Gene Symbol | Gene ID | Gene Info |
---|---|---|
Hmx2
|
ENSMUSG00000050100.7 | H6 homeobox 2 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Hmx2 | chr7_131554331_131554482 | 345 | 0.827262 | 0.06 | 6.4e-01 | Click! |
Hmx2 | chr7_131553923_131554191 | 4 | 0.967049 | 0.06 | 6.5e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr18_45123336_45123706 | 7.92 |
Gm4839 |
predicted gene 4839 |
23605 |
0.15 |
chr2_179535243_179535569 | 5.96 |
Gm14300 |
predicted gene 14300 |
78161 |
0.1 |
chr1_42691969_42692512 | 5.87 |
Pantr1 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 1 |
853 |
0.48 |
chr2_14535423_14535658 | 5.82 |
Gm13266 |
predicted gene 13266 |
22941 |
0.16 |
chr6_138419995_138420190 | 5.79 |
Lmo3 |
LIM domain only 3 |
1360 |
0.42 |
chrX_58445733_58445903 | 5.69 |
Gm14645 |
predicted gene 14645 |
17743 |
0.26 |
chr13_84565715_84565948 | 5.68 |
Gm26913 |
predicted gene, 26913 |
125110 |
0.06 |
chr4_120170416_120170874 | 5.62 |
Edn2 |
endothelin 2 |
9439 |
0.24 |
chr14_99734308_99734471 | 5.48 |
Gm22970 |
predicted gene, 22970 |
39419 |
0.16 |
chr6_8956056_8956243 | 5.36 |
Nxph1 |
neurexophilin 1 |
6473 |
0.33 |
chr9_108824703_108825009 | 5.28 |
Gm35025 |
predicted gene, 35025 |
5 |
0.87 |
chr4_32189105_32189411 | 5.17 |
Gm11929 |
predicted gene 11929 |
17890 |
0.19 |
chr10_17203245_17203406 | 5.00 |
Gm25382 |
predicted gene, 25382 |
86521 |
0.09 |
chr15_79695574_79695970 | 4.99 |
Gtpbp1 |
GTP binding protein 1 |
1592 |
0.19 |
chr3_79146093_79146259 | 4.96 |
Rapgef2 |
Rap guanine nucleotide exchange factor (GEF) 2 |
301 |
0.92 |
chr16_89530496_89531006 | 4.94 |
Krtap7-1 |
keratin associated protein 7-1 |
22428 |
0.15 |
chr1_66395305_66395711 | 4.91 |
Map2 |
microtubule-associated protein 2 |
8497 |
0.21 |
chr5_78622542_78622942 | 4.85 |
Gm43232 |
predicted gene 43232 |
82214 |
0.11 |
chr1_78167977_78168321 | 4.81 |
Pax3 |
paired box 3 |
28689 |
0.2 |
chr4_148291962_148292123 | 4.78 |
Disp3 |
dispatched RND transporter family member 3 |
4077 |
0.19 |
chr8_9228096_9228438 | 4.77 |
Gm44542 |
predicted gene 44542 |
10857 |
0.2 |
chr4_105180814_105180965 | 4.72 |
Plpp3 |
phospholipid phosphatase 3 |
23542 |
0.24 |
chr19_14436131_14436458 | 4.70 |
Tle4 |
transducin-like enhancer of split 4 |
159245 |
0.04 |
chr2_51087621_51088075 | 4.59 |
Rnd3 |
Rho family GTPase 3 |
61246 |
0.13 |
chr6_6881841_6882211 | 4.58 |
Dlx5 |
distal-less homeobox 5 |
42 |
0.96 |
chr1_89739598_89739966 | 4.45 |
Agap1 |
ArfGAP with GTPase domain, ankyrin repeat and PH domain 1 |
49381 |
0.14 |
chr6_107711195_107711474 | 4.36 |
4933431M02Rik |
RIKEN cDNA 4933431M02 gene |
83560 |
0.1 |
chr10_110835477_110835754 | 4.31 |
Gm23698 |
predicted gene, 23698 |
39442 |
0.12 |
chr9_61550073_61550272 | 4.30 |
Gm34424 |
predicted gene, 34424 |
16757 |
0.23 |
chr11_40456488_40456834 | 4.23 |
3110004A20Rik |
RIKEN cDNA 3110004A20 gene |
19016 |
0.17 |
chr14_12393556_12393971 | 4.20 |
Gm48267 |
predicted gene, 48267 |
8467 |
0.14 |
chr14_123626303_123627238 | 4.19 |
Nalcn |
sodium leak channel, non-selective |
106 |
0.98 |
chr7_63445460_63445631 | 4.17 |
Otud7a |
OTU domain containing 7A |
768 |
0.51 |
chr14_77584549_77584776 | 4.07 |
Enox1 |
ecto-NOX disulfide-thiol exchanger 1 |
11806 |
0.19 |
chr9_99994460_99994673 | 4.07 |
4930519F24Rik |
RIKEN cDNA 4930519F24 gene |
27734 |
0.17 |
chr8_36014873_36015024 | 4.07 |
Rps12-ps24 |
ribosomal protein S12, pseudogene 24 |
10805 |
0.2 |
chr12_36666799_36666950 | 4.04 |
Gm7252 |
predicted gene 7252 |
127517 |
0.05 |
chr9_75610973_75611679 | 4.04 |
Tmod2 |
tropomodulin 2 |
1 |
0.97 |
chr12_56004549_56004776 | 4.00 |
Gm5183 |
predicted gene 5183 |
45871 |
0.13 |
chr9_83686142_83686307 | 3.98 |
Gm36120 |
predicted gene, 36120 |
1301 |
0.46 |
chr15_74194149_74194481 | 3.97 |
Gm15387 |
predicted gene 15387 |
99982 |
0.07 |
chr6_23382349_23382500 | 3.91 |
Cadps2 |
Ca2+-dependent activator protein for secretion 2 |
26505 |
0.22 |
chr9_37455994_37456160 | 3.90 |
Gm47945 |
predicted gene, 47945 |
22566 |
0.1 |
chr16_77291582_77292053 | 3.90 |
Gm31258 |
predicted gene, 31258 |
13743 |
0.19 |
chr1_166948095_166948312 | 3.90 |
Gm6286 |
predicted gene 6286 |
1845 |
0.39 |
chr3_80802510_80803270 | 3.88 |
Gria2 |
glutamate receptor, ionotropic, AMPA2 (alpha 2) |
55 |
0.98 |
chr13_71507941_71508418 | 3.88 |
1700112M02Rik |
RIKEN cDNA 1700112M02 gene |
20572 |
0.26 |
chr9_58439214_58439365 | 3.85 |
4930461G14Rik |
RIKEN cDNA 4930461G14 gene |
15833 |
0.17 |
chr8_48224421_48225088 | 3.83 |
Gm32842 |
predicted gene, 32842 |
46231 |
0.16 |
chr2_49620647_49620914 | 3.81 |
Kif5c |
kinesin family member 5C |
1482 |
0.5 |
chr1_128758816_128759186 | 3.81 |
Gm29599 |
predicted gene 29599 |
8075 |
0.23 |
chr8_86324726_86324877 | 3.79 |
Gm24490 |
predicted gene, 24490 |
32300 |
0.21 |
chr7_83074528_83074679 | 3.77 |
A530021J07Rik |
Riken cDNA A530021J07 gene |
9778 |
0.23 |
chr18_27530739_27530946 | 3.77 |
Gm7729 |
predicted gene 7729 |
67802 |
0.14 |
chr7_54634148_54634330 | 3.76 |
Gm6290 |
predicted gene 6290 |
23041 |
0.27 |
chr12_25272512_25272663 | 3.73 |
Gm19340 |
predicted gene, 19340 |
10008 |
0.19 |
chr12_29871996_29872873 | 3.73 |
Myt1l |
myelin transcription factor 1-like |
20886 |
0.24 |
chr5_73951353_73951504 | 3.72 |
C78283 |
expressed sequence C78283 |
5047 |
0.2 |
chr3_83486483_83486639 | 3.71 |
Gm38096 |
predicted gene, 38096 |
83159 |
0.09 |
chr2_101592129_101592615 | 3.68 |
B230118H07Rik |
RIKEN cDNA B230118H07 gene |
7438 |
0.19 |
chr4_111356711_111356862 | 3.67 |
Gm12805 |
predicted gene 12805 |
36181 |
0.17 |
chr4_96969208_96969597 | 3.66 |
Gm27521 |
predicted gene, 27521 |
52382 |
0.15 |
chr14_28165013_28165230 | 3.65 |
Erc2 |
ELKS/RAB6-interacting/CAST family member 2 |
118693 |
0.06 |
chr12_79716053_79716204 | 3.63 |
9430078K24Rik |
RIKEN cDNA 9430078K24 gene |
208605 |
0.02 |
chr1_113395375_113395547 | 3.62 |
Gm28189 |
predicted gene 28189 |
106121 |
0.08 |
chr18_30736874_30737155 | 3.59 |
Gm41780 |
predicted gene, 41780 |
128124 |
0.06 |
chr4_72382561_72382773 | 3.58 |
Gm11235 |
predicted gene 11235 |
159999 |
0.04 |
chr19_59394106_59394400 | 3.58 |
Gm33756 |
predicted gene, 33756 |
4469 |
0.19 |
chr11_84376197_84376348 | 3.58 |
Aatf |
apoptosis antagonizing transcription factor |
73261 |
0.1 |
chr15_92839805_92839967 | 3.53 |
Gm49418 |
predicted gene, 49418 |
94003 |
0.07 |
chr4_110050502_110051534 | 3.53 |
Dmrta2 |
doublesex and mab-3 related transcription factor like family A2 |
72965 |
0.11 |
chr5_72698455_72698759 | 3.51 |
Gm43717 |
predicted gene 43717 |
27455 |
0.11 |
chr16_28919525_28919676 | 3.50 |
Mb21d2 |
Mab-21 domain containing 2 |
10073 |
0.26 |
chr15_84812869_84813054 | 3.49 |
Phf21b |
PHD finger protein 21B |
9404 |
0.18 |
chr13_16705709_16706238 | 3.48 |
Gm7537 |
predicted gene 7537 |
66483 |
0.13 |
chr4_39345356_39345507 | 3.48 |
Gm23607 |
predicted gene, 23607 |
49968 |
0.14 |
chr5_111944379_111944557 | 3.45 |
Gm42488 |
predicted gene 42488 |
233 |
0.96 |
chr8_61325062_61325301 | 3.45 |
1700001D01Rik |
RIKEN cDNA 1700001D01 gene |
36309 |
0.13 |
chr10_102616369_102616520 | 3.45 |
Gm47143 |
predicted gene, 47143 |
66821 |
0.1 |
chr10_91514578_91514763 | 3.44 |
Gm47084 |
predicted gene, 47084 |
66290 |
0.12 |
chr14_105588106_105589163 | 3.42 |
9330188P03Rik |
RIKEN cDNA 9330188P03 gene |
842 |
0.61 |
chr11_6603325_6604219 | 3.42 |
Nacad |
NAC alpha domain containing |
2281 |
0.14 |
chr13_83721104_83721451 | 3.42 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
104 |
0.95 |
chr12_35008006_35008205 | 3.42 |
Prps1l1 |
phosphoribosyl pyrophosphate synthetase 1-like 1 |
23344 |
0.17 |
chr9_41611977_41612128 | 3.41 |
Gm48737 |
predicted gene, 48737 |
6940 |
0.12 |
chr2_117439884_117440216 | 3.41 |
Gm13982 |
predicted gene 13982 |
22353 |
0.24 |
chr10_38103605_38103756 | 3.41 |
Gm31378 |
predicted gene, 31378 |
18381 |
0.22 |
chr17_49672194_49672362 | 3.39 |
Kif6 |
kinesin family member 6 |
41832 |
0.18 |
chr12_70367898_70368110 | 3.39 |
Trim9 |
tripartite motif-containing 9 |
20390 |
0.17 |
chr1_48460029_48460180 | 3.38 |
Gm23240 |
predicted gene, 23240 |
2189 |
0.43 |
chr9_42327140_42327291 | 3.38 |
Gm26272 |
predicted gene, 26272 |
9534 |
0.16 |
chr2_82847422_82847589 | 3.37 |
Fsip2 |
fibrous sheath-interacting protein 2 |
96129 |
0.09 |
chr4_73163256_73163465 | 3.36 |
Gm25769 |
predicted gene, 25769 |
48703 |
0.17 |
chr15_26021931_26022113 | 3.35 |
Zfp622 |
zinc finger protein 622 |
26986 |
0.18 |
chr1_168383801_168384185 | 3.35 |
Gm38381 |
predicted gene, 38381 |
33185 |
0.17 |
chr16_24509582_24509735 | 3.35 |
Morf4l1-ps1 |
mortality factor 4 like 1, pseudogene 1 |
19736 |
0.22 |
chr1_98047731_98048151 | 3.35 |
B230216N24Rik |
RIKEN cDNA B230216N24 gene |
148 |
0.94 |
chr8_62356311_62356462 | 3.34 |
Hspd1-ps2 |
heat shock protein 1 (chaperonin), pseudogene 2 |
132102 |
0.05 |
chr6_127701185_127701975 | 3.34 |
Gm43634 |
predicted gene 43634 |
57140 |
0.08 |
chr3_49842289_49842440 | 3.33 |
Gm37550 |
predicted gene, 37550 |
61477 |
0.12 |
chr10_69465967_69466180 | 3.32 |
Gm18636 |
predicted gene, 18636 |
42325 |
0.15 |
chr10_34316564_34316763 | 3.32 |
Nt5dc1 |
5'-nucleotidase domain containing 1 |
2980 |
0.17 |
chr7_51772714_51772887 | 3.32 |
Gm29296 |
predicted gene 29296 |
74 |
0.97 |
chr14_75473590_75473918 | 3.29 |
Siah3 |
siah E3 ubiquitin protein ligase family member 3 |
17772 |
0.22 |
chr4_23913542_23913728 | 3.27 |
Gm28448 |
predicted gene 28448 |
20319 |
0.29 |
chr10_96955553_96955748 | 3.26 |
Gm33981 |
predicted gene, 33981 |
3221 |
0.31 |
chr1_155605487_155606141 | 3.26 |
Acbd6 |
acyl-Coenzyme A binding domain containing 6 |
38566 |
0.17 |
chr5_4811967_4812118 | 3.25 |
Gm44483 |
predicted gene, 44483 |
9585 |
0.12 |
chr9_90693727_90693878 | 3.24 |
Gm2497 |
predicted gene 2497 |
39722 |
0.15 |
chr8_74871793_74871960 | 3.24 |
Isx |
intestine specific homeobox |
1297 |
0.52 |
chr3_62917028_62917179 | 3.22 |
Gm9701 |
predicted gene 9701 |
7130 |
0.32 |
chr11_32063745_32064107 | 3.22 |
Gm12108 |
predicted gene 12108 |
37302 |
0.15 |
chr8_8907911_8908062 | 3.20 |
Gm44515 |
predicted gene 44515 |
24713 |
0.21 |
chr2_63963076_63963322 | 3.20 |
Fign |
fidgetin |
134789 |
0.06 |
chr2_125209362_125209539 | 3.19 |
Gm14002 |
predicted gene 14002 |
8062 |
0.17 |
chr1_73830788_73831006 | 3.18 |
Gm29183 |
predicted gene 29183 |
11020 |
0.18 |
chr18_8027073_8027284 | 3.17 |
Gm4833 |
predicted gene 4833 |
24025 |
0.22 |
chr2_34106829_34107151 | 3.17 |
C230014O12Rik |
RIKEN cDNA C230014O12 gene |
739 |
0.69 |
chr6_28370077_28370232 | 3.16 |
Gm5303 |
predicted gene 5303 |
6989 |
0.16 |
chr2_109579120_109579313 | 3.15 |
Gm20638 |
predicted gene 20638 |
93950 |
0.07 |
chr3_80871615_80871766 | 3.14 |
Glrb |
glycine receptor, beta subunit |
14435 |
0.23 |
chr15_39828831_39829007 | 3.13 |
Dpys |
dihydropyrimidinase |
28548 |
0.17 |
chr2_37842457_37842652 | 3.13 |
Dennd1a |
DENN/MADD domain containing 1A |
9886 |
0.23 |
chr13_39571276_39571508 | 3.12 |
Gm47352 |
predicted gene, 47352 |
191 |
0.95 |
chr11_82473377_82473528 | 3.12 |
Tmem132e |
transmembrane protein 132E |
35195 |
0.17 |
chr16_63278367_63278696 | 3.11 |
Gm33912 |
predicted gene, 33912 |
61089 |
0.15 |
chr4_84137641_84137833 | 3.11 |
Gm12414 |
predicted gene 12414 |
7448 |
0.25 |
chr13_91940258_91940409 | 3.10 |
Rasgrf2 |
RAS protein-specific guanine nucleotide-releasing factor 2 |
47656 |
0.14 |
chr1_18758436_18758855 | 3.09 |
Gm5252 |
predicted gene 5252 |
50217 |
0.18 |
chr17_62821251_62821523 | 3.09 |
Efna5 |
ephrin A5 |
59757 |
0.16 |
chr14_75473074_75473492 | 3.09 |
Siah3 |
siah E3 ubiquitin protein ligase family member 3 |
17301 |
0.22 |
chr13_103806232_103806601 | 3.09 |
Srek1 |
splicing regulatory glutamine/lysine-rich protein 1 |
31808 |
0.2 |
chr2_63962810_63962988 | 3.09 |
Fign |
fidgetin |
135089 |
0.06 |
chr12_13314517_13314668 | 3.07 |
Nbas |
neuroblastoma amplified sequence |
13753 |
0.21 |
chr18_20734398_20734549 | 3.07 |
B4galt6 |
UDP-Gal:betaGlcNAc beta 1,4-galactosyltransferase, polypeptide 6 |
11931 |
0.19 |
chr10_18360177_18360562 | 3.07 |
Gm18942 |
predicted gene, 18942 |
23128 |
0.17 |
chr5_40295141_40295321 | 3.05 |
Gm2810 |
predicted pseudogene 2810 |
33207 |
0.24 |
chr4_72384628_72385513 | 3.05 |
Gm11235 |
predicted gene 11235 |
157596 |
0.04 |
chr14_59737148_59737645 | 3.05 |
Gm19716 |
predicted gene, 19716 |
94848 |
0.07 |
chr16_51521718_51522044 | 3.05 |
Gm49608 |
predicted gene, 49608 |
104933 |
0.08 |
chr4_48335165_48335701 | 3.04 |
Gm12435 |
predicted gene 12435 |
9797 |
0.22 |
chr1_164460892_164461591 | 3.02 |
Gm32391 |
predicted gene, 32391 |
1201 |
0.38 |
chr13_53196415_53196566 | 3.02 |
Ror2 |
receptor tyrosine kinase-like orphan receptor 2 |
79168 |
0.1 |
chr7_95688777_95689120 | 3.02 |
Gm44603 |
predicted gene 44603 |
214002 |
0.02 |
chr13_114992268_114992650 | 3.01 |
Gm47776 |
predicted gene, 47776 |
57391 |
0.11 |
chr3_8864487_8864638 | 3.01 |
Gm15467 |
predicted gene 15467 |
16637 |
0.17 |
chr5_16004397_16004581 | 3.00 |
Gm43000 |
predicted gene 43000 |
6650 |
0.21 |
chr4_104269504_104269672 | 3.00 |
Dab1 |
disabled 1 |
97525 |
0.09 |
chr2_142335075_142335526 | 3.00 |
Macrod2 |
mono-ADP ribosylhydrolase 2 |
158693 |
0.04 |
chr14_93039972_93040145 | 2.99 |
Gm23509 |
predicted gene, 23509 |
98131 |
0.08 |
chr10_86457747_86457979 | 2.98 |
Syn3 |
synapsin III |
34034 |
0.11 |
chr13_84344679_84345030 | 2.98 |
Gm26927 |
predicted gene, 26927 |
4741 |
0.26 |
chr10_127999073_127999224 | 2.94 |
Hsd17b6 |
hydroxysteroid (17-beta) dehydrogenase 6 |
1530 |
0.21 |
chr3_53590274_53590601 | 2.93 |
Frem2 |
Fras1 related extracellular matrix protein 2 |
46169 |
0.11 |
chr1_156184164_156184505 | 2.93 |
Fam163a |
family with sequence similarity 163, member A |
20692 |
0.16 |
chrX_10449723_10449952 | 2.93 |
4933416E14Rik |
RIKEN cDNA 4933416E14 gene |
32599 |
0.17 |
chr7_64631811_64631970 | 2.92 |
Apba2 |
amyloid beta (A4) precursor protein-binding, family A, member 2 |
3141 |
0.33 |
chr5_60600359_60600536 | 2.92 |
Gm43390 |
predicted gene 43390 |
21817 |
0.23 |
chr9_41974629_41974780 | 2.91 |
Sorl1 |
sortilin-related receptor, LDLR class A repeats-containing |
117 |
0.97 |
chr17_83889634_83890169 | 2.91 |
1810073O08Rik |
RIKEN cDNA 1810073O08 gene |
28036 |
0.12 |
chr2_62807459_62807865 | 2.91 |
Gm13569 |
predicted gene 13569 |
1525 |
0.44 |
chr16_71497335_71497513 | 2.90 |
Gm22797 |
predicted gene, 22797 |
166364 |
0.04 |
chr2_56539846_56540169 | 2.90 |
Mir195b |
microRNA 195b |
245804 |
0.02 |
chr6_108249043_108249409 | 2.90 |
Itpr1 |
inositol 1,4,5-trisphosphate receptor 1 |
3732 |
0.31 |
chr2_45158345_45158770 | 2.90 |
Gm28643 |
predicted gene 28643 |
1632 |
0.43 |
chr10_79873290_79873672 | 2.90 |
Plppr3 |
phospholipid phosphatase related 3 |
743 |
0.28 |
chr12_102511368_102511747 | 2.89 |
Golga5 |
golgi autoantigen, golgin subfamily a, 5 |
27100 |
0.14 |
chr13_96132470_96133258 | 2.89 |
Sv2c |
synaptic vesicle glycoprotein 2c |
287 |
0.67 |
chr5_21732624_21732820 | 2.88 |
Pmpcb |
peptidase (mitochondrial processing) beta |
4419 |
0.15 |
chr14_35244974_35245125 | 2.88 |
Gm49034 |
predicted gene, 49034 |
25611 |
0.26 |
chr14_60405864_60406015 | 2.88 |
Amer2 |
APC membrane recruitment 2 |
27653 |
0.17 |
chr4_77316738_77316956 | 2.88 |
Gm23159 |
predicted gene, 23159 |
358349 |
0.01 |
chr3_47668909_47669138 | 2.88 |
Gm2229 |
predicted gene 2229 |
208685 |
0.03 |
chr16_62469382_62469533 | 2.87 |
CT010569.1 |
NADH dehydrogenase 5, mitochondrial (mt-Nd5) pseudogene |
14492 |
0.27 |
chr12_33102326_33102516 | 2.87 |
Gm16267 |
predicted gene 16267 |
9541 |
0.15 |
chr4_35125928_35126141 | 2.86 |
Ifnk |
interferon kappa |
26022 |
0.16 |
chr3_156559909_156560264 | 2.84 |
4930570G19Rik |
RIKEN cDNA 4930570G19 gene |
1496 |
0.36 |
chr13_107247476_107247653 | 2.83 |
Gm2726 |
predicted gene 2726 |
32627 |
0.2 |
chr14_12338097_12338549 | 2.83 |
Gm24578 |
predicted gene, 24578 |
4419 |
0.14 |
chr12_112541437_112541606 | 2.83 |
Tmem179 |
transmembrane protein 179 |
24774 |
0.13 |
chr3_118664419_118664570 | 2.83 |
Dpyd |
dihydropyrimidine dehydrogenase |
102308 |
0.07 |
chr4_22301242_22301470 | 2.83 |
Gm11882 |
predicted gene 11882 |
25523 |
0.2 |
chr10_17202862_17203093 | 2.83 |
Gm25382 |
predicted gene, 25382 |
86173 |
0.09 |
chr5_97409440_97409591 | 2.82 |
4930467D21Rik |
RIKEN cDNA 4930467D21 gene |
17068 |
0.18 |
chr2_62807870_62808021 | 2.81 |
Gm13569 |
predicted gene 13569 |
1242 |
0.51 |
chr13_55912241_55912444 | 2.81 |
Pitx1 |
paired-like homeodomain transcription factor 1 |
76150 |
0.07 |
chr7_52702568_52702719 | 2.80 |
Gm6181 |
predicted pseudogene 6181 |
52822 |
0.18 |
chr7_118402696_118403002 | 2.80 |
Gm32766 |
predicted gene, 32766 |
33132 |
0.13 |
chr15_71809979_71810163 | 2.80 |
Gm16308 |
predicted gene 16308 |
37 |
0.97 |
chr5_35918677_35918991 | 2.80 |
H2af-ps |
H2A histone family, pseudogene |
937 |
0.6 |
chr2_116201553_116201759 | 2.79 |
2810405F15Rik |
RIKEN cDNA 2810405F15 gene |
125560 |
0.05 |
chr16_43800088_43800449 | 2.79 |
Gm25996 |
predicted gene, 25996 |
2851 |
0.23 |
chr2_57907161_57907331 | 2.78 |
Gm33594 |
predicted gene, 33594 |
78771 |
0.1 |
chr14_12716331_12716619 | 2.78 |
Gm48266 |
predicted gene, 48266 |
54075 |
0.13 |
chr5_4651240_4651409 | 2.78 |
Fzd1 |
frizzled class receptor 1 |
106711 |
0.06 |
chr3_34411611_34411783 | 2.77 |
Gm34599 |
predicted gene, 34599 |
4798 |
0.21 |
chr5_116208601_116208793 | 2.77 |
Gm14507 |
predicted gene 14507 |
35009 |
0.12 |
chr10_69706157_69706324 | 2.77 |
Ank3 |
ankyrin 3, epithelial |
56 |
0.99 |
chr8_54836687_54836851 | 2.76 |
n-R5s98 |
nuclear encoded rRNA 5S 98 |
29492 |
0.18 |
chr1_74103754_74104304 | 2.76 |
Tns1 |
tensin 1 |
5353 |
0.18 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.2 | 6.7 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
2.0 | 5.9 | GO:0060166 | olfactory pit development(GO:0060166) |
1.3 | 3.8 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
1.0 | 3.0 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.8 | 3.1 | GO:0060437 | lung growth(GO:0060437) |
0.8 | 2.3 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.7 | 2.1 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.7 | 6.0 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
0.7 | 2.0 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.6 | 1.8 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.6 | 3.5 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.6 | 1.7 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.5 | 2.2 | GO:0030091 | protein repair(GO:0030091) |
0.5 | 1.6 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.5 | 1.6 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
0.5 | 2.6 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.5 | 1.6 | GO:0060594 | mammary gland specification(GO:0060594) |
0.5 | 2.0 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.5 | 1.9 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.5 | 1.4 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.5 | 1.4 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.4 | 0.9 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.4 | 1.8 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.4 | 2.1 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.4 | 1.3 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.4 | 0.8 | GO:2000437 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
0.4 | 2.5 | GO:1902913 | positive regulation of neuroepithelial cell differentiation(GO:1902913) |
0.4 | 1.2 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.4 | 3.3 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.4 | 1.2 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.4 | 1.6 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.4 | 1.2 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.4 | 2.4 | GO:0097264 | self proteolysis(GO:0097264) |
0.4 | 1.6 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.4 | 1.6 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.4 | 1.6 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.4 | 1.2 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.4 | 1.5 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.4 | 1.1 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.4 | 1.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.4 | 0.4 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.4 | 5.0 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.4 | 0.7 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
0.3 | 1.3 | GO:0007412 | axon target recognition(GO:0007412) |
0.3 | 1.0 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.3 | 1.0 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.3 | 1.6 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.3 | 1.3 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.3 | 3.2 | GO:0071625 | vocalization behavior(GO:0071625) |
0.3 | 1.0 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.3 | 1.6 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
0.3 | 1.6 | GO:0034182 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
0.3 | 0.9 | GO:0015889 | cobalamin transport(GO:0015889) |
0.3 | 0.9 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.3 | 0.9 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
0.3 | 1.2 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.3 | 2.1 | GO:0060013 | righting reflex(GO:0060013) |
0.3 | 0.6 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.3 | 0.9 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.3 | 0.9 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.3 | 0.6 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.3 | 1.1 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.3 | 1.4 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.3 | 2.3 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.3 | 0.8 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.3 | 1.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.3 | 0.5 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
0.3 | 0.8 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.3 | 0.8 | GO:0030070 | insulin processing(GO:0030070) |
0.3 | 0.8 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.3 | 0.8 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.3 | 0.8 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.3 | 0.8 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.3 | 1.0 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.3 | 1.8 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.3 | 0.8 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.2 | 0.7 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.2 | 0.2 | GO:0086043 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.2 | 0.2 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
0.2 | 0.7 | GO:0071699 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.2 | 1.0 | GO:0072104 | glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
0.2 | 1.7 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.2 | 1.4 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.2 | 0.7 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.2 | 0.9 | GO:0030035 | microspike assembly(GO:0030035) |
0.2 | 0.7 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.2 | 1.6 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.2 | 0.9 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
0.2 | 0.4 | GO:0072106 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
0.2 | 0.7 | GO:2001201 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.2 | 0.2 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
0.2 | 1.3 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.2 | 0.6 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.2 | 0.9 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.2 | 0.4 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
0.2 | 0.8 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.2 | 0.6 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.2 | 1.0 | GO:0014028 | notochord formation(GO:0014028) |
0.2 | 0.6 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.2 | 0.8 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.2 | 0.6 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.2 | 0.8 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.2 | 0.6 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.2 | 0.6 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.2 | 1.0 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.2 | 0.4 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.2 | 0.8 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.2 | 0.6 | GO:0090135 | actin filament branching(GO:0090135) |
0.2 | 0.2 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.2 | 0.6 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.2 | 0.6 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.2 | 0.5 | GO:0051665 | membrane raft localization(GO:0051665) |
0.2 | 0.4 | GO:0098598 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.2 | 0.4 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.2 | 0.4 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
0.2 | 0.7 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.2 | 0.5 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.2 | 0.9 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
0.2 | 0.5 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
0.2 | 0.5 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.2 | 0.3 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.2 | 0.3 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
0.2 | 2.7 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.2 | 2.2 | GO:0061339 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
0.2 | 0.5 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.2 | 0.8 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.2 | 0.5 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.2 | 1.5 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
0.2 | 0.5 | GO:0003289 | septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
0.2 | 2.3 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.2 | 0.6 | GO:0030432 | peristalsis(GO:0030432) |
0.2 | 0.3 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
0.2 | 0.6 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.2 | 0.5 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.2 | 1.1 | GO:0007207 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.2 | 0.6 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.2 | 0.6 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.2 | 0.5 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.2 | 0.5 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.2 | 0.5 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.2 | 0.8 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
0.2 | 0.8 | GO:0015808 | L-alanine transport(GO:0015808) |
0.2 | 0.5 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.2 | 4.4 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
0.2 | 0.6 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.1 | 0.7 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.6 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 0.6 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.1 | 2.5 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.1 | 0.3 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.1 | 0.6 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.1 | 0.6 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.6 | GO:0001997 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
0.1 | 0.4 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.1 | 0.4 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.1 | 0.7 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.1 | 0.4 | GO:0048505 | regulation of timing of cell differentiation(GO:0048505) |
0.1 | 0.3 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.1 | 0.3 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.1 | 2.7 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.1 | 0.3 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.1 | 0.4 | GO:1901656 | glycoside transport(GO:1901656) |
0.1 | 0.3 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.1 | 0.5 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.1 | 0.4 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.1 | 0.7 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.1 | 0.4 | GO:0050705 | regulation of interleukin-1 alpha secretion(GO:0050705) |
0.1 | 0.3 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.1 | 0.5 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.1 | 0.4 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.1 | 0.4 | GO:0009139 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
0.1 | 0.5 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 0.4 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.1 | 1.7 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
0.1 | 0.2 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.1 | 0.6 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.1 | 0.4 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.1 | 0.4 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.4 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
0.1 | 0.7 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.1 | 0.4 | GO:0021778 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.1 | 0.7 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.1 | 0.9 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.1 | 0.5 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
0.1 | 0.5 | GO:1902669 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
0.1 | 0.3 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.1 | 0.8 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.1 | 0.3 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.1 | 0.3 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.1 | 0.3 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.1 | 0.3 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.1 | 0.1 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.1 | 0.7 | GO:1900044 | regulation of protein K63-linked ubiquitination(GO:1900044) |
0.1 | 0.3 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
0.1 | 0.2 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.1 | 0.6 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.1 | 0.1 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.1 | 0.3 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.1 | 0.8 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.1 | 0.4 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.1 | 1.3 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.1 | 0.3 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.1 | 0.3 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.1 | 0.3 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.1 | 0.2 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.1 | 0.2 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.1 | 0.4 | GO:1900094 | nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
0.1 | 0.5 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.1 | 0.1 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
0.1 | 0.3 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.1 | 0.3 | GO:1904587 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.1 | 0.3 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.1 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.1 | 0.3 | GO:1904180 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
0.1 | 0.3 | GO:2000822 | regulation of fear response(GO:1903365) regulation of behavioral fear response(GO:2000822) |
0.1 | 0.5 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.1 | 0.3 | GO:0048664 | neuron fate determination(GO:0048664) |
0.1 | 1.1 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.8 | GO:1902547 | regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902547) |
0.1 | 0.4 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.1 | 0.1 | GO:0061346 | non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
0.1 | 0.6 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.1 | 0.1 | GO:0032831 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.1 | 0.5 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.1 | 0.2 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.1 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.1 | 0.3 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.1 | 0.3 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.1 | 0.3 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.1 | 0.4 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.1 | 0.3 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.1 | 1.2 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
0.1 | 0.4 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
0.1 | 0.2 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.1 | 0.4 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.1 | 0.4 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
0.1 | 0.1 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.1 | 0.9 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.1 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 0.4 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.1 | 0.6 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.1 | 0.3 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 0.1 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.1 | 0.1 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.1 | 0.2 | GO:1903998 | regulation of eating behavior(GO:1903998) negative regulation of eating behavior(GO:1903999) |
0.1 | 0.2 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.3 | GO:0034239 | macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) |
0.1 | 0.2 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.1 | 0.2 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.1 | 0.2 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.1 | 1.6 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
0.1 | 0.2 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.1 | 0.3 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.1 | 0.6 | GO:1903817 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
0.1 | 1.6 | GO:0048665 | neuron fate specification(GO:0048665) |
0.1 | 0.7 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.1 | 0.4 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.1 | 1.1 | GO:0001964 | startle response(GO:0001964) |
0.1 | 0.3 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
0.1 | 0.6 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.1 | 0.2 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.1 | 0.8 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.1 | 0.5 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.1 | 0.5 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.1 | 0.1 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
0.1 | 0.2 | GO:0071435 | potassium ion export(GO:0071435) |
0.1 | 0.6 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.2 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.1 | 0.1 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.1 | 0.1 | GO:0003211 | cardiac ventricle formation(GO:0003211) |
0.1 | 0.3 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.1 | 0.2 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.1 | 0.2 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.1 | 0.6 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
0.1 | 0.7 | GO:0006568 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
0.1 | 0.3 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.1 | 0.5 | GO:0099500 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.1 | 0.2 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.1 | 0.8 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.1 | 0.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.1 | 0.2 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.1 | 0.3 | GO:1904970 | brush border assembly(GO:1904970) |
0.1 | 0.5 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.1 | 0.3 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.1 | 0.2 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.1 | 0.7 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.1 | 0.1 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.1 | 0.2 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.1 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 0.4 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
0.1 | 0.4 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.1 | 0.3 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.1 | 0.2 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.1 | 0.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.1 | 0.9 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 0.3 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.1 | 0.1 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
0.1 | 0.2 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.1 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.1 | 0.2 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.2 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
0.1 | 0.1 | GO:1904124 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.1 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.3 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.1 | 0.2 | GO:0030242 | pexophagy(GO:0030242) |
0.1 | 0.1 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
0.1 | 0.2 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.1 | 0.3 | GO:0048368 | lateral mesoderm development(GO:0048368) |
0.1 | 1.0 | GO:0019228 | neuronal action potential(GO:0019228) |
0.1 | 0.2 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.1 | 3.6 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.1 | 0.3 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.1 | 0.2 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.1 | 0.2 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 0.1 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
0.1 | 0.4 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.1 | 0.2 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.1 | 0.2 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 0.1 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.1 | 0.1 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.1 | 0.2 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.1 | 1.1 | GO:0021954 | central nervous system neuron development(GO:0021954) |
0.1 | 0.1 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
0.1 | 0.3 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
0.1 | 0.3 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.1 | 0.2 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
0.1 | 0.1 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.1 | 0.1 | GO:0007442 | hindgut morphogenesis(GO:0007442) |
0.0 | 0.1 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.0 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.0 | 0.4 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
0.0 | 0.1 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.0 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.0 | 0.1 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.0 | 0.2 | GO:0072173 | metanephric tubule morphogenesis(GO:0072173) |
0.0 | 0.2 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.0 | 0.1 | GO:0060618 | nipple development(GO:0060618) |
0.0 | 0.5 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.0 | 0.2 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.0 | 0.2 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.0 | 0.0 | GO:0021794 | thalamus development(GO:0021794) |
0.0 | 0.1 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.0 | 0.1 | GO:0046504 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.3 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.0 | 0.0 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.0 | 0.1 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.0 | 0.3 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.6 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.0 | 0.0 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.0 | 0.2 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.0 | 0.1 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.0 | 0.2 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.1 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.0 | 0.0 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.0 | 0.2 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
0.0 | 0.0 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.0 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
0.0 | 0.2 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.0 | 0.0 | GO:0090325 | regulation of locomotion involved in locomotory behavior(GO:0090325) |
0.0 | 0.1 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
0.0 | 1.1 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
0.0 | 0.0 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.0 | 0.4 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.3 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.0 | 0.1 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.1 | GO:0002327 | immature B cell differentiation(GO:0002327) |
0.0 | 0.1 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.0 | 0.3 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
0.0 | 0.1 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.1 | GO:2000543 | positive regulation of gastrulation(GO:2000543) |
0.0 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.0 | 0.0 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.2 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.2 | GO:0002692 | negative regulation of cellular extravasation(GO:0002692) |
0.0 | 0.2 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
0.0 | 0.7 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.3 | GO:0034650 | cortisol metabolic process(GO:0034650) |
0.0 | 0.1 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.2 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.0 | 0.7 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
0.0 | 0.2 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.0 | 0.0 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.0 | 0.2 | GO:0001975 | response to amphetamine(GO:0001975) |
0.0 | 0.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.0 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.0 | 0.1 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.0 | 0.7 | GO:0019226 | transmission of nerve impulse(GO:0019226) |
0.0 | 0.1 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.0 | 0.0 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
0.0 | 0.0 | GO:0048143 | astrocyte activation(GO:0048143) |
0.0 | 0.1 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.0 | 0.4 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.2 | GO:0060353 | regulation of cell adhesion molecule production(GO:0060353) |
0.0 | 0.3 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.0 | 0.1 | GO:0031394 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
0.0 | 0.1 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.0 | 0.1 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.0 | 0.1 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.1 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
0.0 | 0.1 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.0 | 0.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.0 | 0.1 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.2 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.1 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.0 | 0.1 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.0 | 0.3 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.0 | 0.1 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.0 | 0.2 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 0.1 | GO:0070346 | positive regulation of fat cell proliferation(GO:0070346) |
0.0 | 0.1 | GO:0097283 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
0.0 | 0.2 | GO:0051639 | actin filament network formation(GO:0051639) |
0.0 | 0.1 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.0 | GO:0061743 | motor learning(GO:0061743) |
0.0 | 0.1 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.0 | 0.1 | GO:0050942 | positive regulation of pigment cell differentiation(GO:0050942) |
0.0 | 0.1 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.0 | 0.2 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
0.0 | 0.1 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.0 | 0.2 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.1 | GO:2000847 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.0 | 0.2 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.1 | GO:0061308 | cardiac neural crest cell development involved in heart development(GO:0061308) cardiac neural crest cell development involved in outflow tract morphogenesis(GO:0061309) |
0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.1 | GO:0046110 | xanthine metabolic process(GO:0046110) |
0.0 | 0.1 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.0 | 0.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.0 | GO:2001055 | embryonic nail plate morphogenesis(GO:0035880) positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
0.0 | 0.1 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
0.0 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.1 | GO:0021895 | cerebral cortex neuron differentiation(GO:0021895) |
0.0 | 0.0 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.0 | 0.3 | GO:0015858 | nucleoside transport(GO:0015858) |
0.0 | 0.2 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.0 | 0.2 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.0 | GO:0034136 | negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
0.0 | 0.0 | GO:0071639 | positive regulation of monocyte chemotactic protein-1 production(GO:0071639) |
0.0 | 1.2 | GO:1900006 | positive regulation of dendrite development(GO:1900006) |
0.0 | 0.2 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.2 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.0 | 0.1 | GO:0070459 | prolactin secretion(GO:0070459) |
0.0 | 0.1 | GO:0032252 | secretory granule localization(GO:0032252) |
0.0 | 0.1 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.0 | 0.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.0 | 0.1 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
0.0 | 0.2 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
0.0 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.0 | GO:0035799 | ureter maturation(GO:0035799) |
0.0 | 0.1 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.0 | 0.6 | GO:0051489 | regulation of filopodium assembly(GO:0051489) |
0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.1 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.2 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.0 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.2 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.0 | 0.0 | GO:0033084 | regulation of immature T cell proliferation in thymus(GO:0033084) |
0.0 | 0.1 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 0.2 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.0 | 0.0 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.1 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
0.0 | 0.0 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.0 | 0.0 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
0.0 | 0.0 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.0 | 0.0 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.0 | 0.0 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.1 | GO:0021984 | adenohypophysis development(GO:0021984) |
0.0 | 0.2 | GO:0060997 | dendritic spine morphogenesis(GO:0060997) |
0.0 | 0.1 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.0 | 0.0 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.0 | 0.1 | GO:0001705 | ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
0.0 | 0.1 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.0 | 0.0 | GO:0051593 | response to folic acid(GO:0051593) |
0.0 | 0.0 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.0 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
0.0 | 0.0 | GO:0006562 | proline catabolic process(GO:0006562) |
0.0 | 0.2 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.0 | 0.0 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
0.0 | 0.0 | GO:0070488 | neutrophil aggregation(GO:0070488) |
0.0 | 0.1 | GO:0051466 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
0.0 | 0.0 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.0 | GO:0021764 | amygdala development(GO:0021764) |
0.0 | 0.1 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.0 | 0.0 | GO:0072199 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.0 | GO:0015865 | purine nucleotide transport(GO:0015865) |
0.0 | 0.0 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.0 | 0.1 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
0.0 | 0.1 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.0 | 0.0 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
0.0 | 0.1 | GO:0042253 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
0.0 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.0 | 0.0 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.0 | 0.0 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.0 | 0.0 | GO:0090032 | negative regulation of steroid hormone biosynthetic process(GO:0090032) |
0.0 | 0.1 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
0.0 | 0.0 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.0 | 0.0 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.0 | 0.1 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.0 | 0.2 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
0.0 | 0.0 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
0.0 | 0.1 | GO:0033278 | cell proliferation in midbrain(GO:0033278) |
0.0 | 0.1 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.0 | 0.1 | GO:0023058 | adaptation of signaling pathway(GO:0023058) |
0.0 | 0.5 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.2 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.0 | 0.1 | GO:0032277 | negative regulation of gonadotropin secretion(GO:0032277) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.1 | GO:0002325 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.0 | 0.0 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
0.0 | 0.0 | GO:0007525 | somatic muscle development(GO:0007525) |
0.0 | 0.1 | GO:0021511 | spinal cord patterning(GO:0021511) |
0.0 | 0.0 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.0 | 0.0 | GO:0034165 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.0 | 0.0 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.0 | 0.1 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 0.1 | GO:0097503 | sialylation(GO:0097503) |
0.0 | 0.0 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
0.0 | 0.0 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
0.0 | 0.0 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
0.0 | 0.0 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.1 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.0 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.0 | 0.7 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
0.0 | 0.1 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.0 | 0.0 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
0.0 | 0.0 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.0 | 0.1 | GO:0000054 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.5 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.0 | 0.1 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.0 | 0.0 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.1 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.0 | 0.0 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.0 | 0.0 | GO:0002339 | B cell selection(GO:0002339) |
0.0 | 0.1 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.0 | 0.0 | GO:0010755 | regulation of plasminogen activation(GO:0010755) |
0.0 | 0.1 | GO:0042045 | epithelial fluid transport(GO:0042045) |
0.0 | 0.0 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.1 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.0 | 0.0 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.0 | 0.1 | GO:0000052 | citrulline metabolic process(GO:0000052) |
0.0 | 0.0 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.1 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.2 | GO:0035176 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
0.0 | 0.0 | GO:2001054 | negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.0 | 0.0 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.0 | 0.0 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
0.0 | 0.0 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.0 | 0.3 | GO:0010107 | potassium ion import(GO:0010107) |
0.0 | 0.0 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.0 | 0.1 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.0 | 0.1 | GO:0042640 | anagen(GO:0042640) |
0.0 | 0.0 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.0 | 0.0 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
0.0 | 0.0 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.0 | 0.0 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.0 | 0.0 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.0 | 0.0 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
0.0 | 0.1 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.0 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.0 | 0.0 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.0 | 0.0 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.0 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
0.0 | 0.1 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.0 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.0 | 0.0 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.0 | 0.0 | GO:0050703 | interleukin-1 alpha secretion(GO:0050703) |
0.0 | 0.0 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.0 | 0.1 | GO:0009081 | branched-chain amino acid metabolic process(GO:0009081) branched-chain amino acid catabolic process(GO:0009083) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.0 | GO:0097441 | basilar dendrite(GO:0097441) |
0.6 | 3.8 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.5 | 2.1 | GO:0033010 | paranodal junction(GO:0033010) |
0.4 | 4.5 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.4 | 1.3 | GO:0072534 | perineuronal net(GO:0072534) |
0.4 | 6.3 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
0.3 | 1.4 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.3 | 1.3 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.3 | 1.0 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.3 | 2.8 | GO:0005883 | neurofilament(GO:0005883) |
0.3 | 1.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.3 | 3.0 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.3 | 1.4 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.3 | 1.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.3 | 0.8 | GO:0048179 | activin receptor complex(GO:0048179) |
0.2 | 2.5 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.2 | 1.9 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.2 | 1.6 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.2 | 1.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.2 | 1.5 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.2 | 2.2 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.2 | 3.2 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.2 | 2.2 | GO:0030673 | axolemma(GO:0030673) |
0.2 | 2.1 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.2 | 2.0 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.2 | 1.3 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.2 | 0.5 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.2 | 1.3 | GO:0043194 | axon initial segment(GO:0043194) |
0.2 | 2.3 | GO:0031045 | dense core granule(GO:0031045) |
0.2 | 0.3 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.1 | 0.7 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 0.4 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.1 | 0.5 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.9 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 0.8 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.1 | 0.4 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.1 | 0.6 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 0.6 | GO:0097433 | dense body(GO:0097433) |
0.1 | 5.1 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.1 | 0.1 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.1 | 0.4 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 0.4 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 1.5 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 0.1 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.1 | 2.6 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.1 | 0.6 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.1 | 6.3 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.1 | 0.4 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.1 | 0.9 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.1 | 1.6 | GO:0070822 | Sin3-type complex(GO:0070822) |
0.1 | 0.2 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 0.8 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.1 | 2.5 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.1 | 0.4 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.1 | 0.9 | GO:0031527 | filopodium membrane(GO:0031527) |
0.1 | 0.8 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.1 | 1.0 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 0.3 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.6 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 0.6 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.1 | 0.4 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.5 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.1 | 1.4 | GO:0044295 | axonal growth cone(GO:0044295) |
0.1 | 0.5 | GO:0044292 | dendrite terminus(GO:0044292) |
0.1 | 10.1 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.1 | 0.5 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.1 | 1.1 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 0.4 | GO:0000801 | central element(GO:0000801) |
0.1 | 0.1 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.1 | 0.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.1 | 0.2 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 0.2 | GO:0097452 | GAIT complex(GO:0097452) |
0.1 | 0.2 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 1.3 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.1 | 0.4 | GO:0071437 | invadopodium(GO:0071437) |
0.1 | 0.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.1 | 0.1 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.1 | 0.1 | GO:0000802 | transverse filament(GO:0000802) |
0.1 | 0.4 | GO:0036157 | outer dynein arm(GO:0036157) |
0.1 | 0.2 | GO:0071953 | elastic fiber(GO:0071953) |
0.1 | 0.9 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.1 | 0.7 | GO:0043205 | fibril(GO:0043205) |
0.1 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.0 | 0.3 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.5 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.4 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.0 | 0.8 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.0 | 0.3 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.5 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.4 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.0 | 0.2 | GO:0098651 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 1.4 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.0 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.0 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.2 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.3 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
0.0 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.1 | GO:0031429 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
0.0 | 0.0 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
0.0 | 0.2 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
0.0 | 0.5 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.0 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.0 | 0.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.0 | 0.1 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.0 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.0 | 2.4 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.3 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.0 | 0.3 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.0 | 0.1 | GO:0044447 | axoneme part(GO:0044447) |
0.0 | 0.1 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.1 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.0 | 0.6 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.0 | 0.1 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.0 | 0.0 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.0 | 0.0 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.0 | 0.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.2 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.0 | GO:0016939 | kinesin II complex(GO:0016939) |
0.0 | 0.2 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.1 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.1 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.0 | 0.0 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.0 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 0.0 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.0 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.2 | 6.5 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
1.8 | 5.4 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
1.1 | 4.4 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.9 | 2.7 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.8 | 2.4 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.6 | 1.2 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.6 | 2.9 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.5 | 1.5 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.5 | 1.4 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.5 | 2.9 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.5 | 1.4 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.4 | 1.8 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.4 | 3.9 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.4 | 1.6 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.4 | 2.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.4 | 1.9 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.4 | 2.6 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.4 | 1.1 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.4 | 2.2 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.4 | 1.1 | GO:0005148 | prolactin receptor binding(GO:0005148) |
0.3 | 1.0 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.3 | 1.2 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.3 | 0.9 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.3 | 1.2 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.3 | 6.9 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.3 | 0.9 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.3 | 3.2 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.3 | 2.1 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.3 | 3.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.3 | 3.8 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.2 | 1.2 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.2 | 1.7 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.2 | 1.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.2 | 0.6 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.2 | 0.8 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.2 | 1.7 | GO:0038191 | neuropilin binding(GO:0038191) |
0.2 | 0.8 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.2 | 1.1 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.2 | 0.6 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.2 | 1.3 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.2 | 1.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.2 | 5.7 | GO:0005272 | sodium channel activity(GO:0005272) |
0.2 | 0.7 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.2 | 1.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.2 | 0.8 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.2 | 1.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.2 | 0.5 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.2 | 0.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.2 | 0.5 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.2 | 1.6 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.2 | 1.8 | GO:0016595 | glutamate binding(GO:0016595) |
0.2 | 0.3 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.2 | 3.0 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.2 | 1.7 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 2.7 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.1 | 0.4 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.4 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 0.4 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.1 | 0.6 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 0.3 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.1 | 1.1 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.4 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.1 | 0.8 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.1 | 1.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.1 | 0.3 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.1 | 1.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.1 | 1.5 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.1 | 0.4 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.1 | 0.4 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.4 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.1 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.4 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.1 | 0.5 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.1 | 2.8 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.1 | 0.4 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.1 | 0.5 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 0.4 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.1 | 0.2 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.1 | 0.9 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.1 | 0.7 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.1 | 0.3 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.4 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 0.4 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 0.5 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.1 | 1.0 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.1 | 0.3 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.1 | 1.4 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.1 | 1.5 | GO:0030955 | potassium ion binding(GO:0030955) |
0.1 | 0.3 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.1 | 0.3 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.1 | 1.7 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.1 | 0.3 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 0.6 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 0.3 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.1 | 0.4 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.4 | GO:0004083 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) |
0.1 | 0.8 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.1 | 0.4 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.1 | 0.6 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 1.0 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
0.1 | 0.2 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.1 | 0.6 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.1 | 0.7 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.1 | 0.3 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.1 | 1.0 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.1 | 1.0 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.1 | 0.1 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.1 | 0.2 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.1 | 0.3 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.1 | 0.3 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.1 | 1.1 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 0.4 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.1 | 1.5 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.1 | 0.2 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.1 | 0.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.1 | 0.3 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.1 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
0.1 | 0.4 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.1 | 0.1 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.1 | 1.1 | GO:0004890 | GABA-A receptor activity(GO:0004890) GABA receptor activity(GO:0016917) |
0.1 | 0.5 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.1 | 1.8 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.1 | 0.6 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.1 | 1.3 | GO:0030552 | cAMP binding(GO:0030552) |
0.1 | 0.4 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.1 | 0.4 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.1 | 0.4 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 0.3 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.1 | 0.3 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.1 | 0.3 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.2 | GO:0070052 | collagen V binding(GO:0070052) |
0.1 | 0.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 0.8 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 1.7 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.1 | 0.2 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.1 | 0.2 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.1 | 0.2 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.8 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.1 | 0.2 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.4 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.6 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.1 | 0.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.1 | 0.9 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.1 | 0.3 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.1 | 0.2 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.2 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 0.2 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 0.3 | GO:0005113 | patched binding(GO:0005113) |
0.1 | 0.3 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.1 | 0.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.0 | 0.3 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.5 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.0 | 0.2 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.0 | 0.3 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.0 | 0.4 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.5 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.3 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.4 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.4 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.2 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.0 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.2 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.2 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.0 | 0.1 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.5 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.2 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.8 | GO:0008579 | JUN kinase phosphatase activity(GO:0008579) |
0.0 | 1.8 | GO:0005267 | potassium channel activity(GO:0005267) |
0.0 | 0.3 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.0 | 0.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.0 | 0.7 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.3 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.2 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.0 | 0.1 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.0 | 0.3 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.0 | 0.3 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.4 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.2 | GO:0030553 | cGMP binding(GO:0030553) |
0.0 | 0.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.0 | 0.0 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 0.1 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.2 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.0 | 0.3 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.0 | 0.1 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.5 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.0 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.2 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.1 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.3 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.0 | 1.1 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.1 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.4 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.5 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
0.0 | 0.3 | GO:0031404 | chloride ion binding(GO:0031404) |
0.0 | 0.2 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.0 | 0.2 | GO:0015211 | purine nucleoside transmembrane transporter activity(GO:0015211) |
0.0 | 0.1 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.0 | 0.1 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.0 | 0.0 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.0 | 0.2 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.9 | GO:0050694 | galactose 3-O-sulfotransferase activity(GO:0050694) |
0.0 | 0.2 | GO:0018854 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.1 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.0 | 0.1 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.0 | 0.2 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.2 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.4 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.2 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.2 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.0 | 0.6 | GO:0090595 | dihydrolipoamide branched chain acyltransferase activity(GO:0004147) palmitoleoyl [acyl-carrier-protein]-dependent acyltransferase activity(GO:0008951) serine O-acyltransferase activity(GO:0016412) O-succinyltransferase activity(GO:0016750) sinapoyltransferase activity(GO:0016752) O-sinapoyltransferase activity(GO:0016753) peptidyl-lysine N6-myristoyltransferase activity(GO:0018030) peptidyl-lysine N6-palmitoyltransferase activity(GO:0018031) benzoyl acetate-CoA thiolase activity(GO:0018711) 3-hydroxybutyryl-CoA thiolase activity(GO:0018712) 3-ketopimelyl-CoA thiolase activity(GO:0018713) N-palmitoyltransferase activity(GO:0019105) acyl-CoA N-acyltransferase activity(GO:0019186) protein-cysteine S-myristoyltransferase activity(GO:0019705) glucosaminyl-phosphotidylinositol O-acyltransferase activity(GO:0032216) ergosterol O-acyltransferase activity(GO:0034737) lanosterol O-acyltransferase activity(GO:0034738) naphthyl-2-oxomethyl-succinyl-CoA succinyl transferase activity(GO:0034848) 2,4,4-trimethyl-3-oxopentanoyl-CoA 2-C-propanoyl transferase activity(GO:0034851) 2-methylhexanoyl-CoA C-acetyltransferase activity(GO:0034915) butyryl-CoA 2-C-propionyltransferase activity(GO:0034919) 2,6-dimethyl-5-methylene-3-oxo-heptanoyl-CoA C-acetyltransferase activity(GO:0034945) L-2-aminoadipate N-acetyltransferase activity(GO:0043741) keto acid formate lyase activity(GO:0043806) azetidine-2-carboxylic acid acetyltransferase activity(GO:0046941) peptidyl-lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0052858) acetyl-CoA:L-lysine N6-acetyltransferase(GO:0090595) |
0.0 | 0.1 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.0 | 0.0 | GO:0043849 | Ras palmitoyltransferase activity(GO:0043849) |
0.0 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.2 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.0 | 0.2 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.6 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.0 | 0.1 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
0.0 | 0.0 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.0 | 0.1 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.5 | GO:0052770 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 0.1 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 0.0 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.0 | GO:0032356 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.0 | 0.1 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.0 | 0.0 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.0 | 0.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.1 | GO:0051378 | serotonin binding(GO:0051378) |
0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.0 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.2 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.0 | 0.2 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.0 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.0 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.0 | 0.0 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.0 | 0.1 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.0 | 0.2 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.1 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.1 | PID REELIN PATHWAY | Reelin signaling pathway |
0.2 | 0.5 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.1 | 0.6 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.1 | 1.3 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.1 | 2.0 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.1 | 0.7 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 0.7 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 0.3 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.1 | 3.9 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 0.3 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.1 | 2.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 0.8 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.1 | 0.1 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.1 | 0.7 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 2.1 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.1 | 1.0 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.1 | 1.2 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 1.1 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.1 | 1.2 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 1.6 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 1.1 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.2 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 1.2 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.6 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.3 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.1 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.0 | 1.6 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.5 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.0 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.0 | 0.7 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.0 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 0.6 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.2 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.0 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 4.3 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.2 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 2.2 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.0 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.0 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 5.3 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.4 | 3.9 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.2 | 2.3 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.2 | 2.3 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.2 | 4.2 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.2 | 0.8 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.2 | 3.1 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
0.2 | 2.6 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.2 | 2.1 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.2 | 1.5 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.2 | 1.9 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.1 | 2.0 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.1 | 0.8 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 0.8 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 1.9 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 5.2 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 2.1 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 0.4 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.1 | 0.9 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.1 | 1.2 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.1 | 3.4 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
0.1 | 2.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 0.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 0.4 | REACTOME TCR SIGNALING | Genes involved in TCR signaling |
0.1 | 0.4 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.1 | 0.7 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.1 | 0.6 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.1 | 0.2 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 1.6 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.1 | 1.2 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 0.3 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.1 | 1.2 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 0.5 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 0.3 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.1 | 0.9 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.0 | 0.8 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.3 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.5 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 2.2 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
0.0 | 0.0 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
0.0 | 0.2 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.0 | 1.0 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.3 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.7 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.8 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.6 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 1.4 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 0.8 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.2 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.5 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.1 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.0 | REACTOME SIGNALING BY THE B CELL RECEPTOR BCR | Genes involved in Signaling by the B Cell Receptor (BCR) |
0.0 | 0.2 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.2 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.3 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.0 | 0.6 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 1.8 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.5 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.2 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.0 | 0.5 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.2 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
0.0 | 0.0 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.0 | 0.2 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 0.6 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.6 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.2 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.1 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.0 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.1 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.1 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |