Gene Symbol | Gene ID | Gene Info |
---|---|---|
Gbx2
|
ENSMUSG00000034486.7 | gastrulation brain homeobox 2 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Gbx2 | chr1_89941738_89942193 | 10786 | 0.191651 | 0.57 | 5.2e-06 | Click! |
Gbx2 | chr1_89942264_89942415 | 11160 | 0.190855 | 0.47 | 3.1e-04 | Click! |
Gbx2 | chr1_89931099_89931638 | 189 | 0.909788 | 0.43 | 1.2e-03 | Click! |
Gbx2 | chr1_89930860_89931046 | 226 | 0.825608 | 0.37 | 5.7e-03 | Click! |
Gbx2 | chr1_89962211_89962362 | 31107 | 0.147917 | 0.36 | 6.9e-03 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr13_72298631_72298782 | 4.58 |
Gm4052 |
predicted gene 4052 |
51515 |
0.15 |
chr2_101592687_101592869 | 4.06 |
B230118H07Rik |
RIKEN cDNA B230118H07 gene |
7844 |
0.19 |
chr15_70156585_70156736 | 3.35 |
Gm5216 |
predicted gene 5216 |
91991 |
0.1 |
chr3_34559225_34559387 | 3.29 |
Sox2ot |
SOX2 overlapping transcript (non-protein coding) |
1022 |
0.48 |
chr14_64596034_64596216 | 3.15 |
Mir3078 |
microRNA 3078 |
4940 |
0.17 |
chr2_112733041_112733261 | 3.11 |
Ryr3 |
ryanodine receptor 3 |
76603 |
0.1 |
chr18_76816111_76816262 | 3.10 |
Skor2 |
SKI family transcriptional corepressor 2 |
40219 |
0.18 |
chr3_4796668_4797120 | 3.07 |
1110015O18Rik |
RIKEN cDNA 1110015O18 gene |
664 |
0.77 |
chr2_40643950_40644201 | 2.98 |
Lrp1b |
low density lipoprotein-related protein 1B |
13313 |
0.29 |
chr6_99669465_99669765 | 2.98 |
Gm20696 |
predicted gene 20696 |
2818 |
0.18 |
chr2_152048577_152049360 | 2.98 |
AA387200 |
expressed sequence AA387200 |
27840 |
0.11 |
chr3_6886348_6886531 | 2.96 |
Gm22074 |
predicted gene, 22074 |
90829 |
0.09 |
chr9_37114956_37115270 | 2.96 |
Gm48716 |
predicted gene, 48716 |
3543 |
0.18 |
chr8_89271835_89272008 | 2.91 |
Gm5356 |
predicted pseudogene 5356 |
84361 |
0.1 |
chr6_40024235_40024578 | 2.91 |
Gm37995 |
predicted gene, 37995 |
2488 |
0.33 |
chr1_53467098_53467267 | 2.89 |
Gm25240 |
predicted gene, 25240 |
23787 |
0.17 |
chr11_16299934_16300272 | 2.86 |
Vstm2a |
V-set and transmembrane domain containing 2A |
36885 |
0.19 |
chr5_131586049_131586310 | 2.86 |
Gm27266 |
predicted gene, 27266 |
8192 |
0.13 |
chr1_42243123_42243275 | 2.81 |
Gm29664 |
predicted gene 29664 |
4504 |
0.21 |
chr3_56669098_56669263 | 2.78 |
Gm2622 |
predicted gene 2622 |
159607 |
0.04 |
chr4_154952661_154953271 | 2.77 |
Hes5 |
hes family bHLH transcription factor 5 |
7957 |
0.11 |
chr4_99274083_99274257 | 2.72 |
Gm10305 |
predicted gene 10305 |
1499 |
0.39 |
chr3_134605538_134605802 | 2.66 |
Gm26820 |
predicted gene, 26820 |
25095 |
0.24 |
chr9_94768211_94768379 | 2.66 |
Mir7656 |
microRNA 7656 |
16466 |
0.22 |
chr16_96673609_96673791 | 2.65 |
Gm49907 |
predicted gene, 49907 |
39330 |
0.15 |
chr10_86492150_86492313 | 2.63 |
Syn3 |
synapsin III |
334 |
0.82 |
chr17_68837314_68837806 | 2.59 |
Gm38593 |
predicted gene, 38593 |
334 |
0.56 |
chr4_73488356_73488573 | 2.58 |
Gm11488 |
predicted gene 11488 |
10013 |
0.2 |
chr13_29349395_29349902 | 2.56 |
Gm11364 |
predicted gene 11364 |
113028 |
0.07 |
chrX_60545622_60545821 | 2.56 |
Gm715 |
predicted gene 715 |
2298 |
0.23 |
chr13_109312646_109312797 | 2.55 |
Mir582 |
microRNA 582 |
12023 |
0.28 |
chr7_73196833_73197263 | 2.51 |
Gm20083 |
predicted gene, 20083 |
11245 |
0.16 |
chr13_85067648_85067905 | 2.50 |
Gm47745 |
predicted gene, 47745 |
26559 |
0.17 |
chr7_54782042_54782216 | 2.48 |
Luzp2 |
leucine zipper protein 2 |
53369 |
0.15 |
chr14_54158375_54158526 | 2.47 |
Traj57 |
T cell receptor alpha joining 57 |
55 |
0.9 |
chr15_62284459_62284610 | 2.42 |
Pvt1 |
Pvt1 oncogene |
61931 |
0.14 |
chr9_34923762_34923954 | 2.41 |
Kirrel3os |
kirre like nephrin family adhesion molecule 3, opposite strand |
5651 |
0.24 |
chr5_5664612_5664780 | 2.40 |
Cfap69 |
cilia and flagella associated protein 69 |
457 |
0.8 |
chr2_49679429_49679650 | 2.40 |
Gm13525 |
predicted gene 13525 |
960 |
0.63 |
chr6_141302168_141302320 | 2.39 |
Gm10400 |
predicted gene 10400 |
38309 |
0.16 |
chr2_163297044_163297260 | 2.37 |
Tox2 |
TOX high mobility group box family member 2 |
23226 |
0.18 |
chr19_60148852_60149003 | 2.36 |
E330013P04Rik |
RIKEN cDNA E330013P04 gene |
2367 |
0.31 |
chr4_106959954_106960105 | 2.36 |
Ssbp3 |
single-stranded DNA binding protein 3 |
4170 |
0.24 |
chr6_135525824_135526357 | 2.35 |
Gm25136 |
predicted gene, 25136 |
58102 |
0.13 |
chr19_21487446_21487643 | 2.35 |
Gda |
guanine deaminase |
14099 |
0.24 |
chr2_53385096_53385308 | 2.32 |
Gm13501 |
predicted gene 13501 |
13285 |
0.28 |
chr16_79091563_79091714 | 2.32 |
Tmprss15 |
transmembrane protease, serine 15 |
541 |
0.87 |
chr5_16166576_16166763 | 2.31 |
Gm43490 |
predicted gene 43490 |
59540 |
0.14 |
chr3_86447588_86447739 | 2.29 |
Gm25039 |
predicted gene, 25039 |
63416 |
0.1 |
chr10_100865897_100866065 | 2.28 |
Gm35722 |
predicted gene, 35722 |
124346 |
0.05 |
chr1_6767739_6768048 | 2.28 |
St18 |
suppression of tumorigenicity 18 |
30318 |
0.2 |
chr3_26330975_26331149 | 2.26 |
A830092H15Rik |
RIKEN cDNA A830092H15 gene |
88 |
0.94 |
chr6_4555457_4555608 | 2.25 |
Gm18289 |
predicted gene, 18289 |
16184 |
0.13 |
chr7_90261871_90262047 | 2.25 |
Ccdc83 |
coiled-coil domain containing 83 |
3459 |
0.19 |
chr17_44398213_44398364 | 2.24 |
Gm49872 |
predicted gene, 49872 |
30385 |
0.23 |
chr10_92333030_92333340 | 2.24 |
Gm20757 |
predicted gene, 20757 |
42188 |
0.14 |
chr17_61033656_61033810 | 2.23 |
Gm18070 |
predicted gene, 18070 |
17115 |
0.27 |
chr1_51090512_51090708 | 2.19 |
Gm28319 |
predicted gene 28319 |
50612 |
0.13 |
chr3_67036781_67036950 | 2.19 |
Gm22295 |
predicted gene, 22295 |
19093 |
0.19 |
chr7_79509109_79509299 | 2.18 |
A330074H02Rik |
RIKEN cDNA A330074H02 gene |
1158 |
0.27 |
chr6_30654676_30654871 | 2.16 |
Cep41 |
centrosomal protein 41 |
2036 |
0.22 |
chr3_3832009_3832194 | 2.15 |
Gm2071 |
predicted gene 2071 |
2817 |
0.34 |
chr15_4378780_4379184 | 2.15 |
Plcxd3 |
phosphatidylinositol-specific phospholipase C, X domain containing 3 |
3478 |
0.36 |
chr11_9592079_9592246 | 2.14 |
Gm36954 |
predicted gene, 36954 |
113461 |
0.07 |
chrX_110318504_110318684 | 2.13 |
Gm7134 |
predicted gene 7134 |
54159 |
0.18 |
chr3_122461374_122461840 | 2.12 |
Gm42836 |
predicted gene 42836 |
2547 |
0.2 |
chr17_48999548_48999943 | 2.12 |
Lrfn2 |
leucine rich repeat and fibronectin type III domain containing 2 |
67366 |
0.11 |
chr18_55016032_55016196 | 2.11 |
Zfp608 |
zinc finger protein 608 |
23559 |
0.17 |
chr9_35402818_35403314 | 2.11 |
Cdon |
cell adhesion molecule-related/down-regulated by oncogenes |
18062 |
0.15 |
chr14_35244974_35245125 | 2.10 |
Gm49034 |
predicted gene, 49034 |
25611 |
0.26 |
chr14_122480555_122480706 | 2.10 |
Zic2 |
zinc finger protein of the cerebellum 2 |
2530 |
0.16 |
chr13_78445539_78445710 | 2.09 |
Gm31946 |
predicted gene, 31946 |
18376 |
0.19 |
chr2_57597721_57598247 | 2.09 |
Gm13532 |
predicted gene 13532 |
31244 |
0.18 |
chr3_7943878_7944041 | 2.06 |
1700010I02Rik |
RIKEN cDNA 1700010I02 gene |
10923 |
0.27 |
chr10_87489779_87490093 | 2.06 |
Ascl1 |
achaete-scute family bHLH transcription factor 1 |
3724 |
0.24 |
chr7_109234675_109234849 | 2.06 |
Gm45024 |
predicted gene 45024 |
10562 |
0.21 |
chr9_90490877_90491030 | 2.04 |
Gm22866 |
predicted gene, 22866 |
138958 |
0.04 |
chr13_72288859_72289044 | 2.04 |
Gm4052 |
predicted gene 4052 |
61270 |
0.13 |
chr1_31364092_31364251 | 2.01 |
Gm6489 |
predicted gene 6489 |
77226 |
0.08 |
chr2_136108035_136108369 | 2.01 |
Gm14218 |
predicted gene 14218 |
28804 |
0.19 |
chr6_112929919_112930359 | 2.01 |
Srgap3 |
SLIT-ROBO Rho GTPase activating protein 3 |
16615 |
0.14 |
chr13_72289081_72289321 | 2.00 |
Gm4052 |
predicted gene 4052 |
61020 |
0.13 |
chr2_33615871_33616035 | 1.99 |
Gm38011 |
predicted gene, 38011 |
1555 |
0.34 |
chr16_88599937_88600275 | 1.96 |
Gm49688 |
predicted gene, 49688 |
8564 |
0.11 |
chr3_34102978_34103129 | 1.94 |
Sox2ot |
SOX2 overlapping transcript (non-protein coding) |
1217 |
0.4 |
chr1_14842768_14842919 | 1.93 |
Smt3h2-ps4 |
SMT3 suppressor of mif two 3 homolog 2, pseudogene 4 (S. cerevisiae) |
2687 |
0.27 |
chr1_78141770_78141940 | 1.93 |
Pax3 |
paired box 3 |
54983 |
0.14 |
chr2_150735739_150736543 | 1.91 |
Gm28450 |
predicted gene 28450 |
11520 |
0.12 |
chr13_91224420_91224721 | 1.90 |
Atg10 |
autophagy related 10 |
602 |
0.72 |
chr7_48959246_48959717 | 1.89 |
Nav2 |
neuron navigator 2 |
384 |
0.84 |
chr8_4677704_4678740 | 1.89 |
Gm7461 |
predicted gene 7461 |
143 |
0.62 |
chr11_44832819_44833172 | 1.87 |
Ebf1 |
early B cell factor 1 |
79143 |
0.11 |
chr1_127531215_127531971 | 1.87 |
Tmem163 |
transmembrane protein 163 |
5837 |
0.29 |
chr17_65742516_65742902 | 1.85 |
Rab31 |
RAB31, member RAS oncogene family |
29931 |
0.15 |
chr18_29298308_29298459 | 1.83 |
Gm34743 |
predicted gene, 34743 |
53036 |
0.17 |
chr2_68895217_68895368 | 1.82 |
Gm37159 |
predicted gene, 37159 |
3926 |
0.18 |
chr6_107711195_107711474 | 1.82 |
4933431M02Rik |
RIKEN cDNA 4933431M02 gene |
83560 |
0.1 |
chr6_75253494_75253645 | 1.81 |
Gm6210 |
predicted gene 6210 |
44490 |
0.16 |
chr5_146968783_146968954 | 1.81 |
Mtif3 |
mitochondrial translational initiation factor 3 |
5068 |
0.19 |
chr9_81863521_81864338 | 1.80 |
Mei4 |
meiotic double-stranded break formation protein 4 |
220 |
0.95 |
chr1_176018664_176018815 | 1.80 |
Gm38081 |
predicted gene, 38081 |
13984 |
0.19 |
chr11_37650264_37650415 | 1.79 |
Gm12128 |
predicted gene 12128 |
8650 |
0.34 |
chr6_47175944_47176185 | 1.79 |
Cntnap2 |
contactin associated protein-like 2 |
68323 |
0.13 |
chr13_39084790_39084948 | 1.78 |
Slc35b3 |
solute carrier family 35, member B3 |
123994 |
0.05 |
chr4_26347200_26347370 | 1.78 |
Manea |
mannosidase, endo-alpha |
394 |
0.89 |
chr8_13454338_13454755 | 1.78 |
Tmem255b |
transmembrane protein 255B |
932 |
0.51 |
chr4_142638972_142639342 | 1.77 |
Gm37624 |
predicted gene, 37624 |
151651 |
0.04 |
chr10_127031073_127031224 | 1.77 |
Tsfm |
Ts translation elongation factor, mitochondrial |
308 |
0.74 |
chr17_15829209_15829362 | 1.76 |
Rgmb |
repulsive guidance molecule family member B |
1366 |
0.36 |
chr12_48634776_48635069 | 1.76 |
Gm29818 |
predicted gene, 29818 |
2629 |
0.39 |
chr13_84058856_84059007 | 1.76 |
Gm17750 |
predicted gene, 17750 |
5841 |
0.23 |
chr8_26264812_26265008 | 1.74 |
Gm31727 |
predicted gene, 31727 |
2067 |
0.22 |
chr3_109488712_109488866 | 1.74 |
Vav3 |
vav 3 oncogene |
5995 |
0.33 |
chr13_88088380_88088544 | 1.71 |
Gm27044 |
predicted gene, 27044 |
96994 |
0.08 |
chr9_103504895_103505451 | 1.71 |
Tmem108 |
transmembrane protein 108 |
11562 |
0.11 |
chr14_100713703_100713949 | 1.71 |
Gm22401 |
predicted gene, 22401 |
13205 |
0.21 |
chr7_140821656_140822310 | 1.70 |
Zfp941 |
zinc finger protein 941 |
149 |
0.88 |
chr13_115671835_115671986 | 1.70 |
Gm47892 |
predicted gene, 47892 |
47589 |
0.18 |
chr2_74696580_74696731 | 1.70 |
Gm28793 |
predicted gene 28793 |
931 |
0.18 |
chr6_33739125_33739298 | 1.69 |
Exoc4 |
exocyst complex component 4 |
37777 |
0.19 |
chr15_49874691_49874842 | 1.68 |
Gm49186 |
predicted gene, 49186 |
38616 |
0.23 |
chr13_57603228_57603418 | 1.65 |
Spock1 |
sparc/osteonectin, cwcv and kazal-like domains proteoglycan 1 |
304264 |
0.01 |
chr3_158164467_158164635 | 1.64 |
Gm42968 |
predicted gene 42968 |
15685 |
0.19 |
chr1_47164492_47164664 | 1.63 |
Gm28826 |
predicted gene 28826 |
11117 |
0.28 |
chr6_13839580_13839789 | 1.62 |
Gpr85 |
G protein-coupled receptor 85 |
189 |
0.95 |
chr16_62538042_62538193 | 1.62 |
Gm24164 |
predicted gene, 24164 |
32919 |
0.18 |
chr12_107928478_107928826 | 1.62 |
Bcl11b |
B cell leukemia/lymphoma 11B |
74762 |
0.11 |
chr7_3397410_3397561 | 1.62 |
Cacng8 |
calcium channel, voltage-dependent, gamma subunit 8 |
3067 |
0.11 |
chr5_65131292_65131908 | 1.62 |
Klhl5 |
kelch-like 5 |
71 |
0.97 |
chr7_56316212_56316430 | 1.60 |
Oca2 |
oculocutaneous albinism II |
10083 |
0.25 |
chr17_11131050_11131201 | 1.59 |
Gm28505 |
predicted gene 28505 |
41657 |
0.18 |
chr4_126648482_126648847 | 1.59 |
Gm12933 |
predicted gene 12933 |
16590 |
0.13 |
chr8_61325062_61325301 | 1.59 |
1700001D01Rik |
RIKEN cDNA 1700001D01 gene |
36309 |
0.13 |
chr11_24095763_24095931 | 1.58 |
Bcl11a |
B cell CLL/lymphoma 11A (zinc finger protein) |
15177 |
0.13 |
chr17_75809028_75809220 | 1.58 |
Gm50099 |
predicted gene, 50099 |
24713 |
0.23 |
chr10_92556536_92557110 | 1.58 |
Gm4800 |
predicted gene 4800 |
13153 |
0.16 |
chr7_114842602_114842988 | 1.57 |
Gm24982 |
predicted gene, 24982 |
10281 |
0.17 |
chr18_6489234_6489492 | 1.57 |
Gm28529 |
predicted gene 28529 |
780 |
0.45 |
chr8_61515184_61515647 | 1.57 |
Palld |
palladin, cytoskeletal associated protein |
485 |
0.84 |
chr4_13398843_13399022 | 1.57 |
Gm11819 |
predicted gene 11819 |
45838 |
0.17 |
chr2_101967762_101967960 | 1.56 |
Gm13919 |
predicted gene 13919 |
71768 |
0.09 |
chr19_15803250_15803445 | 1.55 |
Gm50348 |
predicted gene, 50348 |
289 |
0.94 |
chr2_97610715_97610866 | 1.54 |
Gm44320 |
predicted gene, 44320 |
16262 |
0.29 |
chr4_110397207_110397538 | 1.53 |
Agbl4 |
ATP/GTP binding protein-like 4 |
289 |
0.94 |
chr1_164957006_164957166 | 1.52 |
1700029M03Rik |
RIKEN cDNA 1700029M03 gene |
3835 |
0.2 |
chr13_83713330_83713555 | 1.52 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
7939 |
0.14 |
chr12_56387696_56387852 | 1.51 |
Cox6c2 |
cytochrome c oxidase subunit 6C2 |
13951 |
0.16 |
chr9_94759923_94760235 | 1.51 |
Mir7656 |
microRNA 7656 |
8250 |
0.24 |
chr1_168908922_168909127 | 1.51 |
Mir6354 |
microRNA 6354 |
110065 |
0.07 |
chr1_93079597_93080373 | 1.51 |
Kif1a |
kinesin family member 1A |
2436 |
0.23 |
chr12_56004549_56004776 | 1.51 |
Gm5183 |
predicted gene 5183 |
45871 |
0.13 |
chr14_75540763_75541352 | 1.51 |
Cby2 |
chibby family member 2 |
50892 |
0.13 |
chr17_59977241_59977392 | 1.49 |
Gm49853 |
predicted gene, 49853 |
122099 |
0.06 |
chr4_84996051_84996225 | 1.49 |
Gm12419 |
predicted gene 12419 |
71949 |
0.11 |
chr17_25803548_25803871 | 1.48 |
Fbxl16 |
F-box and leucine-rich repeat protein 16 |
5376 |
0.05 |
chr5_67466955_67467106 | 1.48 |
C330024D21Rik |
RIKEN cDNA C330024D21 gene |
3127 |
0.19 |
chr1_42877682_42877833 | 1.48 |
Mrps9 |
mitochondrial ribosomal protein S9 |
9980 |
0.19 |
chr3_63963941_63965187 | 1.48 |
Slc33a1 |
solute carrier family 33 (acetyl-CoA transporter), member 1 |
102 |
0.92 |
chr1_55820955_55821106 | 1.47 |
9130227L01Rik |
RIKEN cDNA 9130227L01 gene |
110211 |
0.06 |
chr7_64631811_64631970 | 1.46 |
Apba2 |
amyloid beta (A4) precursor protein-binding, family A, member 2 |
3141 |
0.33 |
chr12_118661557_118661934 | 1.46 |
Gm9267 |
predicted gene 9267 |
59068 |
0.12 |
chr14_12079940_12080241 | 1.46 |
Ptprg |
protein tyrosine phosphatase, receptor type, G |
11070 |
0.24 |
chr8_78346149_78346564 | 1.46 |
Ttc29 |
tetratricopeptide repeat domain 29 |
44626 |
0.16 |
chr18_31999155_31999543 | 1.45 |
Myo7b |
myosin VIIB |
15981 |
0.12 |
chr13_107247476_107247653 | 1.45 |
Gm2726 |
predicted gene 2726 |
32627 |
0.2 |
chr8_77610315_77610937 | 1.45 |
Tmem184c |
transmembrane protein 184C |
27 |
0.75 |
chr9_80391214_80391366 | 1.44 |
Gm18292 |
predicted gene, 18292 |
59958 |
0.12 |
chr12_51000444_51000673 | 1.43 |
Gm40421 |
predicted gene, 40421 |
4315 |
0.24 |
chr3_119947205_119947510 | 1.42 |
Gm18384 |
predicted gene, 18384 |
21374 |
0.24 |
chr18_27956892_27957222 | 1.41 |
Gm33674 |
predicted gene, 33674 |
147325 |
0.05 |
chr2_83829031_83829453 | 1.41 |
Fam171b |
family with sequence similarity 171, member B |
16606 |
0.16 |
chr1_85716491_85716802 | 1.41 |
Sp100 |
nuclear antigen Sp100 |
13204 |
0.11 |
chr18_21654916_21655092 | 1.40 |
Klhl14 |
kelch-like 14 |
286 |
0.92 |
chr7_37628260_37628411 | 1.39 |
Gm44883 |
predicted gene 44883 |
34303 |
0.16 |
chr1_54853447_54853598 | 1.39 |
Ankrd44 |
ankyrin repeat domain 44 |
31189 |
0.17 |
chr11_24804594_24804852 | 1.38 |
Gm10466 |
predicted gene 10466 |
74001 |
0.11 |
chr18_5413929_5414080 | 1.37 |
Gm50065 |
predicted gene, 50065 |
43522 |
0.14 |
chr19_20010077_20010228 | 1.37 |
Gm22684 |
predicted gene, 22684 |
23483 |
0.22 |
chr8_61309392_61309892 | 1.37 |
1700001D01Rik |
RIKEN cDNA 1700001D01 gene |
20770 |
0.18 |
chr4_152642294_152642445 | 1.37 |
Gm13172 |
predicted gene 13172 |
35634 |
0.18 |
chr15_90154166_90154329 | 1.36 |
Alg10b |
asparagine-linked glycosylation 10B (alpha-1,2-glucosyltransferase) |
70064 |
0.1 |
chr9_22707603_22707772 | 1.35 |
Bbs9 |
Bardet-Biedl syndrome 9 (human) |
28937 |
0.15 |
chr8_25392912_25393353 | 1.35 |
Gm39147 |
predicted gene, 39147 |
5888 |
0.16 |
chr14_115406785_115406969 | 1.34 |
4930505G20Rik |
RIKEN cDNA 4930505G20 gene |
2675 |
0.41 |
chr15_58743226_58743422 | 1.33 |
Gm20712 |
predicted gene 20712 |
38627 |
0.14 |
chr7_37650684_37650835 | 1.33 |
Gm44883 |
predicted gene 44883 |
11879 |
0.21 |
chr4_125545547_125545968 | 1.33 |
Mir692-2 |
microRNA 692-2 |
41008 |
0.15 |
chr5_106559652_106559845 | 1.33 |
Gm28050 |
predicted gene, 28050 |
14967 |
0.14 |
chr1_25892841_25892992 | 1.33 |
Gm9884 |
predicted gene 9884 |
62259 |
0.08 |
chr2_17861939_17862094 | 1.33 |
Gm13323 |
predicted gene 13323 |
64032 |
0.11 |
chr6_6163350_6163566 | 1.32 |
Slc25a13 |
solute carrier family 25 (mitochondrial carrier, adenine nucleotide translocator), member 13 |
10493 |
0.26 |
chr14_118436095_118436246 | 1.32 |
Gm5672 |
predicted gene 5672 |
59976 |
0.09 |
chr13_75941248_75941791 | 1.31 |
Rhobtb3 |
Rho-related BTB domain containing 3 |
2348 |
0.18 |
chr11_102963971_102964122 | 1.31 |
2410004I01Rik |
RIKEN cDNA 2410004I01 gene |
341 |
0.8 |
chr3_120983132_120983283 | 1.31 |
Gm43444 |
predicted gene 43444 |
37569 |
0.16 |
chr6_40063542_40063708 | 1.30 |
Gm37673 |
predicted gene, 37673 |
35097 |
0.13 |
chr6_72699485_72699773 | 1.30 |
Gm15402 |
predicted gene 15402 |
415 |
0.77 |
chr15_39876599_39876752 | 1.30 |
Dpys |
dihydropyrimidinase |
19205 |
0.19 |
chr16_43931567_43931842 | 1.29 |
Qtrt2 |
queuine tRNA-ribosyltransferase accessory subunit 2 |
4895 |
0.17 |
chr1_128405021_128405492 | 1.29 |
Dars |
aspartyl-tRNA synthetase |
12103 |
0.18 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.6 | GO:0021564 | vagus nerve development(GO:0021564) |
0.5 | 1.4 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.4 | 1.7 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.4 | 1.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.4 | 1.1 | GO:0060166 | olfactory pit development(GO:0060166) |
0.3 | 1.0 | GO:0021593 | rhombomere morphogenesis(GO:0021593) |
0.3 | 1.4 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.3 | 1.0 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.3 | 1.0 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.3 | 0.9 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.3 | 0.8 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.2 | 0.7 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.2 | 0.7 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.2 | 0.8 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.2 | 0.6 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.2 | 0.5 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.2 | 0.5 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.2 | 0.5 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.2 | 0.6 | GO:0007412 | axon target recognition(GO:0007412) |
0.2 | 2.2 | GO:0003334 | keratinocyte development(GO:0003334) |
0.2 | 1.4 | GO:0006983 | ER overload response(GO:0006983) |
0.1 | 0.3 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.1 | 0.1 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.1 | 0.7 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.1 | 0.6 | GO:0034239 | regulation of macrophage fusion(GO:0034239) |
0.1 | 1.2 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.1 | 0.4 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.1 | 0.5 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.1 | 0.9 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.1 | 0.4 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.1 | 0.5 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.1 | 0.6 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.1 | 0.3 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.3 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.1 | 0.3 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.1 | 0.6 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.1 | 0.6 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.5 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.1 | 0.6 | GO:0022028 | tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
0.1 | 0.3 | GO:0007525 | somatic muscle development(GO:0007525) |
0.1 | 0.3 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.8 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
0.1 | 0.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.1 | 0.3 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.1 | 0.3 | GO:0021586 | pons maturation(GO:0021586) |
0.1 | 0.3 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.1 | 0.3 | GO:0060437 | lung growth(GO:0060437) |
0.1 | 0.3 | GO:0060066 | oviduct development(GO:0060066) |
0.1 | 0.8 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.1 | 0.3 | GO:0060594 | mammary gland specification(GO:0060594) |
0.1 | 0.2 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.1 | 0.5 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.1 | 0.3 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.1 | 0.3 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.1 | 0.3 | GO:0009177 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
0.1 | 0.3 | GO:0048478 | replication fork protection(GO:0048478) |
0.1 | 0.2 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.1 | 0.2 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.1 | 1.0 | GO:0001553 | luteinization(GO:0001553) |
0.1 | 0.4 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.1 | 0.5 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
0.1 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.2 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.1 | 0.7 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
0.1 | 0.1 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.1 | 0.4 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.1 | 0.2 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.7 | GO:0002934 | desmosome organization(GO:0002934) |
0.1 | 0.5 | GO:0007000 | nucleolus organization(GO:0007000) |
0.1 | 0.3 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
0.1 | 0.1 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.1 | 0.2 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.1 | 0.3 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.1 | 0.6 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.1 | 0.3 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.1 | 0.9 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.1 | 0.2 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.1 | 0.1 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
0.1 | 0.2 | GO:0042938 | dipeptide transport(GO:0042938) |
0.1 | 0.2 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.1 | 0.3 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.1 | 0.2 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.1 | 0.3 | GO:0045410 | positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
0.1 | 0.2 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.1 | 0.3 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
0.1 | 0.7 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.1 | 0.5 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.2 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.1 | 0.2 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.1 | 0.5 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.1 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.4 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.1 | 0.1 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.1 | 0.2 | GO:0021747 | cochlear nucleus development(GO:0021747) |
0.1 | 0.2 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.1 | 0.2 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.1 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
0.1 | 0.1 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.0 | 0.1 | GO:1904684 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
0.0 | 0.3 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.0 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.0 | 0.0 | GO:0071335 | hair follicle cell proliferation(GO:0071335) |
0.0 | 0.2 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.0 | 0.3 | GO:0006621 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
0.0 | 0.2 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.2 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.0 | 0.2 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
0.0 | 0.0 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.0 | 0.2 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.0 | 0.2 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.0 | 0.1 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.0 | 0.4 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.4 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.0 | 0.1 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.0 | 0.1 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.0 | 0.2 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.0 | 0.2 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.0 | 0.1 | GO:0052203 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.0 | 0.4 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.1 | GO:0048371 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.0 | 0.4 | GO:0047497 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.0 | 0.4 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.2 | GO:0022605 | oogenesis stage(GO:0022605) |
0.0 | 0.2 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.0 | 0.2 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.0 | 0.1 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.0 | 0.1 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.0 | 1.0 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
0.0 | 0.2 | GO:0000436 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) carbon catabolite activation of transcription(GO:0045991) |
0.0 | 0.2 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.0 | 0.0 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.0 | 0.0 | GO:0035905 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.0 | 0.6 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.2 | GO:0002604 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
0.0 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.0 | 0.1 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
0.0 | 0.2 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.0 | 0.2 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.1 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
0.0 | 0.1 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.0 | 0.5 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.0 | 0.1 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
0.0 | 0.3 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.0 | 0.3 | GO:0060581 | ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
0.0 | 0.1 | GO:0072033 | renal vesicle formation(GO:0072033) |
0.0 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.0 | 0.1 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.2 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.0 | 0.5 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
0.0 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.0 | 0.1 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.0 | 0.7 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.0 | 0.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.0 | 0.1 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.0 | 0.0 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
0.0 | 0.1 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.0 | 0.4 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.0 | 0.2 | GO:0001714 | endodermal cell fate specification(GO:0001714) |
0.0 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.2 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.0 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.0 | 0.2 | GO:0060897 | neural plate anterior/posterior regionalization(GO:0021999) neural plate regionalization(GO:0060897) |
0.0 | 0.1 | GO:0097461 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.0 | 0.0 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.0 | 0.2 | GO:0006559 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.2 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
0.0 | 0.1 | GO:0009080 | alanine catabolic process(GO:0006524) pyruvate family amino acid catabolic process(GO:0009080) |
0.0 | 0.0 | GO:0006808 | regulation of nitrogen utilization(GO:0006808) |
0.0 | 0.1 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.0 | 0.1 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.0 | 0.1 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.0 | 0.1 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
0.0 | 0.1 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.0 | 0.5 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
0.0 | 0.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.0 | 0.1 | GO:0031223 | auditory behavior(GO:0031223) |
0.0 | 0.1 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.0 | 0.1 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.0 | 0.5 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.2 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.0 | 0.1 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
0.0 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.0 | 0.1 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.0 | 0.1 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.0 | 0.1 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.0 | 0.1 | GO:0046958 | nonassociative learning(GO:0046958) habituation(GO:0046959) |
0.0 | 0.0 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.0 | 0.1 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
0.0 | 0.1 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.0 | 0.1 | GO:2000143 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
0.0 | 0.3 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.0 | 0.0 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.0 | 0.2 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.1 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.0 | 0.0 | GO:0061205 | paramesonephric duct development(GO:0061205) |
0.0 | 0.0 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.0 | 0.1 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.0 | 0.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.0 | 0.1 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.0 | 0.3 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.0 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.0 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.0 | 0.1 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.5 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
0.0 | 0.0 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.0 | 0.1 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.0 | 0.2 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.0 | 0.1 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.0 | 0.1 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.1 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.0 | 0.6 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.1 | GO:0035624 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
0.0 | 0.1 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.0 | 0.0 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.0 | 0.2 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
0.0 | 0.2 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.0 | 0.0 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
0.0 | 0.2 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
0.0 | 0.1 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
0.0 | 0.0 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.0 | 1.9 | GO:0007269 | neurotransmitter secretion(GO:0007269) signal release from synapse(GO:0099643) |
0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.2 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
0.0 | 0.3 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
0.0 | 0.1 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.0 | GO:0061046 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) regulation of branching involved in lung morphogenesis(GO:0061046) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.0 | 0.1 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.0 | 0.1 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.0 | 0.0 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.0 | 0.2 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
0.0 | 0.1 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.0 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.0 | 0.1 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.0 | 0.1 | GO:0002692 | negative regulation of cellular extravasation(GO:0002692) |
0.0 | 0.0 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.0 | 0.1 | GO:0008355 | olfactory learning(GO:0008355) |
0.0 | 0.1 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.1 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.0 | 0.3 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
0.0 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.0 | 0.1 | GO:0046137 | negative regulation of vitamin metabolic process(GO:0046137) |
0.0 | 0.0 | GO:2001280 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
0.0 | 0.1 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.0 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.0 | 0.0 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.0 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.0 | 0.1 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.0 | 0.0 | GO:0097195 | pilomotor reflex(GO:0097195) |
0.0 | 0.1 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.1 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.0 | 0.0 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.0 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.0 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.2 | GO:0042438 | melanin biosynthetic process(GO:0042438) |
0.0 | 0.1 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.0 | 0.2 | GO:0090382 | phagosome maturation(GO:0090382) |
0.0 | 0.0 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.0 | 0.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.1 | GO:0044598 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.2 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.0 | 0.0 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.0 | 0.1 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.0 | 0.2 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
0.0 | 0.1 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.0 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.0 | 0.3 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.0 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.1 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.0 | 0.2 | GO:0032508 | DNA duplex unwinding(GO:0032508) |
0.0 | 0.1 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.0 | 0.1 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.0 | 0.2 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.0 | 0.1 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.0 | 0.1 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.0 | 0.1 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.3 | GO:0035774 | positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
0.0 | 0.0 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.1 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.0 | 0.0 | GO:0035826 | rubidium ion transport(GO:0035826) |
0.0 | 0.2 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.0 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
0.0 | 0.0 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.0 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) |
0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.1 | GO:0019441 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.0 | 0.0 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.0 | 0.4 | GO:0010762 | regulation of fibroblast migration(GO:0010762) |
0.0 | 0.0 | GO:0010996 | response to auditory stimulus(GO:0010996) |
0.0 | 0.2 | GO:0008272 | sulfate transport(GO:0008272) |
0.0 | 0.0 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.0 | 0.0 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
0.0 | 0.2 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.0 | 0.0 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.1 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.0 | 0.0 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.4 | GO:0009395 | phospholipid catabolic process(GO:0009395) |
0.0 | 0.0 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.0 | 0.4 | GO:0045806 | negative regulation of endocytosis(GO:0045806) |
0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.1 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.0 | 0.2 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.0 | 0.1 | GO:0014047 | glutamate secretion(GO:0014047) |
0.0 | 0.1 | GO:0042220 | response to cocaine(GO:0042220) |
0.0 | 0.0 | GO:0021898 | commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.0 | 0.1 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.0 | GO:0050711 | negative regulation of interleukin-1 secretion(GO:0050711) |
0.0 | 0.0 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
0.0 | 0.0 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.0 | 0.2 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.0 | 0.0 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.0 | 0.1 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.0 | 0.1 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.0 | 0.1 | GO:0060231 | mesenchymal to epithelial transition(GO:0060231) |
0.0 | 0.0 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.0 | 0.0 | GO:0014029 | neural crest formation(GO:0014029) |
0.0 | 0.0 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.0 | 0.1 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.1 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.0 | GO:0010288 | response to lead ion(GO:0010288) |
0.0 | 0.1 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.0 | 0.2 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
0.0 | 0.0 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
0.0 | 0.1 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.0 | 0.1 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.0 | 0.1 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
0.0 | 0.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.0 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.0 | 0.0 | GO:0061009 | common bile duct development(GO:0061009) |
0.0 | 0.1 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.3 | GO:0051567 | histone H3-K9 methylation(GO:0051567) |
0.0 | 0.1 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.0 | 0.0 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.0 | 0.0 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.0 | 0.0 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.0 | 0.5 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.0 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.0 | 0.0 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.0 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:0010761 | fibroblast migration(GO:0010761) |
0.0 | 0.1 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
0.0 | 0.1 | GO:0051177 | meiotic sister chromatid segregation(GO:0045144) meiotic sister chromatid cohesion(GO:0051177) |
0.0 | 0.1 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
0.0 | 0.2 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.0 | 0.1 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.0 | 0.0 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.0 | 0.0 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.0 | 0.0 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.0 | 0.1 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.0 | 0.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.0 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.0 | 0.1 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.0 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.0 | 0.1 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
0.0 | 0.0 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.0 | 0.1 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.0 | 0.0 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.0 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.6 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.1 | 0.9 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.6 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.1 | 1.6 | GO:0000800 | lateral element(GO:0000800) |
0.1 | 0.4 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.1 | 1.6 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 0.3 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 1.7 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.6 | GO:0032584 | growth cone membrane(GO:0032584) |
0.1 | 0.5 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.1 | 0.3 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 0.4 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 1.8 | GO:0044295 | axonal growth cone(GO:0044295) |
0.1 | 0.2 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 0.3 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.1 | 0.8 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.1 | 0.6 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 1.9 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.1 | 0.5 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.4 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.0 | 0.6 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.2 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.0 | 2.5 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.9 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.2 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.5 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.3 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.7 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 0.1 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.0 | 0.2 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
0.0 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.2 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.3 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 0.3 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.3 | GO:0043194 | axon initial segment(GO:0043194) |
0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.9 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.0 | 0.1 | GO:1990696 | USH2 complex(GO:1990696) |
0.0 | 0.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.2 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.0 | 0.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.0 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.0 | GO:0097441 | basilar dendrite(GO:0097441) |
0.0 | 0.1 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.0 | 0.1 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.0 | 0.1 | GO:0000235 | astral microtubule(GO:0000235) |
0.0 | 0.0 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.0 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.0 | 0.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.0 | 0.5 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.0 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.0 | 0.8 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 1.9 | GO:0036064 | ciliary basal body(GO:0036064) |
0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.4 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.0 | 0.1 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.2 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 0.2 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.0 | 0.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.2 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.0 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.1 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
0.0 | 0.0 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.0 | GO:0031088 | platelet dense granule membrane(GO:0031088) platelet dense granule(GO:0042827) |
0.0 | 0.0 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.0 | 0.2 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.1 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.3 | GO:0098878 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.0 | 0.2 | GO:1904949 | ATPase complex(GO:1904949) |
0.0 | 0.0 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.2 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.2 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 0.4 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.1 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.0 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.1 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.0 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.0 | 0.0 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.0 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.0 | GO:0098536 | deuterosome(GO:0098536) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.3 | 0.8 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.2 | 0.9 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.2 | 1.0 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.2 | 0.5 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.2 | 0.3 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.2 | 0.5 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.2 | 0.8 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.1 | 0.7 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.1 | 0.9 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 0.4 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.1 | 0.3 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 2.2 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.1 | 0.8 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.1 | 0.6 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.1 | 0.7 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.1 | 0.5 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.1 | 0.2 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.1 | 0.2 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.1 | 0.7 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.1 | 0.4 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.1 | 0.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 0.7 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.1 | 0.2 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.1 | 0.2 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.1 | 0.4 | GO:0002054 | nucleobase binding(GO:0002054) |
0.1 | 1.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.2 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.2 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 0.3 | GO:0048495 | Roundabout binding(GO:0048495) |
0.1 | 0.9 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.1 | 0.6 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.8 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 0.6 | GO:0019841 | retinol binding(GO:0019841) |
0.1 | 0.2 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.0 | 0.2 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.9 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
0.0 | 0.1 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.0 | 0.1 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.4 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.0 | 0.2 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 1.7 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.0 | 0.7 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.0 | 0.3 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.5 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.1 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.0 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.0 | 0.2 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.2 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.0 | 0.6 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.0 | 0.3 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.5 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.7 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.0 | 0.5 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.0 | 0.4 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.0 | 0.4 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.3 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.4 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.1 | GO:0032551 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.0 | 0.4 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.1 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.0 | 0.5 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.1 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 0.0 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.0 | 0.1 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.0 | 0.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.5 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.1 | GO:0000295 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.0 | 0.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.2 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.3 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.2 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.0 | 0.4 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.4 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 0.1 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.0 | 0.3 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.2 | GO:0050544 | arachidonic acid binding(GO:0050544) |
0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.1 | GO:0004064 | arylesterase activity(GO:0004064) |
0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.0 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.2 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.0 | GO:0030911 | TPR domain binding(GO:0030911) |
0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.1 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.0 | 0.2 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.0 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.0 | 0.1 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.3 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.1 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.0 | 0.2 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.2 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.0 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.0 | 0.7 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.0 | 0.2 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) |
0.0 | 0.0 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.0 | 0.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.0 | 0.1 | GO:0035671 | enone reductase activity(GO:0035671) |
0.0 | 0.2 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.1 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.0 | 0.1 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.4 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.0 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.0 | 0.0 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 1.1 | GO:0008081 | phosphoric diester hydrolase activity(GO:0008081) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.2 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.1 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.6 | GO:0019186 | dihydrolipoamide branched chain acyltransferase activity(GO:0004147) palmitoleoyl [acyl-carrier-protein]-dependent acyltransferase activity(GO:0008951) serine O-acyltransferase activity(GO:0016412) O-succinyltransferase activity(GO:0016750) sinapoyltransferase activity(GO:0016752) O-sinapoyltransferase activity(GO:0016753) peptidyl-lysine N6-myristoyltransferase activity(GO:0018030) peptidyl-lysine N6-palmitoyltransferase activity(GO:0018031) benzoyl acetate-CoA thiolase activity(GO:0018711) 3-hydroxybutyryl-CoA thiolase activity(GO:0018712) 3-ketopimelyl-CoA thiolase activity(GO:0018713) N-palmitoyltransferase activity(GO:0019105) acyl-CoA N-acyltransferase activity(GO:0019186) protein-cysteine S-myristoyltransferase activity(GO:0019705) glucosaminyl-phosphotidylinositol O-acyltransferase activity(GO:0032216) ergosterol O-acyltransferase activity(GO:0034737) lanosterol O-acyltransferase activity(GO:0034738) naphthyl-2-oxomethyl-succinyl-CoA succinyl transferase activity(GO:0034848) 2,4,4-trimethyl-3-oxopentanoyl-CoA 2-C-propanoyl transferase activity(GO:0034851) 2-methylhexanoyl-CoA C-acetyltransferase activity(GO:0034915) butyryl-CoA 2-C-propionyltransferase activity(GO:0034919) 2,6-dimethyl-5-methylene-3-oxo-heptanoyl-CoA C-acetyltransferase activity(GO:0034945) L-2-aminoadipate N-acetyltransferase activity(GO:0043741) keto acid formate lyase activity(GO:0043806) azetidine-2-carboxylic acid acetyltransferase activity(GO:0046941) peptidyl-lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0052858) acetyl-CoA:L-lysine N6-acetyltransferase(GO:0090595) |
0.0 | 0.5 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 1.6 | GO:0070035 | ATP-dependent helicase activity(GO:0008026) purine NTP-dependent helicase activity(GO:0070035) |
0.0 | 0.2 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.2 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.0 | 0.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.0 | 0.3 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.0 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.1 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.0 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.2 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.0 | 0.0 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.0 | 0.0 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.1 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.0 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.1 | GO:0051378 | serotonin binding(GO:0051378) |
0.0 | 0.6 | GO:0030295 | protein kinase activator activity(GO:0030295) |
0.0 | 0.4 | GO:0019239 | deaminase activity(GO:0019239) |
0.0 | 0.0 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.0 | 0.1 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.1 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.0 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.0 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.3 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.0 | 0.1 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.0 | 0.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.0 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.0 | 0.2 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.0 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.0 | 0.1 | GO:0070990 | snRNP binding(GO:0070990) |
0.0 | 0.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.0 | 0.1 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.0 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 0.0 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.0 | 0.1 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.0 | 0.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.0 | 0.0 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.0 | 0.1 | GO:0030547 | receptor inhibitor activity(GO:0030547) |
0.0 | 0.3 | GO:0019707 | protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.1 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.1 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.6 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
0.0 | 0.1 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.1 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.2 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.4 | GO:0005109 | frizzled binding(GO:0005109) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.1 | 0.4 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 1.2 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 1.2 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.1 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 1.0 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 1.0 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.5 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.3 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.3 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.4 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.1 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.6 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.4 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.0 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 0.3 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.2 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.0 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.0 | 0.3 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.3 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.2 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.0 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 0.7 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 2.5 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.1 | 0.6 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.1 | 1.5 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 0.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 0.6 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 0.5 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 0.6 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 1.6 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 1.2 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.0 | 1.3 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.3 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.9 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.0 | 0.4 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.0 | 0.7 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.0 | 1.0 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.7 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.5 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 1.1 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.2 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.7 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.5 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.2 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.3 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
0.0 | 0.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.5 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.2 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 0.2 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.1 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.4 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.3 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.1 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 0.3 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.0 | 0.2 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.0 | 0.4 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.1 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.0 | 0.2 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.0 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 0.5 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.1 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.0 | 0.4 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.0 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
0.0 | 0.1 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.1 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 0.0 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.0 | 0.1 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.0 | 0.0 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.0 | 0.1 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.0 | 0.1 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |