| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
E2f3
|
ENSMUSG00000016477.11 | E2F transcription factor 3 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr13_29983108_29983296 | E2f3 | 1039 | 0.581215 | 0.87 | 9.1e-18 | Click! |
| chr13_29985064_29986057 | E2f3 | 503 | 0.825465 | 0.84 | 9.8e-16 | Click! |
| chr13_29983349_29983610 | E2f3 | 762 | 0.697821 | 0.83 | 4.0e-15 | Click! |
| chr13_29983768_29983919 | E2f3 | 398 | 0.875929 | 0.76 | 1.4e-11 | Click! |
| chr13_29986777_29986997 | E2f3 | 824 | 0.669235 | 0.66 | 5.0e-08 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr14_116926469_116927236 | 8.68 |
Gpc6 |
glypican 6 |
916 |
0.75 |
| chr4_33189135_33189836 | 7.40 |
Pm20d2 |
peptidase M20 domain containing 2 |
52 |
0.97 |
| chr15_30172351_30173308 | 7.32 |
Ctnnd2 |
catenin (cadherin associated protein), delta 2 |
138 |
0.98 |
| chr4_74013869_74014245 | 6.76 |
Frmd3 |
FERM domain containing 3 |
613 |
0.74 |
| chr9_91365711_91366045 | 6.75 |
Zic1 |
zinc finger protein of the cerebellum 1 |
68 |
0.95 |
| chr7_6729309_6729829 | 6.60 |
Peg3 |
paternally expressed 3 |
850 |
0.28 |
| chr18_67464673_67465310 | 6.00 |
Prelid3a |
PRELI domain containing 3A |
100 |
0.95 |
| chr7_7300279_7300878 | 5.99 |
Clcn4 |
chloride channel, voltage-sensitive 4 |
273 |
0.8 |
| chr12_55598801_55599099 | 5.45 |
Insm2 |
insulinoma-associated 2 |
477 |
0.8 |
| chr13_31408869_31409060 | 5.45 |
G630018N14Rik |
RIKEN cDNA G630018N14 gene |
42 |
0.97 |
| chr5_86172175_86173131 | 5.38 |
Uba6 |
ubiquitin-like modifier activating enzyme 6 |
86 |
0.97 |
| chr7_73208852_73209302 | 5.35 |
Gm20083 |
predicted gene, 20083 |
23274 |
0.14 |
| chrX_169997358_169997792 | 5.31 |
Gm15247 |
predicted gene 15247 |
10636 |
0.15 |
| chrX_106186707_106187081 | 5.21 |
Pgk1 |
phosphoglycerate kinase 1 |
206 |
0.92 |
| chr6_97616874_97617122 | 5.15 |
Frmd4b |
FERM domain containing 4B |
531 |
0.79 |
| chr2_149830360_149831343 | 4.92 |
Syndig1 |
synapse differentiation inducing 1 |
8 |
0.86 |
| chr15_4375378_4375720 | 4.91 |
Plcxd3 |
phosphatidylinositol-specific phospholipase C, X domain containing 3 |
45 |
0.99 |
| chr18_67133406_67133615 | 4.90 |
Gnal |
guanine nucleotide binding protein, alpha stimulating, olfactory type |
240 |
0.9 |
| chr7_65527681_65527984 | 4.82 |
Tjp1 |
tight junction protein 1 |
51 |
0.98 |
| chr17_27203606_27204996 | 4.80 |
Lemd2 |
LEM domain containing 2 |
168 |
0.9 |
| chr14_7488846_7489218 | 4.77 |
Gm3752 |
predicted gene 3752 |
5270 |
0.15 |
| chr18_20621651_20622570 | 4.60 |
Gm16090 |
predicted gene 16090 |
43150 |
0.11 |
| chr15_36967359_36968246 | 4.60 |
Gm34590 |
predicted gene, 34590 |
28938 |
0.13 |
| chr17_57062013_57062656 | 4.55 |
Crb3 |
crumbs family member 3 |
35 |
0.93 |
| chr12_105336106_105336602 | 4.54 |
Tunar |
Tcl1 upstream neural differentiation associated RNA |
240 |
0.93 |
| chr7_89632412_89633229 | 4.50 |
Me3 |
malic enzyme 3, NADP(+)-dependent, mitochondrial |
66 |
0.79 |
| chr3_80802510_80803270 | 4.48 |
Gria2 |
glutamate receptor, ionotropic, AMPA2 (alpha 2) |
55 |
0.98 |
| chr10_81232562_81232915 | 4.45 |
Zfr2 |
zinc finger RNA binding protein 2 |
417 |
0.59 |
| chr14_5501056_5501435 | 4.44 |
Gm3488 |
predicted gene, 3488 |
429 |
0.73 |
| chr13_73604216_73604826 | 4.28 |
Clptm1l |
CLPTM1-like |
515 |
0.77 |
| chr3_85300020_85300198 | 4.26 |
1700036G14Rik |
RIKEN cDNA 1700036G14 gene |
17410 |
0.24 |
| chr10_103367406_103367811 | 4.22 |
Slc6a15 |
solute carrier family 6 (neurotransmitter transporter), member 15 |
175 |
0.96 |
| chr13_83724808_83725277 | 4.21 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
3064 |
0.17 |
| chr14_5148601_5148795 | 4.21 |
Gm3317 |
predicted gene 3317 |
15837 |
0.11 |
| chr7_57590461_57591180 | 4.19 |
Gabrb3 |
gamma-aminobutyric acid (GABA) A receptor, subunit beta 3 |
302 |
0.92 |
| chr14_66910808_66911486 | 4.18 |
Pnma2 |
paraneoplastic antigen MA2 |
23 |
0.97 |
| chr5_98180681_98181156 | 4.17 |
Prdm8 |
PR domain containing 8 |
60 |
0.97 |
| chr1_81593953_81594167 | 4.17 |
Gm6198 |
predicted gene 6198 |
36577 |
0.2 |
| chr16_60605812_60606560 | 4.05 |
Gm9017 |
predicted gene 9017 |
431 |
0.6 |
| chr17_52602043_52602770 | 4.03 |
Gm27217 |
predicted gene 27217 |
254 |
0.55 |
| chr4_22487751_22488274 | 4.03 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
354 |
0.84 |
| chr1_38835547_38836894 | 4.02 |
Lonrf2 |
LON peptidase N-terminal domain and ring finger 2 |
154 |
0.95 |
| chr4_154856178_154856666 | 4.00 |
Ttc34 |
tetratricopeptide repeat domain 34 |
222 |
0.91 |
| chr15_53902158_53902619 | 3.97 |
Samd12 |
sterile alpha motif domain containing 12 |
7 |
0.98 |
| chr14_55054973_55055741 | 3.93 |
Gm20687 |
predicted gene 20687 |
136 |
0.88 |
| chr15_39197089_39197893 | 3.86 |
Rims2 |
regulating synaptic membrane exocytosis 2 |
770 |
0.61 |
| chr14_3651630_3651809 | 3.83 |
Gm3020 |
predicted gene 3020 |
311 |
0.84 |
| chr4_124862200_124862378 | 3.82 |
Maneal |
mannosidase, endo-alpha-like |
118 |
0.93 |
| chr9_122294282_122295077 | 3.81 |
Ano10 |
anoctamin 10 |
256 |
0.84 |
| chr18_20616739_20617639 | 3.80 |
Gm16090 |
predicted gene 16090 |
48071 |
0.1 |
| chr7_29071715_29071901 | 3.79 |
Gm26604 |
predicted gene, 26604 |
171 |
0.61 |
| chr17_9726102_9726458 | 3.74 |
Gm34684 |
predicted gene, 34684 |
73 |
0.98 |
| chrX_137806852_137807006 | 3.70 |
Il1rapl2 |
interleukin 1 receptor accessory protein-like 2 |
155209 |
0.04 |
| chr8_4492910_4494136 | 3.68 |
Cers4 |
ceramide synthase 4 |
2 |
0.97 |
| chr2_32875948_32876955 | 3.67 |
Fam129b |
family with sequence similarity 129, member B |
337 |
0.54 |
| chr7_79547149_79547439 | 3.64 |
Gm35040 |
predicted gene, 35040 |
11251 |
0.09 |
| chr10_87419886_87420133 | 3.61 |
Gm23191 |
predicted gene, 23191 |
55863 |
0.12 |
| chr3_66985559_66985775 | 3.60 |
Rsrc1 |
arginine/serine-rich coiled-coil 1 |
3 |
0.98 |
| chr6_127080200_127080424 | 3.59 |
Fgf23 |
fibroblast growth factor 23 |
7410 |
0.12 |
| chr15_39659223_39659553 | 3.58 |
Rims2 |
regulating synaptic membrane exocytosis 2 |
178 |
0.97 |
| chr7_91262206_91262389 | 3.57 |
Gm24552 |
predicted gene, 24552 |
19302 |
0.18 |
| chr5_40953011_40953179 | 3.57 |
4930519E07Rik |
RIKEN cDNA 4930519E07 gene |
328141 |
0.01 |
| chr10_18743618_18743843 | 3.56 |
Arfgef3 |
ARFGEF family member 3 |
23 |
0.51 |
| chr4_12140164_12140623 | 3.56 |
Rbm12b1 |
RNA binding motif protein 12 B1 |
76 |
0.95 |
| chr4_28935550_28935919 | 3.55 |
Epha7 |
Eph receptor A7 |
63810 |
0.13 |
| chr16_20622024_20622654 | 3.52 |
Camk2n2 |
calcium/calmodulin-dependent protein kinase II inhibitor 2 |
1052 |
0.23 |
| chr13_68707280_68707492 | 3.51 |
Gm26929 |
predicted gene, 26929 |
102694 |
0.06 |
| chr1_20819843_20820501 | 3.46 |
Mcm3 |
minichromosome maintenance complex component 3 |
88 |
0.93 |
| chr4_91371091_91372260 | 3.44 |
Elavl2 |
ELAV like RNA binding protein 1 |
281 |
0.88 |
| chr7_79535477_79536145 | 3.43 |
Gm35040 |
predicted gene, 35040 |
232 |
0.85 |
| chr6_71013070_71013507 | 3.43 |
Gm23485 |
predicted gene, 23485 |
26445 |
0.15 |
| chr1_194746751_194747168 | 3.42 |
2900035J10Rik |
RIKEN cDNA 2900035J10 gene |
14252 |
0.16 |
| chr3_116251584_116252494 | 3.42 |
Gpr88 |
G-protein coupled receptor 88 |
1050 |
0.53 |
| chr5_37163228_37163473 | 3.37 |
Gm1043 |
predicted gene 1043 |
501 |
0.8 |
| chr11_51584327_51584883 | 3.37 |
Phykpl |
5-phosphohydroxy-L-lysine phospholyase |
152 |
0.94 |
| chr19_41743069_41743507 | 3.36 |
Slit1 |
slit guidance ligand 1 |
198 |
0.95 |
| chr15_4375774_4376213 | 3.35 |
Plcxd3 |
phosphatidylinositol-specific phospholipase C, X domain containing 3 |
489 |
0.88 |
| chr11_71750409_71750794 | 3.34 |
Wscd1 |
WSC domain containing 1 |
84 |
0.97 |
| chr1_168163496_168163647 | 3.33 |
Pbx1 |
pre B cell leukemia homeobox 1 |
1091 |
0.67 |
| chr4_119338861_119339361 | 3.33 |
Ldha-ps2 |
lactate dehydrogenase A, pseudogene 2 |
3666 |
0.13 |
| chr18_60923667_60923881 | 3.32 |
Camk2a |
calcium/calmodulin-dependent protein kinase II alpha |
1844 |
0.26 |
| chr9_75683708_75684585 | 3.32 |
Scg3 |
secretogranin III |
90 |
0.96 |
| chr18_30197959_30198135 | 3.32 |
Gm49980 |
predicted gene, 49980 |
69202 |
0.12 |
| chr12_76255070_76255867 | 3.32 |
Mthfd1 |
methylenetetrahydrofolate dehydrogenase (NADP+ dependent), methenyltetrahydrofolate cyclohydrolase, formyltetrahydrofolate synthase |
12 |
0.63 |
| chr13_105294170_105294752 | 3.30 |
Rnf180 |
ring finger protein 180 |
32 |
0.99 |
| chr4_119733256_119734302 | 3.29 |
Hivep3 |
human immunodeficiency virus type I enhancer binding protein 3 |
5 |
0.98 |
| chr10_58814057_58814210 | 3.24 |
Sh3rf3 |
SH3 domain containing ring finger 3 |
74 |
0.95 |
| chr2_174472333_174473544 | 3.23 |
Prelid3b |
PRELI domain containing 3B |
4 |
0.96 |
| chr11_6068270_6068496 | 3.23 |
Camk2b |
calcium/calmodulin-dependent protein kinase II, beta |
2021 |
0.31 |
| chr11_43747463_43748363 | 3.21 |
Ttc1 |
tetratricopeptide repeat domain 1 |
69 |
0.98 |
| chr5_27049317_27050134 | 3.17 |
Dpp6 |
dipeptidylpeptidase 6 |
332 |
0.92 |
| chr14_24004441_24005239 | 3.16 |
Kcnma1 |
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
19 |
0.65 |
| chr13_105293859_105294168 | 3.15 |
Rnf180 |
ring finger protein 180 |
389 |
0.91 |
| chr1_191224278_191225037 | 3.14 |
D730003I15Rik |
RIKEN cDNA D730003I15 gene |
183 |
0.92 |
| chr5_20701781_20702802 | 3.14 |
Magi2 |
membrane associated guanylate kinase, WW and PDZ domain containing 2 |
622 |
0.76 |
| chr13_21259904_21260134 | 3.13 |
Gpx5 |
glutathione peroxidase 5 |
32712 |
0.09 |
| chr8_64946989_64947925 | 3.13 |
Tmem192 |
transmembrane protein 192 |
203 |
0.55 |
| chr18_45268123_45268493 | 3.12 |
Kcnn2 |
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 2 |
552 |
0.79 |
| chr8_9770365_9770564 | 3.12 |
Fam155a |
family with sequence similarity 155, member A |
360 |
0.52 |
| chr3_127626187_127626399 | 3.10 |
Neurog2 |
neurogenin 2 |
6842 |
0.13 |
| chrX_155623065_155623373 | 3.09 |
Ptchd1 |
patched domain containing 1 |
101 |
0.83 |
| chr1_92910895_92912569 | 3.09 |
Rnpepl1 |
arginyl aminopeptidase (aminopeptidase B)-like 1 |
523 |
0.52 |
| chr7_96869441_96869781 | 3.09 |
Gm25712 |
predicted gene, 25712 |
6232 |
0.18 |
| chr8_77610315_77610937 | 3.07 |
Tmem184c |
transmembrane protein 184C |
27 |
0.75 |
| chr7_105569472_105569823 | 3.06 |
Apbb1 |
amyloid beta (A4) precursor protein-binding, family B, member 1 |
55 |
0.95 |
| chr4_45763967_45764400 | 3.04 |
Gm12409 |
predicted gene 12409 |
40 |
0.97 |
| chr10_71237497_71237922 | 3.04 |
Tfam |
transcription factor A, mitochondrial |
31 |
0.97 |
| chrX_51680429_51680618 | 3.03 |
Hs6st2 |
heparan sulfate 6-O-sulfotransferase 2 |
42 |
0.98 |
| chr5_92504695_92505420 | 3.02 |
Scarb2 |
scavenger receptor class B, member 2 |
580 |
0.71 |
| chrX_43429975_43430537 | 3.02 |
Tenm1 |
teneurin transmembrane protein 1 |
1130 |
0.54 |
| chr9_81863521_81864338 | 3.00 |
Mei4 |
meiotic double-stranded break formation protein 4 |
220 |
0.95 |
| chr5_72558899_72559546 | 3.00 |
Nfxl1 |
nuclear transcription factor, X-box binding-like 1 |
190 |
0.9 |
| chr5_109556763_109557843 | 2.99 |
Crlf2 |
cytokine receptor-like factor 2 |
830 |
0.53 |
| chr3_86920207_86921011 | 2.99 |
Dclk2 |
doublecortin-like kinase 2 |
230 |
0.91 |
| chr17_3275020_3275269 | 2.96 |
Gm34035 |
predicted gene, 34035 |
8063 |
0.17 |
| chr17_56418341_56418598 | 2.96 |
Mir6977 |
microRNA 6977 |
440 |
0.76 |
| chr3_56183086_56183571 | 2.96 |
Nbea |
neurobeachin |
373 |
0.87 |
| chr13_83737818_83738360 | 2.94 |
Gm33366 |
predicted gene, 33366 |
446 |
0.49 |
| chr4_116651131_116651767 | 2.93 |
Akr1a1 |
aldo-keto reductase family 1, member A1 (aldehyde reductase) |
53 |
0.95 |
| chr2_174109835_174111101 | 2.91 |
Npepl1 |
aminopeptidase-like 1 |
119 |
0.96 |
| chr1_50927042_50927323 | 2.91 |
Tmeff2 |
transmembrane protein with EGF-like and two follistatin-like domains 2 |
337 |
0.91 |
| chrX_93297447_93297621 | 2.89 |
Arx |
aristaless related homeobox |
11024 |
0.23 |
| chr11_35798265_35798431 | 2.89 |
Fbll1 |
fibrillarin-like 1 |
536 |
0.71 |
| chr9_15045344_15045748 | 2.88 |
Panx1 |
pannexin 1 |
68 |
0.97 |
| chr6_85513641_85513875 | 2.88 |
Egr4 |
early growth response 4 |
169 |
0.93 |
| chr7_57508956_57510254 | 2.87 |
Gabra5 |
gamma-aminobutyric acid (GABA) A receptor, subunit alpha 5 |
234 |
0.95 |
| chr15_82293240_82293859 | 2.86 |
Wbp2nl |
WBP2 N-terminal like |
5405 |
0.09 |
| chr3_9629972_9630123 | 2.85 |
Zfp704 |
zinc finger protein 704 |
19962 |
0.19 |
| chr3_52784594_52784745 | 2.84 |
Gm30292 |
predicted gene, 30292 |
13116 |
0.19 |
| chr15_82968491_82968856 | 2.84 |
Tcf20 |
transcription factor 20 |
5115 |
0.15 |
| chr14_5388691_5389629 | 2.83 |
Gm3500 |
predicted gene 3500 |
111 |
0.95 |
| chr13_47708144_47708298 | 2.82 |
4930471G24Rik |
RIKEN cDNA 4930471G24 gene |
40671 |
0.21 |
| chr16_88681405_88681556 | 2.82 |
Gm7667 |
predicted gene 7667 |
1248 |
0.3 |
| chr11_17460047_17460676 | 2.81 |
Gm12015 |
predicted gene 12015 |
161942 |
0.03 |
| chr4_142411187_142411488 | 2.81 |
Gm13052 |
predicted gene 13052 |
64862 |
0.13 |
| chr9_14751478_14752576 | 2.80 |
Fut4 |
fucosyltransferase 4 |
366 |
0.74 |
| chr12_102468744_102469733 | 2.80 |
Golga5 |
golgi autoantigen, golgin subfamily a, 5 |
46 |
0.97 |
| chr5_14834201_14834402 | 2.79 |
Gm43665 |
predicted gene 43665 |
29400 |
0.17 |
| chr4_122960418_122961045 | 2.78 |
Mfsd2a |
major facilitator superfamily domain containing 2A |
421 |
0.55 |
| chr2_68471780_68472489 | 2.78 |
Stk39 |
serine/threonine kinase 39 |
134 |
0.96 |
| chr3_133310211_133310733 | 2.78 |
Ppa2 |
pyrophosphatase (inorganic) 2 |
10 |
0.9 |
| chr2_23040440_23040621 | 2.77 |
Abi1 |
abl-interactor 1 |
289 |
0.9 |
| chr11_4947352_4948069 | 2.77 |
Nefh |
neurofilament, heavy polypeptide |
354 |
0.82 |
| chr3_152605960_152606111 | 2.77 |
AI115009 |
expressed sequence AI115009 |
60878 |
0.11 |
| chr1_178856348_178856609 | 2.77 |
Kif26b |
kinesin family member 26B |
58040 |
0.13 |
| chrX_74282355_74283413 | 2.76 |
Taz |
tafazzin |
37 |
0.86 |
| chr5_39644016_39644192 | 2.76 |
Hs3st1 |
heparan sulfate (glucosamine) 3-O-sulfotransferase 1 |
493 |
0.82 |
| chr12_103324974_103325864 | 2.76 |
Asb2 |
ankyrin repeat and SOCS box-containing 2 |
10165 |
0.11 |
| chr13_103333732_103334394 | 2.76 |
Mast4 |
microtubule associated serine/threonine kinase family member 4 |
129 |
0.97 |
| chr5_36868372_36868572 | 2.76 |
Ppp2r2c |
protein phosphatase 2, regulatory subunit B, gamma |
41 |
0.97 |
| chr13_8995529_8996265 | 2.74 |
Gtpbp4 |
GTP binding protein 4 |
153 |
0.91 |
| chr13_77708524_77709187 | 2.73 |
Fam172a |
family with sequence similarity 172, member A |
71 |
0.98 |
| chr19_32485448_32485688 | 2.73 |
Minpp1 |
multiple inositol polyphosphate histidine phosphatase 1 |
201 |
0.67 |
| chr15_98674807_98675128 | 2.72 |
Rnd1 |
Rho family GTPase 1 |
2491 |
0.15 |
| chr2_39189958_39190585 | 2.72 |
Scai |
suppressor of cancer cell invasion |
421 |
0.74 |
| chr14_12821852_12822433 | 2.72 |
Cadps |
Ca2+-dependent secretion activator |
903 |
0.65 |
| chr9_77655376_77655957 | 2.72 |
Klhl31 |
kelch-like 31 |
19166 |
0.15 |
| chr15_52712198_52712465 | 2.71 |
Med30 |
mediator complex subunit 30 |
77 |
0.98 |
| chr6_145585388_145585553 | 2.70 |
Lmntd1 |
lamin tail domain containing 1 |
28499 |
0.17 |
| chr5_16093409_16093635 | 2.70 |
Gm43490 |
predicted gene 43490 |
13607 |
0.24 |
| chr12_81228166_81228347 | 2.69 |
Gm3693 |
predicted gene 3693 |
28 |
0.98 |
| chr2_84887072_84887267 | 2.68 |
Rtn4rl2 |
reticulon 4 receptor-like 2 |
459 |
0.74 |
| chrX_20060430_20060724 | 2.68 |
Chst7 |
carbohydrate (N-acetylglucosamino) sulfotransferase 7 |
1017 |
0.65 |
| chr13_35503635_35503824 | 2.68 |
Gm48704 |
predicted gene, 48704 |
40173 |
0.17 |
| chrX_48518492_48518694 | 2.68 |
Rab33a |
RAB33A, member RAS oncogene family |
692 |
0.65 |
| chr2_116768782_116768933 | 2.66 |
Gm13990 |
predicted gene 13990 |
108311 |
0.06 |
| chr1_134987429_134987924 | 2.65 |
Ube2t |
ubiquitin-conjugating enzyme E2T |
15720 |
0.15 |
| chr5_144479960_144480111 | 2.65 |
Nptx2 |
neuronal pentraxin 2 |
65867 |
0.1 |
| chr5_30343243_30343480 | 2.63 |
Drc1 |
dynein regulatory complex subunit 1 |
1581 |
0.35 |
| chr19_36082976_36083293 | 2.62 |
Rpp30 |
ribonuclease P/MRP 30 subunit |
582 |
0.76 |
| chr8_23669523_23669919 | 2.62 |
Zmat4 |
zinc finger, matrin type 4 |
47 |
0.98 |
| chr3_73056881_73057482 | 2.62 |
Slitrk3 |
SLIT and NTRK-like family, member 3 |
238 |
0.92 |
| chr1_170255237_170255616 | 2.62 |
Gm6345 |
predicted gene 6345 |
154 |
0.93 |
| chr13_73467432_73468163 | 2.62 |
Lpcat1 |
lysophosphatidylcholine acyltransferase 1 |
374 |
0.89 |
| chr1_55237308_55237788 | 2.62 |
Mars2 |
methionine-tRNA synthetase 2 (mitochondrial) |
371 |
0.82 |
| chr15_75566838_75567525 | 2.61 |
Ly6h |
lymphocyte antigen 6 complex, locus H |
35 |
0.96 |
| chr9_110245036_110245402 | 2.61 |
Cspg5 |
chondroitin sulfate proteoglycan 5 |
264 |
0.87 |
| chr13_86046221_86046640 | 2.61 |
Cox7c |
cytochrome c oxidase subunit 7C |
30 |
0.97 |
| chr17_34398691_34398900 | 2.60 |
BC051142 |
cDNA sequence BC051142 |
25 |
0.9 |
| chr18_3337890_3338126 | 2.60 |
Crem |
cAMP responsive element modulator |
260 |
0.87 |
| chr13_95443458_95443716 | 2.59 |
Crhbp |
corticotropin releasing hormone binding protein |
1244 |
0.41 |
| chr7_48138225_48138412 | 2.59 |
Gm28665 |
predicted gene 28665 |
20877 |
0.11 |
| chr8_30916293_30916764 | 2.58 |
Gm45252 |
predicted gene 45252 |
87380 |
0.09 |
| chr3_35089121_35089279 | 2.58 |
Mir6378 |
microRNA 6378 |
166549 |
0.03 |
| chr6_97617127_97617759 | 2.58 |
Frmd4b |
FERM domain containing 4B |
86 |
0.97 |
| chr5_147958003_147958198 | 2.57 |
Mtus2 |
microtubule associated tumor suppressor candidate 2 |
758 |
0.47 |
| chr5_63649781_63650446 | 2.57 |
Gm9954 |
predicted gene 9954 |
151 |
0.9 |
| chr2_13793221_13793992 | 2.56 |
St8sia6 |
ST8 alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase 6 |
313 |
0.94 |
| chr11_4946958_4947325 | 2.56 |
Nefh |
neurofilament, heavy polypeptide |
923 |
0.47 |
| chr13_55362078_55363351 | 2.56 |
Lman2 |
lectin, mannose-binding 2 |
69 |
0.95 |
| chr14_5741218_5741986 | 2.56 |
Gm3373 |
predicted gene 3373 |
25 |
0.96 |
| chr12_40445293_40445730 | 2.56 |
Zfp277 |
zinc finger protein 277 |
263 |
0.67 |
| chr8_12915219_12915955 | 2.56 |
Gm15351 |
predicted gene 15351 |
32 |
0.8 |
| chr10_75560497_75560717 | 2.55 |
Lrrc75b |
leucine rich repeat containing 75B |
277 |
0.78 |
| chr6_10969635_10970167 | 2.55 |
AA545190 |
EST AA545190 |
4477 |
0.3 |
| chr12_49385232_49385510 | 2.55 |
Gm43517 |
predicted gene 43517 |
197 |
0.9 |
| chr5_104046656_104047580 | 2.55 |
Nudt9 |
nudix (nucleoside diphosphate linked moiety X)-type motif 9 |
36 |
0.76 |
| chr5_148398815_148400002 | 2.54 |
Slc7a1 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 1 |
383 |
0.89 |
| chr12_74317046_74317342 | 2.54 |
Gm34552 |
predicted gene, 34552 |
32 |
0.94 |
| chrX_135795471_135796247 | 2.54 |
Gprasp1 |
G protein-coupled receptor associated sorting protein 1 |
1729 |
0.22 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.8 | 5.3 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 1.7 | 5.2 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 1.7 | 5.1 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 1.6 | 4.8 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 1.6 | 4.8 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 1.6 | 7.8 | GO:0021764 | amygdala development(GO:0021764) |
| 1.5 | 6.1 | GO:0046959 | habituation(GO:0046959) |
| 1.5 | 7.6 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 1.4 | 5.8 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 1.3 | 5.3 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 1.3 | 3.9 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
| 1.3 | 3.8 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 1.2 | 2.5 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 1.2 | 4.8 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 1.2 | 3.5 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 1.2 | 1.2 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 1.1 | 3.3 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 1.1 | 5.5 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 1.0 | 3.1 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 1.0 | 4.1 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
| 1.0 | 4.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 1.0 | 2.9 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 1.0 | 2.9 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
| 1.0 | 6.8 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.9 | 1.8 | GO:1904023 | regulation of fermentation(GO:0043465) regulation of NAD metabolic process(GO:1902688) regulation of glucose catabolic process to lactate via pyruvate(GO:1904023) |
| 0.9 | 2.7 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.9 | 2.7 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.9 | 2.7 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.9 | 2.7 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
| 0.9 | 10.6 | GO:0042428 | serotonin metabolic process(GO:0042428) |
| 0.9 | 0.9 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.9 | 2.6 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.9 | 4.3 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.9 | 1.7 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.8 | 6.8 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.8 | 3.4 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.8 | 2.4 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.8 | 3.9 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
| 0.8 | 4.6 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
| 0.8 | 3.8 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.7 | 3.7 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.7 | 2.2 | GO:0042628 | mating plug formation(GO:0042628) post-mating behavior(GO:0045297) |
| 0.7 | 2.2 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
| 0.7 | 2.2 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.7 | 2.2 | GO:1901656 | glycoside transport(GO:1901656) |
| 0.7 | 2.1 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.7 | 2.1 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.7 | 4.2 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.7 | 2.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.7 | 4.2 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
| 0.7 | 1.4 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.7 | 4.8 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
| 0.7 | 2.7 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.7 | 8.0 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.7 | 5.3 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.7 | 4.6 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.7 | 2.0 | GO:0009158 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 0.6 | 1.9 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.6 | 3.2 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
| 0.6 | 4.5 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.6 | 2.6 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.6 | 0.6 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
| 0.6 | 1.3 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.6 | 2.5 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.6 | 3.8 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.6 | 1.9 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.6 | 3.1 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.6 | 2.5 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.6 | 3.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.6 | 1.8 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.6 | 1.8 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.6 | 1.8 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
| 0.6 | 2.4 | GO:0060437 | lung growth(GO:0060437) |
| 0.6 | 2.3 | GO:0021554 | optic nerve development(GO:0021554) |
| 0.6 | 2.3 | GO:0061743 | motor learning(GO:0061743) |
| 0.6 | 3.5 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.6 | 2.9 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.6 | 1.7 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.6 | 1.1 | GO:0099612 | protein localization to paranode region of axon(GO:0002175) protein localization to axon(GO:0099612) |
| 0.6 | 4.5 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
| 0.6 | 5.6 | GO:0031000 | response to caffeine(GO:0031000) |
| 0.6 | 2.2 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.5 | 0.5 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.5 | 1.6 | GO:0098597 | observational learning(GO:0098597) |
| 0.5 | 3.2 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.5 | 1.6 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.5 | 0.5 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.5 | 3.2 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.5 | 2.6 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
| 0.5 | 3.7 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.5 | 1.6 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.5 | 1.6 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.5 | 1.0 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
| 0.5 | 1.0 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
| 0.5 | 2.6 | GO:0051036 | regulation of endosome size(GO:0051036) |
| 0.5 | 2.0 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.5 | 2.0 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.5 | 1.0 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.5 | 1.5 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 0.5 | 1.0 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.5 | 0.5 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
| 0.5 | 0.5 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.5 | 2.0 | GO:0019346 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.5 | 2.0 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.5 | 1.4 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.5 | 0.5 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
| 0.5 | 7.6 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.5 | 6.6 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.5 | 0.9 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 0.5 | 1.4 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.5 | 1.4 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.5 | 1.8 | GO:0015822 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
| 0.5 | 1.4 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.5 | 1.8 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.5 | 0.5 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
| 0.5 | 5.9 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) |
| 0.5 | 1.4 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
| 0.5 | 9.0 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.5 | 0.9 | GO:0021828 | cerebral cortex tangential migration using cell-axon interactions(GO:0021824) gonadotrophin-releasing hormone neuronal migration to the hypothalamus(GO:0021828) hypothalamic tangential migration using cell-axon interactions(GO:0021856) facioacoustic ganglion development(GO:1903375) |
| 0.5 | 1.4 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.5 | 1.4 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
| 0.4 | 2.7 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.4 | 1.8 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.4 | 3.6 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.4 | 3.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.4 | 1.8 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.4 | 1.3 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.4 | 1.3 | GO:0022615 | protein to membrane docking(GO:0022615) |
| 0.4 | 2.2 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.4 | 4.4 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.4 | 1.3 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.4 | 1.3 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.4 | 0.9 | GO:0048880 | sensory system development(GO:0048880) |
| 0.4 | 0.9 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 0.4 | 1.3 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.4 | 6.3 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
| 0.4 | 0.8 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.4 | 1.3 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 0.4 | 6.3 | GO:0061462 | protein localization to lysosome(GO:0061462) |
| 0.4 | 0.8 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
| 0.4 | 1.7 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.4 | 1.6 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.4 | 4.5 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.4 | 2.0 | GO:0048505 | regulation of timing of cell differentiation(GO:0048505) |
| 0.4 | 0.8 | GO:0071435 | potassium ion export(GO:0071435) |
| 0.4 | 0.4 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.4 | 0.8 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.4 | 0.4 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
| 0.4 | 1.2 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.4 | 1.2 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.4 | 1.2 | GO:0071600 | otic vesicle morphogenesis(GO:0071600) |
| 0.4 | 2.8 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.4 | 1.2 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.4 | 2.0 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.4 | 2.0 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.4 | 0.8 | GO:0051573 | negative regulation of histone H3-K9 methylation(GO:0051573) |
| 0.4 | 1.5 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.4 | 3.5 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.4 | 0.8 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.4 | 1.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.4 | 0.8 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.4 | 1.5 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.4 | 1.1 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.4 | 0.7 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.4 | 1.1 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.4 | 2.2 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.4 | 1.4 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.4 | 1.4 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.4 | 1.1 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
| 0.4 | 2.2 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
| 0.4 | 1.1 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
| 0.4 | 0.7 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.4 | 2.5 | GO:0035581 | sequestering of extracellular ligand from receptor(GO:0035581) extracellular regulation of signal transduction(GO:1900115) extracellular negative regulation of signal transduction(GO:1900116) |
| 0.4 | 4.6 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
| 0.4 | 0.7 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.4 | 1.8 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.4 | 1.1 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.4 | 1.8 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
| 0.3 | 1.0 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.3 | 3.5 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.3 | 1.7 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.3 | 0.7 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
| 0.3 | 3.1 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.3 | 0.7 | GO:0099624 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
| 0.3 | 1.7 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.3 | 1.0 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
| 0.3 | 2.0 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.3 | 3.3 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.3 | 1.0 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.3 | 1.0 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.3 | 1.3 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.3 | 1.0 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.3 | 0.7 | GO:0046864 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
| 0.3 | 1.3 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.3 | 0.7 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.3 | 3.6 | GO:0036065 | fucosylation(GO:0036065) |
| 0.3 | 0.6 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
| 0.3 | 1.0 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.3 | 1.0 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
| 0.3 | 0.6 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.3 | 0.3 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.3 | 1.0 | GO:0021747 | cochlear nucleus development(GO:0021747) |
| 0.3 | 0.6 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
| 0.3 | 0.9 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.3 | 0.9 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.3 | 1.2 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
| 0.3 | 0.9 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.3 | 8.6 | GO:0090659 | adult walking behavior(GO:0007628) walking behavior(GO:0090659) |
| 0.3 | 4.6 | GO:0045056 | transcytosis(GO:0045056) |
| 0.3 | 1.2 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.3 | 1.8 | GO:0034204 | lipid translocation(GO:0034204) |
| 0.3 | 1.2 | GO:0006598 | polyamine catabolic process(GO:0006598) |
| 0.3 | 0.6 | GO:0072048 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
| 0.3 | 1.2 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.3 | 1.2 | GO:0030091 | protein repair(GO:0030091) |
| 0.3 | 0.9 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
| 0.3 | 2.1 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.3 | 0.9 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.3 | 0.6 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.3 | 4.8 | GO:0095500 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.3 | 3.6 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.3 | 0.3 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
| 0.3 | 0.6 | GO:0014900 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 0.3 | 8.9 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
| 0.3 | 1.2 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.3 | 0.6 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.3 | 0.3 | GO:1902947 | regulation of tau-protein kinase activity(GO:1902947) |
| 0.3 | 0.9 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.3 | 4.1 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.3 | 0.6 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.3 | 1.2 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.3 | 1.2 | GO:1990035 | calcium ion import into cell(GO:1990035) |
| 0.3 | 0.6 | GO:0051095 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.3 | 0.3 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.3 | 0.6 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
| 0.3 | 1.4 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.3 | 1.4 | GO:0042637 | catagen(GO:0042637) |
| 0.3 | 0.8 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.3 | 0.6 | GO:0071672 | negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
| 0.3 | 0.8 | GO:0052203 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.3 | 0.8 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.3 | 0.8 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.3 | 1.1 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.3 | 0.8 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
| 0.3 | 0.8 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.3 | 1.4 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
| 0.3 | 3.6 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) |
| 0.3 | 1.9 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.3 | 0.8 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.3 | 0.8 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.3 | 1.4 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.3 | 0.8 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.3 | 1.1 | GO:0001964 | startle response(GO:0001964) |
| 0.3 | 1.6 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
| 0.3 | 0.8 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.3 | 1.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.3 | 5.5 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.3 | 5.2 | GO:1901381 | positive regulation of potassium ion transmembrane transport(GO:1901381) |
| 0.3 | 0.8 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
| 0.3 | 0.5 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.3 | 0.3 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.3 | 1.1 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.3 | 0.5 | GO:0072092 | ureteric bud invasion(GO:0072092) |
| 0.3 | 0.5 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
| 0.3 | 21.9 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
| 0.3 | 2.9 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.3 | 2.7 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.3 | 1.1 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
| 0.3 | 0.8 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.3 | 1.3 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.3 | 1.3 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.3 | 0.8 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.3 | 0.8 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.3 | 3.1 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.3 | 0.8 | GO:0015817 | histidine transport(GO:0015817) |
| 0.3 | 0.3 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.3 | 0.3 | GO:0035524 | proline transmembrane transport(GO:0035524) |
| 0.3 | 0.5 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.3 | 1.3 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.3 | 0.3 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.3 | 0.5 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
| 0.3 | 2.3 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.3 | 0.8 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.3 | 1.8 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.3 | 1.8 | GO:0061081 | positive regulation of myeloid leukocyte cytokine production involved in immune response(GO:0061081) |
| 0.3 | 1.5 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
| 0.3 | 1.0 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.3 | 0.8 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.3 | 3.5 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.3 | 0.8 | GO:0070669 | response to interleukin-2(GO:0070669) |
| 0.3 | 0.3 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
| 0.3 | 1.3 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
| 0.2 | 0.2 | GO:0060620 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.2 | 0.2 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.2 | 1.5 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.2 | 0.5 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.2 | 1.0 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.2 | 0.7 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.2 | 0.5 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.2 | 0.7 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.2 | 1.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.2 | 1.0 | GO:0010612 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
| 0.2 | 0.5 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.2 | 0.7 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.2 | 0.5 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.2 | 7.9 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
| 0.2 | 0.9 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.2 | 2.3 | GO:0070203 | regulation of establishment of protein localization to telomere(GO:0070203) |
| 0.2 | 0.7 | GO:0051584 | regulation of dopamine uptake involved in synaptic transmission(GO:0051584) regulation of catecholamine uptake involved in synaptic transmission(GO:0051940) |
| 0.2 | 0.2 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.2 | 1.8 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.2 | 0.5 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.2 | 0.5 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.2 | 0.7 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.2 | 0.9 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.2 | 1.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.2 | 0.7 | GO:0019042 | viral latency(GO:0019042) |
| 0.2 | 0.2 | GO:0061642 | chemoattraction of axon(GO:0061642) |
| 0.2 | 0.7 | GO:0046078 | dUMP metabolic process(GO:0046078) |
| 0.2 | 1.5 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.2 | 0.9 | GO:0003139 | secondary heart field specification(GO:0003139) |
| 0.2 | 4.6 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.2 | 0.4 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
| 0.2 | 0.2 | GO:0070305 | response to cGMP(GO:0070305) |
| 0.2 | 1.3 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.2 | 1.9 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.2 | 1.1 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.2 | 0.9 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.2 | 0.8 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.2 | 0.6 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.2 | 0.2 | GO:0031645 | negative regulation of neurological system process(GO:0031645) |
| 0.2 | 0.4 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 | 0.6 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.2 | 0.2 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
| 0.2 | 1.0 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
| 0.2 | 0.8 | GO:0014894 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.2 | 0.6 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.2 | 0.6 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.2 | 0.2 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.2 | 0.4 | GO:1900086 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.2 | 4.1 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.2 | 0.4 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.2 | 2.2 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
| 0.2 | 1.2 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.2 | 1.6 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.2 | 0.6 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.2 | 1.8 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.2 | 1.0 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.2 | 1.0 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.2 | 1.0 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
| 0.2 | 1.0 | GO:0009115 | xanthine catabolic process(GO:0009115) |
| 0.2 | 1.0 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.2 | 1.8 | GO:0015816 | glycine transport(GO:0015816) |
| 0.2 | 0.6 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.2 | 0.8 | GO:2000143 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.2 | 0.6 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.2 | 0.6 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
| 0.2 | 1.0 | GO:0006105 | succinate metabolic process(GO:0006105) |
| 0.2 | 1.2 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.2 | 0.4 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
| 0.2 | 0.6 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.2 | 1.0 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
| 0.2 | 0.6 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.2 | 0.6 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.2 | 1.3 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.2 | 0.2 | GO:0060594 | mammary gland specification(GO:0060594) |
| 0.2 | 0.6 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
| 0.2 | 0.6 | GO:0021892 | cerebral cortex GABAergic interneuron differentiation(GO:0021892) |
| 0.2 | 0.6 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.2 | 0.9 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.2 | 1.1 | GO:0002158 | osteoclast proliferation(GO:0002158) |
| 0.2 | 0.6 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.2 | 12.5 | GO:0071804 | cellular potassium ion transport(GO:0071804) |
| 0.2 | 1.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.2 | 0.5 | GO:0046066 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
| 0.2 | 1.1 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.2 | 0.4 | GO:0014824 | artery smooth muscle contraction(GO:0014824) |
| 0.2 | 0.4 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.2 | 1.6 | GO:0051382 | kinetochore assembly(GO:0051382) |
| 0.2 | 0.2 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
| 0.2 | 0.9 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.2 | 0.9 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.2 | 0.5 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.2 | 2.3 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
| 0.2 | 0.9 | GO:0006983 | ER overload response(GO:0006983) |
| 0.2 | 0.4 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
| 0.2 | 1.4 | GO:2000505 | regulation of energy homeostasis(GO:2000505) |
| 0.2 | 1.4 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.2 | 0.2 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.2 | 0.2 | GO:0051969 | regulation of transmission of nerve impulse(GO:0051969) |
| 0.2 | 0.9 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.2 | 0.9 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.2 | 0.5 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.2 | 1.5 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.2 | 0.9 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
| 0.2 | 0.5 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.2 | 0.3 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
| 0.2 | 2.7 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.2 | 0.5 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.2 | 0.2 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.2 | 0.5 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.2 | 0.5 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.2 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.2 | 0.5 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.2 | 0.3 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.2 | 0.7 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
| 0.2 | 0.3 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.2 | 0.8 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.2 | 0.7 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
| 0.2 | 0.7 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.2 | 2.8 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.2 | 0.3 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.2 | 0.5 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.2 | 0.7 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.2 | 1.0 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.2 | 0.7 | GO:0042713 | sperm ejaculation(GO:0042713) |
| 0.2 | 0.5 | GO:2000850 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.2 | 0.8 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.2 | 1.0 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.2 | 0.6 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.2 | 0.3 | GO:2001171 | positive regulation of mitochondrial membrane potential(GO:0010918) positive regulation of ATP biosynthetic process(GO:2001171) |
| 0.2 | 0.2 | GO:0035437 | maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.2 | 1.6 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.2 | 0.5 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.2 | 0.3 | GO:0086014 | atrial cardiac muscle cell action potential(GO:0086014) atrial cardiac muscle cell to AV node cell signaling(GO:0086026) atrial cardiac muscle cell to AV node cell communication(GO:0086066) |
| 0.2 | 0.3 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.2 | 7.1 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
| 0.2 | 0.2 | GO:0043366 | beta selection(GO:0043366) |
| 0.2 | 0.9 | GO:0034331 | cell junction maintenance(GO:0034331) |
| 0.2 | 0.9 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.2 | 1.1 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 0.2 | 0.6 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.2 | 5.4 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
| 0.2 | 0.3 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.2 | 0.6 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.2 | 0.8 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.2 | 1.2 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.2 | 0.5 | GO:0030242 | pexophagy(GO:0030242) |
| 0.2 | 0.8 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.1 | 0.3 | GO:0022605 | oogenesis stage(GO:0022605) |
| 0.1 | 1.6 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
| 0.1 | 0.9 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 | 0.9 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.1 | 1.6 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.1 | 0.7 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.1 | 0.1 | GO:0010766 | negative regulation of sodium ion transport(GO:0010766) |
| 0.1 | 0.3 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.1 | 0.4 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.1 | 0.6 | GO:0002328 | pro-B cell differentiation(GO:0002328) |
| 0.1 | 0.4 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 | 1.0 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.1 | 1.7 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
| 0.1 | 0.1 | GO:0051256 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 0.4 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 0.4 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.1 | 0.3 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.1 | 0.3 | GO:0018992 | germ-line sex determination(GO:0018992) |
| 0.1 | 0.6 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.1 | 0.6 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.1 | 1.7 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
| 0.1 | 0.3 | GO:0032225 | regulation of synaptic transmission, dopaminergic(GO:0032225) |
| 0.1 | 0.4 | GO:0035635 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.1 | 0.1 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.1 | 0.8 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.1 | 4.5 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 0.1 | 1.1 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.1 | 0.4 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.1 | 0.4 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.3 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.1 | 0.3 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.1 | 0.9 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 0.3 | GO:0061589 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylserine scrambling(GO:0061589) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 0.1 | 0.4 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.1 | 0.3 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.1 | 0.4 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.1 | 0.8 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.1 | 0.4 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.1 | 0.5 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
| 0.1 | 0.7 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.1 | 0.4 | GO:0016048 | detection of temperature stimulus(GO:0016048) |
| 0.1 | 0.4 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
| 0.1 | 0.4 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.1 | 0.1 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.1 | 1.4 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.1 | 1.4 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.1 | 1.7 | GO:0048854 | brain morphogenesis(GO:0048854) |
| 0.1 | 0.9 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 0.1 | 0.9 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.1 | 0.6 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.1 | 0.8 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.1 | 1.1 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.1 | 0.1 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.1 | 2.4 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.1 | 0.4 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.1 | 0.5 | GO:1900120 | regulation of receptor binding(GO:1900120) |
| 0.1 | 1.9 | GO:0048011 | neurotrophin TRK receptor signaling pathway(GO:0048011) |
| 0.1 | 0.6 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.1 | 0.2 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
| 0.1 | 0.4 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
| 0.1 | 0.5 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.1 | 0.2 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 | 1.8 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 0.7 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.1 | 0.5 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.1 | 1.0 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) |
| 0.1 | 0.4 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.6 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 | 0.4 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.1 | 0.5 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 0.1 | 0.9 | GO:0031643 | positive regulation of myelination(GO:0031643) |
| 0.1 | 1.2 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.1 | 0.1 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.1 | 0.4 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.1 | 2.0 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.1 | 0.3 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
| 0.1 | 0.5 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.3 | GO:0035625 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.1 | 0.3 | GO:0001963 | synaptic transmission, dopaminergic(GO:0001963) |
| 0.1 | 0.5 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
| 0.1 | 0.1 | GO:0043267 | negative regulation of potassium ion transport(GO:0043267) |
| 0.1 | 0.9 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 | 0.1 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.1 | 0.2 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.1 | 0.4 | GO:0006742 | NADP catabolic process(GO:0006742) |
| 0.1 | 0.4 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.1 | 0.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.1 | 2.3 | GO:0014904 | myotube cell development(GO:0014904) |
| 0.1 | 0.3 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.1 | 0.2 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
| 0.1 | 0.5 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.1 | 1.1 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
| 0.1 | 0.4 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.1 | 0.3 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
| 0.1 | 0.3 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.1 | 0.4 | GO:0015884 | folic acid transport(GO:0015884) |
| 0.1 | 0.3 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.1 | 0.3 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.1 | 0.6 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.1 | 0.4 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.1 | 0.4 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.1 | 1.5 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.1 | 0.1 | GO:0051255 | spindle midzone assembly(GO:0051255) |
| 0.1 | 0.1 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.1 | 0.4 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.1 | 2.7 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
| 0.1 | 0.1 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.1 | 0.2 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
| 0.1 | 1.2 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.1 | 0.4 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.1 | 0.2 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.1 | 0.2 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.1 | 0.3 | GO:0009642 | response to light intensity(GO:0009642) |
| 0.1 | 0.3 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.1 | 0.8 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.1 | 0.4 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.1 | 0.3 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.1 | 0.6 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.1 | 0.2 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.1 | 1.6 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.1 | 0.2 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.1 | 0.1 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.1 | 0.3 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.1 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
| 0.1 | 0.2 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.1 | 0.6 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.1 | 0.8 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.1 | 0.6 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.1 | 0.2 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.1 | 0.1 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
| 0.1 | 0.1 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.1 | 0.3 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.1 | 0.4 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.1 | 0.5 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.1 | 0.1 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
| 0.1 | 0.6 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.1 | 0.3 | GO:0044793 | negative regulation by host of viral process(GO:0044793) negative regulation by host of viral genome replication(GO:0044828) |
| 0.1 | 0.1 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.1 | 0.3 | GO:0002578 | negative regulation of antigen processing and presentation(GO:0002578) negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
| 0.1 | 0.3 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.1 | 0.2 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.1 | 0.2 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.1 | 0.2 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 2.8 | GO:0006998 | nuclear envelope organization(GO:0006998) |
| 0.1 | 0.1 | GO:0006868 | glutamine transport(GO:0006868) |
| 0.1 | 0.3 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.1 | 0.8 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.1 | 0.2 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.1 | 0.2 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.1 | 0.2 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.1 | 0.3 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.1 | 0.3 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
| 0.1 | 1.0 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
| 0.1 | 0.2 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.1 | 0.2 | GO:2001280 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
| 0.1 | 1.0 | GO:0030497 | fatty acid elongation(GO:0030497) |
| 0.1 | 0.1 | GO:1903416 | response to glycoside(GO:1903416) |
| 0.1 | 1.0 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 | 0.4 | GO:0032725 | positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
| 0.1 | 0.3 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 | 3.6 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.1 | 0.2 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
| 0.1 | 0.1 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
| 0.1 | 1.1 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.1 | 0.7 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.1 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
| 0.1 | 0.2 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.1 | 0.2 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.1 | 1.9 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.1 | 1.2 | GO:0044247 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.1 | 1.0 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.1 | 2.1 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
| 0.1 | 0.1 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.1 | 0.3 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
| 0.1 | 0.4 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.1 | 0.2 | GO:0031646 | positive regulation of neurological system process(GO:0031646) |
| 0.1 | 0.8 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.1 | 0.1 | GO:0015865 | purine nucleotide transport(GO:0015865) |
| 0.1 | 0.6 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 0.2 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.1 | 0.5 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 | 0.2 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.1 | 2.0 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.1 | 0.2 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
| 0.1 | 0.5 | GO:0031103 | axon regeneration(GO:0031103) |
| 0.1 | 0.1 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 0.1 | 0.5 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.1 | 0.4 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
| 0.1 | 0.4 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.1 | 1.5 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
| 0.1 | 0.1 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.1 | 0.3 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
| 0.1 | 1.2 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.1 | 0.1 | GO:0038001 | paracrine signaling(GO:0038001) |
| 0.1 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.1 | 0.6 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.1 | 0.1 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 0.1 | 0.3 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.1 | 0.4 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 | 0.4 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.1 | 3.2 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.1 | 0.2 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 | 0.1 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.1 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.1 | 0.1 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.1 | 0.5 | GO:0060285 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
| 0.1 | 0.3 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 | 0.6 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.1 | 0.2 | GO:0034627 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.1 | 0.1 | GO:0060631 | regulation of meiosis I(GO:0060631) |
| 0.1 | 0.3 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 | 0.1 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
| 0.1 | 1.2 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
| 0.1 | 0.2 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
| 0.1 | 0.1 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
| 0.1 | 0.3 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.1 | 0.9 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
| 0.1 | 1.3 | GO:0050982 | detection of mechanical stimulus(GO:0050982) |
| 0.1 | 0.8 | GO:0051931 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
| 0.1 | 0.4 | GO:0051797 | regulation of hair follicle development(GO:0051797) |
| 0.1 | 0.5 | GO:0021884 | forebrain neuron development(GO:0021884) |
| 0.1 | 0.4 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.1 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.1 | 0.3 | GO:0071281 | cellular response to iron ion(GO:0071281) |
| 0.1 | 1.2 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
| 0.1 | 0.2 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.1 | 0.6 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 | 0.5 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
| 0.1 | 0.2 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.1 | 0.1 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
| 0.1 | 0.5 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.1 | 0.1 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.1 | 0.1 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
| 0.1 | 0.4 | GO:0032392 | DNA geometric change(GO:0032392) |
| 0.1 | 0.3 | GO:0051904 | pigment granule transport(GO:0051904) |
| 0.1 | 0.1 | GO:0090148 | membrane fission(GO:0090148) |
| 0.1 | 0.1 | GO:0051305 | meiotic chromosome movement towards spindle pole(GO:0016344) meiotic cytokinesis(GO:0033206) chromosome movement towards spindle pole(GO:0051305) |
| 0.1 | 0.5 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.1 | 0.3 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.1 | 0.1 | GO:0050655 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.1 | 0.9 | GO:0007193 | adenylate cyclase-inhibiting G-protein coupled receptor signaling pathway(GO:0007193) |
| 0.1 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.1 | 3.5 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.1 | 0.1 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.1 | 0.1 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.1 | 0.1 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
| 0.1 | 0.1 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.1 | 0.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.1 | 0.4 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.1 | 0.1 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.1 | 0.9 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.1 | 0.1 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.1 | 0.2 | GO:1904415 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.1 | 0.3 | GO:0060632 | regulation of microtubule-based movement(GO:0060632) |
| 0.1 | 0.1 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 | 0.2 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 | 0.3 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
| 0.1 | 0.2 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.1 | 0.1 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.1 | 0.2 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
| 0.1 | 0.2 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.1 | 0.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.1 | 0.1 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.1 | 0.2 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.1 | 0.9 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
| 0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.0 | 0.3 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.2 | GO:1901678 | iron coordination entity transport(GO:1901678) |
| 0.0 | 0.1 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.0 | 0.0 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.0 | 0.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
| 0.0 | 0.2 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 | 0.6 | GO:0032456 | endocytic recycling(GO:0032456) |
| 0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.0 | 0.4 | GO:0032816 | positive regulation of natural killer cell activation(GO:0032816) |
| 0.0 | 0.4 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.0 | 0.1 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) determination of liver left/right asymmetry(GO:0071910) |
| 0.0 | 0.0 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
| 0.0 | 0.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.0 | 0.4 | GO:0014002 | astrocyte development(GO:0014002) |
| 0.0 | 0.0 | GO:0071866 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.0 | 0.6 | GO:0072525 | pyridine-containing compound biosynthetic process(GO:0072525) |
| 0.0 | 0.1 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.0 | 0.4 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.0 | 0.3 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
| 0.0 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.0 | 0.0 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 0.0 | 0.0 | GO:0021978 | telencephalon regionalization(GO:0021978) |
| 0.0 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 | 0.1 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.2 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.0 | 0.2 | GO:0006582 | melanin metabolic process(GO:0006582) |
| 0.0 | 0.2 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.0 | 0.0 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
| 0.0 | 0.4 | GO:1903859 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 0.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.1 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
| 0.0 | 0.3 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
| 0.0 | 0.0 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.0 | 0.5 | GO:0007041 | lysosomal transport(GO:0007041) |
| 0.0 | 0.2 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.1 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.0 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.0 | 0.0 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.0 | 0.6 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
| 0.0 | 0.2 | GO:0001916 | positive regulation of T cell mediated cytotoxicity(GO:0001916) |
| 0.0 | 1.5 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.2 | GO:2000318 | positive regulation of T-helper 17 type immune response(GO:2000318) |
| 0.0 | 0.1 | GO:0060214 | endocardium formation(GO:0060214) |
| 0.0 | 0.3 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.0 | 0.1 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.0 | 0.4 | GO:0098930 | axonal transport(GO:0098930) |
| 0.0 | 0.1 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.1 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
| 0.0 | 0.2 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.0 | 0.3 | GO:0002717 | positive regulation of natural killer cell mediated immunity(GO:0002717) positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
| 0.0 | 0.0 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.0 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.0 | 0.3 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
| 0.0 | 0.0 | GO:0019614 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
| 0.0 | 0.1 | GO:0003091 | renal water homeostasis(GO:0003091) |
| 0.0 | 0.0 | GO:0050705 | regulation of interleukin-1 alpha secretion(GO:0050705) |
| 0.0 | 0.1 | GO:0007635 | chemosensory behavior(GO:0007635) |
| 0.0 | 0.0 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.0 | 0.0 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.0 | 0.1 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.0 | 0.2 | GO:0051657 | maintenance of organelle location(GO:0051657) |
| 0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.2 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.2 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.0 | 0.4 | GO:0032410 | negative regulation of transporter activity(GO:0032410) |
| 0.0 | 0.0 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.0 | 0.2 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
| 0.0 | 0.2 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.0 | 0.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
| 0.0 | 0.0 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.0 | 0.3 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.2 | GO:0060547 | negative regulation of necrotic cell death(GO:0060547) |
| 0.0 | 0.0 | GO:1901660 | calcium ion export(GO:1901660) |
| 0.0 | 0.1 | GO:0060416 | response to growth hormone(GO:0060416) |
| 0.0 | 0.1 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
| 0.0 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.0 | 0.0 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
| 0.0 | 0.0 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.0 | 0.1 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
| 0.0 | 0.5 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
| 0.0 | 0.1 | GO:0008088 | axo-dendritic transport(GO:0008088) |
| 0.0 | 0.1 | GO:0060399 | regulation of growth hormone receptor signaling pathway(GO:0060398) positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.0 | 0.1 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.0 | 0.1 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
| 0.0 | 0.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.0 | 0.0 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.0 | 0.0 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 | 0.3 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 0.0 | GO:0014848 | urinary tract smooth muscle contraction(GO:0014848) |
| 0.0 | 0.0 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
| 0.0 | 0.1 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
| 0.0 | 0.1 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
| 0.0 | 0.0 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.0 | 0.1 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.0 | 0.1 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
| 0.0 | 0.1 | GO:0035902 | response to immobilization stress(GO:0035902) |
| 0.0 | 0.1 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
| 0.0 | 0.1 | GO:0050858 | negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) |
| 0.0 | 0.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.0 | 0.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.0 | 0.1 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.0 | 0.1 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
| 0.0 | 0.2 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
| 0.0 | 0.2 | GO:1901186 | positive regulation of ERBB signaling pathway(GO:1901186) |
| 0.0 | 0.0 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.0 | 0.1 | GO:0048753 | pigment granule organization(GO:0048753) |
| 0.0 | 0.0 | GO:0072126 | positive regulation of glomerular mesangial cell proliferation(GO:0072126) positive regulation of cell proliferation involved in kidney development(GO:1901724) |
| 0.0 | 0.1 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.0 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.0 | 0.0 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.0 | 0.3 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 0.1 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.0 | 0.0 | GO:0001975 | response to amphetamine(GO:0001975) |
| 0.0 | 0.2 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.0 | 0.1 | GO:0051205 | protein insertion into membrane(GO:0051205) |
| 0.0 | 0.2 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.0 | 0.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.0 | 0.0 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
| 0.0 | 0.0 | GO:0009111 | vitamin catabolic process(GO:0009111) fat-soluble vitamin catabolic process(GO:0042363) |
| 0.0 | 0.0 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.0 | 0.0 | GO:0008078 | mesodermal cell migration(GO:0008078) |
| 0.0 | 0.1 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
| 0.0 | 0.0 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.0 | 0.0 | GO:0031033 | myosin filament organization(GO:0031033) |
| 0.0 | 0.0 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.0 | 0.0 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.0 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.0 | 0.1 | GO:0002070 | epithelial cell maturation(GO:0002070) |
| 0.0 | 0.0 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.0 | 1.5 | GO:0007601 | visual perception(GO:0007601) |
| 0.0 | 0.1 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.0 | 0.0 | GO:0061640 | cytoskeleton-dependent cytokinesis(GO:0061640) |
| 0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 0.0 | 0.0 | GO:0034727 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
| 0.0 | 0.0 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.0 | 0.1 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.0 | 0.1 | GO:1990592 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.0 | 0.0 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.0 | 0.0 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.0 | 0.1 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.0 | 0.1 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.0 | 0.1 | GO:0060456 | positive regulation of digestive system process(GO:0060456) |
| 0.0 | 0.0 | GO:0019364 | pyridine nucleotide catabolic process(GO:0019364) |
| 0.0 | 0.0 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
| 0.0 | 0.0 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.0 | 0.1 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
| 0.0 | 0.0 | GO:0032714 | negative regulation of interleukin-5 production(GO:0032714) |
| 0.0 | 0.0 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
| 0.0 | 0.0 | GO:0042253 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
| 0.0 | 0.0 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.0 | 0.1 | GO:0044705 | mating behavior(GO:0007617) multi-organism reproductive behavior(GO:0044705) |
| 0.0 | 0.4 | GO:0090662 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.0 | 0.2 | GO:0002446 | neutrophil mediated immunity(GO:0002446) |
| 0.0 | 0.0 | GO:0007412 | axon target recognition(GO:0007412) |
| 0.0 | 0.0 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) |
| 0.0 | 0.0 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
| 0.0 | 0.0 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.0 | 0.0 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.0 | 0.0 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.0 | 0.0 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.0 | 0.0 | GO:0009211 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
| 0.0 | 0.6 | GO:0043330 | response to exogenous dsRNA(GO:0043330) |
| 0.0 | 0.0 | GO:0009629 | response to gravity(GO:0009629) |
| 0.0 | 0.0 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
| 0.0 | 0.0 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.0 | 0.0 | GO:0042546 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
| 0.0 | 0.1 | GO:0002693 | positive regulation of cellular extravasation(GO:0002693) |
| 0.0 | 0.0 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
| 0.0 | 0.1 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.0 | 0.0 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.0 | 0.0 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.0 | 0.0 | GO:0045026 | plasma membrane fusion(GO:0045026) |
| 0.0 | 0.0 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.0 | 0.2 | GO:0019226 | transmission of nerve impulse(GO:0019226) |
| 0.0 | 0.0 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 0.0 | 0.0 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.0 | 0.1 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
| 0.0 | 0.5 | GO:0006836 | neurotransmitter transport(GO:0006836) |
| 0.0 | 0.0 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.0 | 0.0 | GO:0019374 | galactolipid metabolic process(GO:0019374) |
| 0.0 | 0.3 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
| 0.0 | 0.0 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.0 | 0.0 | GO:0002254 | kinin cascade(GO:0002254) |
| 0.0 | 0.1 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.1 | GO:0006544 | glycine metabolic process(GO:0006544) |
| 0.0 | 0.0 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.0 | 0.4 | GO:0002455 | humoral immune response mediated by circulating immunoglobulin(GO:0002455) |
| 0.0 | 0.0 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.0 | 0.0 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.0 | 0.0 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 | 0.0 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
| 0.0 | 0.0 | GO:0046471 | phosphatidylglycerol metabolic process(GO:0046471) |
| 0.0 | 0.0 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 3.7 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 1.1 | 5.3 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 1.0 | 2.9 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.9 | 2.7 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.9 | 4.4 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.9 | 4.4 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.8 | 18.3 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.7 | 5.9 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.7 | 13.0 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.7 | 1.4 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
| 0.7 | 8.5 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.7 | 6.6 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.7 | 2.6 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
| 0.7 | 6.5 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.6 | 1.9 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.6 | 4.7 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.6 | 3.5 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.6 | 1.7 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.6 | 0.6 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.5 | 7.1 | GO:0008328 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
| 0.5 | 0.5 | GO:0071437 | invadopodium(GO:0071437) |
| 0.5 | 1.6 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.5 | 14.7 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.5 | 3.2 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.5 | 1.6 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.5 | 1.5 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.5 | 7.5 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.5 | 1.9 | GO:0008091 | spectrin(GO:0008091) |
| 0.5 | 0.5 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.5 | 2.3 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.4 | 1.8 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.4 | 3.1 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
| 0.4 | 0.4 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.4 | 10.3 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
| 0.4 | 3.3 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.4 | 3.3 | GO:0005883 | neurofilament(GO:0005883) |
| 0.4 | 1.6 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.4 | 0.4 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
| 0.4 | 1.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.4 | 2.7 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.4 | 1.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.4 | 2.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.4 | 1.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.3 | 0.3 | GO:0044298 | cell body membrane(GO:0044298) |
| 0.3 | 1.7 | GO:0097433 | dense body(GO:0097433) |
| 0.3 | 2.0 | GO:0016589 | NURF complex(GO:0016589) |
| 0.3 | 1.3 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.3 | 3.1 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.3 | 0.9 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.3 | 1.2 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.3 | 4.9 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.3 | 0.9 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.3 | 1.5 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.3 | 1.5 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.3 | 12.2 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.3 | 0.9 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.3 | 1.7 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.3 | 0.6 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.3 | 3.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.3 | 1.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.3 | 3.1 | GO:0042555 | MCM complex(GO:0042555) |
| 0.3 | 1.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.3 | 0.5 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.3 | 1.1 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.3 | 0.8 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.3 | 2.4 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.3 | 14.6 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.3 | 3.0 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.3 | 0.5 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.3 | 1.8 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.3 | 1.0 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.3 | 1.0 | GO:0032021 | NELF complex(GO:0032021) |
| 0.3 | 0.8 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.3 | 0.8 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.3 | 1.0 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.2 | 1.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.2 | 0.7 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.2 | 1.2 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.2 | 1.0 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.2 | 3.3 | GO:0000800 | lateral element(GO:0000800) |
| 0.2 | 0.7 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.2 | 1.0 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.2 | 1.4 | GO:0005767 | secondary lysosome(GO:0005767) |
| 0.2 | 7.8 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.2 | 1.0 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.2 | 1.8 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.2 | 1.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.2 | 1.1 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.2 | 1.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.2 | 2.0 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.2 | 0.6 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.2 | 1.2 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.2 | 0.8 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.2 | 0.6 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.2 | 0.4 | GO:0044308 | axonal spine(GO:0044308) |
| 0.2 | 0.8 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.2 | 0.8 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.2 | 1.0 | GO:0000235 | astral microtubule(GO:0000235) |
| 0.2 | 1.3 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.2 | 0.6 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.2 | 1.3 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.2 | 4.1 | GO:0030057 | desmosome(GO:0030057) |
| 0.2 | 0.7 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.2 | 0.7 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.2 | 0.6 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.2 | 2.2 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
| 0.2 | 1.2 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.2 | 2.8 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.2 | 0.7 | GO:1990745 | EARP complex(GO:1990745) |
| 0.2 | 0.9 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.2 | 0.3 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.2 | 1.0 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.2 | 0.5 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.2 | 0.5 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.2 | 0.7 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.2 | 0.7 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.2 | 1.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.2 | 0.8 | GO:0033503 | HULC complex(GO:0033503) |
| 0.2 | 4.7 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.2 | 1.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.2 | 1.1 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.2 | 1.2 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.2 | 0.2 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.2 | 2.2 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.2 | 2.1 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.2 | 4.0 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.2 | 3.9 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.1 | 0.9 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.1 | 1.9 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.1 | 4.4 | GO:0005921 | gap junction(GO:0005921) |
| 0.1 | 3.5 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.1 | 0.7 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.1 | 1.9 | GO:0043186 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.1 | 1.8 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 0.4 | GO:0035363 | histone locus body(GO:0035363) |
| 0.1 | 19.4 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.1 | 0.8 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
| 0.1 | 1.1 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 0.5 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.1 | 0.5 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 0.1 | 0.4 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.1 | 1.6 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.1 | 0.9 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.1 | 2.4 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.1 | 0.9 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.1 | 0.4 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.1 | 1.0 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 0.2 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.1 | 0.5 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 0.2 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.1 | 0.2 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 0.5 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.1 | 0.5 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.1 | 0.7 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.1 | 2.1 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.1 | 6.6 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.1 | 0.9 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.1 | 3.1 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.1 | 0.7 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.1 | 0.4 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.1 | 1.1 | GO:0033176 | proton-transporting V-type ATPase complex(GO:0033176) |
| 0.1 | 1.2 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.1 | 7.0 | GO:0070469 | respiratory chain(GO:0070469) |
| 0.1 | 10.1 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.1 | 0.3 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.1 | 1.2 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.1 | 0.3 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 0.4 | GO:0031429 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
| 0.1 | 10.2 | GO:0070382 | exocytic vesicle(GO:0070382) |
| 0.1 | 4.2 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.1 | 0.6 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.1 | 1.8 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.1 | 0.3 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 0.2 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.1 | 0.3 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.1 | 0.5 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.1 | 0.6 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 0.9 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 0.1 | 0.6 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 0.4 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.1 | 0.5 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.1 | 0.8 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.1 | 2.0 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.1 | 0.5 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
| 0.1 | 0.4 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.1 | 1.0 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.1 | 0.2 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.1 | 0.5 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 0.7 | GO:0060091 | kinocilium(GO:0060091) |
| 0.1 | 0.5 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.1 | 0.2 | GO:0043511 | inhibin complex(GO:0043511) |
| 0.1 | 0.2 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.1 | 0.1 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.1 | 0.7 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 5.3 | GO:0043204 | perikaryon(GO:0043204) |
| 0.1 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.1 | 0.4 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.1 | 0.8 | GO:0001527 | microfibril(GO:0001527) |
| 0.1 | 1.6 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.1 | 0.7 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.1 | 2.9 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 1.1 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.1 | 0.8 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.1 | 0.6 | GO:0098793 | presynapse(GO:0098793) |
| 0.1 | 0.6 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.1 | 0.2 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.1 | 0.3 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 0.3 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.1 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.1 | 0.5 | GO:0043073 | germ cell nucleus(GO:0043073) |
| 0.1 | 0.2 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.1 | 1.1 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.1 | 0.2 | GO:0044393 | microspike(GO:0044393) |
| 0.1 | 0.2 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.1 | 0.4 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.1 | 0.5 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.1 | 0.3 | GO:0002177 | manchette(GO:0002177) |
| 0.1 | 0.3 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.1 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.1 | 0.5 | GO:0097546 | ciliary base(GO:0097546) |
| 0.1 | 0.2 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.1 | 0.2 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.1 | 0.3 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.1 | 0.6 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.1 | 1.2 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.1 | 0.4 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.1 | 3.0 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.1 | 3.8 | GO:0016607 | nuclear speck(GO:0016607) |
| 0.1 | 0.6 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.4 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.0 | 1.4 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.5 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.9 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 2.1 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
| 0.0 | 0.4 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.2 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.0 | 0.0 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.0 | 0.3 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.0 | 0.5 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.0 | 3.4 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 0.0 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.3 | GO:0031902 | late endosome membrane(GO:0031902) |
| 0.0 | 1.9 | GO:0044306 | neuron projection terminus(GO:0044306) |
| 0.0 | 2.4 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 0.3 | GO:0005858 | axonemal dynein complex(GO:0005858) |
| 0.0 | 0.2 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.0 | 0.0 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.0 | 0.9 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 1.1 | GO:0043197 | dendritic spine(GO:0043197) |
| 0.0 | 2.3 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 0.5 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 1.1 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.0 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.0 | 0.4 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.0 | 0.2 | GO:0016011 | dystroglycan complex(GO:0016011) |
| 0.0 | 1.4 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.0 | 0.2 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 4.1 | GO:0031966 | mitochondrial membrane(GO:0031966) |
| 0.0 | 0.1 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.3 | GO:0033202 | DNA helicase complex(GO:0033202) |
| 0.0 | 0.0 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 0.2 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 0.0 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
| 0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.0 | 0.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.0 | 0.0 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 0.0 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.0 | 0.2 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.0 | GO:0036396 | MIS complex(GO:0036396) |
| 0.0 | 85.9 | GO:0016021 | integral component of membrane(GO:0016021) |
| 0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 1.7 | GO:0005840 | ribosome(GO:0005840) |
| 0.0 | 0.0 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 0.0 | GO:0044447 | axoneme part(GO:0044447) |
| 0.0 | 0.0 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 0.0 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.0 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 0.2 | GO:0070822 | Sin3-type complex(GO:0070822) |
| 0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 0.0 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.0 | 6.0 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
| 1.8 | 7.3 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 1.6 | 4.8 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 1.4 | 4.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 1.3 | 5.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 1.3 | 5.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 1.3 | 6.5 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 1.2 | 3.6 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 1.1 | 3.3 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 1.1 | 5.5 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 1.0 | 3.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 1.0 | 3.0 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 1.0 | 2.9 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.9 | 5.4 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.9 | 2.7 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.8 | 3.2 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.8 | 3.2 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.8 | 0.8 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.8 | 3.9 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.8 | 3.9 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.8 | 2.3 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.8 | 2.3 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.7 | 8.2 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
| 0.7 | 2.2 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.7 | 2.2 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.7 | 3.4 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.7 | 13.0 | GO:0016917 | GABA-A receptor activity(GO:0004890) GABA receptor activity(GO:0016917) |
| 0.7 | 2.1 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.7 | 3.4 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.7 | 7.5 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
| 0.7 | 3.4 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.7 | 4.7 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.7 | 3.3 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.7 | 2.0 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.7 | 1.3 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.6 | 1.9 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.6 | 1.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.6 | 18.5 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.6 | 1.8 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.6 | 2.5 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.6 | 3.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.6 | 6.6 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.6 | 1.8 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.6 | 2.9 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.6 | 1.8 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.6 | 2.8 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
| 0.6 | 3.4 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.6 | 8.3 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.5 | 1.6 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.5 | 1.6 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.5 | 2.7 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.5 | 8.6 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
| 0.5 | 6.9 | GO:0031005 | filamin binding(GO:0031005) |
| 0.5 | 0.5 | GO:0046921 | alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.5 | 2.1 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.5 | 2.1 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.5 | 1.5 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.5 | 3.0 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.5 | 1.5 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.5 | 1.5 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.5 | 1.9 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.5 | 2.8 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.5 | 2.8 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.5 | 1.4 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.5 | 0.5 | GO:0035870 | dITP diphosphatase activity(GO:0035870) XTP diphosphatase activity(GO:0036222) |
| 0.5 | 1.8 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.5 | 1.4 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.5 | 2.3 | GO:0070728 | leucine binding(GO:0070728) |
| 0.5 | 1.8 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) calcium:cation antiporter activity(GO:0015368) |
| 0.5 | 0.5 | GO:0035276 | ethanol binding(GO:0035276) |
| 0.4 | 0.9 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.4 | 1.3 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.4 | 1.3 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.4 | 1.8 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.4 | 4.8 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.4 | 1.3 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.4 | 1.3 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.4 | 5.0 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.4 | 2.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.4 | 4.9 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.4 | 1.2 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.4 | 0.4 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.4 | 2.4 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
| 0.4 | 3.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.4 | 1.5 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.4 | 4.6 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.4 | 1.9 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.4 | 1.9 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.4 | 6.5 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.4 | 3.4 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.4 | 1.9 | GO:0018812 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) |
| 0.4 | 1.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.4 | 1.9 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.4 | 5.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.4 | 2.6 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.4 | 1.1 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.4 | 1.1 | GO:0032142 | single guanine insertion binding(GO:0032142) |
| 0.4 | 1.4 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.4 | 4.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.4 | 1.4 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.4 | 1.8 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.3 | 0.3 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.3 | 1.0 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.3 | 1.0 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.3 | 1.0 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
| 0.3 | 1.4 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.3 | 1.7 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.3 | 2.4 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.3 | 0.3 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.3 | 7.0 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.3 | 3.0 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.3 | 1.9 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
| 0.3 | 4.5 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.3 | 1.3 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.3 | 0.6 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.3 | 0.3 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
| 0.3 | 0.9 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.3 | 0.9 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.3 | 1.8 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
| 0.3 | 1.5 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.3 | 1.2 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.3 | 4.2 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
| 0.3 | 1.2 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.3 | 0.9 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.3 | 3.0 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.3 | 0.9 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.3 | 4.4 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.3 | 1.2 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.3 | 2.0 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.3 | 0.9 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.3 | 0.6 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.3 | 2.8 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.3 | 1.4 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.3 | 0.8 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.3 | 3.6 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.3 | 0.8 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.3 | 1.4 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.3 | 0.6 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.3 | 1.1 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
| 0.3 | 13.2 | GO:0008146 | sulfotransferase activity(GO:0008146) |
| 0.3 | 0.8 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.3 | 1.9 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.3 | 5.1 | GO:0052736 | dextrin alpha-glucosidase activity(GO:0044653) starch alpha-glucosidase activity(GO:0044654) beta-glucanase activity(GO:0052736) beta-6-sulfate-N-acetylglucosaminidase activity(GO:0052769) glucan endo-1,4-beta-glucosidase activity(GO:0052859) |
| 0.3 | 1.6 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.3 | 2.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.3 | 0.3 | GO:0030580 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
| 0.3 | 3.4 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.3 | 1.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.3 | 5.2 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.3 | 1.5 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
| 0.3 | 0.3 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.3 | 0.8 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.2 | 0.7 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.2 | 1.0 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.2 | 2.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.2 | 0.7 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.2 | 0.7 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.2 | 1.0 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.2 | 1.9 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.2 | 1.2 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.2 | 1.9 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.2 | 0.9 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.2 | 1.6 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.2 | 1.8 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.2 | 1.4 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.2 | 0.9 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.2 | 1.8 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.2 | 0.9 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.2 | 5.7 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.2 | 2.2 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.2 | 0.6 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.2 | 1.1 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.2 | 0.8 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.2 | 0.2 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.2 | 0.8 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.2 | 1.7 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.2 | 2.9 | GO:0042923 | neuropeptide binding(GO:0042923) |
| 0.2 | 2.5 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.2 | 1.0 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.2 | 0.6 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.2 | 0.8 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.2 | 0.6 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.2 | 1.0 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.2 | 0.4 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.2 | 1.4 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.2 | 5.3 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.2 | 3.5 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.2 | 0.8 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.2 | 1.2 | GO:0045118 | azole transporter activity(GO:0045118) azole transmembrane transporter activity(GO:1901474) |
| 0.2 | 4.0 | GO:0005537 | mannose binding(GO:0005537) |
| 0.2 | 0.8 | GO:0016595 | glutamate binding(GO:0016595) |
| 0.2 | 2.2 | GO:0005522 | profilin binding(GO:0005522) |
| 0.2 | 1.0 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.2 | 0.6 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.2 | 0.6 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.2 | 0.4 | GO:2001070 | starch binding(GO:2001070) |
| 0.2 | 0.6 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.2 | 0.2 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.2 | 0.6 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.2 | 2.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.2 | 0.6 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.2 | 0.9 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.2 | 1.9 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.2 | 0.6 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.2 | 0.9 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.2 | 0.8 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.2 | 0.7 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.2 | 3.3 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.2 | 1.8 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 0.2 | 0.7 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.2 | 3.1 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.2 | 0.5 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.2 | 0.7 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.2 | 7.3 | GO:0034062 | RNA polymerase activity(GO:0034062) |
| 0.2 | 0.4 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.2 | 3.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.2 | 0.9 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.2 | 0.5 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.2 | 0.4 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.2 | 2.6 | GO:0030553 | cGMP binding(GO:0030553) |
| 0.2 | 5.2 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.2 | 0.5 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
| 0.2 | 8.5 | GO:0035250 | UDP-galactosyltransferase activity(GO:0035250) |
| 0.2 | 0.5 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.2 | 1.6 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
| 0.2 | 1.3 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.2 | 0.7 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.2 | 4.1 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.2 | 0.6 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.2 | 0.6 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.2 | 1.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.2 | 0.5 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.2 | 0.6 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.2 | 0.8 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.2 | 3.3 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.2 | 0.2 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
| 0.2 | 2.4 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.7 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.1 | 0.3 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.1 | 0.6 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.1 | 0.7 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.1 | 4.1 | GO:0005548 | phospholipid transporter activity(GO:0005548) |
| 0.1 | 0.6 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 1.5 | GO:0022821 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) potassium ion antiporter activity(GO:0022821) |
| 0.1 | 0.7 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.1 | 0.4 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.1 | 2.6 | GO:0042166 | acetylcholine binding(GO:0042166) |
| 0.1 | 0.4 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.1 | 0.3 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.1 | 1.3 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
| 0.1 | 0.4 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.6 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 1.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.1 | 4.0 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.3 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.1 | 0.4 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
| 0.1 | 1.0 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.1 | 10.4 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.1 | 0.5 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.1 | 0.3 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 4.6 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
| 0.1 | 0.8 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.1 | 1.5 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.1 | 0.4 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 0.1 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.1 | 0.4 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.1 | 0.4 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.1 | 2.5 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.1 | 0.7 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.1 | 0.6 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.1 | 0.8 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.1 | 2.2 | GO:0005272 | sodium channel activity(GO:0005272) |
| 0.1 | 0.6 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 0.4 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
| 0.1 | 4.6 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.1 | 0.7 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.1 | 1.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.1 | 0.2 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.1 | 0.8 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.1 | 0.5 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.4 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.1 | 1.0 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
| 0.1 | 0.3 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.1 | 0.2 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
| 0.1 | 0.5 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.1 | 0.5 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 2.9 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.1 | 0.1 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.1 | 0.4 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.1 | 2.3 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.1 | 0.7 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 0.4 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 3.0 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.1 | 1.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.1 | 0.4 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 0.7 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.1 | 0.5 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.1 | 0.2 | GO:0016454 | C-palmitoyltransferase activity(GO:0016454) |
| 0.1 | 1.7 | GO:0004118 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.1 | 2.9 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.1 | 1.2 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.1 | 0.6 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.1 | 0.1 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.1 | 0.9 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
| 0.1 | 0.3 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.1 | 1.9 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.1 | 0.4 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.1 | 0.3 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.1 | 0.4 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.1 | 0.5 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 0.3 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.1 | 0.3 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.1 | 0.3 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.1 | 2.3 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.1 | 0.5 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
| 0.1 | 0.9 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.1 | 2.1 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.1 | 0.5 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.1 | 0.4 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.1 | 0.2 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 2.0 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.1 | 0.6 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 0.7 | GO:0050542 | icosanoid binding(GO:0050542) fatty acid derivative binding(GO:1901567) |
| 0.1 | 0.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.1 | 1.7 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.1 | 0.3 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 0.2 | GO:0016428 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.1 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.1 | 0.1 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
| 0.1 | 1.1 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.1 | 0.7 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.1 | 0.2 | GO:0042165 | neurotransmitter binding(GO:0042165) |
| 0.1 | 0.3 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.1 | 0.3 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.1 | 0.2 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.1 | 0.4 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
| 0.1 | 0.3 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.1 | 0.2 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.1 | 0.2 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.1 | 1.3 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.1 | 0.2 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.1 | 0.4 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.1 | 0.9 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
| 0.1 | 0.2 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
| 0.1 | 0.6 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.1 | 0.1 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
| 0.1 | 0.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.3 | GO:0033265 | choline binding(GO:0033265) |
| 0.1 | 0.7 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.1 | 0.7 | GO:0019841 | retinol binding(GO:0019841) |
| 0.1 | 0.2 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.1 | 0.2 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.1 | 0.8 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.1 | 0.3 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.1 | 3.4 | GO:0019003 | GDP binding(GO:0019003) |
| 0.1 | 0.3 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
| 0.1 | 0.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.1 | 0.5 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 0.2 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.1 | 0.3 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.1 | 0.5 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 0.1 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.1 | 1.8 | GO:0016415 | octanoyltransferase activity(GO:0016415) |
| 0.1 | 0.3 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.1 | 0.1 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
| 0.1 | 0.2 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
| 0.1 | 0.1 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) |
| 0.1 | 3.6 | GO:0000149 | SNARE binding(GO:0000149) |
| 0.1 | 0.2 | GO:0030955 | potassium ion binding(GO:0030955) |
| 0.1 | 0.3 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.1 | 0.9 | GO:0008579 | JUN kinase phosphatase activity(GO:0008579) |
| 0.1 | 1.7 | GO:0004601 | peroxidase activity(GO:0004601) |
| 0.1 | 0.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.1 | 0.6 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
| 0.1 | 0.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.1 | 0.4 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.1 | 0.1 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
| 0.1 | 0.2 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 0.6 | GO:0070636 | single-strand selective uracil DNA N-glycosylase activity(GO:0017065) nicotinamide riboside hydrolase activity(GO:0070635) nicotinic acid riboside hydrolase activity(GO:0070636) deoxyribonucleoside 5'-monophosphate N-glycosidase activity(GO:0070694) |
| 0.1 | 0.1 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.1 | 0.3 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
| 0.1 | 0.2 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.1 | 0.4 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.1 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.1 | 0.1 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.1 | 0.3 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.1 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.0 | 0.3 | GO:0022884 | macromolecule transmembrane transporter activity(GO:0022884) |
| 0.0 | 0.1 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 1.0 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.4 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.0 | 0.5 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.0 | 0.2 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 0.9 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
| 0.0 | 1.0 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.2 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.5 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.2 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.0 | 0.0 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.0 | 0.2 | GO:0015925 | galactosidase activity(GO:0015925) |
| 0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.4 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.2 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
| 0.0 | 1.2 | GO:0003678 | DNA helicase activity(GO:0003678) |
| 0.0 | 0.2 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.6 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.0 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.0 | 1.6 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.0 | 0.3 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.7 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.4 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.0 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.0 | 0.1 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
| 0.0 | 1.0 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.0 | 0.4 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.0 | 0.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.1 | GO:0015464 | acetylcholine receptor activity(GO:0015464) |
| 0.0 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
| 0.0 | 0.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.4 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 0.1 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.0 | 0.6 | GO:0005048 | signal sequence binding(GO:0005048) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.0 | 0.6 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.5 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
| 0.0 | 0.4 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 0.8 | GO:0008238 | exopeptidase activity(GO:0008238) |
| 0.0 | 0.0 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.4 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.0 | 0.1 | GO:0008932 | lytic endotransglycosylase activity(GO:0008932) |
| 0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 0.8 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 0.0 | GO:0032138 | single base insertion or deletion binding(GO:0032138) |
| 0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.0 | 0.4 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.0 | 0.1 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.0 | 0.2 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
| 0.0 | 0.2 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.0 | 0.7 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
| 0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.1 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.5 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.0 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.0 | 0.2 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.0 | 0.4 | GO:0030170 | pyridoxal phosphate binding(GO:0030170) |
| 0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.0 | 0.0 | GO:0016631 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.0 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.1 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.0 | 0.1 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
| 0.0 | 0.0 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.0 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.0 | 0.5 | GO:0018602 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
| 0.0 | 0.4 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.0 | GO:0031420 | alkali metal ion binding(GO:0031420) |
| 0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 0.1 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.0 | 0.0 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.1 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.0 | 0.2 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.0 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
| 0.0 | 0.0 | GO:0008147 | structural constituent of bone(GO:0008147) |
| 0.0 | 0.0 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 0.0 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.0 | 0.0 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.1 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.0 | 0.0 | GO:0019767 | IgE receptor activity(GO:0019767) |
| 0.0 | 0.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.0 | GO:0019863 | IgE binding(GO:0019863) |
| 0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
| 0.0 | 0.0 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
| 0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.0 | 0.1 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.0 | 0.0 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.0 | 0.2 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.1 | GO:0005267 | potassium channel activity(GO:0005267) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 1.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.8 | 1.7 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.7 | 2.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.6 | 9.1 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.4 | 8.3 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.4 | 0.4 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.4 | 0.4 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.3 | 6.8 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.3 | 0.3 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.3 | 1.6 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.3 | 3.7 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.2 | 2.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.2 | 0.2 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.2 | 7.6 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.2 | 0.4 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.2 | 1.8 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.2 | 0.3 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.2 | 4.3 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.1 | 0.6 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.1 | 1.4 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.1 | 2.9 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 1.9 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.1 | 0.3 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.1 | 0.2 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.1 | 1.4 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.1 | 1.9 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.1 | 2.8 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.1 | 3.5 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.1 | 0.3 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.1 | 0.5 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.1 | 3.1 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 1.0 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 0.1 | ST ADRENERGIC | Adrenergic Pathway |
| 0.1 | 0.6 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.1 | 1.1 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.1 | 0.6 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 0.2 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.1 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 0.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.1 | 1.6 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.1 | 0.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.8 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.0 | 0.3 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.0 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.0 | 0.2 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 0.3 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.2 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.0 | 0.0 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.5 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.3 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 0.1 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.0 | 0.3 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.4 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.5 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.0 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 0.7 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.3 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.0 | 0.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 0.7 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.4 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.0 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 0.5 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 5.6 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 1.1 | 12.9 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.9 | 14.1 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.6 | 27.1 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.6 | 0.6 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
| 0.6 | 4.9 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.5 | 0.5 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.5 | 1.9 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.5 | 5.5 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
| 0.5 | 2.7 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.4 | 13.1 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.4 | 6.9 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.4 | 3.7 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.4 | 4.0 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.4 | 3.9 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.4 | 4.3 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.4 | 0.8 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.3 | 3.7 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.3 | 6.6 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.3 | 4.4 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.3 | 4.3 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.3 | 2.1 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.3 | 4.1 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.3 | 0.9 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.3 | 3.1 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.3 | 5.3 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.3 | 3.9 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.3 | 1.3 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.3 | 2.9 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.3 | 2.3 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.3 | 0.3 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.2 | 2.6 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.2 | 2.5 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.2 | 2.5 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.2 | 0.9 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.2 | 3.3 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.2 | 2.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.2 | 3.8 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.2 | 6.7 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
| 0.2 | 0.8 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.2 | 1.9 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.2 | 3.1 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.2 | 2.4 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.2 | 1.4 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.2 | 2.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.2 | 10.5 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.2 | 1.5 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.2 | 1.8 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.2 | 2.3 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.2 | 1.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.2 | 1.4 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
| 0.2 | 1.7 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.2 | 4.5 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.2 | 1.1 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.2 | 5.3 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.1 | 0.6 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.1 | 2.8 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.1 | 3.9 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.1 | 1.6 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.1 | 0.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 2.9 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 0.4 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 1.9 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 2.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.1 | 1.3 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.1 | 2.9 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.1 | 4.5 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.1 | 2.0 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.1 | 1.3 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.1 | 2.2 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.1 | 1.2 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 1.6 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 0.7 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.1 | 1.5 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.1 | 1.1 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.1 | 0.9 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.1 | 0.6 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.1 | 5.0 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 0.1 | 0.2 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
| 0.1 | 1.6 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 1.9 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.1 | 2.5 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 0.9 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.1 | 0.5 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.1 | 2.3 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.1 | 1.4 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 0.4 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.1 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.1 | 0.6 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 0.4 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.1 | 0.8 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
| 0.1 | 0.2 | REACTOME P75NTR SIGNALS VIA NFKB | Genes involved in p75NTR signals via NF-kB |
| 0.1 | 1.0 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.1 | 0.3 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 0.3 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.1 | 0.8 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.1 | 2.0 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.1 | 2.6 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.1 | 1.5 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.1 | 0.7 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.1 | 2.4 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.1 | 0.6 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 0.8 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
| 0.1 | 0.3 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.1 | 1.3 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.1 | 3.0 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.1 | 1.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.1 | 1.2 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
| 0.1 | 0.3 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.1 | 0.8 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 0.1 | 0.3 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.1 | 0.8 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.1 | 2.5 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.1 | 8.6 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.1 | 0.6 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.1 | 4.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.1 | 0.7 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 0.5 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.8 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.0 | 0.3 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.3 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 0.4 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.3 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.2 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
| 0.0 | 0.1 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.0 | 1.9 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.6 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.0 | 0.6 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.4 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.3 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.0 | 0.0 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
| 0.0 | 0.4 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.5 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.0 | 0.1 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.0 | 0.3 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 0.2 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
| 0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 0.2 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.5 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 0.0 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
| 0.0 | 0.3 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |