| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Epas1
|
ENSMUSG00000024140.9 | endothelial PAS domain protein 1 |
|
Bcl3
|
ENSMUSG00000053175.10 | B cell leukemia/lymphoma 3 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr7_19830762_19831141 | Bcl3 | 8181 | 0.071844 | -0.49 | 1.4e-04 | Click! |
| chr7_19824135_19824502 | Bcl3 | 1548 | 0.174950 | -0.47 | 3.4e-04 | Click! |
| chr7_19823826_19824116 | Bcl3 | 1201 | 0.231732 | -0.42 | 1.6e-03 | Click! |
| chr7_19831158_19831384 | Bcl3 | 8501 | 0.071381 | -0.40 | 2.6e-03 | Click! |
| chr7_19822671_19822993 | Bcl3 | 62 | 0.926936 | -0.36 | 6.4e-03 | Click! |
| chr17_86801338_86801489 | Epas1 | 22920 | 0.150063 | -0.61 | 9.6e-07 | Click! |
| chr17_86815555_86815706 | Epas1 | 8703 | 0.176391 | -0.59 | 2.4e-06 | Click! |
| chr17_86815400_86815551 | Epas1 | 8858 | 0.175999 | -0.54 | 1.8e-05 | Click! |
| chr17_86800656_86800807 | Epas1 | 23602 | 0.148711 | -0.54 | 2.2e-05 | Click! |
| chr17_86815132_86815283 | Epas1 | 9126 | 0.175348 | -0.52 | 3.9e-05 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr7_79514073_79514898 | 8.89 |
Mir9-3hg |
Mir9-3 host gene |
747 |
0.39 |
| chr6_142868172_142868331 | 8.54 |
St8sia1 |
ST8 alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase 1 |
14789 |
0.19 |
| chr18_60926924_60927473 | 7.61 |
Camk2a |
calcium/calmodulin-dependent protein kinase II alpha |
249 |
0.89 |
| chr19_26770682_26770835 | 6.23 |
Smarca2 |
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily a, member 2 |
267 |
0.93 |
| chr13_59091694_59091997 | 6.01 |
4930415C11Rik |
RIKEN cDNA 4930415C11 gene |
7752 |
0.18 |
| chr6_138424645_138424892 | 5.80 |
Lmo3 |
LIM domain only 3 |
153 |
0.94 |
| chr13_84059070_84059621 | 5.73 |
Gm17750 |
predicted gene, 17750 |
5427 |
0.24 |
| chr6_8956269_8957017 | 5.52 |
Nxph1 |
neurexophilin 1 |
6967 |
0.32 |
| chr7_64697335_64697486 | 5.30 |
Apba2 |
amyloid beta (A4) precursor protein-binding, family A, member 2 |
31992 |
0.2 |
| chr4_22491414_22491594 | 5.20 |
Gm30731 |
predicted gene, 30731 |
956 |
0.5 |
| chr3_88207026_88207397 | 5.12 |
Gm3764 |
predicted gene 3764 |
101 |
0.91 |
| chr9_44456821_44456985 | 5.12 |
Upk2 |
uroplakin 2 |
1927 |
0.12 |
| chr16_97008193_97008472 | 5.07 |
Gm32432 |
predicted gene, 32432 |
89575 |
0.09 |
| chr1_176098797_176098986 | 5.06 |
Gm38081 |
predicted gene, 38081 |
66168 |
0.1 |
| chr2_94246412_94247550 | 4.97 |
Mir670hg |
MIR670 host gene (non-protein coding) |
3643 |
0.17 |
| chr13_18282734_18282900 | 4.90 |
Pou6f2 |
POU domain, class 6, transcription factor 2 |
96331 |
0.08 |
| chr13_84755453_84755617 | 4.89 |
Gm26913 |
predicted gene, 26913 |
64594 |
0.14 |
| chr5_118156978_118157626 | 4.86 |
Fbxw8 |
F-box and WD-40 domain protein 8 |
1838 |
0.27 |
| chr10_106469332_106470360 | 4.77 |
Ppfia2 |
protein tyrosine phosphatase, receptor type, f polypeptide (PTPRF), interacting protein (liprin), alpha 2 |
493 |
0.82 |
| chr10_29145120_29145386 | 4.76 |
Gm9996 |
predicted gene 9996 |
1059 |
0.37 |
| chr5_112239158_112239879 | 4.70 |
Miat |
myocardial infarction associated transcript (non-protein coding) |
10123 |
0.11 |
| chr11_19074209_19074496 | 4.67 |
4933406G16Rik |
RIKEN cDNA 4933406G16 gene |
9076 |
0.18 |
| chr18_45268664_45269252 | 4.66 |
Kcnn2 |
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 2 |
47 |
0.98 |
| chr3_8510910_8511440 | 4.66 |
Stmn2 |
stathmin-like 2 |
1589 |
0.43 |
| chr16_85307927_85308308 | 4.52 |
App |
amyloid beta (A4) precursor protein |
134351 |
0.05 |
| chr13_116575435_116575586 | 4.49 |
Gm47913 |
predicted gene, 47913 |
88026 |
0.08 |
| chr8_4212633_4214018 | 4.42 |
Prr36 |
proline rich 36 |
3587 |
0.11 |
| chr15_102789205_102789501 | 4.39 |
Gm49473 |
predicted gene, 49473 |
6018 |
0.16 |
| chr4_22488420_22489023 | 4.36 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
355 |
0.83 |
| chr2_45225819_45225975 | 4.35 |
Gm28643 |
predicted gene 28643 |
68972 |
0.11 |
| chr2_11362664_11362836 | 4.34 |
Gm37730 |
predicted gene, 37730 |
4701 |
0.12 |
| chr11_19523869_19524493 | 4.33 |
Gm12027 |
predicted gene 12027 |
103880 |
0.07 |
| chr7_93061692_93062023 | 4.30 |
Fam181b |
family with sequence similarity 181, member B |
18008 |
0.16 |
| chr12_17558078_17558276 | 4.29 |
Gm36862 |
predicted gene, 36862 |
478 |
0.75 |
| chr2_152069478_152069822 | 4.28 |
AA387200 |
expressed sequence AA387200 |
7158 |
0.15 |
| chr8_120518680_120519145 | 4.21 |
Gm26971 |
predicted gene, 26971 |
1703 |
0.26 |
| chr1_160351625_160351791 | 4.19 |
Rabgap1l |
RAB GTPase activating protein 1-like |
137 |
0.95 |
| chr12_29527021_29527799 | 4.19 |
Myt1l |
myelin transcription factor 1-like |
974 |
0.61 |
| chr11_57583351_57583694 | 4.16 |
Gm12243 |
predicted gene 12243 |
11010 |
0.18 |
| chr9_91368271_91368422 | 4.15 |
Zic4 |
zinc finger protein of the cerebellum 4 |
21 |
0.96 |
| chr15_4378780_4379184 | 4.12 |
Plcxd3 |
phosphatidylinositol-specific phospholipase C, X domain containing 3 |
3478 |
0.36 |
| chr1_95665024_95665346 | 4.05 |
St8sia4 |
ST8 alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase 4 |
2350 |
0.31 |
| chr9_22017445_22017792 | 4.04 |
Elavl3 |
ELAV like RNA binding protein 3 |
8756 |
0.08 |
| chr2_91183220_91183936 | 3.98 |
Madd |
MAP-kinase activating death domain |
240 |
0.86 |
| chrX_164269205_164269889 | 3.98 |
Pir |
pirin |
0 |
0.96 |
| chr2_65847807_65847994 | 3.97 |
Csrnp3 |
cysteine-serine-rich nuclear protein 3 |
2045 |
0.35 |
| chr3_127749245_127749655 | 3.96 |
Gm23279 |
predicted gene, 23279 |
17856 |
0.1 |
| chr8_71728606_71728807 | 3.93 |
Fcho1 |
FCH domain only 1 |
2990 |
0.13 |
| chr1_173329233_173329707 | 3.93 |
Ackr1 |
atypical chemokine receptor 1 (Duffy blood group) |
4032 |
0.17 |
| chr1_5022831_5023607 | 3.90 |
Rgs20 |
regulator of G-protein signaling 20 |
3680 |
0.21 |
| chr2_122079818_122079969 | 3.90 |
Spg11 |
SPG11, spatacsin vesicle trafficking associated |
38403 |
0.1 |
| chr9_26733864_26734443 | 3.88 |
B3gat1 |
beta-1,3-glucuronyltransferase 1 (glucuronosyltransferase P) |
302 |
0.88 |
| chr8_84934162_84934313 | 3.86 |
Mast1 |
microtubule associated serine/threonine kinase 1 |
3107 |
0.09 |
| chr11_31831040_31831254 | 3.86 |
Gm12107 |
predicted gene 12107 |
1513 |
0.4 |
| chr16_77852087_77852674 | 3.77 |
Gm17333 |
predicted gene, 17333 |
5776 |
0.27 |
| chrX_143902215_143902612 | 3.74 |
Dcx |
doublecortin |
30637 |
0.2 |
| chr4_9323737_9324016 | 3.74 |
Clvs1 |
clavesin 1 |
11733 |
0.24 |
| chr2_18051526_18051808 | 3.72 |
Skida1 |
SKI/DACH domain containing 1 |
2616 |
0.15 |
| chr5_111414144_111414882 | 3.70 |
Mn1 |
meningioma 1 |
2849 |
0.22 |
| chr7_3330567_3330978 | 3.69 |
Prkcg |
protein kinase C, gamma |
1934 |
0.16 |
| chr3_80800657_80801686 | 3.68 |
Gria2 |
glutamate receptor, ionotropic, AMPA2 (alpha 2) |
1408 |
0.52 |
| chr4_83501314_83501465 | 3.63 |
Gm11414 |
predicted gene 11414 |
628 |
0.62 |
| chr3_17326409_17326732 | 3.61 |
Gm30340 |
predicted gene, 30340 |
7855 |
0.24 |
| chr12_103314451_103314805 | 3.60 |
Gm29508 |
predicted gene 29508 |
141 |
0.71 |
| chr13_90644333_90644489 | 3.59 |
Gm36966 |
predicted gene, 36966 |
10326 |
0.25 |
| chr1_42694593_42694777 | 3.58 |
Pantr1 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 1 |
123 |
0.5 |
| chr15_85462012_85462163 | 3.54 |
7530416G11Rik |
RIKEN cDNA 7530416G11 gene |
41140 |
0.14 |
| chr7_72774133_72774289 | 3.53 |
Gm7693 |
predicted gene 7693 |
60590 |
0.12 |
| chr12_88860370_88860732 | 3.48 |
Nrxn3 |
neurexin III |
65112 |
0.13 |
| chr17_43952637_43953575 | 3.48 |
Rcan2 |
regulator of calcineurin 2 |
9 |
0.99 |
| chr2_113217112_113217567 | 3.47 |
Ryr3 |
ryanodine receptor 3 |
243 |
0.95 |
| chr6_88942621_88943289 | 3.46 |
4933427D06Rik |
RIKEN cDNA 4933427D06 gene |
7728 |
0.14 |
| chr3_80802510_80803270 | 3.43 |
Gria2 |
glutamate receptor, ionotropic, AMPA2 (alpha 2) |
55 |
0.98 |
| chr3_73053654_73054054 | 3.42 |
Slitrk3 |
SLIT and NTRK-like family, member 3 |
3089 |
0.24 |
| chr6_119328862_119329613 | 3.42 |
Lrtm2 |
leucine-rich repeats and transmembrane domains 2 |
33 |
0.97 |
| chr7_94042462_94042787 | 3.38 |
Gm32647 |
predicted gene, 32647 |
67 |
0.99 |
| chr16_45723055_45723347 | 3.37 |
Tagln3 |
transgelin 3 |
1407 |
0.33 |
| chr7_44443191_44443771 | 3.36 |
Lrrc4b |
leucine rich repeat containing 4B |
744 |
0.4 |
| chr2_180898324_180898475 | 3.36 |
Gm27032 |
predicted gene, 27032 |
4294 |
0.11 |
| chrX_100768867_100769160 | 3.34 |
Dlg3 |
discs large MAGUK scaffold protein 3 |
1018 |
0.48 |
| chr4_124035183_124035559 | 3.34 |
Gm12902 |
predicted gene 12902 |
109137 |
0.05 |
| chr5_137733670_137734242 | 3.34 |
Nyap1 |
neuronal tyrosine-phosphorylated phosphoinositide 3-kinase adaptor 1 |
5762 |
0.09 |
| chr12_70368116_70368285 | 3.33 |
Trim9 |
tripartite motif-containing 9 |
20586 |
0.17 |
| chr9_120481714_120481865 | 3.33 |
Eif1b |
eukaryotic translation initiation factor 1B |
10443 |
0.14 |
| chr6_39870574_39870972 | 3.31 |
Tmem178b |
transmembrane protein 178B |
688 |
0.54 |
| chr4_81567754_81568245 | 3.31 |
Gm11765 |
predicted gene 11765 |
106267 |
0.07 |
| chr6_24956687_24956854 | 3.31 |
Tmem229a |
transmembrane protein 229A |
473 |
0.84 |
| chr13_104914342_104914493 | 3.29 |
Gm4938 |
predicted pseudogene 4938 |
4363 |
0.27 |
| chr9_27307751_27307915 | 3.26 |
Igsf9b |
immunoglobulin superfamily, member 9B |
8605 |
0.2 |
| chr9_21953247_21953604 | 3.21 |
Swsap1 |
SWIM type zinc finger 7 associated protein 1 |
2330 |
0.14 |
| chr18_14305121_14305422 | 3.19 |
Gm50095 |
predicted gene, 50095 |
3116 |
0.25 |
| chr2_116975074_116976384 | 3.18 |
Gm29340 |
predicted gene 29340 |
699 |
0.69 |
| chr5_103160778_103160955 | 3.18 |
Mapk10 |
mitogen-activated protein kinase 10 |
45063 |
0.16 |
| chr19_18889594_18889774 | 3.17 |
Trpm6 |
transient receptor potential cation channel, subfamily M, member 6 |
49047 |
0.16 |
| chr1_42703489_42704501 | 3.16 |
Pantr2 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 2 |
4057 |
0.16 |
| chr1_172313332_172313682 | 3.14 |
Igsf8 |
immunoglobulin superfamily, member 8 |
1140 |
0.32 |
| chr2_93177725_93177902 | 3.14 |
Trp53i11 |
transformation related protein 53 inducible protein 11 |
9735 |
0.22 |
| chr5_116809853_116810153 | 3.10 |
Gm29926 |
predicted gene, 29926 |
1228 |
0.47 |
| chr12_90132535_90132958 | 3.10 |
Gm48700 |
predicted gene, 48700 |
64647 |
0.14 |
| chr17_55969161_55969943 | 3.10 |
Shd |
src homology 2 domain-containing transforming protein D |
915 |
0.34 |
| chr1_59574324_59574829 | 3.09 |
Gm973 |
predicted gene 973 |
7820 |
0.15 |
| chr4_101235020_101235347 | 3.09 |
Gm12785 |
predicted gene 12785 |
24596 |
0.12 |
| chr18_25549247_25549440 | 3.08 |
Celf4 |
CUGBP, Elav-like family member 4 |
48104 |
0.15 |
| chr7_31149516_31150411 | 3.07 |
G630030J09Rik |
RIKEN cDNA G630030J09 gene |
435 |
0.6 |
| chr3_148992115_148992398 | 3.07 |
Adgrl2 |
adhesion G protein-coupled receptor L2 |
1701 |
0.32 |
| chr19_17491315_17491685 | 3.07 |
Rfk |
riboflavin kinase |
94063 |
0.08 |
| chr18_5979242_5979943 | 3.07 |
Gm34804 |
predicted gene, 34804 |
34409 |
0.16 |
| chr17_90089075_90089226 | 3.06 |
Nrxn1 |
neurexin I |
750 |
0.78 |
| chr8_84945228_84946066 | 3.05 |
Rtbdn |
retbindin |
1344 |
0.18 |
| chr15_76520651_76521002 | 3.03 |
Scrt1 |
scratch family zinc finger 1 |
1076 |
0.25 |
| chr7_96780709_96780907 | 3.03 |
Tenm4 |
teneurin transmembrane protein 4 |
2874 |
0.24 |
| chr11_74589556_74589981 | 3.02 |
Rap1gap2 |
RAP1 GTPase activating protein 2 |
356 |
0.87 |
| chr18_64265188_64265726 | 3.01 |
St8sia3 |
ST8 alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase 3 |
529 |
0.73 |
| chr2_21963373_21963743 | 3.00 |
Gm13337 |
predicted gene 13337 |
104268 |
0.08 |
| chr8_10794231_10794526 | 3.00 |
Rps16-ps3 |
ribosomal protein S16, pseudogene 3 |
14750 |
0.14 |
| chr7_73222985_73223145 | 2.99 |
Gm30075 |
predicted gene, 30075 |
15466 |
0.16 |
| chr8_31964549_31964718 | 2.98 |
Nrg1 |
neuregulin 1 |
14576 |
0.26 |
| chr17_93312747_93312913 | 2.97 |
Gm9665 |
predicted gene 9665 |
4431 |
0.23 |
| chr7_119184201_119185061 | 2.96 |
Gpr139 |
G protein-coupled receptor 139 |
28 |
0.98 |
| chr3_146101045_146101508 | 2.94 |
Wdr63 |
WD repeat domain 63 |
6854 |
0.16 |
| chr4_124881095_124881246 | 2.94 |
Epha10 |
Eph receptor A10 |
271 |
0.84 |
| chr2_147180375_147180526 | 2.91 |
Nkx2-2os |
NK2 homeobox 2, opposite strand |
3633 |
0.18 |
| chr2_150643351_150643502 | 2.91 |
Acss1 |
acyl-CoA synthetase short-chain family member 1 |
5311 |
0.14 |
| chr15_25416367_25416674 | 2.90 |
Gm48957 |
predicted gene, 48957 |
1457 |
0.31 |
| chr10_26912954_26913105 | 2.90 |
Gm48084 |
predicted gene, 48084 |
36711 |
0.15 |
| chr5_128952279_128952430 | 2.90 |
Rimbp2 |
RIMS binding protein 2 |
679 |
0.74 |
| chr9_124439329_124439899 | 2.89 |
Ppp2r3d |
protein phosphatase 2 (formerly 2A), regulatory subunit B'', delta |
1254 |
0.4 |
| chr9_21196197_21196830 | 2.89 |
Pde4a |
phosphodiesterase 4A, cAMP specific |
192 |
0.89 |
| chr18_43391530_43392018 | 2.89 |
Dpysl3 |
dihydropyrimidinase-like 3 |
1603 |
0.44 |
| chr1_81593210_81593372 | 2.88 |
Gm6198 |
predicted gene 6198 |
35808 |
0.21 |
| chr7_46422711_46423348 | 2.88 |
Kcnc1 |
potassium voltage gated channel, Shaw-related subfamily, member 1 |
349 |
0.86 |
| chr6_116056658_116057229 | 2.88 |
Tmcc1 |
transmembrane and coiled coil domains 1 |
12 |
0.98 |
| chr2_62047014_62047411 | 2.86 |
Slc4a10 |
solute carrier family 4, sodium bicarbonate cotransporter-like, member 10 |
567 |
0.84 |
| chr6_142964266_142965074 | 2.86 |
St8sia1 |
ST8 alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase 1 |
218 |
0.91 |
| chr4_65686606_65687272 | 2.86 |
Trim32 |
tripartite motif-containing 32 |
81690 |
0.12 |
| chr18_59062171_59062581 | 2.86 |
Minar2 |
membrane integral NOTCH2 associated receptor 2 |
86 |
0.98 |
| chr12_29528033_29528231 | 2.85 |
Myt1l |
myelin transcription factor 1-like |
252 |
0.93 |
| chr2_58568532_58569073 | 2.85 |
Upp2 |
uridine phosphorylase 2 |
1415 |
0.37 |
| chr2_169405169_169405320 | 2.84 |
4930529I22Rik |
RIKEN cDNA 4930529I22 gene |
206 |
0.95 |
| chr14_118321933_118322131 | 2.84 |
Gm32093 |
predicted gene, 32093 |
945 |
0.47 |
| chr6_83172221_83172546 | 2.84 |
Gm15624 |
predicted gene 15624 |
171 |
0.87 |
| chr4_71483702_71483853 | 2.83 |
Rps18-ps1 |
ribosomal protein S18, pseudogene 1 |
112581 |
0.07 |
| chr5_37241363_37242150 | 2.82 |
Crmp1 |
collapsin response mediator protein 1 |
184 |
0.95 |
| chr6_45059816_45060136 | 2.82 |
Cntnap2 |
contactin associated protein-like 2 |
85 |
0.97 |
| chr3_16819794_16819956 | 2.81 |
Gm26485 |
predicted gene, 26485 |
3437 |
0.4 |
| chr13_119754800_119754951 | 2.81 |
Nim1k |
NIM1 serine/threonine protein kinase |
1007 |
0.33 |
| chr11_82380843_82381103 | 2.81 |
Gm38577 |
predicted gene, 38577 |
6367 |
0.22 |
| chr2_9893444_9893603 | 2.80 |
Gata3 |
GATA binding protein 3 |
3489 |
0.14 |
| chr18_42877563_42877943 | 2.80 |
Ppp2r2b |
protein phosphatase 2, regulatory subunit B, beta |
21062 |
0.23 |
| chr13_46633381_46633649 | 2.80 |
Cap2 |
CAP, adenylate cyclase-associated protein, 2 (yeast) |
6543 |
0.18 |
| chrX_101300549_101300732 | 2.78 |
Nlgn3 |
neuroligin 3 |
166 |
0.9 |
| chr17_27679167_27679824 | 2.78 |
Pacsin1 |
protein kinase C and casein kinase substrate in neurons 1 |
5686 |
0.12 |
| chr10_80298943_80299634 | 2.77 |
Apc2 |
APC regulator of WNT signaling pathway 2 |
197 |
0.83 |
| chr1_42243123_42243275 | 2.77 |
Gm29664 |
predicted gene 29664 |
4504 |
0.21 |
| chr7_4121077_4121272 | 2.76 |
9430041J12Rik |
RIKEN cDNA 9430041J12 gene |
446 |
0.58 |
| chr3_39397328_39397623 | 2.75 |
Gm9845 |
predicted pseudogene 9845 |
38572 |
0.21 |
| chr3_13472740_13473374 | 2.73 |
Ralyl |
RALY RNA binding protein-like |
163 |
0.93 |
| chr1_78190343_78190494 | 2.73 |
Pax3 |
paired box 3 |
6420 |
0.24 |
| chr9_65520371_65520522 | 2.73 |
Ankdd1a |
ankyrin repeat and death domain containing 1A |
253 |
0.88 |
| chr12_67221116_67221279 | 2.73 |
Mdga2 |
MAM domain containing glycosylphosphatidylinositol anchor 2 |
5 |
0.99 |
| chr10_5921042_5921690 | 2.73 |
Rgs17 |
regulator of G-protein signaling 17 |
1000 |
0.68 |
| chr4_125534653_125535467 | 2.73 |
Mir692-2 |
microRNA 692-2 |
30311 |
0.17 |
| chr5_45282398_45282967 | 2.72 |
Gm43303 |
predicted gene 43303 |
30753 |
0.17 |
| chr4_32862228_32862503 | 2.71 |
Ankrd6 |
ankyrin repeat domain 6 |
1682 |
0.36 |
| chr8_58372088_58372271 | 2.71 |
Gm45635 |
predicted gene 45635 |
125592 |
0.06 |
| chr10_103367406_103367811 | 2.70 |
Slc6a15 |
solute carrier family 6 (neurotransmitter transporter), member 15 |
175 |
0.96 |
| chr2_122079517_122079668 | 2.70 |
Spg11 |
SPG11, spatacsin vesicle trafficking associated |
38704 |
0.1 |
| chr13_84056571_84056869 | 2.70 |
Gm17750 |
predicted gene, 17750 |
8052 |
0.22 |
| chr6_102565301_102565562 | 2.69 |
Cntn3 |
contactin 3 |
7670 |
0.3 |
| chr18_22851273_22851524 | 2.69 |
Nol4 |
nucleolar protein 4 |
644 |
0.84 |
| chr13_24104980_24105225 | 2.68 |
Carmil1 |
capping protein regulator and myosin 1 linker 1 |
3482 |
0.25 |
| chr17_62659163_62659314 | 2.67 |
Gm25800 |
predicted gene, 25800 |
202118 |
0.03 |
| chr11_98738699_98739130 | 2.67 |
Thra |
thyroid hormone receptor alpha |
1724 |
0.2 |
| chr14_13813200_13813371 | 2.67 |
Gm3637 |
predicted gene 3637 |
21225 |
0.15 |
| chr9_4794498_4794674 | 2.66 |
Gria4 |
glutamate receptor, ionotropic, AMPA4 (alpha 4) |
933 |
0.73 |
| chr18_29651809_29651960 | 2.66 |
Gm7917 |
predicted gene 7917 |
5712 |
0.34 |
| chr12_53247812_53248102 | 2.65 |
Npas3 |
neuronal PAS domain protein 3 |
200 |
0.97 |
| chr9_118988700_118988851 | 2.65 |
Mir26a-1 |
microRNA 26a-1 |
43021 |
0.1 |
| chr4_80915311_80915567 | 2.65 |
Lurap1l |
leucine rich adaptor protein 1-like |
4793 |
0.29 |
| chr2_33582582_33583081 | 2.65 |
Gm38011 |
predicted gene, 38011 |
31567 |
0.14 |
| chr5_92279150_92279421 | 2.65 |
Naaa |
N-acylethanolamine acid amidase |
1115 |
0.32 |
| chrX_93700958_93701337 | 2.65 |
Pcyt1b |
phosphate cytidylyltransferase 1, choline, beta isoform |
26045 |
0.18 |
| chr1_41166826_41167099 | 2.65 |
4930448I06Rik |
RIKEN cDNA 4930448I06 gene |
14290 |
0.3 |
| chr14_55052682_55052968 | 2.64 |
Zfhx2os |
zinc finger homeobox 2, opposite strand |
1044 |
0.27 |
| chr9_35018117_35018268 | 2.64 |
Kirrel3 |
kirre like nephrin family adhesion molecule 3 |
1740 |
0.36 |
| chr11_11867596_11867791 | 2.64 |
1700042O10Rik |
RIKEN cDNA 1700042O10 gene |
430 |
0.81 |
| chr5_112217659_112217810 | 2.63 |
Gm26953 |
predicted gene, 26953 |
669 |
0.59 |
| chr11_93560626_93560915 | 2.63 |
Gm11502 |
predicted gene 11502 |
89989 |
0.09 |
| chr12_87000887_87001078 | 2.62 |
Zdhhc22 |
zinc finger, DHHC-type containing 22 |
10552 |
0.14 |
| chr3_88228408_88228559 | 2.62 |
Gm3764 |
predicted gene 3764 |
85 |
0.92 |
| chr12_54034761_54035094 | 2.62 |
1700060O08Rik |
RIKEN cDNA 1700060O08 gene |
44465 |
0.17 |
| chr9_50728353_50728545 | 2.61 |
Dixdc1 |
DIX domain containing 1 |
382 |
0.77 |
| chr16_44661031_44661409 | 2.60 |
Nepro |
nucleolus and neural progenitor protein |
63081 |
0.1 |
| chr4_136820408_136820559 | 2.59 |
Ephb2 |
Eph receptor B2 |
15360 |
0.19 |
| chr2_136108035_136108369 | 2.59 |
Gm14218 |
predicted gene 14218 |
28804 |
0.19 |
| chr2_83812501_83813487 | 2.58 |
Fam171b |
family with sequence similarity 171, member B |
358 |
0.86 |
| chr6_28980766_28981191 | 2.58 |
Gm3294 |
predicted gene 3294 |
656 |
0.73 |
| chr8_123332207_123333262 | 2.58 |
Spire2 |
spire type actin nucleation factor 2 |
21 |
0.95 |
| chr17_90086753_90087284 | 2.58 |
Nrxn1 |
neurexin I |
1122 |
0.65 |
| chr4_32862069_32862227 | 2.58 |
Ankrd6 |
ankyrin repeat domain 6 |
1465 |
0.41 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.0 | 9.0 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 1.5 | 4.5 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 1.4 | 4.3 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 1.4 | 8.1 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 1.3 | 18.1 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 1.2 | 3.7 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 1.2 | 6.2 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
| 1.1 | 3.3 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
| 1.0 | 3.0 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
| 0.9 | 3.6 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
| 0.9 | 2.6 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.9 | 3.5 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.8 | 3.3 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.8 | 4.1 | GO:0034091 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
| 0.8 | 1.6 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 0.8 | 2.3 | GO:0097503 | sialylation(GO:0097503) |
| 0.7 | 2.2 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.7 | 2.1 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.6 | 1.9 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.6 | 1.9 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.6 | 1.9 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.6 | 3.2 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.6 | 0.6 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.6 | 1.8 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.6 | 4.7 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.6 | 1.2 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 0.6 | 5.3 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.6 | 1.7 | GO:0072695 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.6 | 1.7 | GO:0002877 | regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
| 0.6 | 2.8 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.6 | 1.7 | GO:2000969 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
| 0.6 | 3.3 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.5 | 2.2 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.5 | 2.1 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.5 | 1.6 | GO:1904220 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.5 | 2.1 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
| 0.5 | 2.1 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.5 | 1.5 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.5 | 1.5 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 0.5 | 1.0 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.5 | 1.5 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.5 | 2.0 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.5 | 0.5 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
| 0.5 | 4.9 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.5 | 1.0 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.5 | 1.4 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.5 | 1.9 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.5 | 2.8 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.4 | 1.3 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
| 0.4 | 1.3 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
| 0.4 | 5.1 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.4 | 1.7 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.4 | 2.5 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.4 | 2.0 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.4 | 6.6 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.4 | 0.8 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
| 0.4 | 3.1 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.4 | 1.9 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.4 | 1.5 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.4 | 1.5 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.4 | 1.5 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.4 | 0.4 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
| 0.4 | 1.5 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.4 | 2.9 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.4 | 0.4 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.4 | 1.1 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.4 | 5.0 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.3 | 1.7 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.3 | 0.7 | GO:0060594 | mammary gland specification(GO:0060594) |
| 0.3 | 1.0 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.3 | 1.7 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
| 0.3 | 1.0 | GO:2000019 | negative regulation of male gonad development(GO:2000019) |
| 0.3 | 1.0 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.3 | 1.0 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
| 0.3 | 1.3 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.3 | 2.6 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
| 0.3 | 0.6 | GO:0061110 | dense core granule biogenesis(GO:0061110) |
| 0.3 | 1.0 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.3 | 3.4 | GO:0001845 | phagolysosome assembly(GO:0001845) |
| 0.3 | 1.5 | GO:0045162 | neuronal ion channel clustering(GO:0045161) clustering of voltage-gated sodium channels(GO:0045162) |
| 0.3 | 3.9 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
| 0.3 | 1.2 | GO:0060535 | trachea cartilage morphogenesis(GO:0060535) |
| 0.3 | 0.9 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 0.3 | 0.9 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
| 0.3 | 1.2 | GO:2000347 | positive regulation of hepatocyte proliferation(GO:2000347) |
| 0.3 | 0.9 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
| 0.3 | 2.6 | GO:0044557 | relaxation of smooth muscle(GO:0044557) |
| 0.3 | 0.3 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.3 | 0.9 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
| 0.3 | 2.6 | GO:0007614 | short-term memory(GO:0007614) |
| 0.3 | 2.0 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 0.3 | 0.6 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.3 | 0.8 | GO:0046959 | habituation(GO:0046959) |
| 0.3 | 0.6 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.3 | 1.4 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.3 | 0.5 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
| 0.3 | 1.6 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.3 | 0.3 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.3 | 5.1 | GO:0001964 | startle response(GO:0001964) |
| 0.3 | 0.8 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.3 | 1.3 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
| 0.3 | 15.1 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
| 0.3 | 0.8 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.3 | 1.3 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.3 | 1.0 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
| 0.3 | 2.9 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.3 | 1.3 | GO:0015884 | folic acid transport(GO:0015884) |
| 0.3 | 0.8 | GO:0009197 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.3 | 0.8 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 0.3 | 0.3 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
| 0.3 | 0.8 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.3 | 1.0 | GO:0015822 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
| 0.3 | 0.8 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.3 | 0.5 | GO:0070346 | positive regulation of fat cell proliferation(GO:0070346) |
| 0.3 | 1.0 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.3 | 1.0 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.2 | 0.7 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.2 | 1.5 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.2 | 0.2 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.2 | 0.7 | GO:0006868 | glutamine transport(GO:0006868) |
| 0.2 | 1.2 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.2 | 0.7 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
| 0.2 | 0.7 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.2 | 0.7 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.2 | 1.0 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.2 | 0.9 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.2 | 0.9 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.2 | 0.9 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
| 0.2 | 0.5 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.2 | 1.4 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.2 | 1.6 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.2 | 0.9 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.2 | 0.5 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.2 | 0.2 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.2 | 0.5 | GO:1990123 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
| 0.2 | 0.4 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 0.2 | 0.4 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.2 | 2.0 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.2 | 2.9 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.2 | 1.3 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.2 | 0.7 | GO:0002254 | kinin cascade(GO:0002254) |
| 0.2 | 4.1 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
| 0.2 | 1.5 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.2 | 1.3 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.2 | 3.0 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.2 | 0.6 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.2 | 0.6 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.2 | 0.4 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
| 0.2 | 0.2 | GO:0070668 | mast cell proliferation(GO:0070662) regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
| 0.2 | 0.6 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.2 | 1.0 | GO:0001956 | positive regulation of neurotransmitter secretion(GO:0001956) |
| 0.2 | 1.0 | GO:0043045 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.2 | 0.6 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 | 0.4 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
| 0.2 | 0.8 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.2 | 0.6 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.2 | 0.6 | GO:0033091 | positive regulation of immature T cell proliferation(GO:0033091) |
| 0.2 | 1.0 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
| 0.2 | 2.0 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
| 0.2 | 0.6 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.2 | 1.0 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.2 | 0.2 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.2 | 1.0 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.2 | 1.0 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
| 0.2 | 0.6 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.2 | 0.6 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.2 | 1.0 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.2 | 1.9 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.2 | 0.6 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.2 | 1.1 | GO:0048675 | axon extension(GO:0048675) |
| 0.2 | 1.3 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
| 0.2 | 1.9 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.2 | 0.9 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.2 | 2.2 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.2 | 1.3 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.2 | 1.3 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.2 | 1.7 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.2 | 5.4 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.2 | 6.7 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.2 | 1.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.2 | 3.3 | GO:0030224 | monocyte differentiation(GO:0030224) |
| 0.2 | 0.4 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.2 | 0.4 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
| 0.2 | 0.5 | GO:0001546 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.2 | 0.2 | GO:0032310 | prostaglandin secretion(GO:0032310) |
| 0.2 | 0.5 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.2 | 1.1 | GO:0014052 | regulation of gamma-aminobutyric acid secretion(GO:0014052) |
| 0.2 | 5.0 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.2 | 0.5 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.2 | 0.7 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.2 | 0.5 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.2 | 0.5 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.2 | 0.5 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.2 | 0.7 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 0.2 | 0.5 | GO:0071280 | cellular response to copper ion(GO:0071280) |
| 0.2 | 0.2 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
| 0.2 | 0.2 | GO:0090325 | regulation of locomotion involved in locomotory behavior(GO:0090325) |
| 0.2 | 3.7 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
| 0.2 | 0.7 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.2 | 2.8 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.2 | 0.7 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.2 | 0.5 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 0.2 | 0.3 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.2 | 0.5 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.2 | 1.1 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.2 | 0.2 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.2 | 0.3 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.2 | 0.3 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
| 0.2 | 0.3 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.2 | 0.6 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.2 | 1.1 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.2 | 0.2 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
| 0.2 | 0.3 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.2 | 0.6 | GO:0070669 | response to interleukin-2(GO:0070669) |
| 0.2 | 0.5 | GO:1902224 | ketone body metabolic process(GO:1902224) |
| 0.2 | 0.3 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
| 0.2 | 0.3 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.2 | 0.8 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.1 | 0.6 | GO:0006056 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
| 0.1 | 1.2 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.1 | 0.4 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.1 | 0.4 | GO:0000087 | mitotic M phase(GO:0000087) |
| 0.1 | 0.7 | GO:0046010 | positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
| 0.1 | 0.9 | GO:0086009 | membrane repolarization(GO:0086009) |
| 0.1 | 0.7 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.1 | 0.4 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 | 0.1 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.1 | 3.8 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.1 | 0.6 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.1 | 0.4 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.1 | 0.8 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.1 | 0.4 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.1 | 0.4 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.1 | 0.3 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.1 | 0.4 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.1 | 0.8 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.1 | 0.4 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.1 | 0.6 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.3 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
| 0.1 | 0.3 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.1 | 0.8 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 2.7 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.1 | 0.7 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
| 0.1 | 0.4 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.1 | 0.7 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 | 0.3 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 | 0.3 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 | 2.2 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 | 0.4 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 | 0.7 | GO:0018101 | protein citrullination(GO:0018101) |
| 0.1 | 0.4 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.1 | 0.1 | GO:0086017 | Purkinje myocyte action potential(GO:0086017) |
| 0.1 | 0.6 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.1 | 0.8 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
| 0.1 | 0.3 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.1 | 1.2 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.1 | 1.8 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 0.3 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
| 0.1 | 0.1 | GO:1905065 | positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.1 | 1.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.1 | 0.3 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
| 0.1 | 0.1 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.1 | 0.3 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
| 0.1 | 0.1 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.1 | 1.2 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.1 | 0.4 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.1 | 0.4 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.1 | 0.1 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.1 | 0.2 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
| 0.1 | 0.9 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.1 | 0.2 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.1 | 0.6 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.1 | 1.1 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.1 | 0.6 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.1 | 0.1 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
| 0.1 | 0.4 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
| 0.1 | 0.5 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.1 | 0.6 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 | 0.6 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.1 | 0.2 | GO:1901660 | calcium ion export(GO:1901660) |
| 0.1 | 0.8 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.1 | 0.7 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.1 | 0.2 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
| 0.1 | 0.8 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.1 | 1.5 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
| 0.1 | 3.7 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.1 | 0.4 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.1 | 7.8 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
| 0.1 | 0.8 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.1 | 0.4 | GO:0098597 | observational learning(GO:0098597) |
| 0.1 | 0.7 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.1 | 0.5 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
| 0.1 | 0.1 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.1 | 0.3 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.1 | 0.1 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 | 0.3 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.1 | 0.8 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
| 0.1 | 0.3 | GO:0014028 | notochord formation(GO:0014028) |
| 0.1 | 0.2 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.1 | 0.4 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.1 | 0.3 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.1 | 0.3 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
| 0.1 | 0.5 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.1 | 2.9 | GO:0008361 | regulation of cell size(GO:0008361) |
| 0.1 | 0.2 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.1 | 0.5 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
| 0.1 | 0.3 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 0.1 | 0.3 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
| 0.1 | 0.6 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.1 | 0.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 0.3 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.1 | 0.2 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.1 | 0.2 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.1 | 1.8 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.1 | 2.3 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.1 | 2.8 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.1 | 0.6 | GO:0015791 | polyol transport(GO:0015791) |
| 0.1 | 0.8 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
| 0.1 | 0.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.1 | 0.3 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.1 | 0.4 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.1 | 0.2 | GO:0003190 | atrioventricular valve formation(GO:0003190) |
| 0.1 | 1.1 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
| 0.1 | 0.2 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.1 | 0.1 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
| 0.1 | 0.4 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 | 0.3 | GO:0097154 | GABAergic neuron differentiation(GO:0097154) |
| 0.1 | 0.6 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.2 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.1 | 0.1 | GO:0048755 | branching morphogenesis of a nerve(GO:0048755) |
| 0.1 | 0.7 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.1 | 0.1 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.1 | 0.4 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.1 | 0.6 | GO:0006559 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.1 | 0.1 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.1 | 0.2 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
| 0.1 | 0.4 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.3 | GO:0002930 | trabecular meshwork development(GO:0002930) |
| 0.1 | 0.1 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.1 | 0.3 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.1 | 0.4 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.1 | 0.3 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.1 | 0.4 | GO:0060231 | mesenchymal to epithelial transition(GO:0060231) |
| 0.1 | 0.2 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.1 | 0.3 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
| 0.1 | 0.2 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
| 0.1 | 0.5 | GO:0051231 | mitotic spindle elongation(GO:0000022) spindle elongation(GO:0051231) mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 0.2 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.1 | 0.4 | GO:0010359 | regulation of anion channel activity(GO:0010359) |
| 0.1 | 1.0 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.1 | 0.2 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.1 | 0.6 | GO:0010642 | negative regulation of platelet-derived growth factor receptor signaling pathway(GO:0010642) |
| 0.1 | 0.4 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
| 0.1 | 0.6 | GO:2000696 | regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
| 0.1 | 0.3 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.1 | 0.8 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.1 | 1.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.1 | 3.0 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
| 0.1 | 0.2 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.1 | 0.6 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.1 | 1.2 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.1 | 0.2 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 0.1 | 0.2 | GO:0035826 | rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.1 | 0.2 | GO:0032672 | regulation of interleukin-3 production(GO:0032672) |
| 0.1 | 0.3 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.1 | 0.5 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.1 | 0.6 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.1 | 0.3 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.1 | 0.7 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
| 0.1 | 0.2 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.1 | 0.2 | GO:2001023 | regulation of response to drug(GO:2001023) |
| 0.1 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.2 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.1 | 0.6 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.1 | 0.2 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.1 | 1.6 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
| 0.1 | 0.8 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
| 0.1 | 1.0 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
| 0.1 | 0.2 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.1 | 0.1 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 0.1 | 0.1 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.1 | 0.2 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
| 0.1 | 0.7 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.1 | 0.2 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.1 | 0.5 | GO:2000018 | regulation of male gonad development(GO:2000018) |
| 0.1 | 0.2 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.1 | 0.3 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.1 | 0.2 | GO:0050651 | dermatan sulfate biosynthetic process(GO:0030208) dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.1 | 1.1 | GO:1990138 | neuron projection extension(GO:1990138) |
| 0.1 | 0.4 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 2.1 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
| 0.1 | 0.2 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 | 0.5 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 | 0.3 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.1 | 0.2 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.1 | 0.3 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.1 | 0.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
| 0.1 | 0.6 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.1 | 0.2 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.1 | 0.5 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.1 | 0.5 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
| 0.1 | 0.2 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
| 0.1 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 | 0.4 | GO:1902803 | regulation of synaptic vesicle transport(GO:1902803) |
| 0.1 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) protein K27-linked ubiquitination(GO:0044314) |
| 0.1 | 0.2 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.1 | 0.1 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 0.1 | 0.1 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 0.1 | 0.2 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.1 | 0.3 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 0.1 | 10.7 | GO:0006813 | potassium ion transport(GO:0006813) |
| 0.1 | 0.4 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.1 | 0.2 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
| 0.1 | 0.4 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.1 | 0.1 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.1 | 0.2 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.1 | 0.1 | GO:0052428 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.1 | 0.8 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.1 | 0.5 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 0.1 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 0.3 | GO:0006742 | NADP catabolic process(GO:0006742) |
| 0.1 | 0.1 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.1 | 0.3 | GO:0090656 | t-circle formation(GO:0090656) |
| 0.1 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.1 | 0.3 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.1 | 0.3 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.1 | 0.2 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
| 0.1 | 0.2 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.1 | 0.1 | GO:0043400 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) positive regulation of cortisol secretion(GO:0051464) |
| 0.1 | 0.3 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.1 | 0.1 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
| 0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 | 0.1 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
| 0.1 | 0.2 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.1 | 0.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.1 | 0.1 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.1 | 0.4 | GO:0033700 | phospholipid efflux(GO:0033700) |
| 0.1 | 0.3 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.1 | 0.3 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.1 | 0.2 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.1 | 0.5 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.1 | 0.3 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) regulation of histone H3-K9 acetylation(GO:2000615) |
| 0.1 | 1.8 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
| 0.1 | 0.5 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 | 2.4 | GO:0002028 | regulation of sodium ion transport(GO:0002028) |
| 0.1 | 0.3 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
| 0.1 | 0.1 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
| 0.1 | 0.9 | GO:0007616 | long-term memory(GO:0007616) |
| 0.1 | 0.2 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.1 | 0.3 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.1 | 0.3 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.1 | 0.3 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.1 | 0.4 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.1 | 0.1 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.1 | 0.1 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
| 0.1 | 0.1 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 0.1 | 0.1 | GO:0034370 | triglyceride-rich lipoprotein particle remodeling(GO:0034370) |
| 0.1 | 0.1 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
| 0.1 | 0.3 | GO:0060023 | soft palate development(GO:0060023) |
| 0.1 | 0.1 | GO:0032099 | negative regulation of appetite(GO:0032099) |
| 0.1 | 0.1 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 | 0.2 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.1 | 0.3 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.1 | 0.1 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.1 | 0.1 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.1 | 0.4 | GO:0000305 | response to oxygen radical(GO:0000305) |
| 0.1 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.1 | 0.3 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
| 0.1 | 0.6 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
| 0.1 | 0.2 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.1 | 0.1 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.1 | 0.3 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 0.1 | 0.2 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
| 0.1 | 0.2 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 0.1 | 0.1 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
| 0.1 | 0.2 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.1 | 0.1 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.1 | 0.2 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.1 | 0.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.1 | 0.3 | GO:1990001 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.1 | 0.5 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 0.2 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) |
| 0.1 | 0.2 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
| 0.1 | 0.2 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
| 0.1 | 0.3 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
| 0.1 | 0.2 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.1 | 0.1 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.1 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
| 0.1 | 0.3 | GO:0015074 | DNA integration(GO:0015074) |
| 0.1 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.1 | 0.1 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.1 | 1.2 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.1 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.1 | 0.1 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.1 | 0.3 | GO:1903019 | negative regulation of glycoprotein metabolic process(GO:1903019) |
| 0.1 | 0.4 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.1 | 0.3 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.1 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.1 | 0.1 | GO:0046037 | GMP metabolic process(GO:0046037) |
| 0.1 | 0.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 | 0.2 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 | 0.2 | GO:0055075 | potassium ion homeostasis(GO:0055075) |
| 0.1 | 2.9 | GO:0050770 | regulation of axonogenesis(GO:0050770) |
| 0.1 | 0.4 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.1 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.1 | 0.1 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.1 | 0.3 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
| 0.1 | 0.2 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
| 0.1 | 0.1 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.1 | 0.2 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.1 | 0.1 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
| 0.1 | 0.1 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.1 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 0.1 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.1 | 0.1 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.1 | 0.3 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 | 0.4 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.1 | 0.9 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 | 1.4 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.1 | 1.0 | GO:0021766 | hippocampus development(GO:0021766) |
| 0.1 | 0.1 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.1 | 0.1 | GO:0042635 | positive regulation of hair cycle(GO:0042635) |
| 0.1 | 0.5 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 | 0.5 | GO:0010669 | epithelial structure maintenance(GO:0010669) |
| 0.1 | 0.3 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.1 | 0.3 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.0 | 0.9 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.2 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 | 0.4 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.0 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.0 | 0.3 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.0 | 0.0 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.0 | 0.1 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.0 | 0.3 | GO:0021756 | striatum development(GO:0021756) |
| 0.0 | 0.1 | GO:0034088 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.0 | 0.1 | GO:1900086 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.0 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.0 | 0.0 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.1 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
| 0.0 | 0.1 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.0 | 1.9 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
| 0.0 | 0.5 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.0 | 0.0 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
| 0.0 | 0.1 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.0 | 0.6 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
| 0.0 | 0.1 | GO:0008054 | negative regulation of cyclin-dependent protein serine/threonine kinase by cyclin degradation(GO:0008054) |
| 0.0 | 0.3 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.3 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
| 0.0 | 0.5 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.0 | 1.0 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.0 | 0.0 | GO:1903297 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
| 0.0 | 0.3 | GO:0051195 | negative regulation of nucleotide catabolic process(GO:0030812) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.0 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.1 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
| 0.0 | 0.3 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.0 | 0.3 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.2 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 0.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
| 0.0 | 1.0 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.2 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.0 | 0.1 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.0 | 0.2 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.2 | GO:2000641 | regulation of early endosome to late endosome transport(GO:2000641) |
| 0.0 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.0 | 1.0 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.0 | 0.0 | GO:0019364 | pyridine nucleotide catabolic process(GO:0019364) |
| 0.0 | 0.2 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.0 | 0.4 | GO:0043094 | cellular metabolic compound salvage(GO:0043094) |
| 0.0 | 0.3 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
| 0.0 | 0.1 | GO:0043931 | ossification involved in bone maturation(GO:0043931) |
| 0.0 | 0.0 | GO:0035696 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.0 | 0.1 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.0 | 0.3 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.1 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.0 | 0.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.0 | 0.1 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.0 | 0.0 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.0 | 0.2 | GO:1901341 | positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.0 | 0.1 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.0 | 0.1 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.0 | 0.1 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
| 0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.1 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.0 | 0.1 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) |
| 0.0 | 0.2 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
| 0.0 | 0.4 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.1 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.0 | 0.1 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
| 0.0 | 0.3 | GO:0036119 | response to platelet-derived growth factor(GO:0036119) |
| 0.0 | 0.0 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
| 0.0 | 0.6 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
| 0.0 | 0.2 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.0 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.0 | 0.2 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.0 | 0.1 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.3 | GO:0002052 | positive regulation of neuroblast proliferation(GO:0002052) |
| 0.0 | 0.1 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.0 | 0.1 | GO:0031587 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.0 | 0.1 | GO:0002689 | negative regulation of leukocyte chemotaxis(GO:0002689) |
| 0.0 | 0.5 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 | 0.5 | GO:0003016 | respiratory system process(GO:0003016) |
| 0.0 | 0.2 | GO:0008210 | estrogen metabolic process(GO:0008210) |
| 0.0 | 0.2 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.4 | GO:1903206 | negative regulation of hydrogen peroxide-induced cell death(GO:1903206) |
| 0.0 | 0.3 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.0 | 1.9 | GO:0000045 | autophagosome assembly(GO:0000045) |
| 0.0 | 0.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.0 | 0.4 | GO:0006828 | manganese ion transport(GO:0006828) |
| 0.0 | 0.4 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.0 | 1.4 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.1 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.0 | 0.3 | GO:0009452 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.0 | 0.0 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.0 | 0.3 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.5 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 | 1.1 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
| 0.0 | 0.1 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.0 | 0.0 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
| 0.0 | 0.2 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.0 | 0.2 | GO:0032239 | regulation of nucleobase-containing compound transport(GO:0032239) |
| 0.0 | 1.0 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.0 | 0.2 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.0 | 0.0 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.7 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.1 | GO:0051665 | membrane raft localization(GO:0051665) |
| 0.0 | 0.1 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.0 | 0.1 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 0.0 | 0.0 | GO:0035743 | CD4-positive, alpha-beta T cell cytokine production(GO:0035743) |
| 0.0 | 0.1 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.0 | 0.0 | GO:0072243 | metanephric nephron epithelium development(GO:0072243) |
| 0.0 | 0.1 | GO:0014050 | negative regulation of glutamate secretion(GO:0014050) |
| 0.0 | 0.0 | GO:0060462 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
| 0.0 | 0.2 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.0 | 0.1 | GO:0002645 | positive regulation of tolerance induction(GO:0002645) |
| 0.0 | 0.0 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.0 | 0.1 | GO:0060005 | vestibular reflex(GO:0060005) |
| 0.0 | 0.0 | GO:1904478 | regulation of intestinal absorption(GO:1904478) |
| 0.0 | 0.3 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.0 | 0.2 | GO:0031629 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.0 | 0.1 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.0 | 0.3 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.0 | 0.1 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.0 | 0.5 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 | 0.1 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 0.2 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.0 | 0.1 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
| 0.0 | 0.4 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.0 | 0.1 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 0.0 | 0.0 | GO:0001787 | natural killer cell proliferation(GO:0001787) |
| 0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.0 | 0.3 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
| 0.0 | 0.3 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.0 | 0.3 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
| 0.0 | 0.0 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.0 | 0.1 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.0 | 0.0 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.0 | 0.2 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
| 0.0 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.0 | 0.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.1 | GO:0046149 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.0 | 0.2 | GO:0033198 | response to ATP(GO:0033198) |
| 0.0 | 0.2 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.0 | 0.1 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.0 | 0.1 | GO:0071816 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.0 | 0.1 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.0 | 0.2 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 0.1 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
| 0.0 | 0.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 | 0.0 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.0 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.0 | 0.0 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.0 | 0.1 | GO:0032827 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
| 0.0 | 0.0 | GO:1904938 | dopaminergic neuron axon guidance(GO:0036514) planar cell polarity pathway involved in axon guidance(GO:1904938) |
| 0.0 | 0.1 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
| 0.0 | 0.1 | GO:1901642 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
| 0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.0 | 0.1 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.0 | 0.9 | GO:0033141 | regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033139) positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.0 | 0.0 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.0 | 0.1 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.0 | 0.1 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.0 | 0.2 | GO:0046321 | positive regulation of fatty acid oxidation(GO:0046321) |
| 0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.0 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.0 | 0.2 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.0 | 0.1 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.0 | 0.0 | GO:0070977 | bone maturation(GO:0070977) |
| 0.0 | 0.1 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
| 0.0 | 0.1 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.0 | 0.3 | GO:0042417 | dopamine metabolic process(GO:0042417) |
| 0.0 | 0.1 | GO:0002455 | humoral immune response mediated by circulating immunoglobulin(GO:0002455) |
| 0.0 | 0.2 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.0 | 0.1 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.0 | 0.1 | GO:0032740 | positive regulation of interleukin-17 production(GO:0032740) |
| 0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.1 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.0 | 0.1 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.0 | 0.0 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
| 0.0 | 0.2 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
| 0.0 | 0.6 | GO:0007040 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
| 0.0 | 0.1 | GO:0046716 | muscle cell cellular homeostasis(GO:0046716) |
| 0.0 | 0.2 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.0 | 0.1 | GO:0042640 | anagen(GO:0042640) |
| 0.0 | 0.3 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.0 | 0.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 | 0.0 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.0 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.1 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.0 | 0.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.0 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.0 | 0.2 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.1 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.0 | 0.1 | GO:0021794 | thalamus development(GO:0021794) |
| 0.0 | 0.1 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 0.0 | 0.0 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 0.0 | 0.0 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.0 | 0.2 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.0 | 0.1 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.0 | 0.1 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.0 | 0.1 | GO:0009651 | response to salt stress(GO:0009651) |
| 0.0 | 0.1 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.0 | 0.2 | GO:0051931 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
| 0.0 | 0.0 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) vestibulocochlear nerve morphogenesis(GO:0021648) |
| 0.0 | 0.0 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
| 0.0 | 0.1 | GO:0009225 | nucleotide-sugar metabolic process(GO:0009225) |
| 0.0 | 0.0 | GO:0002238 | response to molecule of fungal origin(GO:0002238) |
| 0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.0 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.3 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.0 | 0.1 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.0 | 0.1 | GO:0006544 | glycine metabolic process(GO:0006544) |
| 0.0 | 0.0 | GO:0097360 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.0 | 0.4 | GO:0046834 | lipid phosphorylation(GO:0046834) |
| 0.0 | 0.0 | GO:0072273 | metanephric nephron morphogenesis(GO:0072273) |
| 0.0 | 0.0 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.0 | 0.0 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.0 | 0.0 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.0 | 0.0 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 0.0 | 0.0 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.0 | 0.1 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.0 | 0.0 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.0 | 0.7 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.0 | 0.0 | GO:0042701 | progesterone secretion(GO:0042701) regulation of progesterone secretion(GO:2000870) |
| 0.0 | 0.0 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.0 | 0.0 | GO:0072319 | vesicle uncoating(GO:0072319) |
| 0.0 | 0.1 | GO:0009071 | serine family amino acid catabolic process(GO:0009071) |
| 0.0 | 0.4 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.0 | 0.0 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.0 | 0.1 | GO:0035418 | protein localization to synapse(GO:0035418) |
| 0.0 | 0.1 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
| 0.0 | 0.2 | GO:0071470 | cellular response to osmotic stress(GO:0071470) |
| 0.0 | 0.2 | GO:0036093 | germ cell proliferation(GO:0036093) |
| 0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
| 0.0 | 0.0 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.0 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.0 | 0.1 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 0.0 | GO:0060745 | mammary gland branching involved in pregnancy(GO:0060745) |
| 0.0 | 0.2 | GO:0016556 | mRNA modification(GO:0016556) |
| 0.0 | 0.0 | GO:0003140 | determination of left/right asymmetry in lateral mesoderm(GO:0003140) |
| 0.0 | 0.0 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.0 | 0.1 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.0 | 0.0 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.0 | 0.1 | GO:0050858 | negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) |
| 0.0 | 0.0 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 | 0.1 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.0 | 0.2 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 | 2.2 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.0 | 0.0 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.0 | 0.2 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.0 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.0 | 0.0 | GO:0006069 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
| 0.0 | 0.0 | GO:0010996 | response to auditory stimulus(GO:0010996) |
| 0.0 | 0.3 | GO:0006921 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
| 0.0 | 0.1 | GO:0051797 | regulation of hair follicle development(GO:0051797) |
| 0.0 | 0.0 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.0 | 0.0 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.0 | 0.1 | GO:0051095 | regulation of helicase activity(GO:0051095) |
| 0.0 | 0.0 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.0 | 0.6 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.1 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
| 0.0 | 0.1 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.0 | 0.1 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.0 | 0.0 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.0 | 0.2 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
| 0.0 | 0.1 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.0 | 0.0 | GO:0021978 | telencephalon regionalization(GO:0021978) |
| 0.0 | 0.0 | GO:0033108 | mitochondrial respiratory chain complex assembly(GO:0033108) |
| 0.0 | 0.0 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.0 | 0.0 | GO:0042987 | amyloid precursor protein catabolic process(GO:0042987) |
| 0.0 | 0.0 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
| 0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.0 | 0.0 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.0 | GO:0010872 | regulation of cholesterol esterification(GO:0010872) |
| 0.0 | 0.0 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.0 | 0.1 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
| 0.0 | 0.3 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
| 0.0 | 0.0 | GO:0015684 | ferrous iron transport(GO:0015684) |
| 0.0 | 0.1 | GO:0034238 | macrophage fusion(GO:0034238) |
| 0.0 | 0.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.0 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
| 0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 0.1 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
| 0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.0 | 0.1 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 0.1 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.0 | 0.0 | GO:1902023 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
| 0.0 | 0.0 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 | 0.0 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 | 0.0 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.0 | 0.1 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.0 | 0.1 | GO:0015865 | purine nucleotide transport(GO:0015865) purine ribonucleotide transport(GO:0015868) |
| 0.0 | 0.1 | GO:0006903 | vesicle targeting(GO:0006903) |
| 0.0 | 0.1 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 0.0 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
| 0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.0 | 0.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.0 | 0.0 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.0 | 0.1 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
| 0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.0 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.0 | 0.0 | GO:2001273 | glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.0 | 0.0 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 | 0.0 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
| 0.0 | 0.1 | GO:0018904 | ether metabolic process(GO:0018904) |
| 0.0 | 0.0 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
| 0.0 | 0.1 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.0 | 1.4 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.0 | 0.0 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
| 0.0 | 0.0 | GO:0045402 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
| 0.0 | 0.0 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
| 0.0 | 0.0 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.0 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.0 | 0.1 | GO:0061318 | renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
| 0.0 | 0.0 | GO:0006273 | lagging strand elongation(GO:0006273) |
| 0.0 | 0.1 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.0 | 0.2 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.0 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.0 | 0.1 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.0 | 0.2 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
| 0.0 | 0.1 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 | 0.0 | GO:0006527 | arginine catabolic process(GO:0006527) |
| 0.0 | 0.0 | GO:0008038 | neuron recognition(GO:0008038) |
| 0.0 | 0.0 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 0.0 | 0.0 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
| 0.0 | 0.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.0 | 0.0 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.0 | 0.0 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.0 | 0.0 | GO:0009996 | negative regulation of cell fate specification(GO:0009996) |
| 0.0 | 0.0 | GO:0071281 | cellular response to iron ion(GO:0071281) |
| 0.0 | 0.1 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.0 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.0 | 0.1 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.0 | 0.0 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.0 | 0.0 | GO:0042428 | serotonin metabolic process(GO:0042428) |
| 0.0 | 0.0 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.0 | 0.0 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.0 | 0.0 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.0 | 0.1 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
| 0.0 | 0.0 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.0 | 0.0 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.0 | 0.0 | GO:0044036 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
| 0.0 | 0.0 | GO:0046599 | regulation of centriole replication(GO:0046599) |
| 0.0 | 0.0 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
| 0.0 | 0.1 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.0 | 0.0 | GO:0060789 | hair follicle placode formation(GO:0060789) |
| 0.0 | 0.0 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 | 0.0 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.0 | 0.0 | GO:0031446 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 0.0 | 0.0 | GO:0030826 | regulation of cGMP biosynthetic process(GO:0030826) |
| 0.0 | 0.0 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
| 0.0 | 0.0 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.0 | 0.0 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 | 0.0 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
| 0.0 | 0.0 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.0 | 0.0 | GO:0045332 | phospholipid translocation(GO:0045332) |
| 0.0 | 0.0 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.0 | 0.0 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.0 | 0.0 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.0 | 0.1 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
| 0.0 | 0.0 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.0 | 0.3 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 0.1 | GO:0046688 | response to copper ion(GO:0046688) |
| 0.0 | 0.0 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 3.3 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 1.0 | 3.1 | GO:0097441 | basilar dendrite(GO:0097441) |
| 1.0 | 5.2 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 1.0 | 3.0 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.8 | 14.7 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.7 | 3.4 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.6 | 10.9 | GO:0030673 | axolemma(GO:0030673) |
| 0.6 | 1.2 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.6 | 1.7 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.5 | 0.5 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.5 | 1.9 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.5 | 1.4 | GO:1990393 | 3M complex(GO:1990393) |
| 0.5 | 4.3 | GO:0016342 | catenin complex(GO:0016342) |
| 0.5 | 0.5 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.5 | 5.1 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.4 | 18.5 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.4 | 1.3 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.4 | 2.1 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.4 | 1.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.4 | 3.2 | GO:0071437 | invadopodium(GO:0071437) |
| 0.4 | 11.1 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.4 | 4.1 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.4 | 0.7 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.4 | 2.1 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.3 | 4.2 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.3 | 2.1 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.3 | 1.4 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.3 | 5.9 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.3 | 1.9 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.3 | 1.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.3 | 1.9 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.3 | 0.6 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.3 | 0.5 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.3 | 11.4 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.2 | 0.7 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.2 | 3.3 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.2 | 0.7 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.2 | 0.7 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.2 | 0.7 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.2 | 5.0 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.2 | 2.1 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.2 | 2.3 | GO:0098878 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
| 0.2 | 1.0 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.2 | 1.0 | GO:0097433 | dense body(GO:0097433) |
| 0.2 | 1.0 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.2 | 0.4 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.2 | 0.6 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.2 | 1.3 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.2 | 0.7 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.2 | 1.8 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.2 | 0.9 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.2 | 0.2 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.2 | 0.5 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.2 | 0.7 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.2 | 0.2 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
| 0.2 | 1.8 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.2 | 1.0 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.2 | 2.3 | GO:0031430 | M band(GO:0031430) |
| 0.2 | 1.4 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.2 | 0.9 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.2 | 0.8 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 0.6 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
| 0.1 | 2.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.1 | 2.4 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.1 | 0.4 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.1 | 1.0 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
| 0.1 | 0.4 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.1 | 0.1 | GO:0042827 | platelet dense granule(GO:0042827) |
| 0.1 | 0.1 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.1 | 0.3 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.1 | 0.6 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 0.3 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.1 | 5.6 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.1 | 0.4 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.1 | 0.4 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 12.5 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.1 | 0.3 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.1 | 1.0 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.8 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.1 | 0.7 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.1 | 0.4 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.1 | 0.2 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.1 | 1.7 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.1 | 0.5 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.1 | 1.5 | GO:0010369 | chromocenter(GO:0010369) |
| 0.1 | 0.7 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 0.7 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 0.4 | GO:0031429 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
| 0.1 | 1.1 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.1 | 0.3 | GO:0000811 | GINS complex(GO:0000811) |
| 0.1 | 2.0 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
| 0.1 | 0.6 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 0.4 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.1 | 0.4 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 0.3 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.1 | 0.6 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 0.4 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 0.3 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.1 | 1.1 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.1 | 0.8 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.1 | 0.9 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.1 | 0.8 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.1 | 0.9 | GO:0060091 | kinocilium(GO:0060091) |
| 0.1 | 1.0 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.1 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.1 | 0.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.1 | 0.4 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.1 | 0.3 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.1 | 0.3 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.1 | 0.6 | GO:0042627 | chylomicron(GO:0042627) |
| 0.1 | 0.5 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.1 | 0.5 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 0.8 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 2.2 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 0.2 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.1 | 0.4 | GO:0000796 | condensin complex(GO:0000796) |
| 0.1 | 3.6 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 0.9 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
| 0.1 | 0.3 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 0.8 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.1 | 0.7 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.1 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 0.3 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.1 | 0.4 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.1 | 0.8 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.1 | 0.7 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.1 | 0.4 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.1 | 0.9 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.1 | 0.2 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.1 | 2.0 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.1 | 0.6 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 0.4 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.1 | 0.4 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 0.3 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.1 | 0.4 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.1 | 0.3 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.1 | 0.3 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.1 | 0.3 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.1 | 0.3 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.1 | 0.4 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.1 | 0.8 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.1 | 0.3 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.1 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
| 0.1 | 0.7 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.1 | 0.3 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.1 | 0.3 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.1 | 0.3 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.1 | 0.3 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.1 | 2.6 | GO:0043195 | terminal bouton(GO:0043195) |
| 0.1 | 0.6 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 0.3 | GO:0098536 | deuterosome(GO:0098536) |
| 0.1 | 1.7 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.1 | 0.3 | GO:1990745 | EARP complex(GO:1990745) |
| 0.1 | 1.7 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.1 | 3.0 | GO:0034705 | potassium channel complex(GO:0034705) |
| 0.1 | 0.3 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.1 | 0.4 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 0.7 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
| 0.1 | 1.1 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 3.5 | GO:0043197 | dendritic spine(GO:0043197) |
| 0.1 | 0.6 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.1 | 0.5 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.1 | 7.0 | GO:0097060 | synaptic membrane(GO:0097060) |
| 0.1 | 0.2 | GO:0000800 | lateral element(GO:0000800) |
| 0.1 | 0.4 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 0.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.1 | 0.4 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.1 | 0.7 | GO:0030894 | replisome(GO:0030894) |
| 0.1 | 0.2 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 0.6 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.1 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.1 | 0.3 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 0.3 | GO:0031045 | dense core granule(GO:0031045) |
| 0.1 | 0.2 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.1 | 0.3 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.0 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.0 | 0.2 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.0 | 1.0 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.0 | 0.1 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 6.1 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.3 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 0.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.0 | 1.0 | GO:0043679 | axon terminus(GO:0043679) |
| 0.0 | 0.2 | GO:0002177 | manchette(GO:0002177) |
| 0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.0 | 0.5 | GO:0070382 | exocytic vesicle(GO:0070382) |
| 0.0 | 1.6 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 2.7 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.0 | 0.6 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 0.2 | GO:0045240 | dihydrolipoyl dehydrogenase complex(GO:0045240) oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.2 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.0 | 0.9 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.3 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.1 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.0 | 0.1 | GO:0005767 | secondary lysosome(GO:0005767) |
| 0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.3 | GO:0045120 | pronucleus(GO:0045120) |
| 0.0 | 0.2 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.0 | 0.4 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 6.0 | GO:0030425 | dendrite(GO:0030425) |
| 0.0 | 0.2 | GO:0000801 | central element(GO:0000801) |
| 0.0 | 0.3 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.0 | 0.5 | GO:0031231 | intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.0 | 0.5 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
| 0.0 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.0 | 0.2 | GO:0005675 | holo TFIIH complex(GO:0005675) |
| 0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 0.1 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.2 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) lumenal side of membrane(GO:0098576) |
| 0.0 | 0.1 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 2.0 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.4 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.2 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.0 | 0.0 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.0 | 0.2 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.1 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 0.2 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.0 | 0.1 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.0 | 0.2 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.2 | GO:0030120 | vesicle coat(GO:0030120) |
| 0.0 | 0.1 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.1 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 0.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.0 | GO:0035838 | growing cell tip(GO:0035838) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.1 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.3 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.0 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
| 0.0 | 0.2 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 0.1 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.1 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.0 | 0.0 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.2 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 0.1 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.0 | 0.6 | GO:0043204 | perikaryon(GO:0043204) |
| 0.0 | 0.0 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 0.0 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.1 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.2 | GO:0097346 | INO80-type complex(GO:0097346) |
| 0.0 | 0.1 | GO:0097449 | astrocyte projection(GO:0097449) |
| 0.0 | 0.1 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.7 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.9 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 0.5 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.0 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
| 0.0 | 0.0 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
| 0.0 | 0.3 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.0 | 0.0 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
| 0.0 | 0.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.1 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.1 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 1.0 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.0 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.0 | 0.0 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.0 | 11.5 | GO:0005887 | integral component of plasma membrane(GO:0005887) |
| 0.0 | 1.2 | GO:0043209 | myelin sheath(GO:0043209) |
| 0.0 | 0.0 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.0 | 0.0 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
| 0.0 | 0.0 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.3 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.0 | 0.6 | GO:1990204 | oxidoreductase complex(GO:1990204) |
| 0.0 | 0.0 | GO:0031082 | BLOC complex(GO:0031082) |
| 0.0 | 0.1 | GO:0098802 | plasma membrane receptor complex(GO:0098802) |
| 0.0 | 0.1 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.0 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.0 | 0.1 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.0 | 0.1 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.0 | 0.0 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.0 | 0.0 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.2 | 6.5 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 2.1 | 8.5 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 1.9 | 5.7 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 1.7 | 8.7 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 1.6 | 4.7 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 1.6 | 7.8 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 1.3 | 5.0 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 1.2 | 3.6 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 1.2 | 3.5 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.9 | 2.7 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.8 | 4.1 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.8 | 3.1 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.8 | 4.6 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.8 | 3.0 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.7 | 2.0 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.6 | 1.9 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.6 | 2.6 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.5 | 5.8 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
| 0.5 | 1.6 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.5 | 1.6 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.5 | 4.5 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.5 | 1.5 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.5 | 1.4 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.4 | 4.8 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
| 0.4 | 3.4 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.4 | 1.3 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.4 | 5.9 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.4 | 1.6 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.4 | 1.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.4 | 0.8 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.4 | 6.4 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.4 | 8.5 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.4 | 0.7 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
| 0.4 | 2.1 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.4 | 1.4 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.3 | 1.7 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.3 | 1.0 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.3 | 2.7 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.3 | 2.7 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.3 | 1.0 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.3 | 1.6 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.3 | 1.0 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.3 | 1.6 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.3 | 1.2 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.3 | 1.5 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.3 | 0.9 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.3 | 1.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.3 | 1.2 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.3 | 5.7 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.3 | 1.7 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.3 | 0.8 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.3 | 1.7 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.3 | 3.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.3 | 1.7 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.3 | 1.4 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.3 | 3.0 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.3 | 1.3 | GO:0052759 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
| 0.3 | 1.8 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.3 | 0.8 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.3 | 1.8 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.2 | 1.7 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.2 | 0.7 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.2 | 0.7 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.2 | 0.9 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.2 | 0.7 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.2 | 3.6 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.2 | 1.0 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.2 | 1.2 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.2 | 0.6 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.2 | 2.9 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.2 | 0.6 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.2 | 0.4 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.2 | 0.2 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.2 | 0.6 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.2 | 5.3 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.2 | 0.4 | GO:0016428 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.2 | 1.5 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.2 | 0.4 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.2 | 5.0 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.2 | 0.5 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.2 | 2.4 | GO:0031005 | filamin binding(GO:0031005) |
| 0.2 | 0.9 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.2 | 2.4 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.2 | 0.7 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.2 | 2.3 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.2 | 1.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.2 | 0.5 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
| 0.2 | 0.4 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.2 | 2.8 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.2 | 0.2 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.2 | 0.7 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.2 | 1.4 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.2 | 0.7 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.2 | 0.7 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.2 | 0.5 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.2 | 0.5 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.2 | 1.5 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.2 | 0.8 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.2 | 1.0 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.2 | 0.6 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.2 | 0.5 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.2 | 1.7 | GO:0016405 | CoA-ligase activity(GO:0016405) |
| 0.2 | 0.5 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.2 | 0.5 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.1 | 1.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.1 | 1.1 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.1 | 0.4 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 3.5 | GO:0035254 | glutamate receptor binding(GO:0035254) |
| 0.1 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.1 | 3.0 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.1 | 4.4 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.1 | 0.3 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.1 | 3.6 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
| 0.1 | 0.8 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.1 | 0.4 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
| 0.1 | 0.8 | GO:0042910 | xenobiotic-transporting ATPase activity(GO:0008559) xenobiotic transporter activity(GO:0042910) |
| 0.1 | 1.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.1 | 0.4 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.1 | 0.7 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.1 | 0.3 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.1 | 1.3 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.1 | 0.4 | GO:0019961 | interferon binding(GO:0019961) |
| 0.1 | 3.8 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.1 | 2.0 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
| 0.1 | 0.4 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.1 | 1.6 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.1 | 0.6 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.1 | 0.4 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.1 | 1.0 | GO:0036122 | BMP binding(GO:0036122) |
| 0.1 | 1.0 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.1 | 0.8 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
| 0.1 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.1 | 2.2 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 0.7 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.1 | 1.5 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.1 | 0.3 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.1 | 0.9 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.1 | 1.0 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 0.3 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.1 | 0.3 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
| 0.1 | 0.4 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
| 0.1 | 1.4 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.1 | 0.1 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.1 | 1.0 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.1 | 0.3 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.1 | 0.4 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.1 | 1.6 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.1 | 4.4 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
| 0.1 | 9.0 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.1 | 0.2 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.1 | 0.1 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
| 0.1 | 0.4 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.1 | 0.3 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 0.7 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.1 | 0.6 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.1 | 4.0 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.1 | 0.3 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.1 | 0.3 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.1 | 0.4 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 0.5 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.1 | 0.4 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
| 0.1 | 0.6 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.1 | 0.2 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.1 | 0.3 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 0.4 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.1 | 0.8 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.1 | 0.6 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 0.4 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
| 0.1 | 0.5 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.1 | 0.9 | GO:0042923 | neuropeptide binding(GO:0042923) |
| 0.1 | 0.3 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.1 | 0.3 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.1 | 0.3 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.1 | 0.6 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.1 | 0.5 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.1 | 1.4 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.1 | 0.8 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.1 | 0.1 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
| 0.1 | 0.3 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.1 | 0.6 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.1 | 0.3 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 0.8 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 0.2 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.1 | 0.8 | GO:0051183 | vitamin transporter activity(GO:0051183) |
| 0.1 | 0.4 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.1 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.1 | 0.9 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.1 | 0.3 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.1 | 2.2 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.6 | GO:0016594 | glycine binding(GO:0016594) |
| 0.1 | 0.5 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.1 | 0.5 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.1 | 0.2 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.1 | 0.2 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.1 | 4.5 | GO:0008146 | sulfotransferase activity(GO:0008146) |
| 0.1 | 0.8 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.1 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.1 | 0.2 | GO:0089720 | caspase binding(GO:0089720) |
| 0.1 | 0.2 | GO:0032142 | single guanine insertion binding(GO:0032142) |
| 0.1 | 0.2 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
| 0.1 | 0.3 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.1 | 0.8 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.8 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.1 | 1.0 | GO:0005521 | lamin binding(GO:0005521) |
| 0.1 | 2.1 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.1 | 1.1 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.1 | 0.4 | GO:0031420 | alkali metal ion binding(GO:0031420) |
| 0.1 | 1.3 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.1 | 0.9 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.1 | 0.1 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
| 0.1 | 0.7 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.1 | 0.3 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.1 | 0.8 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.1 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.1 | 0.8 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.1 | 0.4 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.1 | 1.4 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.1 | 0.3 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.1 | 0.3 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.1 | 0.1 | GO:0000700 | mismatch base pair DNA N-glycosylase activity(GO:0000700) |
| 0.1 | 1.3 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.1 | 0.8 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.1 | 1.3 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
| 0.1 | 1.4 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 0.1 | 0.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.1 | 0.4 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.7 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.5 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.1 | 0.3 | GO:0004556 | alpha-amylase activity(GO:0004556) |
| 0.1 | 0.4 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 0.4 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.1 | 1.0 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.1 | 0.2 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.1 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.1 | 1.1 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.1 | 0.9 | GO:0016917 | GABA-A receptor activity(GO:0004890) GABA receptor activity(GO:0016917) |
| 0.1 | 0.3 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.1 | 0.6 | GO:0070694 | single-strand selective uracil DNA N-glycosylase activity(GO:0017065) nicotinamide riboside hydrolase activity(GO:0070635) nicotinic acid riboside hydrolase activity(GO:0070636) deoxyribonucleoside 5'-monophosphate N-glycosidase activity(GO:0070694) |
| 0.1 | 0.2 | GO:0071253 | connexin binding(GO:0071253) |
| 0.1 | 0.2 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.1 | 0.8 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
| 0.1 | 0.3 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.1 | 0.2 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.1 | 1.3 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.1 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.1 | 0.2 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.1 | 0.2 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.1 | 0.2 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.1 | 0.2 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.1 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
| 0.1 | 0.2 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.1 | 1.2 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.1 | 1.0 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.1 | 0.4 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.1 | 0.2 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.1 | 0.4 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.1 | 0.2 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.1 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.5 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.5 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.0 | 0.7 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.0 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.0 | 0.4 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.0 | 0.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.0 | 0.6 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.2 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.0 | 0.0 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.0 | 0.3 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.1 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.0 | 0.2 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.0 | 0.2 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 0.2 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.1 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.0 | 1.1 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.0 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.0 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.0 | 0.4 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.0 | 0.1 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.0 | 0.0 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.0 | 0.9 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.0 | 2.9 | GO:0019210 | kinase inhibitor activity(GO:0019210) |
| 0.0 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.0 | 0.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.1 | GO:0008412 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
| 0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.0 | 1.1 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
| 0.0 | 0.3 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.0 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.4 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.0 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.0 | 0.3 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.0 | 0.1 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
| 0.0 | 0.2 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.2 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.0 | 0.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.0 | 0.2 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.0 | 0.5 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 0.2 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.0 | 0.2 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.0 | 0.2 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 0.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.0 | 0.3 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.0 | 0.4 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.0 | 0.2 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.0 | 1.3 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.1 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.0 | 0.2 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.0 | 0.8 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.0 | 1.1 | GO:0008081 | phosphoric diester hydrolase activity(GO:0008081) |
| 0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.2 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.0 | 0.7 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.1 | GO:0031720 | haptoglobin binding(GO:0031720) |
| 0.0 | 1.4 | GO:0044823 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
| 0.0 | 0.6 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
| 0.0 | 0.3 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.1 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.0 | 0.1 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.0 | 1.1 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.1 | GO:0048019 | receptor antagonist activity(GO:0048019) |
| 0.0 | 0.0 | GO:0035276 | ethanol binding(GO:0035276) |
| 0.0 | 0.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.0 | 0.1 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.0 | 0.3 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.1 | GO:0019767 | IgE receptor activity(GO:0019767) |
| 0.0 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.6 | GO:0042165 | neurotransmitter binding(GO:0042165) |
| 0.0 | 0.3 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.1 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.0 | 0.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 0.1 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
| 0.0 | 0.1 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
| 0.0 | 0.1 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
| 0.0 | 0.3 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.0 | 0.0 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.0 | 0.1 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.0 | 0.3 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.0 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.0 | 0.3 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.0 | 0.5 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.0 | 0.1 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.0 | 0.5 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.0 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.0 | 0.1 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 0.1 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.0 | 0.0 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.0 | 0.1 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.0 | 0.2 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.2 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
| 0.0 | 0.1 | GO:0034912 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
| 0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.0 | 0.4 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.2 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
| 0.0 | 0.1 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.0 | 1.0 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 0.4 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 1.7 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.0 | 0.2 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.0 | 0.3 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.3 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.2 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.0 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
| 0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.2 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
| 0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.1 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
| 0.0 | 0.1 | GO:0035473 | lipase binding(GO:0035473) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.0 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 0.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.1 | GO:0019976 | interleukin-2 binding(GO:0019976) |
| 0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.0 | 0.0 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 0.0 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.2 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.1 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
| 0.0 | 0.0 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 0.9 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) |
| 0.0 | 0.3 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.1 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
| 0.0 | 0.0 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.0 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.0 | 0.0 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) |
| 0.0 | 0.1 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
| 0.0 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.0 | 0.0 | GO:0033265 | choline binding(GO:0033265) |
| 0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 0.1 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.0 | 0.1 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.0 | 0.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.0 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
| 0.0 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.1 | GO:0019841 | retinol binding(GO:0019841) |
| 0.0 | 0.0 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
| 0.0 | 0.1 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
| 0.0 | 0.0 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 0.3 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.1 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
| 0.0 | 0.4 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.0 | 0.0 | GO:0008147 | structural constituent of bone(GO:0008147) |
| 0.0 | 0.0 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.0 | 0.1 | GO:0015665 | polyol transmembrane transporter activity(GO:0015166) alcohol transmembrane transporter activity(GO:0015665) |
| 0.0 | 0.1 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.0 | 0.1 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.2 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.0 | 0.0 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.1 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.0 | 0.4 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.0 | 0.0 | GO:0043176 | amine binding(GO:0043176) |
| 0.0 | 0.0 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 0.0 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.0 | 0.0 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.0 | 0.0 | GO:0019863 | IgE binding(GO:0019863) |
| 0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.0 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.0 | 0.2 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.1 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 10.4 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.4 | 0.4 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.4 | 11.5 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.2 | 11.1 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.2 | 4.0 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.2 | 4.2 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.2 | 3.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.1 | 0.7 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.1 | 1.3 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.1 | 0.6 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 1.6 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.1 | 4.4 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.1 | 1.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 0.4 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.1 | 0.7 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.1 | 1.6 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 0.6 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.1 | 0.6 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.1 | 1.3 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.1 | 1.9 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.1 | 0.5 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.1 | 0.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.1 | 3.2 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 1.1 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.1 | 0.2 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.1 | 1.0 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 1.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 0.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.1 | 1.2 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.1 | 0.5 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 1.4 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.1 | 0.5 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.1 | 0.4 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.1 | 1.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.1 | 0.8 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.1 | 0.8 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.1 | 0.7 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.1 | 1.0 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 1.0 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.6 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.0 | 1.4 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 1.4 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.2 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 0.4 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.6 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 0.6 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.6 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 1.1 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.0 | 0.2 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.4 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.5 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 1.5 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.7 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.0 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 1.0 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.0 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 0.4 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.3 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.4 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.0 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.6 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.0 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.0 | 0.2 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 0.3 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.1 | PID EPO PATHWAY | EPO signaling pathway |
| 0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.2 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.6 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.2 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 0.2 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.3 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.0 | 0.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 0.2 | PID BARD1 PATHWAY | BARD1 signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 16.9 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.7 | 4.0 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.6 | 0.6 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.5 | 4.2 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.4 | 5.9 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.4 | 7.1 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.4 | 0.4 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.4 | 2.5 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.3 | 4.8 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.3 | 0.3 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.3 | 2.9 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.3 | 4.0 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.3 | 6.6 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.3 | 3.6 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.3 | 3.3 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.3 | 0.5 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
| 0.3 | 0.3 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.2 | 2.1 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.2 | 4.6 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.2 | 3.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.2 | 0.6 | REACTOME TRANSMISSION ACROSS CHEMICAL SYNAPSES | Genes involved in Transmission across Chemical Synapses |
| 0.2 | 2.3 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.2 | 1.7 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.2 | 2.3 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.2 | 6.9 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
| 0.2 | 2.6 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
| 0.2 | 3.2 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.2 | 3.9 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.2 | 1.7 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.2 | 4.4 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.1 | 1.5 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.1 | 5.7 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 0.7 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.1 | 4.6 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 0.1 | 1.7 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 0.4 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.1 | 1.9 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.1 | 0.2 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.1 | 0.8 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.1 | 0.7 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.1 | 1.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.1 | 1.5 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.1 | 1.7 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.1 | 2.1 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.1 | 0.3 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
| 0.1 | 1.2 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 2.0 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.1 | 1.4 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 0.3 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.1 | 1.0 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 0.4 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 0.9 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
| 0.1 | 3.4 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.1 | 0.3 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 0.5 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 0.6 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 1.1 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.1 | 0.2 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.1 | 0.6 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.1 | 1.4 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.1 | 0.6 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.1 | 0.4 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.1 | 0.7 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.1 | 0.9 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.1 | 0.8 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.1 | 1.1 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.1 | 0.2 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.1 | 0.9 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.1 | 1.4 | REACTOME TCR SIGNALING | Genes involved in TCR signaling |
| 0.1 | 0.9 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 1.1 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.1 | 0.3 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 3.5 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.1 | 0.3 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.1 | 0.2 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.1 | 0.8 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 0.5 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.1 | 0.2 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.1 | 0.5 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.1 | 0.6 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.1 | 0.4 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.1 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
| 0.0 | 0.6 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.0 | 0.7 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 0.5 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.0 | REACTOME NEGATIVE REGULATION OF FGFR SIGNALING | Genes involved in Negative regulation of FGFR signaling |
| 0.0 | 0.2 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 0.7 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.0 | 0.4 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.3 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 0.1 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.0 | 0.6 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 1.4 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.0 | 0.7 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 1.9 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.0 | 0.8 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.1 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.0 | 0.8 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.3 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.0 | 1.0 | REACTOME ION CHANNEL TRANSPORT | Genes involved in Ion channel transport |
| 0.0 | 0.3 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
| 0.0 | 0.1 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.0 | 0.2 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.4 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.3 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 0.0 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
| 0.0 | 0.3 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.0 | 0.5 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.1 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 0.6 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.0 | 1.7 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 1.2 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 0.3 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.1 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.1 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.4 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.0 | 0.3 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.0 | 0.1 | REACTOME APOPTOTIC EXECUTION PHASE | Genes involved in Apoptotic execution phase |
| 0.0 | 0.9 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 0.6 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.5 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.3 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.0 | 0.1 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 0.8 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
| 0.0 | 3.1 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 1.0 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.0 | 0.2 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.0 | 0.2 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.0 | 0.5 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.3 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.2 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 0.2 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.0 | 0.5 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.0 | 0.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 0.1 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.0 | 0.2 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 0.0 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.0 | 0.8 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.1 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.0 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.1 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 0.2 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
| 0.0 | 0.1 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.1 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |