| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Ebf3
|
ENSMUSG00000010476.7 | early B cell factor 3 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr7_137309101_137309265 | Ebf3 | 4733 | 0.219391 | 0.43 | 9.9e-04 | Click! |
| chr7_137309456_137309632 | Ebf3 | 4372 | 0.224229 | 0.42 | 1.6e-03 | Click! |
| chr7_137317681_137317906 | Ebf3 | 3348 | 0.240734 | 0.38 | 4.1e-03 | Click! |
| chr7_137304030_137304181 | Ebf3 | 9811 | 0.195287 | 0.37 | 5.5e-03 | Click! |
| chr7_137289421_137289572 | Ebf3 | 21958 | 0.173857 | 0.32 | 1.7e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr15_34348110_34348431 | 3.35 |
9430069I07Rik |
RIKEN cDNA 9430069I07 gene |
8151 |
0.16 |
| chr2_152024927_152025503 | 2.26 |
Slc52a3 |
solute carrier protein family 52, member 3 |
25318 |
0.12 |
| chr9_46998384_46998535 | 2.15 |
Gm4791 |
predicted gene 4791 |
282 |
0.93 |
| chr13_57611624_57611834 | 2.13 |
Spock1 |
sparc/osteonectin, cwcv and kazal-like domains proteoglycan 1 |
295858 |
0.01 |
| chr5_15993236_15993532 | 2.07 |
Gm43000 |
predicted gene 43000 |
4455 |
0.23 |
| chr14_105016315_105016530 | 2.05 |
Gm5671 |
predicted gene 5671 |
27028 |
0.19 |
| chr10_40737248_40737833 | 1.87 |
Mettl24 |
methyltransferase like 24 |
54258 |
0.13 |
| chr5_139548851_139549214 | 1.70 |
Uncx |
UNC homeobox |
5134 |
0.19 |
| chr11_33670427_33670692 | 1.62 |
Kcnip1 |
Kv channel-interacting protein 1 |
10012 |
0.18 |
| chr16_21869919_21870275 | 1.60 |
Map3k13 |
mitogen-activated protein kinase kinase kinase 13 |
21872 |
0.11 |
| chr1_141137215_141137503 | 1.59 |
Gm4845 |
predicted gene 4845 |
119798 |
0.06 |
| chr1_116489077_116489260 | 1.59 |
Gm23393 |
predicted gene, 23393 |
94755 |
0.09 |
| chr1_155605487_155606141 | 1.58 |
Acbd6 |
acyl-Coenzyme A binding domain containing 6 |
38566 |
0.17 |
| chr1_35528071_35528323 | 1.58 |
Gm37068 |
predicted gene, 37068 |
123100 |
0.06 |
| chr15_72864842_72864993 | 1.57 |
Gm3150 |
predicted gene 3150 |
48440 |
0.15 |
| chr11_76709804_76709963 | 1.56 |
Trarg1 |
trafficking regulator of GLUT4 (SLC2A4) 1 |
30075 |
0.14 |
| chr5_22243650_22243801 | 1.53 |
Gm16113 |
predicted gene 16113 |
37857 |
0.14 |
| chr1_127348346_127348948 | 1.53 |
Gm23370 |
predicted gene, 23370 |
16834 |
0.16 |
| chr14_16554652_16554846 | 1.50 |
Rarb |
retinoic acid receptor, beta |
20296 |
0.21 |
| chr12_103359301_103359475 | 1.50 |
Asb2 |
ankyrin repeat and SOCS box-containing 2 |
3387 |
0.13 |
| chr1_165834309_165834656 | 1.50 |
Gm32999 |
predicted gene, 32999 |
10126 |
0.1 |
| chr7_46116120_46116518 | 1.46 |
Abcc8 |
ATP-binding cassette, sub-family C (CFTR/MRP), member 8 |
269 |
0.84 |
| chr7_136214095_136214250 | 1.46 |
Gm36737 |
predicted gene, 36737 |
40876 |
0.16 |
| chr7_132403928_132404079 | 1.44 |
Gm44893 |
predicted gene 44893 |
16027 |
0.16 |
| chr5_89912145_89912323 | 1.43 |
Adamts3 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 3 |
28900 |
0.23 |
| chr3_109496606_109496769 | 1.43 |
Vav3 |
vav 3 oncogene |
1903 |
0.49 |
| chr19_47518878_47519080 | 1.42 |
Gm19557 |
predicted gene, 19557 |
5997 |
0.17 |
| chr8_35607592_35607749 | 1.41 |
Mfhas1 |
malignant fibrous histiocytoma amplified sequence 1 |
393 |
0.86 |
| chr14_84532521_84532672 | 1.41 |
9630013A20Rik |
RIKEN cDNA 9630013A20 gene |
56172 |
0.15 |
| chr1_78198463_78198654 | 1.39 |
Pax3 |
paired box 3 |
1424 |
0.47 |
| chr10_98543461_98543643 | 1.38 |
Gm34297 |
predicted gene, 34297 |
6070 |
0.28 |
| chr15_85892631_85893116 | 1.38 |
Trmu |
tRNA 5-methylaminomethyl-2-thiouridylate methyltransferase |
296 |
0.86 |
| chr5_15993645_15993826 | 1.37 |
Gm43000 |
predicted gene 43000 |
4104 |
0.23 |
| chr2_118499147_118499298 | 1.36 |
Gm13983 |
predicted gene 13983 |
15045 |
0.14 |
| chr10_69535459_69535866 | 1.36 |
Ank3 |
ankyrin 3, epithelial |
1440 |
0.49 |
| chr1_39394229_39394380 | 1.36 |
Tbc1d8 |
TBC1 domain family, member 8 |
1673 |
0.32 |
| chr5_110553490_110553641 | 1.36 |
Galnt9 |
polypeptide N-acetylgalactosaminyltransferase 9 |
9210 |
0.15 |
| chr1_88237157_88237810 | 1.35 |
Mroh2a |
maestro heat-like repeat family member 2A |
625 |
0.52 |
| chr9_65307231_65307382 | 1.35 |
Clpx |
caseinolytic mitochondrial matrix peptidase chaperone subunit |
2846 |
0.14 |
| chr1_100416777_100417174 | 1.34 |
Gm29667 |
predicted gene 29667 |
134184 |
0.05 |
| chr5_107222744_107222924 | 1.33 |
Gm8145 |
predicted gene 8145 |
18789 |
0.14 |
| chr10_118121607_118122166 | 1.32 |
5330439M10Rik |
RIKEN cDNA 5330439M10 gene |
9369 |
0.16 |
| chrX_52425751_52425916 | 1.31 |
Mir717 |
microRNA 717 |
3318 |
0.3 |
| chr8_5285972_5286176 | 1.31 |
n-R5s94 |
nuclear encoded rRNA 5S 94 |
47039 |
0.17 |
| chr6_72714254_72714642 | 1.28 |
Gm15402 |
predicted gene 15402 |
15234 |
0.13 |
| chr2_141201792_141201962 | 1.28 |
Macrod2os2 |
mono-ADP ribosylhydrolase 2, opposite strand 2 |
30493 |
0.21 |
| chr13_76810564_76810975 | 1.26 |
Mctp1 |
multiple C2 domains, transmembrane 1 |
14438 |
0.26 |
| chr15_58022258_58022537 | 1.26 |
9130401M01Rik |
RIKEN cDNA 9130401M01 gene |
5498 |
0.15 |
| chr2_93126251_93126402 | 1.26 |
Gm13802 |
predicted gene 13802 |
28082 |
0.18 |
| chr15_93063824_93063975 | 1.26 |
Gm18685 |
predicted gene, 18685 |
25331 |
0.19 |
| chr5_31083308_31083483 | 1.25 |
Slc30a3 |
solute carrier family 30 (zinc transporter), member 3 |
4961 |
0.09 |
| chr14_67969837_67970001 | 1.25 |
Dock5 |
dedicator of cytokinesis 5 |
36477 |
0.17 |
| chr15_91634355_91634506 | 1.25 |
4933438A12Rik |
RIKEN cDNA 4933438A12 gene |
36847 |
0.14 |
| chr5_35963768_35964054 | 1.24 |
Afap1 |
actin filament associated protein 1 |
20277 |
0.21 |
| chr2_105023117_105023362 | 1.24 |
Ccdc73 |
coiled-coil domain containing 73 |
6118 |
0.16 |
| chr1_155681235_155681404 | 1.24 |
Acbd6 |
acyl-Coenzyme A binding domain containing 6 |
5672 |
0.23 |
| chr12_104247526_104248046 | 1.24 |
Serpina3h |
serine (or cysteine) peptidase inhibitor, clade A, member 3H |
119 |
0.92 |
| chr17_84405689_84405840 | 1.23 |
Gm24722 |
predicted gene, 24722 |
14335 |
0.2 |
| chr10_8762887_8763091 | 1.22 |
Sash1 |
SAM and SH3 domain containing 1 |
515 |
0.82 |
| chr7_124239994_124240186 | 1.22 |
Gm15338 |
predicted gene 15338 |
53372 |
0.16 |
| chr16_87834575_87834726 | 1.22 |
2810407A14Rik |
RIKEN cDNA 2810407A14 gene |
47078 |
0.15 |
| chr1_118873594_118873797 | 1.21 |
Gm28467 |
predicted gene 28467 |
63559 |
0.11 |
| chr7_122716584_122716735 | 1.21 |
Gm44749 |
predicted gene 44749 |
14741 |
0.2 |
| chr16_32523992_32524226 | 1.21 |
Zdhhc19 |
zinc finger, DHHC domain containing 19 |
24498 |
0.11 |
| chr19_4167148_4167330 | 1.21 |
Carns1 |
carnosine synthase 1 |
2176 |
0.08 |
| chr18_35402290_35402527 | 1.21 |
Sil1 |
endoplasmic reticulum chaperone SIL1 homolog (S. cerevisiae) |
59341 |
0.09 |
| chr9_119634386_119634548 | 1.20 |
Scn10a |
sodium channel, voltage-gated, type X, alpha |
53572 |
0.12 |
| chr7_142330244_142330874 | 1.20 |
Ifitm10 |
interferon induced transmembrane protein 10 |
7463 |
0.09 |
| chr12_4509582_4509733 | 1.19 |
2900045O20Rik |
RIKEN cDNA 2900045O20 gene |
340 |
0.85 |
| chr6_38970443_38970610 | 1.19 |
Tbxas1 |
thromboxane A synthase 1, platelet |
1339 |
0.42 |
| chr6_92869696_92869978 | 1.18 |
Gm15737 |
predicted gene 15737 |
480 |
0.81 |
| chr14_58626986_58627148 | 1.18 |
Gm25614 |
predicted gene, 25614 |
23333 |
0.26 |
| chr5_22009261_22009412 | 1.18 |
Reln |
reelin |
928 |
0.6 |
| chr1_13078284_13078435 | 1.17 |
Gm29283 |
predicted gene 29283 |
9521 |
0.15 |
| chr8_25483421_25483657 | 1.17 |
Gm31045 |
predicted gene, 31045 |
4046 |
0.14 |
| chr8_84934869_84935487 | 1.17 |
Mast1 |
microtubule associated serine/threonine kinase 1 |
2166 |
0.11 |
| chr10_4261525_4261676 | 1.16 |
Akap12 |
A kinase (PRKA) anchor protein (gravin) 12 |
4780 |
0.24 |
| chr5_138076195_138076346 | 1.15 |
Zkscan1 |
zinc finger with KRAB and SCAN domains 1 |
8814 |
0.09 |
| chr17_71949025_71949176 | 1.15 |
Gm49924 |
predicted gene, 49924 |
22070 |
0.23 |
| chr16_9092221_9092372 | 1.15 |
Gm49448 |
predicted gene, 49448 |
12151 |
0.18 |
| chr2_31477677_31477828 | 1.15 |
Ass1 |
argininosuccinate synthetase 1 |
7545 |
0.19 |
| chr13_92735797_92735982 | 1.14 |
Gm5199 |
predicted gene 5199 |
16527 |
0.18 |
| chr4_127365955_127366137 | 1.11 |
Gjb5 |
gap junction protein, beta 5 |
7865 |
0.14 |
| chr13_32764744_32764895 | 1.11 |
Gm27342 |
predicted gene, 27342 |
6617 |
0.16 |
| chr13_12159431_12159582 | 1.11 |
Gm47323 |
predicted gene, 47323 |
1248 |
0.39 |
| chr12_103359502_103359691 | 1.11 |
Asb2 |
ankyrin repeat and SOCS box-containing 2 |
3595 |
0.13 |
| chr4_139639864_139640099 | 1.11 |
Mir7020 |
microRNA 7020 |
4061 |
0.17 |
| chr4_54652062_54652379 | 1.10 |
Gm12480 |
predicted gene 12480 |
317 |
0.87 |
| chr1_178552373_178552554 | 1.10 |
Kif26b |
kinesin family member 26B |
23338 |
0.21 |
| chr15_31292732_31292883 | 1.10 |
Gm49296 |
predicted gene, 49296 |
10718 |
0.14 |
| chr9_43466938_43467236 | 1.10 |
Gm28215 |
predicted gene 28215 |
2335 |
0.29 |
| chr5_35609331_35609878 | 1.10 |
Acox3 |
acyl-Coenzyme A oxidase 3, pristanoyl |
495 |
0.75 |
| chr8_98463471_98463622 | 1.08 |
Gm23494 |
predicted gene, 23494 |
211656 |
0.02 |
| chr18_61335961_61336150 | 1.07 |
Pde6a |
phosphodiesterase 6A, cGMP-specific, rod, alpha |
61032 |
0.07 |
| chr14_33707768_33708211 | 1.07 |
Gm26228 |
predicted gene, 26228 |
63494 |
0.1 |
| chr10_39588362_39588651 | 1.06 |
Gm16364 |
predicted gene 16364 |
54 |
0.97 |
| chr4_32530550_32530721 | 1.05 |
Bach2 |
BTB and CNC homology, basic leucine zipper transcription factor 2 |
29130 |
0.16 |
| chr1_194793377_194793528 | 1.05 |
Plxna2 |
plexin A2 |
11258 |
0.16 |
| chr4_57842868_57843050 | 1.05 |
Pakap |
paralemmin A kinase anchor protein |
2288 |
0.32 |
| chr2_77127019_77127177 | 1.05 |
Ccdc141 |
coiled-coil domain containing 141 |
43478 |
0.14 |
| chr14_69830997_69831190 | 1.04 |
Pebp4 |
phosphatidylethanolamine binding protein 4 |
9327 |
0.17 |
| chrX_12165221_12165372 | 1.04 |
Bcor |
BCL6 interacting corepressor |
4941 |
0.26 |
| chr1_9578784_9578974 | 1.03 |
Gm6161 |
predicted gene 6161 |
4331 |
0.15 |
| chr11_4308611_4309015 | 1.03 |
Gm24803 |
predicted gene, 24803 |
15442 |
0.12 |
| chr4_107348654_107348805 | 1.02 |
Gm12869 |
predicted gene 12869 |
2624 |
0.18 |
| chr15_79741326_79742933 | 1.02 |
Sun2 |
Sad1 and UNC84 domain containing 2 |
14 |
0.89 |
| chr12_65382458_65382659 | 1.02 |
Gm26015 |
predicted gene, 26015 |
23412 |
0.22 |
| chr7_49088814_49088965 | 1.02 |
Gm32849 |
predicted gene, 32849 |
3806 |
0.23 |
| chr6_121166005_121166561 | 1.01 |
Pex26 |
peroxisomal biogenesis factor 26 |
17384 |
0.13 |
| chr6_12785023_12785207 | 1.01 |
Thsd7a |
thrombospondin, type I, domain containing 7A |
35705 |
0.17 |
| chr16_21782025_21782176 | 1.01 |
Ehhadh |
enoyl-Coenzyme A, hydratase/3-hydroxyacyl Coenzyme A dehydrogenase |
5707 |
0.13 |
| chr10_70181869_70182020 | 1.00 |
Ccdc6 |
coiled-coil domain containing 6 |
6897 |
0.21 |
| chr5_120192844_120192995 | 1.00 |
Rbm19 |
RNA binding motif protein 19 |
17194 |
0.19 |
| chr17_50182666_50182817 | 1.00 |
Rftn1 |
raftlin lipid raft linker 1 |
7756 |
0.15 |
| chr4_73163256_73163465 | 1.00 |
Gm25769 |
predicted gene, 25769 |
48703 |
0.17 |
| chr7_19410749_19411152 | 0.99 |
Ckm |
creatine kinase, muscle |
75 |
0.92 |
| chr8_12905294_12905445 | 0.99 |
Mcf2l |
mcf.2 transforming sequence-like |
9887 |
0.11 |
| chr2_31954707_31954858 | 0.99 |
Aif1l |
allograft inflammatory factor 1-like |
4265 |
0.13 |
| chr16_87789654_87789805 | 0.98 |
2810407A14Rik |
RIKEN cDNA 2810407A14 gene |
2157 |
0.35 |
| chr4_120856843_120856999 | 0.98 |
Rims3 |
regulating synaptic membrane exocytosis 3 |
2102 |
0.21 |
| chr6_103377396_103377547 | 0.98 |
Gm44295 |
predicted gene, 44295 |
97485 |
0.07 |
| chr6_90764809_90765015 | 0.98 |
Iqsec1 |
IQ motif and Sec7 domain 1 |
771 |
0.63 |
| chr2_154577420_154577745 | 0.97 |
E2f1 |
E2F transcription factor 1 |
7690 |
0.11 |
| chr16_91746685_91746856 | 0.97 |
Itsn1 |
intersectin 1 (SH3 domain protein 1A) |
9329 |
0.15 |
| chr1_34060654_34060805 | 0.97 |
Dst |
dystonin |
16498 |
0.16 |
| chr7_143300077_143300471 | 0.97 |
Gm37364 |
predicted gene, 37364 |
2576 |
0.2 |
| chr5_139893973_139894324 | 0.96 |
Gm42423 |
predicted gene 42423 |
1661 |
0.32 |
| chr4_150707173_150707528 | 0.96 |
Gm16079 |
predicted gene 16079 |
28558 |
0.17 |
| chr15_86188274_86188597 | 0.96 |
Cerk |
ceramide kinase |
2294 |
0.24 |
| chr8_124141218_124141369 | 0.96 |
Gm3889 |
predicted gene 3889 |
18780 |
0.17 |
| chr6_86875172_86875334 | 0.96 |
Gm44152 |
predicted gene, 44152 |
1467 |
0.31 |
| chr15_82856794_82856945 | 0.96 |
Gm20324 |
predicted gene, 20324 |
42211 |
0.08 |
| chr5_37851494_37851652 | 0.96 |
Msx1 |
msh homeobox 1 |
26990 |
0.16 |
| chr15_11179892_11180210 | 0.95 |
Adamts12 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 12 |
115233 |
0.06 |
| chr4_139771235_139771386 | 0.95 |
Pax7 |
paired box 7 |
61697 |
0.11 |
| chr2_66028839_66029192 | 0.95 |
Galnt3 |
polypeptide N-acetylgalactosaminyltransferase 3 |
65056 |
0.1 |
| chr5_111154673_111154856 | 0.95 |
Gm43677 |
predicted gene 43677 |
3547 |
0.25 |
| chr6_8153097_8153248 | 0.94 |
Col28a1 |
collagen, type XXVIII, alpha 1 |
27002 |
0.18 |
| chr16_87916566_87916764 | 0.94 |
Grik1 |
glutamate receptor, ionotropic, kainate 1 |
7166 |
0.29 |
| chr7_27607656_27607893 | 0.94 |
Akt2 |
thymoma viral proto-oncogene 2 |
26 |
0.96 |
| chr10_57040297_57040501 | 0.93 |
Gm36827 |
predicted gene, 36827 |
58167 |
0.13 |
| chr3_146198903_146199454 | 0.93 |
Mcoln2 |
mucolipin 2 |
7095 |
0.19 |
| chr9_85663212_85663363 | 0.93 |
Gm48842 |
predicted gene, 48842 |
23720 |
0.18 |
| chr11_79674332_79674483 | 0.93 |
Rab11fip4os2 |
RAB11 family interacting protein 4 (class II), opposite strand 2 |
676 |
0.56 |
| chr1_126360942_126361240 | 0.93 |
Gm38177 |
predicted gene, 38177 |
36417 |
0.22 |
| chr5_4731972_4732169 | 0.92 |
Fzd1 |
frizzled class receptor 1 |
25965 |
0.15 |
| chr6_5495964_5496856 | 0.92 |
Pdk4 |
pyruvate dehydrogenase kinase, isoenzyme 4 |
101 |
0.98 |
| chr19_53670851_53671086 | 0.92 |
Rbm20 |
RNA binding motif protein 20 |
6338 |
0.19 |
| chr1_152164865_152165264 | 0.92 |
Gm8964 |
predicted gene 8964 |
36479 |
0.19 |
| chr13_34441425_34441576 | 0.91 |
Gm47120 |
predicted gene, 47120 |
15069 |
0.18 |
| chr5_22031730_22032005 | 0.91 |
Reln |
reelin |
16886 |
0.21 |
| chr5_105110554_105110705 | 0.91 |
Gbp9 |
guanylate-binding protein 9 |
352 |
0.87 |
| chr14_61098125_61098356 | 0.91 |
Gm41168 |
predicted gene, 41168 |
34813 |
0.15 |
| chr5_36373145_36373857 | 0.91 |
Sorcs2 |
sortilin-related VPS10 domain containing receptor 2 |
7583 |
0.22 |
| chr1_152817972_152818175 | 0.91 |
Ncf2 |
neutrophil cytosolic factor 2 |
5496 |
0.16 |
| chr8_117387781_117387932 | 0.91 |
Cmip |
c-Maf inducing protein |
35560 |
0.16 |
| chr11_96857576_96857727 | 0.90 |
Copz2 |
coatomer protein complex, subunit zeta 2 |
3520 |
0.12 |
| chr7_112644756_112644914 | 0.90 |
Gm45473 |
predicted gene 45473 |
7947 |
0.17 |
| chr3_67952529_67952740 | 0.90 |
Iqschfp |
Iqcj and Schip1 fusion protein |
60402 |
0.12 |
| chr18_13896425_13897019 | 0.90 |
Gm50094 |
predicted gene, 50094 |
6748 |
0.26 |
| chr4_123000651_123001088 | 0.90 |
Mycl |
v-myc avian myelocytomatosis viral oncogene lung carcinoma derived |
1530 |
0.32 |
| chr5_121187843_121187994 | 0.89 |
Gm42930 |
predicted gene 42930 |
2922 |
0.17 |
| chr3_105718484_105718635 | 0.89 |
Gm43848 |
predicted gene 43848 |
8588 |
0.11 |
| chr14_41101365_41101516 | 0.89 |
Mat1a |
methionine adenosyltransferase I, alpha |
3595 |
0.15 |
| chr11_116814454_116814927 | 0.89 |
Mxra7 |
matrix-remodelling associated 7 |
13313 |
0.11 |
| chr3_124011754_124011905 | 0.89 |
Gm15399 |
predicted gene 15399 |
26725 |
0.24 |
| chr4_52643943_52644118 | 0.89 |
Toporsl |
topoisomerase I binding, arginine/serine-rich like |
36824 |
0.18 |
| chr6_88717355_88717772 | 0.89 |
Mgll |
monoglyceride lipase |
6849 |
0.13 |
| chr11_109460698_109460850 | 0.89 |
Slc16a6 |
solute carrier family 16 (monocarboxylic acid transporters), member 6 |
5585 |
0.12 |
| chr11_119558324_119558475 | 0.89 |
Gm11762 |
predicted gene 11762 |
9769 |
0.15 |
| chr14_33189340_33189491 | 0.88 |
Wdfy4 |
WD repeat and FYVE domain containing 4 |
3907 |
0.16 |
| chr3_29183893_29184069 | 0.88 |
Gm38029 |
predicted gene, 38029 |
9143 |
0.24 |
| chr4_133656432_133656583 | 0.88 |
Zdhhc18 |
zinc finger, DHHC domain containing 18 |
6353 |
0.13 |
| chr5_130019590_130019741 | 0.88 |
Asl |
argininosuccinate lyase |
4635 |
0.13 |
| chr5_123315324_123315475 | 0.88 |
Gm15857 |
predicted gene 15857 |
5075 |
0.11 |
| chr6_126502827_126503006 | 0.88 |
Kcna5 |
potassium voltage-gated channel, shaker-related subfamily, member 5 |
32496 |
0.16 |
| chr9_67581947_67582250 | 0.87 |
Tln2 |
talin 2 |
22395 |
0.22 |
| chr11_4031679_4031852 | 0.87 |
Sec14l4 |
SEC14-like lipid binding 4 |
18 |
0.96 |
| chr1_75400528_75400709 | 0.87 |
Speg |
SPEG complex locus |
17 |
0.95 |
| chr4_115905730_115906018 | 0.87 |
6430628N08Rik |
RIKEN cDNA 6430628N08 gene |
15208 |
0.11 |
| chr11_46119683_46120006 | 0.87 |
Adam19 |
a disintegrin and metallopeptidase domain 19 (meltrin beta) |
8061 |
0.13 |
| chr15_88831534_88831784 | 0.87 |
Gm23144 |
predicted gene, 23144 |
3641 |
0.16 |
| chr3_96571806_96572214 | 0.87 |
Gm16253 |
predicted gene 16253 |
4974 |
0.08 |
| chr15_78957163_78957314 | 0.87 |
Triobp |
TRIO and F-actin binding protein |
8993 |
0.08 |
| chr11_114040405_114040972 | 0.87 |
Sdk2 |
sidekick cell adhesion molecule 2 |
25287 |
0.2 |
| chr9_27781856_27782007 | 0.87 |
Opcml |
opioid binding protein/cell adhesion molecule-like |
8844 |
0.3 |
| chr5_139243500_139243801 | 0.87 |
Sun1 |
Sad1 and UNC84 domain containing 1 |
2296 |
0.22 |
| chr1_152203275_152203472 | 0.86 |
Gm8964 |
predicted gene 8964 |
74788 |
0.1 |
| chr4_137882730_137882881 | 0.86 |
Gm13012 |
predicted gene 13012 |
607 |
0.76 |
| chr3_141112597_141112774 | 0.86 |
Pdha2 |
pyruvate dehydrogenase E1 alpha 2 |
99670 |
0.08 |
| chr4_67539550_67539701 | 0.86 |
Hmgb1-rs18 |
high mobility group box 1, related sequence 18 |
20693 |
0.27 |
| chr15_103301203_103301447 | 0.86 |
Gm49482 |
predicted gene, 49482 |
260 |
0.84 |
| chr10_128247158_128247309 | 0.85 |
Timeless |
timeless circadian clock 1 |
52 |
0.93 |
| chr15_102377835_102378213 | 0.85 |
Gm23590 |
predicted gene, 23590 |
4144 |
0.1 |
| chr10_94621478_94622295 | 0.85 |
Gm48657 |
predicted gene, 48657 |
1346 |
0.34 |
| chr17_10451515_10451727 | 0.85 |
A230009B12Rik |
RIKEN cDNA A230009B12 gene |
4595 |
0.29 |
| chr14_31662753_31663001 | 0.85 |
Hacl1 |
2-hydroxyacyl-CoA lyase 1 |
21591 |
0.13 |
| chr12_71337990_71338141 | 0.85 |
Gm33016 |
predicted gene, 33016 |
437 |
0.78 |
| chr4_96687381_96687532 | 0.85 |
Cyp2j5 |
cytochrome P450, family 2, subfamily j, polypeptide 5 |
23302 |
0.22 |
| chr11_102401780_102402034 | 0.84 |
Rundc3a |
RUN domain containing 3A |
2049 |
0.15 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.3 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.4 | 1.2 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.3 | 1.0 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
| 0.3 | 1.0 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 0.3 | 1.2 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.2 | 0.7 | GO:0061205 | paramesonephric duct development(GO:0061205) |
| 0.2 | 0.9 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
| 0.2 | 1.1 | GO:0003228 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
| 0.2 | 0.9 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.2 | 0.6 | GO:0003253 | cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
| 0.2 | 0.6 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
| 0.2 | 0.5 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.2 | 0.7 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.2 | 0.5 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.2 | 0.7 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.2 | 0.3 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 0.2 | 0.5 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.2 | 0.5 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.2 | 0.9 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.2 | 0.6 | GO:0060594 | mammary gland specification(GO:0060594) |
| 0.1 | 0.4 | GO:0035910 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
| 0.1 | 0.6 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 0.1 | 0.9 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.1 | 0.3 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.1 | 0.6 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.1 | 0.4 | GO:0060618 | nipple development(GO:0060618) |
| 0.1 | 0.4 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
| 0.1 | 0.4 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
| 0.1 | 0.5 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.1 | 0.5 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.1 | 0.4 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.1 | 0.4 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 0.1 | 0.4 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.1 | 0.5 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.1 | 0.5 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.1 | 0.7 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 | 0.6 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.1 | 0.1 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.1 | 0.3 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.1 | 0.3 | GO:2000591 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 0.1 | 0.8 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.1 | 0.3 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.1 | 0.5 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.1 | 0.3 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.1 | 0.4 | GO:0070295 | renal water absorption(GO:0070295) |
| 0.1 | 0.3 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.1 | 0.2 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
| 0.1 | 0.3 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.1 | 0.3 | GO:0032056 | positive regulation of translation in response to stress(GO:0032056) positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.1 | 0.6 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.1 | 0.2 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
| 0.1 | 0.6 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.1 | 0.3 | GO:0072106 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
| 0.1 | 0.4 | GO:0003383 | apical constriction(GO:0003383) |
| 0.1 | 0.3 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 0.1 | 0.3 | GO:0072092 | ureteric bud invasion(GO:0072092) |
| 0.1 | 0.5 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.1 | 0.3 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
| 0.1 | 0.4 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.1 | 1.3 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 0.4 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.1 | 0.2 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.1 | 0.2 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
| 0.1 | 0.3 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.1 | 0.2 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
| 0.1 | 0.7 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 | 0.2 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.1 | 0.2 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 | 0.4 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.1 | 0.2 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.1 | 0.3 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.1 | 0.6 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 | 0.8 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.1 | 0.2 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
| 0.1 | 0.6 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.1 | 0.6 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.1 | 0.7 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.1 | 0.2 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
| 0.1 | 0.3 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.1 | 0.8 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.1 | 0.4 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.1 | 0.1 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) |
| 0.1 | 0.3 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.1 | 0.2 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.1 | 0.4 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.1 | 0.2 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.1 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.1 | 0.3 | GO:0021778 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.1 | 0.1 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
| 0.1 | 0.6 | GO:0045760 | positive regulation of action potential(GO:0045760) |
| 0.1 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.1 | 0.1 | GO:0003284 | septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
| 0.1 | 0.1 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
| 0.1 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.1 | 0.2 | GO:0030070 | insulin processing(GO:0030070) |
| 0.1 | 0.2 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.1 | 0.2 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.1 | 0.3 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.1 | 0.3 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.1 | 0.1 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.1 | 0.1 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
| 0.1 | 0.8 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.1 | 0.5 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.1 | 0.2 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.1 | 0.1 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
| 0.1 | 0.2 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
| 0.1 | 0.4 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.1 | 0.1 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.1 | 0.3 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.1 | 0.3 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
| 0.1 | 0.2 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
| 0.1 | 0.1 | GO:0061184 | positive regulation of dermatome development(GO:0061184) |
| 0.1 | 0.3 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.1 | 0.9 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
| 0.1 | 0.1 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.1 | 0.4 | GO:0014721 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
| 0.1 | 0.3 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
| 0.1 | 0.3 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.1 | 0.1 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.1 | 0.4 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.1 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.1 | 0.4 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.1 | 0.4 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.1 | 0.2 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.1 | 0.7 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.1 | 0.2 | GO:1905065 | regulation of vascular smooth muscle cell differentiation(GO:1905063) positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.1 | 0.1 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
| 0.1 | 0.1 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.1 | 0.2 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.1 | 0.2 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.1 | 0.3 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
| 0.1 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 | 0.5 | GO:0060068 | vagina development(GO:0060068) |
| 0.1 | 0.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.1 | 0.4 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.1 | 0.2 | GO:1905049 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
| 0.1 | 0.2 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.1 | 0.3 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.1 | 0.1 | GO:0072108 | positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) |
| 0.1 | 0.1 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
| 0.1 | 0.2 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.1 | 0.2 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.1 | 0.1 | GO:0061196 | fungiform papilla development(GO:0061196) |
| 0.1 | 0.1 | GO:0072050 | S-shaped body morphogenesis(GO:0072050) |
| 0.1 | 0.4 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.1 | 0.1 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.1 | 0.1 | GO:0072053 | renal inner medulla development(GO:0072053) |
| 0.1 | 0.4 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 | 0.1 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.1 | 0.3 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.1 | 0.1 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.1 | 0.1 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.1 | 0.4 | GO:0021670 | lateral ventricle development(GO:0021670) |
| 0.1 | 0.1 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.1 | 0.2 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.1 | 0.1 | GO:0002877 | regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
| 0.1 | 0.2 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
| 0.1 | 0.2 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.1 | 0.2 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 0.4 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 | 0.2 | GO:0014745 | negative regulation of muscle adaptation(GO:0014745) |
| 0.1 | 0.2 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.0 | 0.1 | GO:0052203 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.0 | 0.1 | GO:0061624 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.0 | 0.1 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.0 | 0.0 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.0 | 0.3 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.0 | 0.5 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.0 | 0.2 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.0 | 0.2 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.0 | 0.4 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 0.0 | 0.1 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
| 0.0 | 0.5 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.0 | 0.2 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.0 | 0.1 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.0 | 0.2 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 0.1 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.0 | 0.1 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.1 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.0 | 0.0 | GO:0071699 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.0 | 0.0 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
| 0.0 | 0.5 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
| 0.0 | 0.2 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.0 | 0.0 | GO:1903416 | response to glycoside(GO:1903416) |
| 0.0 | 0.4 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.0 | 0.1 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.0 | 0.1 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
| 0.0 | 1.0 | GO:0001958 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 | 0.3 | GO:0003177 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
| 0.0 | 0.4 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.0 | 0.1 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
| 0.0 | 0.2 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 | 0.1 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.0 | 0.3 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.2 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
| 0.0 | 0.2 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 | 0.2 | GO:0097490 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
| 0.0 | 0.0 | GO:2000619 | negative regulation of histone H4-K16 acetylation(GO:2000619) |
| 0.0 | 0.1 | GO:0046101 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.0 | 0.4 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.3 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.0 | 0.8 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
| 0.0 | 0.1 | GO:0071873 | response to norepinephrine(GO:0071873) |
| 0.0 | 0.1 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.0 | 0.1 | GO:0015744 | succinate transport(GO:0015744) |
| 0.0 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.0 | 0.3 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.0 | 0.1 | GO:0042297 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
| 0.0 | 0.0 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
| 0.0 | 0.2 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 0.2 | GO:0006742 | NADP catabolic process(GO:0006742) |
| 0.0 | 0.2 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.0 | 0.2 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.0 | 0.4 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.0 | 0.2 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 0.2 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.0 | 0.5 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.0 | 0.1 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.0 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.0 | 0.0 | GO:0060452 | positive regulation of cardiac muscle contraction(GO:0060452) |
| 0.0 | 0.1 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.0 | 0.1 | GO:0098597 | observational learning(GO:0098597) |
| 0.0 | 0.1 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
| 0.0 | 0.1 | GO:1902548 | negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 0.0 | 0.0 | GO:0060290 | transdifferentiation(GO:0060290) |
| 0.0 | 0.1 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.0 | 0.2 | GO:0022605 | oogenesis stage(GO:0022605) |
| 0.0 | 0.5 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.0 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.0 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
| 0.0 | 0.2 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.0 | 0.2 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.0 | 0.1 | GO:1904139 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
| 0.0 | 0.0 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
| 0.0 | 0.3 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.0 | 0.0 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.0 | 0.2 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.0 | 0.0 | GO:0010159 | specification of organ position(GO:0010159) |
| 0.0 | 0.1 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.0 | 0.2 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
| 0.0 | 0.4 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.0 | 0.5 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.0 | 0.1 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.0 | 0.3 | GO:0086009 | membrane repolarization(GO:0086009) |
| 0.0 | 0.1 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.0 | 0.1 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.0 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.0 | 0.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.0 | 0.1 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.0 | 0.1 | GO:0051944 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.0 | 0.1 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.1 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.0 | 0.7 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.0 | 0.0 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.0 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.0 | 0.1 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.0 | 0.1 | GO:0006551 | leucine metabolic process(GO:0006551) |
| 0.0 | 0.0 | GO:2000974 | negative regulation of pro-B cell differentiation(GO:2000974) |
| 0.0 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.0 | 0.3 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.2 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.9 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
| 0.0 | 0.6 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
| 0.0 | 0.7 | GO:0055013 | cardiac muscle cell development(GO:0055013) |
| 0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.0 | 0.0 | GO:0061316 | canonical Wnt signaling pathway involved in heart development(GO:0061316) canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:0061317) |
| 0.0 | 0.1 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
| 0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.0 | 0.2 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.0 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
| 0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.0 | 0.1 | GO:0061430 | bone trabecula morphogenesis(GO:0061430) |
| 0.0 | 0.0 | GO:0022009 | central nervous system vasculogenesis(GO:0022009) |
| 0.0 | 0.2 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.1 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.0 | 0.1 | GO:0010692 | regulation of alkaline phosphatase activity(GO:0010692) positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.0 | 0.9 | GO:0030890 | positive regulation of B cell proliferation(GO:0030890) |
| 0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.0 | GO:1902947 | regulation of tau-protein kinase activity(GO:1902947) |
| 0.0 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.0 | 0.1 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.0 | 0.0 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 0.0 | 0.4 | GO:0046549 | retinal cone cell development(GO:0046549) |
| 0.0 | 0.1 | GO:0010534 | regulation of activation of JAK2 kinase activity(GO:0010534) |
| 0.0 | 0.3 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 0.0 | 0.1 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.0 | 0.2 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.0 | 0.0 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.0 | 0.1 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
| 0.0 | 0.1 | GO:0010182 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
| 0.0 | 0.2 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.3 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.0 | 0.1 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.0 | 0.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.0 | 0.1 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
| 0.0 | 0.2 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
| 0.0 | 0.1 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.0 | 0.2 | GO:0001946 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
| 0.0 | 0.1 | GO:0015867 | ATP transport(GO:0015867) |
| 0.0 | 0.1 | GO:0001840 | neural plate development(GO:0001840) |
| 0.0 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.0 | 0.2 | GO:0014898 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
| 0.0 | 0.5 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
| 0.0 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
| 0.0 | 0.2 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.0 | 0.1 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.0 | 0.1 | GO:0071870 | cellular response to catecholamine stimulus(GO:0071870) |
| 0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.0 | 0.1 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.0 | 0.0 | GO:0021593 | rhombomere morphogenesis(GO:0021593) |
| 0.0 | 0.1 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 | 0.0 | GO:0042670 | retinal cone cell differentiation(GO:0042670) |
| 0.0 | 0.1 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.0 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
| 0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.0 | 0.1 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.0 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.2 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.0 | 0.2 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 | 0.1 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.0 | 0.1 | GO:0030432 | peristalsis(GO:0030432) |
| 0.0 | 0.1 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.0 | 0.0 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.0 | 0.1 | GO:0097501 | stress response to metal ion(GO:0097501) |
| 0.0 | 1.0 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.0 | 0.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.0 | 0.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.0 | 0.2 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 | 0.1 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.0 | 0.3 | GO:0010611 | regulation of cardiac muscle hypertrophy(GO:0010611) |
| 0.0 | 0.1 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
| 0.0 | 0.1 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
| 0.0 | 0.2 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.0 | 0.1 | GO:0043586 | tongue development(GO:0043586) |
| 0.0 | 0.1 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
| 0.0 | 0.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.3 | GO:0014002 | astrocyte development(GO:0014002) |
| 0.0 | 0.0 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.0 | 0.1 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.0 | 0.0 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.0 | 0.1 | GO:0046037 | GMP metabolic process(GO:0046037) |
| 0.0 | 0.1 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 | 0.0 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.0 | 0.0 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.0 | 0.0 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.0 | 1.4 | GO:0035914 | skeletal muscle cell differentiation(GO:0035914) |
| 0.0 | 0.1 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
| 0.0 | 0.5 | GO:0021696 | cerebellar cortex morphogenesis(GO:0021696) |
| 0.0 | 0.1 | GO:0060044 | negative regulation of cardiac muscle tissue growth(GO:0055022) negative regulation of cardiac muscle cell proliferation(GO:0060044) negative regulation of heart growth(GO:0061117) |
| 0.0 | 0.0 | GO:1902566 | regulation of eosinophil degranulation(GO:0043309) regulation of eosinophil activation(GO:1902566) |
| 0.0 | 0.1 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
| 0.0 | 0.0 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.0 | 0.1 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.0 | 0.2 | GO:0001553 | luteinization(GO:0001553) |
| 0.0 | 0.5 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.0 | 0.0 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.0 | 0.1 | GO:0060231 | mesenchymal to epithelial transition(GO:0060231) |
| 0.0 | 0.1 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 | 0.0 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.3 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
| 0.0 | 0.1 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
| 0.0 | 0.2 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.0 | 0.2 | GO:0051873 | disruption by host of symbiont cells(GO:0051852) killing by host of symbiont cells(GO:0051873) |
| 0.0 | 0.0 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.0 | 0.1 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.0 | 0.4 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.0 | 0.1 | GO:0033668 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
| 0.0 | 0.0 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.0 | 0.0 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
| 0.0 | 0.0 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
| 0.0 | 0.1 | GO:0048619 | hindgut morphogenesis(GO:0007442) embryonic hindgut morphogenesis(GO:0048619) |
| 0.0 | 0.2 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.0 | 0.0 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
| 0.0 | 0.0 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.0 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.0 | 0.0 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.0 | 0.2 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.1 | GO:0042637 | catagen(GO:0042637) |
| 0.0 | 0.0 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.0 | 0.0 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.0 | 0.2 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.1 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.0 | 0.1 | GO:0003417 | growth plate cartilage development(GO:0003417) |
| 0.0 | 0.0 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.0 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.0 | 0.1 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
| 0.0 | 0.0 | GO:0003164 | His-Purkinje system development(GO:0003164) |
| 0.0 | 0.0 | GO:2000053 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 0.0 | 0.2 | GO:0003323 | type B pancreatic cell development(GO:0003323) |
| 0.0 | 0.0 | GO:0008354 | germ cell migration(GO:0008354) |
| 0.0 | 0.1 | GO:0045990 | carbon catabolite regulation of transcription(GO:0045990) |
| 0.0 | 0.0 | GO:0010882 | regulation of cardiac muscle contraction by calcium ion signaling(GO:0010882) |
| 0.0 | 0.1 | GO:0010667 | negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
| 0.0 | 0.2 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
| 0.0 | 0.0 | GO:2000617 | positive regulation of histone H3-K9 acetylation(GO:2000617) |
| 0.0 | 0.2 | GO:0042559 | folic acid-containing compound biosynthetic process(GO:0009396) pteridine-containing compound biosynthetic process(GO:0042559) |
| 0.0 | 0.1 | GO:0010359 | regulation of anion channel activity(GO:0010359) |
| 0.0 | 0.0 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.0 | 0.1 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.0 | 0.0 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.0 | 0.0 | GO:0021578 | hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
| 0.0 | 0.1 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
| 0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
| 0.0 | 0.0 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 0.0 | 0.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 | 0.1 | GO:0072366 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.0 | 0.0 | GO:0042747 | regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) circadian sleep/wake cycle, REM sleep(GO:0042747) |
| 0.0 | 0.0 | GO:0003175 | tricuspid valve development(GO:0003175) |
| 0.0 | 0.2 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 | 0.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 0.0 | 0.1 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
| 0.0 | 0.0 | GO:0060057 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.0 | GO:0030578 | PML body organization(GO:0030578) |
| 0.0 | 0.2 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.0 | 0.0 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
| 0.0 | 0.5 | GO:0042398 | cellular modified amino acid biosynthetic process(GO:0042398) |
| 0.0 | 0.0 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.0 | 0.1 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.0 | 0.1 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.0 | 0.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.1 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.0 | 0.3 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.0 | 0.1 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.0 | 0.0 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.0 | 0.0 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.0 | 0.2 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
| 0.0 | 0.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
| 0.0 | 0.1 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.0 | 0.0 | GO:0060005 | vestibular reflex(GO:0060005) |
| 0.0 | 0.1 | GO:0030828 | positive regulation of cGMP metabolic process(GO:0030825) positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.0 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.0 | 0.1 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.0 | 0.0 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 0.0 | 0.1 | GO:0042983 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.0 | 0.0 | GO:0009180 | ADP biosynthetic process(GO:0006172) purine nucleoside diphosphate biosynthetic process(GO:0009136) purine ribonucleoside diphosphate biosynthetic process(GO:0009180) |
| 0.0 | 0.0 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.0 | 0.0 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.0 | 0.0 | GO:0002692 | negative regulation of cellular extravasation(GO:0002692) |
| 0.0 | 0.0 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
| 0.0 | 0.0 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.0 | 0.0 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.0 | 0.0 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 | 0.0 | GO:0046958 | nonassociative learning(GO:0046958) |
| 0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.0 | 0.7 | GO:0050913 | sensory perception of bitter taste(GO:0050913) |
| 0.0 | 0.1 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.0 | 0.0 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.0 | 0.0 | GO:0008228 | opsonization(GO:0008228) |
| 0.0 | 0.1 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 | 0.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.1 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.0 | 0.1 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.0 | 0.0 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.0 | 0.2 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.0 | 0.0 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
| 0.0 | 0.1 | GO:0045820 | negative regulation of glycolytic process(GO:0045820) |
| 0.0 | 0.2 | GO:0040019 | positive regulation of embryonic development(GO:0040019) |
| 0.0 | 0.0 | GO:0009732 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.0 | 0.1 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.0 | 0.1 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.0 | 0.1 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
| 0.0 | 0.1 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 | 0.2 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.0 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.0 | 0.0 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.0 | 0.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.0 | 0.0 | GO:0036315 | cellular response to sterol(GO:0036315) |
| 0.0 | 0.1 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.0 | 0.3 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.0 | 0.0 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.0 | 0.0 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.0 | 0.0 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.0 | 0.1 | GO:0007028 | cytoplasm organization(GO:0007028) |
| 0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.1 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.0 | 0.0 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.1 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.0 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
| 0.0 | 0.0 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) |
| 0.0 | 0.1 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.0 | 0.1 | GO:0010388 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
| 0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.0 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.0 | 0.1 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
| 0.0 | 0.1 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
| 0.0 | 0.1 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.0 | 0.0 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.0 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
| 0.0 | 0.0 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.0 | 0.0 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.0 | 0.0 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.0 | 0.0 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.0 | 0.1 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
| 0.0 | 0.0 | GO:0010664 | negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.0 | 0.0 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.1 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.0 | GO:0033762 | response to glucagon(GO:0033762) |
| 0.0 | 0.1 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.0 | 0.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.0 | 0.1 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.0 | 0.1 | GO:1900426 | positive regulation of defense response to bacterium(GO:1900426) |
| 0.0 | 0.1 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
| 0.0 | 0.1 | GO:0031049 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
| 0.0 | 0.0 | GO:0060149 | negative regulation of posttranscriptional gene silencing(GO:0060149) negative regulation of gene silencing by RNA(GO:0060967) |
| 0.0 | 0.1 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.0 | 0.2 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.0 | GO:0003215 | cardiac right ventricle morphogenesis(GO:0003215) |
| 0.0 | 0.0 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.0 | 0.0 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 | 0.0 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.0 | 0.2 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.0 | 0.1 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.0 | 0.0 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.0 | 0.1 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
| 0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.0 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.0 | 0.0 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.1 | GO:1901016 | regulation of potassium ion transmembrane transporter activity(GO:1901016) |
| 0.0 | 0.0 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 0.0 | 0.0 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.0 | 0.0 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.0 | 0.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.0 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
| 0.0 | 0.1 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.0 | 0.0 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.0 | 0.0 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.0 | 0.0 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.0 | 0.0 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
| 0.0 | 0.0 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.0 | 0.0 | GO:0090399 | replicative senescence(GO:0090399) |
| 0.0 | 0.0 | GO:0007635 | chemosensory behavior(GO:0007635) |
| 0.0 | 0.2 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.0 | 0.0 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.0 | 0.0 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.0 | 0.0 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.0 | 0.0 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
| 0.0 | 0.1 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.0 | 0.0 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 0.1 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.0 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.0 | 0.1 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
| 0.0 | 0.0 | GO:0019530 | taurine metabolic process(GO:0019530) |
| 0.0 | 0.1 | GO:1901409 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.0 | 0.1 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 | 0.0 | GO:0045356 | positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
| 0.0 | 0.0 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.0 | 0.1 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.0 | 0.0 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.0 | 0.0 | GO:0071451 | cellular response to oxygen radical(GO:0071450) cellular response to superoxide(GO:0071451) |
| 0.0 | 0.0 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.0 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
| 0.0 | 0.1 | GO:0034650 | cortisol metabolic process(GO:0034650) |
| 0.0 | 0.0 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 | 0.0 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.0 | 0.0 | GO:0036314 | response to sterol(GO:0036314) |
| 0.0 | 0.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 0.0 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.0 | 0.0 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
| 0.0 | 0.2 | GO:0010883 | regulation of lipid storage(GO:0010883) |
| 0.0 | 0.1 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
| 0.0 | 0.1 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.0 | 0.0 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.0 | 0.0 | GO:0036508 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
| 0.0 | 0.1 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.0 | 0.0 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
| 0.0 | 0.0 | GO:0070431 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.0 | 0.1 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.0 | 0.1 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.0 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.0 | 0.1 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.7 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.2 | 0.9 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.2 | 0.6 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.2 | 1.4 | GO:0005861 | troponin complex(GO:0005861) |
| 0.2 | 0.5 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.2 | 0.5 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 1.6 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.1 | 0.4 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.1 | 0.4 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.1 | 0.7 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.1 | 0.4 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.1 | 0.1 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.1 | 0.3 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.1 | 0.3 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.1 | 0.4 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.1 | 0.8 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.1 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.1 | 0.7 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.5 | GO:0005587 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 0.1 | 0.7 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.1 | 0.2 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.1 | 0.4 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.1 | 0.2 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.1 | 0.2 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.1 | 0.5 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.1 | 0.7 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.1 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 0.4 | GO:0016342 | catenin complex(GO:0016342) |
| 0.1 | 0.5 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 0.4 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 0.5 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
| 0.1 | 0.5 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.5 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.1 | 0.2 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 0.5 | GO:0060091 | kinocilium(GO:0060091) |
| 0.1 | 0.4 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.1 | 0.5 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 0.4 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.1 | 0.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.1 | 0.8 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.3 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 0.3 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.0 | 0.4 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 0.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.2 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.0 | 0.2 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.0 | 0.3 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.0 | 0.8 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 1.5 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.0 | 0.0 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.0 | 0.8 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.2 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.0 | 0.7 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.2 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 1.1 | GO:0031672 | A band(GO:0031672) |
| 0.0 | 0.6 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.6 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.1 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.1 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.0 | 0.7 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 0.3 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.0 | 0.3 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.0 | 0.4 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.0 | 0.0 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.0 | 1.0 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.0 | 0.0 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.4 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.0 | 0.1 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 0.1 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.0 | 0.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.2 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 0.3 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.3 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.0 | 0.3 | GO:0042627 | chylomicron(GO:0042627) |
| 0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
| 0.0 | 0.5 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.0 | 0.2 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.1 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.0 | 0.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.0 | 0.0 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.2 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 0.0 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
| 0.0 | 0.2 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
| 0.0 | 0.1 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.2 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.1 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 0.1 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
| 0.0 | 0.5 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.2 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.2 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 1.3 | GO:0005604 | basement membrane(GO:0005604) |
| 0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.0 | 0.2 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 0.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 0.0 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.0 | 0.1 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.0 | 0.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.3 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.0 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.0 | 0.0 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.0 | 0.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.0 | 0.9 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.0 | GO:0036396 | MIS complex(GO:0036396) |
| 0.0 | 0.1 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 0.0 | 0.1 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 0.5 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.1 | GO:0005921 | gap junction(GO:0005921) |
| 0.0 | 0.1 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.0 | 0.0 | GO:0043293 | apoptosome(GO:0043293) |
| 0.0 | 0.4 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 0.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 2.1 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
| 0.0 | 0.0 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.0 | 0.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 0.1 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 0.0 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.0 | 0.0 | GO:0030689 | Noc complex(GO:0030689) |
| 0.0 | 0.0 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.0 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.8 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.2 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 0.1 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.1 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.1 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 1.3 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 0.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.0 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.3 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.2 | 0.7 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.2 | 1.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.2 | 0.5 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.2 | 0.7 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.2 | 0.9 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.2 | 0.2 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.2 | 0.6 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.2 | 0.6 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
| 0.2 | 0.7 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.2 | 0.7 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.2 | 0.5 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.2 | 0.5 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.1 | 0.4 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
| 0.1 | 0.3 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.3 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.3 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.1 | 0.6 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 0.6 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.1 | 0.4 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.1 | 0.3 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.1 | 0.3 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.1 | 1.4 | GO:0005521 | lamin binding(GO:0005521) |
| 0.1 | 0.9 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.1 | 0.4 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.1 | 0.5 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.1 | 0.3 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.1 | 0.3 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 0.6 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
| 0.1 | 0.4 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.1 | 0.7 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.1 | 0.4 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 0.4 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.1 | 0.3 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.1 | 0.3 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 0.3 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.1 | 0.4 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.1 | 0.5 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 0.2 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.1 | 0.4 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.1 | 0.4 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.1 | 0.7 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 1.0 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.1 | 0.4 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.1 | 0.4 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.1 | 1.4 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 0.2 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.1 | 0.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.1 | 0.2 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.1 | 0.2 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.1 | 0.2 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.1 | 1.2 | GO:0051183 | vitamin transporter activity(GO:0051183) |
| 0.1 | 1.4 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.1 | 0.3 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.1 | 0.2 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.1 | 0.2 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.1 | 0.2 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.1 | 0.6 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.1 | 0.2 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.1 | 0.2 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.1 | 0.7 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.1 | 0.2 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.1 | 1.4 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.1 | 0.2 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.1 | 1.2 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.1 | 0.3 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 0.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.1 | 0.2 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
| 0.1 | 0.2 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.1 | 0.2 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 0.8 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.0 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
| 0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.0 | 0.7 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.1 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.6 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.6 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.4 | GO:0015254 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
| 0.0 | 0.4 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.0 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.0 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.0 | 0.8 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 0.4 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.4 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
| 0.0 | 0.5 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.1 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.0 | 0.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.1 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.0 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.0 | 0.2 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.7 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 0.1 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
| 0.0 | 0.4 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.6 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.9 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 0.4 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.0 | 0.1 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.0 | 0.5 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.0 | 0.7 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
| 0.0 | 0.0 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.0 | 0.2 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.0 | 0.3 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 0.3 | GO:0048185 | activin binding(GO:0048185) |
| 0.0 | 0.2 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 0.1 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.2 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.0 | 0.5 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.1 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.0 | 0.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.0 | 0.2 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.0 | 0.3 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.4 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.2 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.0 | 0.3 | GO:0090409 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
| 0.0 | 0.5 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.0 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.0 | 0.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.0 | 0.1 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.0 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.0 | 0.4 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.0 | 0.3 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.1 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.0 | 0.2 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.0 | 0.2 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.2 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.0 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
| 0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.0 | 0.2 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.7 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.1 | GO:0018741 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
| 0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.0 | 0.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.0 | 0.1 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
| 0.0 | 0.3 | GO:0070694 | single-strand selective uracil DNA N-glycosylase activity(GO:0017065) nicotinamide riboside hydrolase activity(GO:0070635) nicotinic acid riboside hydrolase activity(GO:0070636) deoxyribonucleoside 5'-monophosphate N-glycosidase activity(GO:0070694) |
| 0.0 | 0.2 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.0 | 0.1 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
| 0.0 | 0.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.0 | 0.3 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.5 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.0 | 0.2 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
| 0.0 | 0.2 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 0.4 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.2 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.2 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.0 | 0.1 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.0 | 1.2 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.0 | 0.1 | GO:0034895 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
| 0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.7 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.1 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.0 | 0.3 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 0.0 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.0 | 0.5 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.5 | GO:0052769 | dextrin alpha-glucosidase activity(GO:0044653) starch alpha-glucosidase activity(GO:0044654) beta-glucanase activity(GO:0052736) beta-6-sulfate-N-acetylglucosaminidase activity(GO:0052769) glucan endo-1,4-beta-glucosidase activity(GO:0052859) |
| 0.0 | 0.1 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.0 | 0.2 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
| 0.0 | 0.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.0 | 0.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.1 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.0 | 0.0 | GO:0001962 | alpha-1,3-galactosyltransferase activity(GO:0001962) |
| 0.0 | 1.5 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.0 | GO:0009931 | calcium-dependent protein kinase C activity(GO:0004698) calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.1 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.0 | 0.3 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.0 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.0 | 0.3 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.0 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 0.3 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.0 | 0.0 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.0 | 0.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.0 | 0.3 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.2 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.3 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.2 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.0 | 0.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.5 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.4 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.1 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.0 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.0 | 0.1 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.0 | 0.1 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 0.1 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.6 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 0.0 | 0.2 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.0 | 0.3 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.0 | 0.2 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 0.8 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.2 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.0 | 0.2 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.0 | GO:0008556 | potassium-transporting ATPase activity(GO:0008556) |
| 0.0 | 0.2 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.0 | 0.4 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.1 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.4 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
| 0.0 | 0.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.0 | 0.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.1 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.0 | 0.1 | GO:0030546 | receptor activator activity(GO:0030546) |
| 0.0 | 0.1 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.0 | 0.5 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.0 | 0.2 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.0 | 0.0 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.0 | 0.1 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
| 0.0 | 0.2 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.0 | 0.1 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.0 | 0.2 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.0 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 0.0 | GO:0019976 | interleukin-2 binding(GO:0019976) |
| 0.0 | 0.1 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.0 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.0 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 0.1 | GO:0044682 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
| 0.0 | 0.0 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 0.0 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 0.6 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
| 0.0 | 0.0 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.6 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
| 0.0 | 0.1 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
| 0.0 | 0.3 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.0 | 0.0 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.0 | 0.1 | GO:0043236 | laminin binding(GO:0043236) |
| 0.0 | 0.0 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.0 | 0.1 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.0 | 0.1 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.0 | 0.0 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.1 | GO:0042299 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
| 0.0 | 0.2 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.0 | 0.0 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
| 0.0 | 0.5 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.0 | 0.0 | GO:0015928 | fucosidase activity(GO:0015928) |
| 0.0 | 0.1 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 0.2 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.1 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.1 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.1 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.0 | 0.1 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 0.0 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) tetrahydrobiopterin binding(GO:0034617) |
| 0.0 | 0.1 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.0 | 0.1 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.0 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.0 | 0.2 | GO:0045182 | translation regulator activity(GO:0045182) |
| 0.0 | 0.1 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
| 0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 0.4 | GO:0043914 | NADPH:sulfur oxidoreductase activity(GO:0043914) |
| 0.0 | 0.0 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 0.0 | GO:0070717 | poly-purine tract binding(GO:0070717) |
| 0.0 | 0.0 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.0 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.0 | 0.1 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.1 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
| 0.0 | 0.0 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.0 | 0.2 | GO:0022840 | leak channel activity(GO:0022840) potassium ion leak channel activity(GO:0022841) narrow pore channel activity(GO:0022842) |
| 0.0 | 0.1 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.0 | 0.0 | GO:0045340 | mercury ion binding(GO:0045340) |
| 0.0 | 0.1 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
| 0.0 | 0.0 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.0 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.0 | 0.2 | GO:0038024 | cargo receptor activity(GO:0038024) |
| 0.0 | 0.0 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.0 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.1 | GO:0015922 | aspartate oxidase activity(GO:0015922) |
| 0.0 | 0.6 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 0.0 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.4 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.0 | 0.0 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.1 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.0 | 0.0 | GO:0038100 | nodal binding(GO:0038100) |
| 0.0 | 0.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.1 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.0 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.0 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.0 | 0.0 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.0 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.0 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.0 | 0.8 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.2 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.1 | 1.4 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 0.2 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.1 | 0.6 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.1 | 0.9 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 1.4 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.1 | 0.1 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 1.4 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 0.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 1.3 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.2 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 1.1 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.8 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.2 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.4 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 0.4 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.8 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.4 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.8 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.4 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 0.2 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.9 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.3 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 0.8 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.2 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 3.5 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 0.3 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 0.3 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 0.3 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.0 | 0.2 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.4 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 1.0 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 0.3 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 0.4 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 0.4 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.3 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.1 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.0 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.0 | 0.3 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.2 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.2 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 2.9 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.2 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.2 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.0 | 0.1 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 0.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.2 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.0 | 0.0 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.2 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.2 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 0.4 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 0.1 | ST GA13 PATHWAY | G alpha 13 Pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.9 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 3.4 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.1 | 1.0 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.1 | 0.3 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.1 | 0.5 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.1 | 0.8 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.1 | 0.8 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 0.7 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 0.6 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.1 | 0.6 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.1 | 1.4 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.1 | 0.3 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.1 | 1.4 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
| 0.1 | 1.0 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.1 | 1.1 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 0.3 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.7 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 0.8 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 0.6 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.4 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.6 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.0 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.4 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.8 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.0 | 0.4 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.0 | 0.4 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.5 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 0.5 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.7 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 0.8 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.0 | 0.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.3 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 0.1 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 0.3 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.0 | 0.1 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.6 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 1.4 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.2 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.0 | 1.0 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.3 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 0.2 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.0 | 0.2 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 0.2 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.1 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.0 | 0.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
| 0.0 | 0.2 | REACTOME GABA B RECEPTOR ACTIVATION | Genes involved in GABA B receptor activation |
| 0.0 | 0.0 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.0 | 0.2 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 0.0 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.0 | 0.1 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
| 0.0 | 0.1 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.0 | 0.0 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.0 | 0.4 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 0.2 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.0 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.2 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.0 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.0 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.0 | 0.2 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 0.3 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.0 | 0.2 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 0.5 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.2 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.1 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 0.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.2 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.1 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.0 | 0.1 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.0 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.0 | 0.4 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.0 | 0.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 0.1 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.0 | 0.0 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 0.1 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.0 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.1 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.0 | 0.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.3 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
| 0.0 | 0.4 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 2.1 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.0 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
| 0.0 | 0.0 | REACTOME NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Neurotransmitter Release Cycle |
| 0.0 | 0.1 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.0 | 0.3 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.0 | 0.1 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.0 | 0.0 | REACTOME ACTIVATION OF NMDA RECEPTOR UPON GLUTAMATE BINDING AND POSTSYNAPTIC EVENTS | Genes involved in Activation of NMDA receptor upon glutamate binding and postsynaptic events |
| 0.0 | 0.1 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.1 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |