 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 | 0.2 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
| 0.0 | 0.4 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.1 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.0 | 0.0 | GO:0061588 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 0.0 | 0.2 | GO:0032570 | response to progesterone(GO:0032570) |
| 0.0 | 0.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.0 | 0.1 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
| 0.0 | 0.1 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.0 | 0.2 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.0 | 0.1 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.0 | 0.1 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.0 | 0.1 | GO:0007603 | phototransduction, visible light(GO:0007603) |
| 0.0 | 0.0 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.0 | 0.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 | 0.5 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.0 | 0.3 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.0 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
| 0.0 | 0.1 | GO:0048840 | otolith development(GO:0048840) |
| 0.0 | 0.0 | GO:0015744 | succinate transport(GO:0015744) |
| 0.0 | 0.2 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.0 | 0.2 | GO:0033240 | positive regulation of cellular amine metabolic process(GO:0033240) |
| 0.0 | 0.1 | GO:0060492 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
| 0.0 | 0.1 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.0 | 0.1 | GO:0021571 | rhombomere 5 development(GO:0021571) |
| 0.0 | 0.2 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.2 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
| 0.0 | 0.0 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
| 0.0 | 0.1 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
| 0.0 | 0.4 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
| 0.0 | 0.2 | GO:0060526 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
| 0.0 | 0.0 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 | 0.1 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.0 | 0.1 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.0 | 0.4 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
| 0.0 | 0.0 | GO:0072173 | metanephric tubule morphogenesis(GO:0072173) |
| 0.0 | 0.2 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.3 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
| 0.0 | 0.1 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.0 | 0.1 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.0 | 0.1 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
| 0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.1 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.0 | 0.0 | GO:0034651 | cortisol biosynthetic process(GO:0034651) |
| 0.0 | 0.1 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
| 0.0 | 0.1 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.0 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.0 | 0.2 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 | 0.1 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.0 | 0.4 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.0 | 0.1 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.0 | 0.2 | GO:0060536 | cartilage morphogenesis(GO:0060536) |
| 0.0 | 0.1 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.0 | 0.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 0.8 | GO:0048286 | lung alveolus development(GO:0048286) |
| 0.0 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.0 | 0.2 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.0 | 0.1 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 0.0 | 0.0 | GO:1900040 | regulation of interleukin-2 secretion(GO:1900040) |
| 0.0 | 0.0 | GO:1903960 | negative regulation of anion transmembrane transport(GO:1903960) |
| 0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.1 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
| 0.0 | 0.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.0 | 0.1 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
| 0.0 | 0.1 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
| 0.0 | 0.0 | GO:0060921 | sinoatrial node cell differentiation(GO:0060921) |
| 0.0 | 0.1 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.0 | 0.1 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.0 | 0.1 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.0 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.0 | 0.1 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.0 | 0.0 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.0 | 0.0 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
| 0.0 | 0.1 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.0 | 0.2 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.0 | GO:0032762 | mast cell cytokine production(GO:0032762) regulation of mast cell cytokine production(GO:0032763) |
| 0.0 | 0.1 | GO:0048505 | regulation of timing of cell differentiation(GO:0048505) |
| 0.0 | 0.1 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.0 | 0.1 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.0 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
| 0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.1 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
| 0.0 | 0.0 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 0.0 | 0.0 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.0 | 0.0 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.0 | 0.0 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.0 | 0.0 | GO:0060462 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
| 0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.0 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
| 0.0 | 0.0 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.0 | 0.0 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.0 | 0.1 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.0 | 0.1 | GO:1990000 | amyloid fibril formation(GO:1990000) |
| 0.0 | 0.1 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.0 | 0.0 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.0 | 0.1 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
| 0.0 | 0.0 | GO:0032342 | aldosterone biosynthetic process(GO:0032342) |
| 0.0 | 0.1 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.0 | 0.0 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
| 0.0 | 0.3 | GO:0061436 | establishment of skin barrier(GO:0061436) |
| 0.0 | 0.0 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
| 0.0 | 0.0 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.0 | 0.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 | 0.0 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
| 0.0 | 0.1 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.2 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.0 | 0.0 | GO:0061549 | sympathetic ganglion development(GO:0061549) |
| 0.0 | 0.6 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.0 | 0.0 | GO:1905209 | positive regulation of cardiocyte differentiation(GO:1905209) |
| 0.0 | 0.0 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.0 | 0.0 | GO:0007442 | hindgut morphogenesis(GO:0007442) |
| 0.0 | 0.2 | GO:0051205 | protein insertion into membrane(GO:0051205) |
| 0.0 | 0.0 | GO:0014900 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 0.0 | 0.0 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
| 0.0 | 0.0 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
| 0.0 | 0.1 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
| 0.0 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.0 | 0.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 0.1 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.0 | 0.2 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.0 | 0.1 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.0 | 0.1 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.0 | 0.2 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.1 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
| 0.0 | 0.0 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 | 0.1 | GO:1900271 | regulation of long-term synaptic potentiation(GO:1900271) |
| 0.0 | 0.0 | GO:0021978 | telencephalon regionalization(GO:0021978) |
| 0.0 | 0.0 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.0 | 0.1 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.0 | 0.0 | GO:0060431 | primary lung bud formation(GO:0060431) |
| 0.0 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.0 | 0.0 | GO:0032661 | regulation of interleukin-18 production(GO:0032661) |
| 0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.0 | 0.1 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.1 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
| 0.0 | 0.1 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.0 | 0.0 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
| 0.0 | 0.1 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.0 | 0.1 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.0 | 0.0 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.0 | 0.0 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
| 0.0 | 0.1 | GO:0051124 | synaptic growth at neuromuscular junction(GO:0051124) |
| 0.0 | 0.0 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 | 0.0 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.0 | 0.1 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.0 | 0.1 | GO:0045354 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
| 0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.0 | 0.3 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.0 | 0.2 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.1 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.0 | 0.2 | GO:0060746 | parental behavior(GO:0060746) |
| 0.0 | 0.0 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.0 | 0.1 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.0 | 0.1 | GO:0060831 | smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:0060831) |
| 0.0 | 0.0 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.0 | 0.1 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 | 0.0 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
| 0.0 | 0.0 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.0 | 0.1 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 | 0.1 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.0 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.0 | 0.6 | GO:0021987 | cerebral cortex development(GO:0021987) |
| 0.0 | 0.1 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
| 0.0 | 0.0 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.0 | 0.0 | GO:0042505 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.0 | 0.0 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.0 | 0.0 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.0 | 0.1 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.0 | 0.0 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.0 | 0.4 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
| 0.0 | 0.0 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.1 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.0 | 0.3 | GO:1901016 | regulation of potassium ion transmembrane transporter activity(GO:1901016) |
| 0.0 | 0.0 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 | 0.0 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
| 0.0 | 0.1 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 0.0 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.0 | 0.1 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
| 0.0 | 0.1 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.0 | 0.0 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.0 | 0.1 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
| 0.0 | 0.1 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.0 | 0.0 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.0 | 0.0 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
| 0.0 | 0.1 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.0 | 0.0 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 0.0 | 0.0 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.0 | 0.1 | GO:0032288 | myelin assembly(GO:0032288) |
| 0.0 | 0.2 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
| 0.0 | 0.0 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.0 | 0.1 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 | 0.0 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
| 0.0 | 0.0 | GO:0038089 | positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
| 0.0 | 0.1 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.0 | 0.0 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.0 | 0.0 | GO:0031944 | negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
| 0.0 | 0.1 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
| 0.0 | 0.0 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.0 | 0.0 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.0 | 0.1 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.0 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
| 0.0 | 0.2 | GO:0010107 | potassium ion import(GO:0010107) |
| 0.0 | 0.0 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.0 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.0 | 0.0 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.0 | 0.0 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.0 | 0.0 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.1 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.0 | 0.0 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.0 | 0.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.0 | 0.0 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.0 | 0.0 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
| 0.0 | 0.0 | GO:0015884 | folic acid transport(GO:0015884) |
| 0.0 | 0.1 | GO:0032196 | transposition(GO:0032196) |
| 0.0 | 0.1 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.0 | 0.0 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.0 | 0.0 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.0 | 0.0 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.3 | GO:0048538 | thymus development(GO:0048538) |
| 0.0 | 0.0 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
| 0.0 | 0.0 | GO:0043476 | pigment accumulation(GO:0043476) |
| 0.0 | 0.0 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.0 | 0.0 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 | 0.0 | GO:0030421 | defecation(GO:0030421) |
| 0.0 | 0.0 | GO:0086103 | G-protein coupled receptor signaling pathway involved in heart process(GO:0086103) |
| 0.0 | 0.0 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
| 0.0 | 0.0 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.0 | 0.0 | GO:0021559 | trigeminal nerve development(GO:0021559) |
| 0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.0 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.0 | 0.1 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.0 | 0.0 | GO:0042253 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
| 0.0 | 0.2 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
| 0.0 | 0.0 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.0 | 0.0 | GO:0010635 | regulation of mitochondrial fusion(GO:0010635) |
| 0.0 | 0.0 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.0 | 0.1 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
| 0.0 | 0.0 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 | 0.0 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.0 | 0.0 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.0 | 0.0 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
| 0.0 | 0.0 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.0 | 0.0 | GO:2000209 | regulation of anoikis(GO:2000209) |
| 0.0 | 0.0 | GO:0071402 | cellular response to lipoprotein particle stimulus(GO:0071402) |
| 0.0 | 0.0 | GO:0001999 | renal response to blood flow involved in circulatory renin-angiotensin regulation of systemic arterial blood pressure(GO:0001999) renin secretion into blood stream(GO:0002001) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.2 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.4 | 1.1 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.2 | 0.7 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.2 | 0.9 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.2 | 0.7 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.2 | 0.5 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.2 | 1.3 | GO:0071437 | invadopodium(GO:0071437) |
| 0.2 | 1.1 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.2 | 2.3 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.2 | 0.3 | GO:0044308 | axonal spine(GO:0044308) |
| 0.1 | 0.4 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.1 | 0.3 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.1 | 1.8 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.7 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.1 | 0.5 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 0.3 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.1 | 0.3 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.1 | 4.0 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.1 | 0.4 | GO:0098536 | deuterosome(GO:0098536) |
| 0.1 | 0.9 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.1 | 0.3 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.1 | 0.3 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 0.3 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.1 | 0.6 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 0.2 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.1 | 0.2 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.1 | 0.4 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.1 | 0.3 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 1.1 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.1 | 0.4 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.1 | 0.6 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 0.2 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.1 | 0.1 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.1 | 0.5 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.2 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.1 | 0.6 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.1 | 0.8 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.1 | 0.7 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.1 | 0.3 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 0.7 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.1 | 0.3 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.1 | 0.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 0.2 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.1 | 0.2 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.4 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 1.1 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.2 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.2 | GO:0097449 | astrocyte projection(GO:0097449) |
| 0.0 | 0.1 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 0.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.1 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.0 | 0.4 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.0 | 0.4 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.2 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.0 | 0.1 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 0.0 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.0 | 0.3 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.3 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.0 | 0.3 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 0.5 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.6 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.4 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 0.2 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 1.0 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.0 | 0.2 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.6 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 0.6 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.2 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.0 | 0.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 0.4 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.3 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 0.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.0 | 0.1 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.2 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.1 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.0 | 0.3 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.0 | 0.1 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.0 | 0.1 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.0 | 0.6 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.9 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 1.3 | GO:0016459 | myosin complex(GO:0016459) |
| 0.0 | 0.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.0 | 0.3 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 0.6 | GO:0032809 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.0 | 0.2 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 3.3 | GO:0099572 | postsynaptic density(GO:0014069) postsynaptic specialization(GO:0099572) |
| 0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.1 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
| 0.0 | 0.0 | GO:0035838 | growing cell tip(GO:0035838) |
| 0.0 | 0.2 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 0.2 | GO:0001527 | microfibril(GO:0001527) |
| 0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.3 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.0 | 0.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.0 | 0.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.0 | GO:0030689 | Noc complex(GO:0030689) |
| 0.0 | 0.1 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.2 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.1 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.0 | 0.1 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.1 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.1 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.0 | 0.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.0 | 0.2 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.4 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.1 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.2 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.0 | 0.7 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 0.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.0 | 0.6 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.4 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 0.0 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.2 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.1 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.0 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.0 | 1.2 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 0.0 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.0 | 0.1 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.0 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.0 | 0.1 | GO:0060076 | excitatory synapse(GO:0060076) |
| 0.0 | 0.0 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.0 | 0.0 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.0 | 0.2 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.1 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
| 0.0 | 0.1 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.2 | GO:0031672 | A band(GO:0031672) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.7 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.6 | 2.8 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.4 | 1.1 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.4 | 1.1 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.3 | 0.9 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.3 | 1.5 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.2 | 0.6 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.2 | 1.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.2 | 0.7 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.1 | 0.4 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.1 | 0.6 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.1 | 1.2 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.1 | 0.4 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.1 | 0.4 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 0.7 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
| 0.1 | 0.6 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.1 | 0.6 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.1 | 0.2 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.1 | 0.6 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.1 | 0.3 | GO:0005148 | prolactin receptor binding(GO:0005148) |
| 0.1 | 0.3 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 0.7 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.1 | 0.5 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.1 | 0.2 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.1 | 0.3 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.1 | 0.3 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.1 | 0.5 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.1 | 0.7 | GO:0018640 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
| 0.1 | 0.4 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.1 | 0.3 | GO:0004096 | catalase activity(GO:0004096) |
| 0.1 | 0.5 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 0.3 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.1 | 1.6 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.1 | 0.3 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 0.3 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.1 | 0.9 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.1 | 0.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.1 | 0.4 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
| 0.1 | 0.2 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.1 | 0.3 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.1 | 0.3 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.1 | 0.7 | GO:0016595 | glutamate binding(GO:0016595) |
| 0.1 | 0.2 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.1 | 0.3 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.1 | 0.5 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 0.2 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.1 | 0.2 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.1 | 0.4 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.1 | 2.2 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.1 | 0.3 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.1 | 0.2 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.1 | 0.3 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.1 | 0.2 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.1 | 0.2 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.1 | 0.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
| 0.1 | 0.1 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.1 | 0.4 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 0.6 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.1 | 0.3 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 0.8 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.1 | 0.7 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.1 | 0.5 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.1 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 1.1 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 0.2 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.1 | 0.3 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.1 | 0.4 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.1 | 1.2 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.1 | 0.2 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.1 | 0.3 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.1 | 0.3 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 0.9 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.1 | 0.3 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.1 | 0.3 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.1 | 0.6 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.1 | 0.6 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 1.0 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.4 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.0 | 0.2 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.0 | 0.1 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.0 | 0.5 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.0 | 0.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.0 | 0.2 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.0 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.2 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.0 | 0.1 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
| 0.0 | 0.3 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.0 | 0.3 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.0 | 0.1 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.0 | 0.2 | GO:0034547 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
| 0.0 | 0.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.0 | 0.2 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.0 | 0.1 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.0 | 0.3 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
| 0.0 | 0.3 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.0 | 0.5 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.2 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.0 | 0.5 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.0 | 0.0 | GO:0004083 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) |
| 0.0 | 0.1 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.2 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.0 | 0.6 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 0.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 0.2 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.0 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.0 | 0.4 | GO:0015385 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 0.3 | GO:0052688 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
| 0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 1.1 | GO:0005272 | sodium channel activity(GO:0005272) |
| 0.0 | 0.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 0.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.5 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.0 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.0 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.0 | 0.0 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.3 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.0 | 0.0 | GO:0015556 | C4-dicarboxylate transmembrane transporter activity(GO:0015556) |
| 0.0 | 0.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.0 | 0.2 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
| 0.0 | 0.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 0.1 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
| 0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.3 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.1 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.0 | 0.2 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.0 | 0.8 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.0 | 0.1 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
| 0.0 | 0.0 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.0 | 0.1 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.0 | 0.4 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.3 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.2 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.0 | 0.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.0 | 0.0 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
| 0.0 | 0.3 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.0 | 0.4 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.0 | 0.5 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.4 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.4 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.0 | 0.1 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.0 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.5 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.0 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.4 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.0 | 0.2 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.0 | 0.0 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.0 | 0.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 2.0 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| 0.0 | 0.7 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.4 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.0 | 0.1 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.2 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.0 | 0.2 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.0 | 0.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.0 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
| 0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.5 | GO:0043531 | ADP binding(GO:0043531) |
| 0.0 | 0.4 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.1 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.0 | 0.0 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.0 | 0.0 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.0 | 1.7 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.0 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.0 | 1.0 | GO:0005518 | collagen binding(GO:0005518) |
| 0.0 | 1.3 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.0 | 0.3 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.0 | 0.0 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.0 | 0.1 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.2 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
| 0.0 | 0.1 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
| 0.0 | 0.2 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.5 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.0 | 0.3 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.7 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.0 | 0.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.0 | 0.0 | GO:1904680 | peptide-transporting ATPase activity(GO:0015440) peptide transmembrane transporter activity(GO:1904680) |
| 0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.1 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.0 | 0.2 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.0 | 0.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.0 | GO:0031782 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.0 | 0.0 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.0 | 0.4 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 0.1 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.0 | 0.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.1 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.0 | 0.0 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.0 | 0.0 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.0 | 0.1 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.0 | 0.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.0 | 0.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.0 | 0.0 | GO:0001031 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
| 0.0 | 0.0 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.0 | 0.1 | GO:0034824 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
| 0.0 | 0.0 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.0 | 0.1 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.3 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.0 | 0.1 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.0 | 0.2 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.0 | 0.0 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.0 | 0.2 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.0 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.0 | 0.1 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.0 | 0.1 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.0 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
| 0.0 | 0.1 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.2 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.3 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.0 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.0 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.1 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.3 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.2 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.0 | 0.0 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.1 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.0 | 0.0 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.0 | 0.0 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.0 | 0.1 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.0 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.0 | 0.0 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.0 | 0.2 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
| 0.0 | 0.2 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.0 | 0.0 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.0 | 2.0 | GO:0003779 | actin binding(GO:0003779) |
| 0.0 | 0.8 | GO:0017124 | SH3 domain binding(GO:0017124) |
| 0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.3 | GO:0017022 | myosin binding(GO:0017022) |
| 0.0 | 0.1 | GO:0048185 | activin binding(GO:0048185) |
| 0.0 | 0.0 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
| 0.0 | 0.0 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.0 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.2 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.1 | 0.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.1 | 0.2 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 0.9 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.1 | 0.8 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.6 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.0 | 1.3 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.0 | 1.1 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 1.3 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 1.3 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.0 | 1.2 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 1.0 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.3 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.8 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.8 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 0.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.4 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.4 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.4 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.8 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 0.3 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 0.7 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.4 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.0 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 1.2 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 0.0 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 0.4 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.2 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.0 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.0 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.3 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.0 | 0.4 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.0 | 0.1 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.1 | PID ATR PATHWAY | ATR signaling pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.3 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.2 | 3.4 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.2 | 2.6 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.1 | 1.3 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.1 | 1.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 1.3 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
| 0.1 | 0.2 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 1.4 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.1 | 0.9 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 1.7 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.1 | 0.3 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.1 | 0.3 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 0.7 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 0.6 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.1 | 0.6 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 0.2 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.1 | 0.5 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 0.4 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.1 | 0.6 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 2.0 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.5 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.0 | 0.3 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.0 | 0.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 0.4 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.3 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 0.2 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 0.7 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.0 | 0.0 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.0 | 0.7 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 1.0 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 0.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.1 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.0 | 0.0 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.0 | 0.8 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.2 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.0 | 0.6 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 0.4 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.3 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 0.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 0.3 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 0.3 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.0 | 0.3 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.3 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.0 | 1.2 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.2 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.0 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.0 | 0.0 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.0 | 0.3 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 0.2 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.0 | 0.1 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.0 | 0.1 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
| 0.0 | 0.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 0.0 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.4 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.4 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.0 | 0.2 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.3 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 0.2 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 0.3 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.0 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.0 | 0.2 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.0 | 0.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.1 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 0.3 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.2 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
| 0.0 | 0.2 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.2 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.2 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.3 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 0.7 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.1 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 0.1 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.4 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 0.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.0 | REACTOME SIGNALING BY THE B CELL RECEPTOR BCR | Genes involved in Signaling by the B Cell Receptor (BCR) |
| 0.0 | 0.4 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |