Gene Symbol | Gene ID | Gene Info |
---|---|---|
Erg
|
ENSMUSG00000040732.12 | ETS transcription factor |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Erg | chr16_95422741_95422892 | 36429 | 0.183941 | 0.65 | 1.0e-07 | Click! |
Erg | chr16_95463946_95464097 | 4673 | 0.310417 | 0.63 | 2.0e-07 | Click! |
Erg | chr16_95619853_95620376 | 33521 | 0.191503 | 0.60 | 1.4e-06 | Click! |
Erg | chr16_95408141_95408292 | 51029 | 0.137354 | 0.54 | 2.1e-05 | Click! |
Erg | chr16_95487606_95487757 | 28333 | 0.226910 | 0.52 | 4.0e-05 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr8_20817574_20818579 | 17.28 |
Gm20946 |
predicted gene, 20946 |
10277 |
0.15 |
chr8_20372500_20373383 | 17.15 |
Gm7807 |
predicted gene 7807 |
8140 |
0.18 |
chr4_5560069_5560251 | 16.53 |
Gm11782 |
predicted gene 11782 |
8937 |
0.23 |
chr8_9055391_9055560 | 14.15 |
4933430N04Rik |
RIKEN cDNA 4933430N04 gene |
76813 |
0.08 |
chr8_77711737_77712181 | 12.24 |
4933431K23Rik |
RIKEN cDNA 4933431K23 gene |
11625 |
0.17 |
chr14_23131674_23132058 | 11.45 |
Gm10248 |
predicted gene 10248 |
37295 |
0.22 |
chr5_119811420_119811765 | 11.42 |
1700021F13Rik |
RIKEN cDNA 1700021F13 gene |
3723 |
0.21 |
chr10_97537037_97537188 | 11.12 |
Lum |
lumican |
28016 |
0.16 |
chr18_8328148_8328302 | 10.94 |
Gm5500 |
predicted pseudogene 5500 |
86904 |
0.09 |
chr11_34169627_34169839 | 10.74 |
Gm12121 |
predicted gene 12121 |
27906 |
0.16 |
chr10_75466081_75466463 | 10.42 |
Gm48158 |
predicted gene, 48158 |
17120 |
0.12 |
chr1_134771371_134771653 | 10.39 |
Ppp1r12b |
protein phosphatase 1, regulatory subunit 12B |
11159 |
0.14 |
chr11_102819100_102819714 | 10.18 |
Gjc1 |
gap junction protein, gamma 1 |
197 |
0.89 |
chr3_108759576_108759730 | 10.04 |
Aknad1 |
AKNA domain containing 1 |
561 |
0.71 |
chr8_20024336_20025030 | 9.83 |
Gm45754 |
predicted gene 45754 |
5272 |
0.19 |
chr9_32646902_32647120 | 9.69 |
Ets1 |
E26 avian leukemia oncogene 1, 5' domain |
10763 |
0.16 |
chr1_45043269_45043619 | 9.69 |
Gm3496 |
predicted gene 3496 |
118551 |
0.06 |
chr8_121300585_121301359 | 9.68 |
Gm26815 |
predicted gene, 26815 |
55864 |
0.11 |
chr17_25083410_25083921 | 9.67 |
Tmem204 |
transmembrane protein 204 |
74 |
0.95 |
chr6_4489804_4490272 | 9.65 |
Gm37883 |
predicted gene, 37883 |
5840 |
0.16 |
chr14_67383769_67383938 | 9.64 |
4930438E09Rik |
RIKEN cDNA 4930438E09 gene |
13889 |
0.18 |
chr14_14354416_14355184 | 9.54 |
Il3ra |
interleukin 3 receptor, alpha chain |
5179 |
0.12 |
chr8_19719087_19719899 | 9.53 |
Gm7760 |
predicted gene 7760 |
7788 |
0.16 |
chr7_48845690_48846008 | 9.42 |
Csrp3 |
cysteine and glycine-rich protein 3 |
630 |
0.66 |
chr3_30105594_30105754 | 9.41 |
Mecom |
MDS1 and EVI1 complex locus |
34749 |
0.17 |
chr16_34909527_34909678 | 9.40 |
Mylk |
myosin, light polypeptide kinase |
4463 |
0.24 |
chr18_37836359_37836756 | 9.32 |
Gm29994 |
predicted gene, 29994 |
6357 |
0.07 |
chr8_68416856_68417007 | 9.03 |
Gm15656 |
predicted gene 15656 |
40217 |
0.15 |
chr2_60688910_60689539 | 9.00 |
Itgb6 |
integrin beta 6 |
15470 |
0.23 |
chr19_24258490_24258641 | 8.91 |
Fxn |
frataxin |
19606 |
0.16 |
chr14_29867376_29867800 | 8.88 |
Gm35281 |
predicted gene, 35281 |
15180 |
0.18 |
chr12_119390165_119390727 | 8.86 |
Macc1 |
metastasis associated in colon cancer 1 |
71 |
0.98 |
chr10_91241133_91241544 | 8.82 |
Gm47081 |
predicted gene, 47081 |
13152 |
0.15 |
chr17_88625908_88626248 | 8.75 |
Ston1 |
stonin 1 |
477 |
0.78 |
chr16_23218507_23218680 | 8.75 |
St6gal1 |
beta galactoside alpha 2,6 sialyltransferase 1 |
6147 |
0.11 |
chr17_12631815_12632216 | 8.67 |
Slc22a1 |
solute carrier family 22 (organic cation transporter), member 1 |
20693 |
0.16 |
chr1_167292304_167292628 | 8.50 |
Mir6347 |
microRNA 6347 |
2341 |
0.17 |
chr2_31771229_31771601 | 8.46 |
Abl1 |
c-abl oncogene 1, non-receptor tyrosine kinase |
11242 |
0.15 |
chr14_14347096_14348750 | 8.44 |
Gm48860 |
predicted gene, 48860 |
659 |
0.44 |
chr2_167543392_167543550 | 8.40 |
Snai1 |
snail family zinc finger 1 |
5276 |
0.13 |
chr8_61665080_61665513 | 8.38 |
Palld |
palladin, cytoskeletal associated protein |
74154 |
0.11 |
chr5_130623231_130623604 | 8.36 |
Gm43418 |
predicted gene 43418 |
4866 |
0.31 |
chr2_57997793_57998300 | 8.30 |
Galnt5 |
polypeptide N-acetylgalactosaminyltransferase 5 |
162 |
0.96 |
chr2_75209070_75209435 | 8.26 |
Gm13653 |
predicted gene 13653 |
16975 |
0.14 |
chr15_61770939_61771188 | 8.25 |
D030024E09Rik |
RIKEN cDNA D030024E09 gene |
3388 |
0.34 |
chr11_50635067_50635596 | 8.19 |
Gm12198 |
predicted gene 12198 |
32883 |
0.14 |
chr7_75575337_75575682 | 8.18 |
Gm44835 |
predicted gene 44835 |
14895 |
0.19 |
chr16_4651632_4652201 | 8.05 |
Coro7 |
coronin 7 |
5200 |
0.13 |
chr7_71531558_71531709 | 8.00 |
Gm44689 |
predicted gene 44689 |
156814 |
0.03 |
chr5_73754282_73754433 | 7.93 |
Spata18 |
spermatogenesis associated 18 |
95096 |
0.06 |
chr11_21399160_21399382 | 7.91 |
Ugp2 |
UDP-glucose pyrophosphorylase 2 |
28070 |
0.12 |
chr11_16559053_16559300 | 7.90 |
Akt2-ps |
thymoma viral proto-oncogene 2, pseudogene |
44643 |
0.13 |
chr12_84851732_84851883 | 7.89 |
D030025P21Rik |
RIKEN cDNA D030025P21 gene |
23962 |
0.12 |
chr11_48216901_48217052 | 7.80 |
Gm12178 |
predicted gene 12178 |
73337 |
0.12 |
chr11_79280131_79280327 | 7.75 |
Gm44787 |
predicted gene 44787 |
6336 |
0.16 |
chr11_75623907_75624305 | 7.74 |
Pitpna |
phosphatidylinositol transfer protein, alpha |
3435 |
0.14 |
chr7_89773366_89773742 | 7.72 |
Gm15744 |
predicted gene 15744 |
11879 |
0.19 |
chr6_82127929_82128080 | 7.67 |
Gm15864 |
predicted gene 15864 |
75423 |
0.08 |
chr6_39515138_39515308 | 7.63 |
8030453O22Rik |
RIKEN cDNA 8030453O22 gene |
12290 |
0.15 |
chr4_100435665_100436137 | 7.57 |
Ube2u |
ubiquitin-conjugating enzyme E2U (putative) |
42948 |
0.16 |
chr3_38283633_38283929 | 7.54 |
Gm2965 |
predicted gene 2965 |
60330 |
0.11 |
chr2_163397932_163398257 | 7.53 |
Jph2 |
junctophilin 2 |
101 |
0.95 |
chr15_94139516_94139713 | 7.47 |
Gm30564 |
predicted gene, 30564 |
174906 |
0.03 |
chr5_75152064_75152414 | 7.43 |
Pdgfra |
platelet derived growth factor receptor, alpha polypeptide |
53 |
0.94 |
chr12_27136313_27136467 | 7.41 |
Gm9866 |
predicted gene 9866 |
21395 |
0.27 |
chr7_45567801_45568907 | 7.36 |
Bcat2 |
branched chain aminotransferase 2, mitochondrial |
1799 |
0.12 |
chr6_5750193_5750365 | 7.36 |
Dync1i1 |
dynein cytoplasmic 1 intermediate chain 1 |
7140 |
0.32 |
chr4_45819774_45820345 | 7.29 |
Igfbpl1 |
insulin-like growth factor binding protein-like 1 |
3696 |
0.18 |
chr5_143001041_143001707 | 7.29 |
Rnf216 |
ring finger protein 216 |
15400 |
0.14 |
chr5_134014531_134015255 | 7.28 |
1700030N18Rik |
RIKEN cDNA 1700030N18 gene |
76558 |
0.08 |
chr17_67988919_67989257 | 7.28 |
Arhgap28 |
Rho GTPase activating protein 28 |
15032 |
0.27 |
chr2_128339647_128340198 | 7.28 |
Morrbid |
myeloid RNA regulator of BCL2L11 induced cell death |
6054 |
0.26 |
chr4_127258243_127258443 | 7.23 |
Smim12 |
small integral membrane protein 12 |
14559 |
0.13 |
chr11_75161769_75161983 | 7.23 |
Smg6 |
Smg-6 homolog, nonsense mediated mRNA decay factor (C. elegans) |
2243 |
0.15 |
chr7_101393716_101394494 | 7.17 |
Arap1 |
ArfGAP with RhoGAP domain, ankyrin repeat and PH domain 1 |
263 |
0.87 |
chr14_72200711_72200862 | 7.17 |
Gm49290 |
predicted gene, 49290 |
5090 |
0.32 |
chr2_27888752_27889177 | 7.10 |
2810430I11Rik |
RIKEN cDNA 2810430I11 gene |
1912 |
0.33 |
chr7_108797627_108797969 | 7.06 |
Gm45232 |
predicted gene 45232 |
2795 |
0.17 |
chr17_14640836_14641000 | 7.03 |
Thbs2 |
thrombospondin 2 |
29948 |
0.2 |
chr3_53166136_53166356 | 7.02 |
Gm43803 |
predicted gene 43803 |
52835 |
0.09 |
chr17_86499788_86499939 | 7.00 |
Gm10309 |
predicted gene 10309 |
5369 |
0.24 |
chr11_46065406_46066070 | 7.00 |
Adam19 |
a disintegrin and metallopeptidase domain 19 (meltrin beta) |
9680 |
0.13 |
chr17_6467913_6468580 | 6.99 |
Tmem181b-ps |
transmembrane protein 181B, pseudogene |
1224 |
0.43 |
chr10_83805128_83805750 | 6.97 |
Gm47245 |
predicted gene, 47245 |
6126 |
0.26 |
chr14_62375833_62376061 | 6.97 |
Rnaseh2b |
ribonuclease H2, subunit B |
28648 |
0.17 |
chr7_24907188_24907865 | 6.96 |
Arhgef1 |
Rho guanine nucleotide exchange factor (GEF) 1 |
121 |
0.92 |
chr7_136327434_136327589 | 6.88 |
C230079O03Rik |
RIKEN cDNA C230079O03 gene |
21904 |
0.17 |
chr10_58341700_58341851 | 6.85 |
Gm23058 |
predicted gene, 23058 |
7829 |
0.18 |
chr12_80238416_80238567 | 6.84 |
Actn1 |
actinin, alpha 1 |
20293 |
0.13 |
chr14_16554652_16554846 | 6.83 |
Rarb |
retinoic acid receptor, beta |
20296 |
0.21 |
chr18_61652787_61653138 | 6.82 |
Mir143 |
microRNA 143 |
3704 |
0.13 |
chr8_80895487_80895638 | 6.79 |
Gab1 |
growth factor receptor bound protein 2-associated protein 1 |
15043 |
0.16 |
chr5_148361109_148361516 | 6.79 |
Slc7a1 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 1 |
10234 |
0.23 |
chr7_109561915_109562427 | 6.76 |
Denn2b |
DENN domain containing 2B |
21738 |
0.12 |
chr16_22542946_22543153 | 6.73 |
Gm49565 |
predicted gene, 49565 |
2576 |
0.17 |
chr7_68294485_68294636 | 6.70 |
Fam169b |
family with sequence similarity 169, member B |
5553 |
0.15 |
chr3_97040267_97040581 | 6.70 |
Gja5 |
gap junction protein, alpha 5 |
8008 |
0.17 |
chr2_32317120_32318698 | 6.69 |
Gm23363 |
predicted gene, 23363 |
356 |
0.45 |
chr4_111425371_111425522 | 6.57 |
n-R5s191 |
nuclear encoded rRNA 5S 191 |
2487 |
0.32 |
chr19_60073379_60073544 | 6.56 |
Csf1r-ps |
colony stimulating factor 1 receptor (granulocyte), pseudogene |
5971 |
0.22 |
chr16_44629994_44630289 | 6.55 |
Boc |
biregional cell adhesion molecule-related/down-regulated by oncogenes (Cdon) binding protein |
71244 |
0.09 |
chr4_72946314_72947001 | 6.55 |
Gm25653 |
predicted gene, 25653 |
40319 |
0.16 |
chr2_60922420_60922571 | 6.53 |
Rbms1 |
RNA binding motif, single stranded interacting protein 1 |
33465 |
0.19 |
chr10_83836361_83836512 | 6.51 |
Gm47245 |
predicted gene, 47245 |
24871 |
0.2 |
chr7_128320559_128320729 | 6.49 |
Gm6916 |
predicted pseudogene 6916 |
5860 |
0.11 |
chr6_89003658_89003963 | 6.47 |
4933427D06Rik |
RIKEN cDNA 4933427D06 gene |
53127 |
0.1 |
chr13_59916610_59916800 | 6.41 |
Gm19866 |
predicted gene, 19866 |
883 |
0.51 |
chr3_87150680_87150988 | 6.41 |
Gm37855 |
predicted gene, 37855 |
6859 |
0.18 |
chr2_125470594_125470771 | 6.39 |
Gm9913 |
predicted gene 9913 |
34407 |
0.17 |
chr15_12054957_12055108 | 6.35 |
Gm2559 |
predicted gene 2559 |
23105 |
0.14 |
chr14_27051494_27051859 | 6.27 |
Il17rd |
interleukin 17 receptor D |
12420 |
0.2 |
chr15_82158698_82158898 | 6.26 |
Srebf2 |
sterol regulatory element binding factor 2 |
10773 |
0.09 |
chr1_192799944_192800186 | 6.24 |
Gm38360 |
predicted gene, 38360 |
21062 |
0.12 |
chr11_90054518_90054707 | 6.23 |
Tmem100 |
transmembrane protein 100 |
24264 |
0.2 |
chr8_36952388_36952728 | 6.18 |
Dlc1 |
deleted in liver cancer 1 |
116 |
0.97 |
chr2_73592340_73592590 | 6.17 |
Chn1os3 |
chimerin 1, opposite strand 3 |
4061 |
0.17 |
chr19_47886722_47886925 | 6.10 |
Gsto2 |
glutathione S-transferase omega 2 |
16561 |
0.13 |
chr6_51118984_51119135 | 6.08 |
Mir148a |
microRNA 148a |
150851 |
0.04 |
chr12_92120264_92120459 | 6.05 |
Gm40598 |
predicted gene, 40598 |
41078 |
0.17 |
chr13_51022956_51023153 | 6.04 |
Spin1 |
spindlin 1 |
77826 |
0.1 |
chr7_112719981_112720602 | 6.04 |
Gm44462 |
predicted gene, 44462 |
6340 |
0.2 |
chr3_30246017_30246361 | 6.02 |
Mecom |
MDS1 and EVI1 complex locus |
7870 |
0.17 |
chr7_96774668_96774819 | 6.01 |
Tenm4 |
teneurin transmembrane protein 4 |
3191 |
0.23 |
chr15_79432058_79432288 | 6.01 |
Csnk1e |
casein kinase 1, epsilon |
953 |
0.4 |
chr4_31412252_31412403 | 6.00 |
Gm11922 |
predicted gene 11922 |
31855 |
0.25 |
chr10_122008710_122009082 | 5.98 |
Srgap1 |
SLIT-ROBO Rho GTPase activating protein 1 |
38412 |
0.13 |
chr9_116253593_116253744 | 5.96 |
Gm31410 |
predicted gene, 31410 |
34866 |
0.16 |
chr8_71554693_71554928 | 5.96 |
Tmem221 |
transmembrane protein 221 |
4061 |
0.09 |
chr1_84089647_84089953 | 5.95 |
Pid1 |
phosphotyrosine interaction domain containing 1 |
36547 |
0.17 |
chr18_53607904_53608140 | 5.95 |
Gm19466 |
predicted gene, 19466 |
31084 |
0.21 |
chr6_91546250_91546583 | 5.95 |
Gm45216 |
predicted gene 45216 |
24007 |
0.11 |
chr7_72166451_72166602 | 5.93 |
Mctp2 |
multiple C2 domains, transmembrane 2 |
4152 |
0.25 |
chr10_21669738_21669889 | 5.91 |
Gm5420 |
predicted gene 5420 |
16598 |
0.21 |
chr11_87584840_87585035 | 5.91 |
Septin4 |
septin 4 |
288 |
0.86 |
chr7_123097743_123098471 | 5.85 |
Tnrc6a |
trinucleotide repeat containing 6a |
25778 |
0.17 |
chr7_15933626_15933972 | 5.84 |
Snord23 |
small nucleolar RNA, C/D box 23 |
5071 |
0.11 |
chr2_30078329_30078759 | 5.84 |
Pkn3 |
protein kinase N3 |
40 |
0.95 |
chr10_78590861_78591020 | 5.83 |
Gm30346 |
predicted gene, 30346 |
773 |
0.33 |
chr11_117091482_117091633 | 5.82 |
Gm11730 |
predicted gene 11730 |
5470 |
0.11 |
chr4_127278711_127278880 | 5.82 |
Gm22221 |
predicted gene, 22221 |
6038 |
0.14 |
chr9_35363113_35363479 | 5.81 |
2610105M22Rik |
RIKEN cDNA 2610105M22 gene |
183 |
0.94 |
chr11_35053687_35053873 | 5.77 |
Slit3 |
slit guidance ligand 3 |
67444 |
0.12 |
chr14_31564746_31565181 | 5.74 |
Colq |
collagen-like tail subunit (single strand of homotrimer) of asymmetric acetylcholinesterase |
6823 |
0.16 |
chr1_89092807_89092977 | 5.74 |
Gm38312 |
predicted gene, 38312 |
4181 |
0.23 |
chr6_6299184_6299518 | 5.72 |
Gm20619 |
predicted gene 20619 |
70 |
0.97 |
chr14_24748229_24748551 | 5.68 |
Gm47906 |
predicted gene, 47906 |
85245 |
0.08 |
chr17_31920620_31920938 | 5.67 |
Gm30571 |
predicted gene, 30571 |
8113 |
0.14 |
chr2_163364918_163365073 | 5.66 |
Jph2 |
junctophilin 2 |
32954 |
0.12 |
chr7_115501491_115501878 | 5.66 |
Sox6 |
SRY (sex determining region Y)-box 6 |
96212 |
0.09 |
chr8_121451403_121451770 | 5.66 |
Gm26784 |
predicted gene, 26784 |
16606 |
0.16 |
chr1_90662726_90662877 | 5.66 |
Gm9991 |
predicted gene 9991 |
12360 |
0.23 |
chr1_163444004_163444155 | 5.65 |
Gorab |
golgin, RAB6-interacting |
40410 |
0.15 |
chr3_51270332_51270495 | 5.65 |
4930577N17Rik |
RIKEN cDNA 4930577N17 gene |
6346 |
0.12 |
chr1_92376521_92376675 | 5.65 |
Gm29099 |
predicted gene 29099 |
52088 |
0.1 |
chr6_100975954_100976145 | 5.64 |
Gm43941 |
predicted gene, 43941 |
15060 |
0.19 |
chr16_15368834_15369019 | 5.61 |
Gm21897 |
predicted gene, 21897 |
51468 |
0.13 |
chr17_28079715_28081005 | 5.60 |
Gm50238 |
predicted gene, 50238 |
65 |
0.63 |
chr4_141598441_141598939 | 5.57 |
Fblim1 |
filamin binding LIM protein 1 |
173 |
0.91 |
chr7_27331991_27332142 | 5.57 |
Ltbp4 |
latent transforming growth factor beta binding protein 4 |
1547 |
0.25 |
chr16_38621153_38621308 | 5.56 |
Tmem39a |
transmembrane protein 39a |
33191 |
0.12 |
chr18_61632453_61632775 | 5.56 |
Bvht |
braveheart long non-coding RNA |
6928 |
0.12 |
chr13_53309706_53310161 | 5.53 |
Ror2 |
receptor tyrosine kinase-like orphan receptor 2 |
23809 |
0.2 |
chr6_93648670_93648869 | 5.51 |
Gm7812 |
predicted gene 7812 |
1456 |
0.55 |
chr2_74619787_74619938 | 5.49 |
Gm22975 |
predicted gene, 22975 |
4780 |
0.1 |
chr14_34568066_34568248 | 5.45 |
Ldb3 |
LIM domain binding 3 |
8837 |
0.13 |
chr4_57834121_57834546 | 5.44 |
Pakap |
paralemmin A kinase anchor protein |
5088 |
0.23 |
chr7_110297264_110297888 | 5.44 |
Gm9132 |
predicted gene 9132 |
4425 |
0.2 |
chr14_45826265_45826416 | 5.43 |
Gm8317 |
predicted gene 8317 |
32206 |
0.15 |
chr2_50347526_50347677 | 5.42 |
Gm48908 |
predicted gene 48908 |
32799 |
0.16 |
chr9_41889978_41890642 | 5.42 |
Gm40513 |
predicted gene, 40513 |
294 |
0.89 |
chr2_127722535_127722936 | 5.41 |
Mall |
mal, T cell differentiation protein-like |
7197 |
0.13 |
chr7_27181101_27181592 | 5.41 |
Mia |
melanoma inhibitory activity |
189 |
0.54 |
chr5_130192318_130192469 | 5.41 |
Ndufa12-ps |
NADH:ubiquinone oxidoreductase subunit A12, pseudogene |
3998 |
0.12 |
chr6_120114713_120115026 | 5.40 |
Ninj2 |
ninjurin 2 |
21519 |
0.17 |
chr11_109593625_109593942 | 5.39 |
Wipi1 |
WD repeat domain, phosphoinositide interacting 1 |
17649 |
0.14 |
chr17_6279301_6279621 | 5.39 |
Tmem181a |
transmembrane protein 181A |
8991 |
0.13 |
chr6_53815786_53816211 | 5.38 |
Gm16499 |
predicted gene 16499 |
2745 |
0.25 |
chr6_96028227_96028429 | 5.38 |
Gm5881 |
predicted gene 5881 |
5041 |
0.31 |
chr19_47292491_47292662 | 5.38 |
Mir6995 |
microRNA 6995 |
18987 |
0.13 |
chr5_17116191_17116387 | 5.33 |
Gm6673 |
predicted gene 6673 |
111645 |
0.07 |
chr14_34540679_34541231 | 5.30 |
9230112D13Rik |
RIKEN cDNA 9230112D13 gene |
18154 |
0.11 |
chr2_17364053_17364204 | 5.29 |
Nebl |
nebulette |
3042 |
0.38 |
chr9_119002355_119002561 | 5.28 |
Mir26a-1 |
microRNA 26a-1 |
29338 |
0.12 |
chr2_92645434_92645590 | 5.23 |
Chst1 |
carbohydrate sulfotransferase 1 |
45805 |
0.11 |
chr11_3573105_3573456 | 5.22 |
Smtn |
smoothelin |
32668 |
0.08 |
chr15_84219070_84219275 | 5.22 |
Parvb |
parvin, beta |
12871 |
0.12 |
chr8_128679845_128680004 | 5.21 |
Itgb1 |
integrin beta 1 (fibronectin receptor beta) |
5730 |
0.19 |
chr11_61590765_61590916 | 5.21 |
Epn2 |
epsin 2 |
11153 |
0.16 |
chr9_13645162_13645510 | 5.17 |
Maml2 |
mastermind like transcriptional coactivator 2 |
17124 |
0.19 |
chr3_149117167_149117318 | 5.17 |
Gm25127 |
predicted gene, 25127 |
88310 |
0.07 |
chr1_177531998_177532149 | 5.16 |
Gm37280 |
predicted gene, 37280 |
62449 |
0.09 |
chr6_140354183_140354370 | 5.15 |
n-R5s168 |
nuclear encoded rRNA 5S 168 |
34646 |
0.14 |
chr12_73035571_73035728 | 5.14 |
Six1 |
sine oculis-related homeobox 1 |
7166 |
0.21 |
chr8_114018414_114018750 | 5.14 |
Nudt7 |
nudix (nucleoside diphosphate linked moiety X)-type motif 7 |
114975 |
0.06 |
chr11_35124972_35125394 | 5.13 |
Slit3 |
slit guidance ligand 3 |
3959 |
0.33 |
chr16_18733137_18733525 | 5.13 |
Cldn5 |
claudin 5 |
43516 |
0.1 |
chr5_75900596_75900747 | 5.12 |
Gm25374 |
predicted gene, 25374 |
9156 |
0.18 |
chr15_96834991_96835151 | 5.11 |
Gm8888 |
predicted gene 8888 |
67993 |
0.11 |
chr4_134779088_134779254 | 5.11 |
Ldlrap1 |
low density lipoprotein receptor adaptor protein 1 |
11147 |
0.19 |
chr2_167877725_167877886 | 5.10 |
Gm14319 |
predicted gene 14319 |
19220 |
0.16 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.5 | 7.6 | GO:0038091 | VEGF-activated platelet-derived growth factor receptor signaling pathway(GO:0038086) positive regulation of cell proliferation by VEGF-activated platelet derived growth factor receptor signaling pathway(GO:0038091) |
1.8 | 9.0 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
1.7 | 5.2 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
1.6 | 8.2 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
1.6 | 9.8 | GO:1904424 | regulation of GTP binding(GO:1904424) |
1.6 | 6.3 | GO:0035995 | detection of muscle stretch(GO:0035995) |
1.5 | 4.6 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
1.5 | 2.9 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
1.5 | 4.4 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
1.4 | 5.6 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
1.3 | 4.0 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
1.3 | 5.1 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
1.3 | 2.5 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
1.2 | 5.9 | GO:0030578 | PML body organization(GO:0030578) |
1.1 | 3.3 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
1.1 | 3.3 | GO:2000040 | regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
1.1 | 5.3 | GO:1902548 | negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
1.0 | 3.0 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
1.0 | 3.9 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.9 | 1.9 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.9 | 2.8 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.9 | 2.8 | GO:0048369 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.9 | 2.8 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.9 | 0.9 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.9 | 2.7 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.9 | 16.2 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
0.9 | 2.7 | GO:0031296 | B cell costimulation(GO:0031296) |
0.9 | 2.6 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.9 | 4.3 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.9 | 3.5 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.9 | 0.9 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.9 | 2.6 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
0.9 | 2.6 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.8 | 5.7 | GO:1900746 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902547) |
0.8 | 2.4 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.8 | 4.6 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.8 | 2.3 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.8 | 0.8 | GO:0071335 | hair follicle cell proliferation(GO:0071335) regulation of hair follicle cell proliferation(GO:0071336) |
0.7 | 3.0 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.7 | 1.5 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.7 | 2.2 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.7 | 2.2 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.7 | 3.6 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.7 | 2.0 | GO:2000449 | regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) |
0.7 | 4.7 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.6 | 1.9 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.6 | 2.6 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.6 | 1.8 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.6 | 1.2 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.6 | 3.0 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.6 | 1.2 | GO:0033058 | directional locomotion(GO:0033058) |
0.6 | 2.4 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.6 | 12.5 | GO:0001945 | lymph vessel development(GO:0001945) |
0.6 | 2.9 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.6 | 1.7 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.6 | 1.7 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.6 | 1.1 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.5 | 2.2 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.5 | 1.6 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) prostate gland morphogenetic growth(GO:0060737) |
0.5 | 1.6 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.5 | 1.6 | GO:0034443 | negative regulation of lipoprotein oxidation(GO:0034443) |
0.5 | 5.2 | GO:0033623 | regulation of integrin activation(GO:0033623) |
0.5 | 1.0 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.5 | 1.5 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.5 | 2.0 | GO:0060486 | Clara cell differentiation(GO:0060486) |
0.5 | 1.5 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.5 | 1.0 | GO:0070346 | positive regulation of fat cell proliferation(GO:0070346) |
0.5 | 0.5 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.5 | 2.5 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.5 | 1.5 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.5 | 1.0 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.5 | 3.4 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.5 | 1.9 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.5 | 1.4 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.5 | 2.4 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.5 | 2.8 | GO:0051639 | actin filament network formation(GO:0051639) |
0.5 | 0.9 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.5 | 0.9 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.5 | 1.8 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.5 | 1.8 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.4 | 1.3 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.4 | 1.3 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
0.4 | 1.8 | GO:2000389 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
0.4 | 1.8 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.4 | 1.8 | GO:0060437 | lung growth(GO:0060437) |
0.4 | 1.3 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.4 | 4.7 | GO:0048368 | lateral mesoderm development(GO:0048368) |
0.4 | 0.9 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
0.4 | 0.4 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
0.4 | 4.3 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.4 | 2.1 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.4 | 0.8 | GO:0036484 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
0.4 | 2.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.4 | 1.2 | GO:0051665 | membrane raft localization(GO:0051665) |
0.4 | 1.2 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.4 | 1.2 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.4 | 0.4 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
0.4 | 1.6 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.4 | 1.6 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.4 | 2.4 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
0.4 | 2.0 | GO:0002158 | osteoclast proliferation(GO:0002158) |
0.4 | 2.0 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.4 | 0.8 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.4 | 0.4 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.4 | 1.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.4 | 1.2 | GO:0090135 | actin filament branching(GO:0090135) |
0.4 | 1.2 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.4 | 0.8 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.4 | 1.1 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.4 | 1.5 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.4 | 2.3 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.4 | 3.0 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.4 | 1.5 | GO:0072310 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
0.4 | 1.8 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.4 | 0.7 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.4 | 1.8 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.4 | 0.4 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.4 | 1.8 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.4 | 0.4 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.4 | 2.9 | GO:0007144 | female meiosis I(GO:0007144) |
0.4 | 1.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.4 | 0.7 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
0.4 | 0.4 | GO:1904849 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
0.4 | 0.4 | GO:0021550 | medulla oblongata development(GO:0021550) |
0.3 | 0.7 | GO:0051124 | synaptic growth at neuromuscular junction(GO:0051124) |
0.3 | 0.3 | GO:0060129 | thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
0.3 | 2.7 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.3 | 3.7 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.3 | 0.7 | GO:0007494 | midgut development(GO:0007494) |
0.3 | 1.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.3 | 1.3 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.3 | 1.0 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.3 | 1.3 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.3 | 0.3 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.3 | 1.3 | GO:0019230 | proprioception(GO:0019230) |
0.3 | 2.9 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.3 | 0.7 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.3 | 1.3 | GO:1903672 | positive regulation of sprouting angiogenesis(GO:1903672) |
0.3 | 1.6 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.3 | 1.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.3 | 1.0 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.3 | 1.0 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
0.3 | 1.6 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.3 | 0.6 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.3 | 0.9 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.3 | 0.9 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.3 | 0.9 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.3 | 0.6 | GO:0038109 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.3 | 1.2 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.3 | 1.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.3 | 0.6 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.3 | 0.9 | GO:0060057 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
0.3 | 2.4 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.3 | 0.6 | GO:0003222 | ventricular trabecula myocardium morphogenesis(GO:0003222) |
0.3 | 3.6 | GO:0048484 | enteric nervous system development(GO:0048484) |
0.3 | 0.3 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
0.3 | 2.4 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.3 | 0.9 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.3 | 0.6 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
0.3 | 1.7 | GO:0015871 | choline transport(GO:0015871) |
0.3 | 1.5 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.3 | 0.9 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.3 | 2.0 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.3 | 0.3 | GO:0003096 | renal sodium ion transport(GO:0003096) |
0.3 | 0.9 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.3 | 1.1 | GO:0060534 | trachea cartilage development(GO:0060534) |
0.3 | 0.6 | GO:0003166 | bundle of His development(GO:0003166) |
0.3 | 0.8 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.3 | 1.1 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.3 | 2.0 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.3 | 0.8 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.3 | 1.1 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
0.3 | 0.5 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.3 | 1.6 | GO:0090085 | regulation of protein deubiquitination(GO:0090085) |
0.3 | 1.6 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.3 | 0.5 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.3 | 2.1 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.3 | 0.8 | GO:2000619 | negative regulation of histone H4-K16 acetylation(GO:2000619) |
0.3 | 0.3 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.3 | 1.6 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.3 | 0.5 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.3 | 1.0 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.3 | 3.6 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
0.3 | 1.0 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
0.3 | 0.3 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.3 | 0.8 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.2 | 0.7 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.2 | 0.7 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.2 | 1.2 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.2 | 1.2 | GO:0009202 | deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
0.2 | 0.5 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.2 | 0.5 | GO:2000977 | regulation of forebrain neuron differentiation(GO:2000977) |
0.2 | 1.0 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.2 | 1.2 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.2 | 1.2 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.2 | 1.2 | GO:0061525 | hindgut development(GO:0061525) |
0.2 | 0.7 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.2 | 0.5 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
0.2 | 2.1 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.2 | 0.7 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.2 | 0.9 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.2 | 1.1 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.2 | 2.0 | GO:1904851 | positive regulation of establishment of protein localization to telomere(GO:1904851) |
0.2 | 2.0 | GO:0051043 | regulation of membrane protein ectodomain proteolysis(GO:0051043) positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.2 | 1.3 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.2 | 0.4 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
0.2 | 0.2 | GO:0061046 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) regulation of branching involved in lung morphogenesis(GO:0061046) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.2 | 0.4 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
0.2 | 3.5 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.2 | 0.4 | GO:0032831 | positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.2 | 0.4 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.2 | 0.4 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.2 | 0.4 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.2 | 1.1 | GO:2000553 | positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
0.2 | 0.4 | GO:0043622 | cortical microtubule organization(GO:0043622) |
0.2 | 0.6 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.2 | 0.2 | GO:0014900 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.2 | 0.6 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.2 | 1.1 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.2 | 0.6 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.2 | 0.6 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.2 | 1.5 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.2 | 1.3 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.2 | 0.4 | GO:0042368 | vitamin D biosynthetic process(GO:0042368) regulation of vitamin D biosynthetic process(GO:0060556) |
0.2 | 0.6 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.2 | 1.0 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.2 | 0.8 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.2 | 0.2 | GO:0021564 | vagus nerve development(GO:0021564) |
0.2 | 0.8 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.2 | 1.4 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.2 | 0.4 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.2 | 1.2 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.2 | 0.6 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.2 | 0.8 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.2 | 0.4 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.2 | 0.6 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.2 | 0.6 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.2 | 1.2 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.2 | 0.6 | GO:0009173 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.2 | 0.4 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.2 | 1.6 | GO:0006855 | drug transmembrane transport(GO:0006855) |
0.2 | 0.8 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.2 | 1.0 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.2 | 1.4 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.2 | 0.8 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
0.2 | 0.8 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.2 | 0.6 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.2 | 3.8 | GO:0002021 | response to dietary excess(GO:0002021) |
0.2 | 0.8 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.2 | 0.4 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.2 | 1.1 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.2 | 0.7 | GO:0007412 | axon target recognition(GO:0007412) |
0.2 | 0.4 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.2 | 0.6 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
0.2 | 0.2 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.2 | 0.2 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
0.2 | 0.4 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
0.2 | 0.6 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.2 | 0.9 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.2 | 0.4 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.2 | 0.5 | GO:0050957 | equilibrioception(GO:0050957) |
0.2 | 0.4 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.2 | 1.3 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.2 | 0.9 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.2 | 0.5 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.2 | 0.4 | GO:0071839 | apoptotic process in bone marrow(GO:0071839) |
0.2 | 0.5 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.2 | 0.5 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.2 | 5.2 | GO:0048008 | platelet-derived growth factor receptor signaling pathway(GO:0048008) |
0.2 | 4.0 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.2 | 1.4 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.2 | 0.7 | GO:0009115 | xanthine catabolic process(GO:0009115) |
0.2 | 0.2 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.2 | 1.0 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.2 | 0.2 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.2 | 0.2 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.2 | 0.2 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.2 | 0.5 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
0.2 | 8.3 | GO:0001570 | vasculogenesis(GO:0001570) |
0.2 | 1.0 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.2 | 0.8 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.2 | 1.7 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
0.2 | 1.2 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
0.2 | 1.7 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.2 | 0.2 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.2 | 0.3 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.2 | 1.2 | GO:0071402 | cellular response to lipoprotein particle stimulus(GO:0071402) |
0.2 | 2.5 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.2 | 2.8 | GO:0044247 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
0.2 | 0.5 | GO:0072033 | renal vesicle formation(GO:0072033) ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
0.2 | 0.7 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.2 | 0.3 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.2 | 0.3 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.2 | 0.3 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.2 | 0.2 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.2 | 1.0 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
0.2 | 1.0 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.2 | 1.8 | GO:0033008 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
0.2 | 0.8 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.2 | 0.3 | GO:0002351 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
0.2 | 0.5 | GO:0007512 | adult heart development(GO:0007512) |
0.2 | 1.1 | GO:0006108 | malate metabolic process(GO:0006108) |
0.2 | 0.2 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.2 | 0.2 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
0.2 | 0.9 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.2 | 0.6 | GO:0039532 | negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
0.2 | 0.8 | GO:0016264 | gap junction assembly(GO:0016264) |
0.2 | 0.8 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.2 | 0.8 | GO:0015886 | heme transport(GO:0015886) |
0.2 | 0.3 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.2 | 0.9 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.2 | 0.3 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.2 | 0.9 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
0.2 | 0.6 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.2 | 0.5 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.2 | 0.9 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
0.2 | 0.5 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.2 | 0.3 | GO:0051182 | coenzyme transport(GO:0051182) |
0.1 | 0.4 | GO:0048069 | eye pigmentation(GO:0048069) |
0.1 | 0.1 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.1 | 1.0 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
0.1 | 1.5 | GO:0035588 | G-protein coupled purinergic receptor signaling pathway(GO:0035588) |
0.1 | 0.1 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.1 | 0.7 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.1 | 0.4 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.1 | 1.2 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.1 | 0.9 | GO:0061028 | establishment of endothelial barrier(GO:0061028) |
0.1 | 1.6 | GO:0070166 | enamel mineralization(GO:0070166) |
0.1 | 0.6 | GO:0035106 | operant conditioning(GO:0035106) |
0.1 | 0.4 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.1 | 0.3 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.1 | 0.4 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
0.1 | 0.9 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.3 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.1 | 0.7 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.1 | 0.3 | GO:0072422 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
0.1 | 0.1 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.1 | 0.7 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.1 | 0.1 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.1 | 0.4 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.1 | 0.7 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.1 | 0.6 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.1 | 0.4 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.1 | 2.5 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.1 | 1.2 | GO:0010719 | negative regulation of epithelial to mesenchymal transition(GO:0010719) |
0.1 | 0.3 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.1 | 1.1 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
0.1 | 0.6 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
0.1 | 0.3 | GO:2000809 | positive regulation of presynaptic membrane organization(GO:1901631) positive regulation of synaptic vesicle clustering(GO:2000809) |
0.1 | 0.4 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.7 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.1 | 0.1 | GO:0003177 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
0.1 | 0.3 | GO:0032905 | transforming growth factor beta1 production(GO:0032905) regulation of transforming growth factor beta1 production(GO:0032908) |
0.1 | 0.4 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 0.7 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.1 | 0.4 | GO:2000678 | negative regulation of transcription regulatory region DNA binding(GO:2000678) |
0.1 | 1.2 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
0.1 | 0.3 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
0.1 | 0.4 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.4 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.1 | 0.4 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.5 | GO:0060318 | definitive erythrocyte differentiation(GO:0060318) |
0.1 | 0.3 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.3 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.1 | 0.4 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
0.1 | 0.5 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.1 | 2.8 | GO:0045214 | sarcomere organization(GO:0045214) |
0.1 | 0.4 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.1 | 0.4 | GO:0015744 | succinate transport(GO:0015744) |
0.1 | 0.4 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.1 | 1.2 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.1 | 4.0 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
0.1 | 0.1 | GO:2000544 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
0.1 | 0.1 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.1 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.1 | 0.5 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.1 | 1.4 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.1 | 0.3 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.1 | 0.8 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.1 | 0.5 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.1 | 1.1 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.1 | 0.1 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
0.1 | 0.3 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
0.1 | 1.4 | GO:0014850 | response to muscle activity(GO:0014850) |
0.1 | 0.2 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.1 | 0.5 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.1 | 0.5 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.1 | 0.4 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.1 | 0.5 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.1 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.1 | 0.4 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.1 | 0.4 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.1 | 0.5 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.1 | 0.2 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.1 | 0.2 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.1 | 0.2 | GO:1901890 | positive regulation of cell junction assembly(GO:1901890) |
0.1 | 0.4 | GO:0034651 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) cortisol biosynthetic process(GO:0034651) regulation of cortisol biosynthetic process(GO:2000064) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.1 | 4.3 | GO:0015914 | phospholipid transport(GO:0015914) |
0.1 | 0.8 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.1 | 0.5 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.1 | 0.9 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
0.1 | 1.3 | GO:0002053 | positive regulation of mesenchymal cell proliferation(GO:0002053) |
0.1 | 0.1 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.1 | 2.2 | GO:0034142 | toll-like receptor 4 signaling pathway(GO:0034142) |
0.1 | 0.1 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.1 | 0.5 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.1 | 0.2 | GO:0002248 | connective tissue replacement involved in inflammatory response wound healing(GO:0002248) connective tissue replacement(GO:0097709) |
0.1 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.2 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.1 | 0.2 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.1 | 0.2 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.1 | 0.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.1 | 0.7 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.1 | 0.9 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
0.1 | 0.2 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.1 | 0.8 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.1 | 0.3 | GO:0002693 | positive regulation of cellular extravasation(GO:0002693) |
0.1 | 1.8 | GO:0071539 | protein localization to centrosome(GO:0071539) |
0.1 | 1.1 | GO:0016926 | protein desumoylation(GO:0016926) |
0.1 | 0.2 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
0.1 | 0.3 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.1 | 1.0 | GO:0060148 | positive regulation of posttranscriptional gene silencing(GO:0060148) |
0.1 | 0.3 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.1 | 1.2 | GO:0061377 | mammary gland alveolus development(GO:0060749) mammary gland lobule development(GO:0061377) |
0.1 | 1.5 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 2.5 | GO:0047496 | vesicle transport along microtubule(GO:0047496) |
0.1 | 1.6 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
0.1 | 0.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.1 | 0.5 | GO:0036120 | cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.1 | 0.1 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
0.1 | 0.1 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) regulation of inward rectifier potassium channel activity(GO:1901979) |
0.1 | 0.8 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 0.6 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.1 | 0.4 | GO:0009597 | detection of virus(GO:0009597) |
0.1 | 0.4 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.1 | 0.2 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.2 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.1 | 0.4 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.1 | 0.3 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.1 | 0.1 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.1 | 0.3 | GO:1905208 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) negative regulation of cardiocyte differentiation(GO:1905208) negative regulation of cardiac muscle cell differentiation(GO:2000726) |
0.1 | 0.2 | GO:0014055 | acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) |
0.1 | 0.4 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.1 | 3.1 | GO:0001938 | positive regulation of endothelial cell proliferation(GO:0001938) |
0.1 | 1.2 | GO:0060765 | regulation of androgen receptor signaling pathway(GO:0060765) |
0.1 | 0.5 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.1 | 0.8 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.1 | 0.7 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.1 | 0.3 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 1.2 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.1 | 0.1 | GO:0044243 | multicellular organism catabolic process(GO:0044243) |
0.1 | 0.2 | GO:0030421 | defecation(GO:0030421) |
0.1 | 0.1 | GO:0010958 | regulation of amino acid import(GO:0010958) |
0.1 | 0.6 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.1 | 0.4 | GO:0072311 | renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
0.1 | 0.1 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.1 | 0.2 | GO:0060613 | fat pad development(GO:0060613) |
0.1 | 0.5 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 1.1 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.1 | 0.3 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.1 | 0.3 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.1 | GO:0071313 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.1 | 0.1 | GO:0060290 | transdifferentiation(GO:0060290) |
0.1 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 0.8 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.1 | 0.3 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.1 | 0.2 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
0.1 | 0.7 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.1 | 0.3 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.1 | 1.2 | GO:0001706 | endoderm formation(GO:0001706) |
0.1 | 0.4 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.1 | 0.4 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.1 | 0.5 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.1 | 0.8 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.1 | 0.1 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.1 | 0.2 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.1 | 0.2 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.1 | 3.6 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
0.1 | 0.3 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.1 | 0.1 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.1 | 0.1 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.1 | 0.2 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
0.1 | 0.1 | GO:0060459 | left lung development(GO:0060459) left lung morphogenesis(GO:0060460) |
0.1 | 0.3 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.1 | 0.3 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.1 | 0.4 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.1 | 0.2 | GO:0033504 | floor plate development(GO:0033504) |
0.1 | 0.3 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.1 | 1.3 | GO:0051496 | positive regulation of stress fiber assembly(GO:0051496) |
0.1 | 0.5 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.1 | 0.7 | GO:2001258 | negative regulation of cation channel activity(GO:2001258) |
0.1 | 0.4 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.1 | 0.2 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
0.1 | 0.2 | GO:0038001 | paracrine signaling(GO:0038001) |
0.1 | 1.1 | GO:0034260 | negative regulation of GTPase activity(GO:0034260) |
0.1 | 0.5 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
0.1 | 0.5 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.1 | 0.5 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.1 | 0.6 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.1 | 0.4 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.1 | 0.1 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.1 | 0.4 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
0.1 | 3.2 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
0.1 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.1 | 0.1 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
0.1 | 1.0 | GO:0018208 | peptidyl-proline modification(GO:0018208) |
0.1 | 0.2 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.1 | 0.4 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.1 | 0.5 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.1 | 0.4 | GO:0045760 | positive regulation of action potential(GO:0045760) |
0.1 | 0.4 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.1 | 0.1 | GO:0003256 | regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003256) |
0.1 | 0.5 | GO:0055010 | ventricular cardiac muscle tissue morphogenesis(GO:0055010) |
0.1 | 0.4 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.1 | 0.3 | GO:0050705 | regulation of interleukin-1 alpha secretion(GO:0050705) |
0.1 | 0.1 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.1 | 0.2 | GO:0034123 | positive regulation of toll-like receptor signaling pathway(GO:0034123) |
0.1 | 0.2 | GO:0001865 | NK T cell differentiation(GO:0001865) |
0.1 | 1.8 | GO:0048286 | lung alveolus development(GO:0048286) |
0.1 | 0.5 | GO:0097186 | amelogenesis(GO:0097186) |
0.1 | 0.3 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
0.1 | 1.2 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
0.1 | 0.3 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.1 | 0.2 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.1 | 0.2 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.1 | 0.2 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.1 | 0.1 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.1 | 0.3 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
0.1 | 0.3 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.1 | 0.3 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.1 | 7.8 | GO:0043062 | extracellular structure organization(GO:0043062) |
0.1 | 0.2 | GO:0010288 | response to lead ion(GO:0010288) |
0.1 | 0.5 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.1 | 1.9 | GO:0010761 | fibroblast migration(GO:0010761) |
0.1 | 0.5 | GO:0032060 | bleb assembly(GO:0032060) |
0.1 | 0.3 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.1 | 0.3 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.1 | 0.4 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 0.3 | GO:0046439 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.1 | 0.2 | GO:0015867 | ATP transport(GO:0015867) |
0.1 | 0.2 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 0.3 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.1 | 0.2 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.1 | 1.0 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
0.1 | 0.8 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 0.5 | GO:0071354 | cellular response to interleukin-6(GO:0071354) |
0.1 | 0.1 | GO:0046066 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.1 | 0.1 | GO:0014874 | response to stimulus involved in regulation of muscle adaptation(GO:0014874) |
0.1 | 0.2 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.1 | 0.2 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.1 | 0.2 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.1 | 0.2 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
0.1 | 0.1 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.1 | 0.2 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.1 | 0.4 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.1 | 0.1 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.1 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.1 | 0.4 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.1 | 0.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.1 | 0.2 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.1 | 0.7 | GO:0032400 | melanosome localization(GO:0032400) |
0.1 | 0.1 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.1 | 0.6 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
0.1 | 0.1 | GO:0010159 | specification of organ position(GO:0010159) |
0.1 | 0.8 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.1 | 0.5 | GO:0033572 | transferrin transport(GO:0033572) |
0.1 | 0.4 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
0.1 | 0.2 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.1 | 0.2 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.1 | 0.1 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
0.1 | 0.5 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
0.1 | 0.3 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.1 | 0.5 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.1 | 0.2 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.1 | 0.4 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.1 | 0.2 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.1 | 0.5 | GO:0019321 | pentose metabolic process(GO:0019321) |
0.1 | 1.4 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.1 | 0.2 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.1 | 0.4 | GO:0090109 | regulation of focal adhesion assembly(GO:0051893) regulation of cell-substrate junction assembly(GO:0090109) |
0.1 | 0.8 | GO:0071451 | cellular response to oxygen radical(GO:0071450) cellular response to superoxide(GO:0071451) |
0.1 | 0.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.3 | GO:0015791 | polyol transport(GO:0015791) |
0.1 | 0.2 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.1 | 0.2 | GO:0033145 | positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
0.1 | 0.2 | GO:0036035 | osteoclast development(GO:0036035) |
0.1 | 0.1 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
0.1 | 0.2 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.1 | 0.3 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.1 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
0.1 | 1.0 | GO:0046825 | regulation of protein export from nucleus(GO:0046825) |
0.1 | 0.5 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.1 | 0.1 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.1 | 0.3 | GO:0007097 | nuclear migration(GO:0007097) |
0.1 | 0.1 | GO:2000850 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.1 | 1.5 | GO:0070373 | negative regulation of ERK1 and ERK2 cascade(GO:0070373) |
0.1 | 0.1 | GO:0048865 | stem cell fate commitment(GO:0048865) |
0.1 | 0.3 | GO:0090151 | establishment of protein localization to mitochondrial membrane(GO:0090151) |
0.1 | 0.1 | GO:0061074 | regulation of neural retina development(GO:0061074) |
0.1 | 0.5 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.1 | 0.1 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.1 | 0.3 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.1 | 0.4 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.1 | 0.1 | GO:0060456 | positive regulation of digestive system process(GO:0060456) |
0.1 | 0.1 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.1 | 0.1 | GO:0070202 | regulation of establishment of protein localization to chromosome(GO:0070202) |
0.1 | 0.2 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.1 | 0.1 | GO:0014856 | skeletal muscle cell proliferation(GO:0014856) regulation of skeletal muscle cell proliferation(GO:0014857) |
0.1 | 0.3 | GO:0097283 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
0.1 | 0.4 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.1 | 0.1 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.1 | 0.4 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.1 | 0.1 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
0.1 | 0.2 | GO:0030220 | platelet formation(GO:0030220) |
0.1 | 0.4 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.1 | 0.4 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.1 | 0.1 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.1 | 0.9 | GO:0010842 | retina layer formation(GO:0010842) |
0.1 | 0.5 | GO:0010664 | negative regulation of striated muscle cell apoptotic process(GO:0010664) |
0.1 | 0.2 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.1 | 0.2 | GO:0044351 | macropinocytosis(GO:0044351) |
0.1 | 0.4 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.1 | 0.1 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.1 | 0.9 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.1 | 0.5 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.1 | 0.3 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
0.1 | 0.2 | GO:0008272 | sulfate transport(GO:0008272) |
0.1 | 0.1 | GO:0034650 | cortisol metabolic process(GO:0034650) |
0.1 | 0.5 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.1 | GO:0090148 | membrane fission(GO:0090148) |
0.1 | 0.1 | GO:0060601 | lateral sprouting from an epithelium(GO:0060601) |
0.1 | 0.2 | GO:0046490 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
0.1 | 0.9 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.1 | 0.1 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.1 | 0.1 | GO:0010182 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.1 | 1.3 | GO:0033619 | membrane protein proteolysis(GO:0033619) |
0.1 | 0.3 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
0.1 | 0.2 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
0.1 | 0.2 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
0.1 | 0.2 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.1 | 0.8 | GO:0035329 | hippo signaling(GO:0035329) |
0.1 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.1 | 0.7 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.1 | 0.1 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.1 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.1 | 0.3 | GO:0032495 | response to muramyl dipeptide(GO:0032495) |
0.1 | 0.1 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.1 | 0.6 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.1 | 1.3 | GO:0042168 | heme metabolic process(GO:0042168) |
0.1 | 0.1 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
0.1 | 0.1 | GO:0055015 | ventricular cardiac muscle cell development(GO:0055015) |
0.1 | 0.3 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.1 | 0.4 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.1 | 0.5 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.1 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.7 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.1 | 0.5 | GO:0051014 | actin filament severing(GO:0051014) |
0.1 | 0.1 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.1 | 0.2 | GO:0071158 | positive regulation of cell cycle arrest(GO:0071158) |
0.1 | 0.9 | GO:0002062 | chondrocyte differentiation(GO:0002062) |
0.1 | 0.1 | GO:0035587 | purinergic receptor signaling pathway(GO:0035587) |
0.1 | 0.3 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.1 | 0.4 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.1 | 0.7 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.1 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.1 | 0.1 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
0.1 | 0.2 | GO:0007398 | ectoderm development(GO:0007398) |
0.1 | 0.6 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
0.1 | 0.1 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.1 | 0.2 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.1 | 0.5 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.1 | 0.2 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.1 | 0.2 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.1 | 0.8 | GO:0003382 | epithelial cell morphogenesis(GO:0003382) |
0.1 | 0.2 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 0.5 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.1 | 0.2 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.1 | 0.3 | GO:0050746 | regulation of lipoprotein metabolic process(GO:0050746) |
0.1 | 0.1 | GO:0051126 | negative regulation of actin nucleation(GO:0051126) |
0.1 | 0.2 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.1 | 0.1 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.1 | 0.3 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.1 | 0.1 | GO:0035909 | aorta morphogenesis(GO:0035909) |
0.1 | 0.2 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.1 | 0.1 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.1 | 0.3 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.1 | 0.7 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.1 | 0.2 | GO:0046070 | dGTP catabolic process(GO:0006203) dGTP metabolic process(GO:0046070) |
0.1 | 0.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.1 | 0.6 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.1 | 0.1 | GO:0071863 | regulation of cell proliferation in bone marrow(GO:0071863) |
0.1 | 0.1 | GO:1904504 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.1 | 0.4 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.1 | 0.1 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.1 | 1.5 | GO:0007566 | embryo implantation(GO:0007566) |
0.1 | 0.1 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.1 | 0.2 | GO:0022605 | oogenesis stage(GO:0022605) |
0.1 | 0.5 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
0.1 | 0.2 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.1 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 0.2 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.1 | 0.7 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
0.1 | 0.5 | GO:0051852 | disruption by host of symbiont cells(GO:0051852) killing by host of symbiont cells(GO:0051873) |
0.1 | 0.2 | GO:0006244 | pyrimidine nucleotide catabolic process(GO:0006244) |
0.1 | 0.6 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.1 | 0.1 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
0.1 | 0.1 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.1 | 0.1 | GO:0015755 | fructose transport(GO:0015755) |
0.0 | 0.3 | GO:0010658 | striated muscle cell apoptotic process(GO:0010658) |
0.0 | 0.5 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
0.0 | 0.4 | GO:2000649 | regulation of sodium ion transmembrane transporter activity(GO:2000649) |
0.0 | 0.2 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.6 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
0.0 | 0.1 | GO:0044704 | mating plug formation(GO:0042628) single-organism reproductive behavior(GO:0044704) post-mating behavior(GO:0045297) |
0.0 | 0.0 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
0.0 | 0.3 | GO:0006569 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.0 | 0.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.8 | GO:0050891 | multicellular organismal water homeostasis(GO:0050891) |
0.0 | 0.2 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
0.0 | 0.0 | GO:0045343 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.0 | 0.2 | GO:0015695 | organic cation transport(GO:0015695) |
0.0 | 0.5 | GO:0032620 | interleukin-17 production(GO:0032620) |
0.0 | 0.1 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.0 | 0.1 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.0 | 0.1 | GO:0034350 | regulation of glial cell apoptotic process(GO:0034350) |
0.0 | 0.1 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.0 | 0.1 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.0 | 0.1 | GO:2000105 | positive regulation of DNA-dependent DNA replication(GO:2000105) |
0.0 | 0.2 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.0 | 0.0 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.0 | 0.6 | GO:0048678 | response to axon injury(GO:0048678) |
0.0 | 3.4 | GO:0007266 | Rho protein signal transduction(GO:0007266) |
0.0 | 0.2 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.2 | GO:0007063 | regulation of sister chromatid cohesion(GO:0007063) |
0.0 | 1.0 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.2 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.0 | 0.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.0 | 0.2 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.2 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.0 | 0.2 | GO:0021544 | subpallium development(GO:0021544) |
0.0 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
0.0 | 0.0 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.4 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 0.1 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
0.0 | 0.0 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.0 | 0.0 | GO:1903795 | regulation of inorganic anion transmembrane transport(GO:1903795) |
0.0 | 0.2 | GO:0010560 | positive regulation of glycoprotein biosynthetic process(GO:0010560) |
0.0 | 0.2 | GO:0070230 | positive regulation of lymphocyte apoptotic process(GO:0070230) |
0.0 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.1 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.1 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
0.0 | 0.2 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.0 | 0.2 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.2 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.0 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.0 | 0.1 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.0 | 0.1 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 0.3 | GO:0050860 | negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.0 | 0.2 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.3 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.2 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
0.0 | 0.2 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.1 | GO:0015808 | L-alanine transport(GO:0015808) |
0.0 | 0.1 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.0 | 0.2 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
0.0 | 0.0 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.0 | 0.2 | GO:0015732 | prostaglandin transport(GO:0015732) |
0.0 | 0.1 | GO:0071220 | response to bacterial lipopeptide(GO:0070339) cellular response to bacterial lipoprotein(GO:0071220) cellular response to bacterial lipopeptide(GO:0071221) |
0.0 | 0.2 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.2 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
0.0 | 0.0 | GO:0003174 | mitral valve development(GO:0003174) |
0.0 | 0.0 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
0.0 | 0.0 | GO:0043133 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
0.0 | 0.0 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) multivesicular body organization(GO:0036257) |
0.0 | 0.0 | GO:0006573 | valine metabolic process(GO:0006573) |
0.0 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.0 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.0 | 0.1 | GO:1903963 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
0.0 | 0.2 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.0 | 0.4 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.0 | 0.1 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.0 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.3 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.2 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.0 | 0.1 | GO:0001696 | gastric acid secretion(GO:0001696) |
0.0 | 0.1 | GO:1900193 | regulation of oocyte maturation(GO:1900193) |
0.0 | 0.0 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.0 | 0.1 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.0 | 0.5 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.0 | 0.2 | GO:0040019 | positive regulation of embryonic development(GO:0040019) |
0.0 | 0.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.0 | 0.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.2 | GO:0032292 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
0.0 | 0.0 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
0.0 | 0.0 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.0 | 0.0 | GO:0061548 | ganglion development(GO:0061548) |
0.0 | 0.5 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.0 | 0.1 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.0 | 0.0 | GO:0002713 | negative regulation of B cell mediated immunity(GO:0002713) negative regulation of immunoglobulin mediated immune response(GO:0002890) |
0.0 | 0.5 | GO:0006706 | steroid catabolic process(GO:0006706) |
0.0 | 0.1 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.0 | 1.2 | GO:0002066 | columnar/cuboidal epithelial cell development(GO:0002066) |
0.0 | 0.2 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.2 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.1 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.1 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.0 | 0.0 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.7 | GO:0006611 | protein export from nucleus(GO:0006611) |
0.0 | 0.1 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.0 | 0.1 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.0 | 0.0 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.0 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.1 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
0.0 | 0.4 | GO:0006998 | nuclear envelope organization(GO:0006998) |
0.0 | 0.0 | GO:0071351 | response to interleukin-18(GO:0070673) cellular response to interleukin-18(GO:0071351) |
0.0 | 0.1 | GO:0019532 | oxalate transport(GO:0019532) |
0.0 | 0.3 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.0 | 0.0 | GO:0090045 | positive regulation of deacetylase activity(GO:0090045) |
0.0 | 0.3 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.0 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.0 | 0.1 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.0 | 0.1 | GO:0002328 | pro-B cell differentiation(GO:0002328) |
0.0 | 0.1 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.0 | 0.2 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 0.5 | GO:0060218 | hematopoietic stem cell differentiation(GO:0060218) |
0.0 | 0.2 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.0 | 0.0 | GO:0019364 | pyridine nucleotide catabolic process(GO:0019364) |
0.0 | 0.1 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.1 | GO:0032352 | positive regulation of hormone metabolic process(GO:0032352) |
0.0 | 0.4 | GO:0055007 | cardiac muscle cell differentiation(GO:0055007) |
0.0 | 0.1 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.0 | 0.0 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.0 | 0.2 | GO:0002759 | regulation of antimicrobial humoral response(GO:0002759) |
0.0 | 0.1 | GO:0014037 | Schwann cell differentiation(GO:0014037) |
0.0 | 0.0 | GO:0001555 | oocyte growth(GO:0001555) |
0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.0 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.0 | 0.1 | GO:0003197 | endocardial cushion development(GO:0003197) |
0.0 | 0.0 | GO:0060444 | branching involved in mammary gland duct morphogenesis(GO:0060444) |
0.0 | 0.1 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
0.0 | 0.1 | GO:0051353 | positive regulation of oxidoreductase activity(GO:0051353) |
0.0 | 0.1 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
0.0 | 0.0 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.0 | 0.1 | GO:1901722 | regulation of cell proliferation involved in kidney development(GO:1901722) |
0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.0 | 0.1 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.0 | 0.1 | GO:0001885 | endothelial cell development(GO:0001885) |
0.0 | 0.1 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.0 | 0.1 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.0 | 0.1 | GO:0021794 | thalamus development(GO:0021794) |
0.0 | 0.0 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.0 | 0.1 | GO:0001826 | inner cell mass cell differentiation(GO:0001826) |
0.0 | 0.1 | GO:0045986 | negative regulation of smooth muscle contraction(GO:0045986) |
0.0 | 0.0 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.0 | 0.4 | GO:0046676 | negative regulation of insulin secretion(GO:0046676) |
0.0 | 0.0 | GO:0030432 | peristalsis(GO:0030432) |
0.0 | 0.0 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
0.0 | 0.1 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.0 | 0.1 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.0 | 0.2 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.0 | 0.1 | GO:0070431 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.0 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.2 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
0.0 | 0.1 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.2 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.0 | 0.1 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.1 | GO:2000273 | positive regulation of receptor activity(GO:2000273) |
0.0 | 0.1 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.0 | 0.1 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
0.0 | 0.0 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.0 | 0.0 | GO:0030501 | positive regulation of bone mineralization(GO:0030501) |
0.0 | 0.1 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.0 | 0.1 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
0.0 | 0.4 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.1 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.0 | 1.3 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.1 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
0.0 | 1.5 | GO:0006821 | chloride transport(GO:0006821) |
0.0 | 0.2 | GO:0045616 | regulation of keratinocyte differentiation(GO:0045616) |
0.0 | 0.2 | GO:0072520 | seminiferous tubule development(GO:0072520) |
0.0 | 0.0 | GO:0046113 | purine nucleobase catabolic process(GO:0006145) nucleobase catabolic process(GO:0046113) |
0.0 | 0.0 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.0 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.0 | 0.4 | GO:2001238 | positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
0.0 | 0.0 | GO:0033034 | positive regulation of myeloid cell apoptotic process(GO:0033034) |
0.0 | 0.0 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.0 | 0.1 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.0 | 0.0 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.0 | 0.3 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
0.0 | 0.0 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.0 | 0.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) telencephalon regionalization(GO:0021978) |
0.0 | 0.0 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.1 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.0 | 0.2 | GO:0007044 | cell-substrate junction assembly(GO:0007044) |
0.0 | 0.3 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
0.0 | 0.1 | GO:0002584 | negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
0.0 | 0.1 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.0 | 0.1 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.1 | GO:0015893 | drug transport(GO:0015893) |
0.0 | 0.0 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.0 | 0.6 | GO:0031424 | keratinization(GO:0031424) |
0.0 | 0.0 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.1 | GO:1990403 | embryonic brain development(GO:1990403) |
0.0 | 0.0 | GO:0090110 | cargo loading into vesicle(GO:0035459) cargo loading into COPII-coated vesicle(GO:0090110) regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.0 | 0.0 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.0 | 0.1 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.0 | 0.1 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.0 | 0.0 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) |
0.0 | 0.0 | GO:0014741 | negative regulation of muscle hypertrophy(GO:0014741) |
0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 0.1 | GO:0032410 | negative regulation of transporter activity(GO:0032410) |
0.0 | 0.0 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.0 | 0.0 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.0 | 0.0 | GO:0009301 | snRNA transcription(GO:0009301) |
0.0 | 0.0 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.0 | 0.0 | GO:0015840 | urea transport(GO:0015840) |
0.0 | 0.1 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.0 | GO:0070253 | somatostatin secretion(GO:0070253) |
0.0 | 0.2 | GO:0015698 | inorganic anion transport(GO:0015698) |
0.0 | 0.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.0 | 0.0 | GO:0033005 | positive regulation of mast cell activation(GO:0033005) |
0.0 | 0.0 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
0.0 | 0.0 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.0 | 0.4 | GO:0001541 | ovarian follicle development(GO:0001541) |
0.0 | 0.0 | GO:2000399 | negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
0.0 | 0.0 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
0.0 | 0.1 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
0.0 | 0.0 | GO:0072172 | mesonephric tubule formation(GO:0072172) |
0.0 | 0.0 | GO:0008212 | mineralocorticoid metabolic process(GO:0008212) |
0.0 | 0.1 | GO:0008334 | histone mRNA metabolic process(GO:0008334) |
0.0 | 0.0 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.0 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.1 | GO:0070305 | response to cGMP(GO:0070305) |
0.0 | 0.0 | GO:0000237 | leptotene(GO:0000237) |
0.0 | 0.0 | GO:0033860 | regulation of NAD(P)H oxidase activity(GO:0033860) |
0.0 | 0.0 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
0.0 | 0.1 | GO:0003298 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.0 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.0 | 0.2 | GO:0019985 | translesion synthesis(GO:0019985) |
0.0 | 0.1 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.0 | 0.1 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
0.0 | 0.0 | GO:0060603 | mammary gland duct morphogenesis(GO:0060603) |
0.0 | 0.0 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.0 | 0.0 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.0 | 0.0 | GO:0045683 | negative regulation of epidermis development(GO:0045683) |
0.0 | 0.1 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.0 | 0.0 | GO:0043416 | regulation of skeletal muscle tissue regeneration(GO:0043416) |
0.0 | 0.2 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
0.0 | 0.1 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.0 | 0.1 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.0 | 0.1 | GO:0018216 | peptidyl-arginine methylation(GO:0018216) |
0.0 | 0.0 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.0 | 0.1 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
0.0 | 0.0 | GO:0021940 | positive regulation of cerebellar granule cell precursor proliferation(GO:0021940) |
0.0 | 0.3 | GO:0048240 | sperm capacitation(GO:0048240) |
0.0 | 0.0 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.1 | GO:0021854 | hypothalamus development(GO:0021854) |
0.0 | 0.2 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
0.0 | 0.0 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.0 | 0.2 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
0.0 | 0.1 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.0 | 0.1 | GO:1901409 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.0 | 0.2 | GO:0072661 | protein targeting to plasma membrane(GO:0072661) |
0.0 | 0.1 | GO:0097421 | liver regeneration(GO:0097421) |
0.0 | 0.0 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.0 | 0.1 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
0.0 | 0.0 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.0 | 0.0 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.0 | 0.0 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.0 | 0.0 | GO:0010155 | regulation of proton transport(GO:0010155) |
0.0 | 0.1 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.0 | 0.1 | GO:0046337 | phosphatidylethanolamine biosynthetic process(GO:0006646) phosphatidylethanolamine metabolic process(GO:0046337) |
0.0 | 0.1 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 0.1 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.0 | 0.0 | GO:0046541 | saliva secretion(GO:0046541) |
0.0 | 0.1 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.0 | 0.0 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
0.0 | 0.1 | GO:0006911 | phagocytosis, engulfment(GO:0006911) |
0.0 | 0.0 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.0 | GO:0035404 | histone-serine phosphorylation(GO:0035404) histone H3-S28 phosphorylation(GO:0043988) |
0.0 | 0.0 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.0 | 0.2 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
0.0 | 0.1 | GO:0010388 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.0 | 0.0 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.0 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
0.0 | 0.0 | GO:0060539 | diaphragm development(GO:0060539) |
0.0 | 0.0 | GO:0032239 | regulation of nucleobase-containing compound transport(GO:0032239) regulation of RNA export from nucleus(GO:0046831) |
0.0 | 0.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.0 | GO:1902805 | positive regulation of synaptic vesicle transport(GO:1902805) |
0.0 | 0.0 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.0 | 0.0 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.1 | GO:0002418 | immune response to tumor cell(GO:0002418) |
0.0 | 0.0 | GO:0097113 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.0 | 0.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
0.0 | 0.0 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.0 | 0.0 | GO:0032594 | protein transport within lipid bilayer(GO:0032594) |
0.0 | 0.0 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.0 | 0.0 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.0 | 0.0 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
0.0 | 0.3 | GO:0005977 | glycogen metabolic process(GO:0005977) cellular glucan metabolic process(GO:0006073) glucan metabolic process(GO:0044042) |
0.0 | 0.0 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.0 | 0.0 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.0 | 0.0 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.0 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.0 | 0.0 | GO:0021871 | forebrain regionalization(GO:0021871) |
0.0 | 0.0 | GO:0045072 | regulation of interferon-gamma biosynthetic process(GO:0045072) |
0.0 | 0.0 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.0 | 0.1 | GO:0006828 | manganese ion transport(GO:0006828) |
0.0 | 0.0 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.0 | 0.0 | GO:0006903 | vesicle targeting(GO:0006903) |
0.0 | 0.0 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.0 | 0.3 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
0.0 | 0.0 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
0.0 | 0.1 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
0.0 | 0.0 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.0 | 0.0 | GO:1901317 | regulation of sperm motility(GO:1901317) |
0.0 | 0.1 | GO:0051383 | kinetochore assembly(GO:0051382) kinetochore organization(GO:0051383) |
0.0 | 0.0 | GO:0008354 | germ cell migration(GO:0008354) |
0.0 | 0.0 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.0 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.0 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
0.0 | 0.0 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.0 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.0 | 0.0 | GO:1902570 | protein localization to nucleolus(GO:1902570) regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.0 | 0.0 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.0 | 0.0 | GO:1904936 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
0.0 | 0.0 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.0 | 0.0 | GO:0006563 | L-serine metabolic process(GO:0006563) |
0.0 | 0.0 | GO:0051324 | meiotic prophase I(GO:0007128) prophase(GO:0051324) meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
0.0 | 0.1 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 9.3 | GO:0030314 | junctional membrane complex(GO:0030314) |
1.1 | 7.4 | GO:0045180 | basal cortex(GO:0045180) |
0.9 | 2.7 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.8 | 2.5 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.8 | 2.3 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.8 | 2.3 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.7 | 2.2 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.7 | 4.5 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.7 | 2.2 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.7 | 13.8 | GO:0005922 | connexon complex(GO:0005922) |
0.6 | 3.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.6 | 3.6 | GO:0098651 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.6 | 3.5 | GO:0005915 | zonula adherens(GO:0005915) |
0.6 | 2.3 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.6 | 1.7 | GO:0044393 | microspike(GO:0044393) |
0.6 | 3.3 | GO:0097342 | ripoptosome(GO:0097342) |
0.5 | 1.6 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.5 | 5.0 | GO:0098644 | complex of collagen trimers(GO:0098644) |
0.5 | 3.4 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.4 | 2.6 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.4 | 24.1 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.4 | 1.2 | GO:0072534 | perineuronal net(GO:0072534) |
0.4 | 1.6 | GO:0000938 | GARP complex(GO:0000938) |
0.4 | 3.5 | GO:0097470 | ribbon synapse(GO:0097470) |
0.4 | 4.4 | GO:0005921 | gap junction(GO:0005921) |
0.4 | 2.9 | GO:0001520 | outer dense fiber(GO:0001520) |
0.4 | 3.9 | GO:0001527 | microfibril(GO:0001527) |
0.3 | 2.4 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.3 | 5.2 | GO:0005614 | interstitial matrix(GO:0005614) |
0.3 | 1.6 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.3 | 0.9 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.3 | 0.9 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.3 | 1.8 | GO:0030056 | hemidesmosome(GO:0030056) |
0.3 | 0.9 | GO:0071942 | XPC complex(GO:0071942) |
0.3 | 1.4 | GO:0033503 | HULC complex(GO:0033503) |
0.3 | 0.5 | GO:0097427 | microtubule bundle(GO:0097427) |
0.2 | 0.7 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.2 | 2.2 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.2 | 1.9 | GO:0036157 | outer dynein arm(GO:0036157) |
0.2 | 3.5 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.2 | 0.7 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.2 | 2.7 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.2 | 0.7 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.2 | 3.8 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.2 | 0.6 | GO:0044308 | axonal spine(GO:0044308) |
0.2 | 0.8 | GO:1990357 | terminal web(GO:1990357) |
0.2 | 0.8 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.2 | 0.6 | GO:0016342 | catenin complex(GO:0016342) |
0.2 | 1.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.2 | 1.9 | GO:0031932 | TORC2 complex(GO:0031932) |
0.2 | 0.8 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.2 | 0.6 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.2 | 1.3 | GO:0042382 | paraspeckles(GO:0042382) |
0.2 | 0.7 | GO:0032437 | cuticular plate(GO:0032437) |
0.2 | 3.0 | GO:0097225 | sperm midpiece(GO:0097225) |
0.2 | 0.5 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.2 | 0.5 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.2 | 0.5 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.2 | 0.5 | GO:0035838 | growing cell tip(GO:0035838) |
0.2 | 4.9 | GO:0016235 | aggresome(GO:0016235) |
0.2 | 2.8 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.2 | 2.6 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.2 | 2.6 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.2 | 0.5 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.2 | 0.5 | GO:0071953 | elastic fiber(GO:0071953) |
0.2 | 3.5 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.2 | 0.6 | GO:1990246 | uniplex complex(GO:1990246) |
0.2 | 0.5 | GO:0030870 | Mre11 complex(GO:0030870) |
0.2 | 1.7 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.2 | 0.6 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.2 | 1.8 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.1 | 0.6 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 0.4 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 1.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.1 | 0.3 | GO:0005683 | U7 snRNP(GO:0005683) |
0.1 | 1.6 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 1.3 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.1 | 0.7 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 0.4 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.4 | GO:0005712 | chiasma(GO:0005712) |
0.1 | 0.4 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.1 | 0.4 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.1 | 0.4 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 1.7 | GO:0044295 | axonal growth cone(GO:0044295) |
0.1 | 0.4 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 9.2 | GO:0030018 | Z disc(GO:0030018) |
0.1 | 1.0 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
0.1 | 0.5 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.1 | 8.3 | GO:0016605 | PML body(GO:0016605) |
0.1 | 0.6 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.1 | 0.1 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.1 | 1.8 | GO:0031091 | platelet alpha granule(GO:0031091) |
0.1 | 2.2 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.1 | 0.5 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.1 | 1.1 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 0.7 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.1 | 0.6 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.1 | 0.9 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 0.7 | GO:0090543 | Flemming body(GO:0090543) |
0.1 | 0.3 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.1 | 1.6 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
0.1 | 0.7 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 1.7 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.7 | GO:0043203 | axon hillock(GO:0043203) |
0.1 | 0.2 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.1 | 1.6 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.1 | 0.7 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.1 | 0.7 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.1 | 0.4 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.1 | 0.2 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.1 | 0.6 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.1 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 2.3 | GO:0008305 | integrin complex(GO:0008305) |
0.1 | 0.5 | GO:0005638 | lamin filament(GO:0005638) |
0.1 | 9.7 | GO:0042383 | sarcolemma(GO:0042383) |
0.1 | 0.4 | GO:1990696 | USH2 complex(GO:1990696) |
0.1 | 1.3 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.1 | 0.8 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 1.1 | GO:0031674 | I band(GO:0031674) |
0.1 | 0.5 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.1 | 0.4 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.3 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 1.0 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.1 | 0.5 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 0.3 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 24.8 | GO:0005925 | focal adhesion(GO:0005925) |
0.1 | 0.8 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.1 | 0.3 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.1 | 0.9 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 0.5 | GO:0000796 | condensin complex(GO:0000796) |
0.1 | 0.3 | GO:0031527 | filopodium membrane(GO:0031527) |
0.1 | 0.5 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 0.4 | GO:0042641 | actomyosin(GO:0042641) |
0.1 | 0.7 | GO:0044327 | dendritic spine head(GO:0044327) |
0.1 | 0.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.1 | 1.2 | GO:0005685 | U1 snRNP(GO:0005685) |
0.1 | 1.3 | GO:0097546 | ciliary base(GO:0097546) |
0.1 | 0.2 | GO:1990635 | proximal dendrite(GO:1990635) |
0.1 | 1.5 | GO:0044298 | cell body membrane(GO:0044298) |
0.1 | 0.3 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 2.8 | GO:0032587 | ruffle membrane(GO:0032587) |
0.1 | 0.3 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 0.2 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.1 | 0.7 | GO:0001891 | phagocytic cup(GO:0001891) |
0.1 | 0.3 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 0.3 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.1 | 0.3 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 0.5 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.1 | 0.4 | GO:0042629 | mast cell granule(GO:0042629) |
0.1 | 0.7 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.1 | 0.4 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 3.1 | GO:0036126 | sperm flagellum(GO:0036126) |
0.1 | 0.5 | GO:0016589 | NURF complex(GO:0016589) |
0.1 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 0.7 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 1.6 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.1 | 0.9 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 0.2 | GO:1990923 | PET complex(GO:1990923) |
0.1 | 1.4 | GO:0060170 | ciliary membrane(GO:0060170) |
0.1 | 0.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 0.2 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.1 | 23.0 | GO:0005667 | transcription factor complex(GO:0005667) |
0.1 | 0.3 | GO:0005796 | Golgi lumen(GO:0005796) |
0.1 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 1.9 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.1 | 0.3 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 0.4 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.1 | 0.1 | GO:0005652 | nuclear lamina(GO:0005652) |
0.1 | 5.4 | GO:0043296 | apical junction complex(GO:0043296) |
0.1 | 0.1 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.1 | 0.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.1 | 0.4 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.1 | 0.9 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.1 | 3.5 | GO:0005902 | microvillus(GO:0005902) |
0.1 | 18.7 | GO:0031012 | extracellular matrix(GO:0031012) |
0.1 | 0.3 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.1 | 0.3 | GO:0035339 | SPOTS complex(GO:0035339) |
0.1 | 0.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.1 | 0.8 | GO:0036038 | MKS complex(GO:0036038) |
0.1 | 2.0 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.1 | 0.6 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.1 | 1.2 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.1 | 2.6 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.1 | 0.1 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 0.2 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.1 | 0.4 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.1 | 0.5 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.1 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 0.7 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.1 | 0.6 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.1 | 0.2 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.1 | 0.1 | GO:0001739 | sex chromatin(GO:0001739) |
0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.1 | 1.8 | GO:0005581 | collagen trimer(GO:0005581) |
0.1 | 1.1 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 0.1 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 1.9 | GO:0044853 | plasma membrane raft(GO:0044853) |
0.1 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.9 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.1 | 3.6 | GO:0001669 | acrosomal vesicle(GO:0001669) |
0.0 | 0.0 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.4 | GO:0071010 | prespliceosome(GO:0071010) |
0.0 | 0.0 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.1 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 5.0 | GO:0005802 | trans-Golgi network(GO:0005802) |
0.0 | 0.3 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.7 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.2 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.1 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.0 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.4 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.9 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.6 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.0 | 0.6 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.0 | 0.4 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 3.9 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.0 | 0.0 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.2 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.0 | 0.1 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.0 | 1.2 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.3 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 0.3 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.1 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.2 | GO:0042581 | specific granule(GO:0042581) |
0.0 | 0.2 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 0.1 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
0.0 | 0.1 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.0 | 0.3 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.2 | GO:0000974 | Prp19 complex(GO:0000974) |
0.0 | 0.1 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.0 | 3.3 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.0 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.0 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.0 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.0 | 0.2 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.3 | GO:0044447 | axoneme part(GO:0044447) |
0.0 | 0.2 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.0 | 0.1 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.3 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.0 | 0.5 | GO:0044815 | DNA packaging complex(GO:0044815) |
0.0 | 0.1 | GO:0090568 | nuclear transcriptional repressor complex(GO:0090568) |
0.0 | 0.2 | GO:0031672 | A band(GO:0031672) |
0.0 | 0.8 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.3 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.0 | 0.0 | GO:1903349 | omegasome membrane(GO:1903349) |
0.0 | 0.0 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.0 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.0 | 0.4 | GO:0032421 | stereocilium bundle(GO:0032421) |
0.0 | 2.3 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.2 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 0.0 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.0 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.0 | 1.0 | GO:0098862 | cluster of actin-based cell projections(GO:0098862) |
0.0 | 0.0 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.0 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.0 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.0 | 0.1 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.1 | GO:0042599 | lamellar body(GO:0042599) |
0.0 | 0.0 | GO:0016460 | myosin II complex(GO:0016460) |
0.0 | 0.0 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
0.0 | 0.2 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.1 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.0 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 1.0 | GO:0016324 | apical plasma membrane(GO:0016324) |
0.0 | 0.1 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.0 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.0 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.0 | GO:0071817 | MMXD complex(GO:0071817) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.1 | 6.2 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
2.0 | 5.9 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
1.6 | 9.7 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
1.2 | 5.0 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
1.2 | 3.7 | GO:0070644 | vitamin D response element binding(GO:0070644) |
1.2 | 3.6 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
1.1 | 5.6 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
1.0 | 3.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
1.0 | 2.9 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.9 | 10.8 | GO:0017166 | vinculin binding(GO:0017166) |
0.9 | 2.6 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.8 | 9.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.8 | 9.1 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.8 | 2.5 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.8 | 11.0 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.8 | 4.6 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.8 | 7.5 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.7 | 4.5 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.7 | 2.1 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.7 | 3.4 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.7 | 2.0 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.6 | 3.2 | GO:0030274 | LIM domain binding(GO:0030274) |
0.6 | 2.5 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.6 | 1.9 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.6 | 2.5 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.6 | 0.6 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
0.6 | 1.7 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.5 | 1.6 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.5 | 3.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.5 | 2.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.5 | 3.7 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.5 | 6.1 | GO:0031005 | filamin binding(GO:0031005) |
0.5 | 2.0 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.5 | 1.9 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.5 | 0.9 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.5 | 2.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.4 | 5.7 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.4 | 1.7 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.4 | 0.4 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.4 | 1.7 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.4 | 1.2 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.4 | 1.2 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.4 | 2.0 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.4 | 1.2 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.4 | 6.1 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.4 | 8.0 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.4 | 1.2 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.4 | 2.3 | GO:0048495 | Roundabout binding(GO:0048495) |
0.4 | 1.9 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.4 | 1.9 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.4 | 1.1 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.4 | 1.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.4 | 3.4 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.4 | 4.1 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
0.4 | 1.9 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.4 | 2.2 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.4 | 6.5 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.4 | 2.5 | GO:0030957 | Tat protein binding(GO:0030957) |
0.4 | 2.5 | GO:0018646 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.3 | 1.0 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.3 | 1.7 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.3 | 1.4 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.3 | 1.0 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.3 | 2.7 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.3 | 1.3 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.3 | 1.3 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.3 | 0.3 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.3 | 1.0 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.3 | 1.6 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.3 | 3.5 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.3 | 0.9 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.3 | 4.5 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.3 | 0.9 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.3 | 0.9 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.3 | 1.2 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.3 | 1.5 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.3 | 0.3 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.3 | 4.2 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.3 | 3.1 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.3 | 1.4 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.3 | 1.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.3 | 0.8 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.3 | 9.7 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.3 | 1.8 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.2 | 0.7 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.2 | 2.2 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.2 | 0.7 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.2 | 0.7 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.2 | 1.4 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.2 | 0.7 | GO:0035939 | microsatellite binding(GO:0035939) |
0.2 | 1.2 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.2 | 0.9 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.2 | 0.9 | GO:0015232 | heme transporter activity(GO:0015232) |
0.2 | 0.7 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.2 | 1.6 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.2 | 0.7 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.2 | 10.7 | GO:0005518 | collagen binding(GO:0005518) |
0.2 | 0.9 | GO:0042731 | PH domain binding(GO:0042731) |
0.2 | 1.0 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.2 | 4.2 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.2 | 2.0 | GO:0001968 | fibronectin binding(GO:0001968) |
0.2 | 0.4 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.2 | 0.6 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.2 | 0.6 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.2 | 0.8 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.2 | 0.6 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.2 | 0.8 | GO:0002046 | opsin binding(GO:0002046) |
0.2 | 4.0 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.2 | 3.2 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
0.2 | 0.6 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.2 | 2.2 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.2 | 0.4 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.2 | 0.7 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.2 | 0.5 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.2 | 2.0 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.2 | 0.5 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.2 | 1.3 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.2 | 0.7 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.2 | 0.5 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.2 | 1.4 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.2 | 0.7 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.2 | 1.7 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.2 | 0.3 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
0.2 | 0.5 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.2 | 1.0 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
0.2 | 7.3 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
0.2 | 0.8 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.2 | 2.0 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.2 | 0.7 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
0.2 | 0.8 | GO:0022821 | potassium ion antiporter activity(GO:0022821) |
0.2 | 0.5 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.2 | 0.6 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
0.2 | 0.6 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.2 | 6.3 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.2 | 1.0 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.2 | 1.1 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.2 | 1.0 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.2 | 0.6 | GO:0043829 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
0.2 | 1.4 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.2 | 1.6 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.2 | 0.6 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.2 | 0.5 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.2 | 0.6 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.2 | 0.6 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.2 | 0.3 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.2 | 1.2 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.2 | 0.5 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.2 | 0.5 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.1 | 0.4 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.1 | 0.7 | GO:0018812 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) |
0.1 | 0.6 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.4 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.1 | 0.9 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.1 | 2.7 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.1 | 1.2 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.1 | 1.8 | GO:0044548 | S100 protein binding(GO:0044548) |
0.1 | 1.3 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.1 | 1.3 | GO:0030553 | cGMP binding(GO:0030553) |
0.1 | 0.4 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.1 | 0.3 | GO:0032564 | dATP binding(GO:0032564) |
0.1 | 0.6 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.1 | 0.3 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.1 | 5.2 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.1 | 1.1 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.4 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.6 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 0.6 | GO:0015265 | urea channel activity(GO:0015265) |
0.1 | 2.7 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.1 | 0.4 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.1 | 0.4 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 0.9 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 13.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.1 | 0.4 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.1 | 0.4 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 1.4 | GO:0005521 | lamin binding(GO:0005521) |
0.1 | 0.4 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.1 | 0.4 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 1.2 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.1 | 0.4 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.1 | 0.4 | GO:0016726 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.1 | 0.9 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.1 | 0.4 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.1 | 2.2 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.1 | 1.4 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.1 | 1.7 | GO:0030552 | cAMP binding(GO:0030552) |
0.1 | 1.0 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.1 | 0.7 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.1 | 0.5 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.1 | 0.5 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.1 | 0.4 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.1 | 1.7 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 1.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 0.5 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 1.0 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.1 | 0.6 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 1.7 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.1 | 1.3 | GO:0004954 | prostanoid receptor activity(GO:0004954) |
0.1 | 1.3 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.1 | 0.7 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.1 | 2.5 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.1 | 0.5 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.1 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.1 | 0.2 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.1 | 0.6 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 0.4 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.1 | 0.2 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.1 | 0.3 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 0.9 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 1.3 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.1 | 0.3 | GO:0031432 | titin binding(GO:0031432) |
0.1 | 1.3 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 0.3 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.1 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.1 | 0.5 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.1 | 0.3 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.1 | GO:0015922 | aspartate oxidase activity(GO:0015922) |
0.1 | 0.3 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 0.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.4 | GO:0031013 | troponin I binding(GO:0031013) |
0.1 | 1.5 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.1 | 0.3 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.1 | 0.1 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.1 | 1.1 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.1 | 0.3 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.1 | 0.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.1 | 0.2 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 0.6 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 1.0 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 0.2 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.1 | 0.7 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.1 | 0.2 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) |
0.1 | 0.4 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.1 | 2.4 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.1 | 0.2 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.1 | 0.5 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 0.6 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 0.6 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.1 | 1.4 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.1 | 3.3 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.1 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
0.1 | 0.5 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 0.7 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.1 | 0.4 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.1 | 1.0 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.1 | 0.3 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.1 | 0.3 | GO:0031014 | troponin T binding(GO:0031014) |
0.1 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 1.5 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.7 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 0.4 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.1 | 1.4 | GO:0008143 | poly(A) binding(GO:0008143) |
0.1 | 0.3 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.1 | 0.5 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 0.9 | GO:0034843 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.1 | 2.9 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.1 | 0.9 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.1 | 0.3 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.1 | 0.3 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.1 | 2.5 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.1 | 0.3 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.1 | 2.0 | GO:0015485 | cholesterol binding(GO:0015485) |
0.1 | 0.3 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.1 | 0.3 | GO:0070513 | death domain binding(GO:0070513) |
0.1 | 0.3 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.1 | 0.3 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.1 | 0.5 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.1 | 0.3 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.1 | 0.1 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.1 | 0.9 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.1 | 0.3 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.1 | 0.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.1 | 0.6 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.1 | 0.1 | GO:0018636 | phenanthrene 9,10-monooxygenase activity(GO:0018636) |
0.1 | 0.8 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.1 | 0.6 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 1.6 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.1 | 0.2 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.1 | 1.8 | GO:0008579 | JUN kinase phosphatase activity(GO:0008579) phosphohistidine phosphatase activity(GO:0008969) inositol-1,3,4-trisphosphate 4-phosphatase activity(GO:0017161) NADP phosphatase activity(GO:0019178) transmembrane receptor protein phosphatase activity(GO:0019198) phosphatidylinositol phosphate 5-phosphatase activity(GO:0034595) 5-amino-6-(5-phosphoribitylamino)uracil phosphatase activity(GO:0043726) phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-3,4-bisphosphate 4-phosphatase activity(GO:0052828) inositol-1,3,4-trisphosphate 1-phosphatase activity(GO:0052829) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) phosphatidylinositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052867) IDP phosphatase activity(GO:1990003) |
0.1 | 0.3 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.1 | 0.2 | GO:0051393 | alpha-actinin binding(GO:0051393) |
0.1 | 0.2 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.1 | 0.4 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.1 | 0.1 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.1 | 0.3 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 0.7 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
0.1 | 0.2 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.1 | 4.0 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.1 | 0.2 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.1 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.1 | 0.5 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.1 | 0.1 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.1 | 0.4 | GO:0034865 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.1 | 0.3 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.1 | 0.8 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.1 | 1.0 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.1 | 0.3 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.1 | 0.4 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.1 | 0.2 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.1 | 0.3 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.1 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 2.1 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.1 | 1.3 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 0.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.1 | 0.3 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.3 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 0.1 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) apolipoprotein A-I receptor binding(GO:0034191) |
0.1 | 0.2 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.1 | 0.2 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.1 | 0.3 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
0.1 | 0.2 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
0.1 | 0.2 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.1 | 0.5 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
0.1 | 0.3 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.1 | 0.8 | GO:0015116 | sulfate transmembrane transporter activity(GO:0015116) |
0.1 | 1.1 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.1 | 0.4 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.1 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 0.2 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
0.1 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.1 | 1.2 | GO:0030332 | cyclin binding(GO:0030332) |
0.1 | 0.2 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.1 | 0.3 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.1 | 0.2 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.1 | 0.2 | GO:0034452 | dynactin binding(GO:0034452) |
0.1 | 2.5 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.1 | 0.2 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.1 | 0.1 | GO:0019199 | transmembrane receptor protein kinase activity(GO:0019199) |
0.1 | 0.2 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.1 | 0.2 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.1 | 0.2 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.1 | 0.1 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.1 | 0.5 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
0.1 | 0.2 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.1 | 0.2 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.1 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.1 | 0.3 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.1 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.1 | 0.2 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.1 | 1.2 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.1 | 0.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 1.4 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.1 | 0.3 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 0.1 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.1 | 0.4 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.1 | 0.7 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.1 | 0.2 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.1 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 0.5 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.1 | 0.1 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.1 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
0.1 | 0.8 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.1 | 0.7 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.2 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
0.1 | 0.1 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
0.1 | 0.4 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.1 | 0.4 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 14.2 | GO:0003779 | actin binding(GO:0003779) |
0.1 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.1 | 0.2 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.1 | 0.3 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.1 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.1 | 1.1 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 0.3 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.1 | 0.5 | GO:0039706 | co-receptor binding(GO:0039706) |
0.1 | 0.3 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.1 | 0.3 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.1 | 0.3 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 0.2 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.0 | 0.2 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.0 | 0.2 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.0 | 0.0 | GO:0016675 | oxidoreductase activity, acting on a heme group of donors(GO:0016675) |
0.0 | 0.1 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.0 | 0.7 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 0.4 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.0 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.0 | 0.2 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.0 | 0.0 | GO:0001962 | alpha-1,3-galactosyltransferase activity(GO:0001962) |
0.0 | 0.7 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 2.2 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
0.0 | 0.2 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.1 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.0 | 0.2 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.2 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 1.4 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.1 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
0.0 | 0.0 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.0 | 0.3 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 4.1 | GO:0008083 | growth factor activity(GO:0008083) |
0.0 | 0.5 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.0 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.0 | 0.5 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.7 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.0 | 0.0 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.1 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.0 | 0.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.1 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.0 | 0.4 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.0 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
0.0 | 0.1 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.1 | GO:0030519 | snoRNP binding(GO:0030519) |
0.0 | 0.2 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 11.1 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
0.0 | 0.2 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.0 | 0.8 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.5 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.3 | GO:0015665 | alcohol transmembrane transporter activity(GO:0015665) |
0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.2 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.4 | GO:0016504 | peptidase activator activity(GO:0016504) |
0.0 | 0.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.0 | 0.2 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.4 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.4 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.0 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.0 | 0.2 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 1.1 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.0 | 0.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.1 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.2 | GO:0016454 | C-palmitoyltransferase activity(GO:0016454) |
0.0 | 0.0 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.0 | 0.1 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.0 | 0.1 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.0 | 0.7 | GO:0043621 | protein self-association(GO:0043621) |
0.0 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.1 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.1 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.0 | 0.0 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.0 | GO:0016502 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
0.0 | 0.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.2 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.0 | 0.0 | GO:0015927 | trehalase activity(GO:0015927) |
0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.4 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.0 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.0 | 0.4 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.2 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.0 | 0.0 | GO:0001032 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.0 | 0.0 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.0 | 0.0 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.0 | 0.1 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.1 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.0 | 0.1 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.1 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.0 | 0.4 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
0.0 | 0.2 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.6 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.1 | GO:0031720 | haptoglobin binding(GO:0031720) |
0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.5 | GO:0017048 | Rho GTPase binding(GO:0017048) |
0.0 | 0.1 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.0 | 0.5 | GO:0043738 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.1 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.0 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.0 | 0.1 | GO:0000150 | recombinase activity(GO:0000150) |
0.0 | 0.0 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.0 | 0.1 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.0 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.0 | 0.1 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.0 | 0.1 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.3 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.1 | GO:0004937 | alpha-adrenergic receptor activity(GO:0004936) alpha1-adrenergic receptor activity(GO:0004937) |
0.0 | 0.1 | GO:0038187 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.0 | 0.4 | GO:0097110 | scaffold protein binding(GO:0097110) |
0.0 | 0.1 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.1 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.0 | 0.0 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.1 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.0 | 0.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.2 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.0 | 0.0 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.0 | 0.1 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.8 | GO:0004713 | protein tyrosine kinase activity(GO:0004713) |
0.0 | 0.1 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.4 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.2 | GO:0005542 | folic acid binding(GO:0005542) |
0.0 | 0.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.0 | 0.1 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.0 | 0.3 | GO:0043394 | proteoglycan binding(GO:0043394) |
0.0 | 0.0 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) |
0.0 | 0.7 | GO:0046921 | alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
0.0 | 0.1 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.0 | 0.0 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.1 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.0 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) norepinephrine binding(GO:0051380) |
0.0 | 0.0 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 1.1 | GO:0005179 | hormone activity(GO:0005179) |
0.0 | 0.0 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.1 | GO:0051378 | serotonin binding(GO:0051378) |
0.0 | 0.0 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.0 | 0.0 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.0 | GO:0008251 | tRNA-specific adenosine deaminase activity(GO:0008251) |
0.0 | 0.0 | GO:1990188 | euchromatin binding(GO:1990188) |
0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 0.1 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.3 | GO:0022839 | ion gated channel activity(GO:0022839) |
0.0 | 0.1 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.0 | 0.0 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.0 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.1 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.0 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.0 | 0.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 0.1 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.0 | 0.0 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.0 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.0 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.0 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.0 | 0.0 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.0 | 0.1 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.0 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.0 | 0.2 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.4 | GO:0015108 | chloride transmembrane transporter activity(GO:0015108) |
0.0 | 0.0 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
0.0 | 0.7 | GO:0005539 | glycosaminoglycan binding(GO:0005539) |
0.0 | 0.0 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.0 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 36.1 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.4 | 3.6 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.3 | 8.9 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.3 | 20.3 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.3 | 2.5 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.3 | 6.7 | PID ALK1 PATHWAY | ALK1 signaling events |
0.3 | 5.0 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.3 | 5.5 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.3 | 1.3 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.2 | 1.5 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.2 | 7.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.2 | 0.2 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.2 | 1.2 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.2 | 2.3 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.2 | 4.0 | PID IGF1 PATHWAY | IGF1 pathway |
0.2 | 3.9 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.2 | 2.5 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.2 | 0.8 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.2 | 1.0 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.2 | 6.0 | PID BMP PATHWAY | BMP receptor signaling |
0.2 | 5.2 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.2 | 6.6 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.2 | 4.7 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.2 | 1.7 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.2 | 0.2 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.2 | 1.8 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.2 | 4.4 | PID RAS PATHWAY | Regulation of Ras family activation |
0.2 | 3.8 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.2 | 4.6 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.2 | 3.7 | PID RHOA PATHWAY | RhoA signaling pathway |
0.2 | 0.9 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 6.8 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.1 | 4.8 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.1 | 1.9 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.1 | 1.5 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.1 | 0.8 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 1.1 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 0.9 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 3.2 | PID FGF PATHWAY | FGF signaling pathway |
0.1 | 1.5 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 3.0 | PID ENDOTHELIN PATHWAY | Endothelins |
0.1 | 0.6 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.1 | 0.9 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.1 | 4.0 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 1.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.1 | 17.6 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.1 | 2.7 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.1 | 2.9 | NABA CORE MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
0.1 | 2.4 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.1 | 1.9 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.1 | 1.9 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 2.5 | PID AURORA A PATHWAY | Aurora A signaling |
0.1 | 1.1 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.1 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 0.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 0.4 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 0.3 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.1 | 2.7 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.1 | 2.8 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.1 | 1.6 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 0.4 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.1 | 2.3 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.1 | 2.9 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.1 | 0.5 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.1 | 2.2 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.1 | 1.3 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.1 | 0.8 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 0.4 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.1 | 0.9 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 0.7 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 1.7 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.1 | 1.5 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 1.5 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.1 | 0.8 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.1 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 14.3 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.1 | 0.6 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 1.2 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.1 | 1.5 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.1 | 1.0 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.1 | 0.6 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.1 | 0.3 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.1 | 0.7 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.1 | 0.1 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 0.4 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.1 | 2.0 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.1 | 1.6 | PID AURORA B PATHWAY | Aurora B signaling |
0.1 | 1.9 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.1 | 0.2 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.1 | 12.7 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.1 | 0.1 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 0.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.1 | 1.3 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.1 | 0.5 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.1 | 0.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.1 | 0.5 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.1 | 0.3 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.1 | 0.9 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 0.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 1.1 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.2 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 4.0 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.0 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 0.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.2 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.1 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.0 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.0 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.2 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 12.0 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.8 | 13.5 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.5 | 3.8 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.5 | 3.7 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.4 | 4.0 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.4 | 4.0 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.4 | 3.3 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.4 | 2.9 | REACTOME OPSINS | Genes involved in Opsins |
0.4 | 6.0 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.3 | 7.6 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.3 | 7.2 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.3 | 11.9 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.3 | 3.2 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.3 | 31.2 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.3 | 6.6 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.3 | 1.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.3 | 5.1 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.3 | 2.9 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
0.3 | 6.3 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.3 | 2.3 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.2 | 7.5 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.2 | 2.9 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.2 | 5.3 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.2 | 6.0 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.2 | 1.1 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.2 | 6.7 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.2 | 4.6 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
0.2 | 2.6 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.2 | 2.6 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.2 | 10.9 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.2 | 1.6 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.2 | 1.9 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.2 | 2.6 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.2 | 0.6 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.2 | 5.6 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.2 | 0.9 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.2 | 0.5 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.2 | 1.7 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 1.5 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 1.3 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.1 | 0.7 | REACTOME SIGNALING BY FGFR MUTANTS | Genes involved in Signaling by FGFR mutants |
0.1 | 1.2 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 1.6 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 3.0 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.1 | 1.6 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.1 | 0.9 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.1 | 8.9 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
0.1 | 0.9 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.1 | 1.6 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 0.6 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.1 | 0.6 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 1.0 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 2.1 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 1.3 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.1 | 4.8 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 0.8 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.1 | 0.8 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.1 | 0.4 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
0.1 | 0.7 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.1 | 3.7 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.1 | 0.9 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.1 | 0.1 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
0.1 | 0.5 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.1 | 1.3 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.1 | 0.6 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 0.7 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
0.1 | 1.7 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.1 | 0.4 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.1 | 0.4 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.1 | 0.5 | REACTOME ACTIVATION OF NMDA RECEPTOR UPON GLUTAMATE BINDING AND POSTSYNAPTIC EVENTS | Genes involved in Activation of NMDA receptor upon glutamate binding and postsynaptic events |
0.1 | 1.9 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 2.0 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.1 | 3.4 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.1 | 0.4 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.1 | 1.1 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.1 | 0.2 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.1 | 1.0 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.1 | 0.5 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 0.6 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.1 | 0.4 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
0.1 | 0.5 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.1 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 0.1 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.1 | 0.1 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
0.1 | 1.0 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.1 | 0.9 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.1 | 2.5 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.1 | 0.8 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.1 | 0.4 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.1 | 0.9 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.1 | 0.3 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.1 | 2.8 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.1 | 1.1 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.1 | 0.8 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.1 | 0.2 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.1 | 1.6 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.1 | 0.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.1 | 0.7 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.1 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.1 | 0.5 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.1 | 0.7 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.1 | 0.3 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.1 | 0.9 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.1 | 0.9 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 0.4 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.1 | 0.5 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.1 | 0.7 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.1 | 0.8 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.0 | 0.6 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.0 | 0.3 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.6 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.5 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.4 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.4 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.0 | 0.8 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 2.1 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.0 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.0 | 0.0 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.0 | 0.3 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 3.0 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
0.0 | 0.2 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
0.0 | 0.1 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.0 | 0.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.1 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.5 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.0 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.1 | REACTOME SIGNALING BY ERBB4 | Genes involved in Signaling by ERBB4 |
0.0 | 0.3 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.0 | 0.2 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.1 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.0 | 0.0 | REACTOME CELL CELL COMMUNICATION | Genes involved in Cell-Cell communication |
0.0 | 0.2 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.1 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
0.0 | 0.6 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.3 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.0 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.0 | 0.1 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
0.0 | 0.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.1 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.0 | 0.2 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 0.2 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
0.0 | 0.0 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.1 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.0 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.1 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.3 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.0 | 0.1 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 0.3 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 0.0 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.1 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 0.0 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.0 | 0.0 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.0 | 0.0 | REACTOME ACETYLCHOLINE BINDING AND DOWNSTREAM EVENTS | Genes involved in Acetylcholine Binding And Downstream Events |
0.0 | 0.1 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.0 | 0.5 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |