| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Hoxb1
|
ENSMUSG00000018973.2 | homeobox B1 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr11_96366782_96366933 | Hoxb1 | 599 | 0.534830 | 0.51 | 7.2e-05 | Click! |
| chr11_96365580_96365731 | Hoxb1 | 97 | 0.926535 | 0.17 | 2.2e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr10_76664550_76664701 | 6.55 |
Gm35608 |
predicted gene, 35608 |
19807 |
0.14 |
| chr10_63476426_63476663 | 6.07 |
Ctnna3 |
catenin (cadherin associated protein), alpha 3 |
19034 |
0.18 |
| chr13_51017915_51018298 | 6.00 |
Spin1 |
spindlin 1 |
82774 |
0.09 |
| chr19_6969291_6970359 | 5.82 |
Plcb3 |
phospholipase C, beta 3 |
11 |
0.93 |
| chr8_26914178_26914456 | 5.66 |
2310008N11Rik |
RIKEN cDNA 2310008N11 gene |
29937 |
0.12 |
| chr6_36890255_36890607 | 5.01 |
1700111E14Rik |
RIKEN cDNA 1700111E14 gene |
46617 |
0.15 |
| chr1_73994001_73994186 | 4.86 |
Tns1 |
tensin 1 |
1279 |
0.53 |
| chr5_64536835_64537066 | 4.81 |
Gm43836 |
predicted gene 43836 |
21233 |
0.11 |
| chr10_127657981_127658224 | 4.75 |
Stat6 |
signal transducer and activator of transcription 6 |
1298 |
0.23 |
| chr2_174064047_174064205 | 4.75 |
Stx16 |
syntaxin 16 |
12182 |
0.16 |
| chr11_76374871_76375078 | 4.73 |
Nxn |
nucleoredoxin |
24094 |
0.16 |
| chr11_45206698_45206883 | 4.64 |
Gm38087 |
predicted gene, 38087 |
16918 |
0.2 |
| chr7_71217437_71217591 | 4.55 |
6030442E23Rik |
RIKEN cDNA 6030442E23 gene |
465 |
0.85 |
| chr18_61653267_61653989 | 4.38 |
Mir143 |
microRNA 143 |
4370 |
0.12 |
| chr19_5071354_5072731 | 4.37 |
Tmem151a |
transmembrane protein 151A |
90 |
0.61 |
| chr5_134970749_134970900 | 4.28 |
Cldn3 |
claudin 3 |
15390 |
0.07 |
| chr1_73986591_73986846 | 4.27 |
Tns1 |
tensin 1 |
345 |
0.91 |
| chr6_127251061_127251482 | 4.20 |
Gm43635 |
predicted gene 43635 |
3373 |
0.17 |
| chr5_106989313_106989464 | 4.18 |
Cdc7 |
cell division cycle 7 (S. cerevisiae) |
14150 |
0.19 |
| chr11_101896932_101897309 | 4.11 |
Meox1 |
mesenchyme homeobox 1 |
2746 |
0.18 |
| chr10_93688942_93689121 | 4.10 |
Gm15915 |
predicted gene 15915 |
5709 |
0.15 |
| chr9_57343017_57343168 | 3.96 |
Gm5121 |
predicted gene 5121 |
8964 |
0.16 |
| chr11_11837497_11837648 | 3.95 |
Ddc |
dopa decarboxylase |
1292 |
0.44 |
| chr12_79561049_79561200 | 3.90 |
Rad51b |
RAD51 paralog B |
233771 |
0.02 |
| chr5_122520422_122520685 | 3.88 |
Gm22965 |
predicted gene, 22965 |
13764 |
0.09 |
| chr10_127657764_127657946 | 3.85 |
Stat6 |
signal transducer and activator of transcription 6 |
1094 |
0.28 |
| chr1_73307384_73307555 | 3.78 |
Gm29184 |
predicted gene 29184 |
4581 |
0.25 |
| chr11_68601519_68601724 | 3.78 |
Ccdc42 |
coiled-coil domain containing 42 |
7566 |
0.17 |
| chr17_12799364_12799644 | 3.78 |
Gm49958 |
predicted gene, 49958 |
1291 |
0.27 |
| chr5_120102120_120102491 | 3.76 |
Rbm19 |
RNA binding motif protein 19 |
14160 |
0.19 |
| chr3_121396050_121396213 | 3.74 |
Gm5711 |
predicted gene 5711 |
15452 |
0.14 |
| chr4_133833106_133833404 | 3.71 |
Gm12974 |
predicted gene 12974 |
16835 |
0.12 |
| chr17_14540567_14540754 | 3.68 |
Gm38551 |
predicted gene, 38551 |
91089 |
0.07 |
| chr4_145279130_145279281 | 3.67 |
Tnfrsf1b |
tumor necrosis factor receptor superfamily, member 1b |
32335 |
0.14 |
| chr3_84395975_84396129 | 3.64 |
4930565D16Rik |
RIKEN cDNA 4930565D16 gene |
16131 |
0.22 |
| chr8_114882578_114882764 | 3.62 |
Gm22556 |
predicted gene, 22556 |
170242 |
0.03 |
| chr14_76931408_76931559 | 3.54 |
Gm4291 |
predicted gene 4291 |
44766 |
0.14 |
| chr8_70330272_70331426 | 3.48 |
Gdf1 |
growth differentiation factor 1 |
1032 |
0.34 |
| chr8_123617360_123617734 | 3.41 |
n-R5s146 |
nuclear encoded rRNA 5S 146 |
619 |
0.21 |
| chr8_91966987_91967371 | 3.36 |
Gm36670 |
predicted gene, 36670 |
24690 |
0.14 |
| chr4_97690108_97690304 | 3.35 |
E130114P18Rik |
RIKEN cDNA E130114P18 gene |
530 |
0.84 |
| chr17_74710786_74711167 | 3.33 |
Ttc27 |
tetratricopeptide repeat domain 27 |
6756 |
0.21 |
| chr9_43754684_43755222 | 3.32 |
Gm30015 |
predicted gene, 30015 |
8853 |
0.16 |
| chr9_67114163_67114314 | 3.28 |
Gm22145 |
predicted gene, 22145 |
10030 |
0.16 |
| chr5_118488782_118489619 | 3.26 |
Gm15754 |
predicted gene 15754 |
2233 |
0.32 |
| chr2_163256780_163256947 | 3.25 |
Tox2 |
TOX high mobility group box family member 2 |
31409 |
0.16 |
| chr11_99147302_99147564 | 3.23 |
Ccr7 |
chemokine (C-C motif) receptor 7 |
7644 |
0.16 |
| chr5_130310920_130311071 | 3.22 |
Tyw1 |
tRNA-yW synthesizing protein 1 homolog (S. cerevisiae) |
52065 |
0.09 |
| chr15_83167234_83167461 | 3.20 |
Cyb5r3 |
cytochrome b5 reductase 3 |
2830 |
0.15 |
| chr10_76684115_76684285 | 3.16 |
Gm35608 |
predicted gene, 35608 |
232 |
0.92 |
| chr10_8213987_8214315 | 3.15 |
Gm30906 |
predicted gene, 30906 |
38020 |
0.2 |
| chr6_148283574_148283791 | 3.12 |
Gm15763 |
predicted gene 15763 |
22532 |
0.16 |
| chr2_167582959_167583472 | 3.12 |
Gm11475 |
predicted gene 11475 |
8180 |
0.12 |
| chr11_103340757_103340961 | 3.10 |
Arhgap27 |
Rho GTPase activating protein 27 |
1140 |
0.36 |
| chr13_84515013_84515539 | 3.10 |
Gm26927 |
predicted gene, 26927 |
175163 |
0.03 |
| chr7_141364479_141364665 | 3.10 |
B230206H07Rik |
RIKEN cDNA B230206H07 gene |
510 |
0.56 |
| chr8_110793240_110793421 | 3.07 |
Il34 |
interleukin 34 |
2442 |
0.19 |
| chr2_164866768_164866935 | 3.06 |
Pltp |
phospholipid transfer protein |
9140 |
0.09 |
| chr15_97003998_97004174 | 3.05 |
Slc38a4 |
solute carrier family 38, member 4 |
15865 |
0.26 |
| chr17_33920147_33920573 | 3.03 |
Gm19412 |
predicted gene, 19412 |
71 |
0.59 |
| chr18_42510920_42511513 | 3.01 |
Tcerg1 |
transcription elongation regulator 1 (CA150) |
271 |
0.91 |
| chr2_35269305_35269476 | 2.99 |
Gm43128 |
predicted gene 43128 |
11000 |
0.14 |
| chr12_79975588_79975937 | 2.98 |
Gm8275 |
predicted gene 8275 |
4089 |
0.22 |
| chr13_60099930_60100135 | 2.95 |
A530065N20Rik |
RIKEN cDNA A530046M15 gene |
9083 |
0.17 |
| chr3_146284037_146284198 | 2.94 |
Gm43334 |
predicted gene 43334 |
40303 |
0.13 |
| chr8_88394816_88394967 | 2.92 |
Gm45497 |
predicted gene 45497 |
3770 |
0.26 |
| chr8_123600606_123600938 | 2.91 |
n-R5s136 |
nuclear encoded rRNA 5S 136 |
793 |
0.13 |
| chr7_16046417_16047443 | 2.87 |
Bicra |
BRD4 interacting chromatin remodeling complex associated protein |
991 |
0.44 |
| chr3_53059978_53060130 | 2.86 |
Gm42898 |
predicted gene 42898 |
15183 |
0.11 |
| chr5_143055749_143055940 | 2.84 |
Gm43378 |
predicted gene 43378 |
5801 |
0.15 |
| chr10_127508848_127510720 | 2.83 |
Stac3 |
SH3 and cysteine rich domain 3 |
2559 |
0.15 |
| chr16_18876300_18877282 | 2.83 |
Mrpl40 |
mitochondrial ribosomal protein L40 |
71 |
0.73 |
| chr14_69321459_69321646 | 2.82 |
Gm16677 |
predicted gene, 16677 |
15530 |
0.09 |
| chr14_69539708_69539896 | 2.82 |
Gm27174 |
predicted gene 27174 |
15530 |
0.09 |
| chr3_69812507_69812796 | 2.81 |
Sptssb |
serine palmitoyltransferase, small subunit B |
47271 |
0.13 |
| chr9_47279937_47280178 | 2.80 |
Gm31816 |
predicted gene, 31816 |
9314 |
0.26 |
| chr13_49461115_49461307 | 2.80 |
Tes3-ps |
testis derived transcript 3, pseudogene |
32107 |
0.13 |
| chr1_71944626_71944777 | 2.77 |
Gm28818 |
predicted gene 28818 |
27576 |
0.15 |
| chr4_114624028_114624539 | 2.76 |
Gm28864 |
predicted gene 28864 |
49057 |
0.15 |
| chr14_63255646_63255864 | 2.73 |
Gata4 |
GATA binding protein 4 |
10484 |
0.17 |
| chr14_27044712_27044863 | 2.72 |
Il17rd |
interleukin 17 receptor D |
5531 |
0.22 |
| chr7_80447420_80447676 | 2.70 |
Blm |
Bloom syndrome, RecQ like helicase |
9824 |
0.13 |
| chr2_158893293_158893478 | 2.66 |
Dhx35 |
DEAH (Asp-Glu-Ala-His) box polypeptide 35 |
42756 |
0.17 |
| chr10_22928274_22928426 | 2.65 |
Gm47787 |
predicted gene, 47787 |
28234 |
0.2 |
| chr11_80845419_80845570 | 2.64 |
4930507D10Rik |
RIKEN cDNA 4930507D10 gene |
12806 |
0.16 |
| chr17_45318310_45318516 | 2.63 |
Cdc5l |
cell division cycle 5-like (S. pombe) |
97271 |
0.06 |
| chr8_122654843_122655024 | 2.63 |
Cbfa2t3 |
CBFA2/RUNX1 translocation partner 3 |
8467 |
0.1 |
| chr11_81612309_81613487 | 2.61 |
Gm11418 |
predicted gene 11418 |
25537 |
0.22 |
| chr5_118385956_118386107 | 2.61 |
Gm28563 |
predicted gene 28563 |
11299 |
0.2 |
| chr11_79753220_79753373 | 2.59 |
Mir365-2 |
microRNA 365-2 |
26896 |
0.12 |
| chr9_64576223_64576428 | 2.57 |
Megf11 |
multiple EGF-like-domains 11 |
29426 |
0.21 |
| chr17_45812049_45812200 | 2.56 |
Gm35692 |
predicted gene, 35692 |
10199 |
0.16 |
| chr6_92035215_92035366 | 2.56 |
4930466I24Rik |
RIKEN cDNA 4930466I24 gene |
19173 |
0.14 |
| chr7_16793141_16793292 | 2.55 |
Slc1a5 |
solute carrier family 1 (neutral amino acid transporter), member 5 |
39 |
0.96 |
| chr17_43407689_43407856 | 2.54 |
Adgrf5 |
adhesion G protein-coupled receptor F5 |
18284 |
0.21 |
| chr11_88068171_88069196 | 2.53 |
Vezf1 |
vascular endothelial zinc finger 1 |
404 |
0.76 |
| chr8_34572981_34573169 | 2.52 |
Gm34096 |
predicted gene, 34096 |
35230 |
0.13 |
| chr15_103069289_103069502 | 2.52 |
5730585A16Rik |
RIKEN cDNA 5730585A16 gene |
10089 |
0.1 |
| chr2_173976785_173976936 | 2.52 |
Atp5k-ps2 |
ATP synthase, H+ transporting, mitochondrial F1F0 complex, subunit E, pseudogene 2 |
7831 |
0.21 |
| chr7_142660536_142661042 | 2.51 |
Igf2 |
insulin-like growth factor 2 |
416 |
0.66 |
| chr1_182988733_182989130 | 2.50 |
Gm38079 |
predicted gene, 38079 |
12655 |
0.19 |
| chr3_37906780_37907292 | 2.49 |
Gm20755 |
predicted gene, 20755 |
8223 |
0.18 |
| chr4_114688343_114688538 | 2.49 |
Gm12829 |
predicted gene 12829 |
7636 |
0.22 |
| chr15_76668038_76668213 | 2.48 |
Foxh1 |
forkhead box H1 |
1677 |
0.15 |
| chr4_146485303_146485561 | 2.48 |
Gm13245 |
predicted gene 13245 |
4765 |
0.15 |
| chr16_43335455_43335957 | 2.47 |
Gm15711 |
predicted gene 15711 |
23112 |
0.14 |
| chr5_134210189_134210449 | 2.44 |
Gtf2ird2 |
GTF2I repeat domain containing 2 |
3662 |
0.16 |
| chr11_96365580_96365731 | 2.43 |
Hoxb1 |
homeobox B1 |
97 |
0.93 |
| chr5_119574899_119575093 | 2.42 |
Tbx3os1 |
T-box 3, opposite strand 1 |
50 |
0.97 |
| chr4_55843971_55844321 | 2.42 |
Gm12519 |
predicted gene 12519 |
149593 |
0.04 |
| chr5_134966335_134966938 | 2.41 |
Cldn3 |
claudin 3 |
19578 |
0.07 |
| chr15_74909593_74910029 | 2.40 |
Ly6m |
lymphocyte antigen 6 complex, locus M |
12790 |
0.09 |
| chr4_139697823_139697974 | 2.40 |
Tas1r2 |
taste receptor, type 1, member 2 |
44349 |
0.12 |
| chr11_69366461_69367262 | 2.39 |
Chd3 |
chromodomain helicase DNA binding protein 3 |
2082 |
0.14 |
| chr4_10285623_10285774 | 2.39 |
Gm11814 |
predicted gene 11814 |
154045 |
0.04 |
| chr7_4614178_4614338 | 2.38 |
Gm18973 |
predicted gene, 18973 |
1093 |
0.25 |
| chr1_72951925_72952076 | 2.37 |
1700027A15Rik |
RIKEN cDNA 1700027A15 gene |
32844 |
0.18 |
| chr4_133122044_133122225 | 2.37 |
Wasf2 |
WAS protein family, member 2 |
8371 |
0.18 |
| chr19_46348504_46349514 | 2.36 |
2310034G01Rik |
RIKEN cDNA 2310034G01 gene |
1293 |
0.23 |
| chr2_32424397_32424585 | 2.35 |
Slc25a25 |
solute carrier family 25 (mitochondrial carrier, phosphate carrier), member 25 |
486 |
0.65 |
| chr8_104610295_104610507 | 2.34 |
Cdh16 |
cadherin 16 |
2863 |
0.13 |
| chr7_68073200_68073351 | 2.33 |
Igf1r |
insulin-like growth factor I receptor |
75315 |
0.1 |
| chr10_9557782_9557933 | 2.32 |
Gm48757 |
predicted gene, 48757 |
8519 |
0.13 |
| chr18_83065511_83065662 | 2.30 |
1700095A13Rik |
RIKEN cDNA 1700095A13 gene |
14255 |
0.17 |
| chr10_21636718_21637002 | 2.30 |
1700020N01Rik |
RIKEN cDNA 1700020N01 gene |
20540 |
0.2 |
| chrX_162749156_162749312 | 2.29 |
Gm23786 |
predicted gene, 23786 |
678 |
0.6 |
| chr3_132995231_132995388 | 2.29 |
Gstcd |
glutathione S-transferase, C-terminal domain containing |
10368 |
0.15 |
| chr8_27091292_27091593 | 2.26 |
Adgra2 |
adhesion G protein-coupled receptor A2 |
5844 |
0.12 |
| chr10_80963206_80963454 | 2.26 |
Gm3828 |
predicted gene 3828 |
8620 |
0.1 |
| chr9_116091571_116091722 | 2.26 |
Gm9385 |
predicted pseudogene 9385 |
50582 |
0.13 |
| chr7_107691723_107691874 | 2.25 |
Ppfibp2 |
PTPRF interacting protein, binding protein 2 (liprin beta 2) |
26487 |
0.13 |
| chr4_150800189_150800340 | 2.25 |
Gm13049 |
predicted gene 13049 |
25469 |
0.15 |
| chr5_142457568_142457719 | 2.23 |
Ap5z1 |
adaptor-related protein complex 5, zeta 1 subunit |
6301 |
0.2 |
| chr7_109221019_109221498 | 2.21 |
Gm45024 |
predicted gene 45024 |
2942 |
0.28 |
| chr8_88325268_88325641 | 2.19 |
Brd7 |
bromodomain containing 7 |
7465 |
0.19 |
| chr12_111914199_111914350 | 2.18 |
Ppp1r13b |
protein phosphatase 1, regulatory subunit 13B |
6164 |
0.12 |
| chr14_31166318_31166503 | 2.18 |
Stab1 |
stabilin 1 |
2185 |
0.18 |
| chr6_47835391_47836477 | 2.18 |
Zfp398 |
zinc finger protein 398 |
239 |
0.86 |
| chr3_101430437_101431033 | 2.18 |
Gm42538 |
predicted gene 42538 |
3799 |
0.2 |
| chr3_100820875_100821197 | 2.18 |
Vtcn1 |
V-set domain containing T cell activation inhibitor 1 |
4423 |
0.26 |
| chr8_23193185_23193517 | 2.17 |
Gpat4 |
glycerol-3-phosphate acyltransferase 4 |
2413 |
0.18 |
| chr1_82597305_82597465 | 2.17 |
Col4a3 |
collagen, type IV, alpha 3 |
10409 |
0.17 |
| chr15_89211527_89212038 | 2.16 |
Ppp6r2 |
protein phosphatase 6, regulatory subunit 2 |
181 |
0.9 |
| chr16_5845713_5845864 | 2.14 |
Rbfox1 |
RNA binding protein, fox-1 homolog (C. elegans) 1 |
39567 |
0.21 |
| chr14_36618830_36619011 | 2.14 |
Gm17940 |
predicted gene, 17940 |
358 |
0.9 |
| chr7_141638107_141638510 | 2.14 |
Muc6 |
mucin 6, gastric |
17000 |
0.12 |
| chr10_98794238_98794389 | 2.12 |
Gm5427 |
predicted gene 5427 |
94603 |
0.08 |
| chr2_166325086_166325237 | 2.11 |
Gm11468 |
predicted gene 11468 |
51253 |
0.13 |
| chr9_61368103_61368336 | 2.10 |
Gm10655 |
predicted gene 10655 |
3408 |
0.23 |
| chr1_45502972_45503216 | 2.08 |
Col5a2 |
collagen, type V, alpha 2 |
188 |
0.93 |
| chr4_119105802_119106331 | 2.07 |
Slc2a1 |
solute carrier family 2 (facilitated glucose transporter), member 1 |
2645 |
0.16 |
| chr10_127605196_127605347 | 2.07 |
Gm16217 |
predicted gene 16217 |
8723 |
0.1 |
| chr15_11173986_11174284 | 2.06 |
Adamts12 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 12 |
109317 |
0.06 |
| chr16_30244126_30244284 | 2.06 |
Gm49645 |
predicted gene, 49645 |
10947 |
0.14 |
| chr9_116847264_116847490 | 2.04 |
Rbms3 |
RNA binding motif, single stranded interacting protein |
24558 |
0.27 |
| chr2_13372864_13373126 | 2.03 |
Cubn |
cubilin (intrinsic factor-cobalamin receptor) |
82632 |
0.08 |
| chr15_93518420_93518822 | 2.03 |
Prickle1 |
prickle planar cell polarity protein 1 |
902 |
0.68 |
| chr9_30809196_30809347 | 2.02 |
Gm31013 |
predicted gene, 31013 |
27792 |
0.19 |
| chr14_69253618_69253952 | 2.02 |
Gm27222 |
predicted gene 27222 |
5361 |
0.11 |
| chr11_95631410_95631605 | 2.01 |
Gm11528 |
predicted gene 11528 |
8847 |
0.15 |
| chr7_73390556_73391998 | 2.00 |
Rgma |
repulsive guidance molecule family member A |
1 |
0.97 |
| chr5_66786390_66786548 | 2.00 |
Limch1 |
LIM and calponin homology domains 1 |
40580 |
0.13 |
| chr5_119563543_119563700 | 1.98 |
Tbx3os1 |
T-box 3, opposite strand 1 |
7141 |
0.19 |
| chr1_71938719_71938882 | 1.97 |
Gm28818 |
predicted gene 28818 |
21675 |
0.17 |
| chr6_6697724_6697891 | 1.96 |
Gm20618 |
predicted gene 20618 |
6286 |
0.21 |
| chr2_38532577_38532738 | 1.95 |
Gm35808 |
predicted gene, 35808 |
3050 |
0.17 |
| chr18_66449138_66449418 | 1.94 |
Pmaip1 |
phorbol-12-myristate-13-acetate-induced protein 1 |
9255 |
0.12 |
| chr11_59428195_59428346 | 1.94 |
Snap47 |
synaptosomal-associated protein, 47 |
19221 |
0.1 |
| chr10_4178942_4179093 | 1.94 |
Gm25369 |
predicted gene, 25369 |
9130 |
0.21 |
| chr9_54802741_54803110 | 1.93 |
Rab7-ps1 |
RAB7, member RAS oncogene family, pseudogene 1 |
22357 |
0.14 |
| chr10_13376697_13376854 | 1.93 |
Phactr2 |
phosphatase and actin regulator 2 |
11956 |
0.26 |
| chr15_86107688_86108176 | 1.93 |
Gm15722 |
predicted gene 15722 |
17872 |
0.16 |
| chr6_117688695_117688872 | 1.92 |
Gm7292 |
predicted gene 7292 |
27559 |
0.16 |
| chr16_76529757_76529908 | 1.91 |
Gm30726 |
predicted gene, 30726 |
18963 |
0.2 |
| chr3_89429792_89430990 | 1.91 |
Pygo2 |
pygopus 2 |
33 |
0.94 |
| chr1_139232680_139232956 | 1.90 |
Crb1 |
crumbs family member 1, photoreceptor morphogenesis associated |
22944 |
0.18 |
| chr13_63515649_63515800 | 1.90 |
Ptch1 |
patched 1 |
3695 |
0.19 |
| chr17_17618533_17618694 | 1.88 |
Lnpep |
leucyl/cystinyl aminopeptidase |
5876 |
0.17 |
| chr10_58226784_58226978 | 1.88 |
Gm10807 |
predicted gene 10807 |
1770 |
0.22 |
| chr6_128078542_128078832 | 1.86 |
Gm26338 |
predicted gene, 26338 |
16339 |
0.15 |
| chr2_93880605_93880756 | 1.86 |
Accsl |
1-aminocyclopropane-1-carboxylate synthase (non-functional)-like |
11523 |
0.16 |
| chr5_137349031_137350198 | 1.86 |
Ephb4 |
Eph receptor B4 |
495 |
0.62 |
| chr18_11119128_11119285 | 1.86 |
Gata6 |
GATA binding protein 6 |
60159 |
0.13 |
| chr11_97138529_97139219 | 1.83 |
Mir7235 |
microRNA 7235 |
7545 |
0.09 |
| chr7_99141062_99141898 | 1.82 |
Gm45185 |
predicted gene 45185 |
113 |
0.76 |
| chr6_30121712_30121863 | 1.82 |
Nrf1 |
nuclear respiratory factor 1 |
5672 |
0.17 |
| chr11_102896217_102896397 | 1.81 |
Gfap |
glial fibrillary acidic protein |
824 |
0.44 |
| chr19_7103754_7103960 | 1.80 |
Flrt1 |
fibronectin leucine rich transmembrane protein 1 |
1872 |
0.24 |
| chr10_78395785_78396875 | 1.79 |
Gm10146 |
predicted gene 10146 |
3010 |
0.11 |
| chr17_49756892_49757208 | 1.79 |
Kif6 |
kinesin family member 6 |
3139 |
0.33 |
| chr6_99928022_99928202 | 1.78 |
Gm44442 |
predicted gene, 44442 |
3437 |
0.24 |
| chr17_47909349_47909983 | 1.78 |
Gm15556 |
predicted gene 15556 |
12712 |
0.13 |
| chr10_80071527_80071891 | 1.77 |
Sbno2 |
strawberry notch 2 |
3691 |
0.11 |
| chr8_122452355_122452506 | 1.77 |
Gm20735 |
predicted gene, 20735 |
1108 |
0.27 |
| chr16_3934198_3934349 | 1.76 |
Gm15537 |
predicted gene 15537 |
4916 |
0.08 |
| chr10_119803667_119803963 | 1.75 |
Grip1 |
glutamate receptor interacting protein 1 |
15574 |
0.2 |
| chr16_86888571_86888722 | 1.75 |
Gm25715 |
predicted gene, 25715 |
43176 |
0.16 |
| chr15_97060183_97060372 | 1.74 |
Slc38a4 |
solute carrier family 38, member 4 |
4321 |
0.32 |
| chr11_98707956_98708690 | 1.73 |
Med24 |
mediator complex subunit 24 |
320 |
0.76 |
| chr14_70776357_70776629 | 1.72 |
Dok2 |
docking protein 2 |
130 |
0.96 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 2.9 | GO:0021570 | rhombomere 4 development(GO:0021570) |
| 0.8 | 2.4 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.5 | 1.6 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.5 | 1.5 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.5 | 2.0 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.4 | 1.7 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.4 | 1.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.4 | 0.8 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.4 | 0.8 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
| 0.4 | 1.1 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.4 | 2.5 | GO:0015825 | L-serine transport(GO:0015825) |
| 0.3 | 1.0 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.3 | 1.2 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.3 | 0.9 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.3 | 0.9 | GO:0046864 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
| 0.3 | 1.5 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
| 0.3 | 0.9 | GO:2000320 | negative regulation of T-helper 17 type immune response(GO:2000317) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
| 0.3 | 0.8 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.3 | 2.1 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
| 0.3 | 0.8 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.3 | 0.5 | GO:0021569 | rhombomere 3 development(GO:0021569) |
| 0.3 | 1.0 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.2 | 0.7 | GO:0001757 | somite specification(GO:0001757) |
| 0.2 | 0.9 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.2 | 1.4 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.2 | 2.2 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.2 | 1.1 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.2 | 0.6 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.2 | 0.9 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.2 | 0.9 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.2 | 1.1 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.2 | 0.7 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.2 | 1.2 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.2 | 0.9 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.2 | 1.2 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.2 | 0.7 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.2 | 5.7 | GO:0009395 | phospholipid catabolic process(GO:0009395) |
| 0.2 | 0.5 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.2 | 0.6 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.4 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 | 0.4 | GO:0090259 | regulation of retinal ganglion cell axon guidance(GO:0090259) |
| 0.1 | 0.6 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.1 | 0.3 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.1 | 0.3 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.1 | 1.1 | GO:0071501 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.1 | 1.7 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| 0.1 | 0.7 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.1 | 0.4 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.1 | 0.6 | GO:0060023 | soft palate development(GO:0060023) |
| 0.1 | 0.6 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.1 | 0.2 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.1 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 | 0.5 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 0.6 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.1 | 0.4 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.1 | 0.6 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.1 | 0.3 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
| 0.1 | 0.3 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.1 | 0.5 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
| 0.1 | 0.3 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.1 | 4.7 | GO:0010761 | fibroblast migration(GO:0010761) |
| 0.1 | 0.5 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 0.5 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
| 0.1 | 0.4 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.1 | 0.4 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 | 0.5 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.1 | 0.2 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.1 | 0.3 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.1 | 0.9 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.1 | 0.7 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 | 0.4 | GO:1903911 | positive regulation of receptor clustering(GO:1903911) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 0.1 | 0.3 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 0.1 | 0.5 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 | 0.3 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
| 0.1 | 1.0 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.1 | 0.3 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.1 | 0.4 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 | 0.4 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.1 | 0.4 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.1 | 0.4 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
| 0.1 | 0.2 | GO:0072277 | renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
| 0.1 | 0.6 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.1 | 0.3 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.1 | 1.3 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
| 0.1 | 0.1 | GO:0072095 | regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 0.1 | 0.3 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.1 | 0.2 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
| 0.1 | 0.3 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.1 | 0.2 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
| 0.1 | 0.3 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.1 | 1.7 | GO:0002021 | response to dietary excess(GO:0002021) |
| 0.1 | 0.1 | GO:0010182 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
| 0.1 | 0.2 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.1 | 0.2 | GO:0009629 | response to gravity(GO:0009629) |
| 0.1 | 1.4 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
| 0.1 | 0.2 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.1 | 0.2 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.1 | 0.1 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
| 0.1 | 0.2 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.1 | 0.2 | GO:0002513 | tolerance induction to self antigen(GO:0002513) |
| 0.1 | 0.2 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.1 | 0.2 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.1 | 0.3 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.1 | 0.2 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
| 0.1 | 0.2 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.1 | 0.2 | GO:1902065 | response to L-glutamate(GO:1902065) |
| 0.1 | 0.2 | GO:1903899 | positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
| 0.1 | 0.3 | GO:0060426 | lung vasculature development(GO:0060426) |
| 0.1 | 0.2 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.1 | 0.4 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
| 0.1 | 0.1 | GO:0060956 | endocardial cell differentiation(GO:0060956) |
| 0.1 | 0.4 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
| 0.1 | 0.6 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.1 | 0.4 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.1 | 0.1 | GO:0038109 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.1 | 1.1 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.1 | 0.1 | GO:0060594 | mammary gland specification(GO:0060594) |
| 0.1 | 0.4 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.1 | 0.2 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.1 | 0.1 | GO:0010159 | specification of organ position(GO:0010159) |
| 0.1 | 0.2 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
| 0.1 | 0.4 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.1 | 0.1 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.1 | 0.2 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.1 | 0.3 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
| 0.1 | 0.3 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.1 | 0.3 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.1 | 0.2 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
| 0.1 | 0.8 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.1 | 0.1 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.1 | 0.1 | GO:0044533 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.1 | 1.0 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.1 | 0.5 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.1 | 0.1 | GO:0007403 | glial cell fate determination(GO:0007403) |
| 0.1 | 0.1 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.1 | 0.5 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
| 0.1 | 0.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.1 | 0.2 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.1 | 0.4 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.1 | 0.1 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
| 0.1 | 1.2 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
| 0.1 | 0.2 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
| 0.1 | 0.2 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
| 0.1 | 0.2 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.1 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 0.4 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.1 | 1.3 | GO:0035066 | positive regulation of histone acetylation(GO:0035066) |
| 0.1 | 0.2 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.1 | 0.1 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 0.1 | 0.1 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
| 0.1 | 0.3 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.1 | 0.5 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
| 0.1 | 0.3 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 0.1 | 0.2 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 | 0.4 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
| 0.1 | 0.1 | GO:0043465 | regulation of fermentation(GO:0043465) regulation of NAD metabolic process(GO:1902688) regulation of glucose catabolic process to lactate via pyruvate(GO:1904023) |
| 0.1 | 0.2 | GO:0046959 | habituation(GO:0046959) |
| 0.1 | 0.7 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.1 | 0.1 | GO:0060534 | trachea cartilage development(GO:0060534) |
| 0.1 | 0.6 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.1 | 0.1 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
| 0.1 | 0.3 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.1 | 0.2 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.1 | 0.2 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.1 | 0.1 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.1 | 0.2 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.1 | 1.4 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
| 0.0 | 0.2 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.0 | 0.3 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
| 0.0 | 0.2 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.4 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.1 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
| 0.0 | 0.1 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.0 | 0.2 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.0 | 0.2 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.0 | 0.4 | GO:0030033 | microvillus assembly(GO:0030033) |
| 0.0 | 0.9 | GO:0002347 | response to tumor cell(GO:0002347) |
| 0.0 | 0.2 | GO:1904396 | regulation of synaptic growth at neuromuscular junction(GO:0008582) regulation of neuromuscular junction development(GO:1904396) |
| 0.0 | 0.1 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.0 | 0.2 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.0 | 0.3 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 0.0 | 0.1 | GO:1901524 | regulation of macromitophagy(GO:1901524) negative regulation of macromitophagy(GO:1901525) |
| 0.0 | 0.7 | GO:0046549 | retinal cone cell development(GO:0046549) |
| 0.0 | 0.2 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 | 0.2 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.0 | 0.0 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.0 | 0.0 | GO:0061054 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
| 0.0 | 1.3 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
| 0.0 | 0.2 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.0 | 0.5 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 | 0.3 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.0 | 0.0 | GO:2000109 | macrophage apoptotic process(GO:0071888) regulation of macrophage apoptotic process(GO:2000109) |
| 0.0 | 0.3 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.3 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.0 | 0.5 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.4 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
| 0.0 | 0.0 | GO:0009212 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
| 0.0 | 0.2 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
| 0.0 | 0.3 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.0 | 0.3 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.0 | 0.1 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.0 | 0.1 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
| 0.0 | 0.7 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.0 | 0.1 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.0 | 0.1 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.0 | 0.2 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.0 | 0.6 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 | 0.4 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.0 | 1.9 | GO:0001885 | endothelial cell development(GO:0001885) |
| 0.0 | 0.6 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
| 0.0 | 0.0 | GO:0048880 | sensory system development(GO:0048880) |
| 0.0 | 0.1 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.1 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.1 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
| 0.0 | 0.1 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.0 | 0.1 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 0.0 | 0.2 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.0 | 0.1 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.0 | 0.3 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.0 | 0.0 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.0 | 0.1 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.0 | 0.2 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 0.1 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.0 | 0.5 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.0 | 0.2 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.0 | 0.0 | GO:0032621 | interleukin-18 production(GO:0032621) |
| 0.0 | 0.2 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.0 | 0.1 | GO:0018158 | protein oxidation(GO:0018158) |
| 0.0 | 0.1 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.0 | 0.8 | GO:0040019 | positive regulation of embryonic development(GO:0040019) |
| 0.0 | 0.0 | GO:0072053 | renal inner medulla development(GO:0072053) |
| 0.0 | 0.1 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
| 0.0 | 0.0 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
| 0.0 | 0.2 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.0 | 0.9 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
| 0.0 | 0.6 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.0 | 0.0 | GO:0009642 | response to light intensity(GO:0009642) |
| 0.0 | 0.1 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.0 | 0.2 | GO:0018101 | protein citrullination(GO:0018101) |
| 0.0 | 0.4 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.1 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.0 | 0.2 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.0 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.0 | 0.1 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.0 | 0.2 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.0 | 0.2 | GO:0010649 | regulation of cell communication by electrical coupling(GO:0010649) |
| 0.0 | 0.1 | GO:0051305 | chromosome movement towards spindle pole(GO:0051305) |
| 0.0 | 0.1 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
| 0.0 | 0.1 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.0 | 0.2 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.0 | 0.2 | GO:2000345 | regulation of hepatocyte proliferation(GO:2000345) |
| 0.0 | 0.1 | GO:0035513 | oxidative DNA demethylation(GO:0035511) oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.0 | 0.1 | GO:0050812 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 | 0.1 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 0.1 | GO:0038031 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 | 0.1 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.0 | 0.1 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.0 | 0.4 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 | 0.1 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 | 0.2 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.0 | 0.4 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
| 0.0 | 0.1 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.0 | 0.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.1 | GO:2001225 | regulation of chloride transport(GO:2001225) |
| 0.0 | 0.1 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.0 | 0.5 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.0 | 0.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.2 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 0.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.1 | GO:0010737 | protein kinase A signaling(GO:0010737) |
| 0.0 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.0 | 0.8 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.0 | 0.1 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
| 0.0 | 0.1 | GO:0060605 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.0 | 0.1 | GO:0060037 | pharyngeal system development(GO:0060037) |
| 0.0 | 0.1 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
| 0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.1 | GO:0007412 | axon target recognition(GO:0007412) |
| 0.0 | 0.2 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 | 0.2 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
| 0.0 | 0.5 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.0 | 0.1 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.0 | 0.1 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 | 0.2 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.0 | 0.2 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.0 | 0.3 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
| 0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.0 | 0.4 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.0 | 0.1 | GO:0021546 | rhombomere development(GO:0021546) |
| 0.0 | 0.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.0 | 0.0 | GO:0044650 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
| 0.0 | 0.1 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.0 | 0.1 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.0 | 0.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.1 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
| 0.0 | 0.1 | GO:0035733 | hepatic stellate cell activation(GO:0035733) |
| 0.0 | 0.2 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 0.3 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.0 | 0.0 | GO:0019627 | urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 0.0 | 0.7 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
| 0.0 | 0.1 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.0 | 0.1 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.0 | 0.0 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.0 | 0.3 | GO:0043584 | nose development(GO:0043584) |
| 0.0 | 0.5 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
| 0.0 | 0.6 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
| 0.0 | 0.1 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.0 | 0.0 | GO:0048320 | axial mesoderm formation(GO:0048320) |
| 0.0 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 | 0.1 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.0 | 0.1 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
| 0.0 | 0.1 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.0 | 0.8 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.0 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 0.0 | 0.4 | GO:0030857 | negative regulation of epithelial cell differentiation(GO:0030857) |
| 0.0 | 0.0 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
| 0.0 | 0.1 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.0 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
| 0.0 | 0.5 | GO:0070542 | response to fatty acid(GO:0070542) |
| 0.0 | 0.0 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.0 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.0 | 0.0 | GO:0045624 | positive regulation of T-helper cell differentiation(GO:0045624) |
| 0.0 | 0.1 | GO:0051189 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.0 | 0.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.0 | 0.0 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
| 0.0 | 0.7 | GO:0032648 | regulation of interferon-beta production(GO:0032648) |
| 0.0 | 0.1 | GO:0072402 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 | 0.2 | GO:0051570 | regulation of histone H3-K9 methylation(GO:0051570) |
| 0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.0 | 0.1 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
| 0.0 | 0.0 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.0 | 0.3 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.0 | 0.0 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
| 0.0 | 0.2 | GO:1902751 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.0 | 0.4 | GO:0006301 | postreplication repair(GO:0006301) |
| 0.0 | 0.0 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.0 | 0.0 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
| 0.0 | 0.1 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.0 | 0.4 | GO:0043551 | regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
| 0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.3 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.1 | GO:0051645 | Golgi localization(GO:0051645) |
| 0.0 | 0.1 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.2 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.0 | 0.0 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.0 | 0.0 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.0 | 0.3 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.1 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.0 | 0.1 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.0 | 0.2 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.0 | 0.0 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.0 | 0.0 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.0 | 0.0 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
| 0.0 | 0.1 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.0 | 0.2 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.0 | 0.1 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.0 | 0.0 | GO:0032329 | serine transport(GO:0032329) |
| 0.0 | 0.1 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.0 | 0.2 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.0 | 0.2 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 0.1 | GO:0006925 | inflammatory cell apoptotic process(GO:0006925) |
| 0.0 | 0.1 | GO:0030913 | paranodal junction assembly(GO:0030913) |
| 0.0 | 0.7 | GO:0006749 | glutathione metabolic process(GO:0006749) |
| 0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.0 | 0.6 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.0 | 0.2 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.0 | 0.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 | 0.2 | GO:0060972 | left/right pattern formation(GO:0060972) |
| 0.0 | 0.1 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.1 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.0 | 0.4 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.0 | 0.0 | GO:1902023 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
| 0.0 | 0.0 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
| 0.0 | 1.4 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
| 0.0 | 1.5 | GO:0051028 | mRNA transport(GO:0051028) |
| 0.0 | 0.2 | GO:0099500 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.0 | 0.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.0 | 0.2 | GO:0051602 | response to electrical stimulus(GO:0051602) |
| 0.0 | 0.1 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.1 | GO:0002923 | regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002923) |
| 0.0 | 0.1 | GO:0046697 | decidualization(GO:0046697) |
| 0.0 | 0.0 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
| 0.0 | 0.4 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
| 0.0 | 0.0 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.0 | 0.1 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.0 | 0.1 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.0 | 0.0 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.0 | 0.0 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.0 | 0.0 | GO:0090148 | membrane fission(GO:0090148) |
| 0.0 | 0.0 | GO:0032347 | negative regulation of aldosterone metabolic process(GO:0032345) regulation of aldosterone biosynthetic process(GO:0032347) negative regulation of aldosterone biosynthetic process(GO:0032348) regulation of cortisol biosynthetic process(GO:2000064) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 0.0 | 0.2 | GO:0072395 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
| 0.0 | 0.1 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.1 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.0 | 0.0 | GO:0060368 | regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060368) |
| 0.0 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.1 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 | 0.0 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.0 | 0.0 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.0 | 0.0 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.0 | 0.0 | GO:0007063 | regulation of sister chromatid cohesion(GO:0007063) |
| 0.0 | 0.1 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.0 | 0.4 | GO:0035904 | aorta development(GO:0035904) |
| 0.0 | 0.1 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 | 0.0 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 0.1 | GO:0033129 | regulation of histone phosphorylation(GO:0033127) positive regulation of histone phosphorylation(GO:0033129) |
| 0.0 | 0.5 | GO:0006721 | terpenoid metabolic process(GO:0006721) |
| 0.0 | 0.0 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.0 | 0.1 | GO:0060375 | mast cell differentiation(GO:0060374) regulation of mast cell differentiation(GO:0060375) |
| 0.0 | 0.0 | GO:1903376 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
| 0.0 | 0.0 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.0 | 0.1 | GO:1901679 | nucleotide transmembrane transport(GO:1901679) |
| 0.0 | 0.0 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.0 | 0.1 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.0 | 0.1 | GO:0034032 | nucleoside bisphosphate metabolic process(GO:0033865) ribonucleoside bisphosphate metabolic process(GO:0033875) purine nucleoside bisphosphate metabolic process(GO:0034032) |
| 0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
| 0.0 | 0.1 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.0 | 0.1 | GO:0051195 | negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.0 | 0.0 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.0 | 0.0 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.0 | 0.3 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.0 | 0.0 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.0 | 0.0 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.0 | 0.2 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
| 0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.3 | GO:0010633 | negative regulation of epithelial cell migration(GO:0010633) |
| 0.0 | 0.2 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 | 0.0 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.0 | 0.0 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.0 | 0.0 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.0 | 0.0 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.0 | 0.0 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 0.0 | 0.2 | GO:0032964 | collagen biosynthetic process(GO:0032964) |
| 0.0 | 0.0 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.0 | 0.0 | GO:0070836 | caveola assembly(GO:0070836) |
| 0.0 | 0.0 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.0 | GO:0010534 | regulation of activation of JAK2 kinase activity(GO:0010534) |
| 0.0 | 0.0 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.0 | 0.0 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
| 0.0 | 0.1 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.0 | 0.1 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
| 0.0 | 0.0 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
| 0.0 | 0.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.0 | 0.0 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.0 | 0.1 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
| 0.0 | 0.0 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 0.0 | 0.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.0 | 0.0 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.0 | 0.0 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.0 | 0.1 | GO:1902895 | positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
| 0.0 | 0.0 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.0 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.0 | 0.0 | GO:0015819 | lysine transport(GO:0015819) |
| 0.0 | 0.0 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.0 | 0.0 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.0 | 0.1 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.0 | 0.8 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.1 | GO:0033599 | regulation of mammary gland epithelial cell proliferation(GO:0033599) |
| 0.0 | 0.0 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.0 | 0.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.0 | 0.0 | GO:0034351 | negative regulation of glial cell apoptotic process(GO:0034351) |
| 0.0 | 0.1 | GO:0010561 | negative regulation of glycoprotein biosynthetic process(GO:0010561) |
| 0.0 | 0.3 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.0 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.0 | 0.0 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.0 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.0 | 0.4 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 | 0.0 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.0 | 0.1 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
| 0.0 | 0.0 | GO:0032608 | interferon-beta production(GO:0032608) |
| 0.0 | 0.1 | GO:0051458 | corticotropin secretion(GO:0051458) regulation of corticotropin secretion(GO:0051459) |
| 0.0 | 0.0 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.1 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.0 | 0.0 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.0 | 0.0 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
| 0.0 | 0.1 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.0 | 0.2 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
| 0.0 | 0.0 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.0 | 0.1 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
| 0.0 | 0.1 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.0 | 0.0 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.0 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.0 | 0.0 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 | 0.0 | GO:0060914 | heart formation(GO:0060914) |
| 0.0 | 0.0 | GO:0071839 | apoptotic process in bone marrow(GO:0071839) regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.0 | 0.1 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.0 | 0.0 | GO:2000040 | regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
| 0.0 | 0.0 | GO:0060439 | trachea morphogenesis(GO:0060439) |
| 0.0 | 0.0 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.0 | 0.1 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.0 | 0.0 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.0 | 0.1 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.0 | 0.0 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 | 0.0 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.0 | 0.3 | GO:0090662 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.0 | 0.0 | GO:0032682 | negative regulation of chemokine production(GO:0032682) |
| 0.0 | 0.0 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.0 | 0.0 | GO:0042117 | monocyte activation(GO:0042117) |
| 0.0 | 0.0 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.0 | 0.1 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
| 0.0 | 0.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.0 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.4 | GO:0000725 | double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 0.0 | 0.0 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.0 | 0.1 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.0 | 0.0 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.0 | 0.0 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.0 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 0.0 | 0.0 | GO:0010829 | negative regulation of glucose transport(GO:0010829) |
| 0.0 | 0.1 | GO:0031639 | plasminogen activation(GO:0031639) |
| 0.0 | 0.0 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 | 0.1 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.0 | 0.0 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
| 0.0 | 0.1 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.0 | 0.1 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.0 | 0.0 | GO:0071941 | nitrogen cycle metabolic process(GO:0071941) |
| 0.0 | 0.0 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.0 | 0.3 | GO:0006829 | zinc II ion transport(GO:0006829) |
| 0.0 | 0.0 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 0.1 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.0 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.0 | 0.0 | GO:0048241 | epinephrine transport(GO:0048241) epinephrine secretion(GO:0048242) |
| 0.0 | 0.1 | GO:0090266 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.0 | 0.0 | GO:0001692 | histamine metabolic process(GO:0001692) |
| 0.0 | 0.4 | GO:1900181 | negative regulation of protein localization to nucleus(GO:1900181) |
| 0.0 | 0.1 | GO:0001759 | organ induction(GO:0001759) |
| 0.0 | 0.1 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.0 | 0.0 | GO:0032727 | positive regulation of interferon-alpha production(GO:0032727) |
| 0.0 | 0.0 | GO:1990144 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.0 | 0.1 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.0 | 0.0 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 | 0.0 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.0 | 0.0 | GO:0035872 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) |
| 0.0 | 0.0 | GO:1904752 | vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.0 | 0.1 | GO:0046688 | response to copper ion(GO:0046688) |
| 0.0 | 0.0 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 1.1 | GO:0043547 | positive regulation of GTPase activity(GO:0043547) |
| 0.0 | 0.0 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.9 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.4 | 1.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.3 | 0.8 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.2 | 1.0 | GO:0042825 | TAP complex(GO:0042825) |
| 0.2 | 0.6 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.2 | 0.8 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.1 | 0.6 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 0.1 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
| 0.1 | 0.4 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.1 | 0.4 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.1 | 0.5 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.1 | 0.4 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.1 | 0.7 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 0.1 | 0.7 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 0.3 | GO:0044393 | microspike(GO:0044393) |
| 0.1 | 0.1 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.1 | 0.6 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 0.8 | GO:0034464 | BBSome(GO:0034464) |
| 0.1 | 0.3 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 0.7 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.1 | 0.4 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
| 0.1 | 0.3 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.1 | 0.3 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 0.5 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.1 | 0.3 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.1 | 0.4 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.1 | 0.2 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.1 | 0.8 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.1 | 0.3 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 1.2 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.1 | 1.3 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.1 | 0.3 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.1 | 0.2 | GO:0000811 | GINS complex(GO:0000811) |
| 0.1 | 0.3 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.1 | 0.4 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.1 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.2 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.3 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.0 | 0.8 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.5 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.0 | 0.4 | GO:0005861 | troponin complex(GO:0005861) |
| 0.0 | 0.2 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.0 | 0.3 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.0 | 0.4 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.0 | 1.4 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 1.7 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.2 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.1 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.0 | 0.3 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.0 | 0.6 | GO:0005605 | basal lamina(GO:0005605) |
| 0.0 | 5.4 | GO:0042383 | sarcolemma(GO:0042383) |
| 0.0 | 0.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 0.4 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.2 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.0 | 0.7 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.3 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.0 | 0.3 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 0.5 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
| 0.0 | 1.1 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.0 | 0.3 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 0.2 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.0 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.0 | 0.7 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.0 | 2.4 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.3 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 1.6 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.0 | 0.3 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.0 | 0.2 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.0 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.0 | 0.2 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.0 | 0.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.3 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 1.4 | GO:0042641 | actomyosin(GO:0042641) |
| 0.0 | 2.1 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.0 | 1.1 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 0.4 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.1 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.0 | 0.3 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.3 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 1.7 | GO:0005604 | basement membrane(GO:0005604) |
| 0.0 | 0.1 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 0.1 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
| 0.0 | 0.2 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.2 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
| 0.0 | 1.4 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
| 0.0 | 0.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.0 | 0.5 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 0.6 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.0 | 0.8 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.0 | 1.4 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 0.3 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.0 | 0.1 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.3 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.1 | GO:0031082 | BLOC complex(GO:0031082) |
| 0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.2 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 0.0 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.0 | 0.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
| 0.0 | 0.1 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.0 | 0.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.2 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 4.0 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.0 | 0.4 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 0.0 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.0 | 0.3 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.0 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 2.8 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 1.5 | GO:0030496 | midbody(GO:0030496) |
| 0.0 | 0.1 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.0 | 0.2 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 1.5 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.0 | 0.0 | GO:0005914 | spot adherens junction(GO:0005914) |
| 0.0 | 0.5 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.0 | 1.0 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 4.6 | GO:0005925 | focal adhesion(GO:0005925) |
| 0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.1 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.0 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.0 | 0.1 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 0.2 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.6 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.0 | 0.0 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
| 0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.0 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.0 | 0.2 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.0 | 0.3 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.0 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.0 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.0 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.0 | GO:0000805 | X chromosome(GO:0000805) |
| 0.0 | 0.1 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.0 | 2.0 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.0 | 0.0 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.0 | 0.1 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.0 | 0.2 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.2 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.0 | GO:0043219 | lateral loop(GO:0043219) |
| 0.0 | 0.0 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 0.0 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.0 | 0.1 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.0 | 0.0 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.0 | 0.0 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 0.1 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 0.3 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 0.2 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 0.0 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.0 | 0.5 | GO:0005901 | caveola(GO:0005901) |
| 0.0 | 0.2 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.0 | 0.0 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.0 | 0.1 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.1 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.0 | 0.1 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.0 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
| 0.3 | 4.7 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.3 | 1.1 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.3 | 1.9 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.3 | 2.5 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.2 | 0.7 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.2 | 1.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.2 | 1.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.2 | 1.6 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.2 | 1.0 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.2 | 0.6 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.2 | 1.1 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.2 | 0.2 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.2 | 0.5 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
| 0.1 | 1.8 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.1 | 0.4 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.1 | 0.7 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.1 | 0.7 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.1 | 2.4 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.5 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.1 | 1.3 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.1 | 1.0 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.1 | 0.4 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.1 | 0.4 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.1 | 0.7 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 0.7 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.1 | 0.6 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.1 | 0.7 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.1 | 0.3 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.1 | 0.8 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.1 | 0.4 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.1 | 0.2 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.1 | 0.6 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.1 | 0.4 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.1 | 0.6 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 0.5 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.5 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.1 | 0.3 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.1 | 0.3 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.1 | 0.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.1 | 0.3 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.1 | 0.8 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.1 | 1.2 | GO:0051183 | vitamin transporter activity(GO:0051183) |
| 0.1 | 0.2 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.1 | 0.3 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 0.4 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
| 0.1 | 1.0 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.1 | 0.3 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.1 | 1.1 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.1 | 0.5 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.2 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.1 | 1.3 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.1 | 0.2 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.1 | 0.5 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.1 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 0.3 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.1 | 0.1 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.1 | 0.5 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 1.0 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.1 | 0.4 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.1 | 0.2 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.1 | 0.9 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.1 | 0.7 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.1 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.1 | 0.2 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 0.8 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.1 | 1.3 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.1 | 0.2 | GO:0043559 | insulin binding(GO:0043559) |
| 0.1 | 0.3 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.1 | 1.2 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.1 | 0.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.1 | 3.1 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.1 | 0.4 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.1 | 0.3 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.1 | 0.2 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.1 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.1 | 0.2 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.1 | 0.2 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.1 | 0.2 | GO:0031782 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.1 | 0.3 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.1 | 0.1 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
| 0.1 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.1 | 0.3 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 0.0 | 0.3 | GO:0018652 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
| 0.0 | 1.0 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 0.6 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.0 | 0.4 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.2 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.2 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.0 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.0 | 0.9 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.0 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.0 | 0.7 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.3 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.3 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 2.6 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.0 | 0.2 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.4 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 1.2 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.0 | 0.2 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.0 | 0.5 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.0 | 0.2 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 0.3 | GO:0070635 | single-strand selective uracil DNA N-glycosylase activity(GO:0017065) nicotinamide riboside hydrolase activity(GO:0070635) nicotinic acid riboside hydrolase activity(GO:0070636) deoxyribonucleoside 5'-monophosphate N-glycosidase activity(GO:0070694) |
| 0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.0 | 0.3 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 0.4 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.2 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.0 | 1.3 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.0 | 0.2 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 0.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.0 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.0 | 0.8 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.0 | 0.2 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.0 | 0.1 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.4 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
| 0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.0 | 1.2 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.0 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.0 | 0.0 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.0 | 0.7 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.9 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
| 0.0 | 1.1 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.0 | 0.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.0 | 1.7 | GO:0005518 | collagen binding(GO:0005518) |
| 0.0 | 0.2 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.0 | 0.2 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.0 | 0.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.0 | 0.3 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.1 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.3 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.0 | 0.3 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.0 | 0.4 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.1 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 0.1 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.2 | GO:0052668 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.0 | 0.6 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.3 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.9 | GO:0061650 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.0 | 0.5 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.5 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.0 | 0.4 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.0 | 0.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.0 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.0 | 0.2 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.0 | 0.7 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.9 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 0.0 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.2 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.0 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.0 | 0.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.0 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.0 | 0.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.0 | 0.1 | GO:0035671 | enone reductase activity(GO:0035671) |
| 0.0 | 0.4 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.0 | 0.2 | GO:0019841 | retinol binding(GO:0019841) |
| 0.0 | 0.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.0 | 0.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.0 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.1 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 0.0 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.0 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.0 | 0.1 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.0 | 0.1 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.0 | 0.1 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.0 | 0.0 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.6 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.6 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.0 | 0.7 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 1.2 | GO:0008186 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
| 0.0 | 0.2 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.5 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.0 | 0.2 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.0 | 0.1 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.0 | 0.0 | GO:0051380 | norepinephrine binding(GO:0051380) |
| 0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.2 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
| 0.0 | 0.2 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.3 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.0 | 0.0 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.6 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 0.0 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.0 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.7 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 0.1 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.0 | 1.8 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.0 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.1 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
| 0.0 | 0.2 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.2 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.0 | 0.0 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.1 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 0.0 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.0 | 0.2 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.1 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.0 | 0.0 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 5.2 | GO:0003779 | actin binding(GO:0003779) |
| 0.0 | 2.0 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.0 | 0.2 | GO:0010181 | FMN binding(GO:0010181) |
| 0.0 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.0 | 0.0 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.0 | 0.3 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
| 0.0 | 0.1 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.1 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 0.0 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.0 | 0.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.0 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.0 | 0.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.0 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.2 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 0.0 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.2 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.1 | GO:0015385 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 0.0 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.0 | 0.0 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
| 0.0 | 0.6 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.1 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.0 | 0.0 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
| 0.0 | 0.0 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.0 | 0.1 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
| 0.0 | 0.7 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.0 | 0.4 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
| 0.0 | 0.1 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
| 0.0 | 0.1 | GO:0033558 | histone deacetylase activity(GO:0004407) protein deacetylase activity(GO:0033558) |
| 0.0 | 0.0 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.0 | 0.0 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 0.1 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.0 | 0.0 | GO:0045340 | mercury ion binding(GO:0045340) |
| 0.0 | 0.3 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.0 | 0.4 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 0.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.0 | 0.9 | GO:0008083 | growth factor activity(GO:0008083) |
| 0.0 | 0.3 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.0 | 0.2 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.0 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.7 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 2.4 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.1 | GO:0044213 | intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.0 | 0.0 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.0 | 0.1 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.0 | 0.0 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.0 | 0.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.1 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.0 | 0.0 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.0 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.0 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.2 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
| 0.0 | 2.8 | GO:0008134 | transcription factor binding(GO:0008134) |
| 0.0 | 0.1 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.0 | 0.1 | GO:0036122 | BMP binding(GO:0036122) |
| 0.0 | 0.0 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.0 | 0.3 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.2 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
| 0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
| 0.0 | 0.0 | GO:0032138 | DNA insertion or deletion binding(GO:0032135) single base insertion or deletion binding(GO:0032138) |
| 0.0 | 0.0 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.4 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.0 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.0 | 0.0 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 6.6 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.2 | 7.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 1.4 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 2.9 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.1 | 4.3 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.1 | 1.4 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.1 | 1.8 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.1 | 1.0 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.1 | 0.5 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.1 | 1.9 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.1 | 0.8 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.1 | 1.8 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.1 | 0.7 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.1 | 1.5 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.1 | 0.9 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 1.7 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.2 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 1.3 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.0 | 1.1 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.1 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.5 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 0.4 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.9 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.5 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 1.0 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 0.3 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.4 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.3 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 1.3 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.6 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.2 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.6 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.1 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.0 | 0.3 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.6 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.3 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.0 | 0.5 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.2 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.0 | 0.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 0.1 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.0 | 0.3 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.0 | 0.7 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.4 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.5 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.2 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.3 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.2 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.3 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 2.9 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 0.1 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 0.3 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.4 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.0 | 0.0 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.0 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 0.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 0.3 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.1 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 5.4 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.2 | 4.7 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.1 | 2.1 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 0.5 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.1 | 2.6 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.1 | 4.6 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.1 | 1.9 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.1 | 0.3 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.1 | 1.5 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 1.3 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
| 0.1 | 0.8 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.1 | 1.5 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 0.8 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.1 | 0.9 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 1.3 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.1 | 1.8 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.1 | 1.1 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.1 | 0.6 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.1 | 0.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 1.8 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.0 | 0.4 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
| 0.0 | 1.5 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 0.7 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.6 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 0.8 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 1.6 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.0 | 0.5 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 2.1 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.0 | 0.4 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 1.0 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.0 | 0.3 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 1.0 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.9 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
| 0.0 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.6 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.3 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.4 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.0 | 0.2 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 0.3 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 0.3 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.4 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.0 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 0.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.2 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.5 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.1 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.0 | 0.3 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.0 | 0.2 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.0 | 0.5 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.9 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.5 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 0.3 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.0 | 1.1 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.6 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.3 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 0.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.3 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.0 | 0.6 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.5 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.1 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
| 0.0 | 0.1 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.0 | 0.1 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.0 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
| 0.0 | 0.5 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.5 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.7 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.0 | 0.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.0 | 0.2 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
| 0.0 | 0.0 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.0 | 0.4 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.0 | 0.0 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 0.1 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.1 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 0.0 | 0.0 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 0.1 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.0 | 0.2 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 0.0 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.1 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.0 | 0.3 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.1 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.1 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.0 | 0.1 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 0.5 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 0.6 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.0 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.0 | 0.1 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.0 | 0.1 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.1 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.0 | 0.1 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 0.1 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |